E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI0108(ACE-inhibitory peptide)
DFBP ID DFBPACEI0108
Peptide sequence VF
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antihypertensive activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Val-Phe
Single-letter amino acid VF
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 264.32 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 43.7 uM, 53 uM [4]
pIC50 -1.64, -1.724
GRAVY 3.5000 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal, Insect
Organism/Source Cotton leafworm, Spodoptera littoralis (Lepidoptera)
Precursor protein Cotton leafworm hydrolysates
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.3: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit
Source.4: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein
Source.5: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.6: DFBPPR0748 ---- Plant proteins ---- Agglutinin
Source.7: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.8: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.9: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.10: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.11: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1
Source.12: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.13: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2
Source.14: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.15: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.16: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.17: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.18: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.19: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.20: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.21: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.22: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.23: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.24: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.25: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.26: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.27: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.28: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.29: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.30: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.31: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.32: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.33: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.34: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.35: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.36: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.37: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.38: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.39: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.40: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.41: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.42: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.43: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.44: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.45: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.46: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.47: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.48: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.49: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A
Source.50: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.51: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.52: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.53: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.54: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.55: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.56: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.57: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.58: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.59: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.60: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.61: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.62: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.63: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.64: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1
Source.65: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.66: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.67: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.68: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1
Source.69: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.70: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.71: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.72: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.73: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.74: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.75: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.76: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.77: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a
Source.78: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.79: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.80: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.81: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.82: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.83: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.84: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.85: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.86: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.87: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.88: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.89: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.90: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.91: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.92: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.93: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.94: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.95: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.96: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.97: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.98: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.99: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.100: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.101: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog
Source.102: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.103: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.104: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.105: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.106: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.107: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.108: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.109: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.110: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.111: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.112: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.113: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.114: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.115: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.116: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50
Source.117: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.118: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.119: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.120: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.121: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.122: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.123: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.124: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.125: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.126: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1
Source.127: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.128: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.129: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.130: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.131: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.132: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.133: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.134: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.135: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.136: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.137: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.138: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.139: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.140: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.141: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.142: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.143: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.144: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.145: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.146: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.147: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.148: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.149: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.150: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.151: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.152: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.153: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.154: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.155: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.156: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.157: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.158: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.159: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.160: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.161: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5
Source.162: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.163: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.164: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.165: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.166: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.167: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10
Source.168: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.169: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.170: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.171: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.172: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.173: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.174: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.175: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.176: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.177: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.178: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.179: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2
Source.180: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.181: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.182: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.183: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.184: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.185: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.186: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.187: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.188: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.189: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.190: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.191: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.192: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13
Source.193: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.194: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.195: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.196: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.197: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.198: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.199: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.200: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.201: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.202: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.203: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.204: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.205: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B
Source.206: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.207: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.208: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.209: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.210: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.211: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.212: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.213: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.214: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.215: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.216: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog
Source.217: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.218: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.219: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog
Source.220: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.221: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.222: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.223: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.224: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.225: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.226: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.227: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6
Source.228: DFBPPR1151 ---- Plant proteins ---- Cytochrome c
Source.229: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.230: DFBPPR1154 ---- Plant proteins ---- MADS-box transcription factor 22
Source.231: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.232: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.233: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1
Source.234: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.235: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.236: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.237: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.238: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.239: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.240: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic
Source.241: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.242: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.243: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.244: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.245: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.246: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.247: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic
Source.248: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.249: DFBPPR1183 ---- Plant proteins ---- MADS-box transcription factor 18
Source.250: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.251: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.252: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.253: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.254: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.255: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.256: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.257: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.258: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic
Source.259: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.260: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.261: DFBPPR1223 ---- Plant proteins ---- Elicitor-responsive protein 1
Source.262: DFBPPR1224 ---- Plant proteins ---- MADS-box transcription factor 50
Source.263: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.264: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.265: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.266: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.267: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.268: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.269: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.270: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.271: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.272: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.273: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.274: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.275: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.276: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.277: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.278: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.279: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.280: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.281: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.282: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic
Source.283: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.284: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.285: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23
Source.286: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.287: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3
Source.288: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.289: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.290: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.291: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.292: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.293: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.294: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2
Source.295: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.296: DFBPPR1283 ---- Plant proteins ---- Arsenate reductase 2.1
Source.297: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.298: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.299: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.300: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.301: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.302: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.303: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.304: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.305: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.306: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.307: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1
Source.308: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.309: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic
Source.310: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.311: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.312: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.313: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.314: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.315: DFBPPR1310 ---- Plant proteins ---- Rac-like GTP-binding protein 6
Source.316: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.317: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.318: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.319: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.320: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.321: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.322: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.323: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.324: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.325: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.326: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.327: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.328: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.329: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.330: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.331: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.332: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.333: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.334: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.335: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.336: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.337: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.338: DFBPPR1340 ---- Plant proteins ---- F-box protein GID2
Source.339: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.340: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.341: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.342: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.343: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.344: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.345: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.346: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.347: DFBPPR1351 ---- Plant proteins ---- Probable phospholipase A2 homolog 2
Source.348: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.349: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.350: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.351: DFBPPR1357 ---- Plant proteins ---- MADS-box transcription factor 47
Source.352: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.353: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.354: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.355: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.356: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.357: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.358: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.359: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.360: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.361: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.362: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3
Source.363: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.364: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.365: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.366: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.367: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.368: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.369: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.370: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.371: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.372: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.373: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.374: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.375: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.376: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.377: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.378: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.379: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.380: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.381: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.382: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.383: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.384: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.385: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.386: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.387: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.388: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.389: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7
Source.390: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.391: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.392: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.393: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.394: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.395: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.396: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.397: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.398: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.399: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156
Source.400: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.401: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.402: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.403: DFBPPR1431 ---- Plant proteins ---- Glutaredoxin-C6
Source.404: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.405: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.406: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.407: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic
Source.408: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.409: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3
Source.410: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.411: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.412: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.413: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.414: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.415: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.416: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.417: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.418: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.419: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.420: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.421: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.422: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.423: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.424: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.425: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.426: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.427: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.428: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.429: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.430: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.431: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.432: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.433: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.434: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic
Source.435: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.436: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.437: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.438: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.439: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.440: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.441: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.442: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.443: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.444: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.445: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.446: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.447: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.448: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.449: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.450: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.451: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.452: DFBPPR1491 ---- Plant proteins ---- Rac-like GTP-binding protein 4
Source.453: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.454: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.455: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.456: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.457: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.458: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.459: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1
Source.460: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.461: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.462: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.463: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.464: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.465: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.466: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.467: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.468: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F
Source.469: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.470: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.471: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.472: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.473: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.474: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.475: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5
Source.476: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.477: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.478: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.479: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.480: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.481: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.482: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.483: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.484: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.485: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.486: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.487: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8
Source.488: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.489: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.490: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.491: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.492: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.493: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.494: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.495: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.496: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.497: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.498: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.499: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.500: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.501: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.502: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.503: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.504: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.505: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A
Source.506: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.507: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.508: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.509: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.510: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.511: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.512: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.513: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.514: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.515: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.516: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic
Source.517: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.518: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.519: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.520: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.521: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.522: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.523: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.524: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.525: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.526: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.527: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.528: DFBPPR1597 ---- Plant proteins ---- MADS-box transcription factor 51
Source.529: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.530: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.531: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5
Source.532: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase
Source.533: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.534: DFBPPR1606 ---- Plant proteins ---- 17.4 kDa class I heat shock protein
Source.535: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.536: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.537: DFBPPR1610 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.538: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.539: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.540: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase
Source.541: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.542: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.543: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.544: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.545: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.546: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.547: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.548: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.549: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.550: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.551: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.552: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.553: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.554: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.555: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.556: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.557: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2
Source.558: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.559: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.560: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.561: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.562: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.563: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.564: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.565: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.566: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.567: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.568: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.569: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.570: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.571: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.572: DFBPPR1671 ---- Plant proteins ---- MADS-box transcription factor 4
Source.573: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.574: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.575: DFBPPR1676 ---- Plant proteins ---- MADS-box transcription factor 55
Source.576: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.577: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.578: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.579: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.580: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.581: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.582: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.583: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.584: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3
Source.585: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062
Source.586: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.587: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.588: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.589: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.590: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.591: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.592: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1
Source.593: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.594: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.595: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.596: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.597: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.598: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.599: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2
Source.600: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.601: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.602: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.603: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.604: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.605: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.606: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.607: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.608: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.609: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.610: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3
Source.611: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.612: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.613: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.614: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.615: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.616: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.617: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.618: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.619: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.620: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.621: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.622: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.623: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.624: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.625: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.626: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.627: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein
Source.628: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.629: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.630: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.631: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57
Source.632: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.633: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.634: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.635: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.636: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1
Source.637: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.638: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.639: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.640: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2
Source.641: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.642: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.643: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.644: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.645: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.646: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.647: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.648: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.649: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.650: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.651: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.652: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.653: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.654: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22
Source.655: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.656: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.657: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.658: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.659: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.660: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.661: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.662: DFBPPR1798 ---- Plant proteins ---- UMP-CMP kinase 2
Source.663: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1
Source.664: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.665: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.666: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.667: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.668: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.669: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.670: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.671: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.672: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4
Source.673: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.674: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.675: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.676: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.677: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.678: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.679: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.680: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.681: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.682: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.683: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.684: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.685: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1
Source.686: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.687: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1
Source.688: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.689: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.690: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.691: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.692: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.693: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2
Source.694: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.695: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.696: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.697: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.698: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.699: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.700: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.701: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.702: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.703: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.704: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.705: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.706: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.707: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.708: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.709: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.710: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.711: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.712: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.713: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.714: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B
Source.715: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3
Source.716: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.717: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.718: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.719: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.720: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.721: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.722: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.723: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.724: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.725: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.726: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.727: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.728: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.729: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.730: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.731: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.732: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.733: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.734: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.735: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.736: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.737: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.738: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.739: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.740: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.741: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.742: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.743: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.744: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.745: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.746: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.747: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A
Source.748: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.749: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.750: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.751: DFBPPR1932 ---- Plant proteins ---- Inactive casein kinase II subunit alpha-2
Source.752: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.753: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.754: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.755: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.756: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2
Source.757: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4
Source.758: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.759: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.760: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.761: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.762: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B
Source.763: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.764: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.765: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.766: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4
Source.767: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.768: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1
Source.769: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.770: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.771: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.772: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.773: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.774: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1
Source.775: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.776: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.777: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.778: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.779: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.780: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4
Source.781: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2
Source.782: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.783: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.784: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38
Source.785: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.786: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.787: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.788: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.789: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.790: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.791: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.792: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.793: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.794: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.795: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.796: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.797: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.798: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.799: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.800: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.801: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.802: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5
Source.803: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.804: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.805: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.806: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.807: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.808: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.809: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.810: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.811: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.812: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.813: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.814: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.815: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.816: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.817: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.818: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.819: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.820: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.821: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.822: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.823: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.824: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein
Source.825: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23
Source.826: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.827: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.828: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.829: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.830: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.831: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.832: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.833: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.834: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.835: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.836: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.837: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.838: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.839: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa
Source.840: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.841: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1
Source.842: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.843: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.844: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.845: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.846: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.847: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.848: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.849: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.850: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.851: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.852: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.853: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.854: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.855: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.856: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.857: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.858: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.859: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.860: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.861: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.862: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.863: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1
Source.864: DFBPPR2101 ---- Plant proteins ---- Cupincin
Source.865: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.866: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.867: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.868: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.869: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.870: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.871: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.872: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.873: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.874: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.875: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.876: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.877: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.878: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.879: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.880: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.881: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.882: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.883: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.884: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.885: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.886: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.887: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein
Source.888: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.889: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.890: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.891: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.892: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.893: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.894: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.895: DFBPPR2148 ---- Plant proteins ---- Auxin-responsive protein SAUR36
Source.896: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.897: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A
Source.898: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.899: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.900: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2
Source.901: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.902: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.903: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.904: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.905: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.906: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.907: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.908: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.909: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.910: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.911: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.912: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.913: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.914: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.915: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2
Source.916: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C
Source.917: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.918: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.919: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.920: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1
Source.921: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.922: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.923: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.924: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.925: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1
Source.926: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.927: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.928: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.929: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.930: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.931: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.932: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.933: DFBPPR2206 ---- Plant proteins ---- Leucine-rich repeat protein 1
Source.934: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.935: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21
Source.936: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial
Source.937: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.938: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.939: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.940: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.941: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4
Source.942: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.943: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.944: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.945: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.946: DFBPPR2223 ---- Plant proteins ---- Urease
Source.947: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.948: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.949: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.950: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.951: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.952: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.953: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.954: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.955: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.956: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.957: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.958: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.959: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.960: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.961: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.962: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3
Source.963: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.964: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.965: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.966: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.967: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.968: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.969: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.970: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.971: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.972: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.973: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.974: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.975: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.976: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.977: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.978: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa
Source.979: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.980: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1
Source.981: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.982: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.983: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.984: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.985: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.986: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.987: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.988: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.989: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.990: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.991: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.992: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.993: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.994: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.995: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.996: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.997: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.998: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.999: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.1000: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.1001: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.1002: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.1003: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.1004: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.1005: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.1006: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.1007: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.1008: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.1009: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.1010: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b
Source.1011: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.1012: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.1013: DFBPPR2344 ---- Plant proteins ---- Calcineurin B-like protein 8
Source.1014: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.1015: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1016: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.1017: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.1018: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.1019: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.1020: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1021: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.1022: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.1023: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.1024: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6
Source.1025: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11
Source.1026: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.1027: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1028: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.1029: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.1030: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.1031: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.1032: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.1033: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1
Source.1034: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.1035: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.1036: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.1037: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1038: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.1039: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.1040: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.1041: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.1042: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.1043: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.1044: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2
Source.1045: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.1046: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.1047: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.1048: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase
Source.1049: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.1050: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1
Source.1051: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.1052: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.1053: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1054: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.1055: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.1056: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.1057: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.1058: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.1059: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.1060: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.1061: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.1062: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.1063: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.1064: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.1065: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.1066: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.1067: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.1068: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.1069: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1
Source.1070: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.1071: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.1072: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.1073: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.1074: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1075: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.1076: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.1077: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B
Source.1078: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.1079: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.1080: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.1081: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1082: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3
Source.1083: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9
Source.1084: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.1085: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.1086: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.1087: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.1088: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56
Source.1089: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.1090: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.1091: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3
Source.1092: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.1093: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.1094: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.1095: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.1096: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.1097: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34
Source.1098: DFBPPR2468 ---- Plant proteins ---- Germin-like protein 8-3
Source.1099: DFBPPR2469 ---- Plant proteins ---- Germin-like protein 8-4
Source.1100: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2
Source.1101: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.1102: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1103: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.1104: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.1105: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1106: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7
Source.1107: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.1108: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.1109: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.1110: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.1111: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.1112: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.1113: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.1114: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1115: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.1116: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.1117: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.1118: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.1119: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10
Source.1120: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.1121: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.1122: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B
Source.1123: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5
Source.1124: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic
Source.1125: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4
Source.1126: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.1127: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1128: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.1129: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.1130: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.1131: DFBPPR2516 ---- Plant proteins ---- Expansin-B16
Source.1132: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9
Source.1133: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.1134: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.1135: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.1136: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1137: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.1138: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.1139: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.1140: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.1141: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.1142: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.1143: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300
Source.1144: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5
Source.1145: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.1146: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.1147: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.1148: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.1149: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.1150: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.1151: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.1152: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1153: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.1154: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.1155: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1156: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.1157: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.1158: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9
Source.1159: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.1160: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.1161: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.1162: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4
Source.1163: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20
Source.1164: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.1165: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.1166: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.1167: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.1168: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9
Source.1169: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.1170: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.1171: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.1172: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.1173: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1
Source.1174: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.1175: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.1176: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.1177: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.1178: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.1179: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.1180: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.1181: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.1182: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.1183: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.1184: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.1185: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1186: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.1187: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.1188: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.1189: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.1190: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.1191: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.1192: DFBPPR2614 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.1193: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.1194: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2
Source.1195: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.1196: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.1197: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1
Source.1198: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3
Source.1199: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1
Source.1200: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.1201: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1
Source.1202: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34
Source.1203: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.1204: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.1205: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1206: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.1207: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2
Source.1208: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.1209: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.1210: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.1211: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.1212: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.1213: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.1214: DFBPPR2648 ---- Plant proteins ---- SKP1-like protein 20
Source.1215: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.1216: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3
Source.1217: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.1218: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4
Source.1219: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.1220: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.1221: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.1222: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.1223: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.1224: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.1225: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3
Source.1226: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.1227: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.1228: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1
Source.1229: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.1230: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.1231: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2
Source.1232: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.1233: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.1234: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.1235: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.1236: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.1237: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.1238: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.1239: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.1240: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.1241: DFBPPR2689 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.1242: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.1243: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.1244: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.1245: DFBPPR2697 ---- Plant proteins ---- Calcineurin B-like protein 2
Source.1246: DFBPPR2698 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.1247: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1248: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.1249: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.1250: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72
Source.1251: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.1252: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1
Source.1253: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.1254: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2
Source.1255: DFBPPR2712 ---- Plant proteins ---- Expansin-A20
Source.1256: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.1257: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1258: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.1259: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.1260: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.1261: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.1262: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.1263: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.1264: DFBPPR2721 ---- Plant proteins ---- Expansin-A18
Source.1265: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.1266: DFBPPR2724 ---- Plant proteins ---- Putative germin-like protein 8-1
Source.1267: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.1268: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.1269: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2
Source.1270: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.1271: DFBPPR2732 ---- Plant proteins ---- Small ubiquitin-related modifier 1
Source.1272: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.1273: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.1274: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A
Source.1275: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.1276: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500
Source.1277: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1278: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.1279: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.1280: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.1281: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.1282: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.1283: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.1284: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.1285: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.1286: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2
Source.1287: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.1288: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.1289: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.1290: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.1291: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.1292: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.1293: DFBPPR2764 ---- Plant proteins ---- MADS-box transcription factor 30
Source.1294: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.1295: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.1296: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.1297: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.1298: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.1299: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1300: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.1301: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.1302: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.1303: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.1304: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.1305: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.1306: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.1307: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.1308: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.1309: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1310: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.1311: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.1312: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.1313: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.1314: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.1315: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1316: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.1317: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1318: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic
Source.1319: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c
Source.1320: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.1321: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.1322: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12
Source.1323: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.1324: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.1325: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.1326: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.1327: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.1328: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.1329: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1330: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.1331: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.1332: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.1333: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.1334: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.1335: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.1336: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.1337: DFBPPR2823 ---- Plant proteins ---- Germin-like protein 8-9
Source.1338: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.1339: DFBPPR2825 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.1340: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.1341: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8
Source.1342: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.1343: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.1344: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.1345: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.1346: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.1347: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.1348: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.1349: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.1350: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.1351: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.1352: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.1353: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.1354: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.1355: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.1356: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.1357: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.1358: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic
Source.1359: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1360: DFBPPR2849 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 3
Source.1361: DFBPPR2850 ---- Plant proteins ---- Germin-like protein 8-6
Source.1362: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.1363: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.1364: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1365: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.1366: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131
Source.1367: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1
Source.1368: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.1369: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.1370: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.1371: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase
Source.1372: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.1373: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.1374: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.1375: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1376: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1377: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.1378: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.1379: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.1380: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.1381: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.1382: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.1383: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1384: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32
Source.1385: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6
Source.1386: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.1387: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.1388: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A
Source.1389: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21
Source.1390: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.1391: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1
Source.1392: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.1393: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.1394: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.1395: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.1396: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.1397: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.1398: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.1399: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.1400: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.1401: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.1402: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.1403: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1
Source.1404: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2
Source.1405: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28
Source.1406: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.1407: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5
Source.1408: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3
Source.1409: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.1410: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.1411: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.1412: DFBPPR2925 ---- Plant proteins ---- Two-component response regulator ORR13
Source.1413: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.1414: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.1415: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.1416: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.1417: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4
Source.1418: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.1419: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.1420: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.1421: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.1422: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1
Source.1423: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.1424: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.1425: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.1426: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.1427: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2
Source.1428: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.1429: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.1430: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1431: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.1432: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.1433: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.1434: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23
Source.1435: DFBPPR2952 ---- Plant proteins ---- Expansin-A17
Source.1436: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.1437: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1438: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.1439: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.1440: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.1441: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.1442: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.1443: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2
Source.1444: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1
Source.1445: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.1446: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1447: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.1448: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.1449: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.1450: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.1451: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.1452: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.1453: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.1454: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.1455: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.1456: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.1457: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.1458: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.1459: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.1460: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.1461: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.1462: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.1463: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.1464: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.1465: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.1466: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.1467: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.1468: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.1469: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.1470: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.1471: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20
Source.1472: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.1473: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.1474: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.1475: DFBPPR3007 ---- Plant proteins ---- Thioredoxin H2-2
Source.1476: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.1477: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.1478: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4
Source.1479: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.1480: DFBPPR3015 ---- Plant proteins ---- Expansin-A13
Source.1481: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.1482: DFBPPR3017 ---- Plant proteins ---- Expansin-A12
Source.1483: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.1484: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.1485: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.1486: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.1487: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.1488: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.1489: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.1490: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.1491: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.1492: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.1493: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.1494: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b
Source.1495: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.1496: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.1497: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.1498: DFBPPR3044 ---- Plant proteins ---- Thioredoxin-like 4, chloroplastic
Source.1499: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.1500: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.1501: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10
Source.1502: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.1503: DFBPPR3052 ---- Plant proteins ---- MADS-box transcription factor 31
Source.1504: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.1505: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.1506: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1
Source.1507: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.1508: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1509: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.1510: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.1511: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.1512: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1513: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.1514: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic
Source.1515: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.1516: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.1517: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.1518: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.1519: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.1520: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.1521: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.1522: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.1523: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.1524: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.1525: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.1526: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3
Source.1527: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.1528: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.1529: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.1530: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.1531: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.1532: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.1533: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.1534: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.1535: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.1536: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.1537: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.1538: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.1539: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.1540: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.1541: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.1542: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.1543: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.1544: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5
Source.1545: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.1546: DFBPPR3113 ---- Plant proteins ---- Putative autophagy-related protein 8E
Source.1547: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.1548: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.1549: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.1550: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.1551: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20
Source.1552: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.1553: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.1554: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.1555: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.1556: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6
Source.1557: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1558: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1559: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8
Source.1560: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.1561: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.1562: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.1563: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.1564: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1565: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.1566: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1
Source.1567: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.1568: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8
Source.1569: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.1570: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.1571: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1572: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.1573: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.1574: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.1575: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic
Source.1576: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.1577: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.1578: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.1579: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.1580: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.1581: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.1582: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1583: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.1584: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.1585: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.1586: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1587: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.1588: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.1589: DFBPPR3176 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1590: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.1591: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.1592: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.1593: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1594: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.1595: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1596: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1597: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1598: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1599: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1600: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.1601: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1602: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.1603: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59
Source.1604: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.1605: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1606: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.1607: DFBPPR3203 ---- Plant proteins ---- Monothiol glutaredoxin-S10
Source.1608: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1609: DFBPPR3205 ---- Plant proteins ---- Monothiol glutaredoxin-S3
Source.1610: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.1611: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.1612: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1613: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.1614: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1615: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.1616: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.1617: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1618: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1619: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.1620: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.1621: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1622: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.1623: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.1624: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.1625: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.1626: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.1627: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.1628: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.1629: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.1630: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.1631: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.1632: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.1633: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic
Source.1634: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.1635: DFBPPR3238 ---- Plant proteins ---- Hydrophobic protein LTI6A
Source.1636: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.1637: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1638: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.1639: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.1640: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.1641: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.1642: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.1643: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.1644: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.1645: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.1646: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1647: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.1648: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.1649: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.1650: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1651: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit
Source.1652: DFBPPR3261 ---- Plant proteins ---- Autophagy-related protein 8D
Source.1653: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.1654: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1655: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.1656: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.1657: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1658: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1
Source.1659: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.1660: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase
Source.1661: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.1662: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16
Source.1663: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.1664: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.1665: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1666: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1667: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.1668: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.1669: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.1670: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b
Source.1671: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.1672: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.1673: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4
Source.1674: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.1675: DFBPPR3298 ---- Plant proteins ---- Hydrophobic protein LTI6B
Source.1676: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1677: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9
Source.1678: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E
Source.1679: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.1680: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.1681: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.1682: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.1683: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1684: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.1685: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.1686: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2
Source.1687: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.1688: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.1689: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.1690: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8
Source.1691: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.1692: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7
Source.1693: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1
Source.1694: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.1695: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1696: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.1697: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.1698: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1699: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.1700: DFBPPR3342 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.1701: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.1702: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.1703: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.1704: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1705: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.1706: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.1707: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.1708: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1709: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.1710: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1711: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1712: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.1713: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1714: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1715: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.1716: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.1717: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.1718: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1719: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.1720: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.1721: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1722: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.1723: DFBPPR3372 ---- Plant proteins ---- Calcineurin B-like protein 3
Source.1724: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.1725: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1
Source.1726: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1727: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.1728: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18
Source.1729: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.1730: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.1731: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18
Source.1732: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1733: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1734: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1735: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1736: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.1737: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1738: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.1739: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.1740: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3
Source.1741: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1742: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.1743: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1744: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.1745: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5
Source.1746: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.1747: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.1748: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.1749: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.1750: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1751: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1752: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1753: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.1754: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.1755: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.1756: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.1757: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.1758: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.1759: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1760: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.1761: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2
Source.1762: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1763: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1764: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1765: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C
Source.1766: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.1767: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.1768: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.1769: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1770: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.1771: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.1772: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic
Source.1773: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.1774: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.1775: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.1776: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.1777: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.1778: DFBPPR3471 ---- Plant proteins ---- Monothiol glutaredoxin-S6
Source.1779: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.1780: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.1781: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.1782: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3
Source.1783: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1784: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.1785: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1786: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8
Source.1787: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.1788: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5
Source.1789: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5
Source.1790: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1791: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.1792: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19
Source.1793: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.1794: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1795: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9
Source.1796: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1797: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.1798: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.1799: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6
Source.1800: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.1801: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1802: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.1803: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.1804: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1805: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.1806: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.1807: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.1808: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.1809: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.1810: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.1811: DFBPPR3521 ---- Plant proteins ---- Photosystem II reaction center W protein, chloroplastic
Source.1812: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.1813: DFBPPR3523 ---- Plant proteins ---- Ubiquitin-like protein ATG12
Source.1814: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1815: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.1816: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2
Source.1817: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1818: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4
Source.1819: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1820: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1821: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.1822: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.1823: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1824: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1825: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.1826: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1827: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2
Source.1828: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.1829: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.1830: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.1831: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.1832: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1833: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.1834: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.1835: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.1836: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.1837: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.1838: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.1839: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.1840: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.1841: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1
Source.1842: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1843: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1844: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.1845: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.1846: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1847: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.1848: DFBPPR3578 ---- Plant proteins ---- Glutaredoxin-C13
Source.1849: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.1850: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1851: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1852: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1853: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1854: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.1855: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1856: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1857: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1
Source.1858: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.1859: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.1860: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.1861: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.1862: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic
Source.1863: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1864: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1865: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.1866: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.1867: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1868: DFBPPR3614 ---- Plant proteins ---- Prolamin PPROL 17D
Source.1869: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b
Source.1870: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.1871: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.1872: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1873: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1
Source.1874: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.1875: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1876: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.1877: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.1878: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1879: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.1880: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.1881: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1882: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1883: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.1884: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.1885: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1886: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.1887: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2
Source.1888: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1889: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.1890: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1891: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3
Source.1892: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.1893: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e
Source.1894: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.1895: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.1896: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.1897: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2
Source.1898: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1899: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin
Source.1900: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1901: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.1902: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.1903: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1904: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.1905: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5
Source.1906: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.1907: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.1908: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6
Source.1909: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10
Source.1910: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.1911: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1912: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1913: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.1914: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic
Source.1915: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1916: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.1917: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2
Source.1918: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.1919: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1920: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.1921: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.1922: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1923: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1924: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.1925: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67
Source.1926: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.1927: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.1928: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d
Source.1929: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1
Source.1930: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.1931: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7
Source.1932: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.1933: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.1934: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.1935: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.1936: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.1937: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.1938: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.1939: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.1940: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.1941: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.1942: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.1943: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.1944: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.1945: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1946: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.1947: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.1948: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.1949: DFBPPR3725 ---- Plant proteins ---- 60S ribosomal protein L10a
Source.1950: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.1951: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.1952: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.1953: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.1954: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.1955: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.1956: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28
Source.1957: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1958: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.1959: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.1960: DFBPPR3743 ---- Plant proteins ---- Putative auxin-responsive protein IAA28
Source.1961: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.1962: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.1963: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.1964: DFBPPR3749 ---- Plant proteins ---- MADS-box transcription factor 25
Source.1965: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.1966: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.1967: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.1968: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.1969: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.1970: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.1971: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.1972: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.1973: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.1974: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.1975: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1976: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1977: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.1978: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.1979: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.1980: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.1981: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.1982: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4
Source.1983: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.1984: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.1985: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.1986: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.1987: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.1988: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55
Source.1989: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.1990: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial
Source.1991: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1992: DFBPPR3791 ---- Plant proteins ---- Putative glutaredoxin-C12
Source.1993: DFBPPR3793 ---- Plant proteins ---- Coatomer subunit zeta-2
Source.1994: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1
Source.1995: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7
Source.1996: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.1997: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.1998: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6
Source.1999: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2000: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic
Source.2001: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.2002: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.2003: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8
Source.2004: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.2005: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.2006: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.2007: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.2008: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.2009: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.2010: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.2011: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.2012: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.2013: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.2014: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.2015: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.2016: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.2017: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.2018: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit
Source.2019: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.2020: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.2021: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.2022: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7
Source.2023: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.2024: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.2025: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54
Source.2026: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.2027: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.2028: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.2029: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.2030: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.2031: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.2032: DFBPPR3854 ---- Plant proteins ---- Glutaredoxin-C10
Source.2033: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.2034: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.2035: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.2036: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.2037: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.2038: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.2039: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.2040: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.2041: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.2042: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.2043: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.2044: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.2045: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.2046: DFBPPR3871 ---- Plant proteins ---- Putative glutaredoxin-C11
Source.2047: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.2048: DFBPPR3873 ---- Plant proteins ---- Putative glutaredoxin-C14
Source.2049: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.2050: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10
Source.2051: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.2052: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2
Source.2053: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.2054: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.2055: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.2056: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.2057: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.2058: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.2059: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.2060: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.2061: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3
Source.2062: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.2063: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.2064: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.2065: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.2066: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.2067: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.2068: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5
Source.2069: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.2070: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.2071: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.2072: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.2073: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.2074: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.2075: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.2076: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.2077: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g
Source.2078: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9
Source.2079: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.2080: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.2081: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.2082: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.2083: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.2084: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.2085: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.2086: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10
Source.2087: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3
Source.2088: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3
Source.2089: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.2090: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.2091: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.2092: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.2093: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1
Source.2094: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.2095: DFBPPR3947 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic
Source.2096: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.2097: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial
Source.2098: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.2099: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.2100: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1
Source.2101: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.2102: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.2103: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.2104: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.2105: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.2106: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8
Source.2107: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.2108: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.2109: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial
Source.2110: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.2111: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.2112: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.2113: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.2114: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.2115: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4
Source.2116: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.2117: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1
Source.2118: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.2119: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.2120: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.2121: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.2122: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.2123: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.2124: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.2125: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.2126: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.2127: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.2128: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.2129: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.2130: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.2131: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.2132: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.2133: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.2134: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.2135: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.2136: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11
Source.2137: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.2138: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.2139: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.2140: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.2141: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.2142: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f
Source.2143: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.2144: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.2145: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.2146: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.2147: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.2148: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27
Source.2149: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.2150: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G
Source.2151: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.2152: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.2153: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.2154: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.2155: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.2156: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.2157: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.2158: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.2159: DFBPPR4045 ---- Plant proteins ---- 60S ribosomal protein L11
Source.2160: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.2161: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.2162: DFBPPR4051 ---- Plant proteins ---- 40S ribosomal protein S3a
Source.2163: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.2164: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.2165: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.2166: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.2167: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.2168: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.2169: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.2170: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2171: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.2172: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.2173: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.2174: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.2175: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.2176: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.2177: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.2178: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.2179: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.2180: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.2181: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.2182: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.2183: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.2184: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.2185: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.2186: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.2187: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.2188: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.2189: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.2190: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.2191: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.2192: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D
Source.2193: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.2194: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29
Source.2195: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.2196: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.2197: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.2198: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.2199: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.2200: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.2201: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.2202: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.2203: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.2204: DFBPPR4104 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.2205: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.2206: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.2207: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.2208: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.2209: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.2210: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.2211: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.2212: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4
Source.2213: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.2214: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.2215: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.2216: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.2217: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.2218: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.2219: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.2220: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.2221: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.2222: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.2223: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.2224: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.2225: DFBPPR4134 ---- Plant proteins ---- Glutaredoxin-C1
Source.2226: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.2227: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.2228: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7
Source.2229: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.2230: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.2231: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.2232: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.2233: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.2234: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.2235: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.2236: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.2237: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.2238: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.2239: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.2240: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.2241: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.2242: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.2243: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.2244: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.2245: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.2246: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.2247: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.2248: DFBPPR4164 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 1
Source.2249: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.2250: DFBPPR4166 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.2251: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.2252: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4
Source.2253: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.2254: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.2255: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.2256: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.2257: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.2258: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2259: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.2260: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2
Source.2261: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.2262: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.2263: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.2264: DFBPPR4198 ---- Plant proteins ---- Glutaredoxin-C15
Source.2265: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.2266: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.2267: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.2268: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.2269: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.2270: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.2271: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.2272: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P
Source.2273: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.2274: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.2275: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.2276: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.2277: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22
Source.2278: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.2279: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2
Source.2280: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.2281: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.2282: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.2283: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2
Source.2284: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.2285: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.2286: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.2287: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.2288: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.2289: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.2290: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.2291: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.2292: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.2293: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic
Source.2294: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.2295: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.2296: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.2297: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.2298: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6
Source.2299: DFBPPR4255 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.2300: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.2301: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.2302: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.2303: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.2304: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.2305: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.2306: DFBPPR4266 ---- Plant proteins ---- Probable protein BRICK1
Source.2307: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.2308: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.2309: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.2310: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.2311: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.2312: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.2313: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.2314: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.2315: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.2316: DFBPPR4282 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.2317: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.2318: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.2319: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.2320: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20
Source.2321: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.2322: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2323: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3
Source.2324: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7
Source.2325: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.2326: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.2327: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.2328: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.2329: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.2330: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.2331: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.2332: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.2333: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6
Source.2334: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.2335: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.2336: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.2337: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.2338: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.2339: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.2340: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.2341: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.2342: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.2343: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.2344: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.2345: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.2346: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.2347: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic
Source.2348: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.2349: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.2350: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.2351: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.2352: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.2353: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.2354: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.2355: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.2356: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9
Source.2357: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.2358: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.2359: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.2360: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic
Source.2361: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic
Source.2362: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.2363: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.2364: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.2365: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.2366: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.2367: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.2368: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.2369: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.2370: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.2371: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.2372: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1
Source.2373: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.2374: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.2375: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.2376: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.2377: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.2378: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.2379: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.2380: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.2381: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.2382: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.2383: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.2384: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.2385: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25
Source.2386: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2387: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D
Source.2388: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.2389: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.2390: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.2391: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.2392: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.2393: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.2394: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.2395: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.2396: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.2397: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.2398: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.2399: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.2400: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.2401: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.2402: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.2403: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.2404: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.2405: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.2406: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.2407: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.2408: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.2409: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.2410: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.2411: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.2412: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.2413: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.2414: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.2415: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.2416: DFBPPR4454 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.2417: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.2418: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28
Source.2419: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.2420: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.2421: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.2422: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18
Source.2423: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.2424: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17
Source.2425: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.2426: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.2427: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.2428: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.2429: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.2430: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.2431: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.2432: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.2433: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.2434: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16
Source.2435: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.2436: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.2437: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.2438: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.2439: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.2440: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.2441: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.2442: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.2443: DFBPPR4483 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 11
Source.2444: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.2445: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.2446: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.2447: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.2448: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.2449: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.2450: DFBPPR4496 ---- Plant proteins ---- Transcription elongation factor 1 homolog
Source.2451: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.2452: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.2453: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.2454: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.2455: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.2456: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.2457: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.2458: DFBPPR4511 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 9
Source.2459: DFBPPR4512 ---- Plant proteins ---- Actin-depolymerizing factor 3
Source.2460: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.2461: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.2462: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.2463: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.2464: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.2465: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.2466: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.2467: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26
Source.2468: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.2469: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.2470: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.2471: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2
Source.2472: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.2473: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.2474: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.2475: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.2476: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.2477: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.2478: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.2479: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.2480: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.2481: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.2482: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.2483: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.2484: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.2485: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16
Source.2486: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.2487: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.2488: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1
Source.2489: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1
Source.2490: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.2491: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.2492: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1
Source.2493: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.2494: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10
Source.2495: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.2496: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.2497: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.2498: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15
Source.2499: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.2500: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.2501: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.2502: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.2503: DFBPPR4591 ---- Plant proteins ---- Uncharacterized protein ycf76
Source.2504: DFBPPR4592 ---- Plant proteins ---- Ubiquitin-fold modifier 1
Source.2505: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.2506: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19
Source.2507: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23
Source.2508: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.2509: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.2510: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.2511: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16
Source.2512: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.2513: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.2514: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.2515: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.2516: DFBPPR4619 ---- Plant proteins ---- Actin-depolymerizing factor 9
Source.2517: DFBPPR4621 ---- Plant proteins ---- Actin-depolymerizing factor 6
Source.2518: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2519: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.2520: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.2521: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.2522: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.2523: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.2524: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.2525: DFBPPR4642 ---- Plant proteins ---- Actin-depolymerizing factor 1
Source.2526: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2527: DFBPPR4644 ---- Plant proteins ---- Nuclear transport factor 2
Source.2528: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.2529: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.2530: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.2531: DFBPPR4649 ---- Plant proteins ---- Succinate dehydrogenase subunit 8B, mitochondrial
Source.2532: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.2533: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.2534: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.2535: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.2536: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.2537: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.2538: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1
Source.2539: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.2540: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.2541: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.2542: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.2543: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.2544: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.2545: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.2546: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.2547: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.2548: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3
Source.2549: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2
Source.2550: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.2551: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.2552: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.2553: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.2554: DFBPPR4715 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 2
Source.2555: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.2556: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.2557: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.2558: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.2559: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.2560: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.2561: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.2562: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.2563: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.2564: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.2565: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.2566: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.2567: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.2568: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.2569: DFBPPR4752 ---- Plant proteins ---- Uncharacterized protein ycf70
Source.2570: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.2571: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.2572: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7
Source.2573: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13
Source.2574: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.2575: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.2576: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A
Source.2577: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.2578: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G
Source.2579: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.2580: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H
Source.2581: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4
Source.2582: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.2583: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.2584: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.2585: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.2586: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.2587: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.2588: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.2589: DFBPPR4786 ---- Plant proteins ---- B3 domain-containing protein Os12g0592300
Source.2590: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2591: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600
Source.2592: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300
Source.2593: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.2594: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.2595: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.2596: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.2597: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.2598: DFBPPR4810 ---- Plant proteins ---- Hydrophobic protein OSR8
Source.2599: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1
Source.2600: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.2601: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.2602: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.2603: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.2604: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.2605: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.2606: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.2607: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1
Source.2608: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.2609: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3
Source.2610: DFBPPR4841 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 5
Source.2611: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400
Source.2612: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400
Source.2613: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.2614: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.2615: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.2616: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.2617: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.2618: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500
Source.2619: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.2620: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.2621: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.2622: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090
Source.2623: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2624: DFBPPR4861 ---- Plant proteins ---- B3 domain-containing protein Os06g0112300
Source.2625: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.2626: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820
Source.2627: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.2628: DFBPPR4872 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0158600
Source.2629: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.2630: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58
Source.2631: DFBPPR4880 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 29
Source.2632: DFBPPR4883 ---- Plant proteins ---- Uncharacterized protein Os02g0798400
Source.2633: DFBPPR4884 ---- Plant proteins ---- Uncharacterized protein Os02g0798501
Source.2634: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.2635: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.2636: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.2637: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.2638: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.2639: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.2640: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.2641: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.2642: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.2643: DFBPPR4896 ---- Plant proteins ---- Thioredoxin H1
Source.2644: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.2645: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.2646: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.2647: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5
Source.2648: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic
Source.2649: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.2650: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.2651: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.2652: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.2653: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.2654: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.2655: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.2656: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.2657: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.2658: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.2659: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.2660: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.2661: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.2662: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.2663: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.2664: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.2665: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.2666: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.2667: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.2668: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.2669: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.2670: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1
Source.2671: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.2672: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic
Source.2673: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2674: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.2675: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.2676: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.2677: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.2678: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.2679: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.2680: DFBPPR4963 ---- Plant proteins ---- Soybean toxin 17 kDa chain
Source.2681: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.2682: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.2683: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.2684: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.2685: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2686: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.2687: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.2688: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.2689: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.2690: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.2691: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.2692: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.2693: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2694: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.2695: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.2696: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2697: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.2698: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.2699: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.2700: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.2701: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.2702: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.2703: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.2704: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1
Source.2705: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.2706: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.2707: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.2708: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2709: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.2710: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.2711: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2712: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.2713: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.2714: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.2715: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.2716: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.2717: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.2718: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2719: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.2720: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2721: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.2722: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.2723: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.2724: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.2725: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A
Source.2726: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.2727: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.2728: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.2729: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.2730: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.2731: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2732: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.2733: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.2734: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2735: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.2736: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.2737: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1
Source.2738: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.2739: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A
Source.2740: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.2741: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2742: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.2743: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.2744: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.2745: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.2746: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2
Source.2747: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.2748: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.2749: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.2750: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2751: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2752: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.2753: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.2754: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2755: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.2756: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3
Source.2757: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.2758: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.2759: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2760: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.2761: DFBPPR5071 ---- Plant proteins ---- Leghemoglobin C1
Source.2762: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.2763: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.2764: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.2765: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.2766: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.2767: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.2768: DFBPPR5079 ---- Plant proteins ---- Albumin-1
Source.2769: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.2770: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.2771: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.2772: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.2773: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.2774: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2775: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2776: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.2777: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.2778: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.2779: DFBPPR5100 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase 1
Source.2780: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2781: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.2782: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.2783: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.2784: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.2785: DFBPPR5109 ---- Plant proteins ---- Chalcone--flavonone isomerase 1A
Source.2786: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22
Source.2787: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B
Source.2788: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.2789: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.2790: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein
Source.2791: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2792: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.2793: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.2794: DFBPPR5127 ---- Plant proteins ---- Pathogenesis-related protein 10
Source.2795: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.2796: DFBPPR5131 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.2797: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein
Source.2798: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2
Source.2799: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.2800: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.2801: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.2802: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2803: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.2804: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.2805: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2806: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.2807: DFBPPR5144 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-A
Source.2808: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.2809: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase
Source.2810: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2811: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.2812: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2813: DFBPPR5157 ---- Plant proteins ---- 17.6 kDa class I heat shock protein
Source.2814: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.2815: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.2816: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2817: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2818: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.2819: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.2820: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2821: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2822: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2823: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.2824: DFBPPR5177 ---- Plant proteins ---- Anamorsin homolog
Source.2825: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.2826: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1
Source.2827: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.2828: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.2829: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.2830: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2831: DFBPPR5191 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.2832: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.2833: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.2834: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.2835: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2836: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.2837: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2
Source.2838: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.2839: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2840: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.2841: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.2842: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.2843: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.2844: DFBPPR5219 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.2845: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.2846: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.2847: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.2848: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.2849: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.2850: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2851: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.2852: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.2853: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein
Source.2854: DFBPPR5235 ---- Plant proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.2855: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.2856: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B
Source.2857: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2858: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.2859: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.2860: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2
Source.2861: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1
Source.2862: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2
Source.2863: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.2864: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.2865: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein
Source.2866: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.2867: DFBPPR5249 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.2868: DFBPPR5253 ---- Plant proteins ---- CASP-like protein 7
Source.2869: DFBPPR5254 ---- Plant proteins ---- Chalcone--flavonone isomerase 3
Source.2870: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B
Source.2871: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.2872: DFBPPR5258 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.2873: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2874: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.2875: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.2876: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.2877: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.2878: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.2879: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.2880: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.2881: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.2882: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6
Source.2883: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.2884: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.2885: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2
Source.2886: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1
Source.2887: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2888: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.2889: DFBPPR5301 ---- Plant proteins ---- DNA-binding protein DRP90
Source.2890: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.2891: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.2892: DFBPPR5305 ---- Plant proteins ---- Defensin-like protein
Source.2893: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2894: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1
Source.2895: DFBPPR5309 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.2896: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.2897: DFBPPR5317 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.2898: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2899: DFBPPR5320 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.2900: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.2901: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.2902: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.2903: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1
Source.2904: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.2905: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.2906: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2
Source.2907: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1
Source.2908: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2909: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2910: DFBPPR5341 ---- Plant proteins ---- HMG1/2-like protein
Source.2911: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.2912: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1
Source.2913: DFBPPR5346 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic
Source.2914: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein
Source.2915: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11
Source.2916: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.2917: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.2918: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.2919: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D
Source.2920: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A
Source.2921: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B
Source.2922: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C
Source.2923: DFBPPR5365 ---- Plant proteins ---- Auxin-induced protein 6B
Source.2924: DFBPPR5366 ---- Plant proteins ---- Auxin-induced protein 15A
Source.2925: DFBPPR5367 ---- Plant proteins ---- Auxin-induced protein X15
Source.2926: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.2927: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.2928: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.2929: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.2930: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.2931: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.2932: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2933: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.2934: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2935: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.2936: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.2937: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4
Source.2938: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2939: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.2940: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.2941: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.2942: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.2943: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2944: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.2945: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2946: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.2947: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.2948: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.2949: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.2950: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.2951: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.2952: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.2953: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.2954: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1
Source.2955: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.2956: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.2957: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.2958: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.2959: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.2960: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.2961: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.2962: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.2963: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.2964: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A
Source.2965: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.2966: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.2967: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.2968: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.2969: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.2970: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.2971: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2
Source.2972: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.2973: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.2974: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.2975: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.2976: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.2977: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.2978: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic
Source.2979: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1
Source.2980: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha
Source.2981: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.2982: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.2983: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.2984: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.2985: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.2986: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.2987: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.2988: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.2989: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.2990: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.2991: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.2992: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2993: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.2994: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.2995: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.2996: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.2997: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.2998: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.2999: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.3000: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.3001: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.3002: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.3003: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.3004: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.3005: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.3006: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.3007: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.3008: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.3009: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.3010: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.3011: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.3012: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.3013: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.3014: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.3015: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.3016: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.3017: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.3018: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.3019: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.3020: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.3021: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.3022: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.3023: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42
Source.3024: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.3025: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.3026: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.3027: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.3028: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.3029: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.3030: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II
Source.3031: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1
Source.3032: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3033: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase
Source.3034: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.3035: DFBPPR5534 ---- Plant proteins ---- Ubiquitin-40S ribosomal protein S27a
Source.3036: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.3037: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3038: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.3039: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.3040: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.3041: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.3042: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.3043: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.3044: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.3045: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.3046: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.3047: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.3048: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.3049: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.3050: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.3051: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.3052: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.3053: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3054: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.3055: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.3056: DFBPPR5571 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 1
Source.3057: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.3058: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.3059: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.3060: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3061: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.3062: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.3063: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.3064: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.3065: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3066: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3067: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.3068: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.3069: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.3070: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.3071: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.3072: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.3073: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3074: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.3075: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.3076: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.3077: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.3078: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.3079: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.3080: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.3081: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.3082: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.3083: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.3084: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.3085: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.3086: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.3087: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.3088: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.3089: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.3090: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3091: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.3092: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.3093: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.3094: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.3095: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6
Source.3096: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3097: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.3098: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.3099: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.3100: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.3101: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.3102: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.3103: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.3104: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.3105: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3106: DFBPPR5648 ---- Plant proteins ---- AP-2 complex subunit sigma
Source.3107: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.3108: DFBPPR5651 ---- Plant proteins ---- Cytochrome c
Source.3109: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.3110: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.3111: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.3112: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.3113: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.3114: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.3115: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.3116: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3117: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3118: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.3119: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3120: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.3121: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.3122: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.3123: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4
Source.3124: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.3125: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.3126: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.3127: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3128: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.3129: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.3130: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.3131: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.3132: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.3133: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.3134: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.3135: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.3136: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.3137: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.3138: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.3139: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3140: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3141: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.3142: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.3143: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.3144: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.3145: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.3146: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3147: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.3148: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.3149: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.3150: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.3151: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.3152: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3153: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.3154: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.3155: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.3156: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.3157: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.3158: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.3159: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.3160: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.3161: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.3162: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.3163: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.3164: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3165: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.3166: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.3167: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.3168: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.3169: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.3170: DFBPPR5779 ---- Plant proteins ---- Protein BRICK1
Source.3171: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.3172: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3173: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.3174: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.3175: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.3176: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.3177: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.3178: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.3179: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.3180: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3181: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.3182: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.3183: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.3184: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.3185: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a
Source.3186: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.3187: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.3188: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3189: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.3190: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3191: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.3192: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.3193: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1
Source.3194: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.3195: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.3196: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.3197: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.3198: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.3199: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.3200: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.3201: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.3202: DFBPPR5837 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.3203: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.3204: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.3205: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.3206: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.3207: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12
Source.3208: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.3209: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic
Source.3210: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.3211: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.3212: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.3213: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.3214: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6
Source.3215: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3216: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.3217: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3218: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.3219: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.3220: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5
Source.3221: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.3222: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3223: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.3224: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor
Source.3225: DFBPPR5877 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3226: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.3227: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.3228: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.3229: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.3230: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.3231: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.3232: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.3233: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.3234: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.3235: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B
Source.3236: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2
Source.3237: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3238: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.3239: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A
Source.3240: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.3241: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.3242: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3243: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.3244: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3
Source.3245: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.3246: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.3247: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.3248: DFBPPR5921 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.3249: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.3250: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.3251: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.3252: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.3253: DFBPPR5933 ---- Plant proteins ---- Pathogenesis-related protein PRMS
Source.3254: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1
Source.3255: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.3256: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.3257: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.3258: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.3259: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.3260: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.3261: DFBPPR5945 ---- Plant proteins ---- Calmodulin
Source.3262: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.3263: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.3264: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.3265: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.3266: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.3267: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2
Source.3268: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.3269: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.3270: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.3271: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.3272: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.3273: DFBPPR5974 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.3274: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.3275: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.3276: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.3277: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.3278: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.3279: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.3280: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.3281: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.3282: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.3283: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.3284: DFBPPR5987 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic
Source.3285: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.3286: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.3287: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.3288: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.3289: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.3290: DFBPPR5997 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3291: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.3292: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.3293: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1
Source.3294: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.3295: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1
Source.3296: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1
Source.3297: DFBPPR6012 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 2
Source.3298: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.3299: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3300: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.3301: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.3302: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.3303: DFBPPR6021 ---- Plant proteins ---- Actin-depolymerizing factor 2
Source.3304: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3305: DFBPPR6025 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.3306: DFBPPR6026 ---- Plant proteins ---- Actin-depolymerizing factor 1
Source.3307: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.3308: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.3309: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.3310: DFBPPR6031 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.3311: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.3312: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.3313: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4
Source.3314: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.3315: DFBPPR6046 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.3316: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1
Source.3317: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1
Source.3318: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.3319: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2
Source.3320: DFBPPR6056 ---- Plant proteins ---- Bowman-Birk type wound-induced proteinase inhibitor WIP1
Source.3321: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.3322: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.3323: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.3324: DFBPPR6065 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3325: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.3326: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3327: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.3328: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.3329: DFBPPR6078 ---- Plant proteins ---- Putative 18 kDa spermidine-binding protein
Source.3330: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.3331: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5
Source.3332: DFBPPR6087 ---- Plant proteins ---- 40S ribosomal protein S14
Source.3333: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6
Source.3334: DFBPPR6090 ---- Plant proteins ---- 40S ribosomal protein S14
Source.3335: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.3336: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.3337: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3
Source.3338: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1
Source.3339: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1
Source.3340: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4
Source.3341: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.3342: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.3343: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.3344: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.3345: DFBPPR6117 ---- Plant proteins ---- Putative uncharacterized protein ycf15
Source.3346: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.3347: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11
Source.3348: DFBPPR6122 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 4
Source.3349: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.3350: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.3351: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.3352: DFBPPR6146 ---- Plant proteins ---- Uncharacterized protein ycf76
Source.3353: DFBPPR6148 ---- Plant proteins ---- Uncharacterized protein ycf70
Source.3354: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.3355: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.3356: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5
Source.3357: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2
Source.3358: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4
Source.3359: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.3360: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3
Source.3361: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid
Source.3362: DFBPPR6182 ---- Plant proteins ---- Unknown protein from spot 360 of 2D-PAGE of etiolated coleoptile
Source.3363: DFBPPR6185 ---- Plant proteins ---- Unknown protein from spot 415 of 2D-PAGE of etiolated coleoptile
Source.3364: DFBPPR6190 ---- Plant proteins ---- Unknown protein from spot 32 of 2D-PAGE of etiolated coleoptile
Source.3365: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.3366: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase
Source.3367: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.3368: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.3369: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.3370: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.3371: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.3372: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.3373: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.3374: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.3375: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.3376: DFBPPR6231 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.3377: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.3378: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3379: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.3380: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.3381: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.3382: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.3383: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein
Source.3384: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.3385: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.3386: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.3387: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.3388: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.3389: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.3390: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.3391: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.3392: DFBPPR6254 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.3393: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.3394: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.3395: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.3396: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.3397: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.3398: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.3399: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.3400: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.3401: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.3402: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.3403: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.3404: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1
Source.3405: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3406: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1
Source.3407: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.3408: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic
Source.3409: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3410: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor
Source.3411: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.3412: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.3413: DFBPPR6285 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.3414: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein
Source.3415: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.3416: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta
Source.3417: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.3418: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.3419: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.3420: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.3421: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3422: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial
Source.3423: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.3424: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3
Source.3425: DFBPPR6301 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3426: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.3427: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3428: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.3429: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.3430: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.3431: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.3432: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.3433: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.3434: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.3435: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.3436: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.3437: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.3438: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.3439: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.3440: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.3441: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.3442: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.3443: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.3444: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F
Source.3445: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.3446: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.3447: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.3448: DFBPPR6331 ---- Plant proteins ---- Rac-like GTP-binding protein RHO1
Source.3449: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.3450: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.3451: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.3452: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3453: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.3454: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.3455: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3456: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.3457: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.3458: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.3459: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.3460: DFBPPR6352 ---- Plant proteins ---- Protein TIC 22, chloroplastic
Source.3461: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.3462: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3463: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3464: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic
Source.3465: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3466: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.3467: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.3468: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3469: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.3470: DFBPPR6368 ---- Plant proteins ---- Provicilin
Source.3471: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.3472: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.3473: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.3474: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.3475: DFBPPR6375 ---- Plant proteins ---- Chlorophyll a-b binding protein 3c, chloroplastic
Source.3476: DFBPPR6377 ---- Plant proteins ---- Lectin
Source.3477: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D
Source.3478: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C
Source.3479: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.3480: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.3481: DFBPPR6384 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.3482: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.3483: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.3484: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.3485: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.3486: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6
Source.3487: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.3488: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.3489: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.3490: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.3491: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3492: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.3493: DFBPPR6401 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.3494: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.3495: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.3496: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.3497: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase
Source.3498: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.3499: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3500: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.3501: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.3502: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.3503: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.3504: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.3505: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.3506: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.3507: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.3508: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3509: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.3510: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.3511: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.3512: DFBPPR6427 ---- Plant proteins ---- MADS-box transcription factor 1
Source.3513: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.3514: DFBPPR6430 ---- Plant proteins ---- Legumin J
Source.3515: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.3516: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B
Source.3517: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A
Source.3518: DFBPPR6440 ---- Plant proteins ---- Cell division control protein 2 homolog 2
Source.3519: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72
Source.3520: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206
Source.3521: DFBPPR6444 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3522: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.3523: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.3524: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.3525: DFBPPR6455 ---- Plant proteins ---- Legumin K
Source.3526: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.3527: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.3528: DFBPPR6459 ---- Plant proteins ---- Legumin B
Source.3529: DFBPPR6461 ---- Plant proteins ---- Leghemoglobin Lb5-10
Source.3530: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.3531: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3532: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.3533: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.3534: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.3535: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.3536: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.3537: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.3538: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein
Source.3539: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.3540: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a
Source.3541: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.3542: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic
Source.3543: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.3544: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.3545: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1
Source.3546: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.3547: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.3548: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E
Source.3549: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.3550: DFBPPR6495 ---- Plant proteins ---- Leghemoglobin Lb120-34
Source.3551: DFBPPR6496 ---- Plant proteins ---- Leghemoglobin Lb120-1
Source.3552: DFBPPR6497 ---- Plant proteins ---- Leghemoglobin Lb120-8
Source.3553: DFBPPR6498 ---- Plant proteins ---- Leghemoglobin Lb120-29
Source.3554: DFBPPR6499 ---- Plant proteins ---- Provicilin
Source.3555: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A
Source.3556: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.3557: DFBPPR6512 ---- Plant proteins ---- Photosystem I reaction center subunit V
Source.3558: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic
Source.3559: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.3560: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3561: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.3562: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.3563: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3564: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.3565: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.3566: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.3567: DFBPPR6527 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.3568: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3569: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin
Source.3570: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.3571: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49
Source.3572: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.3573: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.3574: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.3575: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3576: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3577: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.3578: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.3579: DFBPPR6561 ---- Plant proteins ---- Blue copper protein
Source.3580: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.3581: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.3582: DFBPPR6572 ---- Plant proteins ---- Photosystem I reaction center subunit N
Source.3583: DFBPPR6573 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial
Source.3584: DFBPPR6578 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.3585: DFBPPR6579 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.3586: DFBPPR6580 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.3587: DFBPPR6581 ---- Plant proteins ---- Nodulin-3
Source.3588: DFBPPR6608 ---- Plant proteins ---- Unknown protein from spot 19 of 2D-PAGE of thylakoid
Source.3589: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein
Source.3590: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176
Source.3591: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.3592: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28
Source.3593: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3594: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.3595: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.3596: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.3597: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.3598: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.3599: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3600: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.3601: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1
Source.3602: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.3603: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.3604: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3605: DFBPPR6640 ---- Plant proteins ---- Puroindoline-B
Source.3606: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.3607: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.3608: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.3609: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.3610: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3611: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8
Source.3612: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.3613: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1
Source.3614: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.3615: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2
Source.3616: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.3617: DFBPPR6661 ---- Plant proteins ---- Agglutinin isolectin 3
Source.3618: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.3619: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.3620: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.3621: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.3622: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.3623: DFBPPR6667 ---- Plant proteins ---- Cytochrome c
Source.3624: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.3625: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.3626: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3627: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.3628: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.3629: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8
Source.3630: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3631: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.3632: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3633: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.3634: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.3635: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.3636: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.3637: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.3638: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.3639: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.3640: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.3641: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3642: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.3643: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.3644: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2
Source.3645: DFBPPR6705 ---- Plant proteins ---- Calmodulin
Source.3646: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1
Source.3647: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.3648: DFBPPR6713 ---- Plant proteins ---- Histone H2B.6
Source.3649: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3650: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.3651: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.3652: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3653: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.3654: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.3655: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3656: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.3657: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.3658: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.3659: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.3660: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3661: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.3662: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3663: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.3664: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3665: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.3666: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.3667: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.3668: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3669: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.3670: DFBPPR6761 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM1
Source.3671: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.3672: DFBPPR6766 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3673: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.3674: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3675: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.3676: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3677: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.3678: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.3679: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.3680: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3681: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.3682: DFBPPR6783 ---- Plant proteins ---- Thioredoxin H-type
Source.3683: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3684: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3685: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.3686: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7
Source.3687: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI
Source.3688: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.3689: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.3690: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.3691: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.3692: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.3693: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.3694: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.3695: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.3696: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.3697: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3698: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3699: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.3700: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3701: DFBPPR6817 ---- Plant proteins ---- Phosphomannomutase
Source.3702: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.3703: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C
Source.3704: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3705: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.3706: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.3707: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.3708: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3709: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2
Source.3710: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.3711: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3712: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.3713: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3714: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3715: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.3716: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.3717: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.3718: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3719: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.3720: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3721: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1
Source.3722: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3723: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.3724: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.3725: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.3726: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A
Source.3727: DFBPPR6864 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.3728: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3729: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3730: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3731: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.3732: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3733: DFBPPR6879 ---- Plant proteins ---- Type-5 thionin
Source.3734: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.3735: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.3736: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor
Source.3737: DFBPPR6887 ---- Plant proteins ---- Glutenin, low molecular weight subunit
Source.3738: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3739: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.3740: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1
Source.3741: DFBPPR6893 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.3742: DFBPPR6895 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor
Source.3743: DFBPPR6897 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.3744: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.3745: DFBPPR6903 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic
Source.3746: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3747: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.3748: DFBPPR6918 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.3749: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.3750: DFBPPR6933 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.3751: DFBPPR6946 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3752: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.3753: DFBPPR6949 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.3754: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3755: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3756: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.3757: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.3758: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.3759: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.3760: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I
Source.3761: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.3762: DFBPPR6975 ---- Plant proteins ---- Gamma-gliadin
Source.3763: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3764: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2
Source.3765: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.3766: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.3767: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.3768: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.3769: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.3770: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.3771: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.3772: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.3773: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3
Source.3774: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.3775: DFBPPR6997 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor I-2B
Source.3776: DFBPPR7003 ---- Plant proteins ---- Protein RAFTIN 1C
Source.3777: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.3778: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3779: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3780: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.3781: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3782: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.3783: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.3784: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.3785: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.3786: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.3787: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.3788: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1
Source.3789: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.3790: DFBPPR7032 ---- Plant proteins ---- Hordoindoline-B2
Source.3791: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.3792: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.3793: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2
Source.3794: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.3795: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3796: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.3797: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.3798: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.3799: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.3800: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.3801: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.3802: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.3803: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.3804: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3805: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.3806: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3807: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa
Source.3808: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.3809: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.3810: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3811: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.3812: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3813: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.3814: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3815: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3816: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.3817: DFBPPR7068 ---- Plant proteins ---- Peroxidase 2
Source.3818: DFBPPR7069 ---- Plant proteins ---- Hordoindoline-B1
Source.3819: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase
Source.3820: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4
Source.3821: DFBPPR7077 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor
Source.3822: DFBPPR7078 ---- Plant proteins ---- Alpha-amylase inhibitor BDAI-1
Source.3823: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.3824: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3825: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.3826: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.3827: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3828: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.3829: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.3830: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.3831: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.3832: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.3833: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.3834: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.3835: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.3836: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.3837: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.3838: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3839: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.3840: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.3841: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3842: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.3843: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.3844: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.3845: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.3846: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.3847: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.3848: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3849: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.3850: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.3851: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3852: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.3853: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.3854: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.3855: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.3856: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.3857: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.3858: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.3859: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.3860: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.3861: DFBPPR7137 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3862: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.3863: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.3864: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.3865: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.3866: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.3867: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.3868: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.3869: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.3870: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.3871: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3872: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3873: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.3874: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.3875: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.3876: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.3877: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.3878: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.3879: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.3880: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.3881: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.3882: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2
Source.3883: DFBPPR7168 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.3884: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.3885: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.3886: DFBPPR7172 ---- Plant proteins ---- Barwin
Source.3887: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.3888: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.3889: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3890: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.3891: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.3892: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3893: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin
Source.3894: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3895: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3896: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3897: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc
Source.3898: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.3899: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3900: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.3901: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.3902: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.3903: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.3904: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.3905: DFBPPR7198 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.3906: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3
Source.3907: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.3908: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.3909: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3910: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic
Source.3911: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.3912: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.3913: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.3914: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.3915: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.3916: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3917: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.3918: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3919: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3920: DFBPPR7228 ---- Plant proteins ---- Calmodulin
Source.3921: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.3922: DFBPPR7234 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3923: DFBPPR7235 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD2
Source.3924: DFBPPR7236 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.3925: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1
Source.3926: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2
Source.3927: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.3928: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3929: DFBPPR7245 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.3930: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.3931: DFBPPR7251 ---- Plant proteins ---- Leaf-specific thionin DB4
Source.3932: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.3933: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.3934: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.3935: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.3936: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6
Source.3937: DFBPPR7269 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.3938: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.3939: DFBPPR7271 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.3940: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.3941: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C
Source.3942: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.3943: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.3944: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3945: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1
Source.3946: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.3947: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.3948: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.3949: DFBPPR7297 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic
Source.3950: DFBPPR7299 ---- Plant proteins ---- Low temperature-induced protein lt101.1
Source.3951: DFBPPR7300 ---- Plant proteins ---- 40S ribosomal protein S27
Source.3952: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.3953: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.3954: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.3955: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.3956: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.3957: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.3958: DFBPPR7312 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3959: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.3960: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3961: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3962: DFBPPR7318 ---- Plant proteins ---- B3-hordein
Source.3963: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3964: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.3965: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.3966: DFBPPR7337 ---- Plant proteins ---- Low temperature-induced protein lt101.2
Source.3967: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24
Source.3968: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C
Source.3969: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B
Source.3970: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7
Source.3971: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A
Source.3972: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B
Source.3973: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2
Source.3974: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein
Source.3975: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein
Source.3976: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.3977: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.3978: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.3979: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.3980: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.3981: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.3982: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor
Source.3983: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.3984: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.3985: DFBPPR7406 ---- Plant proteins ---- Cytochrome c
Source.3986: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1
Source.3987: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.3988: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.3989: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.3990: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.3991: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.3992: DFBPPR7415 ---- Plant proteins ---- Co-chaperone protein p23-1
Source.3993: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.3994: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.3995: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6
Source.3996: DFBPPR7419 ---- Plant proteins ---- Cytochrome b
Source.3997: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase
Source.3998: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.3999: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.4000: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.4001: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.4002: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.4003: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.4004: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.4005: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.4006: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.4007: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.4008: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.4009: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.4010: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.4011: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase
Source.4012: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.4013: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.4014: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase
Source.4015: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.4016: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.4017: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.4018: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1
Source.4019: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.4020: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.4021: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.4022: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.4023: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.4024: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.4025: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.4026: DFBPPR7480 ---- Plant proteins ---- Defensin-like protein 1
Source.4027: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.4028: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.4029: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II
Source.4030: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.4031: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.4032: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.4033: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.4034: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.4035: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.4036: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.4037: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.4038: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1
Source.4039: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.4040: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.4041: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.4042: DFBPPR7513 ---- Plant proteins ---- Thioredoxin H-type 2
Source.4043: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.4044: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.4045: DFBPPR7516 ---- Plant proteins ---- Defensin-like protein 3
Source.4046: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15
Source.4047: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial
Source.4048: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.4049: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.4050: DFBPPR7529 ---- Plant proteins ---- Profilin
Source.4051: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.4052: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.4053: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.4054: DFBPPR7537 ---- Plant proteins ---- Actin-depolymerizing factor
Source.4055: DFBPPR7540 ---- Plant proteins ---- Ribosomal protein S14, mitochondrial
Source.4056: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1
Source.4057: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.4058: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.4059: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.4060: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.4061: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.4062: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.4063: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.4064: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2
Source.4065: DFBPPR7606 ---- Milk proteins ---- Osteopontin
Source.4066: DFBPPR7609 ---- Milk proteins ---- Lysozyme C
Source.4067: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2
Source.4068: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.4069: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.4070: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.4071: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.4072: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.4073: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.4074: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.4075: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.4076: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.4077: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.4078: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein
Source.4079: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain
Source.4080: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.4081: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.4082: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.4083: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.4084: DFBPPR7634 ---- Milk proteins ---- CD59 glycoprotein
Source.4085: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.4086: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.4087: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator
Source.4088: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.4089: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.4090: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.4091: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6
Source.4092: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.4093: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.4094: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.4095: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.4096: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.4097: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.4098: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.4099: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.4100: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.4101: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.4102: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.4103: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.4104: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.4105: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein
Source.4106: DFBPPR7667 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.4107: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.4108: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1
Source.4109: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2
Source.4110: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin
Source.4111: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.4112: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A
Source.4113: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein
Source.4114: DFBPPR7681 ---- Milk proteins ---- Beta-casein
Source.4115: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.4116: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.4117: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin
Source.4118: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.4119: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein
Source.4120: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein
Source.4121: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.4122: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein
Source.4123: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein
Source.4124: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin
Source.4125: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.4126: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.4127: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein
Source.4128: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.4129: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein
Source.4130: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin
Source.4131: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.4132: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.4133: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.4134: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.4135: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.4136: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.4137: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.4138: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.4139: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4140: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.4141: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.4142: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.4143: DFBPPR7732 ---- Plant proteins ---- Plasma membrane ATPase
Source.4144: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2
Source.4145: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1
Source.4146: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.4147: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.4148: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.4149: DFBPPR7739 ---- Plant proteins ---- Avenin-E
Source.4150: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.4151: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4
Source.4152: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.4153: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.4154: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.4155: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.4156: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.4157: DFBPPR8187 ---- Plant proteins ---- Cytochrome c
Source.4158: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.4159: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.4160: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.4161: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.4162: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.4163: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.4164: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.4165: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.4166: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.4167: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.4168: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.4169: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.4170: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.4171: DFBPPR8358 ---- Plant proteins ---- Cytochrome c
Source.4172: DFBPPR8359 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.4173: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.4174: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.4175: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.4176: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.4177: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.4178: DFBPPR8368 ---- Plant proteins ---- 13S globulin basic chain
Source.4179: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.4180: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.4181: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.4182: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4183: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.4184: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.4185: DFBPPR8377 ---- Plant proteins ---- Profilin
Source.4186: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2
Source.4187: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2
Source.4188: DFBPPR8388 ---- Plant proteins ---- Oleosin Ara h 14.0101
Source.4189: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102
Source.4190: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin
Source.4191: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.4192: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.4193: DFBPPR8395 ---- Plant proteins ---- Oleosin Ara h 14.0103
Source.4194: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.4195: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.4196: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.4197: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.4198: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3
Source.4199: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.4200: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.4201: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.4202: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.4203: DFBPPR8423 ---- Plant proteins ---- Cytochrome c
Source.4204: DFBPPR8424 ---- Plant proteins ---- Oleosin H1
Source.4205: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4206: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.4207: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.4208: DFBPPR8434 ---- Plant proteins ---- Lectin
Source.4209: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.4210: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.4211: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.4212: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.4213: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.4214: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.4215: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.4216: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.4217: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.4218: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.4219: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.4220: DFBPPR8465 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.4221: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.4222: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.4223: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.4224: DFBPPR8475 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.4225: DFBPPR8481 ---- Plant proteins ---- Granule-bound starch synthase 1
Source.4226: DFBPPR8482 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.4227: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein
Source.4228: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.4229: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.4230: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin
Source.4231: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.4232: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.4233: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein
Source.4234: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1
Source.4235: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.4236: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.4237: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.4238: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.4239: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.4240: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.4241: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.4242: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.4243: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.4244: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.4245: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.4246: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.4247: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.4248: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4249: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor
Source.4250: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.4251: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.4252: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.4253: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.4254: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.4255: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein
Source.4256: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.4257: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.4258: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.4259: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.4260: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.4261: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.4262: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.4263: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.4264: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.4265: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4266: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.4267: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.4268: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4269: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.4270: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.4271: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.4272: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.4273: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.4274: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.4275: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.4276: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4277: DFBPPR15967 ---- Animal proteins ---- Interleukin-4
Source.4278: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.4279: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.4280: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.4281: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.4282: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.4283: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.4284: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.4285: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor
Source.4286: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.4287: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.4288: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.4289: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.4290: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.4291: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.4292: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.4293: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.4294: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.4295: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.4296: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4297: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.4298: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.4299: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.4300: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.4301: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.4302: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4303: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.4304: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4305: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.4306: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.4307: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4308: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.4309: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.4310: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA
Source.4311: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.4312: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.4313: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4314: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.4315: DFBPPR16032 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.4316: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.4317: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.4318: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.4319: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.4320: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4321: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.4322: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.4323: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.4324: DFBPPR16046 ---- Animal proteins ---- C-C motif chemokine 3
Source.4325: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.4326: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.4327: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.4328: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.4329: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.4330: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.4331: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4332: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4333: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.4334: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.4335: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.4336: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.4337: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.4338: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.4339: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.4340: DFBPPR16067 ---- Animal proteins ---- CD40 ligand
Source.4341: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.4342: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.4343: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4344: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.4345: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.4346: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.4347: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.4348: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.4349: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.4350: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4351: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.4352: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.4353: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.4354: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.4355: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.4356: DFBPPR16093 ---- Animal proteins ---- Menin
Source.4357: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.4358: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.4359: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.4360: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.4361: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.4362: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.4363: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.4364: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.4365: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.4366: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.4367: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.4368: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.4369: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.4370: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.4371: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.4372: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.4373: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.4374: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.4375: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.4376: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.4377: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.4378: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.4379: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.4380: DFBPPR16139 ---- Animal proteins ---- Lipocalin Can f 6.0101
Source.4381: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.4382: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.4383: DFBPPR16143 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase
Source.4384: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.4385: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.4386: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.4387: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.4388: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4389: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta
Source.4390: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4391: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2
Source.4392: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.4393: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.4394: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.4395: DFBPPR16168 ---- Animal proteins ---- Annexin A2
Source.4396: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.4397: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.4398: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.4399: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.4400: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.4401: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.4402: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.4403: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.4404: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.4405: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.4406: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.4407: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.4408: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4409: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.4410: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.4411: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.4412: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.4413: DFBPPR16196 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.4414: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4415: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.4416: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.4417: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4418: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.4419: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4420: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.4421: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.4422: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.4423: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4424: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.4425: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.4426: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.4427: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.4428: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.4429: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.4430: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.4431: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.4432: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.4433: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.4434: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.4435: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24
Source.4436: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.4437: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.4438: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.4439: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.4440: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.4441: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.4442: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.4443: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.4444: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.4445: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.4446: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4447: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.4448: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.4449: DFBPPR16247 ---- Animal proteins ---- Recoverin
Source.4450: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4451: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.4452: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.4453: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.4454: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.4455: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4456: DFBPPR16258 ---- Animal proteins ---- Decorin
Source.4457: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.4458: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.4459: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.4460: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.4461: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.4462: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4463: DFBPPR16267 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.4464: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.4465: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.4466: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.4467: DFBPPR16273 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.4468: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.4469: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.4470: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.4471: DFBPPR16285 ---- Animal proteins ---- Chymase
Source.4472: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4473: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.4474: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.4475: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.4476: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4477: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.4478: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.4479: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.4480: DFBPPR16301 ---- Animal proteins ---- Major allergen Can f 1
Source.4481: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.4482: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.4483: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25
Source.4484: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.4485: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.4486: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.4487: DFBPPR16315 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.4488: DFBPPR16316 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.4489: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.4490: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.4491: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.4492: DFBPPR16322 ---- Animal proteins ---- Interleukin-18
Source.4493: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2
Source.4494: DFBPPR16325 ---- Animal proteins ---- Peripherin-2
Source.4495: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.4496: DFBPPR16328 ---- Animal proteins ---- Fibroblast growth factor 8
Source.4497: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.4498: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.4499: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.4500: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.4501: DFBPPR16338 ---- Animal proteins ---- Endothelin-2
Source.4502: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.4503: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.4504: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.4505: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.4506: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.4507: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5
Source.4508: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.4509: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.4510: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.4511: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.4512: DFBPPR16429 ---- Animal proteins ---- C-C motif chemokine 4
Source.4513: DFBPPR16435 ---- Animal proteins ---- S-arrestin
Source.4514: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4515: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.4516: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.4517: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.4518: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.4519: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.4520: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.4521: DFBPPR16444 ---- Animal proteins ---- Interleukin-33
Source.4522: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.4523: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.4524: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.4525: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.4526: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.4527: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.4528: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.4529: DFBPPR16464 ---- Animal proteins ---- Interferon alpha-1/2
Source.4530: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.4531: DFBPPR16471 ---- Animal proteins ---- Interferon alpha-3
Source.4532: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.4533: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.4534: DFBPPR16475 ---- Animal proteins ---- Transmembrane protein 258
Source.4535: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.4536: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.4537: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.4538: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.4539: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.4540: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.4541: DFBPPR16487 ---- Animal proteins ---- Claudin-2
Source.4542: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.4543: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.4544: DFBPPR16492 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.4545: DFBPPR16494 ---- Animal proteins ---- C-C motif chemokine 25
Source.4546: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.4547: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.4548: DFBPPR16497 ---- Animal proteins ---- Interleukin-5
Source.4549: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.4550: DFBPPR16500 ---- Animal proteins ---- C-C motif chemokine 5
Source.4551: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.4552: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.4553: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.4554: DFBPPR16508 ---- Animal proteins ---- Protein crumbs homolog 3
Source.4555: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.4556: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.4557: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.4558: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.4559: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.4560: DFBPPR16521 ---- Animal proteins ---- Interleukin-3
Source.4561: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.4562: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.4563: DFBPPR16528 ---- Animal proteins ---- Signal recognition particle 14 kDa protein
Source.4564: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.4565: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.4566: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.4567: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.4568: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.4569: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.4570: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83
Source.4571: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.4572: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.4573: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.4574: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4575: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.4576: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.4577: DFBPPR16558 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.4578: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.4579: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.4580: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.4581: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.4582: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2
Source.4583: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.4584: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2
Source.4585: DFBPPR16571 ---- Animal proteins ---- Pro-MCH
Source.4586: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.4587: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.4588: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.4589: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.4590: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.4591: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4592: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.4593: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin
Source.4594: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.4595: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20
Source.4596: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c
Source.4597: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.4598: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.4599: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.4600: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.4601: DFBPPR16599 ---- Animal proteins ---- Receptor-binding cancer antigen expressed on SiSo cells
Source.4602: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.4603: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.4604: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.4605: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.4606: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.4607: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.4608: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.4609: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4
Source.4610: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.4611: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4612: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.4613: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4614: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.4615: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.4616: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.4617: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6
Source.4618: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.4619: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.4620: DFBPPR16645 ---- Animal proteins ---- Putative protein SCAMPER
Source.4621: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.4622: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27
Source.4623: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1
Source.4624: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4
Source.4625: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.4626: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.4627: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.4628: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1
Source.4629: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2
Source.4630: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein
Source.4631: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.4632: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.4633: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.4634: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.4635: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.4636: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.4637: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.4638: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.4639: DFBPPR16706 ---- Animal proteins ---- 60S ribosomal protein L19
Source.4640: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.4641: DFBPPR16710 ---- Animal proteins ---- Translocation protein SEC63 homolog
Source.4642: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4643: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.4644: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.4645: DFBPPR16721 ---- Animal proteins ---- Testin
Source.4646: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.4647: DFBPPR16732 ---- Animal proteins ---- HORMA domain-containing protein 2
Source.4648: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.4649: DFBPPR16747 ---- Animal proteins ---- Pleckstrin
Source.4650: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.4651: DFBPPR16750 ---- Animal proteins ---- 60S ribosomal protein L23
Source.4652: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.4653: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.4654: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region
Source.4655: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.4656: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.4657: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4658: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.4659: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.4660: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.4661: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.4662: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.4663: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.4664: DFBPPR16772 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial
Source.4665: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.4666: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.4667: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.4668: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4669: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.4670: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.4671: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.4672: DFBPPR16786 ---- Animal proteins ---- Ubiquitin-fold modifier 1
Source.4673: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.4674: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.4675: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.4676: DFBPPR16799 ---- Animal proteins ---- Somatotropin
Source.4677: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.4678: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.4679: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.4680: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.4681: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.4682: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.4683: DFBPPR16816 ---- Animal proteins ---- Decorin
Source.4684: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4685: DFBPPR16822 ---- Animal proteins ---- Kininogen-2
Source.4686: DFBPPR16823 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.4687: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.4688: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.4689: DFBPPR16830 ---- Animal proteins ---- Kininogen-1
Source.4690: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.4691: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.4692: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109
Source.4693: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.4694: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.4695: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.4696: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6
Source.4697: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.4698: DFBPPR16843 ---- Animal proteins ---- Calmodulin
Source.4699: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.4700: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.4701: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.4702: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.4703: DFBPPR16853 ---- Animal proteins ---- Protein S100-B
Source.4704: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.4705: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.4706: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor
Source.4707: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.4708: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15
Source.4709: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial
Source.4710: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.4711: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.4712: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.4713: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.4714: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.4715: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.4716: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.4717: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.4718: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.4719: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.4720: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.4721: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.4722: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.4723: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.4724: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.4725: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.4726: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial
Source.4727: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4728: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.4729: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.4730: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.4731: DFBPPR16897 ---- Animal proteins ---- Interleukin-4
Source.4732: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.4733: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.4734: DFBPPR16902 ---- Animal proteins ---- Interleukin-8
Source.4735: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.4736: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.4737: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.4738: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.4739: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.4740: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.4741: DFBPPR16919 ---- Animal proteins ---- VIP peptides
Source.4742: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4743: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.4744: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.4745: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4746: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.4747: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.4748: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.4749: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.4750: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13
Source.4751: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.4752: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.4753: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.4754: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.4755: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.4756: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA
Source.4757: DFBPPR16946 ---- Animal proteins ---- Recoverin
Source.4758: DFBPPR16952 ---- Animal proteins ---- Annexin A2
Source.4759: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.4760: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.4761: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.4762: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4763: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.4764: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.4765: DFBPPR16962 ---- Animal proteins ---- Interleukin-18
Source.4766: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.4767: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.4768: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.4769: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.4770: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.4771: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.4772: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.4773: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.4774: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4775: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.4776: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.4777: DFBPPR16981 ---- Animal proteins ---- Clusterin
Source.4778: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.4779: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.4780: DFBPPR16984 ---- Animal proteins ---- Caveolin-2
Source.4781: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.4782: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.4783: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.4784: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2
Source.4785: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.4786: DFBPPR16994 ---- Animal proteins ---- Somatoliberin
Source.4787: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1
Source.4788: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4789: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.4790: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.4791: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.4792: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.4793: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.4794: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.4795: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.4796: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.4797: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.4798: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.4799: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.4800: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.4801: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.4802: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4803: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.4804: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.4805: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.4806: DFBPPR17023 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.4807: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.4808: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.4809: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.4810: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.4811: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4812: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.4813: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.4814: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4815: DFBPPR17035 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1
Source.4816: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.4817: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.4818: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.4819: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.4820: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.4821: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.4822: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.4823: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta
Source.4824: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4825: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.4826: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.4827: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.4828: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.4829: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.4830: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.4831: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.4832: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.4833: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4834: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4835: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.4836: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.4837: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.4838: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.4839: DFBPPR17067 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.4840: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.4841: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.4842: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.4843: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4844: DFBPPR17073 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.4845: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.4846: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.4847: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4848: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.4849: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.4850: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.4851: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1
Source.4852: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.4853: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.4854: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.4855: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.4856: DFBPPR17090 ---- Animal proteins ---- Phakinin
Source.4857: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.4858: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.4859: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.4860: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.4861: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.4862: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.4863: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.4864: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.4865: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.4866: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.4867: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.4868: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.4869: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4870: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4871: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.4872: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.4873: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.4874: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4875: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4876: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.4877: DFBPPR17115 ---- Animal proteins ---- CD44 antigen
Source.4878: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.4879: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.4880: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.4881: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.4882: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.4883: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.4884: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short
Source.4885: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4886: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.4887: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4888: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.4889: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.4890: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.4891: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.4892: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.4893: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4894: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.4895: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.4896: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.4897: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.4898: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1
Source.4899: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1
Source.4900: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1
Source.4901: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.4902: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.4903: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.4904: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.4905: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.4906: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.4907: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.4908: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.4909: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.4910: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.4911: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.4912: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6
Source.4913: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.4914: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.4915: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.4916: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.4917: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.4918: DFBPPR17196 ---- Animal proteins ---- Histone H4
Source.4919: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.4920: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.4921: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1
Source.4922: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.4923: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.4924: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.4925: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4926: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4927: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.4928: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.4929: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial
Source.4930: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.4931: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.4932: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.4933: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.4934: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.4935: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.4936: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.4937: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.4938: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.4939: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.4940: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.4941: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.4942: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.4943: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.4944: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.4945: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.4946: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.4947: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.4948: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.4949: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.4950: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.4951: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.4952: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4953: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.4954: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.4955: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.4956: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.4957: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.4958: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.4959: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.4960: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.4961: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.4962: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.4963: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.4964: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.4965: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.4966: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.4967: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.4968: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.4969: DFBPPR17324 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.4970: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.4971: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.4972: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.4973: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.4974: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.4975: DFBPPR17334 ---- Animal proteins ---- Prohibitin
Source.4976: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.4977: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.4978: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.4979: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.4980: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.4981: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.4982: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.4983: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1
Source.4984: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.4985: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.4986: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.4987: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.4988: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.4989: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.4990: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.4991: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.4992: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1
Source.4993: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.4994: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.4995: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.4996: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.4997: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.4998: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.4999: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.5000: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6
Source.5001: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.5002: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.5003: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.5004: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.5005: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.5006: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.5007: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.5008: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.5009: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2
Source.5010: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.5011: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2
Source.5012: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.5013: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.5014: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.5015: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.5016: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.5017: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.5018: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.5019: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.5020: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.5021: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.5022: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.5023: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.5024: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.5025: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.5026: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.5027: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.5028: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.5029: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.5030: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.5031: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.5032: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.5033: DFBPPR17423 ---- Animal proteins ---- Furin
Source.5034: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.5035: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.5036: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.5037: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5038: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.5039: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1
Source.5040: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.5041: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.5042: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.5043: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1
Source.5044: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.5045: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.5046: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.5047: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.5048: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.5049: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.5050: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.5051: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.5052: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.5053: DFBPPR17449 ---- Animal proteins ---- C-C motif chemokine 3
Source.5054: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.5055: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.5056: DFBPPR17452 ---- Animal proteins ---- CD81 antigen
Source.5057: DFBPPR17453 ---- Animal proteins ---- Calcium and integrin-binding protein 1
Source.5058: DFBPPR17454 ---- Animal proteins ---- Peripherin-2
Source.5059: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.5060: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.5061: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.5062: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.5063: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.5064: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.5065: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.5066: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.5067: DFBPPR17469 ---- Animal proteins ---- Cofilin-1
Source.5068: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.5069: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.5070: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.5071: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.5072: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.5073: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.5074: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1
Source.5075: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.5076: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.5077: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.5078: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.5079: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.5080: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.5081: DFBPPR17490 ---- Animal proteins ---- TIR domain-containing adapter molecule 2
Source.5082: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.5083: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.5084: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.5085: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.5086: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.5087: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.5088: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.5089: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.5090: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.5091: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.5092: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.5093: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.5094: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.5095: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.5096: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.5097: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1
Source.5098: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.5099: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.5100: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.5101: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1
Source.5102: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.5103: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.5104: DFBPPR17529 ---- Animal proteins ---- C-type lectin domain family 7 member A
Source.5105: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.5106: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.5107: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.5108: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.5109: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.5110: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.5111: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.5112: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.5113: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.5114: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.5115: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.5116: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.5117: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.5118: DFBPPR17555 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.5119: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.5120: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.5121: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.5122: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.5123: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.5124: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.5125: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.5126: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B
Source.5127: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.5128: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.5129: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.5130: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.5131: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.5132: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.5133: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.5134: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.5135: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.5136: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.5137: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.5138: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.5139: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.5140: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.5141: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.5142: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.5143: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.5144: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.5145: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.5146: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.5147: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.5148: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1
Source.5149: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.5150: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.5151: DFBPPR17619 ---- Animal proteins ---- Vesicle-associated membrane protein 8
Source.5152: DFBPPR17620 ---- Animal proteins ---- Vesicle-associated membrane protein 8
Source.5153: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.5154: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.5155: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.5156: DFBPPR17633 ---- Animal proteins ---- Lysozyme C
Source.5157: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.5158: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.5159: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.5160: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.5161: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.5162: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.5163: DFBPPR17664 ---- Animal proteins ---- Apolipoprotein C-II
Source.5164: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.5165: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta
Source.5166: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.5167: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.5168: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.5169: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.5170: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.5171: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.5172: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.5173: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.5174: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase
Source.5175: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.5176: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.5177: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6
Source.5178: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.5179: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.5180: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.5181: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.5182: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0
Source.5183: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.5184: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.5185: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.5186: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.5187: DFBPPR17749 ---- Animal proteins ---- CD9 antigen
Source.5188: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.5189: DFBPPR17752 ---- Animal proteins ---- Follistatin
Source.5190: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1
Source.5191: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.5192: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.5193: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.5194: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4
Source.5195: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.5196: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.5197: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.5198: DFBPPR17776 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.5199: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.5200: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.5201: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.5202: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.5203: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.5204: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.5205: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.5206: DFBPPR17790 ---- Animal proteins ---- Interleukin-15
Source.5207: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.5208: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.5209: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.5210: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.5211: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.5212: DFBPPR17799 ---- Animal proteins ---- Gamma-synuclein
Source.5213: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.5214: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.5215: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.5216: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.5217: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.5218: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.5219: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.5220: DFBPPR17816 ---- Animal proteins ---- Lumican
Source.5221: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.5222: DFBPPR17820 ---- Animal proteins ---- Osteomodulin
Source.5223: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.5224: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.5225: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.5226: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5227: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.5228: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.5229: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.5230: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.5231: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.5232: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.5233: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.5234: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.5235: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.5236: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1
Source.5237: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.5238: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.5239: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.5240: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.5241: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.5242: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5243: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.5244: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.5245: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.5246: DFBPPR17855 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.5247: DFBPPR17856 ---- Animal proteins ---- Selenoprotein S
Source.5248: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.5249: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor
Source.5250: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.5251: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase
Source.5252: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.5253: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.5254: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1
Source.5255: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.5256: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.5257: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.5258: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.5259: DFBPPR17879 ---- Animal proteins ---- Menin
Source.5260: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.5261: DFBPPR17885 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 6
Source.5262: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor
Source.5263: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.5264: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.5265: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.5266: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.5267: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.5268: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.5269: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.5270: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.5271: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.5272: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.5273: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.5274: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8
Source.5275: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.5276: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein
Source.5277: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.5278: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.5279: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.5280: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.5281: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.5282: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial
Source.5283: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.5284: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.5285: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.5286: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.5287: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.5288: DFBPPR17928 ---- Animal proteins ---- CD40 ligand
Source.5289: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.5290: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.5291: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.5292: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.5293: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.5294: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.5295: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.5296: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.5297: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.5298: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38
Source.5299: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.5300: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9
Source.5301: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.5302: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.5303: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.5304: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.5305: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.5306: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.5307: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.5308: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.5309: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.5310: DFBPPR17954 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member A
Source.5311: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase
Source.5312: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.5313: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.5314: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG
Source.5315: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.5316: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.5317: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.5318: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.5319: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.5320: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.5321: DFBPPR17970 ---- Animal proteins ---- Profilin-2
Source.5322: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.5323: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.5324: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.5325: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.5326: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.5327: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.5328: DFBPPR17981 ---- Animal proteins ---- Retinol-binding protein 4
Source.5329: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.5330: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.5331: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.5332: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.5333: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3
Source.5334: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.5335: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.5336: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.5337: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.5338: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.5339: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.5340: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.5341: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.5342: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.5343: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase
Source.5344: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.5345: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.5346: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5347: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.5348: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.5349: DFBPPR18011 ---- Animal proteins ---- Afamin
Source.5350: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.5351: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.5352: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.5353: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.5354: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.5355: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.5356: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.5357: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.5358: DFBPPR18022 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.5359: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.5360: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.5361: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.5362: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.5363: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain
Source.5364: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.5365: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.5366: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.5367: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.5368: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.5369: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.5370: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.5371: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S
Source.5372: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.5373: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.5374: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.5375: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1
Source.5376: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial
Source.5377: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.5378: DFBPPR18050 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.5379: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1
Source.5380: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.5381: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.5382: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T
Source.5383: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A
Source.5384: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.5385: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.5386: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.5387: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.5388: DFBPPR18065 ---- Animal proteins ---- Isopentenyl-diphosphate Delta-isomerase 1
Source.5389: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.5390: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.5391: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.5392: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.5393: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.5394: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.5395: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.5396: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.5397: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta
Source.5398: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.5399: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.5400: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.5401: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.5402: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.5403: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.5404: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4
Source.5405: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.5406: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.5407: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.5408: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.5409: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.5410: DFBPPR18104 ---- Animal proteins ---- Thioredoxin
Source.5411: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.5412: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.5413: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29
Source.5414: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.5415: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.5416: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.5417: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4
Source.5418: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.5419: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.5420: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.5421: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.5422: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.5423: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.5424: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.5425: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.5426: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.5427: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.5428: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1
Source.5429: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.5430: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.5431: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.5432: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.5433: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.5434: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.5435: DFBPPR18157 ---- Animal proteins ---- Hematopoietic cell signal transducer
Source.5436: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.5437: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.5438: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.5439: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.5440: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.5441: DFBPPR18166 ---- Animal proteins ---- Selenoprotein P
Source.5442: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.5443: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.5444: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.5445: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.5446: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.5447: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2
Source.5448: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5449: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.5450: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.5451: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.5452: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.5453: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.5454: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.5455: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.5456: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.5457: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta
Source.5458: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.5459: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.5460: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor
Source.5461: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40
Source.5462: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.5463: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.5464: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.5465: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.5466: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.5467: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.5468: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.5469: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.5470: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.5471: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.5472: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a
Source.5473: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.5474: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.5475: DFBPPR18254 ---- Animal proteins ---- C-type lectin domain family 6 member A
Source.5476: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.5477: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10
Source.5478: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41
Source.5479: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.5480: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.5481: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.5482: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta
Source.5483: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.5484: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.5485: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.5486: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein
Source.5487: DFBPPR18271 ---- Animal proteins ---- Lysozyme C-2
Source.5488: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.5489: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial
Source.5490: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.5491: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.5492: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.5493: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.5494: DFBPPR18285 ---- Animal proteins ---- ADP-ribose glycohydrolase OARD1
Source.5495: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.5496: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.5497: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.5498: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.5499: DFBPPR18292 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 11
Source.5500: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.5501: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.5502: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.5503: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.5504: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.5505: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1
Source.5506: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.5507: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.5508: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.5509: DFBPPR18307 ---- Animal proteins ---- Claudin-4
Source.5510: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A
Source.5511: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.5512: DFBPPR18312 ---- Animal proteins ---- Interleukin-10
Source.5513: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.5514: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.5515: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.5516: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.5517: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1
Source.5518: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial
Source.5519: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.5520: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.5521: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.5522: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.5523: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.5524: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.5525: DFBPPR18340 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.5526: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2
Source.5527: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.5528: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.5529: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.5530: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.5531: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.5532: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.5533: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.5534: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.5535: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.5536: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.5537: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.5538: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.5539: DFBPPR18363 ---- Animal proteins ---- Spexin
Source.5540: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.5541: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.5542: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.5543: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.5544: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.5545: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.5546: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.5547: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.5548: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.5549: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.5550: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3
Source.5551: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1
Source.5552: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.5553: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.5554: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.5555: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.5556: DFBPPR18391 ---- Animal proteins ---- Exosome complex component RRP43
Source.5557: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.5558: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.5559: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.5560: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.5561: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.5562: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.5563: DFBPPR18400 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.5564: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.5565: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.5566: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.5567: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.5568: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen
Source.5569: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.5570: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.5571: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.5572: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.5573: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14
Source.5574: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.5575: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.5576: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.5577: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.5578: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.5579: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.5580: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.5581: DFBPPR18433 ---- Animal proteins ---- Basigin
Source.5582: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.5583: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.5584: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.5585: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.5586: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.5587: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.5588: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2
Source.5589: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.5590: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.5591: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.5592: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.5593: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.5594: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.5595: DFBPPR18458 ---- Animal proteins ---- Fatty acid-binding protein, liver
Source.5596: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.5597: DFBPPR18462 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.5598: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.5599: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.5600: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.5601: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.5602: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.5603: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.5604: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.5605: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.5606: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.5607: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.5608: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.5609: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.5610: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.5611: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.5612: DFBPPR18488 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.5613: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1
Source.5614: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.5615: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.5616: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.5617: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.5618: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.5619: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.5620: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb
Source.5621: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.5622: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial
Source.5623: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.5624: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.5625: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.5626: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.5627: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.5628: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.5629: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C
Source.5630: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.5631: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1
Source.5632: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.5633: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.5634: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.5635: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.5636: DFBPPR18528 ---- Animal proteins ---- 14-3-3 protein sigma
Source.5637: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.5638: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.5639: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.5640: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.5641: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.5642: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1
Source.5643: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.5644: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.5645: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.5646: DFBPPR18543 ---- Animal proteins ---- Proproteinase E
Source.5647: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.5648: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.5649: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.5650: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.5651: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor
Source.5652: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.5653: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.5654: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.5655: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.5656: DFBPPR18560 ---- Animal proteins ---- Rho-related GTP-binding protein RhoF
Source.5657: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3
Source.5658: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.5659: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.5660: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal
Source.5661: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.5662: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1
Source.5663: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.5664: DFBPPR18573 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain
Source.5665: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.5666: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.5667: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.5668: DFBPPR18581 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 7
Source.5669: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.5670: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.5671: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.5672: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.5673: DFBPPR18589 ---- Animal proteins ---- Interleukin-13
Source.5674: DFBPPR18590 ---- Animal proteins ---- Retinol-binding protein 1
Source.5675: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.5676: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.5677: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.5678: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2
Source.5679: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.5680: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.5681: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.5682: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26
Source.5683: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.5684: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.5685: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.5686: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.5687: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.5688: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.5689: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.5690: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.5691: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.5692: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase
Source.5693: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.5694: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.5695: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase
Source.5696: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.5697: DFBPPR18632 ---- Animal proteins ---- Syntaxin-4
Source.5698: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.5699: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.5700: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB
Source.5701: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.5702: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.5703: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3
Source.5704: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.5705: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.5706: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.5707: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.5708: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.5709: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.5710: DFBPPR18651 ---- Animal proteins ---- Allergen Bos d 2
Source.5711: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.5712: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.5713: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.5714: DFBPPR18686 ---- Animal proteins ---- Intraflagellar transport protein 27 homolog
Source.5715: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.5716: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.5717: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D
Source.5718: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.5719: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.5720: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor
Source.5721: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.5722: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase
Source.5723: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.5724: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5
Source.5725: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.5726: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.5727: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.5728: DFBPPR18719 ---- Animal proteins ---- A-kinase anchor protein 5
Source.5729: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.5730: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.5731: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.5732: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial
Source.5733: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.5734: DFBPPR18734 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF114
Source.5735: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.5736: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.5737: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.5738: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.5739: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II
Source.5740: DFBPPR18743 ---- Animal proteins ---- Sperm-egg fusion protein TMEM95
Source.5741: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.5742: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.5743: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.5744: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase
Source.5745: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.5746: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.5747: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.5748: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.5749: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.5750: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.5751: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50
Source.5752: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.5753: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9
Source.5754: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.5755: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9
Source.5756: DFBPPR18775 ---- Animal proteins ---- tRNA methyltransferase 10 homolog A
Source.5757: DFBPPR18779 ---- Animal proteins ---- Mucin-15
Source.5758: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.5759: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.5760: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A
Source.5761: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.5762: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.5763: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU
Source.5764: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein
Source.5765: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.5766: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.5767: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C
Source.5768: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2
Source.5769: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.5770: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.5771: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.5772: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.5773: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.5774: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha
Source.5775: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.5776: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.5777: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.5778: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.5779: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.5780: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.5781: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1
Source.5782: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.5783: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.5784: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.5785: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.5786: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.5787: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.5788: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.5789: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.5790: DFBPPR18825 ---- Animal proteins ---- Glutaredoxin-1
Source.5791: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.5792: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.5793: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1
Source.5794: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.5795: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.5796: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor
Source.5797: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.5798: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.5799: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.5800: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.5801: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.5802: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.5803: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.5804: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.5805: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.5806: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.5807: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.5808: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.5809: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.5810: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.5811: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.5812: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.5813: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.5814: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.5815: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.5816: DFBPPR18869 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit beta
Source.5817: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.5818: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.5819: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.5820: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.5821: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.5822: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.5823: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase
Source.5824: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.5825: DFBPPR18882 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.5826: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.5827: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.5828: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.5829: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.5830: DFBPPR18893 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM20 homolog
Source.5831: DFBPPR18894 ---- Animal proteins ---- NEDD8-conjugating enzyme Ubc12
Source.5832: DFBPPR18895 ---- Animal proteins ---- Lysozyme C-1
Source.5833: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.5834: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.5835: DFBPPR18899 ---- Animal proteins ---- Cofilin-2
Source.5836: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.5837: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.5838: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.5839: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.5840: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.5841: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.5842: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.5843: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.5844: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.5845: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.5846: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.5847: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.5848: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.5849: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.5850: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.5851: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.5852: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.5853: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.5854: DFBPPR18931 ---- Animal proteins ---- Ficolin-2
Source.5855: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.5856: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.5857: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.5858: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.5859: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.5860: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.5861: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.5862: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1
Source.5863: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.5864: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.5865: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.5866: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.5867: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.5868: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.5869: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.5870: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.5871: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.5872: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.5873: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.5874: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.5875: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1
Source.5876: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog
Source.5877: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.5878: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein
Source.5879: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.5880: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.5881: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.5882: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.5883: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.5884: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.5885: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.5886: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor
Source.5887: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.5888: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.5889: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.5890: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.5891: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.5892: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.5893: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1
Source.5894: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.5895: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.5896: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.5897: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.5898: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.5899: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1
Source.5900: DFBPPR19011 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF138
Source.5901: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.5902: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.5903: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.5904: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.5905: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.5906: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.5907: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.5908: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.5909: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.5910: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.5911: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.5912: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.5913: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.5914: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.5915: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.5916: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.5917: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.5918: DFBPPR19037 ---- Animal proteins ---- Transthyretin
Source.5919: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.5920: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.5921: DFBPPR19042 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 2
Source.5922: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.5923: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.5924: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.5925: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.5926: DFBPPR19059 ---- Animal proteins ---- Lysozyme C, non-stomach isozyme
Source.5927: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.5928: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.5929: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.5930: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.5931: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.5932: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.5933: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.5934: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.5935: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21
Source.5936: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.5937: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2
Source.5938: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.5939: DFBPPR19078 ---- Animal proteins ---- Cystatin-B
Source.5940: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.5941: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.5942: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.5943: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.5944: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.5945: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A
Source.5946: DFBPPR19094 ---- Animal proteins ---- C-C motif chemokine 4
Source.5947: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.5948: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.5949: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.5950: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.5951: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.5952: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.5953: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.5954: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.5955: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.5956: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.5957: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.5958: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.5959: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.5960: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.5961: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2
Source.5962: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.5963: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.5964: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.5965: DFBPPR19140 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 5
Source.5966: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.5967: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.5968: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.5969: DFBPPR19150 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase H
Source.5970: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.5971: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.5972: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.5973: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.5974: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.5975: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma
Source.5976: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.5977: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.5978: DFBPPR19174 ---- Animal proteins ---- Neuroendocrine secretory protein 55
Source.5979: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.5980: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.5981: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.5982: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33
Source.5983: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.5984: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.5985: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.5986: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.5987: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.5988: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.5989: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.5990: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.5991: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein
Source.5992: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A
Source.5993: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.5994: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.5995: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.5996: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.5997: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.5998: DFBPPR19211 ---- Animal proteins ---- Beta-synuclein
Source.5999: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1
Source.6000: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2
Source.6001: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.6002: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.6003: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.6004: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.6005: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.6006: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.6007: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.6008: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.6009: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.6010: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.6011: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.6012: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.6013: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.6014: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.6015: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.6016: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.6017: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.6018: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.6019: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.6020: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.6021: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.6022: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.6023: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.6024: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.6025: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.6026: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.6027: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like
Source.6028: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.6029: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.6030: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.6031: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.6032: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.6033: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.6034: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.6035: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.6036: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.6037: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.6038: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.6039: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.6040: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.6041: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3
Source.6042: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.6043: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.6044: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6
Source.6045: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B
Source.6046: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.6047: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.6048: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.6049: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3
Source.6050: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.6051: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.6052: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.6053: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.6054: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1
Source.6055: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.6056: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.6057: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.6058: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1
Source.6059: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.6060: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.6061: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.6062: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.6063: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.6064: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.6065: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.6066: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9
Source.6067: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.6068: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.6069: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.6070: DFBPPR19342 ---- Animal proteins ---- Calcium load-activated calcium channel
Source.6071: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.6072: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1
Source.6073: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3
Source.6074: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.6075: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.6076: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.6077: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.6078: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.6079: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.6080: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.6081: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3
Source.6082: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.6083: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.6084: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel
Source.6085: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.6086: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.6087: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A
Source.6088: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1
Source.6089: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.6090: DFBPPR19377 ---- Animal proteins ---- ER lumen protein-retaining receptor 2
Source.6091: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.6092: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.6093: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.6094: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.6095: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.6096: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A
Source.6097: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.6098: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.6099: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.6100: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6
Source.6101: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.6102: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.6103: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4
Source.6104: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.6105: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.6106: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog
Source.6107: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.6108: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.6109: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.6110: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.6111: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.6112: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22
Source.6113: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.6114: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19
Source.6115: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.6116: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.6117: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.6118: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.6119: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2
Source.6120: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.6121: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.6122: DFBPPR19438 ---- Animal proteins ---- Protein Mis18-alpha
Source.6123: DFBPPR19439 ---- Animal proteins ---- Adenylate kinase isoenzyme 6
Source.6124: DFBPPR19443 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.6125: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.6126: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.6127: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.6128: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.6129: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.6130: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.6131: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.6132: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.6133: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.6134: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4
Source.6135: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.6136: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.6137: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.6138: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.6139: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2
Source.6140: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.6141: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.6142: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12
Source.6143: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.6144: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6145: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.6146: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.6147: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.6148: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.6149: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.6150: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.6151: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.6152: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5
Source.6153: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase
Source.6154: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.6155: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3
Source.6156: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.6157: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.6158: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.6159: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.6160: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.6161: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5
Source.6162: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.6163: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.6164: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.6165: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.6166: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.6167: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.6168: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.6169: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta
Source.6170: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E
Source.6171: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.6172: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.6173: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.6174: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.6175: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.6176: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.6177: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.6178: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase
Source.6179: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.6180: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1
Source.6181: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.6182: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.6183: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.6184: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.6185: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.6186: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.6187: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.6188: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.6189: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.6190: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.6191: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.6192: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.6193: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.6194: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.6195: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.6196: DFBPPR19575 ---- Animal proteins ---- Acylphosphatase-2
Source.6197: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.6198: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.6199: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.6200: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.6201: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.6202: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.6203: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.6204: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.6205: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.6206: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.6207: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.6208: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.6209: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.6210: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.6211: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.6212: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C
Source.6213: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.6214: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.6215: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.6216: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.6217: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.6218: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.6219: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.6220: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.6221: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.6222: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.6223: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.6224: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.6225: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.6226: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.6227: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.6228: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.6229: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.6230: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.6231: DFBPPR19640 ---- Animal proteins ---- Prolargin
Source.6232: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.6233: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.6234: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.6235: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.6236: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.6237: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.6238: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.6239: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B
Source.6240: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.6241: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.6242: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.6243: DFBPPR19662 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1
Source.6244: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.6245: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.6246: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.6247: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.6248: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.6249: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.6250: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.6251: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.6252: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3
Source.6253: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.6254: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5
Source.6255: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.6256: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.6257: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.6258: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.6259: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.6260: DFBPPR19696 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.6261: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.6262: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.6263: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.6264: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.6265: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.6266: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.6267: DFBPPR19709 ---- Animal proteins ---- Centromere protein X
Source.6268: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.6269: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2
Source.6270: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1
Source.6271: DFBPPR19717 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM14
Source.6272: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.6273: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.6274: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1
Source.6275: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3
Source.6276: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.6277: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.6278: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.6279: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.6280: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1
Source.6281: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.6282: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.6283: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5
Source.6284: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.6285: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.6286: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2
Source.6287: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.6288: DFBPPR19748 ---- Animal proteins ---- 60S ribosomal protein L23
Source.6289: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.6290: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1
Source.6291: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.6292: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase
Source.6293: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.6294: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2
Source.6295: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.6296: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.6297: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH
Source.6298: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.6299: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.6300: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.6301: DFBPPR19777 ---- Animal proteins ---- Translin
Source.6302: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.6303: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit
Source.6304: DFBPPR19781 ---- Animal proteins ---- Secretory carrier-associated membrane protein 5
Source.6305: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.6306: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.6307: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11
Source.6308: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.6309: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.6310: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.6311: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.6312: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.6313: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1
Source.6314: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.6315: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.6316: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.6317: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.6318: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.6319: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.6320: DFBPPR19812 ---- Animal proteins ---- Probable inactive serine protease 37
Source.6321: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.6322: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.6323: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.6324: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6
Source.6325: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.6326: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B
Source.6327: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.6328: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.6329: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.6330: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.6331: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.6332: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.6333: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.6334: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.6335: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.6336: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.6337: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30
Source.6338: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.6339: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4
Source.6340: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.6341: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.6342: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.6343: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.6344: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial
Source.6345: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.6346: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.6347: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1
Source.6348: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.6349: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.6350: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.6351: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.6352: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.6353: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.6354: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.6355: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.6356: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.6357: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.6358: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.6359: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.6360: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.6361: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.6362: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.6363: DFBPPR19880 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.6364: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.6365: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.6366: DFBPPR19886 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4A
Source.6367: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2
Source.6368: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase
Source.6369: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.6370: DFBPPR19893 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.6371: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.6372: DFBPPR19898 ---- Animal proteins ---- Essential MCU regulator, mitochondrial
Source.6373: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.6374: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.6375: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.6376: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.6377: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.6378: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.6379: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.6380: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial
Source.6381: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.6382: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.6383: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.6384: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.6385: DFBPPR19921 ---- Animal proteins ---- Histone deacetylase complex subunit SAP18
Source.6386: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.6387: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.6388: DFBPPR19927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] flavoprotein 3, mitochondrial
Source.6389: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6
Source.6390: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.6391: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1
Source.6392: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.6393: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.6394: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.6395: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.6396: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.6397: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.6398: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.6399: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.6400: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.6401: DFBPPR19956 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.6402: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.6403: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B
Source.6404: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.6405: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.6406: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.6407: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial
Source.6408: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.6409: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.6410: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma
Source.6411: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.6412: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.6413: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.6414: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1
Source.6415: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.6416: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.6417: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.6418: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.6419: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.6420: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.6421: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.6422: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.6423: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.6424: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.6425: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.6426: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.6427: DFBPPR19996 ---- Animal proteins ---- Interleukin-3
Source.6428: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16
Source.6429: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.6430: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.6431: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.6432: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer
Source.6433: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.6434: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR
Source.6435: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.6436: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1
Source.6437: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.6438: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.6439: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.6440: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1
Source.6441: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.6442: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.6443: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.6444: DFBPPR20034 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C1, mitochondrial
Source.6445: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.6446: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.6447: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.6448: DFBPPR20044 ---- Animal proteins ---- Secernin-1
Source.6449: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B
Source.6450: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.6451: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.6452: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.6453: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.6454: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.6455: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.6456: DFBPPR20057 ---- Animal proteins ---- AP-3 complex subunit sigma-1
Source.6457: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.6458: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.6459: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial
Source.6460: DFBPPR20065 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3
Source.6461: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.6462: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.6463: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.6464: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.6465: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.6466: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.6467: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.6468: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.6469: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2
Source.6470: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.6471: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.6472: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.6473: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.6474: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1
Source.6475: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.6476: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.6477: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.6478: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1
Source.6479: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.6480: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.6481: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.6482: DFBPPR20098 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B
Source.6483: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.6484: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6485: DFBPPR20102 ---- Animal proteins ---- Cylicin-2
Source.6486: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.6487: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.6488: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.6489: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.6490: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.6491: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.6492: DFBPPR20124 ---- Animal proteins ---- Serine palmitoyltransferase small subunit B
Source.6493: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.6494: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.6495: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.6496: DFBPPR20139 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm4
Source.6497: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.6498: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.6499: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.6500: DFBPPR20145 ---- Animal proteins ---- Adipogenin
Source.6501: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.6502: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C
Source.6503: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.6504: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.6505: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma
Source.6506: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.6507: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.6508: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.6509: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A
Source.6510: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.6511: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.6512: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.6513: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.6514: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.6515: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.6516: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.6517: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein
Source.6518: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.6519: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.6520: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.6521: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.6522: DFBPPR20184 ---- Animal proteins ---- Centromere protein H
Source.6523: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.6524: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3
Source.6525: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.6526: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.6527: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.6528: DFBPPR20194 ---- Animal proteins ---- 28S ribosomal protein S24, mitochondrial
Source.6529: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20
Source.6530: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.6531: DFBPPR20204 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.6532: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.6533: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1
Source.6534: DFBPPR20210 ---- Animal proteins ---- Exonuclease V
Source.6535: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.6536: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.6537: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.6538: DFBPPR20225 ---- Animal proteins ---- Claudin-2
Source.6539: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase
Source.6540: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.6541: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.6542: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.6543: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.6544: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1
Source.6545: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.6546: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.6547: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.6548: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B
Source.6549: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.6550: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.6551: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2
Source.6552: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.6553: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.6554: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28
Source.6555: DFBPPR20250 ---- Animal proteins ---- General transcription factor IIH subunit 5
Source.6556: DFBPPR20252 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform
Source.6557: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.6558: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.6559: DFBPPR20262 ---- Animal proteins ---- DNA-directed RNA polymerase I subunit RPA12
Source.6560: DFBPPR20264 ---- Animal proteins ---- AP-3 complex subunit sigma-2
Source.6561: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1
Source.6562: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.6563: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.6564: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3
Source.6565: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.6566: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.6567: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.6568: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.6569: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6
Source.6570: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.6571: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2
Source.6572: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.6573: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.6574: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.6575: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like
Source.6576: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase
Source.6577: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal
Source.6578: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.6579: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.6580: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.6581: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.6582: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator
Source.6583: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3
Source.6584: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3
Source.6585: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.6586: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B
Source.6587: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.6588: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3
Source.6589: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.6590: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9
Source.6591: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.6592: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV
Source.6593: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.6594: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.6595: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.6596: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.6597: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3
Source.6598: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.6599: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.6600: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.6601: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.6602: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6603: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial
Source.6604: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1
Source.6605: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.6606: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial
Source.6607: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.6608: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.6609: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.6610: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.6611: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2
Source.6612: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.6613: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2
Source.6614: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase
Source.6615: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.6616: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.6617: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.6618: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.6619: DFBPPR20363 ---- Animal proteins ---- F-box/LRR-repeat protein 2
Source.6620: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.6621: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1
Source.6622: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.6623: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2
Source.6624: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.6625: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.6626: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.6627: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.6628: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.6629: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.6630: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.6631: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.6632: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.6633: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.6634: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.6635: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.6636: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.6637: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.6638: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.6639: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2
Source.6640: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.6641: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2
Source.6642: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A
Source.6643: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.6644: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.6645: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.6646: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.6647: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.6648: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.6649: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.6650: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.6651: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.6652: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2
Source.6653: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.6654: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.6655: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.6656: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.6657: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.6658: DFBPPR20438 ---- Animal proteins ---- Small ubiquitin-related modifier 3
Source.6659: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.6660: DFBPPR20440 ---- Animal proteins ---- 28S ribosomal protein S25, mitochondrial
Source.6661: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7
Source.6662: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5
Source.6663: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.6664: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.6665: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.6666: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.6667: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.6668: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.6669: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.6670: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.6671: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.6672: DFBPPR20461 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm8
Source.6673: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.6674: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.6675: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.6676: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.6677: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial
Source.6678: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.6679: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.6680: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.6681: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.6682: DFBPPR20479 ---- Animal proteins ---- Ribonuclease P protein subunit p29
Source.6683: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54
Source.6684: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1
Source.6685: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator
Source.6686: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.6687: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein
Source.6688: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.6689: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.6690: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.6691: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan
Source.6692: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.6693: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog
Source.6694: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog
Source.6695: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.6696: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.6697: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.6698: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.6699: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.6700: DFBPPR20509 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 1
Source.6701: DFBPPR20510 ---- Animal proteins ---- Josephin-1
Source.6702: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.6703: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.6704: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.6705: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.6706: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6
Source.6707: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.6708: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.6709: DFBPPR20522 ---- Animal proteins ---- Serine palmitoyltransferase small subunit A
Source.6710: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.6711: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6
Source.6712: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.6713: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.6714: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.6715: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2
Source.6716: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.6717: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.6718: DFBPPR20546 ---- Animal proteins ---- Odorant-binding protein
Source.6719: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.6720: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1
Source.6721: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.6722: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.6723: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.6724: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.6725: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.6726: DFBPPR20557 ---- Animal proteins ---- Asporin
Source.6727: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.6728: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.6729: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D
Source.6730: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.6731: DFBPPR20570 ---- Animal proteins ---- Intraflagellar transport protein 22 homolog
Source.6732: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.6733: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.6734: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a
Source.6735: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog
Source.6736: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.6737: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.6738: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.6739: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.6740: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.6741: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.6742: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.6743: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein
Source.6744: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.6745: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.6746: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.6747: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.6748: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.6749: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.6750: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.6751: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.6752: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.6753: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.6754: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.6755: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.6756: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.6757: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.6758: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.6759: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3
Source.6760: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.6761: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5
Source.6762: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C
Source.6763: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.6764: DFBPPR20637 ---- Animal proteins ---- Mitochondrial mRNA pseudouridine synthase RPUSD3
Source.6765: DFBPPR20638 ---- Animal proteins ---- DPH3 homolog
Source.6766: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.6767: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.6768: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.6769: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog
Source.6770: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.6771: DFBPPR20651 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 2, mitochondrial
Source.6772: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.6773: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.6774: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.6775: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.6776: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.6777: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3
Source.6778: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.6779: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.6780: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2
Source.6781: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.6782: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45
Source.6783: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.6784: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.6785: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2
Source.6786: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.6787: DFBPPR20679 ---- Animal proteins ---- Ragulator complex protein LAMTOR4
Source.6788: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.6789: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.6790: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.6791: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial
Source.6792: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial
Source.6793: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.6794: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.6795: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.6796: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.6797: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.6798: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2
Source.6799: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.6800: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.6801: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.6802: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.6803: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial
Source.6804: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.6805: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.6806: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase
Source.6807: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.6808: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.6809: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.6810: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.6811: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.6812: DFBPPR20728 ---- Animal proteins ---- Serine protease 45
Source.6813: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6
Source.6814: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.6815: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.6816: DFBPPR20736 ---- Animal proteins ---- Osteopontin-K
Source.6817: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.6818: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.6819: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.6820: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.6821: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.6822: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.6823: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B
Source.6824: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1
Source.6825: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.6826: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.6827: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.6828: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.6829: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.6830: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.6831: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.6832: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.6833: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.6834: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.6835: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.6836: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.6837: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.6838: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.6839: DFBPPR20780 ---- Animal proteins ---- Retinol-binding protein 5
Source.6840: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.6841: DFBPPR20786 ---- Animal proteins ---- 40S ribosomal protein S27
Source.6842: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.6843: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6
Source.6844: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.6845: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6846: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.6847: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.6848: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.6849: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.6850: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.6851: DFBPPR20809 ---- Animal proteins ---- F-box and leucine-rich protein 22
Source.6852: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.6853: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.6854: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.6855: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1
Source.6856: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.6857: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT
Source.6858: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2
Source.6859: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.6860: DFBPPR20821 ---- Animal proteins ---- Prefoldin subunit 4
Source.6861: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.6862: DFBPPR20824 ---- Animal proteins ---- CD151 antigen
Source.6863: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.6864: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.6865: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.6866: DFBPPR20832 ---- Animal proteins ---- Metalloproteinase inhibitor 4
Source.6867: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.6868: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.6869: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.6870: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.6871: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.6872: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.6873: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.6874: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.6875: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.6876: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.6877: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.6878: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.6879: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.6880: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase
Source.6881: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.6882: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.6883: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.6884: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.6885: DFBPPR20871 ---- Animal proteins ---- Iron-sulfur cluster assembly 2 homolog, mitochondrial
Source.6886: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.6887: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.6888: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.6889: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.6890: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B
Source.6891: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.6892: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3
Source.6893: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta
Source.6894: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3
Source.6895: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.6896: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.6897: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.6898: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.6899: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B
Source.6900: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.6901: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.6902: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.6903: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.6904: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.6905: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.6906: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator
Source.6907: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2
Source.6908: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.6909: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.6910: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.6911: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.6912: DFBPPR20919 ---- Animal proteins ---- Protein cornichon homolog 4
Source.6913: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.6914: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.6915: DFBPPR20922 ---- Animal proteins ---- Calcipressin-2
Source.6916: DFBPPR20923 ---- Animal proteins ---- Cystatin-A
Source.6917: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.6918: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8
Source.6919: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.6920: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.6921: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.6922: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.6923: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.6924: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18
Source.6925: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25
Source.6926: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4
Source.6927: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.6928: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1
Source.6929: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.6930: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.6931: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.6932: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.6933: DFBPPR20950 ---- Animal proteins ---- WAP four-disulfide core domain protein 18
Source.6934: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.6935: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial
Source.6936: DFBPPR20953 ---- Animal proteins ---- Ubiquitin-fold modifier 1
Source.6937: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.6938: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.6939: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17
Source.6940: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog
Source.6941: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.6942: DFBPPR20964 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP2
Source.6943: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein
Source.6944: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.6945: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.6946: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.6947: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.6948: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit
Source.6949: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.6950: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.6951: DFBPPR20982 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial
Source.6952: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.6953: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.6954: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.6955: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.6956: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27
Source.6957: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.6958: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181
Source.6959: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.6960: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.6961: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.6962: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.6963: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.6964: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.6965: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2
Source.6966: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.6967: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.6968: DFBPPR21014 ---- Animal proteins ---- Transmembrane protein 258
Source.6969: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.6970: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.6971: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.6972: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.6973: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5
Source.6974: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.6975: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.6976: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.6977: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.6978: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.6979: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.6980: DFBPPR21034 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 25
Source.6981: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.6982: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.6983: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.6984: DFBPPR21040 ---- Animal proteins ---- Neuritin
Source.6985: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B
Source.6986: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.6987: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.6988: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.6989: DFBPPR21051 ---- Animal proteins ---- SH2 domain-containing protein 1A
Source.6990: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.6991: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.6992: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.6993: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B
Source.6994: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.6995: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.6996: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.6997: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.6998: DFBPPR21066 ---- Animal proteins ---- 40S ribosomal protein S27-like
Source.6999: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.7000: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog
Source.7001: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.7002: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial
Source.7003: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.7004: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.7005: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22
Source.7006: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.7007: DFBPPR21083 ---- Animal proteins ---- TRAF-interacting protein with FHA domain-containing protein A
Source.7008: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial
Source.7009: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.7010: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.7011: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.7012: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.7013: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.7014: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.7015: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.7016: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.7017: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.7018: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3
Source.7019: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.7020: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7
Source.7021: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.7022: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein
Source.7023: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.7024: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3
Source.7025: DFBPPR21122 ---- Animal proteins ---- Derlin-3
Source.7026: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.7027: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.7028: DFBPPR21128 ---- Animal proteins ---- Stefin-C
Source.7029: DFBPPR21130 ---- Animal proteins ---- Transmembrane protein 17
Source.7030: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.7031: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B
Source.7032: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.7033: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.7034: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.7035: DFBPPR21144 ---- Animal proteins ---- Repressor of RNA polymerase III transcription MAF1 homolog
Source.7036: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.7037: DFBPPR21149 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 4
Source.7038: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.7039: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.7040: DFBPPR21152 ---- Animal proteins ---- Protein S100-A2
Source.7041: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.7042: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.7043: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1
Source.7044: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.7045: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4
Source.7046: DFBPPR21160 ---- Animal proteins ---- Prefoldin subunit 3
Source.7047: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.7048: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22
Source.7049: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1
Source.7050: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.7051: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.7052: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.7053: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52
Source.7054: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.7055: DFBPPR21177 ---- Animal proteins ---- Ran guanine nucleotide release factor
Source.7056: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.7057: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7
Source.7058: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.7059: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.7060: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.7061: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.7062: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.7063: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.7064: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.7065: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.7066: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.7067: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.7068: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.7069: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.7070: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.7071: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.7072: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.7073: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.7074: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1
Source.7075: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.7076: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.7077: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.7078: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.7079: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.7080: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein
Source.7081: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2
Source.7082: DFBPPR21239 ---- Animal proteins ---- Coordinator of PRMT5 and differentiation stimulator
Source.7083: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.7084: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1
Source.7085: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36
Source.7086: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.7087: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.7088: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.7089: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3
Source.7090: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.7091: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.7092: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.7093: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6
Source.7094: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.7095: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.7096: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.7097: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.7098: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21
Source.7099: DFBPPR21272 ---- Animal proteins ---- Testin
Source.7100: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.7101: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.7102: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.7103: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.7104: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.7105: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.7106: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.7107: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial
Source.7108: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.7109: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.7110: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.7111: DFBPPR21302 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC9
Source.7112: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.7113: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.7114: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.7115: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.7116: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.7117: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.7118: DFBPPR21322 ---- Animal proteins ---- Zinc finger protein 227
Source.7119: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.7120: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3
Source.7121: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.7122: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3
Source.7123: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.7124: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.7125: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.7126: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.7127: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.7128: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.7129: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.7130: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.7131: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.7132: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform
Source.7133: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.7134: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.7135: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4
Source.7136: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.7137: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.7138: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.7139: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.7140: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog
Source.7141: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.7142: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.7143: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2
Source.7144: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.7145: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.7146: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.7147: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.7148: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.7149: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.7150: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.7151: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.7152: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.7153: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.7154: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.7155: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.7156: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A
Source.7157: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2
Source.7158: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.7159: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.7160: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog
Source.7161: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.7162: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.7163: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.7164: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.7165: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.7166: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.7167: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.7168: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.7169: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.7170: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.7171: DFBPPR21425 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 A
Source.7172: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.7173: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.7174: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.7175: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.7176: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.7177: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207
Source.7178: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.7179: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.7180: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2
Source.7181: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.7182: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.7183: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.7184: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2
Source.7185: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.7186: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.7187: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.7188: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.7189: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.7190: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.7191: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.7192: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.7193: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial
Source.7194: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.7195: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.7196: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2
Source.7197: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.7198: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14
Source.7199: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.7200: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.7201: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2
Source.7202: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.7203: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.7204: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.7205: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1
Source.7206: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.7207: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40
Source.7208: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.7209: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.7210: DFBPPR21509 ---- Animal proteins ---- Myoneurin
Source.7211: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.7212: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B
Source.7213: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.7214: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1
Source.7215: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20
Source.7216: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2
Source.7217: DFBPPR21521 ---- Animal proteins ---- Active regulator of SIRT1
Source.7218: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1
Source.7219: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.7220: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.7221: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.7222: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.7223: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.7224: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.7225: DFBPPR21538 ---- Animal proteins ---- Small cell adhesion glycoprotein
Source.7226: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.7227: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.7228: DFBPPR21542 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6c
Source.7229: DFBPPR21545 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1
Source.7230: DFBPPR21547 ---- Animal proteins ---- Osteoclast-stimulating factor 1
Source.7231: DFBPPR21549 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit Y
Source.7232: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.7233: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.7234: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.7235: DFBPPR21555 ---- Animal proteins ---- Zinc finger and SCAN domain-containing protein 26
Source.7236: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55
Source.7237: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.7238: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3
Source.7239: DFBPPR21564 ---- Animal proteins ---- HORMA domain-containing protein 2
Source.7240: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3
Source.7241: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.7242: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B
Source.7243: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.7244: DFBPPR21574 ---- Animal proteins ---- Parvalbumin alpha
Source.7245: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.7246: DFBPPR21582 ---- Animal proteins ---- MORN repeat-containing protein 4
Source.7247: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.7248: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19
Source.7249: DFBPPR21586 ---- Animal proteins ---- Cyclin-C
Source.7250: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.7251: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.7252: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.7253: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.7254: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like
Source.7255: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.7256: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.7257: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.7258: DFBPPR21599 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.7259: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1
Source.7260: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138
Source.7261: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.7262: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.7263: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.7264: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.7265: DFBPPR21617 ---- Animal proteins ---- Proteasome assembly chaperone 3
Source.7266: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.7267: DFBPPR21620 ---- Animal proteins ---- Claudin-12
Source.7268: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.7269: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.7270: DFBPPR21625 ---- Animal proteins ---- 40S ribosomal protein S24
Source.7271: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.7272: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.7273: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.7274: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta
Source.7275: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19
Source.7276: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial
Source.7277: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.7278: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.7279: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.7280: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.7281: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.7282: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6
Source.7283: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.7284: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.7285: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.7286: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2
Source.7287: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.7288: DFBPPR21663 ---- Animal proteins ---- Trafficking protein particle complex subunit 6B
Source.7289: DFBPPR21664 ---- Animal proteins ---- Signal recognition particle 14 kDa protein
Source.7290: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.7291: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.7292: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.7293: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4
Source.7294: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A
Source.7295: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.7296: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26
Source.7297: DFBPPR21682 ---- Animal proteins ---- Protein SYS1 homolog
Source.7298: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.7299: DFBPPR21686 ---- Animal proteins ---- FXYD domain-containing ion transport regulator 6
Source.7300: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2
Source.7301: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18
Source.7302: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.7303: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.7304: DFBPPR21698 ---- Animal proteins ---- Alpha-hemoglobin-stabilizing protein
Source.7305: DFBPPR21699 ---- Animal proteins ---- Transmembrane protein 208
Source.7306: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.7307: DFBPPR21706 ---- Animal proteins ---- Small membrane A-kinase anchor protein
Source.7308: DFBPPR21708 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.7309: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog
Source.7310: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.7311: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.7312: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.7313: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.7314: DFBPPR21719 ---- Animal proteins ---- Protein reprimo
Source.7315: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.7316: DFBPPR21723 ---- Animal proteins ---- OCIA domain-containing protein 1
Source.7317: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.7318: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.7319: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.7320: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.7321: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.7322: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.7323: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.7324: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.7325: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.7326: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.7327: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.7328: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.7329: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.7330: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta
Source.7331: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog
Source.7332: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.7333: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1
Source.7334: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.7335: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.7336: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.7337: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6
Source.7338: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.7339: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.7340: DFBPPR21771 ---- Animal proteins ---- RAD9, HUS1, RAD1-interacting nuclear orphan protein 1
Source.7341: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.7342: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.7343: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.7344: DFBPPR21777 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 10
Source.7345: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.7346: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.7347: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog
Source.7348: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.7349: DFBPPR21789 ---- Animal proteins ---- Protein kish-B
Source.7350: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.7351: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.7352: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial
Source.7353: DFBPPR21793 ---- Animal proteins ---- Dynein light chain Tctex-type protein 2B
Source.7354: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.7355: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.7356: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.7357: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.7358: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.7359: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.7360: DFBPPR21805 ---- Animal proteins ---- 60S ribosomal protein L19
Source.7361: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1
Source.7362: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.7363: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1
Source.7364: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.7365: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog
Source.7366: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.7367: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2
Source.7368: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24
Source.7369: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410
Source.7370: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.7371: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.7372: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.7373: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.7374: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1
Source.7375: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier
Source.7376: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2
Source.7377: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.7378: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein
Source.7379: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.7380: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.7381: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.7382: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.7383: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2
Source.7384: DFBPPR21846 ---- Animal proteins ---- Izumo sperm-egg fusion protein 3
Source.7385: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.7386: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.7387: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.7388: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS
Source.7389: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3
Source.7390: DFBPPR21869 ---- Animal proteins ---- Centromere protein O
Source.7391: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.7392: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.7393: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.7394: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.7395: DFBPPR21876 ---- Animal proteins ---- IgA-inducing protein
Source.7396: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.7397: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.7398: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1
Source.7399: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial
Source.7400: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39
Source.7401: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.7402: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1
Source.7403: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.7404: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.7405: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial
Source.7406: DFBPPR21892 ---- Animal proteins ---- COMM domain-containing protein 9
Source.7407: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5
Source.7408: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3
Source.7409: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.7410: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.7411: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.7412: DFBPPR21905 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 2
Source.7413: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.7414: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.7415: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11
Source.7416: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.7417: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1
Source.7418: DFBPPR21912 ---- Animal proteins ---- Death-associated protein 1
Source.7419: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.7420: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13
Source.7421: DFBPPR21915 ---- Animal proteins ---- Tetraspanin-13
Source.7422: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.7423: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2
Source.7424: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12
Source.7425: DFBPPR21920 ---- Animal proteins ---- Protein DPCD
Source.7426: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4
Source.7427: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.7428: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14
Source.7429: DFBPPR21927 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase-interacting protein
Source.7430: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.7431: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.7432: DFBPPR21935 ---- Animal proteins ---- Sentan
Source.7433: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.7434: DFBPPR21938 ---- Animal proteins ---- Protein RER1
Source.7435: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.7436: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.7437: DFBPPR21941 ---- Animal proteins ---- MOB kinase activator 3A
Source.7438: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.7439: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.7440: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.7441: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.7442: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.7443: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.7444: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1
Source.7445: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3
Source.7446: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.7447: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.7448: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.7449: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.7450: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.7451: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.7452: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.7453: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.7454: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.7455: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.7456: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.7457: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.7458: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7459: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.7460: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.7461: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.7462: DFBPPR21994 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial
Source.7463: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2
Source.7464: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1
Source.7465: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.7466: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3
Source.7467: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.7468: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.7469: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81
Source.7470: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.7471: DFBPPR22012 ---- Animal proteins ---- GRB2-related adapter protein
Source.7472: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.7473: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.7474: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2
Source.7475: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial
Source.7476: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1
Source.7477: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.7478: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.7479: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.7480: DFBPPR22031 ---- Animal proteins ---- KxDL motif-containing protein 1
Source.7481: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.7482: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.7483: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.7484: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.7485: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.7486: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37
Source.7487: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.7488: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.7489: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.7490: DFBPPR22048 ---- Animal proteins ---- Regulated endocrine-specific protein 18
Source.7491: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ
Source.7492: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B
Source.7493: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.7494: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.7495: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A
Source.7496: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.7497: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.7498: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.7499: DFBPPR22070 ---- Animal proteins ---- Maturin
Source.7500: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B
Source.7501: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8
Source.7502: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6
Source.7503: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4
Source.7504: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.7505: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.7506: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1
Source.7507: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.7508: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.7509: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3
Source.7510: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.7511: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.7512: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B
Source.7513: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog
Source.7514: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.7515: DFBPPR22099 ---- Animal proteins ---- Beta-centractin
Source.7516: DFBPPR22100 ---- Animal proteins ---- Centromere protein M
Source.7517: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.7518: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.7519: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1
Source.7520: DFBPPR22105 ---- Animal proteins ---- Centromere protein L
Source.7521: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.7522: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1
Source.7523: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1
Source.7524: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.7525: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.7526: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4
Source.7527: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.7528: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.7529: DFBPPR22125 ---- Animal proteins ---- 40S ribosomal protein S16
Source.7530: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11
Source.7531: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.7532: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.7533: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.7534: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a
Source.7535: DFBPPR22133 ---- Animal proteins ---- MOB kinase activator 3C
Source.7536: DFBPPR22134 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8
Source.7537: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.7538: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.7539: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.7540: DFBPPR22141 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.7541: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.7542: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.7543: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.7544: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.7545: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.7546: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.7547: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.7548: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.7549: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.7550: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.7551: DFBPPR22164 ---- Animal proteins ---- Complex III assembly factor LYRM7
Source.7552: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.7553: DFBPPR22170 ---- Animal proteins ---- Transmembrane protein 106C
Source.7554: DFBPPR22173 ---- Animal proteins ---- Electron transfer flavoprotein regulatory factor 1
Source.7555: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.7556: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.7557: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.7558: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.7559: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.7560: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.7561: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.7562: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.7563: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5
Source.7564: DFBPPR22193 ---- Animal proteins ---- CapZ-interacting protein
Source.7565: DFBPPR22194 ---- Animal proteins ---- Cystatin-9
Source.7566: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.7567: DFBPPR22196 ---- Animal proteins ---- Bladder cancer-associated protein
Source.7568: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.7569: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.7570: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4
Source.7571: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein
Source.7572: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.7573: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.7574: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.7575: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.7576: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.7577: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.7578: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8
Source.7579: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.7580: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22
Source.7581: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.7582: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.7583: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.7584: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.7585: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.7586: DFBPPR22239 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.7587: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.7588: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.7589: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3
Source.7590: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26
Source.7591: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.7592: DFBPPR22249 ---- Animal proteins ---- CXXC motif containing zinc binding protein
Source.7593: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1
Source.7594: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.7595: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.7596: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.7597: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.7598: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog
Source.7599: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.7600: DFBPPR22266 ---- Animal proteins ---- Vexin
Source.7601: DFBPPR22267 ---- Animal proteins ---- Keratin-associated protein 12-2
Source.7602: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.7603: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.7604: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.7605: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.7606: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2
Source.7607: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.7608: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.7609: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.7610: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31
Source.7611: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein
Source.7612: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.7613: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.7614: DFBPPR22309 ---- Animal proteins ---- Spermatogenesis-associated protein 9
Source.7615: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1
Source.7616: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218
Source.7617: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.7618: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.7619: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.7620: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7
Source.7621: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.7622: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.7623: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3
Source.7624: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.7625: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1
Source.7626: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.7627: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1
Source.7628: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.7629: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.7630: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.7631: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.7632: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11
Source.7633: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.7634: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.7635: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.7636: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.7637: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.7638: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.7639: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.7640: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7
Source.7641: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.7642: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.7643: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2
Source.7644: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.7645: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.7646: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.7647: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.7648: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.7649: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein
Source.7650: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.7651: DFBPPR22379 ---- Animal proteins ---- Ribosomal biogenesis factor
Source.7652: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.7653: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.7654: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.7655: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.7656: DFBPPR22391 ---- Animal proteins ---- Transmembrane protein 88B
Source.7657: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2
Source.7658: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein
Source.7659: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog
Source.7660: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.7661: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1
Source.7662: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.7663: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.7664: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.7665: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.7666: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.7667: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1
Source.7668: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.7669: DFBPPR22424 ---- Animal proteins ---- Transmembrane protein 243
Source.7670: DFBPPR22426 ---- Animal proteins ---- Single-pass membrane and coiled-coil domain-containing protein 4
Source.7671: DFBPPR22427 ---- Animal proteins ---- Coiled-coil domain-containing protein 58
Source.7672: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.7673: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog
Source.7674: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.7675: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.7676: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.7677: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.7678: DFBPPR22446 ---- Animal proteins ---- Tektin-5
Source.7679: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.7680: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.7681: DFBPPR22452 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 37
Source.7682: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.7683: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97
Source.7684: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein
Source.7685: DFBPPR22459 ---- Animal proteins ---- SCP2 sterol-binding domain-containing protein 1
Source.7686: DFBPPR22461 ---- Animal proteins ---- Ashwin
Source.7687: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13
Source.7688: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.7689: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.7690: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog
Source.7691: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.7692: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.7693: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1
Source.7694: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.7695: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.7696: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3
Source.7697: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.7698: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.7699: DFBPPR22491 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1B
Source.7700: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.7701: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.7702: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1
Source.7703: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1
Source.7704: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183
Source.7705: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.7706: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46
Source.7707: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.7708: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.7709: DFBPPR22505 ---- Animal proteins ---- Protein HP-20 homolog
Source.7710: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.7711: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.7712: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.7713: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.7714: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248
Source.7715: DFBPPR22522 ---- Animal proteins ---- Coiled-coil domain-containing protein 126
Source.7716: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.7717: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.7718: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29
Source.7719: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.7720: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251
Source.7721: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.7722: DFBPPR22536 ---- Animal proteins ---- Suprabasin
Source.7723: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.7724: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.7725: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25
Source.7726: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.7727: DFBPPR22544 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 2
Source.7728: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1
Source.7729: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.7730: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.7731: DFBPPR22556 ---- Animal proteins ---- Protein maestro
Source.7732: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1
Source.7733: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.7734: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein
Source.7735: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.7736: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5
Source.7737: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein
Source.7738: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.7739: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.7740: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.7741: DFBPPR22576 ---- Animal proteins ---- UPF0547 protein C16orf87 homolog
Source.7742: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1
Source.7743: DFBPPR22585 ---- Animal proteins ---- UPF0449 protein C19orf25 homolog
Source.7744: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.7745: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.7746: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.7747: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.7748: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125
Source.7749: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.7750: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.7751: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.7752: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36
Source.7753: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.7754: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.7755: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105
Source.7756: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71
Source.7757: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.7758: DFBPPR22618 ---- Animal proteins ---- BSD domain-containing protein 1
Source.7759: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.7760: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.7761: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.7762: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61
Source.7763: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30
Source.7764: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.7765: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157
Source.7766: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.7767: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1
Source.7768: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.7769: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog
Source.7770: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.7771: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog
Source.7772: DFBPPR22671 ---- Animal proteins ---- Uncharacterized protein C1orf185 homolog
Source.7773: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89
Source.7774: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog
Source.7775: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.7776: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.7777: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.7778: DFBPPR22693 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1
Source.7779: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein
Source.7780: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.7781: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.7782: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.7783: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.7784: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D
Source.7785: DFBPPR22713 ---- Animal proteins ---- UPF0728 protein C10orf53 homolog
Source.7786: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein
Source.7787: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.7788: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.7789: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.7790: DFBPPR22729 ---- Animal proteins ---- UPF0538 protein C2orf76 homolog
Source.7791: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1
Source.7792: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1
Source.7793: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.7794: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.7795: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.7796: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.7797: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.7798: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog
Source.7799: DFBPPR22751 ---- Animal proteins ---- Uncharacterized protein C8orf74 homolog
Source.7800: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog
Source.7801: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog
Source.7802: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog
Source.7803: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog
Source.7804: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.7805: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.7806: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.7807: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.7808: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7809: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.7810: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.7811: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.7812: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.7813: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.7814: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.7815: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.7816: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.7817: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.7818: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.7819: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.7820: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.7821: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.7822: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.7823: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.7824: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.7825: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.7826: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7827: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.7828: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.7829: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.7830: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.7831: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.7832: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.7833: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.7834: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.7835: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.7836: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.7837: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.7838: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.7839: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.7840: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.7841: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.7842: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.7843: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.7844: DFBPPR8592 ---- Animal proteins ---- Interleukin-18
Source.7845: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.7846: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.7847: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.7848: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.7849: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.7850: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.7851: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein
Source.7852: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.7853: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.7854: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.7855: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6
Source.7856: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.7857: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.7858: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.7859: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.7860: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.7861: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.7862: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.7863: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.7864: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.7865: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.7866: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.7867: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.7868: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.7869: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.7870: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.7871: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.7872: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.7873: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.7874: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.7875: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.7876: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.7877: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.7878: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.7879: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.7880: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.7881: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.7882: DFBPPR8655 ---- Animal proteins ---- Azurocidin
Source.7883: DFBPPR8657 ---- Animal proteins ---- Annexin A2
Source.7884: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.7885: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.7886: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.7887: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.7888: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.7889: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.7890: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.7891: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.7892: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.7893: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.7894: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7895: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.7896: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.7897: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.7898: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.7899: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.7900: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.7901: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.7902: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor
Source.7903: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.7904: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.7905: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.7906: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.7907: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7908: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.7909: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.7910: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.7911: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.7912: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.7913: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.7914: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.7915: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.7916: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.7917: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.7918: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.7919: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.7920: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.7921: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.7922: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.7923: DFBPPR8720 ---- Animal proteins ---- Interleukin-4
Source.7924: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.7925: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.7926: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.7927: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.7928: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.7929: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase
Source.7930: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A
Source.7931: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.7932: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.7933: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.7934: DFBPPR8738 ---- Animal proteins ---- Interleukin-8
Source.7935: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.7936: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.7937: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.7938: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9
Source.7939: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.7940: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.7941: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.7942: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.7943: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.7944: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.7945: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.7946: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.7947: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.7948: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.7949: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.7950: DFBPPR8758 ---- Animal proteins ---- Caveolin-2
Source.7951: DFBPPR8759 ---- Animal proteins ---- Caveolin-3
Source.7952: DFBPPR8760 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.7953: DFBPPR8761 ---- Animal proteins ---- VIP peptides
Source.7954: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.7955: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.7956: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.7957: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.7958: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.7959: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.7960: DFBPPR8771 ---- Animal proteins ---- Cofilin-1
Source.7961: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.7962: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.7963: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.7964: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.7965: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.7966: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.7967: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.7968: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.7969: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.7970: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.7971: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.7972: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.7973: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.7974: DFBPPR8788 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.7975: DFBPPR8789 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.7976: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.7977: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.7978: DFBPPR8793 ---- Animal proteins ---- Histone H4
Source.7979: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.7980: DFBPPR8796 ---- Animal proteins ---- UMP-CMP kinase
Source.7981: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.7982: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.7983: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.7984: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II
Source.7985: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.7986: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.7987: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.7988: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S
Source.7989: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.7990: DFBPPR8810 ---- Animal proteins ---- Follistatin
Source.7991: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.7992: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.7993: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.7994: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.7995: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.7996: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.7997: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.7998: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.7999: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2
Source.8000: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase
Source.8001: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.8002: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.8003: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.8004: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.8005: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.8006: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.8007: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.8008: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.8009: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.8010: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.8011: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.8012: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.8013: DFBPPR8848 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase
Source.8014: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.8015: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.8016: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.8017: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.8018: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.8019: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.8020: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.8021: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.8022: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.8023: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.8024: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.8025: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8026: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.8027: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.8028: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.8029: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.8030: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.8031: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.8032: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.8033: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.8034: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.8035: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.8036: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.8037: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.8038: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.8039: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.8040: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.8041: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.8042: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.8043: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha
Source.8044: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha
Source.8045: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.8046: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.8047: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.8048: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.8049: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.8050: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.8051: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.8052: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.8053: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.8054: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.8055: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.8056: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta
Source.8057: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.8058: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.8059: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.8060: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.8061: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.8062: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.8063: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.8064: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.8065: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.8066: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.8067: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.8068: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.8069: DFBPPR9018 ---- Animal proteins ---- Transthyretin
Source.8070: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.8071: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.8072: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.8073: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.8074: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.8075: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.8076: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.8077: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.8078: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.8079: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.8080: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.8081: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.8082: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.8083: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.8084: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.8085: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3
Source.8086: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.8087: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.8088: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4
Source.8089: DFBPPR9052 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B
Source.8090: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.8091: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.8092: DFBPPR9065 ---- Animal proteins ---- GTPase NRas
Source.8093: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.8094: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.8095: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.8096: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.8097: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.8098: DFBPPR9072 ---- Animal proteins ---- CD9 antigen
Source.8099: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.8100: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.8101: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.8102: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.8103: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.8104: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.8105: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.8106: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.8107: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.8108: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.8109: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5
Source.8110: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.8111: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.8112: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32
Source.8113: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.8114: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.8115: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.8116: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.8117: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.8118: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.8119: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.8120: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.8121: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1
Source.8122: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.8123: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.8124: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.8125: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.8126: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6
Source.8127: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.8128: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.8129: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.8130: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.8131: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.8132: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.8133: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.8134: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.8135: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8136: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.8137: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.8138: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.8139: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II
Source.8140: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.8141: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.8142: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.8143: DFBPPR9149 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.8144: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8145: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.8146: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.8147: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.8148: DFBPPR9159 ---- Animal proteins ---- Hematopoietic cell signal transducer
Source.8149: DFBPPR9160 ---- Animal proteins ---- Acylphosphatase-1
Source.8150: DFBPPR9162 ---- Animal proteins ---- Thioredoxin
Source.8151: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.8152: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.8153: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.8154: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.8155: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.8156: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.8157: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.8158: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.8159: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3
Source.8160: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.8161: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.8162: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.8163: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.8164: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.8165: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.8166: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.8167: DFBPPR9188 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.8168: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2
Source.8169: DFBPPR9192 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.8170: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.8171: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.8172: DFBPPR9199 ---- Animal proteins ---- 60S ribosomal protein L23
Source.8173: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.8174: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.8175: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.8176: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.8177: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein
Source.8178: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.8179: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.8180: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase
Source.8181: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.8182: DFBPPR9218 ---- Animal proteins ---- POU domain, class 3, transcription factor 3
Source.8183: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.8184: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.8185: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.8186: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.8187: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.8188: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.8189: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.8190: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C
Source.8191: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.8192: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.8193: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.8194: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.8195: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.8196: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.8197: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.8198: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1
Source.8199: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.8200: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.8201: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8202: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.8203: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.8204: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.8205: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.8206: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.8207: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8208: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.8209: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.8210: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.8211: DFBPPR9272 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.8212: DFBPPR9273 ---- Animal proteins ---- C-C motif chemokine 4
Source.8213: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.8214: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.8215: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.8216: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.8217: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.8218: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.8219: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.8220: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.8221: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27
Source.8222: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.8223: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.8224: DFBPPR9293 ---- Animal proteins ---- Calcium load-activated calcium channel
Source.8225: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2
Source.8226: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1
Source.8227: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.8228: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.8229: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.8230: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.8231: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.8232: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.8233: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.8234: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.8235: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.8236: DFBPPR9311 ---- Animal proteins ---- Beta-defensin 1
Source.8237: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.8238: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.8239: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.8240: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.8241: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1
Source.8242: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.8243: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.8244: DFBPPR9328 ---- Animal proteins ---- Cofilin-2
Source.8245: DFBPPR9329 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.8246: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.8247: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.8248: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.8249: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.8250: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.8251: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.8252: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.8253: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.8254: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.8255: DFBPPR9345 ---- Animal proteins ---- Relaxin-3
Source.8256: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.8257: DFBPPR9347 ---- Animal proteins ---- C-reactive protein
Source.8258: DFBPPR9348 ---- Animal proteins ---- 60S ribosomal protein L18
Source.8259: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.8260: DFBPPR9356 ---- Animal proteins ---- Odorant-binding protein
Source.8261: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.8262: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.8263: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.8264: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.8265: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.8266: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.8267: DFBPPR9366 ---- Animal proteins ---- Decorin
Source.8268: DFBPPR9368 ---- Animal proteins ---- Myosin-11
Source.8269: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.8270: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.8271: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.8272: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.8273: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.8274: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.8275: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.8276: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.8277: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon
Source.8278: DFBPPR9385 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.8279: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.8280: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11
Source.8281: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.8282: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.8283: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.8284: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.8285: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.8286: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.8287: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.8288: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.8289: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34
Source.8290: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.8291: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.8292: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.8293: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8294: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8295: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8296: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.8297: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.8298: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.8299: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.8300: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.8301: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.8302: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.8303: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.8304: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.8305: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.8306: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.8307: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.8308: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.8309: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8310: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8311: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.8312: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4
Source.8313: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.8314: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.8315: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.8316: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.8317: DFBPPR9455 ---- Animal proteins ---- Cystatin-B
Source.8318: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.8319: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.8320: DFBPPR9459 ---- Animal proteins ---- Glutaredoxin-1
Source.8321: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.8322: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.8323: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.8324: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.8325: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.8326: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.8327: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.8328: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.8329: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.8330: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.8331: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.8332: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.8333: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.8334: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.8335: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.8336: DFBPPR9512 ---- Animal proteins ---- Acylphosphatase-2
Source.8337: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.8338: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.8339: DFBPPR9518 ---- Animal proteins ---- Interleukin-5
Source.8340: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.8341: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.8342: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.8343: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.8344: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.8345: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE
Source.8346: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.8347: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.8348: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.8349: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.8350: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.8351: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.8352: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.8353: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.8354: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.8355: DFBPPR9555 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.8356: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.8357: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.8358: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.8359: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.8360: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.8361: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.8362: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.8363: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1
Source.8364: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.8365: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26
Source.8366: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.8367: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.8368: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.8369: DFBPPR9582 ---- Animal proteins ---- C-C motif chemokine 5
Source.8370: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.8371: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.8372: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.8373: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.8374: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor
Source.8375: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin
Source.8376: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.8377: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.8378: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.8379: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.8380: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform
Source.8381: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.8382: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.8383: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.8384: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.8385: DFBPPR9624 ---- Animal proteins ---- Cadherin-3
Source.8386: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.8387: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.8388: DFBPPR9628 ---- Animal proteins ---- Mineralocorticoid receptor
Source.8389: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.8390: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.8391: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561
Source.8392: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.8393: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M
Source.8394: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1
Source.8395: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.8396: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.8397: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1
Source.8398: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.8399: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5
Source.8400: DFBPPR9659 ---- Animal proteins ---- Placenta-expressed transcript 1 protein
Source.8401: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.8402: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.8403: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.8404: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.8405: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.8406: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.8407: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta
Source.8408: DFBPPR9675 ---- Animal proteins ---- Cystatin-A5
Source.8409: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.8410: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8411: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.8412: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.8413: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.8414: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.8415: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.8416: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.8417: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.8418: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.8419: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.8420: DFBPPR9705 ---- Animal proteins ---- Elafin
Source.8421: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.8422: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.8423: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.8424: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.8425: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.8426: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2
Source.8427: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain
Source.8428: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.8429: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.8430: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.8431: DFBPPR9728 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.8432: DFBPPR9732 ---- Animal proteins ---- Leukocyte cysteine proteinase inhibitor 1
Source.8433: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2
Source.8434: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain
Source.8435: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.8436: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.8437: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.8438: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.8439: DFBPPR9741 ---- Animal proteins ---- Syndecan-4
Source.8440: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis
Source.8441: DFBPPR9745 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.8442: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.8443: DFBPPR9753 ---- Animal proteins ---- Syntaxin-binding protein 2
Source.8444: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.8445: DFBPPR9759 ---- Animal proteins ---- Palmdelphin
Source.8446: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.8447: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.8448: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.8449: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.8450: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A
Source.8451: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.8452: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.8453: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.8454: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.8455: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.8456: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.8457: DFBPPR9793 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1
Source.8458: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.8459: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.8460: DFBPPR9803 ---- Animal proteins ---- 60S ribosomal protein L3
Source.8461: DFBPPR9805 ---- Animal proteins ---- Fatty acid-binding protein, intestinal
Source.8462: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.8463: DFBPPR9810 ---- Animal proteins ---- 40S ribosomal protein S16
Source.8464: DFBPPR9811 ---- Animal proteins ---- Protein WAP-3
Source.8465: DFBPPR9814 ---- Animal proteins ---- Testin
Source.8466: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.8467: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.8468: DFBPPR9819 ---- Animal proteins ---- 40S ribosomal protein S9
Source.8469: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.8470: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.8471: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.8472: DFBPPR9827 ---- Animal proteins ---- Guanylate cyclase activator 2B
Source.8473: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.8474: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.8475: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1
Source.8476: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.8477: DFBPPR9839 ---- Animal proteins ---- Nurim
Source.8478: DFBPPR9843 ---- Animal proteins ---- P protein
Source.8479: DFBPPR9850 ---- Animal proteins ---- Retinol-binding protein 2
Source.8480: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.8481: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.8482: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.8483: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.8484: DFBPPR9862 ---- Animal proteins ---- Osteoclast-stimulating factor 1
Source.8485: DFBPPR9866 ---- Animal proteins ---- SH2 domain-containing protein 1A
Source.8486: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2
Source.8487: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.8488: DFBPPR9875 ---- Animal proteins ---- Fatty acid-binding protein, liver
Source.8489: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.8490: DFBPPR9887 ---- Animal proteins ---- Cystatin-A8
Source.8491: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1
Source.8492: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.8493: DFBPPR9899 ---- Animal proteins ---- D-xylulose reductase
Source.8494: DFBPPR9901 ---- Animal proteins ---- 40S ribosomal protein S14
Source.8495: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3
Source.8496: DFBPPR9909 ---- Animal proteins ---- Tetraspanin-31
Source.8497: DFBPPR9912 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial
Source.8498: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.8499: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.8500: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.8501: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.8502: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin
Source.8503: DFBPPR9926 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.8504: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.8505: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.8506: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1
Source.8507: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8508: DFBPPR9940 ---- Animal proteins ---- Neuronatin
Source.8509: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1
Source.8510: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251
Source.8511: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.8512: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.8513: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.8514: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.8515: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.8516: DFBPPR9961 ---- Animal proteins ---- Somatotropin
Source.8517: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.8518: DFBPPR9965 ---- Animal proteins ---- Lysozyme C
Source.8519: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.8520: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8521: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.8522: DFBPPR9972 ---- Animal proteins ---- Taste receptor type 2 member 40
Source.8523: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.8524: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.8525: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.8526: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.8527: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.8528: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.8529: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.8530: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.8531: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.8532: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.8533: DFBPPR9989 ---- Animal proteins ---- VIP peptides
Source.8534: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.8535: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.8536: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.8537: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.8538: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.8539: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.8540: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.8541: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.8542: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.8543: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.8544: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.8545: DFBPPR10009 ---- Animal proteins ---- Transthyretin
Source.8546: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.8547: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.8548: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.8549: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.8550: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.8551: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.8552: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.8553: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6
Source.8554: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.8555: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.8556: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.8557: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.8558: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.8559: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.8560: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.8561: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.8562: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.8563: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2
Source.8564: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.8565: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.8566: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.8567: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.8568: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.8569: DFBPPR10044 ---- Animal proteins ---- Histone H4
Source.8570: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.8571: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.8572: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.8573: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.8574: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.8575: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.8576: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.8577: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.8578: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.8579: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.8580: DFBPPR10064 ---- Animal proteins ---- Pleiotrophin
Source.8581: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6
Source.8582: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.8583: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.8584: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.8585: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.8586: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.8587: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.8588: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.8589: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.8590: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8591: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.8592: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.8593: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.8594: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.8595: DFBPPR10082 ---- Animal proteins ---- Pinopsin
Source.8596: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.8597: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.8598: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.8599: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.8600: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.8601: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.8602: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8603: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4
Source.8604: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor
Source.8605: DFBPPR10094 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.8606: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.8607: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.8608: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.8609: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.8610: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.8611: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.8612: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.8613: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.8614: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.8615: DFBPPR10110 ---- Animal proteins ---- ER lumen protein-retaining receptor 2
Source.8616: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.8617: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.8618: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.8619: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.8620: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.8621: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.8622: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.8623: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.8624: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.8625: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.8626: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.8627: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.8628: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.8629: DFBPPR10129 ---- Animal proteins ---- Gremlin-1
Source.8630: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.8631: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.8632: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.8633: DFBPPR10136 ---- Animal proteins ---- Annexin A2
Source.8634: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.8635: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.8636: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.8637: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.8638: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.8639: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.8640: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.8641: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.8642: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.8643: DFBPPR10148 ---- Animal proteins ---- Ubiquitin-40S ribosomal protein S27a
Source.8644: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.8645: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.8646: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.8647: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.8648: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.8649: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.8650: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.8651: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.8652: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.8653: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.8654: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.8655: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.8656: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.8657: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.8658: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.8659: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.8660: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.8661: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.8662: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3
Source.8663: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.8664: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.8665: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.8666: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.8667: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.8668: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1
Source.8669: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.8670: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.8671: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.8672: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.8673: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.8674: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.8675: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.8676: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.8677: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.8678: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.8679: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.8680: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.8681: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.8682: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.8683: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.8684: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.8685: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.8686: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.8687: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.8688: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.8689: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.8690: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.8691: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.8692: DFBPPR10226 ---- Animal proteins ---- GTPase HRas
Source.8693: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.8694: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.8695: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.8696: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.8697: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.8698: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.8699: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.8700: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8
Source.8701: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.8702: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.8703: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.8704: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.8705: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.8706: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.8707: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.8708: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.8709: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.8710: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.8711: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.8712: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.8713: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.8714: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.8715: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.8716: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.8717: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.8718: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.8719: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.8720: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.8721: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.8722: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.8723: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.8724: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.8725: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.8726: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.8727: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.8728: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.8729: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.8730: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.8731: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.8732: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.8733: DFBPPR10286 ---- Animal proteins ---- Avidin
Source.8734: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.8735: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.8736: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.8737: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.8738: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.8739: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.8740: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.8741: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.8742: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.8743: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.8744: DFBPPR10298 ---- Animal proteins ---- Caldesmon
Source.8745: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.8746: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.8747: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.8748: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.8749: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.8750: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.8751: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.8752: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.8753: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.8754: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.8755: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.8756: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.8757: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.8758: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.8759: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.8760: DFBPPR10320 ---- Animal proteins ---- Insulin
Source.8761: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.8762: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1
Source.8763: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.8764: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.8765: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.8766: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.8767: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.8768: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC
Source.8769: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.8770: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.8771: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.8772: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.8773: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.8774: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.8775: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.8776: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.8777: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.8778: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.8779: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.8780: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.8781: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.8782: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.8783: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.8784: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.8785: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.8786: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.8787: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.8788: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.8789: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.8790: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.8791: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.8792: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.8793: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.8794: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.8795: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.8796: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.8797: DFBPPR10391 ---- Animal proteins ---- Annexin A5
Source.8798: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.8799: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.8800: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.8801: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.8802: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.8803: DFBPPR10400 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.8804: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.8805: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.8806: DFBPPR10403 ---- Animal proteins ---- UMP-CMP kinase
Source.8807: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.8808: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.8809: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.8810: DFBPPR10408 ---- Animal proteins ---- Beta-galactoside-binding lectin
Source.8811: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.8812: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.8813: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.8814: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.8815: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.8816: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.8817: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.8818: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.8819: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.8820: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.8821: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.8822: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.8823: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.8824: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.8825: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.8826: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.8827: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.8828: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.8829: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.8830: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.8831: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.8832: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.8833: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.8834: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.8835: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.8836: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.8837: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.8838: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.8839: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.8840: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.8841: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.8842: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.8843: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.8844: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.8845: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.8846: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8847: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.8848: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.8849: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.8850: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.8851: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.8852: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.8853: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.8854: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.8855: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.8856: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.8857: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.8858: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.8859: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.8860: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.8861: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.8862: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.8863: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.8864: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1
Source.8865: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1
Source.8866: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.8867: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.8868: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.8869: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.8870: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.8871: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.8872: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3
Source.8873: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.8874: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.8875: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.8876: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.8877: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.8878: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.8879: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.8880: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.8881: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta
Source.8882: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.8883: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.8884: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.8885: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.8886: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.8887: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog
Source.8888: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.8889: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.8890: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.8891: DFBPPR10544 ---- Animal proteins ---- Thioredoxin
Source.8892: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.8893: DFBPPR10546 ---- Animal proteins ---- Calmodulin
Source.8894: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.8895: DFBPPR10548 ---- Animal proteins ---- Syndecan-4
Source.8896: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.8897: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.8898: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.8899: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.8900: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.8901: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.8902: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1
Source.8903: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.8904: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.8905: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.8906: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.8907: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.8908: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.8909: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.8910: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.8911: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.8912: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.8913: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.8914: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.8915: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.8916: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.8917: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.8918: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.8919: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.8920: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5
Source.8921: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.8922: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.8923: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.8924: DFBPPR10590 ---- Animal proteins ---- Centromere protein X
Source.8925: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.8926: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.8927: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.8928: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.8929: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.8930: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B
Source.8931: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1
Source.8932: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.8933: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.8934: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.8935: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.8936: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.8937: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.8938: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.8939: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.8940: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.8941: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.8942: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.8943: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.8944: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.8945: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6
Source.8946: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.8947: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.8948: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.8949: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.8950: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.8951: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.8952: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.8953: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.8954: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.8955: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.8956: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.8957: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein
Source.8958: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.8959: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.8960: DFBPPR10640 ---- Animal proteins ---- Caveolin-1
Source.8961: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.8962: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.8963: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.8964: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.8965: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.8966: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.8967: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.8968: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.8969: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.8970: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.8971: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.8972: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.8973: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.8974: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.8975: DFBPPR10660 ---- Animal proteins ---- Tsukushin
Source.8976: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.8977: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.8978: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.8979: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.8980: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.8981: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.8982: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.8983: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.8984: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.8985: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.8986: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.8987: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.8988: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.8989: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.8990: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.8991: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.8992: DFBPPR10683 ---- Animal proteins ---- Histone H4 type VIII
Source.8993: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.8994: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.8995: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.8996: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.8997: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.8998: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.8999: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.9000: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.9001: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.9002: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.9003: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.9004: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.9005: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.9006: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.9007: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.9008: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.9009: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.9010: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.9011: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.9012: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.9013: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.9014: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.9015: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.9016: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.9017: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.9018: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform
Source.9019: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.9020: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.9021: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.9022: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.9023: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.9024: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.9025: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.9026: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.9027: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.9028: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A
Source.9029: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.9030: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10
Source.9031: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.9032: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.9033: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1
Source.9034: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.9035: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.9036: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.9037: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.9038: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.9039: DFBPPR10755 ---- Animal proteins ---- Draxin
Source.9040: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.9041: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.9042: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.9043: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.9044: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6
Source.9045: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.9046: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.9047: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.9048: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1
Source.9049: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.9050: DFBPPR10778 ---- Animal proteins ---- Avidin-related protein 2
Source.9051: DFBPPR10780 ---- Animal proteins ---- Caspase-2
Source.9052: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.9053: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b
Source.9054: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.9055: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.9056: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.9057: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.9058: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.9059: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.9060: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.9061: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.9062: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.9063: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.9064: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.9065: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.9066: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.9067: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.9068: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.9069: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.9070: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.9071: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.9072: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.9073: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.9074: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain
Source.9075: DFBPPR10826 ---- Animal proteins ---- Cofilin-2
Source.9076: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.9077: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.9078: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.9079: DFBPPR10837 ---- Animal proteins ---- GTPase NRas
Source.9080: DFBPPR10838 ---- Animal proteins ---- Protein lin-28 homolog A
Source.9081: DFBPPR10840 ---- Animal proteins ---- C-C motif chemokine 4 homolog
Source.9082: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.9083: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.9084: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.9085: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.9086: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.9087: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.9088: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.9089: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.9090: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.9091: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.9092: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.9093: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.9094: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.9095: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.9096: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.9097: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase
Source.9098: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.9099: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.9100: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.9101: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.9102: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3
Source.9103: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.9104: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.9105: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.9106: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.9107: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.9108: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.9109: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.9110: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.9111: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.9112: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.9113: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.9114: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.9115: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform
Source.9116: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.9117: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152
Source.9118: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.9119: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.9120: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.9121: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.9122: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.9123: DFBPPR10917 ---- Animal proteins ---- Ribonuclease UK114
Source.9124: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.9125: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.9126: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.9127: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.9128: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.9129: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.9130: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.9131: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.9132: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.9133: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.9134: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.9135: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.9136: DFBPPR10939 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.9137: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.9138: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.9139: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.9140: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.9141: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.9142: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.9143: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.9144: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.9145: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.9146: DFBPPR10952 ---- Animal proteins ---- Protein XRP2
Source.9147: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.9148: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.9149: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.9150: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.9151: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type
Source.9152: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.9153: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.9154: DFBPPR10970 ---- Animal proteins ---- Prohibitin
Source.9155: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.9156: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.9157: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.9158: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.9159: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.9160: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.9161: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.9162: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.9163: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.9164: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.9165: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.9166: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.9167: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.9168: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.9169: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.9170: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.9171: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.9172: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.9173: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.9174: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.9175: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.9176: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.9177: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.9178: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.9179: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.9180: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.9181: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.9182: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.9183: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.9184: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.9185: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.9186: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.9187: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1
Source.9188: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.9189: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.9190: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.9191: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.9192: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.9193: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.9194: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.9195: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.9196: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.9197: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.9198: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.9199: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.9200: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.9201: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.9202: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.9203: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.9204: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.9205: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.9206: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.9207: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.9208: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.9209: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.9210: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.9211: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.9212: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.9213: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.9214: DFBPPR11064 ---- Animal proteins ---- General transcription factor IIH subunit 5
Source.9215: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.9216: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.9217: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.9218: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.9219: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.9220: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.9221: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.9222: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.9223: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.9224: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.9225: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.9226: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.9227: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.9228: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.9229: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.9230: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.9231: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.9232: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.9233: DFBPPR11095 ---- Animal proteins ---- Ras-related protein Rab-33B
Source.9234: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.9235: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.9236: DFBPPR11098 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.9237: DFBPPR11099 ---- Animal proteins ---- Acylphosphatase-1
Source.9238: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.9239: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.9240: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.9241: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.9242: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.9243: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.9244: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.9245: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.9246: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1
Source.9247: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.9248: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.9249: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.9250: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.9251: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.9252: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.9253: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.9254: DFBPPR11126 ---- Animal proteins ---- Parvalbumin, thymic
Source.9255: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.9256: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.9257: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.9258: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.9259: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3
Source.9260: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.9261: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.9262: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.9263: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.9264: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.9265: DFBPPR11146 ---- Animal proteins ---- Formin
Source.9266: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.9267: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.9268: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.9269: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.9270: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.9271: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.9272: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.9273: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.9274: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.9275: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.9276: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.9277: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.9278: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.9279: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.9280: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b
Source.9281: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.9282: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.9283: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.9284: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.9285: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.9286: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.9287: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.9288: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.9289: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.9290: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.9291: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.9292: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.9293: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.9294: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.9295: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.9296: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.9297: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1
Source.9298: DFBPPR11209 ---- Animal proteins ---- Protein S100-A11
Source.9299: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.9300: DFBPPR11211 ---- Animal proteins ---- Acylphosphatase-2
Source.9301: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.9302: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.9303: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.9304: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.9305: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.9306: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.9307: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.9308: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.9309: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.9310: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.9311: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.9312: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.9313: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.9314: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.9315: DFBPPR11237 ---- Animal proteins ---- Fibroblast growth factor 3
Source.9316: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.9317: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.9318: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.9319: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3
Source.9320: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.9321: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.9322: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.9323: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.9324: DFBPPR11253 ---- Animal proteins ---- Peripherin-2
Source.9325: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.9326: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.9327: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.9328: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7
Source.9329: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.9330: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.9331: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.9332: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.9333: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.9334: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.9335: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.9336: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.9337: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.9338: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.9339: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2
Source.9340: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.9341: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.9342: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.9343: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.9344: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.9345: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.9346: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.9347: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.9348: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.9349: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.9350: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.9351: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.9352: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.9353: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.9354: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.9355: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.9356: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42
Source.9357: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.9358: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.9359: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.9360: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.9361: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.9362: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.9363: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.9364: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.9365: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.9366: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.9367: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.9368: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.9369: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.9370: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.9371: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.9372: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.9373: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13
Source.9374: DFBPPR11351 ---- Animal proteins ---- Small ubiquitin-related modifier 3
Source.9375: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.9376: DFBPPR11354 ---- Animal proteins ---- Centromere protein O
Source.9377: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.9378: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.9379: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.9380: DFBPPR11373 ---- Animal proteins ---- Decorin
Source.9381: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.9382: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.9383: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.9384: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.9385: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.9386: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.9387: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.9388: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.9389: DFBPPR11388 ---- Animal proteins ---- Matrilin-3
Source.9390: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.9391: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.9392: DFBPPR11393 ---- Animal proteins ---- Avidin-related protein 4/5
Source.9393: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4
Source.9394: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.9395: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.9396: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.9397: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.9398: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.9399: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1
Source.9400: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.9401: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.9402: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.9403: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.9404: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.9405: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.9406: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.9407: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.9408: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.9409: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.9410: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.9411: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.9412: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.9413: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3
Source.9414: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.9415: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.9416: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.9417: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.9418: DFBPPR11441 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B
Source.9419: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.9420: DFBPPR11445 ---- Animal proteins ---- Gallinacin-12
Source.9421: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.9422: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.9423: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2
Source.9424: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1
Source.9425: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2
Source.9426: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.9427: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.9428: DFBPPR11463 ---- Animal proteins ---- Ubiquitin-fold modifier 1
Source.9429: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.9430: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.9431: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.9432: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.9433: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3
Source.9434: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2
Source.9435: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.9436: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.9437: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.9438: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.9439: DFBPPR11488 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.9440: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.9441: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.9442: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.9443: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.9444: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.9445: DFBPPR11499 ---- Animal proteins ---- Myosin regulatory light chain 2B, cardiac muscle isoform
Source.9446: DFBPPR11504 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.9447: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.9448: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b
Source.9449: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.9450: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.9451: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.9452: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide
Source.9453: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.9454: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.9455: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.9456: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.9457: DFBPPR11524 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF166
Source.9458: DFBPPR11525 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.9459: DFBPPR11526 ---- Animal proteins ---- Fibromodulin
Source.9460: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform
Source.9461: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.9462: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform
Source.9463: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.9464: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.9465: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.9466: DFBPPR11543 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.9467: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.9468: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.9469: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.9470: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.9471: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.9472: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.9473: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.9474: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.9475: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.9476: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.9477: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.9478: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.9479: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.9480: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle
Source.9481: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.9482: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.9483: DFBPPR11583 ---- Animal proteins ---- Translin
Source.9484: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.9485: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.9486: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.9487: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.9488: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.9489: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230
Source.9490: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.9491: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.9492: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.9493: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.9494: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.9495: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.9496: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.9497: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13
Source.9498: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.9499: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.9500: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.9501: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.9502: DFBPPR11613 ---- Animal proteins ---- Transmembrane protein 258
Source.9503: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3
Source.9504: DFBPPR11616 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial
Source.9505: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.9506: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.9507: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.9508: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.9509: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.9510: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.9511: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.9512: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.9513: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.9514: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.9515: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.9516: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.9517: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon
Source.9518: DFBPPR11640 ---- Animal proteins ---- Transmembrane protein 170A
Source.9519: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.9520: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.9521: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.9522: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.9523: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.9524: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.9525: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.9526: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.9527: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.9528: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.9529: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.9530: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.9531: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.9532: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.9533: DFBPPR11672 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 3
Source.9534: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.9535: DFBPPR11674 ---- Animal proteins ---- Protein MRP-126
Source.9536: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.9537: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.9538: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.9539: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.9540: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1
Source.9541: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta
Source.9542: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.9543: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.9544: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7
Source.9545: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.9546: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.9547: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.9548: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.9549: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.9550: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.9551: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.9552: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.9553: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.9554: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.9555: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.9556: DFBPPR11719 ---- Animal proteins ---- Protein RER1
Source.9557: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.9558: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.9559: DFBPPR11723 ---- Animal proteins ---- Visinin
Source.9560: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.9561: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.9562: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.9563: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.9564: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.9565: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.9566: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.9567: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.9568: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.9569: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1
Source.9570: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.9571: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.9572: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.9573: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta
Source.9574: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.9575: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1
Source.9576: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.9577: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.9578: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.9579: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.9580: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.9581: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.9582: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.9583: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.9584: DFBPPR11774 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1
Source.9585: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.9586: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.9587: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.9588: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.9589: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.9590: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5
Source.9591: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.9592: DFBPPR11790 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.9593: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.9594: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.9595: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.9596: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.9597: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.9598: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1
Source.9599: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17
Source.9600: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62
Source.9601: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.9602: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.9603: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.9604: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1
Source.9605: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.9606: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27
Source.9607: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.9608: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.9609: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.9610: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.9611: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13
Source.9612: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.9613: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog
Source.9614: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.9615: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.9616: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.9617: DFBPPR11831 ---- Animal proteins ---- Protein lin-28 homolog B
Source.9618: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.9619: DFBPPR11838 ---- Animal proteins ---- Enhancer of mRNA-decapping protein 3
Source.9620: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1
Source.9621: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.9622: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1
Source.9623: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.9624: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7
Source.9625: DFBPPR11847 ---- Animal proteins ---- Borealin-2
Source.9626: DFBPPR11848 ---- Animal proteins ---- Parvalbumin, muscle
Source.9627: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.9628: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.9629: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.9630: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.9631: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.9632: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82
Source.9633: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.9634: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.9635: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.9636: DFBPPR11863 ---- Animal proteins ---- Purpurin
Source.9637: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.9638: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.9639: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.9640: DFBPPR11869 ---- Animal proteins ---- BH3-interacting domain death agonist
Source.9641: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.9642: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.9643: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.9644: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.9645: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.9646: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.9647: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.9648: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.9649: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.9650: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.9651: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.9652: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.9653: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8
Source.9654: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.9655: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.9656: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.9657: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant
Source.9658: DFBPPR11894 ---- Animal proteins ---- Centromere protein K
Source.9659: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.9660: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3
Source.9661: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.9662: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.9663: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.9664: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.9665: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.9666: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.9667: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.9668: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein
Source.9669: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.9670: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.9671: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.9672: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.9673: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.9674: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.9675: DFBPPR11925 ---- Animal proteins ---- GSK3-beta interaction protein
Source.9676: DFBPPR11928 ---- Animal proteins ---- Cyclin-C
Source.9677: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.9678: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta
Source.9679: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.9680: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.9681: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle
Source.9682: DFBPPR11942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.9683: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.9684: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.9685: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.9686: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.9687: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.9688: DFBPPR11952 ---- Animal proteins ---- Avidin-related protein 1
Source.9689: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.9690: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor
Source.9691: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.9692: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.9693: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.9694: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.9695: DFBPPR11962 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.9696: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.9697: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.9698: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.9699: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.9700: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.9701: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.9702: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4
Source.9703: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.9704: DFBPPR11973 ---- Animal proteins ---- Avidin-related protein 3
Source.9705: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.9706: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.9707: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.9708: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.9709: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.9710: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.9711: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.9712: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1
Source.9713: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.9714: DFBPPR11997 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.9715: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.9716: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.9717: DFBPPR12002 ---- Animal proteins ---- Avidin-related protein 6
Source.9718: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.9719: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.9720: DFBPPR12006 ---- Animal proteins ---- Avidin-related protein 7
Source.9721: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein
Source.9722: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein
Source.9723: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.9724: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.9725: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.9726: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.9727: DFBPPR12025 ---- Animal proteins ---- Transmembrane protein 18
Source.9728: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.9729: DFBPPR12027 ---- Animal proteins ---- Centromere protein L
Source.9730: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.9731: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208
Source.9732: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.9733: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.9734: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.9735: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.9736: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.9737: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.9738: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.9739: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.9740: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.9741: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.9742: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.9743: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.9744: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.9745: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.9746: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.9747: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.9748: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.9749: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.9750: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.9751: DFBPPR12065 ---- Animal proteins ---- Testin
Source.9752: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.9753: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.9754: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.9755: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.9756: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4
Source.9757: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.9758: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.9759: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.9760: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.9761: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.9762: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.9763: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma
Source.9764: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.9765: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.9766: DFBPPR12091 ---- Animal proteins ---- Neurofibromin
Source.9767: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.9768: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.9769: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.9770: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.9771: DFBPPR12100 ---- Animal proteins ---- Centromere protein Q
Source.9772: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.9773: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.9774: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.9775: DFBPPR12105 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1
Source.9776: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2
Source.9777: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.9778: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.9779: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic
Source.9780: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.9781: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.9782: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.9783: DFBPPR12115 ---- Animal proteins ---- Active regulator of SIRT1
Source.9784: DFBPPR12118 ---- Animal proteins ---- Protein EURL
Source.9785: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.9786: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.9787: DFBPPR12125 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8
Source.9788: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.9789: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.9790: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.9791: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.9792: DFBPPR12133 ---- Animal proteins ---- Protein Asterix
Source.9793: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.9794: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.9795: DFBPPR12138 ---- Animal proteins ---- Protein LZIC
Source.9796: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.9797: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2
Source.9798: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.9799: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.9800: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.9801: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.9802: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.9803: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.9804: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.9805: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.9806: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin
Source.9807: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.9808: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.9809: DFBPPR12168 ---- Animal proteins ---- Osteoclast-stimulating factor 1
Source.9810: DFBPPR12172 ---- Animal proteins ---- Neuronal regeneration-related protein
Source.9811: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.9812: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.9813: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.9814: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.9815: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.9816: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.9817: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1
Source.9818: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251
Source.9819: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.9820: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A
Source.9821: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10
Source.9822: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.9823: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1
Source.9824: DFBPPR12202 ---- Animal proteins ---- Protein chibby homolog 2
Source.9825: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.9826: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.9827: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.9828: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.9829: DFBPPR12213 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.9830: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.9831: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.9832: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.9833: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.9834: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.9835: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7
Source.9836: DFBPPR12225 ---- Animal proteins ---- Coiled-coil domain-containing protein 50
Source.9837: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.9838: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.9839: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.9840: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.9841: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.9842: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.9843: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.9844: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like
Source.9845: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.9846: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.9847: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.9848: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.9849: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.9850: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.9851: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.9852: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.9853: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.9854: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.9855: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.9856: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.9857: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor
Source.9858: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.9859: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.9860: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.9861: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.9862: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.9863: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.9864: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.9865: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.9866: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.9867: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.9868: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.9869: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.9870: DFBPPR12276 ---- Animal proteins ---- Protein S100-A9
Source.9871: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.9872: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.9873: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.9874: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.9875: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.9876: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.9877: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.9878: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.9879: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.9880: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.9881: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.9882: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.9883: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.9884: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.9885: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.9886: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.9887: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.9888: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.9889: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.9890: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.9891: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.9892: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.9893: DFBPPR12309 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.9894: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.9895: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.9896: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.9897: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.9898: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.9899: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.9900: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.9901: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.9902: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.9903: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.9904: DFBPPR12322 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.9905: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.9906: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.9907: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.9908: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.9909: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.9910: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.9911: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.9912: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.9913: DFBPPR12333 ---- Animal proteins ---- Angiogenin
Source.9914: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.9915: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.9916: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.9917: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.9918: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.9919: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.9920: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.9921: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.9922: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.9923: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.9924: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.9925: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.9926: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.9927: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.9928: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.9929: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.9930: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.9931: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.9932: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a
Source.9933: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.9934: DFBPPR12366 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.9935: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.9936: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.9937: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.9938: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.9939: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1
Source.9940: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.9941: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.9942: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.9943: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.9944: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.9945: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.9946: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.9947: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.9948: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.9949: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.9950: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.9951: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.9952: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.9953: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.9954: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.9955: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.9956: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.9957: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.9958: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.9959: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.9960: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.9961: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.9962: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.9963: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.9964: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.9965: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.9966: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.9967: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.9968: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.9969: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.9970: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.9971: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.9972: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.9973: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.9974: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.9975: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.9976: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.9977: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.9978: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.9979: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.9980: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.9981: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.9982: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.9983: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.9984: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.9985: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.9986: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.9987: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.9988: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.9989: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.9990: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.9991: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.9992: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.9993: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.9994: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.9995: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.9996: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.9997: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.9998: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.9999: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.10000: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.10001: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.10002: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.10003: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.10004: DFBPPR12463 ---- Animal proteins ---- Interleukin-15
Source.10005: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.10006: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.10007: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.10008: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.10009: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.10010: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.10011: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.10012: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.10013: DFBPPR12476 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.10014: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.10015: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.10016: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.10017: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.10018: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.10019: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.10020: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.10021: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.10022: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.10023: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14
Source.10024: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.10025: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.10026: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.10027: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.10028: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.10029: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.10030: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.10031: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.10032: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.10033: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.10034: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.10035: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.10036: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4
Source.10037: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.10038: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.10039: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.10040: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.10041: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.10042: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin
Source.10043: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.10044: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII
Source.10045: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.10046: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.10047: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.10048: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.10049: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.10050: DFBPPR12532 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.10051: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.10052: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.10053: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.10054: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.10055: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.10056: DFBPPR12542 ---- Animal proteins ---- Decorin
Source.10057: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.10058: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.10059: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.10060: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.10061: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.10062: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10063: DFBPPR12551 ---- Animal proteins ---- C-reactive protein
Source.10064: DFBPPR12552 ---- Animal proteins ---- Acylphosphatase-2
Source.10065: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.10066: DFBPPR12554 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.10067: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.10068: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.10069: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.10070: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.10071: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.10072: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.10073: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.10074: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.10075: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.10076: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.10077: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.10078: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.10079: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.10080: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.10081: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.10082: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.10083: DFBPPR12583 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.10084: DFBPPR12585 ---- Animal proteins ---- Calmodulin
Source.10085: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.10086: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.10087: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.10088: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.10089: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.10090: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.10091: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.10092: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.10093: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.10094: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.10095: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.10096: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.10097: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.10098: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14
Source.10099: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.10100: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.10101: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.10102: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.10103: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.10104: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase
Source.10105: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.10106: DFBPPR12629 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.10107: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.10108: DFBPPR12632 ---- Animal proteins ---- Caveolin-2
Source.10109: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.10110: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.10111: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.10112: DFBPPR12637 ---- Animal proteins ---- Thioredoxin
Source.10113: DFBPPR12638 ---- Animal proteins ---- Thioredoxin
Source.10114: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.10115: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.10116: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10117: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.10118: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.10119: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.10120: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.10121: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.10122: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.10123: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.10124: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.10125: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.10126: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.10127: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.10128: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.10129: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.10130: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.10131: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.10132: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.10133: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.10134: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.10135: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.10136: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.10137: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.10138: DFBPPR12725 ---- Animal proteins ---- Uricase
Source.10139: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.10140: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.10141: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.10142: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2
Source.10143: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.10144: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.10145: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.10146: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86
Source.10147: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.10148: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.10149: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.10150: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25
Source.10151: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.10152: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.10153: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.10154: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.10155: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.10156: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.10157: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.10158: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.10159: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.10160: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.10161: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.10162: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.10163: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.10164: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.10165: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.10166: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.10167: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.10168: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.10169: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.10170: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.10171: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.10172: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.10173: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.10174: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.10175: DFBPPR12789 ---- Animal proteins ---- CD59 glycoprotein
Source.10176: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.10177: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.10178: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.10179: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.10180: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.10181: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.10182: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.10183: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.10184: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.10185: DFBPPR12809 ---- Animal proteins ---- Glutaredoxin-1
Source.10186: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.10187: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.10188: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.10189: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.10190: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.10191: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.10192: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.10193: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.10194: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.10195: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.10196: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.10197: DFBPPR12825 ---- Animal proteins ---- Bleomycin hydrolase
Source.10198: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.10199: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4
Source.10200: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.10201: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.10202: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.10203: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.10204: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10205: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.10206: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.10207: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.10208: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.10209: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.10210: DFBPPR12850 ---- Animal proteins ---- VIP peptides
Source.10211: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.10212: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.10213: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.10214: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.10215: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.10216: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.10217: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.10218: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.10219: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.10220: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.10221: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.10222: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.10223: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn]
Source.10224: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.10225: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.10226: DFBPPR12889 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform
Source.10227: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.10228: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.10229: DFBPPR12894 ---- Animal proteins ---- Parvalbumin alpha
Source.10230: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.10231: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.10232: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.10233: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.10234: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.10235: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.10236: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.10237: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.10238: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.10239: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.10240: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.10241: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.10242: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2
Source.10243: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30
Source.10244: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.10245: DFBPPR12924 ---- Animal proteins ---- Adenylate kinase isoenzyme 6
Source.10246: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2
Source.10247: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1
Source.10248: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.10249: DFBPPR12931 ---- Animal proteins ---- Transthyretin
Source.10250: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.10251: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.10252: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.10253: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.10254: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.10255: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.10256: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.10257: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.10258: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.10259: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.10260: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.10261: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.10262: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.10263: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.10264: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.10265: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.10266: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.10267: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.10268: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5
Source.10269: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.10270: DFBPPR12967 ---- Animal proteins ---- Beta-sarcoglycan
Source.10271: DFBPPR12970 ---- Animal proteins ---- Protein S100-B
Source.10272: DFBPPR12971 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase
Source.10273: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.10274: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.10275: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.10276: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.10277: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.10278: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.10279: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.10280: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A
Source.10281: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.10282: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein
Source.10283: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.10284: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.10285: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.10286: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.10287: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.10288: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.10289: DFBPPR13011 ---- Animal proteins ---- C-C motif chemokine 4
Source.10290: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.10291: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.10292: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.10293: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1
Source.10294: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A
Source.10295: DFBPPR13034 ---- Animal proteins ---- Sarcospan
Source.10296: DFBPPR13035 ---- Animal proteins ---- Chymase
Source.10297: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.10298: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.10299: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein
Source.10300: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1
Source.10301: DFBPPR13050 ---- Animal proteins ---- Odorant-binding protein 3
Source.10302: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.10303: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.10304: DFBPPR13061 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.10305: DFBPPR13064 ---- Animal proteins ---- Metalloproteinase inhibitor 4
Source.10306: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.10307: DFBPPR13067 ---- Animal proteins ---- Beta-casein
Source.10308: DFBPPR13069 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP alpha-1 chain
Source.10309: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.10310: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.10311: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.10312: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.10313: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207
Source.10314: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta
Source.10315: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.10316: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.10317: DFBPPR13092 ---- Animal proteins ---- Testin
Source.10318: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.10319: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.10320: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2
Source.10321: DFBPPR13097 ---- Animal proteins ---- Lumican
Source.10322: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1
Source.10323: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.10324: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.10325: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region
Source.10326: DFBPPR13105 ---- Animal proteins ---- Ig kappa chain V region BS-5
Source.10327: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.10328: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.10329: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain
Source.10330: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.10331: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region
Source.10332: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region
Source.10333: DFBPPR13131 ---- Animal proteins ---- Ig kappa chain V region K29-213
Source.10334: DFBPPR13133 ---- Animal proteins ---- Ig kappa chain V region K16-167
Source.10335: DFBPPR13140 ---- Animal proteins ---- Blastocyst protein 4
Source.10336: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.10337: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.10338: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.10339: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.10340: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.10341: DFBPPR13153 ---- Animal proteins ---- Interleukin-18
Source.10342: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.10343: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5
Source.10344: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.10345: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.10346: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.10347: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.10348: DFBPPR13166 ---- Animal proteins ---- CD44 antigen
Source.10349: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.10350: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.10351: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.10352: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.10353: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.10354: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10355: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.10356: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.10357: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.10358: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.10359: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.10360: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.10361: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.10362: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.10363: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.10364: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.10365: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.10366: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.10367: DFBPPR13196 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.10368: DFBPPR13197 ---- Animal proteins ---- Caveolin-2
Source.10369: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha
Source.10370: DFBPPR13201 ---- Animal proteins ---- Major allergen Equ c 1
Source.10371: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.10372: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.10373: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.10374: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.10375: DFBPPR13210 ---- Animal proteins ---- Angiogenin
Source.10376: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.10377: DFBPPR13213 ---- Animal proteins ---- Seminal plasma protein HSP-1
Source.10378: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.10379: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.10380: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.10381: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta
Source.10382: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.10383: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10384: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.10385: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.10386: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.10387: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.10388: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.10389: DFBPPR13237 ---- Animal proteins ---- Thioredoxin
Source.10390: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2
Source.10391: DFBPPR13240 ---- Animal proteins ---- Decorin
Source.10392: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10393: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.10394: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.10395: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.10396: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.10397: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.10398: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.10399: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.10400: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.10401: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.10402: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.10403: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.10404: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.10405: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.10406: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.10407: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.10408: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8
Source.10409: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2
Source.10410: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.10411: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.10412: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.10413: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.10414: DFBPPR13284 ---- Animal proteins ---- Interleukin-8
Source.10415: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.10416: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.10417: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.10418: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.10419: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2
Source.10420: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.10421: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10422: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.10423: DFBPPR13308 ---- Animal proteins ---- Interleukin-10
Source.10424: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.10425: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.10426: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.10427: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0
Source.10428: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.10429: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.10430: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.10431: DFBPPR13324 ---- Animal proteins ---- Acylphosphatase-2
Source.10432: DFBPPR13326 ---- Animal proteins ---- Interferon alpha-1
Source.10433: DFBPPR13328 ---- Animal proteins ---- Interferon alpha-2
Source.10434: DFBPPR13332 ---- Animal proteins ---- Interferon alpha-3
Source.10435: DFBPPR13333 ---- Animal proteins ---- Interferon alpha-4
Source.10436: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.10437: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.10438: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.10439: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.10440: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.10441: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.10442: DFBPPR13352 ---- Animal proteins ---- ATP synthase protein 8
Source.10443: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.10444: DFBPPR13359 ---- Animal proteins ---- Protein S100-A7
Source.10445: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.10446: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.10447: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.10448: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.10449: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.10450: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.10451: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4
Source.10452: DFBPPR13375 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.10453: DFBPPR13376 ---- Animal proteins ---- Interleukin-5
Source.10454: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.10455: DFBPPR13378 ---- Animal proteins ---- Neutrophil elastase 2A
Source.10456: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.10457: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.10458: DFBPPR13390 ---- Animal proteins ---- C-X-C motif chemokine 6
Source.10459: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.10460: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.10461: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.10462: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.10463: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.10464: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.10465: DFBPPR13409 ---- Animal proteins ---- Testin
Source.10466: DFBPPR13410 ---- Animal proteins ---- Lysozyme C, spleen isozyme
Source.10467: DFBPPR13418 ---- Animal proteins ---- 40S ribosomal protein S4
Source.10468: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.10469: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor
Source.10470: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.10471: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.10472: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10473: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.10474: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.10475: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.10476: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.10477: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.10478: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.10479: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10480: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.10481: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10482: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.10483: DFBPPR13457 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.10484: DFBPPR13458 ---- Animal proteins ---- Interleukin-4
Source.10485: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.10486: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.10487: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta
Source.10488: DFBPPR13481 ---- Animal proteins ---- Somatotropin
Source.10489: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.10490: DFBPPR13483 ---- Animal proteins ---- Interleukin-18
Source.10491: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.10492: DFBPPR13488 ---- Animal proteins ---- Lysozyme C-2
Source.10493: DFBPPR13489 ---- Animal proteins ---- Lysozyme C-1
Source.10494: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.10495: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.10496: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.10497: DFBPPR13499 ---- Animal proteins ---- Vasoactive intestinal peptide
Source.10498: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.10499: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor
Source.10500: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.10501: DFBPPR13521 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.10502: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.10503: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.10504: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.10505: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.10506: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.10507: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.10508: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.10509: DFBPPR13540 ---- Animal proteins ---- Somatotropin
Source.10510: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase
Source.10511: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.10512: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.10513: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.10514: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.10515: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10516: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.10517: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.10518: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.10519: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.10520: DFBPPR13564 ---- Animal proteins ---- Calmodulin
Source.10521: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.10522: DFBPPR13566 ---- Animal proteins ---- Calcium and integrin-binding protein 1
Source.10523: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.10524: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.10525: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.10526: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor
Source.10527: DFBPPR13574 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.10528: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.10529: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.10530: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.10531: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.10532: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.10533: DFBPPR13583 ---- Animal proteins ---- Caveolin-2
Source.10534: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.10535: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.10536: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.10537: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.10538: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.10539: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.10540: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.10541: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.10542: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10543: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.10544: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor
Source.10545: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.10546: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.10547: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.10548: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.10549: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.10550: DFBPPR13615 ---- Animal proteins ---- Cofilin-1
Source.10551: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.10552: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.10553: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.10554: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.10555: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.10556: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.10557: DFBPPR13625 ---- Animal proteins ---- Lysozyme C-1
Source.10558: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.10559: DFBPPR13628 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.10560: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.10561: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.10562: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.10563: DFBPPR13635 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.10564: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.10565: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.10566: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.10567: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.10568: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.10569: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.10570: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6
Source.10571: DFBPPR13651 ---- Animal proteins ---- Clusterin
Source.10572: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10573: DFBPPR13656 ---- Animal proteins ---- Thioredoxin
Source.10574: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.10575: DFBPPR13664 ---- Animal proteins ---- Interleukin-10
Source.10576: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.10577: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.10578: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.10579: DFBPPR13672 ---- Animal proteins ---- Annexin A2
Source.10580: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.10581: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.10582: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.10583: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.10584: DFBPPR13683 ---- Animal proteins ---- 14-3-3 protein sigma
Source.10585: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.10586: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.10587: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen
Source.10588: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.10589: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.10590: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.10591: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.10592: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.10593: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.10594: DFBPPR13704 ---- Animal proteins ---- Osteopontin
Source.10595: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.10596: DFBPPR13707 ---- Animal proteins ---- Lysozyme C-3
Source.10597: DFBPPR13708 ---- Animal proteins ---- Renin
Source.10598: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta
Source.10599: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX
Source.10600: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.10601: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.10602: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.10603: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.10604: DFBPPR13719 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.10605: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.10606: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.10607: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.10608: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.10609: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.10610: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1
Source.10611: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.10612: DFBPPR13740 ---- Animal proteins ---- Lysozyme C, kidney isozyme
Source.10613: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.10614: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.10615: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.10616: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic
Source.10617: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.10618: DFBPPR13752 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.10619: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.10620: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.10621: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.10622: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.10623: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.10624: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.10625: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.10626: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.10627: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.10628: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.10629: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.10630: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.10631: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.10632: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.10633: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.10634: DFBPPR13777 ---- Animal proteins ---- Centromere protein C
Source.10635: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.10636: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.10637: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.10638: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.10639: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.10640: DFBPPR13793 ---- Animal proteins ---- Decorin
Source.10641: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain
Source.10642: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel
Source.10643: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.10644: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.10645: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.10646: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.10647: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.10648: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.10649: DFBPPR13810 ---- Animal proteins ---- Transthyretin
Source.10650: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma
Source.10651: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.10652: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.10653: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5
Source.10654: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.10655: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.10656: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.10657: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.10658: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.10659: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.10660: DFBPPR13832 ---- Animal proteins ---- Cystatin-B
Source.10661: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.10662: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.10663: DFBPPR13839 ---- Animal proteins ---- Interleukin-4
Source.10664: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.10665: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.10666: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.10667: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.10668: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.10669: DFBPPR13850 ---- Animal proteins ---- Interleukin-15
Source.10670: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.10671: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.10672: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.10673: DFBPPR13864 ---- Animal proteins ---- Interleukin-5
Source.10674: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9
Source.10675: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.10676: DFBPPR13867 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B
Source.10677: DFBPPR13871 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.10678: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor
Source.10679: DFBPPR13876 ---- Animal proteins ---- Follistatin
Source.10680: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.10681: DFBPPR13879 ---- Animal proteins ---- Vasoactive intestinal peptide
Source.10682: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.10683: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.10684: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.10685: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.10686: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5
Source.10687: DFBPPR13897 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.10688: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.10689: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.10690: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3
Source.10691: DFBPPR13918 ---- Animal proteins ---- Testin
Source.10692: DFBPPR13919 ---- Animal proteins ---- Selenoprotein W
Source.10693: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.10694: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.10695: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.10696: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.10697: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.10698: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.10699: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.10700: DFBPPR13948 ---- Animal proteins ---- Calcium and integrin-binding family member 4
Source.10701: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.10702: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26
Source.10703: DFBPPR13957 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.10704: DFBPPR13959 ---- Animal proteins ---- Calpastatin
Source.10705: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.10706: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.10707: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.10708: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.10709: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2
Source.10710: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10711: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.10712: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.10713: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.10714: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog
Source.10715: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.10716: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.10717: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.10718: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.10719: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.10720: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.10721: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.10722: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin
Source.10723: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.10724: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.10725: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.10726: DFBPPR14010 ---- Animal proteins ---- GTPase KRas
Source.10727: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10728: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1
Source.10729: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.10730: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.10731: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.10732: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.10733: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.10734: DFBPPR14039 ---- Animal proteins ---- ATP synthase protein 8
Source.10735: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.10736: DFBPPR14043 ---- Animal proteins ---- Prolactin
Source.10737: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.10738: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.10739: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.10740: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form
Source.10741: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form
Source.10742: DFBPPR14058 ---- Animal proteins ---- Granulin-3
Source.10743: DFBPPR14071 ---- Marine protein ---- Somatotropin
Source.10744: DFBPPR14073 ---- Marine protein ---- Elastase-1
Source.10745: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.10746: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.10747: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.10748: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.10749: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.10750: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.10751: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta
Source.10752: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.10753: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.10754: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1
Source.10755: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.10756: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.10757: DFBPPR14096 ---- Marine protein ---- Serum amyloid P-component
Source.10758: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.10759: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.10760: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.10761: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.10762: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146
Source.10763: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1
Source.10764: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.10765: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.10766: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial
Source.10767: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.10768: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.10769: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.10770: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.10771: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.10772: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.10773: DFBPPR14141 ---- Marine protein ---- Ependymin-2
Source.10774: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.10775: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.10776: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.10777: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.10778: DFBPPR14155 ---- Marine protein ---- ATP synthase protein 8
Source.10779: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E
Source.10780: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12
Source.10781: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.10782: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.10783: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial
Source.10784: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.10785: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog
Source.10786: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.10787: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.10788: DFBPPR14174 ---- Marine protein ---- Ubiquitin-fold modifier 1
Source.10789: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A
Source.10790: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.10791: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.10792: DFBPPR14188 ---- Marine protein ---- DNA repair protein SWI5 homolog
Source.10793: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.10794: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor
Source.10795: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.10796: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.10797: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.10798: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B
Source.10799: DFBPPR14203 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-A
Source.10800: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.10801: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.10802: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.10803: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial
Source.10804: DFBPPR14217 ---- Marine protein ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.10805: DFBPPR14220 ---- Marine protein ---- Coiled-coil domain-containing protein 58
Source.10806: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.10807: DFBPPR14225 ---- Marine protein ---- LYR motif-containing protein 1
Source.10808: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog
Source.10809: DFBPPR14231 ---- Marine protein ---- Somatotropin
Source.10810: DFBPPR14236 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.10811: DFBPPR14237 ---- Marine protein ---- Stanniocalcin
Source.10812: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.10813: DFBPPR14246 ---- Marine protein ---- Glycoprotein hormones alpha chain 1
Source.10814: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3
Source.10815: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1
Source.10816: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2
Source.10817: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.10818: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.10819: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.10820: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.10821: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.10822: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.10823: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase
Source.10824: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.10825: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.10826: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.10827: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.10828: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.10829: DFBPPR14308 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic
Source.10830: DFBPPR14317 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic
Source.10831: DFBPPR14319 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic
Source.10832: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region
Source.10833: DFBPPR14324 ---- Marine protein ---- Uncharacterized protein ycf19
Source.10834: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.10835: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.10836: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.10837: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.10838: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.10839: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.10840: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.10841: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.10842: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.10843: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.10844: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase
Source.10845: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.10846: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.10847: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.10848: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.10849: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3
Source.10850: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.10851: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.10852: DFBPPR14353 ---- Marine protein ---- Cytochrome c6
Source.10853: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.10854: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.10855: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.10856: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.10857: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.10858: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.10859: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.10860: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.10861: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha
Source.10862: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.10863: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.10864: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha
Source.10865: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta
Source.10866: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.10867: DFBPPR14378 ---- Marine protein ---- Probable replicative DNA helicase
Source.10868: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.10869: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.10870: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.10871: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.10872: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.10873: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.10874: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain
Source.10875: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.10876: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.10877: DFBPPR14408 ---- Marine protein ---- Cytochrome b6-f complex subunit 6
Source.10878: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26
Source.10879: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.10880: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4
Source.10881: DFBPPR14419 ---- Marine protein ---- Photosystem II reaction center protein K
Source.10882: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK
Source.10883: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.10884: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.10885: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.10886: DFBPPR14428 ---- Marine protein ---- Photosystem II reaction center protein I
Source.10887: DFBPPR14433 ---- Marine protein ---- 50S ribosomal protein L14, chloroplastic
Source.10888: DFBPPR14442 ---- Marine protein ---- 50S ribosomal protein L18, chloroplastic
Source.10889: DFBPPR14443 ---- Marine protein ---- 30S ribosomal protein S14, chloroplastic
Source.10890: DFBPPR14445 ---- Marine protein ---- 50S ribosomal protein L21, chloroplastic
Source.10891: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY
Source.10892: DFBPPR14464 ---- Marine protein ---- 30S ribosomal protein S19, chloroplastic
Source.10893: DFBPPR14465 ---- Marine protein ---- 50S ribosomal protein L16, chloroplastic
Source.10894: DFBPPR14478 ---- Marine protein ---- Photosystem II reaction center protein T
Source.10895: DFBPPR14479 ---- Marine protein ---- Photosystem I assembly protein Ycf4
Source.10896: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.10897: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.10898: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28
Source.10899: DFBPPR14491 ---- Marine protein ---- Photosystem I reaction center subunit II
Source.10900: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.10901: DFBPPR14493 ---- Marine protein ---- 50S ribosomal protein L19, chloroplastic
Source.10902: DFBPPR14497 ---- Marine protein ---- 50S ribosomal protein L33, chloroplastic
Source.10903: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63
Source.10904: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.10905: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.10906: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.10907: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92
Source.10908: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.10909: DFBPPR14514 ---- Marine protein ---- Putative single-stranded DNA-binding protein ycf41
Source.10910: DFBPPR14517 ---- Marine protein ---- Uncharacterized protein ycf54
Source.10911: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56
Source.10912: DFBPPR14524 ---- Marine protein ---- Uncharacterized protein ycf36
Source.10913: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.10914: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35
Source.10915: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.10916: DFBPPR14533 ---- Marine protein ---- Uncharacterized protein ORF148
Source.10917: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.10918: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.10919: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.10920: DFBPPR14541 ---- Marine protein ---- Somatotropin-1
Source.10921: DFBPPR14542 ---- Marine protein ---- Somatotropin-2
Source.10922: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.10923: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.10924: DFBPPR14546 ---- Marine protein ---- Stanniocalcin
Source.10925: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor
Source.10926: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.10927: DFBPPR14551 ---- Marine protein ---- Histone H4
Source.10928: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.10929: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.10930: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.10931: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10932: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.10933: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.10934: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.10935: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.10936: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.10937: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.10938: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.10939: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.10940: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4
Source.10941: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.10942: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.10943: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.10944: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I
Source.10945: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.10946: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.10947: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.10948: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.10949: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10950: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.10951: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.10952: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.10953: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.10954: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.10955: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.10956: DFBPPR14618 ---- Marine protein ---- Ependymin-1
Source.10957: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.10958: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.10959: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.10960: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.10961: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18
Source.10962: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.10963: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.10964: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin
Source.10965: DFBPPR14645 ---- Marine protein ---- Ependymin-2
Source.10966: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.10967: DFBPPR14650 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.10968: DFBPPR14651 ---- Marine protein ---- ATP synthase protein 8
Source.10969: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.10970: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.10971: DFBPPR14654 ---- Marine protein ---- Gastrin-releasing peptide
Source.10972: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.10973: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.10974: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc
Source.10975: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.10976: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.10977: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.10978: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.10979: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.10980: DFBPPR14680 ---- Marine protein ---- Steroidogenic acute regulatory protein, mitochondrial
Source.10981: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.10982: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.10983: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.10984: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2
Source.10985: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.10986: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.10987: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1
Source.10988: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.10989: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.10990: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2
Source.10991: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1
Source.10992: DFBPPR14739 ---- Marine protein ---- Interleukin-1 receptor-associated kinase 1-binding protein 1 homolog
Source.10993: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein
Source.10994: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.10995: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.10996: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.10997: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B
Source.10998: DFBPPR14745 ---- Marine protein ---- Parvalbumin beta 2
Source.10999: DFBPPR14746 ---- Marine protein ---- Parvalbumin beta 1
Source.11000: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.11001: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1
Source.11002: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.11003: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.11004: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.11005: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit
Source.11006: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.11007: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.11008: DFBPPR14760 ---- Marine protein ---- Big defensin
Source.11009: DFBPPR14762 ---- Marine protein ---- Coagulogen
Source.11010: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.11011: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.11012: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.11013: DFBPPR14770 ---- Marine protein ---- Lectin L6
Source.11014: DFBPPR14771 ---- Marine protein ---- L-cystatin
Source.11015: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.11016: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11017: DFBPPR14783 ---- Marine protein ---- Enolase
Source.11018: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11019: DFBPPR14787 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform A
Source.11020: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.11021: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.11022: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.11023: DFBPPR14791 ---- Marine protein ---- Guanine nucleotide-binding protein G(i) subunit alpha
Source.11024: DFBPPR14792 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform B
Source.11025: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.11026: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.11027: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.11028: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.11029: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.11030: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.11031: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.11032: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.11033: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.11034: DFBPPR14811 ---- Marine protein ---- Crustacean hyperglycemic hormone
Source.11035: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.11036: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.11037: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.11038: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.11039: DFBPPR14831 ---- Marine protein ---- 40S ribosomal protein S27
Source.11040: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.11041: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.11042: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.11043: DFBPPR14857 ---- Marine protein ---- Hemoglobin anodic subunit alpha
Source.11044: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha
Source.11045: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.11046: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.11047: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.11048: DFBPPR14867 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.11049: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle
Source.11050: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.11051: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.11052: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.11053: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.11054: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.11055: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system
Source.11056: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.11057: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.11058: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.11059: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.11060: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.11061: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.11062: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.11063: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.11064: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.11065: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.11066: DFBPPR14897 ---- Microorganism protein ---- Calmodulin
Source.11067: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.11068: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.11069: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.11070: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.11071: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.11072: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.11073: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.11074: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.11075: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8
Source.11076: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.11077: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.11078: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.11079: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.11080: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.11081: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.11082: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.11083: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.11084: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.11085: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.11086: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.11087: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.11088: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1
Source.11089: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.11090: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.11091: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.11092: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.11093: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.11094: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase
Source.11095: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.11096: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.11097: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5
Source.11098: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.11099: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.11100: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.11101: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.11102: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32
Source.11103: DFBPPR14950 ---- Microorganism protein ---- 5'-AMP-activated protein kinase subunit gamma
Source.11104: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.11105: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.11106: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.11107: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.11108: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.11109: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.11110: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.11111: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1
Source.11112: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.11113: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial
Source.11114: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.11115: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.11116: DFBPPR14968 ---- Microorganism protein ---- Small COPII coat GTPase SAR1
Source.11117: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.11118: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.11119: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.11120: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.11121: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.11122: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.11123: DFBPPR14976 ---- Microorganism protein ---- Adenylate kinase
Source.11124: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1
Source.11125: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.11126: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.11127: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.11128: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.11129: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.11130: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.11131: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.11132: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.11133: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.11134: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.11135: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.11136: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.11137: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.11138: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.11139: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.11140: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.11141: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.11142: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.11143: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.11144: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.11145: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.11146: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.11147: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.11148: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.11149: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.11150: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1
Source.11151: DFBPPR15026 ---- Microorganism protein ---- ATP synthase subunit 9, mitochondrial
Source.11152: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.11153: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.11154: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.11155: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.11156: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.11157: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.11158: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.11159: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.11160: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial
Source.11161: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.11162: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.11163: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.11164: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.11165: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.11166: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial
Source.11167: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.11168: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.11169: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10
Source.11170: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.11171: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.11172: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.11173: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.11174: DFBPPR15053 ---- Microorganism protein ---- 60S ribosomal subunit assembly/export protein LOC1
Source.11175: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.11176: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1
Source.11177: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.11178: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.11179: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.11180: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.11181: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.11182: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.11183: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.11184: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.11185: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.11186: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.11187: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor
Source.11188: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.11189: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.11190: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.11191: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.11192: DFBPPR15079 ---- Microorganism protein ---- Autophagy-related protein 3
Source.11193: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.11194: DFBPPR15082 ---- Microorganism protein ---- Cytochrome c
Source.11195: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.11196: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.11197: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.11198: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial
Source.11199: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial
Source.11200: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.11201: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.11202: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.11203: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.11204: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.11205: DFBPPR15107 ---- Microorganism protein ---- Calcineurin subunit B
Source.11206: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.11207: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.11208: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.11209: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1
Source.11210: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase
Source.11211: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.11212: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.11213: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.11214: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.11215: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.11216: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.11217: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G
Source.11218: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase
Source.11219: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.11220: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.11221: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.11222: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.11223: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.11224: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.11225: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1
Source.11226: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.11227: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.11228: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A
Source.11229: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6
Source.11230: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.11231: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.11232: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.11233: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.11234: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D
Source.11235: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.11236: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic
Source.11237: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.11238: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.11239: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.11240: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.11241: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.11242: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.11243: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.11244: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.11245: DFBPPR15163 ---- Microorganism protein ---- Ubiquitin-related modifier 1
Source.11246: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.11247: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.11248: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1
Source.11249: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.11250: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.11251: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.11252: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.11253: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.11254: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.11255: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.11256: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.11257: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.11258: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.11259: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.11260: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.11261: DFBPPR15185 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 8
Source.11262: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2
Source.11263: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.11264: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.11265: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.11266: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I
Source.11267: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase
Source.11268: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.11269: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.11270: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.11271: DFBPPR15204 ---- Microorganism protein ---- FK506-binding protein 1
Source.11272: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.11273: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.11274: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17
Source.11275: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.11276: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.11277: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.11278: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.11279: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.11280: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1
Source.11281: DFBPPR15223 ---- Microorganism protein ---- FK506-binding protein 2
Source.11282: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.11283: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4
Source.11284: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase
Source.11285: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.11286: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.11287: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.11288: DFBPPR15237 ---- Microorganism protein ---- U6 snRNA-associated Sm-like protein LSm6
Source.11289: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.11290: DFBPPR15239 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 9
Source.11291: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.11292: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.11293: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2
Source.11294: DFBPPR15244 ---- Microorganism protein ---- DASH complex subunit SPC19
Source.11295: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.11296: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a
Source.11297: DFBPPR15248 ---- Microorganism protein ---- DASH complex subunit SPC34
Source.11298: DFBPPR15251 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP38
Source.11299: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.11300: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.11301: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1
Source.11302: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.11303: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.11304: DFBPPR15261 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit alpha
Source.11305: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.11306: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.11307: DFBPPR15267 ---- Microorganism protein ---- Cofilin
Source.11308: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3
Source.11309: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25
Source.11310: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.11311: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.11312: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.11313: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.11314: DFBPPR15277 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 20
Source.11315: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.11316: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5
Source.11317: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.11318: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.11319: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase
Source.11320: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12
Source.11321: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.11322: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.11323: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D
Source.11324: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta
Source.11325: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.11326: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.11327: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.11328: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80
Source.11329: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.11330: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase
Source.11331: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106
Source.11332: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.11333: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.11334: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1
Source.11335: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.11336: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.11337: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.11338: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.11339: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.11340: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.11341: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.11342: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.11343: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1
Source.11344: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.11345: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3
Source.11346: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.11347: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.11348: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1
Source.11349: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.11350: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.11351: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.11352: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.11353: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.11354: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.11355: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.11356: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase
Source.11357: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.11358: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.11359: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog
Source.11360: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.11361: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.11362: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.11363: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.11364: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.11365: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17
Source.11366: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.11367: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.11368: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.11369: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.11370: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.11371: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.11372: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.11373: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.11374: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.11375: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3
Source.11376: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.11377: DFBPPR15410 ---- Microorganism protein ---- Mitochondrial inner membrane protease ATP23
Source.11378: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.11379: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59
Source.11380: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.11381: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16
Source.11382: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.11383: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.11384: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase
Source.11385: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.11386: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82
Source.11387: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.11388: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3
Source.11389: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.11390: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.11391: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1
Source.11392: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1
Source.11393: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.11394: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.11395: DFBPPR15440 ---- Microorganism protein ---- Mitochondrial homologous recombination protein 1
Source.11396: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.11397: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.11398: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.11399: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22
Source.11400: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1
Source.11401: DFBPPR15451 ---- Microorganism protein ---- GrpE protein homolog, mitochondrial
Source.11402: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.11403: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial
Source.11404: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.11405: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.11406: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.11407: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.11408: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.11409: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.11410: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.11411: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.11412: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.11413: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.11414: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.11415: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.11416: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.11417: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.11418: DFBPPR15484 ---- Microorganism protein ---- Protein TOS6
Source.11419: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.11420: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.11421: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.11422: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1
Source.11423: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.11424: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.11425: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123
Source.11426: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.11427: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.11428: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.11429: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.11430: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.11431: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.11432: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.11433: DFBPPR15505 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC15
Source.11434: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.11435: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3
Source.11436: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.11437: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.11438: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.11439: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101
Source.11440: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.11441: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3
Source.11442: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.11443: DFBPPR15530 ---- Microorganism protein ---- Translationally-controlled tumor protein homolog
Source.11444: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5
Source.11445: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta
Source.11446: DFBPPR15537 ---- Microorganism protein ---- mRNA 3'-end-processing protein YTH1
Source.11447: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.11448: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.11449: DFBPPR15541 ---- Microorganism protein ---- F-actin-capping protein subunit alpha
Source.11450: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.11451: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.11452: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.11453: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.11454: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.11455: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14
Source.11456: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4
Source.11457: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.11458: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial
Source.11459: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.11460: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.11461: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.11462: DFBPPR15562 ---- Microorganism protein ---- Mitotic spindle-associated protein SHE1
Source.11463: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1
Source.11464: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2
Source.11465: DFBPPR15567 ---- Microorganism protein ---- Mating-type protein A2
Source.11466: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.11467: DFBPPR15572 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 2, mitochondrial
Source.11468: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.11469: DFBPPR15574 ---- Microorganism protein ---- Protein PXR1
Source.11470: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381
Source.11471: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.11472: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.11473: DFBPPR15583 ---- Microorganism protein ---- DNA replication complex GINS protein PSF3
Source.11474: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.11475: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28
Source.11476: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.11477: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.11478: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27
Source.11479: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1
Source.11480: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial
Source.11481: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.11482: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.11483: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.11484: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.11485: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.11486: DFBPPR15606 ---- Microorganism protein ---- Assembly factor CBP4
Source.11487: DFBPPR15608 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP2
Source.11488: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.11489: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.11490: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.11491: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.11492: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5
Source.11493: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.11494: DFBPPR15621 ---- Microorganism protein ---- Spore membrane assembly protein 2
Source.11495: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.11496: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.11497: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12
Source.11498: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.11499: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.11500: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.11501: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.11502: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.11503: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3
Source.11504: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5
Source.11505: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.11506: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.11507: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22
Source.11508: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.11509: DFBPPR15654 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase
Source.11510: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18
Source.11511: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.11512: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.11513: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.11514: DFBPPR15664 ---- Microorganism protein ---- Spindle pole body component SPC42
Source.11515: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25
Source.11516: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.11517: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1
Source.11518: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial
Source.11519: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.11520: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6
Source.11521: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.11522: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1
Source.11523: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.11524: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.11525: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14
Source.11526: DFBPPR15688 ---- Microorganism protein ---- Nuclear transport factor 2
Source.11527: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.11528: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.11529: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.11530: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.11531: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1
Source.11532: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2
Source.11533: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.11534: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.11535: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.11536: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.11537: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.11538: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.11539: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.11540: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.11541: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.11542: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.11543: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.11544: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2
Source.11545: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial
Source.11546: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.11547: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.11548: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.11549: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.11550: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.11551: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.11552: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.11553: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.11554: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial
Source.11555: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1
Source.11556: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.11557: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1
Source.11558: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.11559: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.11560: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.11561: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3
Source.11562: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.11563: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.11564: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.11565: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial
Source.11566: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.11567: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6
Source.11568: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4
Source.11569: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.11570: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial
Source.11571: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.11572: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.11573: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.11574: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase
Source.11575: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.11576: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.11577: DFBPPR15802 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurQ
Source.11578: DFBPPR15803 ---- Microorganism protein ---- Galactokinase
Source.11579: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.11580: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.11581: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.11582: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.11583: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.11584: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.11585: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.11586: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase
Source.11587: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.11588: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD
Source.11589: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.11590: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.11591: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.11592: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.11593: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.11594: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.11595: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.11596: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR
Source.11597: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.11598: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase
Source.11599: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.11600: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.11601: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.11602: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.11603: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.11604: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.11605: DFBPPR15845 ---- Microorganism protein ---- Calmodulin
Source.11606: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.11607: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.11608: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.11609: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.11610: DFBPPR15856 ---- Microorganism protein ---- Laccase-2
Source.11611: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.11612: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.11613: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.11614: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.11615: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.11616: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.11617: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.11618: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.11619: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.11620: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.11621: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11622: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11623: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.11624: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.11625: DFBPPR15886 ---- Microorganism protein ---- Capsid protein
Source.11626: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.11627: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.11628: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.11629: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.11630: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.11631: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11632: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.11633: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.11634: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.11635: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.11636: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.11637: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.11638: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.11639: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.11640: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.11641: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.11642: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.11643: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.11644: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.11645: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.11646: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11647: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.11648: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.11649: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.11650: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A
Source.11651: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.11652: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.11653: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.11654: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.11655: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11656: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.11657: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.11658: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.11659: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.11660: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.11661: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.11662: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.11663: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.11664: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.11665: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.11666: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.11667: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.11668: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.11669: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.11670: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.11671: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.11672: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.11673: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.11674: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.11675: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.11676: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.11677: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.11678: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.11679: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.11680: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.11681: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.11682: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.11683: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.11684: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.11685: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.11686: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.11687: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.11688: DFBPPR7824 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.11689: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.11690: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.11691: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.11692: DFBPPR7833 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.11693: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.11694: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.11695: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.11696: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.11697: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.11698: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.11699: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.11700: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.11701: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.11702: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2
Source.11703: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.11704: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.11705: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.11706: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.11707: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.11708: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.11709: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.11710: DFBPPR7859 ---- Plant protein ---- Cytochrome b6-f complex subunit 4
Source.11711: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.11712: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Source.11713: DFBPPR7863 ---- Plant protein ---- 50S ribosomal protein L23-B, chloroplastic
Source.11714: DFBPPR7865 ---- Plant protein ---- 50S ribosomal protein L23-A, chloroplastic
Source.11715: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.11716: DFBPPR7872 ---- Plant protein ---- Photosystem II reaction center protein J
Source.11717: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4
Source.11718: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1
Source.11719: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.11720: DFBPPR7881 ---- Plant protein ---- 50S ribosomal protein L20, chloroplastic
Source.11721: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.11722: DFBPPR7888 ---- Plant protein ---- Photosystem II reaction center protein Z
Source.11723: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.11724: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.11725: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.11726: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.11727: DFBPPR7897 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic
Source.11728: DFBPPR7904 ---- Plant protein ---- Photosystem I reaction center subunit VIII
Source.11729: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.11730: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.11731: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1
Source.11732: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.11733: DFBPPR7912 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.11734: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.11735: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.11736: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.11737: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1
Source.11738: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.11739: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.11740: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.11741: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.11742: DFBPPR7933 ---- Plant protein ---- FK506-binding protein 2
Source.11743: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.11744: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.11745: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.11746: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.11747: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1
Source.11748: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.11749: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.11750: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.11751: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1
Source.11752: DFBPPR7947 ---- Plant protein ---- Legumin type B
Source.11753: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.11754: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.11755: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.11756: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.11757: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.11758: DFBPPR7954 ---- Plant protein ---- Favin
Source.11759: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.11760: DFBPPR7956 ---- Plant protein ---- Legumin type B
Source.11761: DFBPPR7957 ---- Plant protein ---- Legumin type B
Source.11762: DFBPPR7958 ---- Plant protein ---- Legumin type B
Source.11763: DFBPPR7959 ---- Plant protein ---- Leghemoglobin 49
Source.11764: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.11765: DFBPPR7963 ---- Plant protein ---- Leghemoglobin 29
Source.11766: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.11767: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.11768: DFBPPR7967 ---- Plant protein ---- Plastocyanin
Source.11769: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.11770: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.11771: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.11772: DFBPPR7975 ---- Plant protein ---- Protein Ycf2
Source.11773: DFBPPR7977 ---- Plant protein ---- Ribosomal protein S14, mitochondrial
Source.11774: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein
Source.11775: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.11776: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.11777: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A
Source.11778: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.11779: DFBPPR7989 ---- Plant protein ---- Cytochrome c
Source.11780: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11781: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1
Source.11782: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11783: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.11784: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.11785: DFBPPR7996 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.11786: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.11787: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.11788: DFBPPR8002 ---- Plant protein ---- Plastocyanin
Source.11789: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.11790: DFBPPR8025 ---- Plant protein ---- Unknown protein 12
Source.11791: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.11792: DFBPPR8029 ---- Plant protein ---- Vignain
Source.11793: DFBPPR8030 ---- Plant protein ---- Arcelin-5A
Source.11794: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.11795: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1
Source.11796: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.11797: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.11798: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.11799: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11800: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.11801: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.11802: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1
Source.11803: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.11804: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11805: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.11806: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.11807: DFBPPR8049 ---- Plant protein ---- Bowman-Birk type proteinase inhibitor 2
Source.11808: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.11809: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.11810: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.11811: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.11812: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.11813: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.11814: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.11815: DFBPPR8063 ---- Plant protein ---- Leghemoglobin A
Source.11816: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.11817: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.11818: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.11819: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.11820: DFBPPR8073 ---- Plant protein ---- Arcelin-5B
Source.11821: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.11822: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.11823: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.11824: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.11825: DFBPPR8082 ---- Plant protein ---- Plastocyanin
Source.11826: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase
Source.11827: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.11828: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.11829: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.11830: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.11831: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.11832: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.11833: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.11834: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.11835: DFBPPR8099 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.11836: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.11837: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.11838: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.11839: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.11840: DFBPPR8107 ---- Plant protein ---- Stress-related protein
Source.11841: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1
Source.11842: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.11843: DFBPPR8110 ---- Plant protein ---- Leghemoglobin
Source.11844: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.11845: DFBPPR8112 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.11846: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.11847: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.11848: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.11849: DFBPPR8119 ---- Plant protein ---- Chalcone--flavonone isomerase
Source.11850: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.11851: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8
Source.11852: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.11853: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.11854: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.11855: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.11856: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.11857: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2
Source.11858: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.11859: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0
Source.11860: DFBPPR8159 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.11861: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.11862: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.11863: DFBPPR8183 ---- Plant protein ---- 26 kDa cell wall protein
Source.11864: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.11865: DFBPPR8214 ---- Plant protein ---- Cytochrome c
Source.11866: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.11867: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.11868: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.11869: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.11870: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11871: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.11872: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.11873: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11874: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.11875: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.11876: DFBPPR8228 ---- Plant protein ---- Albumin-8
Source.11877: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.11878: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.11879: DFBPPR8234 ---- Plant protein ---- Anther-specific protein SF18
Source.11880: DFBPPR8235 ---- Plant protein ---- Catalase
Source.11881: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.11882: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.11883: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3
Source.11884: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.11885: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.11886: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.11887: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.11888: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.11889: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.11890: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.11891: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.11892: DFBPPR8261 ---- Plant protein ---- Photosystem II reaction center protein H
Source.11893: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.11894: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.11895: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.11896: DFBPPR8267 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.11897: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.11898: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.11899: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.11900: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.11901: DFBPPR8273 ---- Plant protein ---- Anther-specific protein SF2
Source.11902: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.11903: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.11904: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.11905: DFBPPR8278 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.11906: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.11907: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.11908: DFBPPR8284 ---- Plant protein ---- Calmodulin
Source.11909: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.11910: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.11911: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.11912: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein
Source.11913: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase
Source.11914: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4
Source.11915: DFBPPR8299 ---- Plant protein ---- 50S ribosomal protein L23, chloroplastic
Source.11916: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.11917: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.11918: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.11919: DFBPPR8306 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.11920: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.11921: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.11922: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.11923: DFBPPR8322 ---- Plant protein ---- Photosystem II reaction center protein J
Source.11924: DFBPPR8324 ---- Plant protein ---- Photosystem II reaction center protein Z
Source.11925: DFBPPR8334 ---- Plant protein ---- Photosystem I reaction center subunit VIII
Source.11926: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.11927: DFBPPR8339 ---- Plant protein ---- Cysteine proteinase inhibitor B
Source.11928: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a
Source.11929: DFBPPR8343 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.11930: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.11931: DFBPPR8348 ---- Plant protein ---- 30S ribosomal protein S16, chloroplastic
Source.11932: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein
Source.11933: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Source.11934: DFBPPR8356 ---- Plant protein ---- Unknown protein 1
Link-research
Link 1: DFBPACEI1194----Wakame (Undaria pinnatifida)----Extract of wakame powder
Link 2: DFBPACEI1362----Wheat----Wheat germ hydrolysates
Link 3: DFBPACEI0484----Sardine muscle----Muscle protein
Link 4: DFBPACEI1896----Amaranth seed proteins----Amaranth glutelins
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 43.7 uM (or 53 uM [4]).

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O
Preparation method
Mode of preparation Enzymatic hydrolysis
Enzyme(s)/starter culture

The tripeptide Ala-Val-Phe is partly hydrolyzed by mucosal peptidases to Val-Phe.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

(1) This peptide could be applied as ingredient in functional and novel foods, dietary supplements or even pharmaceuticals as an antihypertensive agent.
(2) Spodoptera littoralis (Lepidoptera) is an edible insect and it is present in the subtropical regions in Europe, America and Africa.

Database cross-references
DFBP
[D1] DFBPANHY0593
[D2] DFBPMUFU0045
BIOPEP-UWM [D3] 3384, 8917
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Vercruysse L, Van Camp J, Morel N, Rougé P, Herregods G, Smagghe G. Ala-Val-Phe and Val-Phe: ACE inhibitory peptides derived from insect protein with antihypertensive activity in spontaneously hypertensive rats. Peptides. 2010 Mar;31(3):482-8.
PMID: 19524628
Other literature(s) [1] Vercruysse L, Matsui S T, Camp J V. Purification and identification of an angiotensin I converting enzyme (ACE) inhibitory peptide from the gastrointestinal hydrolysate of the cotton leafworm, Spodoptera littoralis[J]. Process Biochemistry, 2008, 43(8):900-904.
[2] Martínez-Maqueda D, Miralles B, Recio I, et al. Antihypertensive peptides from food proteins: a review[J]. Food (&) Function, 2012, 3(4):350-361.
[3] Suetsuna K, Maekawa K, Chen J R. Antihypertensive effects of Undaria pinnatifida (wakame) peptide on blood pressure in spontaneously hypertensive rats[J]. Journal of Nutritional Biochemistry, 2004, 15(5):267-272.
[4] Cheung, H.S., et al., Binding of peptide substrates and inhibitors of angiotensin-converting enzyme. Importance of the COOH-terminal dipeptide sequence. J Biol Chem, 1980. 255(2): p. 401-7.

PubDate 2010
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214