Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI0108(ACE-inhibitory peptide)

DFBP ID	DFBPACEI0108
Peptide sequence	VF
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	Antihypertensive activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Val-Phe

Single-letter amino acid

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	264.32 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

43.7 uM, 53 uM ^[4]

pIC₅₀

-1.64, -1.724

GRAVY

3.5000^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Insect
Organism/Source	Cotton leafworm, Spodoptera littoralis (Lepidoptera)
Precursor protein	Cotton leafworm hydrolysates
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.3: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit Source.4: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein Source.5: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein Source.6: DFBPPR0748 ---- Plant proteins ---- Agglutinin Source.7: DFBPPR0776 ---- Plant proteins ---- 11S globulin Source.8: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.9: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.10: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.11: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.12: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1 Source.13: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.14: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.15: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.16: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.17: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.18: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.19: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.20: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.21: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.22: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.23: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.24: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.25: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic Source.26: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.27: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.28: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic Source.29: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.30: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A Source.31: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.32: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5 Source.33: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.34: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.35: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.36: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.37: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.38: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.39: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.40: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.41: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.42: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.43: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.44: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.45: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.46: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.47: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.48: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.49: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A Source.50: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.51: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.52: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6 Source.53: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.54: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.55: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.56: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic Source.57: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1 Source.58: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.59: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.60: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.61: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.62: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.63: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.64: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1 Source.65: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.66: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.67: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.68: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1 Source.69: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.70: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.71: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase Source.72: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.73: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.74: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.75: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.76: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.77: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.78: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.79: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.80: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.81: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.82: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.83: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.84: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial Source.85: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.86: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.87: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.88: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1 Source.89: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.90: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.91: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.92: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.93: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.94: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A Source.95: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.96: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.97: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.98: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.99: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.100: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.101: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.102: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.103: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.104: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.105: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.106: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.107: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic Source.108: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.109: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.110: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.111: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.112: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.113: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.114: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.115: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.116: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.117: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.118: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.119: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.120: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.121: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185 Source.122: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.123: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.124: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.125: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase Source.126: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1 Source.127: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.128: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.129: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1 Source.130: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.131: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.132: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.133: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.134: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.135: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.136: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.137: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.138: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.139: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.140: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1 Source.141: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.142: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.143: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.144: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.145: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.146: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic Source.147: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.148: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A Source.149: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.150: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.151: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.152: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.153: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.154: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.155: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.156: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.157: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.158: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.159: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.160: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.161: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5 Source.162: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.163: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.164: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.165: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.166: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.167: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10 Source.168: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5 Source.169: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.170: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1 Source.171: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.172: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.173: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3 Source.174: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c Source.175: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.176: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.177: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.178: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.179: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2 Source.180: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.181: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.182: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.183: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.184: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5 Source.185: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46 Source.186: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.187: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.188: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.189: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.190: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.191: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1 Source.192: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13 Source.193: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB Source.194: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic Source.195: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.196: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.197: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.198: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.199: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.200: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.201: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.202: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.203: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic Source.204: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic Source.205: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B Source.206: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.207: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.208: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.209: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.210: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.211: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.212: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.213: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.214: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.215: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.216: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog Source.217: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3 Source.218: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.219: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog Source.220: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.221: DFBPPR1142 ---- Plant proteins ---- Calreticulin Source.222: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13 Source.223: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4 Source.224: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.225: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.226: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.227: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.228: DFBPPR1151 ---- Plant proteins ---- Cytochrome c Source.229: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2 Source.230: DFBPPR1154 ---- Plant proteins ---- MADS-box transcription factor 22 Source.231: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13 Source.232: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.233: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1 Source.234: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.235: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.236: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.237: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.238: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.239: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.240: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic Source.241: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23 Source.242: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.243: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.244: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.245: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2 Source.246: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.247: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic Source.248: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.249: DFBPPR1183 ---- Plant proteins ---- MADS-box transcription factor 18 Source.250: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.251: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.252: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.253: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.254: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.255: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.256: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase Source.257: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4 Source.258: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic Source.259: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.260: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.261: DFBPPR1223 ---- Plant proteins ---- Elicitor-responsive protein 1 Source.262: DFBPPR1224 ---- Plant proteins ---- MADS-box transcription factor 50 Source.263: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.264: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.265: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.266: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.267: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58 Source.268: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.269: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial Source.270: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.271: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10 Source.272: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.273: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.274: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24 Source.275: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.276: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.277: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.278: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.279: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.280: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.281: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.282: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic Source.283: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.284: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.285: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23 Source.286: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15 Source.287: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.288: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.289: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.290: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.291: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.292: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.293: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a Source.294: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2 Source.295: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.296: DFBPPR1283 ---- Plant proteins ---- Arsenate reductase 2.1 Source.297: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.298: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.299: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic Source.300: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.301: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.302: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.303: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.304: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.305: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.306: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic Source.307: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1 Source.308: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.309: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic Source.310: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22 Source.311: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.312: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.313: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.314: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B Source.315: DFBPPR1310 ---- Plant proteins ---- Rac-like GTP-binding protein 6 Source.316: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.317: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.318: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.319: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.320: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2 Source.321: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.322: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.323: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.324: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7 Source.325: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.326: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.327: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d Source.328: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.329: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.330: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.331: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B Source.332: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.333: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.334: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.335: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12 Source.336: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.337: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.338: DFBPPR1340 ---- Plant proteins ---- F-box protein GID2 Source.339: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.340: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1 Source.341: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.342: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.343: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.344: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.345: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.346: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.347: DFBPPR1351 ---- Plant proteins ---- Probable phospholipase A2 homolog 2 Source.348: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.349: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.350: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1 Source.351: DFBPPR1357 ---- Plant proteins ---- MADS-box transcription factor 47 Source.352: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.353: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.354: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.355: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A Source.356: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.357: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1 Source.358: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.359: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.360: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.361: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.362: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3 Source.363: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.364: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.365: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2 Source.366: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.367: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.368: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog Source.369: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.370: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.371: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.372: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.373: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.374: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.375: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.376: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.377: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.378: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.379: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.380: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.381: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B Source.382: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.383: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.384: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.385: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.386: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.387: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.388: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.389: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7 Source.390: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.391: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A Source.392: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.393: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.394: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.395: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1 Source.396: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.397: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.398: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14 Source.399: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.400: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.401: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.402: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3 Source.403: DFBPPR1431 ---- Plant proteins ---- Glutaredoxin-C6 Source.404: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.405: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2 Source.406: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29 Source.407: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic Source.408: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14 Source.409: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.410: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.411: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.412: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.413: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.414: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.415: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.416: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37 Source.417: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.418: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.419: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.420: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8 Source.421: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.422: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.423: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.424: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.425: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.426: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.427: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.428: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c Source.429: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2 Source.430: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.431: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.432: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.433: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.434: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic Source.435: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.436: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.437: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.438: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.439: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.440: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.441: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.442: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.443: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.444: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.445: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.446: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.447: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.448: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.449: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.450: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.451: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1 Source.452: DFBPPR1491 ---- Plant proteins ---- Rac-like GTP-binding protein 4 Source.453: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.454: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.455: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.456: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.457: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.458: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.459: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1 Source.460: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.461: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5 Source.462: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.463: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.464: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.465: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.466: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.467: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.468: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F Source.469: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.470: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.471: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.472: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.473: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.474: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.475: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.476: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.477: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1 Source.478: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.479: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.480: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.481: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.482: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39 Source.483: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.484: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.485: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.486: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.487: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8 Source.488: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.489: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.490: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.491: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.492: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.493: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.494: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.495: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.496: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.497: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2 Source.498: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.499: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.500: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.501: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.502: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.503: DFBPPR1561 ---- Plant proteins ---- Chitinase 4 Source.504: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.505: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A Source.506: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.507: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.508: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.509: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.510: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF Source.511: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2 Source.512: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.513: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.514: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.515: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2 Source.516: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic Source.517: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.518: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.519: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.520: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.521: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.522: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.523: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.524: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.525: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.526: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.527: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.528: DFBPPR1597 ---- Plant proteins ---- MADS-box transcription factor 51 Source.529: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.530: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.531: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5 Source.532: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase Source.533: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.534: DFBPPR1606 ---- Plant proteins ---- 17.4 kDa class I heat shock protein Source.535: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.536: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.537: DFBPPR1610 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.538: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.539: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.540: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase Source.541: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.542: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7 Source.543: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.544: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.545: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.546: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.547: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.548: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.549: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.550: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.551: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.552: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.553: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.554: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2 Source.555: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.556: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.557: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2 Source.558: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.559: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.560: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.561: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3 Source.562: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.563: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.564: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein Source.565: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.566: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.567: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.568: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.569: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1 Source.570: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.571: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal Source.572: DFBPPR1671 ---- Plant proteins ---- MADS-box transcription factor 4 Source.573: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.574: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.575: DFBPPR1676 ---- Plant proteins ---- MADS-box transcription factor 55 Source.576: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic Source.577: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.578: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.579: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.580: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.581: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.582: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.583: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.584: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3 Source.585: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062 Source.586: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic Source.587: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.588: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.589: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.590: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.591: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.592: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1 Source.593: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2 Source.594: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1 Source.595: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.596: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.597: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.598: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.599: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2 Source.600: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.601: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.602: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.603: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.604: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.605: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.606: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.607: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.608: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.609: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.610: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3 Source.611: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.612: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.613: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.614: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.615: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2 Source.616: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.617: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic Source.618: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.619: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1 Source.620: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic Source.621: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.622: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.623: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.624: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.625: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.626: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.627: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein Source.628: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial Source.629: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.630: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.631: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57 Source.632: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.633: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.634: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.635: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1 Source.636: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1 Source.637: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.638: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.639: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.640: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2 Source.641: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B Source.642: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.643: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.644: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.645: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1 Source.646: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.647: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.648: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.649: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.650: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.651: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.652: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.653: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.654: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22 Source.655: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1 Source.656: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.657: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.658: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.659: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.660: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.661: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic Source.662: DFBPPR1798 ---- Plant proteins ---- UMP-CMP kinase 2 Source.663: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1 Source.664: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.665: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4 Source.666: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.667: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.668: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.669: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.670: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.671: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.672: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4 Source.673: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9 Source.674: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.675: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2 Source.676: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.677: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.678: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B Source.679: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1 Source.680: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17 Source.681: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3 Source.682: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.683: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.684: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.685: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1 Source.686: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.687: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1 Source.688: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.689: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.690: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.691: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.692: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.693: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2 Source.694: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.695: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.696: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.697: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.698: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.699: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.700: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.701: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4 Source.702: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.703: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.704: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.705: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.706: DFBPPR1867 ---- Plant proteins ---- Laccase-21 Source.707: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.708: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.709: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.710: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.711: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.712: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4 Source.713: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.714: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B Source.715: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3 Source.716: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.717: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.718: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.719: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.720: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8 Source.721: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.722: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.723: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.724: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.725: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.726: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.727: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.728: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.729: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.730: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.731: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.732: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic Source.733: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8 Source.734: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.735: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.736: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6 Source.737: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.738: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.739: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.740: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial Source.741: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.742: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.743: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.744: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10 Source.745: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.746: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2 Source.747: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A Source.748: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.749: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2 Source.750: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.751: DFBPPR1932 ---- Plant proteins ---- Inactive casein kinase II subunit alpha-2 Source.752: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.753: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.754: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.755: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.756: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2 Source.757: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4 Source.758: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.759: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.760: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.761: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.762: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B Source.763: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.764: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.765: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17 Source.766: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4 Source.767: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.768: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1 Source.769: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.770: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.771: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.772: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.773: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.774: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1 Source.775: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.776: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.777: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.778: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.779: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.780: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4 Source.781: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2 Source.782: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.783: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16 Source.784: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38 Source.785: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2 Source.786: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.787: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.788: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.789: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b Source.790: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.791: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.792: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A Source.793: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.794: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.795: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.796: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33 Source.797: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.798: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.799: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.800: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.801: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.802: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5 Source.803: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain Source.804: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.805: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.806: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.807: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.808: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.809: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.810: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.811: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.812: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5 Source.813: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.814: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.815: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1 Source.816: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.817: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.818: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.819: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.820: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.821: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.822: DFBPPR2045 ---- Plant proteins ---- Expansin-A5 Source.823: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11 Source.824: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein Source.825: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23 Source.826: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.827: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.828: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.829: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.830: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.831: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9 Source.832: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5 Source.833: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3 Source.834: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.835: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.836: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.837: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.838: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.839: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa Source.840: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7 Source.841: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1 Source.842: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.843: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.844: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.845: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.846: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.847: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.848: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.849: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.850: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic Source.851: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.852: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.853: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.854: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.855: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.856: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.857: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.858: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.859: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.860: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.861: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.862: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.863: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1 Source.864: DFBPPR2101 ---- Plant proteins ---- Cupincin Source.865: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12 Source.866: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase Source.867: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.868: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.869: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.870: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.871: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.872: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4 Source.873: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.874: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.875: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.876: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.877: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.878: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.879: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.880: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2 Source.881: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.882: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.883: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.884: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.885: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.886: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.887: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein Source.888: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2 Source.889: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1 Source.890: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.891: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.892: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.893: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.894: DFBPPR2146 ---- Plant proteins ---- Expansin-B4 Source.895: DFBPPR2148 ---- Plant proteins ---- Auxin-responsive protein SAUR36 Source.896: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.897: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A Source.898: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3 Source.899: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.900: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2 Source.901: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2 Source.902: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.903: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.904: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.905: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.906: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.907: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.908: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.909: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.910: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.911: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.912: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.913: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.914: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.915: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2 Source.916: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C Source.917: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.918: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.919: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1 Source.920: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1 Source.921: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.922: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.923: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.924: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.925: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1 Source.926: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.927: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.928: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2 Source.929: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.930: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.931: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.932: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.933: DFBPPR2206 ---- Plant proteins ---- Leucine-rich repeat protein 1 Source.934: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16 Source.935: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21 Source.936: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial Source.937: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32 Source.938: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.939: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.940: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.941: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4 Source.942: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.943: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.944: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.945: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.946: DFBPPR2223 ---- Plant proteins ---- Urease Source.947: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9 Source.948: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.949: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.950: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.951: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1 Source.952: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain Source.953: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.954: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.955: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.956: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.957: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.958: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.959: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21 Source.960: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.961: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.962: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3 Source.963: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.964: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6 Source.965: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.966: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.967: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.968: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2 Source.969: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.970: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8 Source.971: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.972: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.973: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.974: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.975: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.976: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.977: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.978: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa Source.979: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.980: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1 Source.981: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.982: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.983: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3 Source.984: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.985: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.986: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.987: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4 Source.988: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.989: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.990: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.991: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.992: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.993: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b Source.994: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.995: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.996: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.997: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.998: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.999: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.1000: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.1001: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.1002: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.1003: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3 Source.1004: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.1005: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.1006: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4 Source.1007: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.1008: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.1009: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.1010: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b Source.1011: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.1012: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400 Source.1013: DFBPPR2344 ---- Plant proteins ---- Calcineurin B-like protein 8 Source.1014: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial Source.1015: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.1016: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.1017: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.1018: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.1019: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.1020: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1021: DFBPPR2353 ---- Plant proteins ---- Expansin-B12 Source.1022: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.1023: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.1024: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6 Source.1025: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11 Source.1026: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.1027: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1028: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.1029: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.1030: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.1031: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5 Source.1032: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.1033: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1 Source.1034: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.1035: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.1036: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.1037: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1038: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.1039: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase Source.1040: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.1041: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.1042: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.1043: DFBPPR2387 ---- Plant proteins ---- Chitinase 8 Source.1044: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2 Source.1045: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6 Source.1046: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic Source.1047: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.1048: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase Source.1049: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6 Source.1050: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1 Source.1051: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.1052: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.1053: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1054: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.1055: DFBPPR2408 ---- Plant proteins ---- Cytochrome f Source.1056: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3 Source.1057: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B Source.1058: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2 Source.1059: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2 Source.1060: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1061: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.1062: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2 Source.1063: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.1064: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.1065: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.1066: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.1067: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1 Source.1068: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.1069: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1 Source.1070: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.1071: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13 Source.1072: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.1073: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3 Source.1074: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.1075: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.1076: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1 Source.1077: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B Source.1078: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2 Source.1079: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.1080: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c Source.1081: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1082: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3 Source.1083: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9 Source.1084: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.1085: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic Source.1086: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.1087: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial Source.1088: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56 Source.1089: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.1090: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.1091: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3 Source.1092: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.1093: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.1094: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1 Source.1095: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.1096: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.1097: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34 Source.1098: DFBPPR2468 ---- Plant proteins ---- Germin-like protein 8-3 Source.1099: DFBPPR2469 ---- Plant proteins ---- Germin-like protein 8-4 Source.1100: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.1101: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.1102: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.1103: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase Source.1104: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.1105: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1106: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7 Source.1107: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.1108: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.1109: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.1110: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.1111: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1 Source.1112: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.1113: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic Source.1114: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1115: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic Source.1116: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.1117: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.1118: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.1119: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10 Source.1120: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.1121: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.1122: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B Source.1123: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5 Source.1124: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.1125: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4 Source.1126: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.1127: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1128: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.1129: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.1130: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.1131: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.1132: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.1133: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.1134: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.1135: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.1136: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.1137: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10 Source.1138: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24 Source.1139: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.1140: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4 Source.1141: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.1142: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.1143: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.1144: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5 Source.1145: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.1146: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.1147: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.1148: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.1149: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.1150: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.1151: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.1152: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.1153: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.1154: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.1155: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.1156: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic Source.1157: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.1158: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9 Source.1159: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.1160: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.1161: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.1162: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4 Source.1163: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20 Source.1164: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.1165: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.1166: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.1167: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.1168: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9 Source.1169: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.1170: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.1171: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic Source.1172: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.1173: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1 Source.1174: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.1175: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.1176: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4 Source.1177: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1 Source.1178: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.1179: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.1180: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.1181: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.1182: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2 Source.1183: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.1184: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.1185: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.1186: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E Source.1187: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.1188: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2 Source.1189: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57 Source.1190: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.1191: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1 Source.1192: DFBPPR2614 ---- Plant proteins ---- Photosystem II reaction center protein H Source.1193: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.1194: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2 Source.1195: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.1196: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.1197: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1 Source.1198: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3 Source.1199: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1 Source.1200: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a Source.1201: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1 Source.1202: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34 Source.1203: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.1204: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.1205: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.1206: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.1207: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2 Source.1208: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.1209: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.1210: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1 Source.1211: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic Source.1212: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25 Source.1213: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.1214: DFBPPR2648 ---- Plant proteins ---- SKP1-like protein 20 Source.1215: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2 Source.1216: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3 Source.1217: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2 Source.1218: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4 Source.1219: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.1220: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic Source.1221: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.1222: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.1223: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.1224: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.1225: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3 Source.1226: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.1227: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.1228: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1 Source.1229: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.1230: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.1231: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2 Source.1232: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.1233: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.1234: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.1235: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.1236: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1 Source.1237: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30 Source.1238: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.1239: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.1240: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.1241: DFBPPR2689 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.1242: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.1243: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.1244: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1 Source.1245: DFBPPR2697 ---- Plant proteins ---- Calcineurin B-like protein 2 Source.1246: DFBPPR2698 ---- Plant proteins ---- Proteasome subunit alpha type-6 Source.1247: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.1248: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.1249: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18 Source.1250: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72 Source.1251: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.1252: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1 Source.1253: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b Source.1254: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2 Source.1255: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.1256: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.1257: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.1258: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77 Source.1259: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.1260: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.1261: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.1262: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11 Source.1263: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal Source.1264: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.1265: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.1266: DFBPPR2724 ---- Plant proteins ---- Putative germin-like protein 8-1 Source.1267: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.1268: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.1269: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2 Source.1270: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.1271: DFBPPR2732 ---- Plant proteins ---- Small ubiquitin-related modifier 1 Source.1272: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.1273: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.1274: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A Source.1275: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5 Source.1276: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500 Source.1277: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.1278: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.1279: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.1280: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.1281: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6 Source.1282: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15 Source.1283: DFBPPR2751 ---- Plant proteins ---- Actin-7 Source.1284: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5 Source.1285: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.1286: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2 Source.1287: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.1288: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9 Source.1289: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.1290: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.1291: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.1292: DFBPPR2763 ---- Plant proteins ---- Actin-1 Source.1293: DFBPPR2764 ---- Plant proteins ---- MADS-box transcription factor 30 Source.1294: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.1295: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.1296: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.1297: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic Source.1298: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.1299: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1300: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.1301: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.1302: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.1303: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.1304: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.1305: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.1306: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.1307: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.1308: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.1309: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.1310: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.1311: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase Source.1312: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.1313: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a Source.1314: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1315: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1316: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.1317: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.1318: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic Source.1319: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c Source.1320: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.1321: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.1322: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12 Source.1323: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.1324: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.1325: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.1326: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.1327: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.1328: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.1329: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1330: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.1331: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.1332: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.1333: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3 Source.1334: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1 Source.1335: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4 Source.1336: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.1337: DFBPPR2823 ---- Plant proteins ---- Germin-like protein 8-9 Source.1338: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.1339: DFBPPR2825 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1340: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3 Source.1341: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8 Source.1342: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.1343: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.1344: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.1345: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.1346: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.1347: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.1348: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.1349: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.1350: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.1351: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.1352: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.1353: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.1354: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.1355: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.1356: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.1357: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.1358: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic Source.1359: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1360: DFBPPR2849 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 3 Source.1361: DFBPPR2850 ---- Plant proteins ---- Germin-like protein 8-6 Source.1362: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.1363: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.1364: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1365: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.1366: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131 Source.1367: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1 Source.1368: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase Source.1369: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.1370: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX Source.1371: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase Source.1372: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1 Source.1373: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.1374: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.1375: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.1376: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.1377: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.1378: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.1379: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.1380: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.1381: DFBPPR2883 ---- Plant proteins ---- Expansin-B9 Source.1382: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.1383: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1384: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.1385: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6 Source.1386: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2 Source.1387: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c Source.1388: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A Source.1389: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21 Source.1390: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.1391: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1 Source.1392: DFBPPR2900 ---- Plant proteins ---- Expansin-A23 Source.1393: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.1394: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.1395: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.1396: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2 Source.1397: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1398: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.1399: DFBPPR2910 ---- Plant proteins ---- Expansin-B5 Source.1400: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d Source.1401: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.1402: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.1403: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1 Source.1404: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2 Source.1405: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28 Source.1406: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.1407: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5 Source.1408: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3 Source.1409: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.1410: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.1411: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.1412: DFBPPR2925 ---- Plant proteins ---- Two-component response regulator ORR13 Source.1413: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1 Source.1414: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.1415: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein Source.1416: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4 Source.1417: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4 Source.1418: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.1419: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.1420: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.1421: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.1422: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1 Source.1423: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.1424: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.1425: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.1426: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.1427: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2 Source.1428: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.1429: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.1430: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.1431: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5 Source.1432: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.1433: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic Source.1434: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23 Source.1435: DFBPPR2952 ---- Plant proteins ---- Expansin-A17 Source.1436: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1 Source.1437: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1438: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.1439: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.1440: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.1441: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.1442: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.1443: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.1444: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.1445: DFBPPR2964 ---- Plant proteins ---- Expansin-A14 Source.1446: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.1447: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.1448: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.1449: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.1450: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.1451: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.1452: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.1453: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.1454: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.1455: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic Source.1456: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.1457: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.1458: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.1459: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic Source.1460: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.1461: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2 Source.1462: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.1463: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1 Source.1464: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7 Source.1465: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5 Source.1466: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1 Source.1467: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.1468: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.1469: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.1470: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.1471: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20 Source.1472: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.1473: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a Source.1474: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.1475: DFBPPR3007 ---- Plant proteins ---- Thioredoxin H2-2 Source.1476: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.1477: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.1478: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4 Source.1479: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.1480: DFBPPR3015 ---- Plant proteins ---- Expansin-A13 Source.1481: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.1482: DFBPPR3017 ---- Plant proteins ---- Expansin-A12 Source.1483: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit Source.1484: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c Source.1485: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.1486: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.1487: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.1488: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.1489: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.1490: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.1491: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.1492: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.1493: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1 Source.1494: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b Source.1495: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3 Source.1496: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.1497: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.1498: DFBPPR3044 ---- Plant proteins ---- Thioredoxin-like 4, chloroplastic Source.1499: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase Source.1500: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.1501: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10 Source.1502: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.1503: DFBPPR3052 ---- Plant proteins ---- MADS-box transcription factor 31 Source.1504: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.1505: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6 Source.1506: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1 Source.1507: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.1508: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.1509: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2 Source.1510: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.1511: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.1512: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.1513: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.1514: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic Source.1515: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.1516: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.1517: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.1518: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.1519: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3 Source.1520: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.1521: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.1522: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.1523: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2 Source.1524: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.1525: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.1526: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3 Source.1527: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.1528: DFBPPR3087 ---- Plant proteins ---- Actin-3 Source.1529: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34 Source.1530: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.1531: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.1532: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.1533: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.1534: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.1535: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.1536: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.1537: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.1538: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.1539: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.1540: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3 Source.1541: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.1542: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.1543: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1 Source.1544: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5 Source.1545: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6 Source.1546: DFBPPR3113 ---- Plant proteins ---- Putative autophagy-related protein 8E Source.1547: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.1548: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.1549: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.1550: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.1551: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20 Source.1552: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.1553: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.1554: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.1555: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.1556: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6 Source.1557: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.1558: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.1559: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.1560: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.1561: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.1562: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.1563: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.1564: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.1565: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.1566: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1 Source.1567: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.1568: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8 Source.1569: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.1570: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.1571: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.1572: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.1573: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O Source.1574: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2 Source.1575: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.1576: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4 Source.1577: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20 Source.1578: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.1579: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2 Source.1580: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5 Source.1581: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.1582: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.1583: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.1584: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.1585: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2 Source.1586: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.1587: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.1588: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I Source.1589: DFBPPR3176 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.1590: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1 Source.1591: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.1592: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.1593: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.1594: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.1595: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.1596: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.1597: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.1598: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.1599: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.1600: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.1601: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.1602: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1 Source.1603: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59 Source.1604: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.1605: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.1606: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.1607: DFBPPR3203 ---- Plant proteins ---- Monothiol glutaredoxin-S10 Source.1608: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.1609: DFBPPR3205 ---- Plant proteins ---- Monothiol glutaredoxin-S3 Source.1610: DFBPPR3206 ---- Plant proteins ---- Expansin-B15 Source.1611: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B Source.1612: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.1613: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.1614: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.1615: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5 Source.1616: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.1617: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.1618: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.1619: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.1620: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.1621: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.1622: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4 Source.1623: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.1624: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1 Source.1625: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic Source.1626: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3 Source.1627: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1 Source.1628: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.1629: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7 Source.1630: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.1631: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.1632: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic Source.1633: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.1634: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.1635: DFBPPR3238 ---- Plant proteins ---- Hydrophobic protein LTI6A Source.1636: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.1637: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.1638: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2 Source.1639: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1 Source.1640: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.1641: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.1642: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.1643: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.1644: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.1645: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS Source.1646: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.1647: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.1648: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.1649: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.1650: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.1651: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit Source.1652: DFBPPR3261 ---- Plant proteins ---- Autophagy-related protein 8D Source.1653: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.1654: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.1655: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.1656: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.1657: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.1658: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1 Source.1659: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.1660: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase Source.1661: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.1662: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16 Source.1663: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial Source.1664: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b Source.1665: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.1666: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35 Source.1667: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400 Source.1668: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.1669: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.1670: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b Source.1671: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.1672: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4 Source.1673: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4 Source.1674: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4 Source.1675: DFBPPR3298 ---- Plant proteins ---- Hydrophobic protein LTI6B Source.1676: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.1677: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9 Source.1678: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E Source.1679: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.1680: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.1681: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3 Source.1682: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a Source.1683: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.1684: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.1685: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.1686: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.1687: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a Source.1688: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.1689: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.1690: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8 Source.1691: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.1692: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7 Source.1693: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1 Source.1694: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.1695: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.1696: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a Source.1697: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a Source.1698: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.1699: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.1700: DFBPPR3342 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.1701: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.1702: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1 Source.1703: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.1704: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.1705: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.1706: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.1707: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A Source.1708: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22 Source.1709: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.1710: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4 Source.1711: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.1712: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.1713: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.1714: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.1715: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38 Source.1716: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic Source.1717: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.1718: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.1719: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.1720: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.1721: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.1722: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.1723: DFBPPR3372 ---- Plant proteins ---- Calcineurin B-like protein 3 Source.1724: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.1725: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.1726: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.1727: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.1728: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18 Source.1729: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.1730: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.1731: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.1732: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.1733: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.1734: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.1735: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.1736: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.1737: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.1738: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.1739: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.1740: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3 Source.1741: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.1742: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.1743: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.1744: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2 Source.1745: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5 Source.1746: DFBPPR3415 ---- Plant proteins ---- Expansin-A33 Source.1747: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.1748: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.1749: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.1750: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.1751: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.1752: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.1753: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.1754: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.1755: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.1756: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.1757: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.1758: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.1759: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.1760: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1 Source.1761: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2 Source.1762: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.1763: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.1764: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.1765: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C Source.1766: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.1767: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.1768: DFBPPR3456 ---- Plant proteins ---- Maturase K Source.1769: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1770: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.1771: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.1772: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic Source.1773: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1 Source.1774: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1 Source.1775: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73 Source.1776: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.1777: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.1778: DFBPPR3471 ---- Plant proteins ---- Monothiol glutaredoxin-S6 Source.1779: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68 Source.1780: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600 Source.1781: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.1782: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3 Source.1783: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.1784: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.1785: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.1786: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8 Source.1787: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.1788: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5 Source.1789: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.1790: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3 Source.1791: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3 Source.1792: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19 Source.1793: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4 Source.1794: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.1795: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9 Source.1796: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.1797: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.1798: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4 Source.1799: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6 Source.1800: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.1801: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.1802: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9 Source.1803: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1 Source.1804: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.1805: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.1806: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.1807: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.1808: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic Source.1809: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4 Source.1810: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic Source.1811: DFBPPR3521 ---- Plant proteins ---- Photosystem II reaction center W protein, chloroplastic Source.1812: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56 Source.1813: DFBPPR3523 ---- Plant proteins ---- Ubiquitin-like protein ATG12 Source.1814: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.1815: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36 Source.1816: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2 Source.1817: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.1818: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4 Source.1819: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.1820: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.1821: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic Source.1822: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.1823: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.1824: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.1825: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.1826: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.1827: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2 Source.1828: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8 Source.1829: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.1830: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45 Source.1831: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.1832: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.1833: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.1834: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61 Source.1835: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.1836: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.1837: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.1838: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B'' Source.1839: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.1840: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58 Source.1841: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1 Source.1842: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.1843: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.1844: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.1845: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.1846: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.1847: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3 Source.1848: DFBPPR3578 ---- Plant proteins ---- Glutaredoxin-C13 Source.1849: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5 Source.1850: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.1851: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.1852: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.1853: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.1854: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3 Source.1855: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.1856: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.1857: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1 Source.1858: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11 Source.1859: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.1860: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.1861: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.1862: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic Source.1863: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7 Source.1864: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.1865: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1 Source.1866: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.1867: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.1868: DFBPPR3614 ---- Plant proteins ---- Prolamin PPROL 17D Source.1869: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b Source.1870: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A Source.1871: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.1872: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.1873: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1 Source.1874: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.1875: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.1876: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.1877: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.1878: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1 Source.1879: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.1880: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.1881: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.1882: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.1883: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.1884: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5 Source.1885: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.1886: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.1887: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2 Source.1888: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.1889: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2 Source.1890: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.1891: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3 Source.1892: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1 Source.1893: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e Source.1894: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a Source.1895: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.1896: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.1897: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2 Source.1898: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.1899: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin Source.1900: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.1901: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.1902: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.1903: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1904: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3 Source.1905: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5 Source.1906: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3 Source.1907: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J Source.1908: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6 Source.1909: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10 Source.1910: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5 Source.1911: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic Source.1912: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.1913: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41 Source.1914: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.1915: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.1916: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.1917: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2 Source.1918: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.1919: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.1920: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.1921: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.1922: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.1923: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.1924: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.1925: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67 Source.1926: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.1927: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.1928: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d Source.1929: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1 Source.1930: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.1931: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7 Source.1932: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6 Source.1933: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.1934: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.1935: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1936: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.1937: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.1938: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.1939: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15 Source.1940: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.1941: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.1942: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.1943: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1 Source.1944: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5 Source.1945: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36 Source.1946: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.1947: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.1948: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.1949: DFBPPR3725 ---- Plant proteins ---- 60S ribosomal protein L10a Source.1950: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2 Source.1951: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1 Source.1952: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.1953: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.1954: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.1955: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3 Source.1956: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28 Source.1957: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.1958: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.1959: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900 Source.1960: DFBPPR3743 ---- Plant proteins ---- Putative auxin-responsive protein IAA28 Source.1961: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.1962: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.1963: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1 Source.1964: DFBPPR3749 ---- Plant proteins ---- MADS-box transcription factor 25 Source.1965: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.1966: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7 Source.1967: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.1968: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12 Source.1969: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.1970: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8 Source.1971: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.1972: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6 Source.1973: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1 Source.1974: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8 Source.1975: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.1976: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1977: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51 Source.1978: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.1979: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9 Source.1980: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.1981: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.1982: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4 Source.1983: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38 Source.1984: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.1985: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5 Source.1986: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.1987: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.1988: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55 Source.1989: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.1990: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial Source.1991: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.1992: DFBPPR3791 ---- Plant proteins ---- Putative glutaredoxin-C12 Source.1993: DFBPPR3793 ---- Plant proteins ---- Coatomer subunit zeta-2 Source.1994: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1 Source.1995: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7 Source.1996: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.1997: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.1998: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6 Source.1999: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.2000: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic Source.2001: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.2002: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.2003: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8 Source.2004: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.2005: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.2006: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.2007: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.2008: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.2009: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.2010: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G Source.2011: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.2012: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.2013: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.2014: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog Source.2015: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d Source.2016: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12 Source.2017: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial Source.2018: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit Source.2019: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.2020: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.2021: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.2022: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7 Source.2023: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2 Source.2024: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14 Source.2025: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54 Source.2026: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2 Source.2027: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13 Source.2028: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78 Source.2029: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73 Source.2030: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8 Source.2031: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14 Source.2032: DFBPPR3854 ---- Plant proteins ---- Glutaredoxin-C10 Source.2033: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.2034: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.2035: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.2036: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46 Source.2037: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.2038: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.2039: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.2040: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1 Source.2041: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic Source.2042: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.2043: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5 Source.2044: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.2045: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.2046: DFBPPR3871 ---- Plant proteins ---- Putative glutaredoxin-C11 Source.2047: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.2048: DFBPPR3873 ---- Plant proteins ---- Putative glutaredoxin-C14 Source.2049: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.2050: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10 Source.2051: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.2052: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2 Source.2053: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.2054: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.2055: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8 Source.2056: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.2057: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.2058: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.2059: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.2060: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.2061: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3 Source.2062: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1 Source.2063: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.2064: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.2065: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11 Source.2066: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.2067: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.2068: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5 Source.2069: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.2070: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.2071: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.2072: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.2073: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2 Source.2074: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6 Source.2075: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b Source.2076: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b Source.2077: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.2078: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9 Source.2079: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.2080: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13 Source.2081: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.2082: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.2083: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.2084: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.2085: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.2086: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10 Source.2087: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3 Source.2088: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.2089: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein Source.2090: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.2091: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7 Source.2092: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.2093: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1 Source.2094: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10 Source.2095: DFBPPR3947 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.2096: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.2097: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial Source.2098: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA Source.2099: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.2100: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1 Source.2101: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.2102: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.2103: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1 Source.2104: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.2105: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.2106: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8 Source.2107: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.2108: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1 Source.2109: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial Source.2110: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.2111: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.2112: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.2113: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.2114: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.2115: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4 Source.2116: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.2117: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1 Source.2118: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.2119: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.2120: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500 Source.2121: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.2122: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.2123: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2 Source.2124: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.2125: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.2126: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.2127: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.2128: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A Source.2129: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.2130: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2 Source.2131: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.2132: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.2133: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.2134: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5 Source.2135: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.2136: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11 Source.2137: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2 Source.2138: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.2139: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.2140: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1 Source.2141: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3 Source.2142: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f Source.2143: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1 Source.2144: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.2145: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.2146: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.2147: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.2148: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27 Source.2149: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.2150: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G Source.2151: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.2152: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8 Source.2153: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1 Source.2154: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.2155: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.2156: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3 Source.2157: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2 Source.2158: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.2159: DFBPPR4045 ---- Plant proteins ---- 60S ribosomal protein L11 Source.2160: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.2161: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.2162: DFBPPR4051 ---- Plant proteins ---- 40S ribosomal protein S3a Source.2163: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.2164: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.2165: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.2166: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB Source.2167: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11 Source.2168: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.2169: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.2170: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.2171: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F Source.2172: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.2173: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.2174: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C Source.2175: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.2176: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like Source.2177: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.2178: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4 Source.2179: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.2180: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.2181: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.2182: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b Source.2183: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.2184: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.2185: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.2186: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.2187: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.2188: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.2189: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.2190: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.2191: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10 Source.2192: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D Source.2193: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.2194: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29 Source.2195: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.2196: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.2197: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B Source.2198: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic Source.2199: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.2200: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.2201: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.2202: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3 Source.2203: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4 Source.2204: DFBPPR4104 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.2205: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.2206: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.2207: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2 Source.2208: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2 Source.2209: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43 Source.2210: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.2211: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.2212: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4 Source.2213: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.2214: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.2215: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1 Source.2216: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3 Source.2217: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.2218: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2 Source.2219: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75 Source.2220: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5 Source.2221: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.2222: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.2223: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49 Source.2224: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.2225: DFBPPR4134 ---- Plant proteins ---- Glutaredoxin-C1 Source.2226: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.2227: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.2228: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7 Source.2229: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.2230: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.2231: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.2232: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.2233: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2 Source.2234: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.2235: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.2236: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.2237: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.2238: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7 Source.2239: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.2240: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.2241: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1 Source.2242: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.2243: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.2244: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.2245: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.2246: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.2247: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.2248: DFBPPR4164 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 1 Source.2249: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.2250: DFBPPR4166 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.2251: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.2252: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.2253: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.2254: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.2255: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.2256: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40 Source.2257: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.2258: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.2259: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.2260: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.2261: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.2262: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1 Source.2263: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.2264: DFBPPR4198 ---- Plant proteins ---- Glutaredoxin-C15 Source.2265: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.2266: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.2267: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1 Source.2268: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.2269: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.2270: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.2271: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.2272: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P Source.2273: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.2274: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.2275: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.2276: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.2277: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.2278: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A Source.2279: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2 Source.2280: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.2281: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4 Source.2282: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.2283: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2 Source.2284: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.2285: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.2286: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.2287: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.2288: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.2289: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.2290: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3 Source.2291: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.2292: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1 Source.2293: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.2294: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.2295: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600 Source.2296: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1 Source.2297: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1 Source.2298: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6 Source.2299: DFBPPR4255 ---- Plant proteins ---- Photosystem II reaction center protein J Source.2300: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.2301: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.2302: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2 Source.2303: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.2304: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.2305: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13 Source.2306: DFBPPR4266 ---- Plant proteins ---- Probable protein BRICK1 Source.2307: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.2308: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400 Source.2309: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3 Source.2310: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2 Source.2311: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.2312: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.2313: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP Source.2314: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21 Source.2315: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.2316: DFBPPR4282 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.2317: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.2318: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2 Source.2319: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.2320: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20 Source.2321: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.2322: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.2323: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3 Source.2324: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.2325: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.2326: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.2327: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.2328: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like Source.2329: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.2330: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.2331: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.2332: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8 Source.2333: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6 Source.2334: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1 Source.2335: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1 Source.2336: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.2337: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.2338: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.2339: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.2340: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.2341: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.2342: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.2343: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.2344: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.2345: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5 Source.2346: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.2347: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic Source.2348: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5 Source.2349: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.2350: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J Source.2351: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G Source.2352: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2 Source.2353: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.2354: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.2355: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.2356: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9 Source.2357: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3 Source.2358: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.2359: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.2360: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.2361: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic Source.2362: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.2363: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.2364: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2 Source.2365: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.2366: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12 Source.2367: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.2368: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.2369: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.2370: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.2371: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.2372: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1 Source.2373: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.2374: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog Source.2375: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.2376: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.2377: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2 Source.2378: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.2379: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2 Source.2380: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic Source.2381: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.2382: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4 Source.2383: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.2384: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2 Source.2385: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25 Source.2386: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.2387: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D Source.2388: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.2389: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.2390: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.2391: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.2392: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.2393: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.2394: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.2395: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.2396: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.2397: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.2398: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.2399: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.2400: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein Source.2401: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.2402: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.2403: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.2404: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1 Source.2405: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.2406: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.2407: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.2408: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.2409: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.2410: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.2411: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.2412: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.2413: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3 Source.2414: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3 Source.2415: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.2416: DFBPPR4454 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.2417: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13 Source.2418: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28 Source.2419: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2 Source.2420: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1 Source.2421: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.2422: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18 Source.2423: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.2424: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17 Source.2425: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4 Source.2426: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.2427: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.2428: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic Source.2429: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.2430: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.2431: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2 Source.2432: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15 Source.2433: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2 Source.2434: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16 Source.2435: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.2436: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.2437: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.2438: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.2439: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.2440: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.2441: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.2442: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30 Source.2443: DFBPPR4483 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 11 Source.2444: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.2445: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4 Source.2446: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1 Source.2447: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.2448: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.2449: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.2450: DFBPPR4496 ---- Plant proteins ---- Transcription elongation factor 1 homolog Source.2451: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.2452: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2 Source.2453: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.2454: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein Source.2455: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.2456: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.2457: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.2458: DFBPPR4511 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 9 Source.2459: DFBPPR4512 ---- Plant proteins ---- Actin-depolymerizing factor 3 Source.2460: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.2461: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6 Source.2462: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme Source.2463: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.2464: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14 Source.2465: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.2466: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.2467: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26 Source.2468: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.2469: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6 Source.2470: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1 Source.2471: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2 Source.2472: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.2473: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.2474: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.2475: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.2476: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.2477: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27 Source.2478: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.2479: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.2480: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.2481: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.2482: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.2483: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.2484: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.2485: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16 Source.2486: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.2487: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F Source.2488: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1 Source.2489: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1 Source.2490: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.2491: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1 Source.2492: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1 Source.2493: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.2494: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10 Source.2495: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.2496: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.2497: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.2498: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15 Source.2499: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2 Source.2500: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.2501: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.2502: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.2503: DFBPPR4591 ---- Plant proteins ---- Uncharacterized protein ycf76 Source.2504: DFBPPR4592 ---- Plant proteins ---- Ubiquitin-fold modifier 1 Source.2505: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21 Source.2506: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19 Source.2507: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23 Source.2508: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.2509: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.2510: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2 Source.2511: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16 Source.2512: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.2513: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.2514: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.2515: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3 Source.2516: DFBPPR4619 ---- Plant proteins ---- Actin-depolymerizing factor 9 Source.2517: DFBPPR4621 ---- Plant proteins ---- Actin-depolymerizing factor 6 Source.2518: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.2519: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5 Source.2520: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700 Source.2521: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11 Source.2522: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1 Source.2523: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.2524: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.2525: DFBPPR4642 ---- Plant proteins ---- Actin-depolymerizing factor 1 Source.2526: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.2527: DFBPPR4644 ---- Plant proteins ---- Nuclear transport factor 2 Source.2528: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.2529: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.2530: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000 Source.2531: DFBPPR4649 ---- Plant proteins ---- Succinate dehydrogenase subunit 8B, mitochondrial Source.2532: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2 Source.2533: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1 Source.2534: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.2535: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.2536: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.2537: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.2538: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1 Source.2539: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.2540: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.2541: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100 Source.2542: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.2543: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1 Source.2544: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46 Source.2545: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.2546: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17 Source.2547: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1 Source.2548: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3 Source.2549: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2 Source.2550: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.2551: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.2552: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.2553: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.2554: DFBPPR4715 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 2 Source.2555: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.2556: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.2557: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.2558: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.2559: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5 Source.2560: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.2561: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.2562: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.2563: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400 Source.2564: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.2565: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3 Source.2566: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9 Source.2567: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.2568: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.2569: DFBPPR4752 ---- Plant proteins ---- Uncharacterized protein ycf70 Source.2570: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2 Source.2571: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18 Source.2572: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7 Source.2573: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13 Source.2574: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35 Source.2575: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1 Source.2576: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A Source.2577: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.2578: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G Source.2579: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic Source.2580: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H Source.2581: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4 Source.2582: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700 Source.2583: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1 Source.2584: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100 Source.2585: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.2586: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.2587: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10 Source.2588: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900 Source.2589: DFBPPR4786 ---- Plant proteins ---- B3 domain-containing protein Os12g0592300 Source.2590: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.2591: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600 Source.2592: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300 Source.2593: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.2594: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.2595: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200 Source.2596: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100 Source.2597: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800 Source.2598: DFBPPR4810 ---- Plant proteins ---- Hydrophobic protein OSR8 Source.2599: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1 Source.2600: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20 Source.2601: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.2602: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500 Source.2603: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a Source.2604: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1 Source.2605: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.2606: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000 Source.2607: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1 Source.2608: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2 Source.2609: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3 Source.2610: DFBPPR4841 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 5 Source.2611: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400 Source.2612: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400 Source.2613: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48 Source.2614: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.2615: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800 Source.2616: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.2617: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080 Source.2618: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500 Source.2619: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.2620: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600 Source.2621: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400 Source.2622: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090 Source.2623: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.2624: DFBPPR4861 ---- Plant proteins ---- B3 domain-containing protein Os06g0112300 Source.2625: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.2626: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820 Source.2627: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1 Source.2628: DFBPPR4872 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0158600 Source.2629: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.2630: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58 Source.2631: DFBPPR4880 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 29 Source.2632: DFBPPR4883 ---- Plant proteins ---- Uncharacterized protein Os02g0798400 Source.2633: DFBPPR4884 ---- Plant proteins ---- Uncharacterized protein Os02g0798501 Source.2634: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940 Source.2635: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.2636: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.2637: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.2638: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.2639: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.2640: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein Source.2641: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12 Source.2642: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.2643: DFBPPR4896 ---- Plant proteins ---- Thioredoxin H1 Source.2644: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.2645: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.2646: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.2647: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.2648: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic Source.2649: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.2650: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1 Source.2651: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.2652: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.2653: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.2654: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.2655: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.2656: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.2657: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1 Source.2658: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID Source.2659: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.2660: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic Source.2661: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.2662: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.2663: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.2664: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.2665: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.2666: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.2667: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.2668: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.2669: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2 Source.2670: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.2671: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.2672: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic Source.2673: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.2674: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.2675: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G Source.2676: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d Source.2677: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.2678: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.2679: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.2680: DFBPPR4963 ---- Plant proteins ---- Soybean toxin 17 kDa chain Source.2681: DFBPPR4965 ---- Plant proteins ---- Glycinin G1 Source.2682: DFBPPR4966 ---- Plant proteins ---- Glycinin G5 Source.2683: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.2684: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.2685: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.2686: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.2687: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase Source.2688: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.2689: DFBPPR4973 ---- Plant proteins ---- Glycinin G2 Source.2690: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.2691: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.2692: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.2693: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.2694: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1 Source.2695: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.2696: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2697: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.2698: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.2699: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.2700: DFBPPR4992 ---- Plant proteins ---- Glycinin G3 Source.2701: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.2702: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.2703: DFBPPR4995 ---- Plant proteins ---- Glycinin G4 Source.2704: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1 Source.2705: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.2706: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.2707: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.2708: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.2709: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase Source.2710: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.2711: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.2712: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5 Source.2713: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.2714: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.2715: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.2716: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.2717: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.2718: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.2719: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin Source.2720: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.2721: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.2722: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.2723: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.2724: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.2725: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A Source.2726: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB Source.2727: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase Source.2728: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.2729: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.2730: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.2731: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.2732: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.2733: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.2734: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.2735: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D Source.2736: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.2737: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1 Source.2738: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.2739: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A Source.2740: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.2741: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2742: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.2743: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.2744: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.2745: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.2746: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2 Source.2747: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.2748: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog Source.2749: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.2750: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.2751: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.2752: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.2753: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein Source.2754: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.2755: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.2756: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3 Source.2757: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic Source.2758: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic Source.2759: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2760: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic Source.2761: DFBPPR5071 ---- Plant proteins ---- Leghemoglobin C1 Source.2762: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.2763: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.2764: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.2765: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1 Source.2766: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.2767: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.2768: DFBPPR5079 ---- Plant proteins ---- Albumin-1 Source.2769: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.2770: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.2771: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.2772: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.2773: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.2774: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.2775: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.2776: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase Source.2777: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog Source.2778: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic Source.2779: DFBPPR5100 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase 1 Source.2780: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.2781: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.2782: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.2783: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase Source.2784: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial Source.2785: DFBPPR5109 ---- Plant proteins ---- Chalcone--flavonone isomerase 1A Source.2786: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22 Source.2787: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B Source.2788: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.2789: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.2790: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein Source.2791: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.2792: DFBPPR5124 ---- Plant proteins ---- Nodulin-26 Source.2793: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7 Source.2794: DFBPPR5127 ---- Plant proteins ---- Pathogenesis-related protein 10 Source.2795: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.2796: DFBPPR5131 ---- Plant proteins ---- 17.5 kDa class I heat shock protein Source.2797: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein Source.2798: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2 Source.2799: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6 Source.2800: DFBPPR5137 ---- Plant proteins ---- Cytochrome f Source.2801: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580 Source.2802: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.2803: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2 Source.2804: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase Source.2805: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.2806: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein Source.2807: DFBPPR5144 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-A Source.2808: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.2809: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase Source.2810: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.2811: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.2812: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.2813: DFBPPR5157 ---- Plant proteins ---- 17.6 kDa class I heat shock protein Source.2814: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1 Source.2815: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.2816: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.2817: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.2818: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.2819: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein Source.2820: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2821: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.2822: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.2823: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6 Source.2824: DFBPPR5177 ---- Plant proteins ---- Anamorsin homolog Source.2825: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1 Source.2826: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1 Source.2827: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.2828: DFBPPR5185 ---- Plant proteins ---- Actin-1 Source.2829: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.2830: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.2831: DFBPPR5191 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.2832: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.2833: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.2834: DFBPPR5197 ---- Plant proteins ---- Nodulin-21 Source.2835: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.2836: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.2837: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2 Source.2838: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.2839: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.2840: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.2841: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9 Source.2842: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.2843: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.2844: DFBPPR5219 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.2845: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.2846: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein Source.2847: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.2848: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.2849: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.2850: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.2851: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.2852: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.2853: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein Source.2854: DFBPPR5235 ---- Plant proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.2855: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.2856: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B Source.2857: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.2858: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.2859: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1 Source.2860: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2 Source.2861: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1 Source.2862: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2 Source.2863: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.2864: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.2865: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein Source.2866: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.2867: DFBPPR5249 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.2868: DFBPPR5253 ---- Plant proteins ---- CASP-like protein 7 Source.2869: DFBPPR5254 ---- Plant proteins ---- Chalcone--flavonone isomerase 3 Source.2870: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B Source.2871: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.2872: DFBPPR5258 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.2873: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.2874: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.2875: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.2876: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.2877: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.2878: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.2879: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9 Source.2880: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic Source.2881: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.2882: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6 Source.2883: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.2884: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.2885: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2 Source.2886: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1 Source.2887: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.2888: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.2889: DFBPPR5301 ---- Plant proteins ---- DNA-binding protein DRP90 Source.2890: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.2891: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.2892: DFBPPR5305 ---- Plant proteins ---- Defensin-like protein Source.2893: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.2894: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1 Source.2895: DFBPPR5309 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.2896: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1 Source.2897: DFBPPR5317 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.2898: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.2899: DFBPPR5320 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.2900: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.2901: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6 Source.2902: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3 Source.2903: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1 Source.2904: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51 Source.2905: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.2906: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2 Source.2907: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1 Source.2908: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.2909: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.2910: DFBPPR5341 ---- Plant proteins ---- HMG1/2-like protein Source.2911: DFBPPR5342 ---- Plant proteins ---- Nodulin-44 Source.2912: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1 Source.2913: DFBPPR5346 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.2914: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein Source.2915: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11 Source.2916: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.2917: DFBPPR5354 ---- Plant proteins ---- Protein P21 Source.2918: DFBPPR5356 ---- Plant proteins ---- Nodulin-23 Source.2919: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D Source.2920: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A Source.2921: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B Source.2922: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C Source.2923: DFBPPR5365 ---- Plant proteins ---- Auxin-induced protein 6B Source.2924: DFBPPR5366 ---- Plant proteins ---- Auxin-induced protein 15A Source.2925: DFBPPR5367 ---- Plant proteins ---- Auxin-induced protein X15 Source.2926: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.2927: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.2928: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.2929: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.2930: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.2931: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.2932: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.2933: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.2934: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.2935: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.2936: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.2937: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4 Source.2938: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.2939: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.2940: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2 Source.2941: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.2942: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.2943: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.2944: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.2945: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.2946: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.2947: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.2948: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.2949: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.2950: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.2951: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.2952: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.2953: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.2954: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1 Source.2955: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.2956: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.2957: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.2958: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.2959: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.2960: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic Source.2961: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.2962: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1 Source.2963: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit Source.2964: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A Source.2965: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.2966: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.2967: DFBPPR5432 ---- Plant proteins ---- Expansin-B1 Source.2968: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.2969: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.2970: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.2971: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2 Source.2972: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1 Source.2973: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog Source.2974: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.2975: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.2976: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.2977: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.2978: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.2979: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1 Source.2980: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha Source.2981: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.2982: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.2983: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.2984: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.2985: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.2986: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2 Source.2987: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.2988: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.2989: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.2990: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.2991: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.2992: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.2993: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.2994: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.2995: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.2996: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.2997: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.2998: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.2999: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.3000: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein Source.3001: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.3002: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.3003: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.3004: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.3005: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3 Source.3006: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.3007: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic Source.3008: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.3009: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.3010: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.3011: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.3012: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.3013: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic Source.3014: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.3015: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.3016: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.3017: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain Source.3018: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.3019: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.3020: DFBPPR5508 ---- Plant proteins ---- Expansin-B9 Source.3021: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3022: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.3023: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42 Source.3024: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain Source.3025: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.3026: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase Source.3027: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.3028: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.3029: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.3030: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II Source.3031: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1 Source.3032: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3033: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase Source.3034: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.3035: DFBPPR5534 ---- Plant proteins ---- Ubiquitin-40S ribosomal protein S27a Source.3036: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1 Source.3037: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3038: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.3039: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain Source.3040: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain Source.3041: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.3042: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.3043: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.3044: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.3045: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1 Source.3046: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase Source.3047: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.3048: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10 Source.3049: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.3050: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.3051: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7 Source.3052: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.3053: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3054: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.3055: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.3056: DFBPPR5571 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 1 Source.3057: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.3058: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.3059: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.3060: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.3061: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.3062: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3 Source.3063: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.3064: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.3065: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3066: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.3067: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10 Source.3068: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain Source.3069: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1 Source.3070: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1 Source.3071: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.3072: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain Source.3073: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3074: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.3075: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.3076: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6 Source.3077: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.3078: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.3079: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic Source.3080: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.3081: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain Source.3082: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.3083: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I Source.3084: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.3085: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.3086: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1 Source.3087: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3088: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.3089: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.3090: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.3091: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.3092: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic Source.3093: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.3094: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.3095: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6 Source.3096: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.3097: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.3098: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.3099: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.3100: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.3101: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.3102: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.3103: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.3104: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.3105: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.3106: DFBPPR5648 ---- Plant proteins ---- AP-2 complex subunit sigma Source.3107: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.3108: DFBPPR5651 ---- Plant proteins ---- Cytochrome c Source.3109: DFBPPR5652 ---- Plant proteins ---- Expansin-B10 Source.3110: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.3111: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5 Source.3112: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.3113: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.3114: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.3115: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.3116: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3117: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.3118: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.3119: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3120: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.3121: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.3122: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.3123: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4 Source.3124: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.3125: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.3126: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.3127: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3128: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.3129: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.3130: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5 Source.3131: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1 Source.3132: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.3133: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.3134: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase Source.3135: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.3136: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.3137: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.3138: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.3139: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.3140: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.3141: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1 Source.3142: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.3143: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3144: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.3145: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.3146: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase Source.3147: DFBPPR5728 ---- Plant proteins ---- Calreticulin Source.3148: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3 Source.3149: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4 Source.3150: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.3151: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1 Source.3152: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3153: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.3154: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.3155: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.3156: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.3157: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic Source.3158: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B Source.3159: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.3160: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.3161: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.3162: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1 Source.3163: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A Source.3164: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3165: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1 Source.3166: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.3167: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.3168: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.3169: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.3170: DFBPPR5779 ---- Plant proteins ---- Protein BRICK1 Source.3171: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.3172: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.3173: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.3174: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.3175: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.3176: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.3177: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.3178: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.3179: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.3180: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.3181: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.3182: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.3183: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic Source.3184: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.3185: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a Source.3186: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.3187: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.3188: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3189: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.3190: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3191: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.3192: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic Source.3193: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1 Source.3194: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.3195: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.3196: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.3197: DFBPPR5828 ---- Plant proteins ---- Cytochrome f Source.3198: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.3199: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.3200: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.3201: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.3202: DFBPPR5837 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.3203: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19 Source.3204: DFBPPR5841 ---- Plant proteins ---- Actin-1 Source.3205: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.3206: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3 Source.3207: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12 Source.3208: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.3209: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic Source.3210: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.3211: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.3212: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.3213: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.3214: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6 Source.3215: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3216: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.3217: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3218: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.3219: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.3220: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5 Source.3221: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.3222: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3223: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.3224: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor Source.3225: DFBPPR5877 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.3226: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.3227: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.3228: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.3229: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3230: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.3231: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1 Source.3232: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL Source.3233: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.3234: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.3235: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B Source.3236: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2 Source.3237: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3238: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.3239: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A Source.3240: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.3241: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.3242: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.3243: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.3244: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3 Source.3245: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.3246: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4 Source.3247: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1 Source.3248: DFBPPR5921 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.3249: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.3250: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.3251: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.3252: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin Source.3253: DFBPPR5933 ---- Plant proteins ---- Pathogenesis-related protein PRMS Source.3254: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1 Source.3255: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.3256: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.3257: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.3258: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.3259: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.3260: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3 Source.3261: DFBPPR5945 ---- Plant proteins ---- Calmodulin Source.3262: DFBPPR5946 ---- Plant proteins ---- Maturase K Source.3263: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2 Source.3264: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1 Source.3265: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.3266: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B Source.3267: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.3268: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.3269: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.3270: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.3271: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.3272: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.3273: DFBPPR5974 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.3274: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.3275: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.3276: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.3277: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.3278: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.3279: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1 Source.3280: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.3281: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7 Source.3282: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3 Source.3283: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.3284: DFBPPR5987 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.3285: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor Source.3286: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2 Source.3287: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.3288: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.3289: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2 Source.3290: DFBPPR5997 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.3291: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2 Source.3292: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2 Source.3293: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1 Source.3294: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2 Source.3295: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1 Source.3296: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1 Source.3297: DFBPPR6012 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 2 Source.3298: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.3299: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.3300: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.3301: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase Source.3302: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.3303: DFBPPR6021 ---- Plant proteins ---- Actin-depolymerizing factor 2 Source.3304: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.3305: DFBPPR6025 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3306: DFBPPR6026 ---- Plant proteins ---- Actin-depolymerizing factor 1 Source.3307: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.3308: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2 Source.3309: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.3310: DFBPPR6031 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic Source.3311: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2 Source.3312: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1 Source.3313: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4 Source.3314: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.3315: DFBPPR6046 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.3316: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1 Source.3317: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1 Source.3318: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1 Source.3319: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2 Source.3320: DFBPPR6056 ---- Plant proteins ---- Bowman-Birk type wound-induced proteinase inhibitor WIP1 Source.3321: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.3322: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.3323: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1 Source.3324: DFBPPR6065 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3325: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.3326: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.3327: DFBPPR6073 ---- Plant proteins ---- Protein IAL1 Source.3328: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.3329: DFBPPR6078 ---- Plant proteins ---- Putative 18 kDa spermidine-binding protein Source.3330: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1 Source.3331: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5 Source.3332: DFBPPR6087 ---- Plant proteins ---- 40S ribosomal protein S14 Source.3333: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6 Source.3334: DFBPPR6090 ---- Plant proteins ---- 40S ribosomal protein S14 Source.3335: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11 Source.3336: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2 Source.3337: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3 Source.3338: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1 Source.3339: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1 Source.3340: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4 Source.3341: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1 Source.3342: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4 Source.3343: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8 Source.3344: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3345: DFBPPR6117 ---- Plant proteins ---- Putative uncharacterized protein ycf15 Source.3346: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.3347: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11 Source.3348: DFBPPR6122 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 4 Source.3349: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A Source.3350: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.3351: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6 Source.3352: DFBPPR6146 ---- Plant proteins ---- Uncharacterized protein ycf76 Source.3353: DFBPPR6148 ---- Plant proteins ---- Uncharacterized protein ycf70 Source.3354: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.3355: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1 Source.3356: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.3357: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2 Source.3358: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4 Source.3359: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.3360: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3 Source.3361: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid Source.3362: DFBPPR6182 ---- Plant proteins ---- Unknown protein from spot 360 of 2D-PAGE of etiolated coleoptile Source.3363: DFBPPR6185 ---- Plant proteins ---- Unknown protein from spot 415 of 2D-PAGE of etiolated coleoptile Source.3364: DFBPPR6190 ---- Plant proteins ---- Unknown protein from spot 32 of 2D-PAGE of etiolated coleoptile Source.3365: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.3366: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase Source.3367: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.3368: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.3369: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.3370: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1 Source.3371: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic Source.3372: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.3373: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.3374: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.3375: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic Source.3376: DFBPPR6231 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.3377: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein Source.3378: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3379: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.3380: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.3381: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.3382: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.3383: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein Source.3384: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.3385: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.3386: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.3387: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.3388: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.3389: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.3390: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.3391: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.3392: DFBPPR6254 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.3393: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.3394: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.3395: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.3396: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.3397: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.3398: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.3399: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.3400: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.3401: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.3402: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.3403: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1 Source.3404: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1 Source.3405: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3406: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1 Source.3407: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic Source.3408: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic Source.3409: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3410: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor Source.3411: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.3412: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3413: DFBPPR6285 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.3414: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein Source.3415: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.3416: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta Source.3417: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.3418: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.3419: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.3420: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic Source.3421: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3422: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial Source.3423: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.3424: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3 Source.3425: DFBPPR6301 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.3426: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.3427: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3428: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3429: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase Source.3430: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.3431: DFBPPR6310 ---- Plant proteins ---- Catalase Source.3432: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.3433: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.3434: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.3435: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.3436: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic Source.3437: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2 Source.3438: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.3439: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.3440: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.3441: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.3442: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH Source.3443: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2 Source.3444: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F Source.3445: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.3446: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.3447: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.3448: DFBPPR6331 ---- Plant proteins ---- Rac-like GTP-binding protein RHO1 Source.3449: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.3450: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing] Source.3451: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.3452: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3453: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5 Source.3454: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.3455: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.3456: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.3457: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.3458: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.3459: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase Source.3460: DFBPPR6352 ---- Plant proteins ---- Protein TIC 22, chloroplastic Source.3461: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.3462: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.3463: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.3464: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic Source.3465: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.3466: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial Source.3467: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1 Source.3468: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3469: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.3470: DFBPPR6368 ---- Plant proteins ---- Provicilin Source.3471: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.3472: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.3473: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.3474: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.3475: DFBPPR6375 ---- Plant proteins ---- Chlorophyll a-b binding protein 3c, chloroplastic Source.3476: DFBPPR6377 ---- Plant proteins ---- Lectin Source.3477: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D Source.3478: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C Source.3479: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.3480: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3481: DFBPPR6384 ---- Plant proteins ---- Photosystem II reaction center protein H Source.3482: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.3483: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic Source.3484: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.3485: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.3486: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6 Source.3487: DFBPPR6392 ---- Plant proteins ---- Cytochrome f Source.3488: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic Source.3489: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.3490: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3 Source.3491: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3492: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A Source.3493: DFBPPR6401 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3494: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.3495: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.3496: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase Source.3497: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase Source.3498: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.3499: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3500: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.3501: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.3502: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.3503: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.3504: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme Source.3505: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.3506: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B Source.3507: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.3508: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3509: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.3510: DFBPPR6425 ---- Plant proteins ---- Legumin A2 Source.3511: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.3512: DFBPPR6427 ---- Plant proteins ---- MADS-box transcription factor 1 Source.3513: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.3514: DFBPPR6430 ---- Plant proteins ---- Legumin J Source.3515: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.3516: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B Source.3517: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A Source.3518: DFBPPR6440 ---- Plant proteins ---- Cell division control protein 2 homolog 2 Source.3519: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72 Source.3520: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206 Source.3521: DFBPPR6444 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.3522: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic Source.3523: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.3524: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.3525: DFBPPR6455 ---- Plant proteins ---- Legumin K Source.3526: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase Source.3527: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase Source.3528: DFBPPR6459 ---- Plant proteins ---- Legumin B Source.3529: DFBPPR6461 ---- Plant proteins ---- Leghemoglobin Lb5-10 Source.3530: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.3531: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.3532: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.3533: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.3534: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1 Source.3535: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.3536: DFBPPR6470 ---- Plant proteins ---- Vicilin Source.3537: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.3538: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein Source.3539: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.3540: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a Source.3541: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.3542: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic Source.3543: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic Source.3544: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2 Source.3545: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1 Source.3546: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.3547: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.3548: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E Source.3549: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein Source.3550: DFBPPR6495 ---- Plant proteins ---- Leghemoglobin Lb120-34 Source.3551: DFBPPR6496 ---- Plant proteins ---- Leghemoglobin Lb120-1 Source.3552: DFBPPR6497 ---- Plant proteins ---- Leghemoglobin Lb120-8 Source.3553: DFBPPR6498 ---- Plant proteins ---- Leghemoglobin Lb120-29 Source.3554: DFBPPR6499 ---- Plant proteins ---- Provicilin Source.3555: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A Source.3556: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.3557: DFBPPR6512 ---- Plant proteins ---- Photosystem I reaction center subunit V Source.3558: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic Source.3559: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.3560: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3561: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.3562: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.3563: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3564: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.3565: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.3566: DFBPPR6526 ---- Plant proteins ---- Albumin-2 Source.3567: DFBPPR6527 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3568: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3569: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin Source.3570: DFBPPR6542 ---- Plant proteins ---- Maturase K Source.3571: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49 Source.3572: DFBPPR6550 ---- Plant proteins ---- Actin-3 Source.3573: DFBPPR6551 ---- Plant proteins ---- Actin-2 Source.3574: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.3575: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3576: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3577: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.3578: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.3579: DFBPPR6561 ---- Plant proteins ---- Blue copper protein Source.3580: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.3581: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.3582: DFBPPR6572 ---- Plant proteins ---- Photosystem I reaction center subunit N Source.3583: DFBPPR6573 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial Source.3584: DFBPPR6578 ---- Plant proteins ---- 17.1 kDa class II heat shock protein Source.3585: DFBPPR6579 ---- Plant proteins ---- 17.1 kDa class II heat shock protein Source.3586: DFBPPR6580 ---- Plant proteins ---- 17.1 kDa class II heat shock protein Source.3587: DFBPPR6581 ---- Plant proteins ---- Nodulin-3 Source.3588: DFBPPR6608 ---- Plant proteins ---- Unknown protein from spot 19 of 2D-PAGE of thylakoid Source.3589: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein Source.3590: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176 Source.3591: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3592: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28 Source.3593: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3594: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic Source.3595: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic Source.3596: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.3597: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.3598: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.3599: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.3600: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.3601: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1 Source.3602: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3603: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.3604: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.3605: DFBPPR6640 ---- Plant proteins ---- Puroindoline-B Source.3606: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D Source.3607: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.3608: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.3609: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.3610: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.3611: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8 Source.3612: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase Source.3613: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1 Source.3614: DFBPPR6656 ---- Plant proteins ---- Catalase Source.3615: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2 Source.3616: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.3617: DFBPPR6661 ---- Plant proteins ---- Agglutinin isolectin 3 Source.3618: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.3619: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic Source.3620: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1 Source.3621: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.3622: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.3623: DFBPPR6667 ---- Plant proteins ---- Cytochrome c Source.3624: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.3625: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.3626: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.3627: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.3628: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.3629: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8 Source.3630: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3631: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B Source.3632: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.3633: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A Source.3634: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3 Source.3635: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.3636: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.3637: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3638: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.3639: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1 Source.3640: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.3641: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3642: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase Source.3643: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain Source.3644: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2 Source.3645: DFBPPR6705 ---- Plant proteins ---- Calmodulin Source.3646: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.3647: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein Source.3648: DFBPPR6713 ---- Plant proteins ---- Histone H2B.6 Source.3649: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase Source.3650: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.3651: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa Source.3652: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3653: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase Source.3654: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.3655: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3656: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.3657: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase Source.3658: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.3659: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.3660: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.3661: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.3662: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.3663: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.3664: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.3665: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.3666: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1 Source.3667: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase Source.3668: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.3669: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase Source.3670: DFBPPR6761 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM1 Source.3671: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.3672: DFBPPR6766 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.3673: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.3674: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3675: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.3676: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.3677: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6 Source.3678: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.3679: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.3680: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3681: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.3682: DFBPPR6783 ---- Plant proteins ---- Thioredoxin H-type Source.3683: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.3684: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3685: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.3686: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7 Source.3687: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI Source.3688: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta Source.3689: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.3690: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.3691: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.3692: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.3693: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38) Source.3694: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic Source.3695: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic Source.3696: DFBPPR6805 ---- Plant proteins ---- Cytochrome f Source.3697: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3698: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3699: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.3700: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3701: DFBPPR6817 ---- Plant proteins ---- Phosphomannomutase Source.3702: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A Source.3703: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.3704: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3705: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.3706: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.3707: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.3708: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3709: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2 Source.3710: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2 Source.3711: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3712: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.3713: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3714: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3715: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.3716: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.3717: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.3718: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.3719: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta Source.3720: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3721: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1 Source.3722: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3723: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.3724: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.3725: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1 Source.3726: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A Source.3727: DFBPPR6864 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.3728: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3729: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.3730: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3731: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3732: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.3733: DFBPPR6879 ---- Plant proteins ---- Type-5 thionin Source.3734: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.3735: DFBPPR6882 ---- Plant proteins ---- Maturase K Source.3736: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor Source.3737: DFBPPR6887 ---- Plant proteins ---- Glutenin, low molecular weight subunit Source.3738: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3739: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.3740: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1 Source.3741: DFBPPR6893 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.3742: DFBPPR6895 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor Source.3743: DFBPPR6897 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.3744: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.3745: DFBPPR6903 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.3746: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.3747: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.3748: DFBPPR6918 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3749: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.3750: DFBPPR6933 ---- Plant proteins ---- Photosystem II reaction center protein J Source.3751: DFBPPR6946 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.3752: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5 Source.3753: DFBPPR6949 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.3754: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.3755: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3756: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.3757: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2 Source.3758: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6 Source.3759: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7 Source.3760: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I Source.3761: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3762: DFBPPR6975 ---- Plant proteins ---- Gamma-gliadin Source.3763: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3764: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2 Source.3765: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4 Source.3766: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11 Source.3767: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.3768: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10 Source.3769: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9 Source.3770: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8 Source.3771: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3 Source.3772: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2 Source.3773: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3 Source.3774: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein Source.3775: DFBPPR6997 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor I-2B Source.3776: DFBPPR7003 ---- Plant proteins ---- Protein RAFTIN 1C Source.3777: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.3778: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3779: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.3780: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1 Source.3781: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.3782: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.3783: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.3784: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic Source.3785: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.3786: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.3787: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.3788: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1 Source.3789: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.3790: DFBPPR7032 ---- Plant proteins ---- Hordoindoline-B2 Source.3791: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.3792: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.3793: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2 Source.3794: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.3795: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3796: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.3797: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.3798: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.3799: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.3800: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII Source.3801: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.3802: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd Source.3803: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.3804: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase Source.3805: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.3806: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.3807: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa Source.3808: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein Source.3809: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.3810: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.3811: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain Source.3812: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.3813: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain Source.3814: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3815: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.3816: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI Source.3817: DFBPPR7068 ---- Plant proteins ---- Peroxidase 2 Source.3818: DFBPPR7069 ---- Plant proteins ---- Hordoindoline-B1 Source.3819: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase Source.3820: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4 Source.3821: DFBPPR7077 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor Source.3822: DFBPPR7078 ---- Plant proteins ---- Alpha-amylase inhibitor BDAI-1 Source.3823: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.3824: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3825: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.3826: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.3827: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.3828: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.3829: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.3830: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2 Source.3831: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.3832: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.3833: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.3834: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4 Source.3835: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3836: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2 Source.3837: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.3838: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3839: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.3840: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.3841: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3842: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6 Source.3843: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII Source.3844: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.3845: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.3846: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.3847: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.3848: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.3849: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.3850: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.3851: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3852: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.3853: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.3854: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1 Source.3855: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2 Source.3856: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.3857: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.3858: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A Source.3859: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3 Source.3860: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.3861: DFBPPR7137 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.3862: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.3863: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.3864: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B Source.3865: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A Source.3866: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B Source.3867: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.3868: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.3869: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.3870: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.3871: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.3872: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.3873: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3 Source.3874: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9 Source.3875: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.3876: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin Source.3877: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.3878: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8 Source.3879: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase Source.3880: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.3881: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic Source.3882: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2 Source.3883: DFBPPR7168 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.3884: DFBPPR7170 ---- Plant proteins ---- Maturase K Source.3885: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.3886: DFBPPR7172 ---- Plant proteins ---- Barwin Source.3887: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic Source.3888: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.3889: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3890: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.3891: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1 Source.3892: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3893: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin Source.3894: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3895: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3896: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3897: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc Source.3898: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha Source.3899: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3900: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.3901: DFBPPR7194 ---- Plant proteins ---- Cytochrome f Source.3902: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.3903: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.3904: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1 Source.3905: DFBPPR7198 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.3906: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3 Source.3907: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.3908: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.3909: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3910: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic Source.3911: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.3912: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.3913: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.3914: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.3915: DFBPPR7215 ---- Plant proteins ---- Aldose reductase Source.3916: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3917: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.3918: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.3919: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.3920: DFBPPR7228 ---- Plant proteins ---- Calmodulin Source.3921: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.3922: DFBPPR7234 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.3923: DFBPPR7235 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD2 Source.3924: DFBPPR7236 ---- Plant proteins ---- Photosystem II reaction center protein J Source.3925: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1 Source.3926: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2 Source.3927: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2 Source.3928: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.3929: DFBPPR7245 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.3930: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1 Source.3931: DFBPPR7251 ---- Plant proteins ---- Leaf-specific thionin DB4 Source.3932: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.3933: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.3934: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic Source.3935: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic Source.3936: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6 Source.3937: DFBPPR7269 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.3938: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3939: DFBPPR7271 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3940: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A Source.3941: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C Source.3942: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic Source.3943: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.3944: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.3945: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1 Source.3946: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.3947: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.3948: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C Source.3949: DFBPPR7297 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.3950: DFBPPR7299 ---- Plant proteins ---- Low temperature-induced protein lt101.1 Source.3951: DFBPPR7300 ---- Plant proteins ---- 40S ribosomal protein S27 Source.3952: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3 Source.3953: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4 Source.3954: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.3955: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6 Source.3956: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7 Source.3957: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.3958: DFBPPR7312 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.3959: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.3960: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3961: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.3962: DFBPPR7318 ---- Plant proteins ---- B3-hordein Source.3963: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3964: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.3965: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3966: DFBPPR7337 ---- Plant proteins ---- Low temperature-induced protein lt101.2 Source.3967: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24 Source.3968: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C Source.3969: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B Source.3970: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7 Source.3971: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A Source.3972: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B Source.3973: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2 Source.3974: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein Source.3975: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein Source.3976: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.3977: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.3978: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.3979: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.3980: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.3981: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.3982: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor Source.3983: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.3984: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20 Source.3985: DFBPPR7406 ---- Plant proteins ---- Cytochrome c Source.3986: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1 Source.3987: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.3988: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.3989: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.3990: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.3991: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.3992: DFBPPR7415 ---- Plant proteins ---- Co-chaperone protein p23-1 Source.3993: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4 Source.3994: DFBPPR7417 ---- Plant proteins ---- Cruciferin Source.3995: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6 Source.3996: DFBPPR7419 ---- Plant proteins ---- Cytochrome b Source.3997: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase Source.3998: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a Source.3999: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.4000: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.4001: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.4002: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.4003: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.4004: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.4005: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.4006: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.4007: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.4008: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2 Source.4009: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1 Source.4010: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.4011: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase Source.4012: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.4013: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.4014: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase Source.4015: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.4016: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta Source.4017: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.4018: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1 Source.4019: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.4020: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.4021: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.4022: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2 Source.4023: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1 Source.4024: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.4025: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.4026: DFBPPR7480 ---- Plant proteins ---- Defensin-like protein 1 Source.4027: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III Source.4028: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V Source.4029: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II Source.4030: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.4031: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.4032: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.4033: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.4034: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.4035: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.4036: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.4037: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.4038: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1 Source.4039: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.4040: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2 Source.4041: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.4042: DFBPPR7513 ---- Plant proteins ---- Thioredoxin H-type 2 Source.4043: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS Source.4044: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.4045: DFBPPR7516 ---- Plant proteins ---- Defensin-like protein 3 Source.4046: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15 Source.4047: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.4048: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A Source.4049: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.4050: DFBPPR7529 ---- Plant proteins ---- Profilin Source.4051: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C Source.4052: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.4053: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.4054: DFBPPR7537 ---- Plant proteins ---- Actin-depolymerizing factor Source.4055: DFBPPR7540 ---- Plant proteins ---- Ribosomal protein S14, mitochondrial Source.4056: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1 Source.4057: DFBPPR7594 ---- Milk proteins ---- Lactadherin Source.4058: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.4059: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin Source.4060: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.4061: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.4062: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.4063: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.4064: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2 Source.4065: DFBPPR7606 ---- Milk proteins ---- Osteopontin Source.4066: DFBPPR7609 ---- Milk proteins ---- Lysozyme C Source.4067: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2 Source.4068: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.4069: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.4070: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.4071: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase Source.4072: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.4073: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b Source.4074: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.4075: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.4076: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4 Source.4077: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.4078: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein Source.4079: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain Source.4080: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.4081: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain Source.4082: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.4083: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.4084: DFBPPR7634 ---- Milk proteins ---- CD59 glycoprotein Source.4085: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.4086: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.4087: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator Source.4088: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.4089: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.4090: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor Source.4091: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6 Source.4092: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.4093: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.4094: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.4095: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.4096: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.4097: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.4098: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4 Source.4099: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4100: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A Source.4101: DFBPPR7657 ---- Milk proteins ---- Chymosin Source.4102: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin Source.4103: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.4104: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein Source.4105: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein Source.4106: DFBPPR7667 ---- Milk proteins ---- Lysozyme C, milk isozyme Source.4107: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.4108: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1 Source.4109: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2 Source.4110: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin Source.4111: DFBPPR7676 ---- Milk proteins ---- Kappa-casein Source.4112: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A Source.4113: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein Source.4114: DFBPPR7681 ---- Milk proteins ---- Beta-casein Source.4115: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.4116: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin Source.4117: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin Source.4118: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.4119: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.4120: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein Source.4121: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4122: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.4123: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein Source.4124: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin Source.4125: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.4126: DFBPPR7699 ---- Milk proteins ---- Chymosin Source.4127: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein Source.4128: DFBPPR7706 ---- Milk proteins ---- Beta-casein Source.4129: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein Source.4130: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin Source.4131: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.4132: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.4133: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.4134: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein Source.4135: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.4136: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.4137: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.4138: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.4139: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4140: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.4141: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.4142: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain Source.4143: DFBPPR7732 ---- Plant proteins ---- Plasma membrane ATPase Source.4144: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2 Source.4145: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1 Source.4146: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.4147: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.4148: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.4149: DFBPPR7739 ---- Plant proteins ---- Avenin-E Source.4150: DFBPPR7744 ---- Plant proteins ---- Maturase K Source.4151: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4 Source.4152: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2 Source.4153: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1 Source.4154: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3 Source.4155: DFBPPR7749 ---- Plant proteins ---- Avenin Source.4156: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.4157: DFBPPR8187 ---- Plant proteins ---- Cytochrome c Source.4158: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.4159: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.4160: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.4161: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase Source.4162: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33 Source.4163: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.4164: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.4165: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.4166: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2 Source.4167: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.4168: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.4169: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.4170: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.4171: DFBPPR8358 ---- Plant proteins ---- Cytochrome c Source.4172: DFBPPR8359 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.4173: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1 Source.4174: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.4175: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3 Source.4176: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.4177: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.4178: DFBPPR8368 ---- Plant proteins ---- 13S globulin basic chain Source.4179: DFBPPR8370 ---- Plant proteins ---- Maturase K Source.4180: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.4181: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.4182: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4183: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase Source.4184: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase Source.4185: DFBPPR8377 ---- Plant proteins ---- Profilin Source.4186: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2 Source.4187: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2 Source.4188: DFBPPR8388 ---- Plant proteins ---- Oleosin Ara h 14.0101 Source.4189: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102 Source.4190: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin Source.4191: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.4192: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.4193: DFBPPR8395 ---- Plant proteins ---- Oleosin Ara h 14.0103 Source.4194: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.4195: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.4196: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B Source.4197: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17 Source.4198: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3 Source.4199: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic Source.4200: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein Source.4201: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.4202: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.4203: DFBPPR8423 ---- Plant proteins ---- Cytochrome c Source.4204: DFBPPR8424 ---- Plant proteins ---- Oleosin H1 Source.4205: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4206: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.4207: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.4208: DFBPPR8434 ---- Plant proteins ---- Lectin Source.4209: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.4210: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.4211: DFBPPR8445 ---- Plant proteins ---- Maturase K Source.4212: DFBPPR8448 ---- Plant proteins ---- Maturase K Source.4213: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.4214: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.4215: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein Source.4216: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.4217: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.4218: DFBPPR8458 ---- Plant proteins ---- Catalase Source.4219: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.4220: DFBPPR8465 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.4221: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.4222: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.4223: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.4224: DFBPPR8475 ---- Plant proteins ---- Photosystem II reaction center protein J Source.4225: DFBPPR8481 ---- Plant proteins ---- Granule-bound starch synthase 1 Source.4226: DFBPPR8482 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.4227: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein Source.4228: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.4229: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein Source.4230: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin Source.4231: DFBPPR8491 ---- Milk proteins ---- Osteopontin Source.4232: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.4233: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein Source.4234: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1 Source.4235: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.4236: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.4237: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.4238: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.4239: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.4240: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.4241: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.4242: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase Source.4243: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.4244: DFBPPR8505 ---- Milk proteins ---- Chymosin Source.4245: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4246: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.4247: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.4248: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.4249: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor Source.4250: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.4251: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.4252: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.4253: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase Source.4254: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3 Source.4255: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein Source.4256: DFBPPR8523 ---- Milk proteins ---- Perilipin-2 Source.4257: DFBPPR15935 ---- Animal proteins ---- Catalase Source.4258: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.4259: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.4260: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.4261: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.4262: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.4263: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.4264: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.4265: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.4266: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.4267: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.4268: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.4269: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.4270: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase Source.4271: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.4272: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.4273: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.4274: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1 Source.4275: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.4276: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4277: DFBPPR15967 ---- Animal proteins ---- Interleukin-4 Source.4278: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.4279: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.4280: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.4281: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.4282: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.4283: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta Source.4284: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.4285: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor Source.4286: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.4287: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.4288: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.4289: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.4290: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.4291: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.4292: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase Source.4293: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.4294: DFBPPR16001 ---- Animal proteins ---- Battenin Source.4295: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.4296: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.4297: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein Source.4298: DFBPPR16007 ---- Animal proteins ---- Myocilin Source.4299: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14 Source.4300: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.4301: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.4302: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.4303: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.4304: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.4305: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.4306: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.4307: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.4308: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36 Source.4309: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.4310: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA Source.4311: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.4312: DFBPPR16028 ---- Animal proteins ---- Presenilin-1 Source.4313: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.4314: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.4315: DFBPPR16032 ---- Animal proteins ---- Ras-related protein Rab-7a Source.4316: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.4317: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.4318: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.4319: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.4320: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.4321: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.4322: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.4323: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.4324: DFBPPR16046 ---- Animal proteins ---- C-C motif chemokine 3 Source.4325: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.4326: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.4327: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2 Source.4328: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.4329: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog Source.4330: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3 Source.4331: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4332: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.4333: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.4334: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase Source.4335: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.4336: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor Source.4337: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.4338: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.4339: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX Source.4340: DFBPPR16067 ---- Animal proteins ---- CD40 ligand Source.4341: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1 Source.4342: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4 Source.4343: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.4344: DFBPPR16071 ---- Animal proteins ---- CD44 antigen Source.4345: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.4346: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1 Source.4347: DFBPPR16083 ---- Animal proteins ---- Annexin A13 Source.4348: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.4349: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2 Source.4350: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.4351: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.4352: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.4353: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.4354: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.4355: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.4356: DFBPPR16093 ---- Animal proteins ---- Menin Source.4357: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.4358: DFBPPR16096 ---- Animal proteins ---- Protein CLN8 Source.4359: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.4360: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.4361: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.4362: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.4363: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.4364: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.4365: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.4366: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.4367: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.4368: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1 Source.4369: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.4370: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C Source.4371: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.4372: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor Source.4373: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.4374: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.4375: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.4376: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C Source.4377: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.4378: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein Source.4379: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.4380: DFBPPR16139 ---- Animal proteins ---- Lipocalin Can f 6.0101 Source.4381: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.4382: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.4383: DFBPPR16143 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase Source.4384: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.4385: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.4386: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.4387: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.4388: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8 Source.4389: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta Source.4390: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.4391: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2 Source.4392: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.4393: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.4394: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.4395: DFBPPR16168 ---- Animal proteins ---- Annexin A2 Source.4396: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.4397: DFBPPR16170 ---- Animal proteins ---- Inversin Source.4398: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.4399: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.4400: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.4401: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase Source.4402: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.4403: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A Source.4404: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.4405: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.4406: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.4407: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.4408: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.4409: DFBPPR16189 ---- Animal proteins ---- Albumin Source.4410: DFBPPR16191 ---- Animal proteins ---- Somatotropin Source.4411: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.4412: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.4413: DFBPPR16196 ---- Animal proteins ---- Amyloid-beta A4 protein Source.4414: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4415: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.4416: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.4417: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.4418: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.4419: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.4420: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.4421: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.4422: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.4423: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.4424: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type Source.4425: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.4426: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor Source.4427: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11 Source.4428: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.4429: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.4430: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.4431: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.4432: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.4433: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.4434: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.4435: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24 Source.4436: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.4437: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein Source.4438: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.4439: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.4440: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.4441: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.4442: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.4443: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.4444: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2 Source.4445: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.4446: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4447: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.4448: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.4449: DFBPPR16247 ---- Animal proteins ---- Recoverin Source.4450: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.4451: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.4452: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15 Source.4453: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.4454: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.4455: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.4456: DFBPPR16258 ---- Animal proteins ---- Decorin Source.4457: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.4458: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type Source.4459: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha Source.4460: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.4461: DFBPPR16265 ---- Animal proteins ---- Caspase-1 Source.4462: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.4463: DFBPPR16267 ---- Animal proteins ---- Ras-related protein Rab-2A Source.4464: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.4465: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.4466: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.4467: DFBPPR16273 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor Source.4468: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1 Source.4469: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.4470: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.4471: DFBPPR16285 ---- Animal proteins ---- Chymase Source.4472: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.4473: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21 Source.4474: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.4475: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1 Source.4476: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.4477: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.4478: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.4479: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.4480: DFBPPR16301 ---- Animal proteins ---- Major allergen Can f 1 Source.4481: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.4482: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.4483: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25 Source.4484: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41 Source.4485: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.4486: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.4487: DFBPPR16315 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.4488: DFBPPR16316 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.4489: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.4490: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.4491: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.4492: DFBPPR16322 ---- Animal proteins ---- Interleukin-18 Source.4493: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2 Source.4494: DFBPPR16325 ---- Animal proteins ---- Peripherin-2 Source.4495: DFBPPR16326 ---- Animal proteins ---- Desmin Source.4496: DFBPPR16328 ---- Animal proteins ---- Fibroblast growth factor 8 Source.4497: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.4498: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.4499: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.4500: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.4501: DFBPPR16338 ---- Animal proteins ---- Endothelin-2 Source.4502: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.4503: DFBPPR16341 ---- Animal proteins ---- Calmegin Source.4504: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.4505: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.4506: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype Source.4507: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5 Source.4508: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.4509: DFBPPR16368 ---- Animal proteins ---- Tyrosinase Source.4510: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.4511: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.4512: DFBPPR16429 ---- Animal proteins ---- C-C motif chemokine 4 Source.4513: DFBPPR16435 ---- Animal proteins ---- S-arrestin Source.4514: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.4515: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.4516: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.4517: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.4518: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.4519: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2 Source.4520: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.4521: DFBPPR16444 ---- Animal proteins ---- Interleukin-33 Source.4522: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.4523: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain Source.4524: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor Source.4525: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.4526: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.4527: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.4528: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.4529: DFBPPR16464 ---- Animal proteins ---- Interferon alpha-1/2 Source.4530: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.4531: DFBPPR16471 ---- Animal proteins ---- Interferon alpha-3 Source.4532: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4 Source.4533: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.4534: DFBPPR16475 ---- Animal proteins ---- Transmembrane protein 258 Source.4535: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2 Source.4536: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B Source.4537: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2 Source.4538: DFBPPR16481 ---- Animal proteins ---- Caspase-12 Source.4539: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.4540: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.4541: DFBPPR16487 ---- Animal proteins ---- Claudin-2 Source.4542: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.4543: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha Source.4544: DFBPPR16492 ---- Animal proteins ---- Parathyroid hormone-related protein Source.4545: DFBPPR16494 ---- Animal proteins ---- C-C motif chemokine 25 Source.4546: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.4547: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1 Source.4548: DFBPPR16497 ---- Animal proteins ---- Interleukin-5 Source.4549: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.4550: DFBPPR16500 ---- Animal proteins ---- C-C motif chemokine 5 Source.4551: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.4552: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.4553: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.4554: DFBPPR16508 ---- Animal proteins ---- Protein crumbs homolog 3 Source.4555: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.4556: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.4557: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor Source.4558: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.4559: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.4560: DFBPPR16521 ---- Animal proteins ---- Interleukin-3 Source.4561: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.4562: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.4563: DFBPPR16528 ---- Animal proteins ---- Signal recognition particle 14 kDa protein Source.4564: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.4565: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a Source.4566: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.4567: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.4568: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.4569: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.4570: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83 Source.4571: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.4572: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.4573: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein Source.4574: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.4575: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3 Source.4576: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.4577: DFBPPR16558 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.4578: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.4579: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2 Source.4580: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.4581: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.4582: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2 Source.4583: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.4584: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2 Source.4585: DFBPPR16571 ---- Animal proteins ---- Pro-MCH Source.4586: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.4587: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.4588: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.4589: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a Source.4590: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3 Source.4591: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.4592: DFBPPR16582 ---- Animal proteins ---- Pepsin A Source.4593: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin Source.4594: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2 Source.4595: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20 Source.4596: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c Source.4597: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.4598: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.4599: DFBPPR16594 ---- Animal proteins ---- Macoilin Source.4600: DFBPPR16595 ---- Animal proteins ---- Annexin A4 Source.4601: DFBPPR16599 ---- Animal proteins ---- Receptor-binding cancer antigen expressed on SiSo cells Source.4602: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.4603: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype Source.4604: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.4605: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.4606: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1 Source.4607: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.4608: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.4609: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4 Source.4610: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1 Source.4611: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.4612: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1 Source.4613: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.4614: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.4615: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.4616: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.4617: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6 Source.4618: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.4619: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H Source.4620: DFBPPR16645 ---- Animal proteins ---- Putative protein SCAMPER Source.4621: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.4622: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27 Source.4623: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1 Source.4624: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4 Source.4625: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5 Source.4626: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22 Source.4627: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.4628: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1 Source.4629: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2 Source.4630: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein Source.4631: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.4632: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.4633: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT Source.4634: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4 Source.4635: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein Source.4636: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3 Source.4637: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.4638: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.4639: DFBPPR16706 ---- Animal proteins ---- 60S ribosomal protein L19 Source.4640: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.4641: DFBPPR16710 ---- Animal proteins ---- Translocation protein SEC63 homolog Source.4642: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.4643: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.4644: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.4645: DFBPPR16721 ---- Animal proteins ---- Testin Source.4646: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.4647: DFBPPR16732 ---- Animal proteins ---- HORMA domain-containing protein 2 Source.4648: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.4649: DFBPPR16747 ---- Animal proteins ---- Pleckstrin Source.4650: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.4651: DFBPPR16750 ---- Animal proteins ---- 60S ribosomal protein L23 Source.4652: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.4653: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.4654: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region Source.4655: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.4656: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.4657: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4658: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.4659: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.4660: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37 Source.4661: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.4662: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.4663: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase Source.4664: DFBPPR16772 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.4665: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A Source.4666: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35 Source.4667: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.4668: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8 Source.4669: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.4670: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.4671: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.4672: DFBPPR16786 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.4673: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.4674: DFBPPR16797 ---- Animal proteins ---- Albumin Source.4675: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.4676: DFBPPR16799 ---- Animal proteins ---- Somatotropin Source.4677: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin Source.4678: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.4679: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.4680: DFBPPR16809 ---- Animal proteins ---- Rhodopsin Source.4681: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1 Source.4682: DFBPPR16814 ---- Animal proteins ---- Prothrombin Source.4683: DFBPPR16816 ---- Animal proteins ---- Decorin Source.4684: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4685: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.4686: DFBPPR16823 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase Source.4687: DFBPPR16827 ---- Animal proteins ---- S-arrestin Source.4688: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.4689: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.4690: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.4691: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.4692: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109 Source.4693: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.4694: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein Source.4695: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.4696: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6 Source.4697: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.4698: DFBPPR16843 ---- Animal proteins ---- Calmodulin Source.4699: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.4700: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.4701: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.4702: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.4703: DFBPPR16853 ---- Animal proteins ---- Protein S100-B Source.4704: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.4705: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.4706: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor Source.4707: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor Source.4708: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15 Source.4709: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial Source.4710: DFBPPR16863 ---- Animal proteins ---- Biglycan Source.4711: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.4712: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.4713: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX Source.4714: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.4715: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.4716: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.4717: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.4718: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Source.4719: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2 Source.4720: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.4721: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.4722: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.4723: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.4724: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C Source.4725: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.4726: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial Source.4727: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.4728: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.4729: DFBPPR16893 ---- Animal proteins ---- Annexin A4 Source.4730: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.4731: DFBPPR16897 ---- Animal proteins ---- Interleukin-4 Source.4732: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1 Source.4733: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.4734: DFBPPR16902 ---- Animal proteins ---- Interleukin-8 Source.4735: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.4736: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.4737: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.4738: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.4739: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.4740: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.4741: DFBPPR16919 ---- Animal proteins ---- VIP peptides Source.4742: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.4743: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.4744: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.4745: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.4746: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.4747: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor Source.4748: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.4749: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.4750: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13 Source.4751: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.4752: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.4753: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.4754: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.4755: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic Source.4756: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA Source.4757: DFBPPR16946 ---- Animal proteins ---- Recoverin Source.4758: DFBPPR16952 ---- Animal proteins ---- Annexin A2 Source.4759: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.4760: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.4761: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.4762: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.4763: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.4764: DFBPPR16960 ---- Animal proteins ---- Catalase Source.4765: DFBPPR16962 ---- Animal proteins ---- Interleukin-18 Source.4766: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.4767: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.4768: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.4769: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta Source.4770: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.4771: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.4772: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.4773: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.4774: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8 Source.4775: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos Source.4776: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.4777: DFBPPR16981 ---- Animal proteins ---- Clusterin Source.4778: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase Source.4779: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.4780: DFBPPR16984 ---- Animal proteins ---- Caveolin-2 Source.4781: DFBPPR16985 ---- Animal proteins ---- Filensin Source.4782: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.4783: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.4784: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.4785: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.4786: DFBPPR16994 ---- Animal proteins ---- Somatoliberin Source.4787: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1 Source.4788: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.4789: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.4790: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1 Source.4791: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.4792: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase Source.4793: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.4794: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.4795: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.4796: DFBPPR17010 ---- Animal proteins ---- Sestrin-2 Source.4797: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.4798: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.4799: DFBPPR17013 ---- Animal proteins ---- Presenilin-1 Source.4800: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.4801: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.4802: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.4803: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase Source.4804: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.4805: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.4806: DFBPPR17023 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10 Source.4807: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.4808: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator Source.4809: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.4810: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor Source.4811: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.4812: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.4813: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2 Source.4814: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.4815: DFBPPR17035 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 Source.4816: DFBPPR17037 ---- Animal proteins ---- Annexin A1 Source.4817: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.4818: DFBPPR17040 ---- Animal proteins ---- Myocilin Source.4819: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.4820: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.4821: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.4822: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D Source.4823: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta Source.4824: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.4825: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.4826: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.4827: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.4828: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1 Source.4829: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.4830: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.4831: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Source.4832: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1 Source.4833: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.4834: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.4835: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5 Source.4836: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.4837: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.4838: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.4839: DFBPPR17067 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.4840: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1 Source.4841: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.4842: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.4843: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.4844: DFBPPR17073 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform Source.4845: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2 Source.4846: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21 Source.4847: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.4848: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.4849: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.4850: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.4851: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1 Source.4852: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase Source.4853: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.4854: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog Source.4855: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.4856: DFBPPR17090 ---- Animal proteins ---- Phakinin Source.4857: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.4858: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.4859: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2 Source.4860: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.4861: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1 Source.4862: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.4863: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1 Source.4864: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.4865: DFBPPR17101 ---- Animal proteins ---- Annexin A5 Source.4866: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.4867: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.4868: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.4869: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.4870: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.4871: DFBPPR17108 ---- Animal proteins ---- Coronin-1A Source.4872: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.4873: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2 Source.4874: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.4875: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.4876: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.4877: DFBPPR17115 ---- Animal proteins ---- CD44 antigen Source.4878: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.4879: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.4880: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.4881: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7 Source.4882: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.4883: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.4884: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Source.4885: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.4886: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.4887: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.4888: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein Source.4889: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.4890: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta Source.4891: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2 Source.4892: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.4893: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.4894: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.4895: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.4896: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.4897: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.4898: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1 Source.4899: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1 Source.4900: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1 Source.4901: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.4902: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog Source.4903: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.4904: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.4905: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.4906: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1 Source.4907: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.4908: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein Source.4909: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.4910: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.4911: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.4912: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6 Source.4913: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.4914: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.4915: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha Source.4916: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.4917: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.4918: DFBPPR17196 ---- Animal proteins ---- Histone H4 Source.4919: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.4920: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.4921: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1 Source.4922: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.4923: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.4924: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase Source.4925: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.4926: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.4927: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.4928: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.4929: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial Source.4930: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.4931: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1 Source.4932: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.4933: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.4934: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.4935: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.4936: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3 Source.4937: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.4938: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR Source.4939: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein Source.4940: DFBPPR17280 ---- Animal proteins ---- Serine racemase Source.4941: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.4942: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.4943: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7 Source.4944: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.4945: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.4946: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.4947: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.4948: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.4949: DFBPPR17294 ---- Animal proteins ---- Ezrin Source.4950: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.4951: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.4952: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4953: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 Source.4954: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.4955: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.4956: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.4957: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.4958: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.4959: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1 Source.4960: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.4961: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.4962: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.4963: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta Source.4964: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.4965: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase Source.4966: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.4967: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.4968: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein Source.4969: DFBPPR17324 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.4970: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II Source.4971: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.4972: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.4973: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase Source.4974: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.4975: DFBPPR17334 ---- Animal proteins ---- Prohibitin Source.4976: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.4977: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.4978: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.4979: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.4980: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating Source.4981: DFBPPR17341 ---- Animal proteins ---- Radixin Source.4982: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.4983: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1 Source.4984: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.4985: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal Source.4986: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.4987: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.4988: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.4989: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen Source.4990: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1 Source.4991: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.4992: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.4993: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.4994: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.4995: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.4996: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.4997: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1 Source.4998: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.4999: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.5000: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6 Source.5001: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.5002: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.5003: DFBPPR17376 ---- Animal proteins ---- Flotillin-1 Source.5004: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.5005: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2 Source.5006: DFBPPR17379 ---- Animal proteins ---- Dematin Source.5007: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1 Source.5008: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.5009: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2 Source.5010: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.5011: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2 Source.5012: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.5013: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A Source.5014: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.5015: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD Source.5016: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.5017: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1 Source.5018: DFBPPR17401 ---- Animal proteins ---- Moesin Source.5019: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.5020: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.5021: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.5022: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.5023: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.5024: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.5025: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.5026: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1 Source.5027: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type Source.5028: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.5029: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5 Source.5030: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.5031: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.5032: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1 Source.5033: DFBPPR17423 ---- Animal proteins ---- Furin Source.5034: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.5035: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.5036: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.5037: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.5038: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.5039: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1 Source.5040: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5 Source.5041: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein Source.5042: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.5043: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1 Source.5044: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.5045: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.5046: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.5047: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.5048: DFBPPR17443 ---- Animal proteins ---- Beclin-1 Source.5049: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.5050: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.5051: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1 Source.5052: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein Source.5053: DFBPPR17449 ---- Animal proteins ---- C-C motif chemokine 3 Source.5054: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.5055: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.5056: DFBPPR17452 ---- Animal proteins ---- CD81 antigen Source.5057: DFBPPR17453 ---- Animal proteins ---- Calcium and integrin-binding protein 1 Source.5058: DFBPPR17454 ---- Animal proteins ---- Peripherin-2 Source.5059: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.5060: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.5061: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.5062: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.5063: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.5064: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.5065: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.5066: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.5067: DFBPPR17469 ---- Animal proteins ---- Cofilin-1 Source.5068: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.5069: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase Source.5070: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.5071: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.5072: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.5073: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.5074: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1 Source.5075: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.5076: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.5077: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.5078: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.5079: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.5080: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.5081: DFBPPR17490 ---- Animal proteins ---- TIR domain-containing adapter molecule 2 Source.5082: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1 Source.5083: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.5084: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.5085: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.5086: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.5087: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha Source.5088: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.5089: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.5090: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.5091: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD Source.5092: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.5093: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.5094: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.5095: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.5096: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.5097: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1 Source.5098: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5 Source.5099: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1 Source.5100: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.5101: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1 Source.5102: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 Source.5103: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.5104: DFBPPR17529 ---- Animal proteins ---- C-type lectin domain family 7 member A Source.5105: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2 Source.5106: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.5107: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.5108: DFBPPR17538 ---- Animal proteins ---- Septin-7 Source.5109: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.5110: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.5111: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.5112: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.5113: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.5114: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.5115: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.5116: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4 Source.5117: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog Source.5118: DFBPPR17555 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial Source.5119: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.5120: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.5121: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4 Source.5122: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.5123: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.5124: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.5125: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.5126: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B Source.5127: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.5128: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.5129: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.5130: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.5131: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.5132: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase Source.5133: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.5134: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial Source.5135: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2 Source.5136: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.5137: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.5138: DFBPPR17592 ---- Animal proteins ---- Claudin-3 Source.5139: DFBPPR17593 ---- Animal proteins ---- Claudin-3 Source.5140: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial Source.5141: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.5142: DFBPPR17599 ---- Animal proteins ---- Tissue factor Source.5143: DFBPPR17600 ---- Animal proteins ---- Tissue factor Source.5144: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor Source.5145: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.5146: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.5147: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.5148: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1 Source.5149: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.5150: DFBPPR17618 ---- Animal proteins ---- Synaptophysin Source.5151: DFBPPR17619 ---- Animal proteins ---- Vesicle-associated membrane protein 8 Source.5152: DFBPPR17620 ---- Animal proteins ---- Vesicle-associated membrane protein 8 Source.5153: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A Source.5154: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A Source.5155: DFBPPR17626 ---- Animal proteins ---- Elastin Source.5156: DFBPPR17633 ---- Animal proteins ---- Lysozyme C Source.5157: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.5158: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.5159: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2 Source.5160: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.5161: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.5162: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1 Source.5163: DFBPPR17664 ---- Animal proteins ---- Apolipoprotein C-II Source.5164: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2 Source.5165: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta Source.5166: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2 Source.5167: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.5168: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.5169: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.5170: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2 Source.5171: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase Source.5172: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.5173: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.5174: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase Source.5175: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.5176: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.5177: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6 Source.5178: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.5179: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.5180: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.5181: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.5182: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0 Source.5183: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.5184: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A Source.5185: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.5186: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.5187: DFBPPR17749 ---- Animal proteins ---- CD9 antigen Source.5188: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.5189: DFBPPR17752 ---- Animal proteins ---- Follistatin Source.5190: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1 Source.5191: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.5192: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1 Source.5193: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.5194: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4 Source.5195: DFBPPR17764 ---- Animal proteins ---- L-selectin Source.5196: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.5197: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.5198: DFBPPR17776 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.5199: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.5200: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.5201: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.5202: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.5203: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1 Source.5204: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.5205: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.5206: DFBPPR17790 ---- Animal proteins ---- Interleukin-15 Source.5207: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.5208: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.5209: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.5210: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.5211: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.5212: DFBPPR17799 ---- Animal proteins ---- Gamma-synuclein Source.5213: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13 Source.5214: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.5215: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.5216: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.5217: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2 Source.5218: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.5219: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.5220: DFBPPR17816 ---- Animal proteins ---- Lumican Source.5221: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.5222: DFBPPR17820 ---- Animal proteins ---- Osteomodulin Source.5223: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.5224: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.5225: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.5226: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.5227: DFBPPR17828 ---- Animal proteins ---- Aromatase Source.5228: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.5229: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor Source.5230: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B Source.5231: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1 Source.5232: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.5233: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.5234: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13 Source.5235: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.5236: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1 Source.5237: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B Source.5238: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.5239: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20 Source.5240: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.5241: DFBPPR17849 ---- Animal proteins ---- Fibromodulin Source.5242: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.5243: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.5244: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.5245: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.5246: DFBPPR17855 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1 Source.5247: DFBPPR17856 ---- Animal proteins ---- Selenoprotein S Source.5248: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.5249: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor Source.5250: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.5251: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase Source.5252: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.5253: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.5254: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1 Source.5255: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.5256: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.5257: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.5258: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.5259: DFBPPR17879 ---- Animal proteins ---- Menin Source.5260: DFBPPR17883 ---- Animal proteins ---- Sialidase-1 Source.5261: DFBPPR17885 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 6 Source.5262: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor Source.5263: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.5264: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.5265: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase Source.5266: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.5267: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.5268: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.5269: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.5270: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1 Source.5271: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.5272: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.5273: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.5274: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8 Source.5275: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.5276: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein Source.5277: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.5278: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.5279: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.5280: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.5281: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.5282: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial Source.5283: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.5284: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3 Source.5285: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.5286: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.5287: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.5288: DFBPPR17928 ---- Animal proteins ---- CD40 ligand Source.5289: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2 Source.5290: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.5291: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.5292: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.5293: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.5294: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.5295: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.5296: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.5297: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.5298: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38 Source.5299: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.5300: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9 Source.5301: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.5302: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.5303: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.5304: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 Source.5305: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.5306: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.5307: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.5308: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.5309: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.5310: DFBPPR17954 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member A Source.5311: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase Source.5312: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.5313: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.5314: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG Source.5315: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4 Source.5316: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.5317: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.5318: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.5319: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase Source.5320: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase Source.5321: DFBPPR17970 ---- Animal proteins ---- Profilin-2 Source.5322: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.5323: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.5324: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.5325: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.5326: DFBPPR17977 ---- Animal proteins ---- Collagenase 3 Source.5327: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.5328: DFBPPR17981 ---- Animal proteins ---- Retinol-binding protein 4 Source.5329: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.5330: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.5331: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor Source.5332: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.5333: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3 Source.5334: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN Source.5335: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein Source.5336: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2 Source.5337: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.5338: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.5339: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.5340: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Source.5341: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.5342: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.5343: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase Source.5344: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.5345: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.5346: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.5347: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.5348: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.5349: DFBPPR18011 ---- Animal proteins ---- Afamin Source.5350: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.5351: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.5352: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein Source.5353: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.5354: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2 Source.5355: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.5356: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase Source.5357: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.5358: DFBPPR18022 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial Source.5359: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.5360: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.5361: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.5362: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.5363: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain Source.5364: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta Source.5365: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.5366: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.5367: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 Source.5368: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.5369: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3 Source.5370: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.5371: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S Source.5372: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase Source.5373: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.5374: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5 Source.5375: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1 Source.5376: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial Source.5377: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1 Source.5378: DFBPPR18050 ---- Animal proteins ---- Ras-related protein Rab-7a Source.5379: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1 Source.5380: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.5381: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.5382: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T Source.5383: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A Source.5384: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.5385: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.5386: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2 Source.5387: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.5388: DFBPPR18065 ---- Animal proteins ---- Isopentenyl-diphosphate Delta-isomerase 1 Source.5389: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.5390: DFBPPR18068 ---- Animal proteins ---- Annexin A11 Source.5391: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.5392: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein Source.5393: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.5394: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.5395: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial Source.5396: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.5397: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta Source.5398: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.5399: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.5400: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.5401: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.5402: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor Source.5403: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta Source.5404: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4 Source.5405: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.5406: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.5407: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.5408: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.5409: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.5410: DFBPPR18104 ---- Animal proteins ---- Thioredoxin Source.5411: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.5412: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.5413: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29 Source.5414: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.5415: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.5416: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1 Source.5417: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4 Source.5418: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.5419: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.5420: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.5421: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.5422: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.5423: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.5424: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.5425: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.5426: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.5427: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.5428: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1 Source.5429: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C Source.5430: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1 Source.5431: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.5432: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.5433: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.5434: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.5435: DFBPPR18157 ---- Animal proteins ---- Hematopoietic cell signal transducer Source.5436: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.5437: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.5438: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.5439: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.5440: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.5441: DFBPPR18166 ---- Animal proteins ---- Selenoprotein P Source.5442: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.5443: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.5444: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.5445: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6 Source.5446: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25 Source.5447: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2 Source.5448: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.5449: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1 Source.5450: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5 Source.5451: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.5452: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.5453: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein Source.5454: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein Source.5455: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.5456: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.5457: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta Source.5458: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.5459: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8 Source.5460: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.5461: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.5462: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.5463: DFBPPR18227 ---- Animal proteins ---- Desmin Source.5464: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.5465: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A Source.5466: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3 Source.5467: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.5468: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.5469: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa Source.5470: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.5471: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.5472: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a Source.5473: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.5474: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase Source.5475: DFBPPR18254 ---- Animal proteins ---- C-type lectin domain family 6 member A Source.5476: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.5477: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10 Source.5478: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41 Source.5479: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.5480: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.5481: DFBPPR18262 ---- Animal proteins ---- Claudin-1 Source.5482: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta Source.5483: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.5484: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.5485: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.5486: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein Source.5487: DFBPPR18271 ---- Animal proteins ---- Lysozyme C-2 Source.5488: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.5489: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial Source.5490: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.5491: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.5492: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3 Source.5493: DFBPPR18281 ---- Animal proteins ---- CD63 antigen Source.5494: DFBPPR18285 ---- Animal proteins ---- ADP-ribose glycohydrolase OARD1 Source.5495: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.5496: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56 Source.5497: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.5498: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.5499: DFBPPR18292 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 11 Source.5500: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.5501: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.5502: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase Source.5503: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.5504: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.5505: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1 Source.5506: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.5507: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.5508: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.5509: DFBPPR18307 ---- Animal proteins ---- Claudin-4 Source.5510: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A Source.5511: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain Source.5512: DFBPPR18312 ---- Animal proteins ---- Interleukin-10 Source.5513: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B Source.5514: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.5515: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.5516: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.5517: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1 Source.5518: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial Source.5519: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.5520: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6 Source.5521: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.5522: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial Source.5523: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a Source.5524: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.5525: DFBPPR18340 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2 Source.5526: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2 Source.5527: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1 Source.5528: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase Source.5529: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.5530: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.5531: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog Source.5532: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.5533: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1 Source.5534: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.5535: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase Source.5536: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.5537: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.5538: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.5539: DFBPPR18363 ---- Animal proteins ---- Spexin Source.5540: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.5541: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2 Source.5542: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Source.5543: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.5544: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.5545: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.5546: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.5547: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.5548: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.5549: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.5550: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.5551: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.5552: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.5553: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.5554: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.5555: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.5556: DFBPPR18391 ---- Animal proteins ---- Exosome complex component RRP43 Source.5557: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.5558: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.5559: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase Source.5560: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Source.5561: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.5562: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6 Source.5563: DFBPPR18400 ---- Animal proteins ---- Amyloid-beta A4 protein Source.5564: DFBPPR18401 ---- Animal proteins ---- Protrudin Source.5565: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.5566: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.5567: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10 Source.5568: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen Source.5569: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.5570: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.5571: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain Source.5572: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.5573: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14 Source.5574: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.5575: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.5576: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14 Source.5577: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.5578: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.5579: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16 Source.5580: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.5581: DFBPPR18433 ---- Animal proteins ---- Basigin Source.5582: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.5583: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.5584: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.5585: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.5586: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.5587: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.5588: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2 Source.5589: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.5590: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.5591: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4 Source.5592: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.5593: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1 Source.5594: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.5595: DFBPPR18458 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.5596: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.5597: DFBPPR18462 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.5598: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.5599: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor Source.5600: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.5601: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.5602: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.5603: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A Source.5604: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1 Source.5605: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.5606: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.5607: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.5608: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.5609: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.5610: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.5611: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.5612: DFBPPR18488 ---- Animal proteins ---- Parathyroid hormone-related protein Source.5613: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1 Source.5614: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.5615: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.5616: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.5617: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase Source.5618: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.5619: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.5620: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb Source.5621: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.5622: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial Source.5623: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5 Source.5624: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.5625: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.5626: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.5627: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.5628: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.5629: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C Source.5630: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130 Source.5631: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1 Source.5632: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.5633: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1 Source.5634: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial Source.5635: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain Source.5636: DFBPPR18528 ---- Animal proteins ---- 14-3-3 protein sigma Source.5637: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin Source.5638: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain Source.5639: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain Source.5640: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1 Source.5641: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.5642: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1 Source.5643: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.5644: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.5645: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1 Source.5646: DFBPPR18543 ---- Animal proteins ---- Proproteinase E Source.5647: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu Source.5648: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial Source.5649: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.5650: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.5651: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.5652: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.5653: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.5654: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.5655: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.5656: DFBPPR18560 ---- Animal proteins ---- Rho-related GTP-binding protein RhoF Source.5657: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.5658: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.5659: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.5660: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal Source.5661: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.5662: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1 Source.5663: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.5664: DFBPPR18573 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.5665: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5 Source.5666: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.5667: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.5668: DFBPPR18581 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 7 Source.5669: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.5670: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.5671: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.5672: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.5673: DFBPPR18589 ---- Animal proteins ---- Interleukin-13 Source.5674: DFBPPR18590 ---- Animal proteins ---- Retinol-binding protein 1 Source.5675: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase Source.5676: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.5677: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.5678: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2 Source.5679: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3 Source.5680: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.5681: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.5682: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26 Source.5683: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.5684: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.5685: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3 Source.5686: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial Source.5687: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.5688: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.5689: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.5690: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561 Source.5691: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.5692: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase Source.5693: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.5694: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2 Source.5695: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase Source.5696: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.5697: DFBPPR18632 ---- Animal proteins ---- Syntaxin-4 Source.5698: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14 Source.5699: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.5700: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB Source.5701: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.5702: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4 Source.5703: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3 Source.5704: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.5705: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.5706: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1 Source.5707: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.5708: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type Source.5709: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.5710: DFBPPR18651 ---- Animal proteins ---- Allergen Bos d 2 Source.5711: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21 Source.5712: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.5713: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6 Source.5714: DFBPPR18686 ---- Animal proteins ---- Intraflagellar transport protein 27 homolog Source.5715: DFBPPR18698 ---- Animal proteins ---- ATPase GET3 Source.5716: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4 Source.5717: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D Source.5718: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1 Source.5719: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.5720: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor Source.5721: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3 Source.5722: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase Source.5723: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.5724: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5 Source.5725: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.5726: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Source.5727: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor Source.5728: DFBPPR18719 ---- Animal proteins ---- A-kinase anchor protein 5 Source.5729: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2 Source.5730: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.5731: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.5732: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial Source.5733: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.5734: DFBPPR18734 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF114 Source.5735: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.5736: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.5737: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.5738: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.5739: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II Source.5740: DFBPPR18743 ---- Animal proteins ---- Sperm-egg fusion protein TMEM95 Source.5741: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor Source.5742: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1 Source.5743: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.5744: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase Source.5745: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.5746: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.5747: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.5748: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.5749: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.5750: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.5751: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.5752: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.5753: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9 Source.5754: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.5755: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9 Source.5756: DFBPPR18775 ---- Animal proteins ---- tRNA methyltransferase 10 homolog A Source.5757: DFBPPR18779 ---- Animal proteins ---- Mucin-15 Source.5758: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.5759: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.5760: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A Source.5761: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.5762: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.5763: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU Source.5764: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein Source.5765: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.5766: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.5767: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C Source.5768: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2 Source.5769: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A Source.5770: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.5771: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.5772: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.5773: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2 Source.5774: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha Source.5775: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.5776: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.5777: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.5778: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.5779: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.5780: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.5781: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1 Source.5782: DFBPPR18815 ---- Animal proteins ---- Pantetheinase Source.5783: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.5784: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.5785: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.5786: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2 Source.5787: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase Source.5788: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.5789: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.5790: DFBPPR18825 ---- Animal proteins ---- Glutaredoxin-1 Source.5791: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6 Source.5792: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type Source.5793: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1 Source.5794: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.5795: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2 Source.5796: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor Source.5797: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.5798: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.5799: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B Source.5800: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.5801: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.5802: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.5803: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.5804: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin Source.5805: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.5806: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor Source.5807: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase Source.5808: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.5809: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2 Source.5810: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase Source.5811: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7 Source.5812: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.5813: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.5814: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.5815: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.5816: DFBPPR18869 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit beta Source.5817: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.5818: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.5819: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.5820: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.5821: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.5822: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.5823: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase Source.5824: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1 Source.5825: DFBPPR18882 ---- Animal proteins ---- Bisphosphoglycerate mutase Source.5826: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.5827: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.5828: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.5829: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5 Source.5830: DFBPPR18893 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM20 homolog Source.5831: DFBPPR18894 ---- Animal proteins ---- NEDD8-conjugating enzyme Ubc12 Source.5832: DFBPPR18895 ---- Animal proteins ---- Lysozyme C-1 Source.5833: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.5834: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.5835: DFBPPR18899 ---- Animal proteins ---- Cofilin-2 Source.5836: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.5837: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.5838: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.5839: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.5840: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.5841: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless Source.5842: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.5843: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.5844: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.5845: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.5846: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3 Source.5847: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5 Source.5848: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11 Source.5849: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.5850: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.5851: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.5852: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.5853: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.5854: DFBPPR18931 ---- Animal proteins ---- Ficolin-2 Source.5855: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Source.5856: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.5857: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.5858: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.5859: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13 Source.5860: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.5861: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.5862: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1 Source.5863: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.5864: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6 Source.5865: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1 Source.5866: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.5867: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3 Source.5868: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8 Source.5869: DFBPPR18952 ---- Animal proteins ---- Serotransferrin Source.5870: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha Source.5871: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.5872: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.5873: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A Source.5874: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.5875: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1 Source.5876: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog Source.5877: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.5878: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein Source.5879: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.5880: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.5881: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS Source.5882: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3 Source.5883: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease Source.5884: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.5885: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.5886: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor Source.5887: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.5888: DFBPPR18986 ---- Animal proteins ---- Granzyme A Source.5889: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.5890: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.5891: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5 Source.5892: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.5893: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1 Source.5894: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog Source.5895: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.5896: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I Source.5897: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.5898: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.5899: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1 Source.5900: DFBPPR19011 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF138 Source.5901: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D Source.5902: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3 Source.5903: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.5904: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.5905: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.5906: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.5907: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B Source.5908: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog Source.5909: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase Source.5910: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.5911: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.5912: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.5913: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.5914: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.5915: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.5916: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.5917: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.5918: DFBPPR19037 ---- Animal proteins ---- Transthyretin Source.5919: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.5920: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.5921: DFBPPR19042 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 2 Source.5922: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Source.5923: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.5924: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2 Source.5925: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.5926: DFBPPR19059 ---- Animal proteins ---- Lysozyme C, non-stomach isozyme Source.5927: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.5928: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.5929: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.5930: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.5931: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.5932: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.5933: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.5934: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.5935: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.5936: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.5937: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2 Source.5938: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.5939: DFBPPR19078 ---- Animal proteins ---- Cystatin-B Source.5940: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.5941: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3 Source.5942: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.5943: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.5944: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.5945: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A Source.5946: DFBPPR19094 ---- Animal proteins ---- C-C motif chemokine 4 Source.5947: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase Source.5948: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.5949: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.5950: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.5951: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.5952: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2 Source.5953: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.5954: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2 Source.5955: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.5956: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.5957: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.5958: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3 Source.5959: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.5960: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit Source.5961: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2 Source.5962: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.5963: DFBPPR19137 ---- Animal proteins ---- Serpin H1 Source.5964: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.5965: DFBPPR19140 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 5 Source.5966: DFBPPR19145 ---- Animal proteins ---- Pepsin A Source.5967: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.5968: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.5969: DFBPPR19150 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase H Source.5970: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.5971: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.5972: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2 Source.5973: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.5974: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.5975: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma Source.5976: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.5977: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.5978: DFBPPR19174 ---- Animal proteins ---- Neuroendocrine secretory protein 55 Source.5979: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin Source.5980: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16 Source.5981: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone Source.5982: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33 Source.5983: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.5984: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.5985: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.5986: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.5987: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.5988: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4 Source.5989: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.5990: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.5991: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein Source.5992: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A Source.5993: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.5994: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5 Source.5995: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7 Source.5996: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.5997: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.5998: DFBPPR19211 ---- Animal proteins ---- Beta-synuclein Source.5999: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1 Source.6000: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2 Source.6001: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.6002: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.6003: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B Source.6004: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.6005: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase Source.6006: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.6007: DFBPPR19224 ---- Animal proteins ---- Fetuin-B Source.6008: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.6009: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1 Source.6010: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Source.6011: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.6012: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128 Source.6013: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.6014: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein Source.6015: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase Source.6016: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.6017: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog Source.6018: DFBPPR19247 ---- Animal proteins ---- Calmegin Source.6019: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.6020: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.6021: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.6022: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5 Source.6023: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B Source.6024: DFBPPR19253 ---- Animal proteins ---- Limbin Source.6025: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.6026: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2 Source.6027: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like Source.6028: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3 Source.6029: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28 Source.6030: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial Source.6031: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4 Source.6032: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2 Source.6033: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.6034: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.6035: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.6036: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.6037: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.6038: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2 Source.6039: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.6040: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.6041: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3 Source.6042: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5 Source.6043: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1 Source.6044: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6 Source.6045: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B Source.6046: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.6047: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.6048: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1 Source.6049: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3 Source.6050: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.6051: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1 Source.6052: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.6053: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3 Source.6054: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1 Source.6055: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.6056: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.6057: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial Source.6058: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1 Source.6059: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.6060: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.6061: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.6062: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.6063: DFBPPR19329 ---- Animal proteins ---- CD302 antigen Source.6064: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.6065: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.6066: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9 Source.6067: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4 Source.6068: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.6069: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.6070: DFBPPR19342 ---- Animal proteins ---- Calcium load-activated calcium channel Source.6071: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.6072: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1 Source.6073: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3 Source.6074: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.6075: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.6076: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.6077: DFBPPR19359 ---- Animal proteins ---- Spartin Source.6078: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.6079: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14 Source.6080: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1 Source.6081: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3 Source.6082: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.6083: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.6084: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel Source.6085: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.6086: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.6087: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A Source.6088: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1 Source.6089: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific Source.6090: DFBPPR19377 ---- Animal proteins ---- ER lumen protein-retaining receptor 2 Source.6091: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.6092: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3 Source.6093: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.6094: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2 Source.6095: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.6096: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A Source.6097: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6 Source.6098: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein Source.6099: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.6100: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6 Source.6101: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b Source.6102: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.6103: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4 Source.6104: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein Source.6105: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F Source.6106: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog Source.6107: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.6108: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.6109: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.6110: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.6111: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.6112: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22 Source.6113: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1 Source.6114: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19 Source.6115: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1 Source.6116: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.6117: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase Source.6118: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2 Source.6119: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Source.6120: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.6121: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor Source.6122: DFBPPR19438 ---- Animal proteins ---- Protein Mis18-alpha Source.6123: DFBPPR19439 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.6124: DFBPPR19443 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.6125: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.6126: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.6127: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2 Source.6128: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.6129: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.6130: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.6131: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.6132: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2 Source.6133: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.6134: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4 Source.6135: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.6136: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20 Source.6137: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase Source.6138: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137 Source.6139: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2 Source.6140: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.6141: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.6142: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12 Source.6143: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.6144: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.6145: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.6146: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.6147: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.6148: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.6149: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.6150: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase Source.6151: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.6152: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5 Source.6153: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase Source.6154: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.6155: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3 Source.6156: DFBPPR19489 ---- Animal proteins ---- Keratocan Source.6157: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4 Source.6158: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.6159: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.6160: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72 Source.6161: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5 Source.6162: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.6163: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.6164: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.6165: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2 Source.6166: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.6167: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.6168: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.6169: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta Source.6170: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E Source.6171: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.6172: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.6173: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.6174: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.6175: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog Source.6176: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2 Source.6177: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.6178: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.6179: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3 Source.6180: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1 Source.6181: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.6182: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2 Source.6183: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.6184: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9 Source.6185: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.6186: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.6187: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.6188: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.6189: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2 Source.6190: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.6191: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.6192: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.6193: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.6194: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.6195: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.6196: DFBPPR19575 ---- Animal proteins ---- Acylphosphatase-2 Source.6197: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.6198: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial Source.6199: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.6200: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.6201: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2 Source.6202: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.6203: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1 Source.6204: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1 Source.6205: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C Source.6206: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1 Source.6207: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.6208: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.6209: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin Source.6210: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.6211: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.6212: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C Source.6213: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein Source.6214: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.6215: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.6216: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2 Source.6217: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.6218: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.6219: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.6220: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.6221: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.6222: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase Source.6223: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.6224: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.6225: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.6226: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.6227: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2 Source.6228: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.6229: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase Source.6230: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.6231: DFBPPR19640 ---- Animal proteins ---- Prolargin Source.6232: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.6233: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Source.6234: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4 Source.6235: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit Source.6236: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4 Source.6237: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2 Source.6238: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.6239: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B Source.6240: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.6241: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.6242: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator Source.6243: DFBPPR19662 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1 Source.6244: DFBPPR19668 ---- Animal proteins ---- Calicin Source.6245: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.6246: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein Source.6247: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.6248: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.6249: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3 Source.6250: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.6251: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.6252: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3 Source.6253: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.6254: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5 Source.6255: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.6256: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1 Source.6257: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.6258: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase Source.6259: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4 Source.6260: DFBPPR19696 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.6261: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.6262: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1 Source.6263: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3 Source.6264: DFBPPR19703 ---- Animal proteins ---- Claudin-10 Source.6265: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.6266: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.6267: DFBPPR19709 ---- Animal proteins ---- Centromere protein X Source.6268: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.6269: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2 Source.6270: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1 Source.6271: DFBPPR19717 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM14 Source.6272: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.6273: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4 Source.6274: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1 Source.6275: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3 Source.6276: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2 Source.6277: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B Source.6278: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.6279: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.6280: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.6281: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.6282: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.6283: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5 Source.6284: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1 Source.6285: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.6286: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2 Source.6287: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase Source.6288: DFBPPR19748 ---- Animal proteins ---- 60S ribosomal protein L23 Source.6289: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.6290: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1 Source.6291: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.6292: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.6293: DFBPPR19761 ---- Animal proteins ---- N-chimaerin Source.6294: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2 Source.6295: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.6296: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13 Source.6297: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH Source.6298: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.6299: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.6300: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1 Source.6301: DFBPPR19777 ---- Animal proteins ---- Translin Source.6302: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.6303: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit Source.6304: DFBPPR19781 ---- Animal proteins ---- Secretory carrier-associated membrane protein 5 Source.6305: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.6306: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.6307: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11 Source.6308: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.6309: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2 Source.6310: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.6311: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.6312: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3 Source.6313: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1 Source.6314: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.6315: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.6316: DFBPPR19807 ---- Animal proteins ---- Spermine synthase Source.6317: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2 Source.6318: DFBPPR19810 ---- Animal proteins ---- Seipin Source.6319: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.6320: DFBPPR19812 ---- Animal proteins ---- Probable inactive serine protease 37 Source.6321: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Source.6322: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2 Source.6323: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.6324: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6 Source.6325: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.6326: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B Source.6327: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.6328: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein Source.6329: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.6330: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial Source.6331: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1 Source.6332: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.6333: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.6334: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.6335: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.6336: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.6337: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30 Source.6338: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.6339: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4 Source.6340: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.6341: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.6342: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.6343: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.6344: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.6345: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5 Source.6346: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a Source.6347: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1 Source.6348: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.6349: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.6350: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.6351: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1 Source.6352: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B Source.6353: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.6354: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2 Source.6355: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.6356: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.6357: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.6358: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.6359: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.6360: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3 Source.6361: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1 Source.6362: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14 Source.6363: DFBPPR19880 ---- Animal proteins ---- TATA box-binding protein-like 1 Source.6364: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.6365: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1 Source.6366: DFBPPR19886 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4A Source.6367: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2 Source.6368: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase Source.6369: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta Source.6370: DFBPPR19893 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3 Source.6371: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.6372: DFBPPR19898 ---- Animal proteins ---- Essential MCU regulator, mitochondrial Source.6373: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic Source.6374: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.6375: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.6376: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.6377: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.6378: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.6379: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1 Source.6380: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial Source.6381: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.6382: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.6383: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.6384: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7 Source.6385: DFBPPR19921 ---- Animal proteins ---- Histone deacetylase complex subunit SAP18 Source.6386: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.6387: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.6388: DFBPPR19927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] flavoprotein 3, mitochondrial Source.6389: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6 Source.6390: DFBPPR19935 ---- Animal proteins ---- Reticulon-3 Source.6391: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1 Source.6392: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform Source.6393: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.6394: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B Source.6395: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.6396: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.6397: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.6398: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2 Source.6399: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.6400: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.6401: DFBPPR19956 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.6402: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein Source.6403: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B Source.6404: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24 Source.6405: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.6406: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein Source.6407: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial Source.6408: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2 Source.6409: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.6410: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma Source.6411: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.6412: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor Source.6413: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.6414: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1 Source.6415: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.6416: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.6417: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.6418: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.6419: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1 Source.6420: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39 Source.6421: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7 Source.6422: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2 Source.6423: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.6424: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.6425: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3 Source.6426: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.6427: DFBPPR19996 ---- Animal proteins ---- Interleukin-3 Source.6428: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.6429: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.6430: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C Source.6431: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase Source.6432: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.6433: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.6434: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR Source.6435: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.6436: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1 Source.6437: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2 Source.6438: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7 Source.6439: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.6440: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1 Source.6441: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12 Source.6442: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.6443: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.6444: DFBPPR20034 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C1, mitochondrial Source.6445: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.6446: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.6447: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2 Source.6448: DFBPPR20044 ---- Animal proteins ---- Secernin-1 Source.6449: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B Source.6450: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.6451: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.6452: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase Source.6453: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.6454: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.6455: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.6456: DFBPPR20057 ---- Animal proteins ---- AP-3 complex subunit sigma-1 Source.6457: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.6458: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5 Source.6459: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial Source.6460: DFBPPR20065 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3 Source.6461: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.6462: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.6463: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.6464: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26 Source.6465: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4 Source.6466: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.6467: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.6468: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.6469: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2 Source.6470: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.6471: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.6472: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B Source.6473: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.6474: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.6475: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47 Source.6476: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.6477: DFBPPR20089 ---- Animal proteins ---- Fascin-2 Source.6478: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1 Source.6479: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.6480: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.6481: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.6482: DFBPPR20098 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.6483: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.6484: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.6485: DFBPPR20102 ---- Animal proteins ---- Cylicin-2 Source.6486: DFBPPR20103 ---- Animal proteins ---- Protein MAL2 Source.6487: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease Source.6488: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial Source.6489: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.6490: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1 Source.6491: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.6492: DFBPPR20124 ---- Animal proteins ---- Serine palmitoyltransferase small subunit B Source.6493: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase Source.6494: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.6495: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.6496: DFBPPR20139 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm4 Source.6497: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.6498: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.6499: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.6500: DFBPPR20145 ---- Animal proteins ---- Adipogenin Source.6501: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1 Source.6502: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C Source.6503: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.6504: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a Source.6505: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma Source.6506: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.6507: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.6508: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9 Source.6509: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A Source.6510: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein Source.6511: DFBPPR20161 ---- Animal proteins ---- Calponin-2 Source.6512: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog Source.6513: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2 Source.6514: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.6515: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.6516: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.6517: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein Source.6518: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase Source.6519: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.6520: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.6521: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6 Source.6522: DFBPPR20184 ---- Animal proteins ---- Centromere protein H Source.6523: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7 Source.6524: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3 Source.6525: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.6526: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.6527: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.6528: DFBPPR20194 ---- Animal proteins ---- 28S ribosomal protein S24, mitochondrial Source.6529: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20 Source.6530: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial Source.6531: DFBPPR20204 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.6532: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.6533: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1 Source.6534: DFBPPR20210 ---- Animal proteins ---- Exonuclease V Source.6535: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.6536: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.6537: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12 Source.6538: DFBPPR20225 ---- Animal proteins ---- Claudin-2 Source.6539: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase Source.6540: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7 Source.6541: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.6542: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.6543: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.6544: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1 Source.6545: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase Source.6546: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.6547: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1 Source.6548: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B Source.6549: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein Source.6550: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein Source.6551: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2 Source.6552: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.6553: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan Source.6554: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28 Source.6555: DFBPPR20250 ---- Animal proteins ---- General transcription factor IIH subunit 5 Source.6556: DFBPPR20252 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform Source.6557: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor Source.6558: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1 Source.6559: DFBPPR20262 ---- Animal proteins ---- DNA-directed RNA polymerase I subunit RPA12 Source.6560: DFBPPR20264 ---- Animal proteins ---- AP-3 complex subunit sigma-2 Source.6561: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1 Source.6562: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.6563: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.6564: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3 Source.6565: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.6566: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.6567: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1 Source.6568: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214 Source.6569: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6 Source.6570: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.6571: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2 Source.6572: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.6573: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.6574: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.6575: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like Source.6576: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase Source.6577: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal Source.6578: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN Source.6579: DFBPPR20296 ---- Animal proteins ---- Claudin-18 Source.6580: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.6581: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.6582: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator Source.6583: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3 Source.6584: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3 Source.6585: DFBPPR20305 ---- Animal proteins ---- Nostrin Source.6586: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B Source.6587: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.6588: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3 Source.6589: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.6590: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9 Source.6591: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial Source.6592: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV Source.6593: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.6594: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2 Source.6595: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.6596: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.6597: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3 Source.6598: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.6599: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.6600: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.6601: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.6602: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.6603: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial Source.6604: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1 Source.6605: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3 Source.6606: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial Source.6607: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1 Source.6608: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14 Source.6609: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.6610: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.6611: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.6612: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.6613: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2 Source.6614: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase Source.6615: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.6616: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1 Source.6617: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C Source.6618: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.6619: DFBPPR20363 ---- Animal proteins ---- F-box/LRR-repeat protein 2 Source.6620: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1 Source.6621: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1 Source.6622: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.6623: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2 Source.6624: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.6625: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4 Source.6626: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.6627: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.6628: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.6629: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.6630: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a Source.6631: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.6632: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1 Source.6633: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.6634: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1 Source.6635: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.6636: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.6637: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.6638: DFBPPR20401 ---- Animal proteins ---- Bystin Source.6639: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2 Source.6640: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.6641: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2 Source.6642: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A Source.6643: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.6644: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.6645: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.6646: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.6647: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.6648: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor Source.6649: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.6650: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170 Source.6651: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein Source.6652: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2 Source.6653: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog Source.6654: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog Source.6655: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.6656: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1 Source.6657: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1 Source.6658: DFBPPR20438 ---- Animal proteins ---- Small ubiquitin-related modifier 3 Source.6659: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.6660: DFBPPR20440 ---- Animal proteins ---- 28S ribosomal protein S25, mitochondrial Source.6661: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7 Source.6662: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5 Source.6663: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.6664: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.6665: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1 Source.6666: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1 Source.6667: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.6668: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3 Source.6669: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8 Source.6670: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.6671: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.6672: DFBPPR20461 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm8 Source.6673: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.6674: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79 Source.6675: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C Source.6676: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.6677: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial Source.6678: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.6679: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.6680: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.6681: DFBPPR20478 ---- Animal proteins ---- Macoilin Source.6682: DFBPPR20479 ---- Animal proteins ---- Ribonuclease P protein subunit p29 Source.6683: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54 Source.6684: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1 Source.6685: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.6686: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase Source.6687: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein Source.6688: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.6689: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.6690: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial Source.6691: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan Source.6692: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.6693: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog Source.6694: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog Source.6695: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2 Source.6696: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102 Source.6697: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1 Source.6698: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial Source.6699: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.6700: DFBPPR20509 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 1 Source.6701: DFBPPR20510 ---- Animal proteins ---- Josephin-1 Source.6702: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.6703: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29 Source.6704: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial Source.6705: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.6706: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6 Source.6707: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2 Source.6708: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.6709: DFBPPR20522 ---- Animal proteins ---- Serine palmitoyltransferase small subunit A Source.6710: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36 Source.6711: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6 Source.6712: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.6713: DFBPPR20529 ---- Animal proteins ---- Transgelin Source.6714: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.6715: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2 Source.6716: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.6717: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.6718: DFBPPR20546 ---- Animal proteins ---- Odorant-binding protein Source.6719: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230 Source.6720: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1 Source.6721: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.6722: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.6723: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.6724: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4 Source.6725: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.6726: DFBPPR20557 ---- Animal proteins ---- Asporin Source.6727: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial Source.6728: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase Source.6729: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D Source.6730: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.6731: DFBPPR20570 ---- Animal proteins ---- Intraflagellar transport protein 22 homolog Source.6732: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.6733: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.6734: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a Source.6735: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog Source.6736: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.6737: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.6738: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein Source.6739: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.6740: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.6741: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi Source.6742: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.6743: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein Source.6744: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein Source.6745: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.6746: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2 Source.6747: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1 Source.6748: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.6749: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.6750: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.6751: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.6752: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase Source.6753: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.6754: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13 Source.6755: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.6756: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.6757: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2 Source.6758: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5 Source.6759: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3 Source.6760: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.6761: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5 Source.6762: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C Source.6763: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.6764: DFBPPR20637 ---- Animal proteins ---- Mitochondrial mRNA pseudouridine synthase RPUSD3 Source.6765: DFBPPR20638 ---- Animal proteins ---- DPH3 homolog Source.6766: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.6767: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52 Source.6768: DFBPPR20647 ---- Animal proteins ---- Annexin A8 Source.6769: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog Source.6770: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial Source.6771: DFBPPR20651 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 2, mitochondrial Source.6772: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A Source.6773: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein Source.6774: DFBPPR20656 ---- Animal proteins ---- Protein archease Source.6775: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.6776: DFBPPR20659 ---- Animal proteins ---- Cystinosin Source.6777: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3 Source.6778: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.6779: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein Source.6780: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2 Source.6781: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4 Source.6782: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.6783: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.6784: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.6785: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2 Source.6786: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14 Source.6787: DFBPPR20679 ---- Animal proteins ---- Ragulator complex protein LAMTOR4 Source.6788: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.6789: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.6790: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.6791: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial Source.6792: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial Source.6793: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11 Source.6794: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.6795: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.6796: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.6797: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.6798: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2 Source.6799: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.6800: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.6801: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like Source.6802: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.6803: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial Source.6804: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A Source.6805: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.6806: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase Source.6807: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase Source.6808: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21 Source.6809: DFBPPR20721 ---- Animal proteins ---- Myomesin-1 Source.6810: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.6811: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.6812: DFBPPR20728 ---- Animal proteins ---- Serine protease 45 Source.6813: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6 Source.6814: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2 Source.6815: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.6816: DFBPPR20736 ---- Animal proteins ---- Osteopontin-K Source.6817: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.6818: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial Source.6819: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.6820: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5 Source.6821: DFBPPR20743 ---- Animal proteins ---- Myozenin-1 Source.6822: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.6823: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B Source.6824: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1 Source.6825: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog Source.6826: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33 Source.6827: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.6828: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7 Source.6829: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B Source.6830: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9 Source.6831: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.6832: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2 Source.6833: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin Source.6834: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein Source.6835: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.6836: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.6837: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15 Source.6838: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.6839: DFBPPR20780 ---- Animal proteins ---- Retinol-binding protein 5 Source.6840: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1 Source.6841: DFBPPR20786 ---- Animal proteins ---- 40S ribosomal protein S27 Source.6842: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.6843: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6 Source.6844: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1 Source.6845: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.6846: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171 Source.6847: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.6848: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.6849: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2 Source.6850: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13 Source.6851: DFBPPR20809 ---- Animal proteins ---- F-box and leucine-rich protein 22 Source.6852: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148 Source.6853: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14 Source.6854: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.6855: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1 Source.6856: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3 Source.6857: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT Source.6858: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2 Source.6859: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.6860: DFBPPR20821 ---- Animal proteins ---- Prefoldin subunit 4 Source.6861: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.6862: DFBPPR20824 ---- Animal proteins ---- CD151 antigen Source.6863: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial Source.6864: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.6865: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog Source.6866: DFBPPR20832 ---- Animal proteins ---- Metalloproteinase inhibitor 4 Source.6867: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2 Source.6868: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12 Source.6869: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.6870: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.6871: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2 Source.6872: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.6873: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1 Source.6874: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.6875: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.6876: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.6877: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.6878: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.6879: DFBPPR20853 ---- Animal proteins ---- Hemopexin Source.6880: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase Source.6881: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.6882: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta Source.6883: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2 Source.6884: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.6885: DFBPPR20871 ---- Animal proteins ---- Iron-sulfur cluster assembly 2 homolog, mitochondrial Source.6886: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C Source.6887: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.6888: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2 Source.6889: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.6890: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B Source.6891: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237 Source.6892: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3 Source.6893: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta Source.6894: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3 Source.6895: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.6896: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1 Source.6897: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.6898: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.6899: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B Source.6900: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna Source.6901: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a Source.6902: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3 Source.6903: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.6904: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor Source.6905: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27 Source.6906: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator Source.6907: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2 Source.6908: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.6909: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.6910: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.6911: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.6912: DFBPPR20919 ---- Animal proteins ---- Protein cornichon homolog 4 Source.6913: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.6914: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1 Source.6915: DFBPPR20922 ---- Animal proteins ---- Calcipressin-2 Source.6916: DFBPPR20923 ---- Animal proteins ---- Cystatin-A Source.6917: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta Source.6918: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8 Source.6919: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1 Source.6920: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial Source.6921: DFBPPR20930 ---- Animal proteins ---- Centromere protein U Source.6922: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14 Source.6923: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A Source.6924: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18 Source.6925: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25 Source.6926: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4 Source.6927: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.6928: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1 Source.6929: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.6930: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.6931: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1 Source.6932: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2 Source.6933: DFBPPR20950 ---- Animal proteins ---- WAP four-disulfide core domain protein 18 Source.6934: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1 Source.6935: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial Source.6936: DFBPPR20953 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.6937: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.6938: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.6939: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17 Source.6940: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog Source.6941: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.6942: DFBPPR20964 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP2 Source.6943: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein Source.6944: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.6945: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1 Source.6946: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3 Source.6947: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.6948: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit Source.6949: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.6950: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.6951: DFBPPR20982 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.6952: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.6953: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.6954: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1 Source.6955: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7 Source.6956: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27 Source.6957: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.6958: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181 Source.6959: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821 Source.6960: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2 Source.6961: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha Source.6962: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.6963: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.6964: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase Source.6965: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2 Source.6966: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.6967: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.6968: DFBPPR21014 ---- Animal proteins ---- Transmembrane protein 258 Source.6969: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A Source.6970: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.6971: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.6972: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21 Source.6973: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5 Source.6974: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein Source.6975: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.6976: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein Source.6977: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B Source.6978: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C Source.6979: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.6980: DFBPPR21034 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 25 Source.6981: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial Source.6982: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.6983: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.6984: DFBPPR21040 ---- Animal proteins ---- Neuritin Source.6985: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.6986: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.6987: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10 Source.6988: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.6989: DFBPPR21051 ---- Animal proteins ---- SH2 domain-containing protein 1A Source.6990: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D Source.6991: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.6992: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.6993: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B Source.6994: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2 Source.6995: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.6996: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.6997: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.6998: DFBPPR21066 ---- Animal proteins ---- 40S ribosomal protein S27-like Source.6999: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.7000: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog Source.7001: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.7002: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial Source.7003: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.7004: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A Source.7005: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22 Source.7006: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7 Source.7007: DFBPPR21083 ---- Animal proteins ---- TRAF-interacting protein with FHA domain-containing protein A Source.7008: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.7009: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.7010: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43 Source.7011: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.7012: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.7013: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148 Source.7014: DFBPPR21100 ---- Animal proteins ---- Cochlin Source.7015: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.7016: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase Source.7017: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2 Source.7018: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3 Source.7019: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.7020: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7 Source.7021: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16 Source.7022: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein Source.7023: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5 Source.7024: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3 Source.7025: DFBPPR21122 ---- Animal proteins ---- Derlin-3 Source.7026: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor Source.7027: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial Source.7028: DFBPPR21128 ---- Animal proteins ---- Stefin-C Source.7029: DFBPPR21130 ---- Animal proteins ---- Transmembrane protein 17 Source.7030: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.7031: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B Source.7032: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.7033: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.7034: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.7035: DFBPPR21144 ---- Animal proteins ---- Repressor of RNA polymerase III transcription MAF1 homolog Source.7036: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.7037: DFBPPR21149 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 4 Source.7038: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.7039: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350 Source.7040: DFBPPR21152 ---- Animal proteins ---- Protein S100-A2 Source.7041: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel Source.7042: DFBPPR21155 ---- Animal proteins ---- Cyclin-H Source.7043: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1 Source.7044: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.7045: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4 Source.7046: DFBPPR21160 ---- Animal proteins ---- Prefoldin subunit 3 Source.7047: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6 Source.7048: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22 Source.7049: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1 Source.7050: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.7051: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A Source.7052: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial Source.7053: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52 Source.7054: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase Source.7055: DFBPPR21177 ---- Animal proteins ---- Ran guanine nucleotide release factor Source.7056: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5 Source.7057: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7 Source.7058: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173 Source.7059: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2 Source.7060: DFBPPR21187 ---- Animal proteins ---- Plasmolipin Source.7061: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.7062: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.7063: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.7064: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin Source.7065: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.7066: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.7067: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2 Source.7068: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.7069: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog Source.7070: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.7071: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1 Source.7072: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.7073: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2 Source.7074: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.7075: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1 Source.7076: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.7077: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4 Source.7078: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.7079: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.7080: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein Source.7081: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2 Source.7082: DFBPPR21239 ---- Animal proteins ---- Coordinator of PRMT5 and differentiation stimulator Source.7083: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase Source.7084: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1 Source.7085: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36 Source.7086: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal Source.7087: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial Source.7088: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3 Source.7089: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3 Source.7090: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8 Source.7091: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7 Source.7092: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.7093: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6 Source.7094: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B Source.7095: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.7096: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.7097: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4 Source.7098: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21 Source.7099: DFBPPR21272 ---- Animal proteins ---- Testin Source.7100: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4 Source.7101: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.7102: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11 Source.7103: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.7104: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen Source.7105: DFBPPR21290 ---- Animal proteins ---- Metaxin-1 Source.7106: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b Source.7107: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial Source.7108: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.7109: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3 Source.7110: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.7111: DFBPPR21302 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC9 Source.7112: DFBPPR21303 ---- Animal proteins ---- Palmdelphin Source.7113: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial Source.7114: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.7115: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18 Source.7116: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.7117: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein Source.7118: DFBPPR21322 ---- Animal proteins ---- Zinc finger protein 227 Source.7119: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34 Source.7120: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3 Source.7121: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.7122: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3 Source.7123: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.7124: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9 Source.7125: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.7126: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein Source.7127: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.7128: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein Source.7129: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.7130: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.7131: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3 Source.7132: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform Source.7133: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1 Source.7134: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.7135: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4 Source.7136: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.7137: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24 Source.7138: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18 Source.7139: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1 Source.7140: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog Source.7141: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.7142: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420 Source.7143: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2 Source.7144: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2 Source.7145: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4 Source.7146: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.7147: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.7148: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.7149: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4 Source.7150: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.7151: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3 Source.7152: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.7153: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1 Source.7154: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.7155: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.7156: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A Source.7157: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2 Source.7158: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1 Source.7159: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.7160: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog Source.7161: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.7162: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.7163: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like Source.7164: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.7165: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2 Source.7166: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.7167: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.7168: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.7169: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.7170: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84 Source.7171: DFBPPR21425 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 A Source.7172: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1 Source.7173: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.7174: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A Source.7175: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B Source.7176: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.7177: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207 Source.7178: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8 Source.7179: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A Source.7180: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2 Source.7181: DFBPPR21451 ---- Animal proteins ---- Nurim Source.7182: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330 Source.7183: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.7184: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2 Source.7185: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein Source.7186: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.7187: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.7188: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.7189: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.7190: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.7191: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.7192: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9 Source.7193: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial Source.7194: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8 Source.7195: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.7196: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2 Source.7197: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1 Source.7198: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14 Source.7199: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial Source.7200: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.7201: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2 Source.7202: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.7203: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like Source.7204: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.7205: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1 Source.7206: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3 Source.7207: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40 Source.7208: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3 Source.7209: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.7210: DFBPPR21509 ---- Animal proteins ---- Myoneurin Source.7211: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.7212: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B Source.7213: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2 Source.7214: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1 Source.7215: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20 Source.7216: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2 Source.7217: DFBPPR21521 ---- Animal proteins ---- Active regulator of SIRT1 Source.7218: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1 Source.7219: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2 Source.7220: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11 Source.7221: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.7222: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225 Source.7223: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19 Source.7224: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.7225: DFBPPR21538 ---- Animal proteins ---- Small cell adhesion glycoprotein Source.7226: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.7227: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A Source.7228: DFBPPR21542 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6c Source.7229: DFBPPR21545 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1 Source.7230: DFBPPR21547 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.7231: DFBPPR21549 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit Y Source.7232: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22 Source.7233: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4 Source.7234: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.7235: DFBPPR21555 ---- Animal proteins ---- Zinc finger and SCAN domain-containing protein 26 Source.7236: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55 Source.7237: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6 Source.7238: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.7239: DFBPPR21564 ---- Animal proteins ---- HORMA domain-containing protein 2 Source.7240: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.7241: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.7242: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B Source.7243: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2 Source.7244: DFBPPR21574 ---- Animal proteins ---- Parvalbumin alpha Source.7245: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein Source.7246: DFBPPR21582 ---- Animal proteins ---- MORN repeat-containing protein 4 Source.7247: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2 Source.7248: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19 Source.7249: DFBPPR21586 ---- Animal proteins ---- Cyclin-C Source.7250: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.7251: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.7252: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.7253: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.7254: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like Source.7255: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.7256: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.7257: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3 Source.7258: DFBPPR21599 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.7259: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.7260: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138 Source.7261: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1 Source.7262: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.7263: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.7264: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.7265: DFBPPR21617 ---- Animal proteins ---- Proteasome assembly chaperone 3 Source.7266: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2 Source.7267: DFBPPR21620 ---- Animal proteins ---- Claudin-12 Source.7268: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a Source.7269: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1 Source.7270: DFBPPR21625 ---- Animal proteins ---- 40S ribosomal protein S24 Source.7271: DFBPPR21629 ---- Animal proteins ---- Annexin A3 Source.7272: DFBPPR21630 ---- Animal proteins ---- Maspardin Source.7273: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14 Source.7274: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta Source.7275: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19 Source.7276: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial Source.7277: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44 Source.7278: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6 Source.7279: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1 Source.7280: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.7281: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein Source.7282: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6 Source.7283: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.7284: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial Source.7285: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8 Source.7286: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2 Source.7287: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1 Source.7288: DFBPPR21663 ---- Animal proteins ---- Trafficking protein particle complex subunit 6B Source.7289: DFBPPR21664 ---- Animal proteins ---- Signal recognition particle 14 kDa protein Source.7290: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.7291: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.7292: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10 Source.7293: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4 Source.7294: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A Source.7295: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.7296: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26 Source.7297: DFBPPR21682 ---- Animal proteins ---- Protein SYS1 homolog Source.7298: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like Source.7299: DFBPPR21686 ---- Animal proteins ---- FXYD domain-containing ion transport regulator 6 Source.7300: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2 Source.7301: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18 Source.7302: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1 Source.7303: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.7304: DFBPPR21698 ---- Animal proteins ---- Alpha-hemoglobin-stabilizing protein Source.7305: DFBPPR21699 ---- Animal proteins ---- Transmembrane protein 208 Source.7306: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B Source.7307: DFBPPR21706 ---- Animal proteins ---- Small membrane A-kinase anchor protein Source.7308: DFBPPR21708 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial Source.7309: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog Source.7310: DFBPPR21712 ---- Animal proteins ---- Serpin E3 Source.7311: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.7312: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic Source.7313: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.7314: DFBPPR21719 ---- Animal proteins ---- Protein reprimo Source.7315: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.7316: DFBPPR21723 ---- Animal proteins ---- OCIA domain-containing protein 1 Source.7317: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.7318: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.7319: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial Source.7320: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2 Source.7321: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1 Source.7322: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.7323: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1 Source.7324: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A Source.7325: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15 Source.7326: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog Source.7327: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.7328: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.7329: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.7330: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta Source.7331: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog Source.7332: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10 Source.7333: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.7334: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.7335: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.7336: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.7337: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6 Source.7338: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.7339: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.7340: DFBPPR21771 ---- Animal proteins ---- RAD9, HUS1, RAD1-interacting nuclear orphan protein 1 Source.7341: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.7342: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog Source.7343: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B Source.7344: DFBPPR21777 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 10 Source.7345: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.7346: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.7347: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog Source.7348: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2 Source.7349: DFBPPR21789 ---- Animal proteins ---- Protein kish-B Source.7350: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.7351: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.7352: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial Source.7353: DFBPPR21793 ---- Animal proteins ---- Dynein light chain Tctex-type protein 2B Source.7354: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like Source.7355: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.7356: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.7357: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B Source.7358: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.7359: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein Source.7360: DFBPPR21805 ---- Animal proteins ---- 60S ribosomal protein L19 Source.7361: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1 Source.7362: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.7363: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.7364: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.7365: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog Source.7366: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.7367: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2 Source.7368: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24 Source.7369: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410 Source.7370: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11 Source.7371: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.7372: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526 Source.7373: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1 Source.7374: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1 Source.7375: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier Source.7376: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2 Source.7377: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein Source.7378: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein Source.7379: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.7380: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B Source.7381: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.7382: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1 Source.7383: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2 Source.7384: DFBPPR21846 ---- Animal proteins ---- Izumo sperm-egg fusion protein 3 Source.7385: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.7386: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.7387: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B Source.7388: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS Source.7389: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3 Source.7390: DFBPPR21869 ---- Animal proteins ---- Centromere protein O Source.7391: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.7392: DFBPPR21871 ---- Animal proteins ---- Serpin B10 Source.7393: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein Source.7394: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113 Source.7395: DFBPPR21876 ---- Animal proteins ---- IgA-inducing protein Source.7396: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B Source.7397: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.7398: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1 Source.7399: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial Source.7400: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39 Source.7401: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.7402: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1 Source.7403: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor Source.7404: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6 Source.7405: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial Source.7406: DFBPPR21892 ---- Animal proteins ---- COMM domain-containing protein 9 Source.7407: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5 Source.7408: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3 Source.7409: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.7410: DFBPPR21902 ---- Animal proteins ---- Centromere protein N Source.7411: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35 Source.7412: DFBPPR21905 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 2 Source.7413: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.7414: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2 Source.7415: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11 Source.7416: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog Source.7417: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1 Source.7418: DFBPPR21912 ---- Animal proteins ---- Death-associated protein 1 Source.7419: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2 Source.7420: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13 Source.7421: DFBPPR21915 ---- Animal proteins ---- Tetraspanin-13 Source.7422: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6 Source.7423: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2 Source.7424: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12 Source.7425: DFBPPR21920 ---- Animal proteins ---- Protein DPCD Source.7426: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4 Source.7427: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog Source.7428: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14 Source.7429: DFBPPR21927 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase-interacting protein Source.7430: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.7431: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11 Source.7432: DFBPPR21935 ---- Animal proteins ---- Sentan Source.7433: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.7434: DFBPPR21938 ---- Animal proteins ---- Protein RER1 Source.7435: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.7436: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.7437: DFBPPR21941 ---- Animal proteins ---- MOB kinase activator 3A Source.7438: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.7439: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.7440: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.7441: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414 Source.7442: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.7443: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.7444: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1 Source.7445: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3 Source.7446: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.7447: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15 Source.7448: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.7449: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.7450: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial Source.7451: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1 Source.7452: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1 Source.7453: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.7454: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101 Source.7455: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog Source.7456: DFBPPR21977 ---- Animal proteins ---- Protein ARV1 Source.7457: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.7458: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.7459: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.7460: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like Source.7461: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.7462: DFBPPR21994 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial Source.7463: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2 Source.7464: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1 Source.7465: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1 Source.7466: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3 Source.7467: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.7468: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.7469: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81 Source.7470: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.7471: DFBPPR22012 ---- Animal proteins ---- GRB2-related adapter protein Source.7472: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3 Source.7473: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.7474: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2 Source.7475: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial Source.7476: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1 Source.7477: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2 Source.7478: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4 Source.7479: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1 Source.7480: DFBPPR22031 ---- Animal proteins ---- KxDL motif-containing protein 1 Source.7481: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.7482: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.7483: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3 Source.7484: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12 Source.7485: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C Source.7486: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37 Source.7487: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B Source.7488: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.7489: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.7490: DFBPPR22048 ---- Animal proteins ---- Regulated endocrine-specific protein 18 Source.7491: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ Source.7492: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B Source.7493: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3 Source.7494: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.7495: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A Source.7496: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.7497: DFBPPR22068 ---- Animal proteins ---- Protein GPR108 Source.7498: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.7499: DFBPPR22070 ---- Animal proteins ---- Maturin Source.7500: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B Source.7501: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8 Source.7502: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6 Source.7503: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4 Source.7504: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.7505: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.7506: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1 Source.7507: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7 Source.7508: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor Source.7509: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3 Source.7510: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.7511: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41 Source.7512: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B Source.7513: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog Source.7514: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2 Source.7515: DFBPPR22099 ---- Animal proteins ---- Beta-centractin Source.7516: DFBPPR22100 ---- Animal proteins ---- Centromere protein M Source.7517: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.7518: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2 Source.7519: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1 Source.7520: DFBPPR22105 ---- Animal proteins ---- Centromere protein L Source.7521: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2 Source.7522: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1 Source.7523: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1 Source.7524: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.7525: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain Source.7526: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4 Source.7527: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.7528: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog Source.7529: DFBPPR22125 ---- Animal proteins ---- 40S ribosomal protein S16 Source.7530: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11 Source.7531: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.7532: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.7533: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2 Source.7534: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a Source.7535: DFBPPR22133 ---- Animal proteins ---- MOB kinase activator 3C Source.7536: DFBPPR22134 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8 Source.7537: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.7538: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1 Source.7539: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2 Source.7540: DFBPPR22141 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1 Source.7541: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1 Source.7542: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.7543: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.7544: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.7545: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.7546: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog Source.7547: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1 Source.7548: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24 Source.7549: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.7550: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2 Source.7551: DFBPPR22164 ---- Animal proteins ---- Complex III assembly factor LYRM7 Source.7552: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143 Source.7553: DFBPPR22170 ---- Animal proteins ---- Transmembrane protein 106C Source.7554: DFBPPR22173 ---- Animal proteins ---- Electron transfer flavoprotein regulatory factor 1 Source.7555: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.7556: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.7557: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.7558: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.7559: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8 Source.7560: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2 Source.7561: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.7562: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5 Source.7563: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5 Source.7564: DFBPPR22193 ---- Animal proteins ---- CapZ-interacting protein Source.7565: DFBPPR22194 ---- Animal proteins ---- Cystatin-9 Source.7566: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2 Source.7567: DFBPPR22196 ---- Animal proteins ---- Bladder cancer-associated protein Source.7568: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.7569: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.7570: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4 Source.7571: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein Source.7572: DFBPPR22213 ---- Animal proteins ---- Protein TEX261 Source.7573: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.7574: DFBPPR22218 ---- Animal proteins ---- Galectin-4 Source.7575: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.7576: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.7577: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9 Source.7578: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8 Source.7579: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36 Source.7580: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22 Source.7581: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.7582: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.7583: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300 Source.7584: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.7585: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.7586: DFBPPR22239 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.7587: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.7588: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.7589: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3 Source.7590: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26 Source.7591: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.7592: DFBPPR22249 ---- Animal proteins ---- CXXC motif containing zinc binding protein Source.7593: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1 Source.7594: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.7595: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34 Source.7596: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.7597: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18 Source.7598: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog Source.7599: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog Source.7600: DFBPPR22266 ---- Animal proteins ---- Vexin Source.7601: DFBPPR22267 ---- Animal proteins ---- Keratin-associated protein 12-2 Source.7602: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1 Source.7603: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial Source.7604: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.7605: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.7606: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2 Source.7607: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1 Source.7608: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial Source.7609: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2 Source.7610: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31 Source.7611: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein Source.7612: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.7613: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.7614: DFBPPR22309 ---- Animal proteins ---- Spermatogenesis-associated protein 9 Source.7615: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1 Source.7616: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218 Source.7617: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35 Source.7618: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.7619: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70 Source.7620: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7 Source.7621: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39 Source.7622: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.7623: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3 Source.7624: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.7625: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1 Source.7626: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.7627: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1 Source.7628: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.7629: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A Source.7630: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2 Source.7631: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog Source.7632: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11 Source.7633: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80 Source.7634: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.7635: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6 Source.7636: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein Source.7637: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.7638: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.7639: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.7640: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.7641: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein Source.7642: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23 Source.7643: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2 Source.7644: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1 Source.7645: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4 Source.7646: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.7647: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92 Source.7648: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like Source.7649: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein Source.7650: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1 Source.7651: DFBPPR22379 ---- Animal proteins ---- Ribosomal biogenesis factor Source.7652: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39 Source.7653: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B Source.7654: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1 Source.7655: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.7656: DFBPPR22391 ---- Animal proteins ---- Transmembrane protein 88B Source.7657: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2 Source.7658: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein Source.7659: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog Source.7660: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.7661: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1 Source.7662: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9 Source.7663: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.7664: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5 Source.7665: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.7666: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.7667: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1 Source.7668: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.7669: DFBPPR22424 ---- Animal proteins ---- Transmembrane protein 243 Source.7670: DFBPPR22426 ---- Animal proteins ---- Single-pass membrane and coiled-coil domain-containing protein 4 Source.7671: DFBPPR22427 ---- Animal proteins ---- Coiled-coil domain-containing protein 58 Source.7672: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.7673: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog Source.7674: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein Source.7675: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3 Source.7676: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1 Source.7677: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein Source.7678: DFBPPR22446 ---- Animal proteins ---- Tektin-5 Source.7679: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.7680: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9 Source.7681: DFBPPR22452 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 37 Source.7682: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2 Source.7683: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97 Source.7684: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein Source.7685: DFBPPR22459 ---- Animal proteins ---- SCP2 sterol-binding domain-containing protein 1 Source.7686: DFBPPR22461 ---- Animal proteins ---- Ashwin Source.7687: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13 Source.7688: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein Source.7689: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.7690: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog Source.7691: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.7692: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3 Source.7693: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1 Source.7694: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144 Source.7695: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223 Source.7696: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3 Source.7697: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.7698: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog Source.7699: DFBPPR22491 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1B Source.7700: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1 Source.7701: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.7702: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1 Source.7703: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1 Source.7704: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.7705: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog Source.7706: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46 Source.7707: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.7708: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2 Source.7709: DFBPPR22505 ---- Animal proteins ---- Protein HP-20 homolog Source.7710: DFBPPR22507 ---- Animal proteins ---- Secernin-3 Source.7711: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101 Source.7712: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2 Source.7713: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15 Source.7714: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248 Source.7715: DFBPPR22522 ---- Animal proteins ---- Coiled-coil domain-containing protein 126 Source.7716: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54 Source.7717: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8 Source.7718: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29 Source.7719: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169 Source.7720: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251 Source.7721: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9 Source.7722: DFBPPR22536 ---- Animal proteins ---- Suprabasin Source.7723: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.7724: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.7725: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25 Source.7726: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.7727: DFBPPR22544 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 2 Source.7728: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1 Source.7729: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.7730: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2 Source.7731: DFBPPR22556 ---- Animal proteins ---- Protein maestro Source.7732: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1 Source.7733: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187 Source.7734: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein Source.7735: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein Source.7736: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5 Source.7737: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein Source.7738: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1 Source.7739: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.7740: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.7741: DFBPPR22576 ---- Animal proteins ---- UPF0547 protein C16orf87 homolog Source.7742: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1 Source.7743: DFBPPR22585 ---- Animal proteins ---- UPF0449 protein C19orf25 homolog Source.7744: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.7745: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19 Source.7746: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268 Source.7747: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.7748: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.7749: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.7750: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.7751: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53 Source.7752: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36 Source.7753: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.7754: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215 Source.7755: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105 Source.7756: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71 Source.7757: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54 Source.7758: DFBPPR22618 ---- Animal proteins ---- BSD domain-containing protein 1 Source.7759: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42 Source.7760: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72 Source.7761: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1 Source.7762: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61 Source.7763: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30 Source.7764: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175 Source.7765: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157 Source.7766: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog Source.7767: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1 Source.7768: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32 Source.7769: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.7770: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog Source.7771: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog Source.7772: DFBPPR22671 ---- Animal proteins ---- Uncharacterized protein C1orf185 homolog Source.7773: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89 Source.7774: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog Source.7775: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.7776: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3 Source.7777: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.7778: DFBPPR22693 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1 Source.7779: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein Source.7780: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A Source.7781: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28 Source.7782: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.7783: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16 Source.7784: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D Source.7785: DFBPPR22713 ---- Animal proteins ---- UPF0728 protein C10orf53 homolog Source.7786: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein Source.7787: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog Source.7788: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog Source.7789: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog Source.7790: DFBPPR22729 ---- Animal proteins ---- UPF0538 protein C2orf76 homolog Source.7791: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1 Source.7792: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1 Source.7793: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog Source.7794: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein Source.7795: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog Source.7796: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog Source.7797: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog Source.7798: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog Source.7799: DFBPPR22751 ---- Animal proteins ---- Uncharacterized protein C8orf74 homolog Source.7800: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog Source.7801: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog Source.7802: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog Source.7803: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog Source.7804: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6 Source.7805: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.7806: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.7807: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.7808: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.7809: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.7810: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.7811: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.7812: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.7813: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.7814: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.7815: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.7816: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.7817: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.7818: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase Source.7819: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.7820: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.7821: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.7822: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.7823: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.7824: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.7825: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.7826: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.7827: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.7828: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.7829: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.7830: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.7831: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.7832: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.7833: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.7834: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.7835: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1 Source.7836: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.7837: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.7838: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.7839: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1 Source.7840: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.7841: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.7842: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.7843: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.7844: DFBPPR8592 ---- Animal proteins ---- Interleukin-18 Source.7845: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.7846: DFBPPR8595 ---- Animal proteins ---- Annexin A4 Source.7847: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.7848: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.7849: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.7850: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.7851: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein Source.7852: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.7853: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.7854: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.7855: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6 Source.7856: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.7857: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase Source.7858: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.7859: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.7860: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.7861: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.7862: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.7863: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1 Source.7864: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.7865: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.7866: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1 Source.7867: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.7868: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.7869: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C Source.7870: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.7871: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.7872: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.7873: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase Source.7874: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2 Source.7875: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.7876: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.7877: DFBPPR8647 ---- Animal proteins ---- Beclin-1 Source.7878: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.7879: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.7880: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.7881: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.7882: DFBPPR8655 ---- Animal proteins ---- Azurocidin Source.7883: DFBPPR8657 ---- Animal proteins ---- Annexin A2 Source.7884: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog Source.7885: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.7886: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.7887: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.7888: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.7889: DFBPPR8668 ---- Animal proteins ---- Annexin A1 Source.7890: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.7891: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.7892: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.7893: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.7894: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.7895: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.7896: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog Source.7897: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.7898: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.7899: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.7900: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.7901: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.7902: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor Source.7903: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.7904: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.7905: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.7906: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1 Source.7907: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.7908: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.7909: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.7910: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.7911: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein Source.7912: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.7913: DFBPPR8707 ---- Animal proteins ---- Flotillin-1 Source.7914: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.7915: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.7916: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.7917: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.7918: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.7919: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.7920: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6 Source.7921: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.7922: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.7923: DFBPPR8720 ---- Animal proteins ---- Interleukin-4 Source.7924: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.7925: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.7926: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.7927: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1 Source.7928: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.7929: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase Source.7930: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A Source.7931: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.7932: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H Source.7933: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.7934: DFBPPR8738 ---- Animal proteins ---- Interleukin-8 Source.7935: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.7936: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.7937: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.7938: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9 Source.7939: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1 Source.7940: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.7941: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.7942: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.7943: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.7944: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.7945: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.7946: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.7947: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.7948: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin Source.7949: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein Source.7950: DFBPPR8758 ---- Animal proteins ---- Caveolin-2 Source.7951: DFBPPR8759 ---- Animal proteins ---- Caveolin-3 Source.7952: DFBPPR8760 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.7953: DFBPPR8761 ---- Animal proteins ---- VIP peptides Source.7954: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.7955: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.7956: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.7957: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.7958: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.7959: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.7960: DFBPPR8771 ---- Animal proteins ---- Cofilin-1 Source.7961: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.7962: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.7963: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.7964: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.7965: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.7966: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.7967: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.7968: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.7969: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.7970: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain Source.7971: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.7972: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.7973: DFBPPR8787 ---- Animal proteins ---- Cathepsin D Source.7974: DFBPPR8788 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.7975: DFBPPR8789 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.7976: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain Source.7977: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.7978: DFBPPR8793 ---- Animal proteins ---- Histone H4 Source.7979: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.7980: DFBPPR8796 ---- Animal proteins ---- UMP-CMP kinase Source.7981: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.7982: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.7983: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase Source.7984: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II Source.7985: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase Source.7986: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.7987: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.7988: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S Source.7989: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.7990: DFBPPR8810 ---- Animal proteins ---- Follistatin Source.7991: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.7992: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.7993: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.7994: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.7995: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.7996: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.7997: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.7998: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.7999: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2 Source.8000: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.8001: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.8002: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.8003: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1 Source.8004: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance Source.8005: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.8006: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4 Source.8007: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase Source.8008: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1 Source.8009: DFBPPR8843 ---- Animal proteins ---- Pepsin A Source.8010: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.8011: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.8012: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.8013: DFBPPR8848 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase Source.8014: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.8015: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog Source.8016: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide Source.8017: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.8018: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2 Source.8019: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.8020: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.8021: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8022: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8023: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8024: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.8025: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.8026: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B Source.8027: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.8028: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.8029: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.8030: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.8031: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.8032: DFBPPR8906 ---- Animal proteins ---- Sialidase-1 Source.8033: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.8034: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.8035: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.8036: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.8037: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.8038: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.8039: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.8040: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.8041: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.8042: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.8043: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha Source.8044: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha Source.8045: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.8046: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha Source.8047: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.8048: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.8049: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.8050: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.8051: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.8052: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.8053: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.8054: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.8055: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.8056: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta Source.8057: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.8058: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3 Source.8059: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain Source.8060: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain Source.8061: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component Source.8062: DFBPPR9005 ---- Animal proteins ---- Protein amnionless Source.8063: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.8064: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.8065: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.8066: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.8067: DFBPPR9015 ---- Animal proteins ---- Serotransferrin Source.8068: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.8069: DFBPPR9018 ---- Animal proteins ---- Transthyretin Source.8070: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.8071: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.8072: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.8073: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.8074: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.8075: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.8076: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.8077: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.8078: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.8079: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.8080: DFBPPR9039 ---- Animal proteins ---- Desmin Source.8081: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.8082: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.8083: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.8084: DFBPPR9044 ---- Animal proteins ---- Albumin Source.8085: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3 Source.8086: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.8087: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.8088: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4 Source.8089: DFBPPR9052 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B Source.8090: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf Source.8091: DFBPPR9061 ---- Animal proteins ---- Caspase-1 Source.8092: DFBPPR9065 ---- Animal proteins ---- GTPase NRas Source.8093: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1 Source.8094: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.8095: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.8096: DFBPPR9069 ---- Animal proteins ---- E-selectin Source.8097: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.8098: DFBPPR9072 ---- Animal proteins ---- CD9 antigen Source.8099: DFBPPR9073 ---- Animal proteins ---- Vitronectin Source.8100: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.8101: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.8102: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.8103: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.8104: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.8105: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.8106: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.8107: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.8108: DFBPPR9093 ---- Animal proteins ---- Hemopexin Source.8109: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5 Source.8110: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.8111: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1 Source.8112: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32 Source.8113: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.8114: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.8115: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.8116: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.8117: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.8118: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.8119: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.8120: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.8121: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1 Source.8122: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.8123: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6 Source.8124: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.8125: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.8126: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6 Source.8127: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.8128: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.8129: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42 Source.8130: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.8131: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.8132: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.8133: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.8134: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1 Source.8135: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.8136: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.8137: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.8138: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1 Source.8139: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II Source.8140: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.8141: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.8142: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.8143: DFBPPR9149 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1 Source.8144: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.8145: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.8146: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.8147: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.8148: DFBPPR9159 ---- Animal proteins ---- Hematopoietic cell signal transducer Source.8149: DFBPPR9160 ---- Animal proteins ---- Acylphosphatase-1 Source.8150: DFBPPR9162 ---- Animal proteins ---- Thioredoxin Source.8151: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.8152: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.8153: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.8154: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.8155: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase Source.8156: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.8157: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.8158: DFBPPR9174 ---- Animal proteins ---- Ficolin-1 Source.8159: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3 Source.8160: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6 Source.8161: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.8162: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.8163: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.8164: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.8165: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.8166: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10 Source.8167: DFBPPR9188 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain Source.8168: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2 Source.8169: DFBPPR9192 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase Source.8170: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein Source.8171: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.8172: DFBPPR9199 ---- Animal proteins ---- 60S ribosomal protein L23 Source.8173: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.8174: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.8175: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.8176: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.8177: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein Source.8178: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1 Source.8179: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.8180: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase Source.8181: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.8182: DFBPPR9218 ---- Animal proteins ---- POU domain, class 3, transcription factor 3 Source.8183: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.8184: DFBPPR9221 ---- Animal proteins ---- Catalase Source.8185: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.8186: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.8187: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.8188: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1 Source.8189: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.8190: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C Source.8191: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.8192: DFBPPR9236 ---- Animal proteins ---- Radixin Source.8193: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.8194: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B Source.8195: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29 Source.8196: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.8197: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.8198: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1 Source.8199: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor Source.8200: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.8201: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.8202: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.8203: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase Source.8204: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.8205: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.8206: DFBPPR9265 ---- Animal proteins ---- Pantetheinase Source.8207: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.8208: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase Source.8209: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent Source.8210: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.8211: DFBPPR9272 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.8212: DFBPPR9273 ---- Animal proteins ---- C-C motif chemokine 4 Source.8213: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase Source.8214: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type Source.8215: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.8216: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.8217: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.8218: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.8219: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.8220: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.8221: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27 Source.8222: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.8223: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.8224: DFBPPR9293 ---- Animal proteins ---- Calcium load-activated calcium channel Source.8225: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2 Source.8226: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1 Source.8227: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4 Source.8228: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.8229: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2 Source.8230: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.8231: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.8232: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.8233: DFBPPR9308 ---- Animal proteins ---- Aromatase 3 Source.8234: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.8235: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.8236: DFBPPR9311 ---- Animal proteins ---- Beta-defensin 1 Source.8237: DFBPPR9320 ---- Animal proteins ---- Aromatase 1 Source.8238: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.8239: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.8240: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha Source.8241: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1 Source.8242: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.8243: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.8244: DFBPPR9328 ---- Animal proteins ---- Cofilin-2 Source.8245: DFBPPR9329 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2 Source.8246: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor Source.8247: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.8248: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.8249: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.8250: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.8251: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.8252: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.8253: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin Source.8254: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.8255: DFBPPR9345 ---- Animal proteins ---- Relaxin-3 Source.8256: DFBPPR9346 ---- Animal proteins ---- Myozenin-1 Source.8257: DFBPPR9347 ---- Animal proteins ---- C-reactive protein Source.8258: DFBPPR9348 ---- Animal proteins ---- 60S ribosomal protein L18 Source.8259: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor Source.8260: DFBPPR9356 ---- Animal proteins ---- Odorant-binding protein Source.8261: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.8262: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.8263: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.8264: DFBPPR9363 ---- Animal proteins ---- Moesin Source.8265: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.8266: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.8267: DFBPPR9366 ---- Animal proteins ---- Decorin Source.8268: DFBPPR9368 ---- Animal proteins ---- Myosin-11 Source.8269: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.8270: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.8271: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.8272: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.8273: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor Source.8274: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.8275: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.8276: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.8277: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon Source.8278: DFBPPR9385 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.8279: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.8280: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11 Source.8281: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.8282: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.8283: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.8284: DFBPPR9395 ---- Animal proteins ---- Calponin-2 Source.8285: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b Source.8286: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.8287: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1 Source.8288: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.8289: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34 Source.8290: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.8291: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type Source.8292: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type Source.8293: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase Source.8294: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase Source.8295: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase Source.8296: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.8297: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.8298: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.8299: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin Source.8300: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.8301: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.8302: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor Source.8303: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.8304: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.8305: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.8306: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.8307: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.8308: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.8309: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.8310: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.8311: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.8312: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4 Source.8313: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.8314: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.8315: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.8316: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.8317: DFBPPR9455 ---- Animal proteins ---- Cystatin-B Source.8318: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.8319: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase Source.8320: DFBPPR9459 ---- Animal proteins ---- Glutaredoxin-1 Source.8321: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.8322: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.8323: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.8324: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1 Source.8325: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type Source.8326: DFBPPR9484 ---- Animal proteins ---- Macoilin Source.8327: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.8328: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14 Source.8329: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.8330: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor Source.8331: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.8332: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.8333: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.8334: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.8335: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.8336: DFBPPR9512 ---- Animal proteins ---- Acylphosphatase-2 Source.8337: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3 Source.8338: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a Source.8339: DFBPPR9518 ---- Animal proteins ---- Interleukin-5 Source.8340: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.8341: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a Source.8342: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1 Source.8343: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.8344: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.8345: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE Source.8346: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein Source.8347: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.8348: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.8349: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.8350: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha Source.8351: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.8352: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2 Source.8353: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.8354: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3 Source.8355: DFBPPR9555 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.8356: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.8357: DFBPPR9559 ---- Animal proteins ---- CD302 antigen Source.8358: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C Source.8359: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.8360: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.8361: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3 Source.8362: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein Source.8363: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1 Source.8364: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.8365: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26 Source.8366: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.8367: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase Source.8368: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial Source.8369: DFBPPR9582 ---- Animal proteins ---- C-C motif chemokine 5 Source.8370: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.8371: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2 Source.8372: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.8373: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.8374: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor Source.8375: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.8376: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2 Source.8377: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.8378: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.8379: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.8380: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform Source.8381: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.8382: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.8383: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.8384: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.8385: DFBPPR9624 ---- Animal proteins ---- Cadherin-3 Source.8386: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.8387: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.8388: DFBPPR9628 ---- Animal proteins ---- Mineralocorticoid receptor Source.8389: DFBPPR9633 ---- Animal proteins ---- Claudin-17 Source.8390: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.8391: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561 Source.8392: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.8393: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M Source.8394: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1 Source.8395: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.8396: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1 Source.8397: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1 Source.8398: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial Source.8399: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5 Source.8400: DFBPPR9659 ---- Animal proteins ---- Placenta-expressed transcript 1 protein Source.8401: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.8402: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial Source.8403: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.8404: DFBPPR9664 ---- Animal proteins ---- Perilipin-2 Source.8405: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1 Source.8406: DFBPPR9671 ---- Animal proteins ---- S-arrestin Source.8407: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta Source.8408: DFBPPR9675 ---- Animal proteins ---- Cystatin-A5 Source.8409: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.8410: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.8411: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.8412: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1 Source.8413: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4 Source.8414: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.8415: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.8416: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.8417: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1 Source.8418: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39 Source.8419: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein Source.8420: DFBPPR9705 ---- Animal proteins ---- Elafin Source.8421: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.8422: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1 Source.8423: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27 Source.8424: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1 Source.8425: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain Source.8426: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2 Source.8427: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain Source.8428: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.8429: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.8430: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.8431: DFBPPR9728 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.8432: DFBPPR9732 ---- Animal proteins ---- Leukocyte cysteine proteinase inhibitor 1 Source.8433: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2 Source.8434: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain Source.8435: DFBPPR9736 ---- Animal proteins ---- Metaxin-1 Source.8436: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7 Source.8437: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.8438: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.8439: DFBPPR9741 ---- Animal proteins ---- Syndecan-4 Source.8440: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis Source.8441: DFBPPR9745 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.8442: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog Source.8443: DFBPPR9753 ---- Animal proteins ---- Syntaxin-binding protein 2 Source.8444: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.8445: DFBPPR9759 ---- Animal proteins ---- Palmdelphin Source.8446: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.8447: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.8448: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.8449: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.8450: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A Source.8451: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a Source.8452: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.8453: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.8454: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1 Source.8455: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15 Source.8456: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.8457: DFBPPR9793 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1 Source.8458: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.8459: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2 Source.8460: DFBPPR9803 ---- Animal proteins ---- 60S ribosomal protein L3 Source.8461: DFBPPR9805 ---- Animal proteins ---- Fatty acid-binding protein, intestinal Source.8462: DFBPPR9807 ---- Animal proteins ---- Galectin-4 Source.8463: DFBPPR9810 ---- Animal proteins ---- 40S ribosomal protein S16 Source.8464: DFBPPR9811 ---- Animal proteins ---- Protein WAP-3 Source.8465: DFBPPR9814 ---- Animal proteins ---- Testin Source.8466: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.8467: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.8468: DFBPPR9819 ---- Animal proteins ---- 40S ribosomal protein S9 Source.8469: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.8470: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6 Source.8471: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1 Source.8472: DFBPPR9827 ---- Animal proteins ---- Guanylate cyclase activator 2B Source.8473: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.8474: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.8475: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1 Source.8476: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.8477: DFBPPR9839 ---- Animal proteins ---- Nurim Source.8478: DFBPPR9843 ---- Animal proteins ---- P protein Source.8479: DFBPPR9850 ---- Animal proteins ---- Retinol-binding protein 2 Source.8480: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.8481: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.8482: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1 Source.8483: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.8484: DFBPPR9862 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.8485: DFBPPR9866 ---- Animal proteins ---- SH2 domain-containing protein 1A Source.8486: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2 Source.8487: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1 Source.8488: DFBPPR9875 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.8489: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.8490: DFBPPR9887 ---- Animal proteins ---- Cystatin-A8 Source.8491: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1 Source.8492: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.8493: DFBPPR9899 ---- Animal proteins ---- D-xylulose reductase Source.8494: DFBPPR9901 ---- Animal proteins ---- 40S ribosomal protein S14 Source.8495: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3 Source.8496: DFBPPR9909 ---- Animal proteins ---- Tetraspanin-31 Source.8497: DFBPPR9912 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial Source.8498: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B Source.8499: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2 Source.8500: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1 Source.8501: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.8502: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin Source.8503: DFBPPR9926 ---- Animal proteins ---- 60S ribosomal protein L7a Source.8504: DFBPPR9927 ---- Animal proteins ---- Protein BTG3 Source.8505: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1 Source.8506: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1 Source.8507: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.8508: DFBPPR9940 ---- Animal proteins ---- Neuronatin Source.8509: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1 Source.8510: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251 Source.8511: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.8512: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.8513: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.8514: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.8515: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase Source.8516: DFBPPR9961 ---- Animal proteins ---- Somatotropin Source.8517: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.8518: DFBPPR9965 ---- Animal proteins ---- Lysozyme C Source.8519: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.8520: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.8521: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor Source.8522: DFBPPR9972 ---- Animal proteins ---- Taste receptor type 2 member 40 Source.8523: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.8524: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin Source.8525: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.8526: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.8527: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.8528: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput Source.8529: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.8530: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.8531: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.8532: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.8533: DFBPPR9989 ---- Animal proteins ---- VIP peptides Source.8534: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.8535: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.8536: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.8537: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.8538: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.8539: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.8540: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type Source.8541: DFBPPR10004 ---- Animal proteins ---- Spastin Source.8542: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.8543: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1 Source.8544: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.8545: DFBPPR10009 ---- Animal proteins ---- Transthyretin Source.8546: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.8547: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.8548: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13 Source.8549: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.8550: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.8551: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.8552: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.8553: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6 Source.8554: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog Source.8555: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.8556: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.8557: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.8558: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B Source.8559: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.8560: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.8561: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase Source.8562: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.8563: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2 Source.8564: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.8565: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.8566: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase Source.8567: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta Source.8568: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.8569: DFBPPR10044 ---- Animal proteins ---- Histone H4 Source.8570: DFBPPR10045 ---- Animal proteins ---- Albumin Source.8571: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.8572: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.8573: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.8574: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.8575: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.8576: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4 Source.8577: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.8578: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.8579: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.8580: DFBPPR10064 ---- Animal proteins ---- Pleiotrophin Source.8581: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6 Source.8582: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.8583: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.8584: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.8585: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog Source.8586: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.8587: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1 Source.8588: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.8589: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.8590: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.8591: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.8592: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.8593: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor Source.8594: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.8595: DFBPPR10082 ---- Animal proteins ---- Pinopsin Source.8596: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.8597: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.8598: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.8599: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.8600: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.8601: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog Source.8602: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.8603: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4 Source.8604: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor Source.8605: DFBPPR10094 ---- Animal proteins ---- Proliferating cell nuclear antigen Source.8606: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.8607: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor Source.8608: DFBPPR10098 ---- Animal proteins ---- Mucin-6 Source.8609: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.8610: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.8611: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.8612: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.8613: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.8614: DFBPPR10107 ---- Animal proteins ---- Ovomucoid Source.8615: DFBPPR10110 ---- Animal proteins ---- ER lumen protein-retaining receptor 2 Source.8616: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.8617: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.8618: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.8619: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.8620: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.8621: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.8622: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.8623: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.8624: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.8625: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.8626: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase Source.8627: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1 Source.8628: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.8629: DFBPPR10129 ---- Animal proteins ---- Gremlin-1 Source.8630: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.8631: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase Source.8632: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.8633: DFBPPR10136 ---- Animal proteins ---- Annexin A2 Source.8634: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8 Source.8635: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.8636: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.8637: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.8638: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.8639: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2 Source.8640: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.8641: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3 Source.8642: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.8643: DFBPPR10148 ---- Animal proteins ---- Ubiquitin-40S ribosomal protein S27a Source.8644: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.8645: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.8646: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor Source.8647: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.8648: DFBPPR10157 ---- Animal proteins ---- CD40 ligand Source.8649: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.8650: DFBPPR10163 ---- Animal proteins ---- Annexin A6 Source.8651: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.8652: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.8653: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1 Source.8654: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.8655: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.8656: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.8657: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.8658: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2 Source.8659: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.8660: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5 Source.8661: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.8662: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3 Source.8663: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20 Source.8664: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.8665: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.8666: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.8667: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.8668: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1 Source.8669: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85 Source.8670: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.8671: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.8672: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1 Source.8673: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.8674: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.8675: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.8676: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.8677: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.8678: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A Source.8679: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.8680: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.8681: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.8682: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4 Source.8683: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.8684: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1 Source.8685: DFBPPR10219 ---- Animal proteins ---- Presenilin-1 Source.8686: DFBPPR10220 ---- Animal proteins ---- Paxillin Source.8687: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance Source.8688: DFBPPR10222 ---- Animal proteins ---- Podocalyxin Source.8689: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha Source.8690: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.8691: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.8692: DFBPPR10226 ---- Animal proteins ---- GTPase HRas Source.8693: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11 Source.8694: DFBPPR10228 ---- Animal proteins ---- Presenilin-2 Source.8695: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.8696: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.8697: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4 Source.8698: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3 Source.8699: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.8700: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8 Source.8701: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1 Source.8702: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1 Source.8703: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.8704: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.8705: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.8706: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.8707: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1 Source.8708: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.8709: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1 Source.8710: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.8711: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.8712: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6 Source.8713: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.8714: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.8715: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.8716: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1 Source.8717: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.8718: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.8719: DFBPPR10268 ---- Animal proteins ---- CD166 antigen Source.8720: DFBPPR10270 ---- Animal proteins ---- Agrin Source.8721: DFBPPR10271 ---- Animal proteins ---- Cadherin-7 Source.8722: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.8723: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.8724: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.8725: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B Source.8726: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.8727: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.8728: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.8729: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.8730: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6 Source.8731: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.8732: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6 Source.8733: DFBPPR10286 ---- Animal proteins ---- Avidin Source.8734: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.8735: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.8736: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.8737: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.8738: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.8739: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.8740: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP Source.8741: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.8742: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.8743: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.8744: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.8745: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.8746: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.8747: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.8748: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.8749: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.8750: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.8751: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.8752: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.8753: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.8754: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.8755: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.8756: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.8757: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4 Source.8758: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.8759: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.8760: DFBPPR10320 ---- Animal proteins ---- Insulin Source.8761: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.8762: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1 Source.8763: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.8764: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein Source.8765: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.8766: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.8767: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.8768: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC Source.8769: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.8770: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.8771: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.8772: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.8773: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1 Source.8774: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.8775: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.8776: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.8777: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.8778: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.8779: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.8780: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase Source.8781: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.8782: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.8783: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.8784: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.8785: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.8786: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR Source.8787: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24 Source.8788: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.8789: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.8790: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.8791: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.8792: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.8793: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.8794: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.8795: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.8796: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.8797: DFBPPR10391 ---- Animal proteins ---- Annexin A5 Source.8798: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.8799: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.8800: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.8801: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.8802: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.8803: DFBPPR10400 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.8804: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.8805: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.8806: DFBPPR10403 ---- Animal proteins ---- UMP-CMP kinase Source.8807: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.8808: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.8809: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.8810: DFBPPR10408 ---- Animal proteins ---- Beta-galactoside-binding lectin Source.8811: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.8812: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.8813: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.8814: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.8815: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.8816: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.8817: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A Source.8818: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.8819: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin Source.8820: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.8821: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.8822: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.8823: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.8824: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor Source.8825: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.8826: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform Source.8827: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.8828: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.8829: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.8830: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.8831: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.8832: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.8833: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.8834: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.8835: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c Source.8836: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.8837: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.8838: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1 Source.8839: DFBPPR10452 ---- Animal proteins ---- Desmin Source.8840: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.8841: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.8842: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.8843: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.8844: DFBPPR10459 ---- Animal proteins ---- Reelin Source.8845: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.8846: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.8847: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.8848: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.8849: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.8850: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.8851: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.8852: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.8853: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.8854: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.8855: DFBPPR10480 ---- Animal proteins ---- Cathepsin D Source.8856: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.8857: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.8858: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2 Source.8859: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2 Source.8860: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.8861: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.8862: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.8863: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.8864: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1 Source.8865: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1 Source.8866: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.8867: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.8868: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon Source.8869: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.8870: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.8871: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.8872: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3 Source.8873: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.8874: DFBPPR10513 ---- Animal proteins ---- Parafibromin Source.8875: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.8876: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.8877: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.8878: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.8879: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9 Source.8880: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.8881: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta Source.8882: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1 Source.8883: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.8884: DFBPPR10531 ---- Animal proteins ---- Serpin H1 Source.8885: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.8886: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.8887: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog Source.8888: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.8889: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.8890: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3 Source.8891: DFBPPR10544 ---- Animal proteins ---- Thioredoxin Source.8892: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.8893: DFBPPR10546 ---- Animal proteins ---- Calmodulin Source.8894: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type Source.8895: DFBPPR10548 ---- Animal proteins ---- Syndecan-4 Source.8896: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1 Source.8897: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.8898: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.8899: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.8900: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.8901: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.8902: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1 Source.8903: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2 Source.8904: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.8905: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.8906: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.8907: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.8908: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.8909: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.8910: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.8911: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.8912: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.8913: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.8914: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b Source.8915: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.8916: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase Source.8917: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.8918: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.8919: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.8920: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5 Source.8921: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B' Source.8922: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.8923: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.8924: DFBPPR10590 ---- Animal proteins ---- Centromere protein X Source.8925: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase Source.8926: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.8927: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.8928: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.8929: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.8930: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B Source.8931: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1 Source.8932: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.8933: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain Source.8934: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.8935: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.8936: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.8937: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.8938: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.8939: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.8940: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.8941: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5 Source.8942: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.8943: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX Source.8944: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.8945: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.8946: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.8947: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.8948: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin Source.8949: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.8950: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.8951: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.8952: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.8953: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.8954: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.8955: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.8956: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.8957: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein Source.8958: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53 Source.8959: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3 Source.8960: DFBPPR10640 ---- Animal proteins ---- Caveolin-1 Source.8961: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.8962: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.8963: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5 Source.8964: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.8965: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.8966: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.8967: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.8968: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.8969: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.8970: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.8971: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.8972: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.8973: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.8974: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.8975: DFBPPR10660 ---- Animal proteins ---- Tsukushin Source.8976: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.8977: DFBPPR10662 ---- Animal proteins ---- CCN family member 3 Source.8978: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.8979: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.8980: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.8981: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.8982: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.8983: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.8984: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.8985: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.8986: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.8987: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin Source.8988: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.8989: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.8990: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.8991: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3 Source.8992: DFBPPR10683 ---- Animal proteins ---- Histone H4 type VIII Source.8993: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.8994: DFBPPR10686 ---- Animal proteins ---- Collectin-11 Source.8995: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.8996: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.8997: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.8998: DFBPPR10691 ---- Animal proteins ---- Beclin-1 Source.8999: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.9000: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.9001: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2 Source.9002: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.9003: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.9004: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.9005: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.9006: DFBPPR10703 ---- Animal proteins ---- Tensin Source.9007: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2 Source.9008: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.9009: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2 Source.9010: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.9011: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.9012: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.9013: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.9014: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9 Source.9015: DFBPPR10715 ---- Animal proteins ---- Lumican Source.9016: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.9017: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1 Source.9018: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform Source.9019: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.9020: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.9021: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8 Source.9022: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.9023: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.9024: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.9025: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.9026: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.9027: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.9028: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A Source.9029: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.9030: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10 Source.9031: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14 Source.9032: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.9033: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1 Source.9034: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.9035: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6 Source.9036: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.9037: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.9038: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.9039: DFBPPR10755 ---- Animal proteins ---- Draxin Source.9040: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase Source.9041: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A Source.9042: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.9043: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.9044: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6 Source.9045: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.9046: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.9047: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.9048: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1 Source.9049: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.9050: DFBPPR10778 ---- Animal proteins ---- Avidin-related protein 2 Source.9051: DFBPPR10780 ---- Animal proteins ---- Caspase-2 Source.9052: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain Source.9053: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b Source.9054: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.9055: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.9056: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.9057: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.9058: DFBPPR10796 ---- Animal proteins ---- Protrudin Source.9059: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.9060: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1 Source.9061: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.9062: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.9063: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.9064: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.9065: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.9066: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.9067: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.9068: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.9069: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.9070: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.9071: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.9072: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha Source.9073: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.9074: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain Source.9075: DFBPPR10826 ---- Animal proteins ---- Cofilin-2 Source.9076: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Source.9077: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.9078: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.9079: DFBPPR10837 ---- Animal proteins ---- GTPase NRas Source.9080: DFBPPR10838 ---- Animal proteins ---- Protein lin-28 homolog A Source.9081: DFBPPR10840 ---- Animal proteins ---- C-C motif chemokine 4 homolog Source.9082: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5 Source.9083: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.9084: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5 Source.9085: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.9086: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A Source.9087: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.9088: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.9089: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.9090: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.9091: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.9092: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein Source.9093: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.9094: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.9095: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.9096: DFBPPR10865 ---- Animal proteins ---- Transgelin Source.9097: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase Source.9098: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2 Source.9099: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.9100: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.9101: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.9102: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3 Source.9103: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.9104: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.9105: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.9106: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.9107: DFBPPR10885 ---- Animal proteins ---- Pepsin A Source.9108: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1 Source.9109: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.9110: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.9111: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.9112: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.9113: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.9114: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.9115: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform Source.9116: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.9117: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152 Source.9118: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.9119: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.9120: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.9121: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.9122: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1 Source.9123: DFBPPR10917 ---- Animal proteins ---- Ribonuclease UK114 Source.9124: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.9125: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.9126: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3 Source.9127: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.9128: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.9129: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.9130: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase Source.9131: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.9132: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.9133: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.9134: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2 Source.9135: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.9136: DFBPPR10939 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.9137: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.9138: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.9139: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.9140: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.9141: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.9142: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.9143: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.9144: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.9145: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y Source.9146: DFBPPR10952 ---- Animal proteins ---- Protein XRP2 Source.9147: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.9148: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type Source.9149: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type Source.9150: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C Source.9151: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type Source.9152: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.9153: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1 Source.9154: DFBPPR10970 ---- Animal proteins ---- Prohibitin Source.9155: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo Source.9156: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.9157: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog Source.9158: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.9159: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.9160: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.9161: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain Source.9162: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.9163: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein Source.9164: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.9165: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C Source.9166: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.9167: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20 Source.9168: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.9169: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase Source.9170: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2 Source.9171: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.9172: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.9173: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.9174: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.9175: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.9176: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D Source.9177: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.9178: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.9179: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1 Source.9180: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.9181: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein Source.9182: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.9183: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.9184: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.9185: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase Source.9186: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.9187: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1 Source.9188: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.9189: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.9190: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2 Source.9191: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.9192: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein Source.9193: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.9194: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu Source.9195: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.9196: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.9197: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.9198: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.9199: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.9200: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.9201: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.9202: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.9203: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11 Source.9204: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.9205: DFBPPR11047 ---- Animal proteins ---- Nucleolin Source.9206: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.9207: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.9208: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase Source.9209: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.9210: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13 Source.9211: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A Source.9212: DFBPPR11060 ---- Animal proteins ---- Netrin-3 Source.9213: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.9214: DFBPPR11064 ---- Animal proteins ---- General transcription factor IIH subunit 5 Source.9215: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.9216: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.9217: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a Source.9218: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.9219: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.9220: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1 Source.9221: DFBPPR11077 ---- Animal proteins ---- Tyrosinase Source.9222: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.9223: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.9224: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.9225: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.9226: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.9227: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.9228: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1 Source.9229: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.9230: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.9231: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.9232: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.9233: DFBPPR11095 ---- Animal proteins ---- Ras-related protein Rab-33B Source.9234: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.9235: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.9236: DFBPPR11098 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.9237: DFBPPR11099 ---- Animal proteins ---- Acylphosphatase-1 Source.9238: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin Source.9239: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.9240: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS Source.9241: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.9242: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.9243: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.9244: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase Source.9245: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.9246: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1 Source.9247: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.9248: DFBPPR11118 ---- Animal proteins ---- Filensin Source.9249: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.9250: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14 Source.9251: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.9252: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.9253: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.9254: DFBPPR11126 ---- Animal proteins ---- Parvalbumin, thymic Source.9255: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.9256: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.9257: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit Source.9258: DFBPPR11134 ---- Animal proteins ---- Keratocan Source.9259: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3 Source.9260: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.9261: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.9262: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.9263: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.9264: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B Source.9265: DFBPPR11146 ---- Animal proteins ---- Formin Source.9266: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.9267: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.9268: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog Source.9269: DFBPPR11151 ---- Animal proteins ---- SPARC Source.9270: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain Source.9271: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3 Source.9272: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.9273: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.9274: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta Source.9275: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.9276: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.9277: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.9278: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta Source.9279: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2 Source.9280: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b Source.9281: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1 Source.9282: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase Source.9283: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.9284: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.9285: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1 Source.9286: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22 Source.9287: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1 Source.9288: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.9289: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.9290: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.9291: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.9292: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.9293: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.9294: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1 Source.9295: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.9296: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.9297: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1 Source.9298: DFBPPR11209 ---- Animal proteins ---- Protein S100-A11 Source.9299: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1 Source.9300: DFBPPR11211 ---- Animal proteins ---- Acylphosphatase-2 Source.9301: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein Source.9302: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.9303: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.9304: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.9305: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.9306: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1 Source.9307: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.9308: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.9309: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.9310: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.9311: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.9312: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase Source.9313: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.9314: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A Source.9315: DFBPPR11237 ---- Animal proteins ---- Fibroblast growth factor 3 Source.9316: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.9317: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2 Source.9318: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.9319: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3 Source.9320: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.9321: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.9322: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.9323: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.9324: DFBPPR11253 ---- Animal proteins ---- Peripherin-2 Source.9325: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.9326: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.9327: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.9328: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7 Source.9329: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.9330: DFBPPR11269 ---- Animal proteins ---- Anosmin-1 Source.9331: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.9332: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.9333: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.9334: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3 Source.9335: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.9336: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5 Source.9337: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.9338: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin Source.9339: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2 Source.9340: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.9341: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog Source.9342: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.9343: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.9344: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.9345: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.9346: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.9347: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.9348: DFBPPR11294 ---- Animal proteins ---- Frizzled-8 Source.9349: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.9350: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.9351: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.9352: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.9353: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.9354: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A Source.9355: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.9356: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42 Source.9357: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.9358: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15 Source.9359: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8 Source.9360: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.9361: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.9362: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog Source.9363: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1 Source.9364: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1 Source.9365: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.9366: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.9367: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2 Source.9368: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.9369: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.9370: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.9371: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.9372: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase Source.9373: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13 Source.9374: DFBPPR11351 ---- Animal proteins ---- Small ubiquitin-related modifier 3 Source.9375: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase Source.9376: DFBPPR11354 ---- Animal proteins ---- Centromere protein O Source.9377: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.9378: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.9379: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2 Source.9380: DFBPPR11373 ---- Animal proteins ---- Decorin Source.9381: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.9382: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1 Source.9383: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6 Source.9384: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.9385: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.9386: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.9387: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3 Source.9388: DFBPPR11387 ---- Animal proteins ---- Amphiphysin Source.9389: DFBPPR11388 ---- Animal proteins ---- Matrilin-3 Source.9390: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.9391: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.9392: DFBPPR11393 ---- Animal proteins ---- Avidin-related protein 4/5 Source.9393: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4 Source.9394: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.9395: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.9396: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.9397: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.9398: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.9399: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1 Source.9400: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.9401: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF Source.9402: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.9403: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.9404: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.9405: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231 Source.9406: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.9407: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.9408: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.9409: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1 Source.9410: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.9411: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20 Source.9412: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5 Source.9413: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3 Source.9414: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.9415: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.9416: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.9417: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.9418: DFBPPR11441 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.9419: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform Source.9420: DFBPPR11445 ---- Animal proteins ---- Gallinacin-12 Source.9421: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.9422: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7 Source.9423: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2 Source.9424: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1 Source.9425: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2 Source.9426: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin Source.9427: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.9428: DFBPPR11463 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.9429: DFBPPR11467 ---- Animal proteins ---- Synembryn-A Source.9430: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.9431: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase Source.9432: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.9433: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3 Source.9434: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2 Source.9435: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3 Source.9436: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein Source.9437: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.9438: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1 Source.9439: DFBPPR11488 ---- Animal proteins ---- Ras-related protein Rab-2A Source.9440: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2 Source.9441: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.9442: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L Source.9443: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7 Source.9444: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.9445: DFBPPR11499 ---- Animal proteins ---- Myosin regulatory light chain 2B, cardiac muscle isoform Source.9446: DFBPPR11504 ---- Animal proteins ---- TATA box-binding protein-like 1 Source.9447: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.9448: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b Source.9449: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2 Source.9450: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.9451: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A Source.9452: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide Source.9453: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.9454: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.9455: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.9456: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.9457: DFBPPR11524 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF166 Source.9458: DFBPPR11525 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.9459: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.9460: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform Source.9461: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.9462: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform Source.9463: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80 Source.9464: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.9465: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.9466: DFBPPR11543 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.9467: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.9468: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2 Source.9469: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.9470: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1 Source.9471: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.9472: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein Source.9473: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.9474: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog Source.9475: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.9476: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.9477: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein Source.9478: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.9479: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.9480: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle Source.9481: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.9482: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.9483: DFBPPR11583 ---- Animal proteins ---- Translin Source.9484: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.9485: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.9486: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein Source.9487: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.9488: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.9489: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230 Source.9490: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.9491: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.9492: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.9493: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.9494: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.9495: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.9496: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.9497: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13 Source.9498: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.9499: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.9500: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.9501: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.9502: DFBPPR11613 ---- Animal proteins ---- Transmembrane protein 258 Source.9503: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3 Source.9504: DFBPPR11616 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.9505: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B Source.9506: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.9507: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.9508: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.9509: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59 Source.9510: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2 Source.9511: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.9512: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.9513: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.9514: DFBPPR11635 ---- Animal proteins ---- Cochlin Source.9515: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2 Source.9516: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4 Source.9517: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon Source.9518: DFBPPR11640 ---- Animal proteins ---- Transmembrane protein 170A Source.9519: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.9520: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2 Source.9521: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.9522: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.9523: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase Source.9524: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.9525: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37 Source.9526: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.9527: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.9528: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.9529: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.9530: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.9531: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.9532: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.9533: DFBPPR11672 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 3 Source.9534: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Source.9535: DFBPPR11674 ---- Animal proteins ---- Protein MRP-126 Source.9536: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.9537: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.9538: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial Source.9539: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1 Source.9540: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1 Source.9541: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta Source.9542: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H Source.9543: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1 Source.9544: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7 Source.9545: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.9546: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit Source.9547: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.9548: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.9549: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2 Source.9550: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.9551: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.9552: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.9553: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.9554: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.9555: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.9556: DFBPPR11719 ---- Animal proteins ---- Protein RER1 Source.9557: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.9558: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.9559: DFBPPR11723 ---- Animal proteins ---- Visinin Source.9560: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.9561: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta Source.9562: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7 Source.9563: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.9564: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi Source.9565: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3 Source.9566: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.9567: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.9568: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.9569: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.9570: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.9571: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.9572: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.9573: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta Source.9574: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3 Source.9575: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1 Source.9576: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38 Source.9577: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.9578: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6 Source.9579: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.9580: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1 Source.9581: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B Source.9582: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.9583: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like Source.9584: DFBPPR11774 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1 Source.9585: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.9586: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4 Source.9587: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.9588: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.9589: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2 Source.9590: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5 Source.9591: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B Source.9592: DFBPPR11790 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.9593: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5 Source.9594: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.9595: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4 Source.9596: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3 Source.9597: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5 Source.9598: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1 Source.9599: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17 Source.9600: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62 Source.9601: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.9602: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.9603: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.9604: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1 Source.9605: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.9606: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27 Source.9607: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.9608: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.9609: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.9610: DFBPPR11822 ---- Animal proteins ---- Inversin Source.9611: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13 Source.9612: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.9613: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog Source.9614: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.9615: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B Source.9616: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.9617: DFBPPR11831 ---- Animal proteins ---- Protein lin-28 homolog B Source.9618: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.9619: DFBPPR11838 ---- Animal proteins ---- Enhancer of mRNA-decapping protein 3 Source.9620: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1 Source.9621: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.9622: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1 Source.9623: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11 Source.9624: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7 Source.9625: DFBPPR11847 ---- Animal proteins ---- Borealin-2 Source.9626: DFBPPR11848 ---- Animal proteins ---- Parvalbumin, muscle Source.9627: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.9628: DFBPPR11851 ---- Animal proteins ---- Borealin Source.9629: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase Source.9630: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2 Source.9631: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.9632: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82 Source.9633: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.9634: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.9635: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.9636: DFBPPR11863 ---- Animal proteins ---- Purpurin Source.9637: DFBPPR11864 ---- Animal proteins ---- Radixin Source.9638: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2 Source.9639: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog Source.9640: DFBPPR11869 ---- Animal proteins ---- BH3-interacting domain death agonist Source.9641: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.9642: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.9643: DFBPPR11874 ---- Animal proteins ---- Serum response factor Source.9644: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region Source.9645: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.9646: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.9647: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like Source.9648: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.9649: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.9650: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.9651: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2 Source.9652: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.9653: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.9654: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8 Source.9655: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.9656: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like Source.9657: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant Source.9658: DFBPPR11894 ---- Animal proteins ---- Centromere protein K Source.9659: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3 Source.9660: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3 Source.9661: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.9662: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein Source.9663: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.9664: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B Source.9665: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9 Source.9666: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.9667: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.9668: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein Source.9669: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.9670: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.9671: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3 Source.9672: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.9673: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.9674: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.9675: DFBPPR11925 ---- Animal proteins ---- GSK3-beta interaction protein Source.9676: DFBPPR11928 ---- Animal proteins ---- Cyclin-C Source.9677: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20 Source.9678: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta Source.9679: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.9680: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.9681: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle Source.9682: DFBPPR11942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.9683: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.9684: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.9685: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.9686: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.9687: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.9688: DFBPPR11952 ---- Animal proteins ---- Avidin-related protein 1 Source.9689: DFBPPR11953 ---- Animal proteins ---- Protein NEL Source.9690: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor Source.9691: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.9692: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.9693: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.9694: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein Source.9695: DFBPPR11962 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.9696: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.9697: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.9698: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.9699: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.9700: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.9701: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.9702: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4 Source.9703: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1 Source.9704: DFBPPR11973 ---- Animal proteins ---- Avidin-related protein 3 Source.9705: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.9706: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.9707: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.9708: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial Source.9709: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.9710: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.9711: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.9712: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1 Source.9713: DFBPPR11995 ---- Animal proteins ---- Protein orai-2 Source.9714: DFBPPR11997 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.9715: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.9716: DFBPPR11999 ---- Animal proteins ---- Dymeclin Source.9717: DFBPPR12002 ---- Animal proteins ---- Avidin-related protein 6 Source.9718: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.9719: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2 Source.9720: DFBPPR12006 ---- Animal proteins ---- Avidin-related protein 7 Source.9721: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein Source.9722: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein Source.9723: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.9724: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.9725: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2 Source.9726: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.9727: DFBPPR12025 ---- Animal proteins ---- Transmembrane protein 18 Source.9728: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.9729: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.9730: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5 Source.9731: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208 Source.9732: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.9733: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2 Source.9734: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.9735: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.9736: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.9737: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.9738: DFBPPR12041 ---- Animal proteins ---- Paladin Source.9739: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.9740: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24 Source.9741: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.9742: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.9743: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.9744: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.9745: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.9746: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.9747: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.9748: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.9749: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.9750: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.9751: DFBPPR12065 ---- Animal proteins ---- Testin Source.9752: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1 Source.9753: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.9754: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237 Source.9755: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.9756: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4 Source.9757: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.9758: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.9759: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.9760: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129 Source.9761: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.9762: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.9763: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma Source.9764: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2 Source.9765: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.9766: DFBPPR12091 ---- Animal proteins ---- Neurofibromin Source.9767: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.9768: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.9769: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.9770: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.9771: DFBPPR12100 ---- Animal proteins ---- Centromere protein Q Source.9772: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.9773: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2 Source.9774: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2 Source.9775: DFBPPR12105 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1 Source.9776: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.9777: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.9778: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.9779: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic Source.9780: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1 Source.9781: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.9782: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21 Source.9783: DFBPPR12115 ---- Animal proteins ---- Active regulator of SIRT1 Source.9784: DFBPPR12118 ---- Animal proteins ---- Protein EURL Source.9785: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.9786: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.9787: DFBPPR12125 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8 Source.9788: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.9789: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.9790: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19 Source.9791: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.9792: DFBPPR12133 ---- Animal proteins ---- Protein Asterix Source.9793: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.9794: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2 Source.9795: DFBPPR12138 ---- Animal proteins ---- Protein LZIC Source.9796: DFBPPR12140 ---- Animal proteins ---- Centromere protein N Source.9797: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2 Source.9798: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23 Source.9799: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog Source.9800: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3 Source.9801: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.9802: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.9803: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a Source.9804: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.9805: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104 Source.9806: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin Source.9807: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.9808: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog Source.9809: DFBPPR12168 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.9810: DFBPPR12172 ---- Animal proteins ---- Neuronal regeneration-related protein Source.9811: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.9812: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1 Source.9813: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.9814: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.9815: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein Source.9816: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.9817: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1 Source.9818: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251 Source.9819: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B Source.9820: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A Source.9821: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10 Source.9822: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.9823: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1 Source.9824: DFBPPR12202 ---- Animal proteins ---- Protein chibby homolog 2 Source.9825: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40 Source.9826: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.9827: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180 Source.9828: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3 Source.9829: DFBPPR12213 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1 Source.9830: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.9831: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog Source.9832: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.9833: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.9834: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.9835: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.9836: DFBPPR12225 ---- Animal proteins ---- Coiled-coil domain-containing protein 50 Source.9837: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6 Source.9838: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2 Source.9839: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68 Source.9840: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.9841: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.9842: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.9843: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.9844: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.9845: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.9846: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1 Source.9847: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.9848: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.9849: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1 Source.9850: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.9851: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.9852: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.9853: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1 Source.9854: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.9855: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2 Source.9856: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase Source.9857: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor Source.9858: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.9859: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.9860: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1 Source.9861: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.9862: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.9863: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.9864: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.9865: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1 Source.9866: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.9867: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.9868: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.9869: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.9870: DFBPPR12276 ---- Animal proteins ---- Protein S100-A9 Source.9871: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.9872: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.9873: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1 Source.9874: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.9875: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.9876: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.9877: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.9878: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.9879: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.9880: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.9881: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.9882: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.9883: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.9884: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3 Source.9885: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.9886: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.9887: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.9888: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.9889: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.9890: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.9891: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein Source.9892: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.9893: DFBPPR12309 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.9894: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.9895: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.9896: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.9897: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.9898: DFBPPR12314 ---- Animal proteins ---- Annexin A1 Source.9899: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.9900: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.9901: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.9902: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.9903: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.9904: DFBPPR12322 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A Source.9905: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5 Source.9906: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.9907: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.9908: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.9909: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type Source.9910: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type Source.9911: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.9912: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.9913: DFBPPR12333 ---- Animal proteins ---- Angiogenin Source.9914: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1 Source.9915: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.9916: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.9917: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.9918: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.9919: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.9920: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.9921: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.9922: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.9923: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.9924: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.9925: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1 Source.9926: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.9927: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.9928: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.9929: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.9930: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.9931: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.9932: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a Source.9933: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.9934: DFBPPR12366 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10 Source.9935: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2 Source.9936: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.9937: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.9938: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.9939: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1 Source.9940: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.9941: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.9942: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.9943: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.9944: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.9945: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.9946: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.9947: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.9948: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.9949: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.9950: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.9951: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.9952: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.9953: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.9954: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.9955: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.9956: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.9957: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.9958: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.9959: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Source.9960: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.9961: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.9962: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein Source.9963: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1 Source.9964: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.9965: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.9966: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4 Source.9967: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.9968: DFBPPR12408 ---- Animal proteins ---- Vitronectin Source.9969: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.9970: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.9971: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.9972: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2 Source.9973: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.9974: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.9975: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.9976: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.9977: DFBPPR12417 ---- Animal proteins ---- Rhodopsin Source.9978: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.9979: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.9980: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.9981: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.9982: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.9983: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.9984: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.9985: DFBPPR12439 ---- Animal proteins ---- Tissue factor Source.9986: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.9987: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1 Source.9988: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.9989: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.9990: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.9991: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.9992: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.9993: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.9994: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.9995: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.9996: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.9997: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.9998: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.9999: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.10000: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.10001: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.10002: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.10003: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X Source.10004: DFBPPR12463 ---- Animal proteins ---- Interleukin-15 Source.10005: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase Source.10006: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.10007: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.10008: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.10009: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.10010: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.10011: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.10012: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.10013: DFBPPR12476 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1 Source.10014: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.10015: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.10016: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.10017: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.10018: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.10019: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.10020: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.10021: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.10022: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.10023: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14 Source.10024: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.10025: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.10026: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.10027: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.10028: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.10029: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.10030: DFBPPR12501 ---- Animal proteins ---- Ezrin Source.10031: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.10032: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.10033: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3 Source.10034: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1 Source.10035: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.10036: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4 Source.10037: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.10038: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.10039: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.10040: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.10041: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase Source.10042: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin Source.10043: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.10044: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.10045: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10046: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.10047: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.10048: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase Source.10049: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.10050: DFBPPR12532 ---- Animal proteins ---- Amyloid-beta A4 protein Source.10051: DFBPPR12536 ---- Animal proteins ---- Albumin Source.10052: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.10053: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.10054: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.10055: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.10056: DFBPPR12542 ---- Animal proteins ---- Decorin Source.10057: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.10058: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.10059: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.10060: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.10061: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.10062: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10063: DFBPPR12551 ---- Animal proteins ---- C-reactive protein Source.10064: DFBPPR12552 ---- Animal proteins ---- Acylphosphatase-2 Source.10065: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.10066: DFBPPR12554 ---- Animal proteins ---- Ras-related protein Rab-7a Source.10067: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.10068: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.10069: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.10070: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type Source.10071: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.10072: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1 Source.10073: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.10074: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.10075: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.10076: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.10077: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11 Source.10078: DFBPPR12575 ---- Animal proteins ---- CD63 antigen Source.10079: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.10080: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.10081: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.10082: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.10083: DFBPPR12583 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.10084: DFBPPR12585 ---- Animal proteins ---- Calmodulin Source.10085: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.10086: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1 Source.10087: DFBPPR12591 ---- Animal proteins ---- Annexin A11 Source.10088: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.10089: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20 Source.10090: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.10091: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.10092: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.10093: DFBPPR12602 ---- Animal proteins ---- Osteopontin Source.10094: DFBPPR12603 ---- Animal proteins ---- Osteopontin Source.10095: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.10096: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.10097: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.10098: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14 Source.10099: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.10100: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.10101: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.10102: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4 Source.10103: DFBPPR12626 ---- Animal proteins ---- E-selectin Source.10104: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase Source.10105: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.10106: DFBPPR12629 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform Source.10107: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.10108: DFBPPR12632 ---- Animal proteins ---- Caveolin-2 Source.10109: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.10110: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.10111: DFBPPR12636 ---- Animal proteins ---- Complement component C9 Source.10112: DFBPPR12637 ---- Animal proteins ---- Thioredoxin Source.10113: DFBPPR12638 ---- Animal proteins ---- Thioredoxin Source.10114: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.10115: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5 Source.10116: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10117: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.10118: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.10119: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5 Source.10120: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.10121: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.10122: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.10123: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.10124: DFBPPR12681 ---- Animal proteins ---- Myosin-7 Source.10125: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.10126: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.10127: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.10128: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.10129: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10130: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10131: DFBPPR12709 ---- Animal proteins ---- Somatotropin Source.10132: DFBPPR12710 ---- Animal proteins ---- Endoplasmin Source.10133: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.10134: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1 Source.10135: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.10136: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.10137: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein Source.10138: DFBPPR12725 ---- Animal proteins ---- Uricase Source.10139: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.10140: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.10141: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.10142: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2 Source.10143: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.10144: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.10145: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.10146: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86 Source.10147: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3 Source.10148: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.10149: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1 Source.10150: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25 Source.10151: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.10152: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1 Source.10153: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.10154: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.10155: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.10156: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta Source.10157: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3 Source.10158: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.10159: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4 Source.10160: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.10161: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta Source.10162: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.10163: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.10164: DFBPPR12768 ---- Animal proteins ---- Pepsin-3 Source.10165: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.10166: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.10167: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10168: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.10169: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.10170: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.10171: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.10172: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.10173: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.10174: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase Source.10175: DFBPPR12789 ---- Animal proteins ---- CD59 glycoprotein Source.10176: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.10177: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15 Source.10178: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10 Source.10179: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor Source.10180: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6 Source.10181: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.10182: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.10183: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.10184: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.10185: DFBPPR12809 ---- Animal proteins ---- Glutaredoxin-1 Source.10186: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.10187: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.10188: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter Source.10189: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.10190: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.10191: DFBPPR12817 ---- Animal proteins ---- Cathepsin E Source.10192: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.10193: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.10194: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B Source.10195: DFBPPR12821 ---- Animal proteins ---- Gastricsin Source.10196: DFBPPR12823 ---- Animal proteins ---- Pepsin F Source.10197: DFBPPR12825 ---- Animal proteins ---- Bleomycin hydrolase Source.10198: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.10199: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4 Source.10200: DFBPPR12832 ---- Animal proteins ---- Secretin receptor Source.10201: DFBPPR12833 ---- Animal proteins ---- Cullin-5 Source.10202: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor Source.10203: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.10204: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10205: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.10206: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.10207: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.10208: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1 Source.10209: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.10210: DFBPPR12850 ---- Animal proteins ---- VIP peptides Source.10211: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.10212: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.10213: DFBPPR12856 ---- Animal proteins ---- Leupaxin Source.10214: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.10215: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.10216: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11 Source.10217: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein Source.10218: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.10219: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin Source.10220: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.10221: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.10222: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein Source.10223: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn] Source.10224: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.10225: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase Source.10226: DFBPPR12889 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform Source.10227: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.10228: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D Source.10229: DFBPPR12894 ---- Animal proteins ---- Parvalbumin alpha Source.10230: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.10231: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.10232: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.10233: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.10234: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.10235: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a Source.10236: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.10237: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2 Source.10238: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6 Source.10239: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.10240: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.10241: DFBPPR12914 ---- Animal proteins ---- Lipase member H Source.10242: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2 Source.10243: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30 Source.10244: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.10245: DFBPPR12924 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.10246: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2 Source.10247: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1 Source.10248: DFBPPR12930 ---- Animal proteins ---- Kappa-casein Source.10249: DFBPPR12931 ---- Animal proteins ---- Transthyretin Source.10250: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C Source.10251: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.10252: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.10253: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.10254: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.10255: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1 Source.10256: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.10257: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.10258: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.10259: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein Source.10260: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.10261: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.10262: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.10263: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.10264: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2 Source.10265: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3 Source.10266: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.10267: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3 Source.10268: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5 Source.10269: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain Source.10270: DFBPPR12967 ---- Animal proteins ---- Beta-sarcoglycan Source.10271: DFBPPR12970 ---- Animal proteins ---- Protein S100-B Source.10272: DFBPPR12971 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase Source.10273: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.10274: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.10275: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.10276: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.10277: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.10278: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.10279: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.10280: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A Source.10281: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form Source.10282: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.10283: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.10284: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.10285: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.10286: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.10287: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10288: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.10289: DFBPPR13011 ---- Animal proteins ---- C-C motif chemokine 4 Source.10290: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2 Source.10291: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2 Source.10292: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.10293: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1 Source.10294: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A Source.10295: DFBPPR13034 ---- Animal proteins ---- Sarcospan Source.10296: DFBPPR13035 ---- Animal proteins ---- Chymase Source.10297: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.10298: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.10299: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein Source.10300: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1 Source.10301: DFBPPR13050 ---- Animal proteins ---- Odorant-binding protein 3 Source.10302: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D Source.10303: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2 Source.10304: DFBPPR13061 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial Source.10305: DFBPPR13064 ---- Animal proteins ---- Metalloproteinase inhibitor 4 Source.10306: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5 Source.10307: DFBPPR13067 ---- Animal proteins ---- Beta-casein Source.10308: DFBPPR13069 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP alpha-1 chain Source.10309: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.10310: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.10311: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1 Source.10312: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog Source.10313: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207 Source.10314: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta Source.10315: DFBPPR13090 ---- Animal proteins ---- Annexin A8 Source.10316: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10317: DFBPPR13092 ---- Animal proteins ---- Testin Source.10318: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.10319: DFBPPR13094 ---- Animal proteins ---- Atherin Source.10320: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2 Source.10321: DFBPPR13097 ---- Animal proteins ---- Lumican Source.10322: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1 Source.10323: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form Source.10324: DFBPPR13100 ---- Animal proteins ---- Lengsin Source.10325: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region Source.10326: DFBPPR13105 ---- Animal proteins ---- Ig kappa chain V region BS-5 Source.10327: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2 Source.10328: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.10329: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain Source.10330: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10331: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region Source.10332: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region Source.10333: DFBPPR13131 ---- Animal proteins ---- Ig kappa chain V region K29-213 Source.10334: DFBPPR13133 ---- Animal proteins ---- Ig kappa chain V region K16-167 Source.10335: DFBPPR13140 ---- Animal proteins ---- Blastocyst protein 4 Source.10336: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.10337: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.10338: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.10339: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.10340: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.10341: DFBPPR13153 ---- Animal proteins ---- Interleukin-18 Source.10342: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.10343: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5 Source.10344: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor Source.10345: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.10346: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.10347: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.10348: DFBPPR13166 ---- Animal proteins ---- CD44 antigen Source.10349: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.10350: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.10351: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase Source.10352: DFBPPR13176 ---- Animal proteins ---- Aromatase Source.10353: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase Source.10354: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10355: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.10356: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.10357: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain Source.10358: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.10359: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.10360: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.10361: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.10362: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.10363: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain Source.10364: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11 Source.10365: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.10366: DFBPPR13195 ---- Animal proteins ---- Albumin Source.10367: DFBPPR13196 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.10368: DFBPPR13197 ---- Animal proteins ---- Caveolin-2 Source.10369: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha Source.10370: DFBPPR13201 ---- Animal proteins ---- Major allergen Equ c 1 Source.10371: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.10372: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.10373: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.10374: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.10375: DFBPPR13210 ---- Animal proteins ---- Angiogenin Source.10376: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2 Source.10377: DFBPPR13213 ---- Animal proteins ---- Seminal plasma protein HSP-1 Source.10378: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.10379: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase Source.10380: DFBPPR13223 ---- Animal proteins ---- Caspase-1 Source.10381: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta Source.10382: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.10383: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10384: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.10385: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1 Source.10386: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10387: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein Source.10388: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.10389: DFBPPR13237 ---- Animal proteins ---- Thioredoxin Source.10390: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2 Source.10391: DFBPPR13240 ---- Animal proteins ---- Decorin Source.10392: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10393: DFBPPR13242 ---- Animal proteins ---- E-selectin Source.10394: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B Source.10395: DFBPPR13245 ---- Animal proteins ---- Somatotropin Source.10396: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.10397: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2 Source.10398: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.10399: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.10400: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta Source.10401: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.10402: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.10403: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.10404: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E Source.10405: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.10406: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.10407: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.10408: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8 Source.10409: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2 Source.10410: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.10411: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10412: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.10413: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.10414: DFBPPR13284 ---- Animal proteins ---- Interleukin-8 Source.10415: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.10416: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.10417: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.10418: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.10419: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2 Source.10420: DFBPPR13296 ---- Animal proteins ---- Complement component C9 Source.10421: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10422: DFBPPR13305 ---- Animal proteins ---- Cytochrome b Source.10423: DFBPPR13308 ---- Animal proteins ---- Interleukin-10 Source.10424: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta Source.10425: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.10426: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.10427: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0 Source.10428: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.10429: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10430: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.10431: DFBPPR13324 ---- Animal proteins ---- Acylphosphatase-2 Source.10432: DFBPPR13326 ---- Animal proteins ---- Interferon alpha-1 Source.10433: DFBPPR13328 ---- Animal proteins ---- Interferon alpha-2 Source.10434: DFBPPR13332 ---- Animal proteins ---- Interferon alpha-3 Source.10435: DFBPPR13333 ---- Animal proteins ---- Interferon alpha-4 Source.10436: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.10437: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.10438: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a Source.10439: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10440: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.10441: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.10442: DFBPPR13352 ---- Animal proteins ---- ATP synthase protein 8 Source.10443: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.10444: DFBPPR13359 ---- Animal proteins ---- Protein S100-A7 Source.10445: DFBPPR13362 ---- Animal proteins ---- Biglycan Source.10446: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.10447: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.10448: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.10449: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.10450: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.10451: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4 Source.10452: DFBPPR13375 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.10453: DFBPPR13376 ---- Animal proteins ---- Interleukin-5 Source.10454: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein Source.10455: DFBPPR13378 ---- Animal proteins ---- Neutrophil elastase 2A Source.10456: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein Source.10457: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10458: DFBPPR13390 ---- Animal proteins ---- C-X-C motif chemokine 6 Source.10459: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.10460: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.10461: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1 Source.10462: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.10463: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10464: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog Source.10465: DFBPPR13409 ---- Animal proteins ---- Testin Source.10466: DFBPPR13410 ---- Animal proteins ---- Lysozyme C, spleen isozyme Source.10467: DFBPPR13418 ---- Animal proteins ---- 40S ribosomal protein S4 Source.10468: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10469: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor Source.10470: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.10471: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.10472: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10473: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.10474: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.10475: DFBPPR13434 ---- Animal proteins ---- Aromatase Source.10476: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.10477: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8 Source.10478: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.10479: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10480: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.10481: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10482: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.10483: DFBPPR13457 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.10484: DFBPPR13458 ---- Animal proteins ---- Interleukin-4 Source.10485: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase Source.10486: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10487: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta Source.10488: DFBPPR13481 ---- Animal proteins ---- Somatotropin Source.10489: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.10490: DFBPPR13483 ---- Animal proteins ---- Interleukin-18 Source.10491: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.10492: DFBPPR13488 ---- Animal proteins ---- Lysozyme C-2 Source.10493: DFBPPR13489 ---- Animal proteins ---- Lysozyme C-1 Source.10494: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a Source.10495: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1 Source.10496: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.10497: DFBPPR13499 ---- Animal proteins ---- Vasoactive intestinal peptide Source.10498: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.10499: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.10500: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10501: DFBPPR13521 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.10502: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin Source.10503: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.10504: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.10505: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.10506: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.10507: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.10508: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase Source.10509: DFBPPR13540 ---- Animal proteins ---- Somatotropin Source.10510: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase Source.10511: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.10512: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1 Source.10513: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein Source.10514: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1 Source.10515: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10516: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.10517: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.10518: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.10519: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1 Source.10520: DFBPPR13564 ---- Animal proteins ---- Calmodulin Source.10521: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.10522: DFBPPR13566 ---- Animal proteins ---- Calcium and integrin-binding protein 1 Source.10523: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.10524: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase Source.10525: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36 Source.10526: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor Source.10527: DFBPPR13574 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.10528: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.10529: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.10530: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.10531: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein Source.10532: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.10533: DFBPPR13583 ---- Animal proteins ---- Caveolin-2 Source.10534: DFBPPR13584 ---- Animal proteins ---- Calpain-3 Source.10535: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.10536: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.10537: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.10538: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.10539: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.10540: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.10541: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.10542: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10543: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.10544: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor Source.10545: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.10546: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2 Source.10547: DFBPPR13605 ---- Animal proteins ---- Rhodopsin Source.10548: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.10549: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.10550: DFBPPR13615 ---- Animal proteins ---- Cofilin-1 Source.10551: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.10552: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.10553: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.10554: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.10555: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.10556: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.10557: DFBPPR13625 ---- Animal proteins ---- Lysozyme C-1 Source.10558: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10559: DFBPPR13628 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.10560: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.10561: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.10562: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.10563: DFBPPR13635 ---- Animal proteins ---- Amyloid-beta A4 protein Source.10564: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.10565: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.10566: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8 Source.10567: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.10568: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6 Source.10569: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.10570: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6 Source.10571: DFBPPR13651 ---- Animal proteins ---- Clusterin Source.10572: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10573: DFBPPR13656 ---- Animal proteins ---- Thioredoxin Source.10574: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2 Source.10575: DFBPPR13664 ---- Animal proteins ---- Interleukin-10 Source.10576: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor Source.10577: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.10578: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2 Source.10579: DFBPPR13672 ---- Animal proteins ---- Annexin A2 Source.10580: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.10581: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic Source.10582: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.10583: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.10584: DFBPPR13683 ---- Animal proteins ---- 14-3-3 protein sigma Source.10585: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.10586: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.10587: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen Source.10588: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.10589: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.10590: DFBPPR13696 ---- Animal proteins ---- Cathepsin D Source.10591: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.10592: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.10593: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.10594: DFBPPR13704 ---- Animal proteins ---- Osteopontin Source.10595: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase Source.10596: DFBPPR13707 ---- Animal proteins ---- Lysozyme C-3 Source.10597: DFBPPR13708 ---- Animal proteins ---- Renin Source.10598: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta Source.10599: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX Source.10600: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.10601: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.10602: DFBPPR13716 ---- Animal proteins ---- Trichohyalin Source.10603: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d Source.10604: DFBPPR13719 ---- Animal proteins ---- Nitric oxide synthase, brain Source.10605: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10606: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.10607: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.10608: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase Source.10609: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.10610: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1 Source.10611: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.10612: DFBPPR13740 ---- Animal proteins ---- Lysozyme C, kidney isozyme Source.10613: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.10614: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.10615: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase Source.10616: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic Source.10617: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.10618: DFBPPR13752 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.10619: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.10620: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.10621: DFBPPR13755 ---- Animal proteins ---- Aromatase Source.10622: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.10623: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21 Source.10624: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.10625: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.10626: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein Source.10627: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.10628: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor Source.10629: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10630: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10631: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.10632: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.10633: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor Source.10634: DFBPPR13777 ---- Animal proteins ---- Centromere protein C Source.10635: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.10636: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.10637: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.10638: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.10639: DFBPPR13788 ---- Animal proteins ---- Albumin Source.10640: DFBPPR13793 ---- Animal proteins ---- Decorin Source.10641: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain Source.10642: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel Source.10643: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor Source.10644: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6 Source.10645: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24 Source.10646: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.10647: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4 Source.10648: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.10649: DFBPPR13810 ---- Animal proteins ---- Transthyretin Source.10650: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma Source.10651: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2 Source.10652: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1 Source.10653: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5 Source.10654: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.10655: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.10656: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.10657: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a Source.10658: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.10659: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.10660: DFBPPR13832 ---- Animal proteins ---- Cystatin-B Source.10661: DFBPPR13834 ---- Animal proteins ---- Biglycan Source.10662: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3 Source.10663: DFBPPR13839 ---- Animal proteins ---- Interleukin-4 Source.10664: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561 Source.10665: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.10666: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.10667: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor Source.10668: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.10669: DFBPPR13850 ---- Animal proteins ---- Interleukin-15 Source.10670: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1 Source.10671: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.10672: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin Source.10673: DFBPPR13864 ---- Animal proteins ---- Interleukin-5 Source.10674: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9 Source.10675: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor Source.10676: DFBPPR13867 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.10677: DFBPPR13871 ---- Animal proteins ---- Parathyroid hormone-related protein Source.10678: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor Source.10679: DFBPPR13876 ---- Animal proteins ---- Follistatin Source.10680: DFBPPR13877 ---- Animal proteins ---- Sialin Source.10681: DFBPPR13879 ---- Animal proteins ---- Vasoactive intestinal peptide Source.10682: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.10683: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10684: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.10685: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.10686: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5 Source.10687: DFBPPR13897 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.10688: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.10689: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.10690: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3 Source.10691: DFBPPR13918 ---- Animal proteins ---- Testin Source.10692: DFBPPR13919 ---- Animal proteins ---- Selenoprotein W Source.10693: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.10694: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.10695: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.10696: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.10697: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.10698: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.10699: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10700: DFBPPR13948 ---- Animal proteins ---- Calcium and integrin-binding family member 4 Source.10701: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.10702: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26 Source.10703: DFBPPR13957 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.10704: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.10705: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10706: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.10707: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B Source.10708: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A Source.10709: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2 Source.10710: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10711: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.10712: DFBPPR13992 ---- Animal proteins ---- Rhodopsin Source.10713: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.10714: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog Source.10715: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.10716: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.10717: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B Source.10718: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A Source.10719: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.10720: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.10721: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.10722: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin Source.10723: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase Source.10724: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a Source.10725: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10726: DFBPPR14010 ---- Animal proteins ---- GTPase KRas Source.10727: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10728: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1 Source.10729: DFBPPR14017 ---- Animal proteins ---- Ependymin Source.10730: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10731: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1 Source.10732: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2 Source.10733: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.10734: DFBPPR14039 ---- Animal proteins ---- ATP synthase protein 8 Source.10735: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10736: DFBPPR14043 ---- Animal proteins ---- Prolactin Source.10737: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B Source.10738: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.10739: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos Source.10740: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form Source.10741: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form Source.10742: DFBPPR14058 ---- Animal proteins ---- Granulin-3 Source.10743: DFBPPR14071 ---- Marine protein ---- Somatotropin Source.10744: DFBPPR14073 ---- Marine protein ---- Elastase-1 Source.10745: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1 Source.10746: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.10747: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36 Source.10748: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.10749: DFBPPR14082 ---- Marine protein ---- Estrogen receptor Source.10750: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III Source.10751: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta Source.10752: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A Source.10753: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B Source.10754: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1 Source.10755: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.10756: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.10757: DFBPPR14096 ---- Marine protein ---- Serum amyloid P-component Source.10758: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.10759: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.10760: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran Source.10761: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha Source.10762: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146 Source.10763: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1 Source.10764: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.10765: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.10766: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial Source.10767: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.10768: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin Source.10769: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.10770: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.10771: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.10772: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.10773: DFBPPR14141 ---- Marine protein ---- Ependymin-2 Source.10774: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1 Source.10775: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a Source.10776: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein Source.10777: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.10778: DFBPPR14155 ---- Marine protein ---- ATP synthase protein 8 Source.10779: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E Source.10780: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12 Source.10781: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.10782: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.10783: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial Source.10784: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.10785: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog Source.10786: DFBPPR14166 ---- Marine protein ---- Draxin-A Source.10787: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator Source.10788: DFBPPR14174 ---- Marine protein ---- Ubiquitin-fold modifier 1 Source.10789: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A Source.10790: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6 Source.10791: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.10792: DFBPPR14188 ---- Marine protein ---- DNA repair protein SWI5 homolog Source.10793: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein Source.10794: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor Source.10795: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog Source.10796: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.10797: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein Source.10798: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B Source.10799: DFBPPR14203 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-A Source.10800: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2 Source.10801: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a Source.10802: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.10803: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.10804: DFBPPR14217 ---- Marine protein ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.10805: DFBPPR14220 ---- Marine protein ---- Coiled-coil domain-containing protein 58 Source.10806: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.10807: DFBPPR14225 ---- Marine protein ---- LYR motif-containing protein 1 Source.10808: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog Source.10809: DFBPPR14231 ---- Marine protein ---- Somatotropin Source.10810: DFBPPR14236 ---- Marine protein ---- Gonadotropin subunit beta-2 Source.10811: DFBPPR14237 ---- Marine protein ---- Stanniocalcin Source.10812: DFBPPR14240 ---- Marine protein ---- Otolin-1 Source.10813: DFBPPR14246 ---- Marine protein ---- Glycoprotein hormones alpha chain 1 Source.10814: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3 Source.10815: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1 Source.10816: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2 Source.10817: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin Source.10818: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain Source.10819: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial Source.10820: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.10821: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain Source.10822: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein Source.10823: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase Source.10824: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.10825: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.10826: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.10827: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.10828: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.10829: DFBPPR14308 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic Source.10830: DFBPPR14317 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic Source.10831: DFBPPR14319 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic Source.10832: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region Source.10833: DFBPPR14324 ---- Marine protein ---- Uncharacterized protein ycf19 Source.10834: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase Source.10835: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.10836: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.10837: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain Source.10838: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.10839: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain Source.10840: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.10841: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein Source.10842: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH Source.10843: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B Source.10844: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase Source.10845: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.10846: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.10847: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.10848: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase Source.10849: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3 Source.10850: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.10851: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.10852: DFBPPR14353 ---- Marine protein ---- Cytochrome c6 Source.10853: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha Source.10854: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta' Source.10855: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.10856: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.10857: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.10858: DFBPPR14367 ---- Marine protein ---- Cytochrome f Source.10859: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.10860: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.10861: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha Source.10862: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.10863: DFBPPR14373 ---- Marine protein ---- Cytochrome b6 Source.10864: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha Source.10865: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta Source.10866: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.10867: DFBPPR14378 ---- Marine protein ---- Probable replicative DNA helicase Source.10868: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.10869: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.10870: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase Source.10871: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.10872: DFBPPR14392 ---- Marine protein ---- Prenyl transferase Source.10873: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein Source.10874: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain Source.10875: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic Source.10876: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.10877: DFBPPR14408 ---- Marine protein ---- Cytochrome b6-f complex subunit 6 Source.10878: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.10879: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.10880: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4 Source.10881: DFBPPR14419 ---- Marine protein ---- Photosystem II reaction center protein K Source.10882: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.10883: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.10884: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.10885: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III Source.10886: DFBPPR14428 ---- Marine protein ---- Photosystem II reaction center protein I Source.10887: DFBPPR14433 ---- Marine protein ---- 50S ribosomal protein L14, chloroplastic Source.10888: DFBPPR14442 ---- Marine protein ---- 50S ribosomal protein L18, chloroplastic Source.10889: DFBPPR14443 ---- Marine protein ---- 30S ribosomal protein S14, chloroplastic Source.10890: DFBPPR14445 ---- Marine protein ---- 50S ribosomal protein L21, chloroplastic Source.10891: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY Source.10892: DFBPPR14464 ---- Marine protein ---- 30S ribosomal protein S19, chloroplastic Source.10893: DFBPPR14465 ---- Marine protein ---- 50S ribosomal protein L16, chloroplastic Source.10894: DFBPPR14478 ---- Marine protein ---- Photosystem II reaction center protein T Source.10895: DFBPPR14479 ---- Marine protein ---- Photosystem I assembly protein Ycf4 Source.10896: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38 Source.10897: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein Source.10898: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28 Source.10899: DFBPPR14491 ---- Marine protein ---- Photosystem I reaction center subunit II Source.10900: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46 Source.10901: DFBPPR14493 ---- Marine protein ---- 50S ribosomal protein L19, chloroplastic Source.10902: DFBPPR14497 ---- Marine protein ---- 50S ribosomal protein L33, chloroplastic Source.10903: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.10904: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39 Source.10905: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43 Source.10906: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60 Source.10907: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92 Source.10908: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.10909: DFBPPR14514 ---- Marine protein ---- Putative single-stranded DNA-binding protein ycf41 Source.10910: DFBPPR14517 ---- Marine protein ---- Uncharacterized protein ycf54 Source.10911: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56 Source.10912: DFBPPR14524 ---- Marine protein ---- Uncharacterized protein ycf36 Source.10913: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55 Source.10914: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35 Source.10915: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.10916: DFBPPR14533 ---- Marine protein ---- Uncharacterized protein ORF148 Source.10917: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2 Source.10918: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.10919: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.10920: DFBPPR14541 ---- Marine protein ---- Somatotropin-1 Source.10921: DFBPPR14542 ---- Marine protein ---- Somatotropin-2 Source.10922: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A Source.10923: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.10924: DFBPPR14546 ---- Marine protein ---- Stanniocalcin Source.10925: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor Source.10926: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.10927: DFBPPR14551 ---- Marine protein ---- Histone H4 Source.10928: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.10929: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2 Source.10930: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.10931: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10932: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.10933: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor Source.10934: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.10935: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1 Source.10936: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.10937: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific Source.10938: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.10939: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27 Source.10940: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4 Source.10941: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1 Source.10942: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1 Source.10943: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.10944: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I Source.10945: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase Source.10946: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.10947: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2 Source.10948: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2 Source.10949: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10950: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a Source.10951: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.10952: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.10953: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha Source.10954: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.10955: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.10956: DFBPPR14618 ---- Marine protein ---- Ependymin-1 Source.10957: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.10958: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase Source.10959: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.10960: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.10961: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18 Source.10962: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein Source.10963: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.10964: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin Source.10965: DFBPPR14645 ---- Marine protein ---- Ependymin-2 Source.10966: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2 Source.10967: DFBPPR14650 ---- Marine protein ---- Thyroid hormone receptor alpha Source.10968: DFBPPR14651 ---- Marine protein ---- ATP synthase protein 8 Source.10969: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.10970: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.10971: DFBPPR14654 ---- Marine protein ---- Gastrin-releasing peptide Source.10972: DFBPPR14660 ---- Marine protein ---- Otolin-1 Source.10973: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme Source.10974: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc Source.10975: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.10976: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.10977: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.10978: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor Source.10979: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.10980: DFBPPR14680 ---- Marine protein ---- Steroidogenic acute regulatory protein, mitochondrial Source.10981: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II Source.10982: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.10983: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.10984: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2 Source.10985: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3 Source.10986: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.10987: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1 Source.10988: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2 Source.10989: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.10990: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2 Source.10991: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1 Source.10992: DFBPPR14739 ---- Marine protein ---- Interleukin-1 receptor-associated kinase 1-binding protein 1 homolog Source.10993: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein Source.10994: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3 Source.10995: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2 Source.10996: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1 Source.10997: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B Source.10998: DFBPPR14745 ---- Marine protein ---- Parvalbumin beta 2 Source.10999: DFBPPR14746 ---- Marine protein ---- Parvalbumin beta 1 Source.11000: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.11001: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1 Source.11002: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.11003: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.11004: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.11005: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit Source.11006: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.11007: DFBPPR14758 ---- Marine protein ---- Techylectin-5B Source.11008: DFBPPR14760 ---- Marine protein ---- Big defensin Source.11009: DFBPPR14762 ---- Marine protein ---- Coagulogen Source.11010: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.11011: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3 Source.11012: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase Source.11013: DFBPPR14770 ---- Marine protein ---- Lectin L6 Source.11014: DFBPPR14771 ---- Marine protein ---- L-cystatin Source.11015: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.11016: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11017: DFBPPR14783 ---- Marine protein ---- Enolase Source.11018: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11019: DFBPPR14787 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform A Source.11020: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain Source.11021: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain Source.11022: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain Source.11023: DFBPPR14791 ---- Marine protein ---- Guanine nucleotide-binding protein G(i) subunit alpha Source.11024: DFBPPR14792 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform B Source.11025: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.11026: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.11027: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.11028: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit Source.11029: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.11030: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.11031: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1 Source.11032: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.11033: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit Source.11034: DFBPPR14811 ---- Marine protein ---- Crustacean hyperglycemic hormone Source.11035: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1 Source.11036: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1 Source.11037: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3 Source.11038: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2 Source.11039: DFBPPR14831 ---- Marine protein ---- 40S ribosomal protein S27 Source.11040: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1 Source.11041: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form Source.11042: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form Source.11043: DFBPPR14857 ---- Marine protein ---- Hemoglobin anodic subunit alpha Source.11044: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha Source.11045: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.11046: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233 Source.11047: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.11048: DFBPPR14867 ---- Marine protein ---- Gonadotropin subunit beta-2 Source.11049: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle Source.11050: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.11051: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.11052: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.11053: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.11054: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit Source.11055: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system Source.11056: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit Source.11057: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.11058: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1 Source.11059: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.11060: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.11061: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.11062: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific Source.11063: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.11064: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.11065: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase Source.11066: DFBPPR14897 ---- Microorganism protein ---- Calmodulin Source.11067: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.11068: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.11069: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.11070: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.11071: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.11072: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5 Source.11073: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1 Source.11074: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.11075: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8 Source.11076: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.11077: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.11078: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase Source.11079: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.11080: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.11081: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.11082: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.11083: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.11084: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial Source.11085: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18 Source.11086: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.11087: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.11088: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1 Source.11089: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.11090: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.11091: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.11092: DFBPPR14935 ---- Microorganism protein ---- Actin Source.11093: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.11094: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase Source.11095: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.11096: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.11097: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5 Source.11098: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.11099: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.11100: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.11101: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.11102: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32 Source.11103: DFBPPR14950 ---- Microorganism protein ---- 5'-AMP-activated protein kinase subunit gamma Source.11104: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.11105: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.11106: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1 Source.11107: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2 Source.11108: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1 Source.11109: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.11110: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.11111: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.11112: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27 Source.11113: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial Source.11114: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.11115: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.11116: DFBPPR14968 ---- Microorganism protein ---- Small COPII coat GTPase SAR1 Source.11117: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.11118: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.11119: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.11120: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.11121: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.11122: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.11123: DFBPPR14976 ---- Microorganism protein ---- Adenylate kinase Source.11124: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1 Source.11125: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.11126: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3 Source.11127: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.11128: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.11129: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.11130: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.11131: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial Source.11132: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.11133: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.11134: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.11135: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.11136: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.11137: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.11138: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.11139: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1 Source.11140: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase Source.11141: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b Source.11142: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.11143: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase Source.11144: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.11145: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.11146: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4 Source.11147: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1 Source.11148: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.11149: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.11150: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1 Source.11151: DFBPPR15026 ---- Microorganism protein ---- ATP synthase subunit 9, mitochondrial Source.11152: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5 Source.11153: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.11154: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.11155: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2 Source.11156: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.11157: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.11158: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.11159: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate) Source.11160: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial Source.11161: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.11162: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase Source.11163: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2 Source.11164: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.11165: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.11166: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.11167: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit Source.11168: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1 Source.11169: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10 Source.11170: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.11171: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.11172: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21 Source.11173: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.11174: DFBPPR15053 ---- Microorganism protein ---- 60S ribosomal subunit assembly/export protein LOC1 Source.11175: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9 Source.11176: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1 Source.11177: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.11178: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.11179: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1 Source.11180: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9 Source.11181: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.11182: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.11183: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.11184: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.11185: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.11186: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.11187: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor Source.11188: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)] Source.11189: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4 Source.11190: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.11191: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.11192: DFBPPR15079 ---- Microorganism protein ---- Autophagy-related protein 3 Source.11193: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase Source.11194: DFBPPR15082 ---- Microorganism protein ---- Cytochrome c Source.11195: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.11196: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1 Source.11197: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.11198: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial Source.11199: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial Source.11200: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.11201: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.11202: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase Source.11203: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.11204: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.11205: DFBPPR15107 ---- Microorganism protein ---- Calcineurin subunit B Source.11206: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.11207: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.11208: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.11209: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1 Source.11210: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase Source.11211: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.11212: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase Source.11213: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.11214: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.11215: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.11216: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.11217: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G Source.11218: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase Source.11219: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.11220: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.11221: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.11222: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.11223: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.11224: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22 Source.11225: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1 Source.11226: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.11227: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.11228: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A Source.11229: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6 Source.11230: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.11231: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.11232: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.11233: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40 Source.11234: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D Source.11235: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.11236: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic Source.11237: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.11238: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2 Source.11239: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.11240: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase Source.11241: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.11242: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3 Source.11243: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.11244: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.11245: DFBPPR15163 ---- Microorganism protein ---- Ubiquitin-related modifier 1 Source.11246: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain Source.11247: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.11248: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1 Source.11249: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.11250: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1 Source.11251: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.11252: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.11253: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.11254: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.11255: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.11256: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1 Source.11257: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.11258: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1 Source.11259: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.11260: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C Source.11261: DFBPPR15185 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 8 Source.11262: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2 Source.11263: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase Source.11264: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.11265: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.11266: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I Source.11267: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase Source.11268: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9 Source.11269: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3 Source.11270: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.11271: DFBPPR15204 ---- Microorganism protein ---- FK506-binding protein 1 Source.11272: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase Source.11273: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase Source.11274: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.11275: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.11276: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.11277: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.11278: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1 Source.11279: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60 Source.11280: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1 Source.11281: DFBPPR15223 ---- Microorganism protein ---- FK506-binding protein 2 Source.11282: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.11283: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4 Source.11284: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.11285: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4 Source.11286: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.11287: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1 Source.11288: DFBPPR15237 ---- Microorganism protein ---- U6 snRNA-associated Sm-like protein LSm6 Source.11289: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.11290: DFBPPR15239 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 9 Source.11291: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B Source.11292: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3 Source.11293: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2 Source.11294: DFBPPR15244 ---- Microorganism protein ---- DASH complex subunit SPC19 Source.11295: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial Source.11296: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a Source.11297: DFBPPR15248 ---- Microorganism protein ---- DASH complex subunit SPC34 Source.11298: DFBPPR15251 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP38 Source.11299: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.11300: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.11301: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1 Source.11302: DFBPPR15258 ---- Microorganism protein ---- Invertase Source.11303: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase Source.11304: DFBPPR15261 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit alpha Source.11305: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4 Source.11306: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.11307: DFBPPR15267 ---- Microorganism protein ---- Cofilin Source.11308: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3 Source.11309: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25 Source.11310: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.11311: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.11312: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase Source.11313: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.11314: DFBPPR15277 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 20 Source.11315: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.11316: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.11317: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase Source.11318: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1 Source.11319: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase Source.11320: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12 Source.11321: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2 Source.11322: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9 Source.11323: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D Source.11324: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta Source.11325: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.11326: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.11327: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.11328: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.11329: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.11330: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase Source.11331: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106 Source.11332: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1 Source.11333: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7 Source.11334: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.11335: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4 Source.11336: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21 Source.11337: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.11338: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.11339: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.11340: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5 Source.11341: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.11342: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2 Source.11343: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1 Source.11344: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2 Source.11345: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3 Source.11346: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3 Source.11347: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.11348: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1 Source.11349: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial Source.11350: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.11351: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.11352: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.11353: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.11354: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.11355: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase Source.11356: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase Source.11357: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.11358: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.11359: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog Source.11360: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase Source.11361: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5 Source.11362: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.11363: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80 Source.11364: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1 Source.11365: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17 Source.11366: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.11367: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1 Source.11368: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.11369: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.11370: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.11371: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41 Source.11372: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1 Source.11373: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1 Source.11374: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.11375: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3 Source.11376: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2 Source.11377: DFBPPR15410 ---- Microorganism protein ---- Mitochondrial inner membrane protease ATP23 Source.11378: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1 Source.11379: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59 Source.11380: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2 Source.11381: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16 Source.11382: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1 Source.11383: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.11384: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase Source.11385: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.11386: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82 Source.11387: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.11388: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3 Source.11389: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3 Source.11390: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101 Source.11391: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1 Source.11392: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.11393: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase Source.11394: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1 Source.11395: DFBPPR15440 ---- Microorganism protein ---- Mitochondrial homologous recombination protein 1 Source.11396: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2 Source.11397: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22 Source.11398: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.11399: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22 Source.11400: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1 Source.11401: DFBPPR15451 ---- Microorganism protein ---- GrpE protein homolog, mitochondrial Source.11402: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase Source.11403: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial Source.11404: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.11405: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.11406: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1 Source.11407: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.11408: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.11409: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1 Source.11410: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.11411: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.11412: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1 Source.11413: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.11414: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.11415: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.11416: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44 Source.11417: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.11418: DFBPPR15484 ---- Microorganism protein ---- Protein TOS6 Source.11419: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.11420: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1 Source.11421: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.11422: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1 Source.11423: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6 Source.11424: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.11425: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123 Source.11426: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62 Source.11427: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.11428: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.11429: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5 Source.11430: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.11431: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32 Source.11432: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11 Source.11433: DFBPPR15505 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC15 Source.11434: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.11435: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3 Source.11436: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1 Source.11437: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.11438: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1 Source.11439: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101 Source.11440: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10 Source.11441: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3 Source.11442: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.11443: DFBPPR15530 ---- Microorganism protein ---- Translationally-controlled tumor protein homolog Source.11444: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5 Source.11445: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta Source.11446: DFBPPR15537 ---- Microorganism protein ---- mRNA 3'-end-processing protein YTH1 Source.11447: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.11448: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase Source.11449: DFBPPR15541 ---- Microorganism protein ---- F-actin-capping protein subunit alpha Source.11450: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.11451: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial Source.11452: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase Source.11453: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25 Source.11454: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.11455: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14 Source.11456: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4 Source.11457: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110 Source.11458: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial Source.11459: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.11460: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.11461: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.11462: DFBPPR15562 ---- Microorganism protein ---- Mitotic spindle-associated protein SHE1 Source.11463: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1 Source.11464: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2 Source.11465: DFBPPR15567 ---- Microorganism protein ---- Mating-type protein A2 Source.11466: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1 Source.11467: DFBPPR15572 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 2, mitochondrial Source.11468: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1 Source.11469: DFBPPR15574 ---- Microorganism protein ---- Protein PXR1 Source.11470: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381 Source.11471: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7 Source.11472: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6 Source.11473: DFBPPR15583 ---- Microorganism protein ---- DNA replication complex GINS protein PSF3 Source.11474: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.11475: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28 Source.11476: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1 Source.11477: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.11478: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27 Source.11479: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.11480: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial Source.11481: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.11482: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2 Source.11483: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase Source.11484: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1 Source.11485: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2 Source.11486: DFBPPR15606 ---- Microorganism protein ---- Assembly factor CBP4 Source.11487: DFBPPR15608 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP2 Source.11488: DFBPPR15609 ---- Microorganism protein ---- Shugoshin Source.11489: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2 Source.11490: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.11491: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.11492: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5 Source.11493: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial Source.11494: DFBPPR15621 ---- Microorganism protein ---- Spore membrane assembly protein 2 Source.11495: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.11496: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.11497: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12 Source.11498: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1 Source.11499: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7 Source.11500: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.11501: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.11502: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7 Source.11503: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3 Source.11504: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5 Source.11505: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2 Source.11506: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3 Source.11507: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22 Source.11508: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.11509: DFBPPR15654 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.11510: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18 Source.11511: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11 Source.11512: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1 Source.11513: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1 Source.11514: DFBPPR15664 ---- Microorganism protein ---- Spindle pole body component SPC42 Source.11515: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25 Source.11516: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial Source.11517: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1 Source.11518: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial Source.11519: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.11520: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6 Source.11521: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21 Source.11522: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1 Source.11523: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.11524: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2 Source.11525: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14 Source.11526: DFBPPR15688 ---- Microorganism protein ---- Nuclear transport factor 2 Source.11527: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.11528: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3 Source.11529: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1 Source.11530: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.11531: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1 Source.11532: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2 Source.11533: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.11534: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.11535: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.11536: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.11537: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.11538: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23 Source.11539: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.11540: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial Source.11541: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial Source.11542: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial Source.11543: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.11544: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2 Source.11545: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial Source.11546: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial Source.11547: DFBPPR15725 ---- Microorganism protein ---- Protein DML1 Source.11548: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.11549: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.11550: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1 Source.11551: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5 Source.11552: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g Source.11553: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5 Source.11554: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial Source.11555: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1 Source.11556: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog Source.11557: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1 Source.11558: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86 Source.11559: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.11560: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6 Source.11561: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3 Source.11562: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.11563: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.11564: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111 Source.11565: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial Source.11566: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial Source.11567: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6 Source.11568: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4 Source.11569: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.11570: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial Source.11571: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.11572: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g Source.11573: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32 Source.11574: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase Source.11575: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.11576: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.11577: DFBPPR15802 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurQ Source.11578: DFBPPR15803 ---- Microorganism protein ---- Galactokinase Source.11579: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase Source.11580: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.11581: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component Source.11582: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.11583: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase Source.11584: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.11585: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.11586: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase Source.11587: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase Source.11588: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD Source.11589: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.11590: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component Source.11591: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase Source.11592: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain Source.11593: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase Source.11594: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase Source.11595: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.11596: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR Source.11597: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT Source.11598: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.11599: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.11600: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.11601: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.11602: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase Source.11603: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.11604: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase Source.11605: DFBPPR15845 ---- Microorganism protein ---- Calmodulin Source.11606: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.11607: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.11608: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.11609: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.11610: DFBPPR15856 ---- Microorganism protein ---- Laccase-2 Source.11611: DFBPPR15857 ---- Microorganism protein ---- Laccase-1 Source.11612: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase Source.11613: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.11614: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.11615: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.11616: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.11617: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase Source.11618: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase Source.11619: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.11620: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase Source.11621: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11622: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11623: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.11624: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase Source.11625: DFBPPR15886 ---- Microorganism protein ---- Capsid protein Source.11626: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.11627: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1 Source.11628: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase Source.11629: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.11630: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1 Source.11631: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11632: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2 Source.11633: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.11634: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.11635: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.11636: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4 Source.11637: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase Source.11638: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.11639: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.11640: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.11641: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.11642: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.11643: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.11644: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase Source.11645: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.11646: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11647: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.11648: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.11649: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.11650: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A Source.11651: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.11652: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.11653: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B Source.11654: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.11655: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11656: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase Source.11657: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein Source.11658: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.11659: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.11660: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.11661: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial Source.11662: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.11663: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.11664: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.11665: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase Source.11666: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.11667: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.11668: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.11669: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.11670: DFBPPR7794 ---- Plant protein ---- Cytochrome b6 Source.11671: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.11672: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.11673: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.11674: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.11675: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.11676: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.11677: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.11678: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.11679: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.11680: DFBPPR7810 ---- Plant protein ---- Cytochrome f Source.11681: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.11682: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.11683: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.11684: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.11685: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.11686: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.11687: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta Source.11688: DFBPPR7824 ---- Plant protein ---- Cytochrome b559 subunit alpha Source.11689: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.11690: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.11691: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.11692: DFBPPR7833 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.11693: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a Source.11694: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic Source.11695: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.11696: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.11697: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.11698: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.11699: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.11700: DFBPPR7844 ---- Plant protein ---- Actin-1 Source.11701: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.11702: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.11703: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.11704: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.11705: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.11706: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a Source.11707: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic Source.11708: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1 Source.11709: DFBPPR7856 ---- Plant protein ---- Maturase K Source.11710: DFBPPR7859 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.11711: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1 Source.11712: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.11713: DFBPPR7863 ---- Plant protein ---- 50S ribosomal protein L23-B, chloroplastic Source.11714: DFBPPR7865 ---- Plant protein ---- 50S ribosomal protein L23-A, chloroplastic Source.11715: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.11716: DFBPPR7872 ---- Plant protein ---- Photosystem II reaction center protein J Source.11717: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4 Source.11718: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1 Source.11719: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.11720: DFBPPR7881 ---- Plant protein ---- 50S ribosomal protein L20, chloroplastic Source.11721: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.11722: DFBPPR7888 ---- Plant protein ---- Photosystem II reaction center protein Z Source.11723: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1 Source.11724: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1 Source.11725: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1 Source.11726: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1 Source.11727: DFBPPR7897 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic Source.11728: DFBPPR7904 ---- Plant protein ---- Photosystem I reaction center subunit VIII Source.11729: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.11730: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2 Source.11731: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1 Source.11732: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1 Source.11733: DFBPPR7912 ---- Plant protein ---- Chloroplast envelope membrane protein Source.11734: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2 Source.11735: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.11736: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.11737: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1 Source.11738: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.11739: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.11740: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic Source.11741: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.11742: DFBPPR7933 ---- Plant protein ---- FK506-binding protein 2 Source.11743: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.11744: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic Source.11745: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.11746: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic Source.11747: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1 Source.11748: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.11749: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.11750: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.11751: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1 Source.11752: DFBPPR7947 ---- Plant protein ---- Legumin type B Source.11753: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.11754: DFBPPR7949 ---- Plant protein ---- Cytochrome f Source.11755: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP Source.11756: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.11757: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.11758: DFBPPR7954 ---- Plant protein ---- Favin Source.11759: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1 Source.11760: DFBPPR7956 ---- Plant protein ---- Legumin type B Source.11761: DFBPPR7957 ---- Plant protein ---- Legumin type B Source.11762: DFBPPR7958 ---- Plant protein ---- Legumin type B Source.11763: DFBPPR7959 ---- Plant protein ---- Leghemoglobin 49 Source.11764: DFBPPR7960 ---- Plant protein ---- Vicilin Source.11765: DFBPPR7963 ---- Plant protein ---- Leghemoglobin 29 Source.11766: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.11767: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1 Source.11768: DFBPPR7967 ---- Plant protein ---- Plastocyanin Source.11769: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92 Source.11770: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87 Source.11771: DFBPPR7973 ---- Plant protein ---- Maturase K Source.11772: DFBPPR7975 ---- Plant protein ---- Protein Ycf2 Source.11773: DFBPPR7977 ---- Plant protein ---- Ribosomal protein S14, mitochondrial Source.11774: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein Source.11775: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1 Source.11776: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B Source.11777: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A Source.11778: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.11779: DFBPPR7989 ---- Plant protein ---- Cytochrome c Source.11780: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11781: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.11782: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11783: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.11784: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B Source.11785: DFBPPR7996 ---- Plant protein ---- Cytochrome b559 subunit alpha Source.11786: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.11787: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.11788: DFBPPR8002 ---- Plant protein ---- Plastocyanin Source.11789: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein Source.11790: DFBPPR8025 ---- Plant protein ---- Unknown protein 12 Source.11791: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase Source.11792: DFBPPR8029 ---- Plant protein ---- Vignain Source.11793: DFBPPR8030 ---- Plant protein ---- Arcelin-5A Source.11794: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.11795: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1 Source.11796: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.11797: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.11798: DFBPPR8037 ---- Plant protein ---- Arcelin-1 Source.11799: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11800: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.11801: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.11802: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1 Source.11803: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.11804: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11805: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.11806: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.11807: DFBPPR8049 ---- Plant protein ---- Bowman-Birk type proteinase inhibitor 2 Source.11808: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein Source.11809: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.11810: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.11811: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic Source.11812: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha Source.11813: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.11814: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.11815: DFBPPR8063 ---- Plant protein ---- Leghemoglobin A Source.11816: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.11817: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3 Source.11818: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.11819: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.11820: DFBPPR8073 ---- Plant protein ---- Arcelin-5B Source.11821: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.11822: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.11823: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1 Source.11824: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme Source.11825: DFBPPR8082 ---- Plant protein ---- Plastocyanin Source.11826: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase Source.11827: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.11828: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.11829: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.11830: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.11831: DFBPPR8091 ---- Plant protein ---- Cytochrome f Source.11832: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.11833: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.11834: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.11835: DFBPPR8099 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.11836: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.11837: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.11838: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.11839: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.11840: DFBPPR8107 ---- Plant protein ---- Stress-related protein Source.11841: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1 Source.11842: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A Source.11843: DFBPPR8110 ---- Plant protein ---- Leghemoglobin Source.11844: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.11845: DFBPPR8112 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.11846: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.11847: DFBPPR8114 ---- Plant protein ---- Arcelin-2 Source.11848: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.11849: DFBPPR8119 ---- Plant protein ---- Chalcone--flavonone isomerase Source.11850: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.11851: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.11852: DFBPPR8122 ---- Plant protein ---- Arcelin-4 Source.11853: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.11854: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.11855: DFBPPR8144 ---- Plant protein ---- Maturase K Source.11856: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.11857: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2 Source.11858: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.11859: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0 Source.11860: DFBPPR8159 ---- Plant protein ---- Chloroplast envelope membrane protein Source.11861: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.11862: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.11863: DFBPPR8183 ---- Plant protein ---- 26 kDa cell wall protein Source.11864: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.11865: DFBPPR8214 ---- Plant protein ---- Cytochrome c Source.11866: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase Source.11867: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.11868: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase Source.11869: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.11870: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11871: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1 Source.11872: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.11873: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11874: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein Source.11875: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.11876: DFBPPR8228 ---- Plant protein ---- Albumin-8 Source.11877: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.11878: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase Source.11879: DFBPPR8234 ---- Plant protein ---- Anther-specific protein SF18 Source.11880: DFBPPR8235 ---- Plant protein ---- Catalase Source.11881: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.11882: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.11883: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.11884: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.11885: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.11886: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.11887: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.11888: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.11889: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.11890: DFBPPR8259 ---- Plant protein ---- Cytochrome f Source.11891: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.11892: DFBPPR8261 ---- Plant protein ---- Photosystem II reaction center protein H Source.11893: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.11894: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.11895: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.11896: DFBPPR8267 ---- Plant protein ---- Cytochrome b559 subunit alpha Source.11897: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.11898: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.11899: DFBPPR8271 ---- Plant protein ---- Cytochrome b6 Source.11900: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.11901: DFBPPR8273 ---- Plant protein ---- Anther-specific protein SF2 Source.11902: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.11903: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.11904: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.11905: DFBPPR8278 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.11906: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.11907: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.11908: DFBPPR8284 ---- Plant protein ---- Calmodulin Source.11909: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog Source.11910: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.11911: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.11912: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein Source.11913: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase Source.11914: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.11915: DFBPPR8299 ---- Plant protein ---- 50S ribosomal protein L23, chloroplastic Source.11916: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.11917: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5 Source.11918: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.11919: DFBPPR8306 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic Source.11920: DFBPPR8314 ---- Plant protein ---- Maturase K Source.11921: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.11922: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1 Source.11923: DFBPPR8322 ---- Plant protein ---- Photosystem II reaction center protein J Source.11924: DFBPPR8324 ---- Plant protein ---- Photosystem II reaction center protein Z Source.11925: DFBPPR8334 ---- Plant protein ---- Photosystem I reaction center subunit VIII Source.11926: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.11927: DFBPPR8339 ---- Plant protein ---- Cysteine proteinase inhibitor B Source.11928: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a Source.11929: DFBPPR8343 ---- Plant protein ---- Chloroplast envelope membrane protein Source.11930: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.11931: DFBPPR8348 ---- Plant protein ---- 30S ribosomal protein S16, chloroplastic Source.11932: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein Source.11933: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein Source.11934: DFBPPR8356 ---- Plant protein ---- Unknown protein 1
Link-research Inductive analysis	Link 1: DFBPACEI1194----Wakame (Undaria pinnatifida)----Extract of wakame powder Link 2: DFBPACEI1362----Wheat----Wheat germ hydrolysates Link 3: DFBPACEI0484----Sardine muscle----Muscle protein Link 4: DFBPACEI1896----Amaranth seed proteins----Amaranth glutelins

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 43.7 uM (or 53 uM ^[4]).
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	The tripeptide Ala-Val-Phe is partly hydrolyzed by mucosal peptidases to Val-Phe.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

(1) This peptide could be applied as ingredient in functional and novel foods, dietary supplements or even pharmaceuticals as an antihypertensive agent.
(2) Spodoptera littoralis (Lepidoptera) is an edible insect and it is present in the subtropical regions in Europe, America and Africa.

Database cross-references

DFBP

[D1]	DFBPANHY0593
[D2]	DFBPMUFU0045

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	Vercruysse L, Van Camp J, Morel N, Rougé P, Herregods G, Smagghe G. Ala-Val-Phe and Val-Phe: ACE inhibitory peptides derived from insect protein with antihypertensive activity in spontaneously hypertensive rats. Peptides. 2010 Mar;31(3):482-8. PMID: 19524628 DOI: 10.1016/j.peptides.2009.05.029
Other literature(s)	[1] Vercruysse L, Matsui S T, Camp J V. Purification and identification of an angiotensin I converting enzyme (ACE) inhibitory peptide from the gastrointestinal hydrolysate of the cotton leafworm, Spodoptera littoralis[J]. Process Biochemistry, 2008, 43(8):900-904. [2] Martínez-Maqueda D, Miralles B, Recio I, et al. Antihypertensive peptides from food proteins: a review[J]. Food (&) Function, 2012, 3(4):350-361. [3] Suetsuna K, Maekawa K, Chen J R. Antihypertensive effects of Undaria pinnatifida (wakame) peptide on blood pressure in spontaneously hypertensive rats[J]. Journal of Nutritional Biochemistry, 2004, 15(5):267-272. [4] Cheung, H.S., et al., Binding of peptide substrates and inhibitors of angiotensin-converting enzyme. Importance of the COOH-terminal dipeptide sequence. J Biol Chem, 1980. 255(2): p. 401-7.
PubDate	2010