Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI0844(ACE-inhibitory peptide)

DFBP ID	DFBPACEI0844
Peptide sequence	EW
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Glu-Trp

Single-letter amino acid

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	333.34 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.34 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

-2.2000^c

Hydrophilic residue ratio

50%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Milk protein
Precursor protein	Milk protein hydrolysates
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0163 ---- Plant proteins ---- Monellin chain B Source.2: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein Source.3: DFBPPR0776 ---- Plant proteins ---- 11S globulin Source.4: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.5: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.6: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.7: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1 Source.8: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.9: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.10: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.11: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.12: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.13: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.14: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.15: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.16: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.17: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.18: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.19: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A Source.20: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.21: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.22: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.23: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.24: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.25: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.26: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase Source.27: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.28: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.29: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.30: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.31: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.32: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.33: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.34: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.35: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6 Source.36: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.37: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.38: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.39: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.40: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.41: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1 Source.42: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2 Source.43: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.44: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase Source.45: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12 Source.46: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.47: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.48: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.49: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.50: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.51: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6 Source.52: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.53: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.54: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.55: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase Source.56: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.57: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.58: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.59: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.60: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.61: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5 Source.62: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.63: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.64: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.65: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.66: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.67: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.68: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.69: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.70: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.71: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.72: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.73: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.74: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.75: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.76: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4 Source.77: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.78: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.79: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.80: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.81: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.82: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1 Source.83: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.84: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.85: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.86: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.87: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12 Source.88: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.89: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5 Source.90: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.91: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79 Source.92: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.93: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.94: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.95: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.96: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.97: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.98: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.99: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.100: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.101: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.102: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.103: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.104: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.105: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.106: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.107: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.108: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6 Source.109: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.110: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B Source.111: DFBPPR1142 ---- Plant proteins ---- Calreticulin Source.112: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A Source.113: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.114: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.115: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2 Source.116: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.117: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.118: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.119: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.120: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.121: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.122: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.123: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA Source.124: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.125: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.126: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase Source.127: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.128: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4 Source.129: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19 Source.130: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.131: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.132: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10 Source.133: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.134: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2 Source.135: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.136: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.137: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic Source.138: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.139: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.140: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23 Source.141: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.142: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.143: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic Source.144: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.145: DFBPPR1292 ---- Plant proteins ---- Chitinase 3 Source.146: DFBPPR1297 ---- Plant proteins ---- Peroxygenase Source.147: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6 Source.148: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.149: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.150: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.151: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.152: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.153: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.154: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.155: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.156: DFBPPR1340 ---- Plant proteins ---- F-box protein GID2 Source.157: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.158: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.159: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5 Source.160: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.161: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.162: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.163: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic Source.164: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.165: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.166: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.167: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.168: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.169: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.170: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.171: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.172: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.173: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.174: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog Source.175: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.176: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.177: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.178: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase Source.179: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6 Source.180: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.181: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.182: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.183: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.184: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.185: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.186: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.187: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.188: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.189: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.190: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.191: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.192: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.193: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.194: DFBPPR1431 ---- Plant proteins ---- Glutaredoxin-C6 Source.195: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2 Source.196: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.197: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.198: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.199: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.200: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1 Source.201: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.202: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.203: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.204: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.205: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.206: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.207: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.208: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.209: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.210: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.211: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase Source.212: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.213: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.214: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.215: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.216: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.217: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.218: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1 Source.219: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.220: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.221: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.222: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.223: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.224: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.225: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1 Source.226: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.227: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.228: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.229: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.230: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.231: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.232: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.233: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.234: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.235: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.236: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2 Source.237: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.238: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.239: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.240: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.241: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.242: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33 Source.243: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9 Source.244: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.245: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.246: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.247: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8 Source.248: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.249: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1 Source.250: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.251: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.252: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.253: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.254: DFBPPR1609 ---- Plant proteins ---- Expansin-B1 Source.255: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.256: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.257: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.258: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.259: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.260: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.261: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.262: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.263: DFBPPR1641 ---- Plant proteins ---- Enolase Source.264: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.265: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.266: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog Source.267: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic Source.268: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C Source.269: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C Source.270: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19 Source.271: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.272: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.273: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.274: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.275: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic Source.276: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.277: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.278: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.279: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.280: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.281: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.282: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.283: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2 Source.284: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.285: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.286: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.287: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.288: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.289: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.290: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2 Source.291: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1 Source.292: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.293: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.294: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2 Source.295: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.296: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic Source.297: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.298: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.299: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.300: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.301: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial Source.302: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.303: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094 Source.304: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.305: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.306: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.307: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2 Source.308: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.309: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.310: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.311: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3 Source.312: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.313: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.314: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.315: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.316: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22 Source.317: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.318: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.319: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic Source.320: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.321: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.322: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.323: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.324: DFBPPR1818 ---- Plant proteins ---- Chitinase 9 Source.325: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.326: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.327: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.328: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.329: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.330: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.331: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.332: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2 Source.333: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.334: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.335: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.336: DFBPPR1847 ---- Plant proteins ---- Amidase 1 Source.337: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.338: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.339: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.340: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.341: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.342: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.343: DFBPPR1867 ---- Plant proteins ---- Laccase-21 Source.344: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.345: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.346: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.347: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.348: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2 Source.349: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.350: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.351: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.352: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.353: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.354: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.355: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.356: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.357: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.358: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.359: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.360: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.361: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.362: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.363: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.364: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.365: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.366: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.367: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.368: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.369: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.370: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.371: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.372: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.373: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1 Source.374: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17 Source.375: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4 Source.376: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.377: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.378: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.379: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.380: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.381: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.382: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.383: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.384: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.385: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2 Source.386: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.387: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB Source.388: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.389: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.390: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.391: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.392: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1 Source.393: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.394: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33 Source.395: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.396: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.397: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5 Source.398: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.399: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.400: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.401: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.402: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.403: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.404: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15 Source.405: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.406: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5 Source.407: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.408: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.409: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9 Source.410: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2 Source.411: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.412: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.413: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.414: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.415: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.416: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.417: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.418: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.419: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.420: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.421: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.422: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.423: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.424: DFBPPR2101 ---- Plant proteins ---- Cupincin Source.425: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.426: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.427: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.428: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.429: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.430: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1 Source.431: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.432: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.433: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.434: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.435: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.436: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD Source.437: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57 Source.438: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.439: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.440: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.441: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.442: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.443: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2 Source.444: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.445: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.446: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.447: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.448: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.449: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.450: DFBPPR2175 ---- Plant proteins ---- Expansin-A16 Source.451: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.452: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.453: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.454: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.455: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1 Source.456: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1 Source.457: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.458: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.459: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21 Source.460: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32 Source.461: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.462: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4 Source.463: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.464: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.465: DFBPPR2220 ---- Plant proteins ---- Expansin-A7 Source.466: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.467: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.468: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6 Source.469: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.470: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.471: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.472: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.473: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.474: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.475: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.476: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.477: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.478: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.479: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.480: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.481: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.482: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.483: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.484: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.485: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.486: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.487: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.488: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.489: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3 Source.490: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4 Source.491: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.492: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.493: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.494: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.495: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.496: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.497: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.498: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.499: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.500: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.501: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.502: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.503: DFBPPR2344 ---- Plant proteins ---- Calcineurin B-like protein 8 Source.504: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial Source.505: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.506: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.507: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.508: DFBPPR2353 ---- Plant proteins ---- Expansin-B12 Source.509: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.510: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5 Source.511: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.512: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.513: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.514: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic Source.515: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.516: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.517: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.518: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089 Source.519: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6 Source.520: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2 Source.521: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1 Source.522: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.523: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.524: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.525: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.526: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1 Source.527: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.528: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain Source.529: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.530: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.531: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial Source.532: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.533: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.534: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.535: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34 Source.536: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14 Source.537: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.538: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.539: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.540: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.541: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.542: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.543: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.544: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.545: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.546: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.547: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.548: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.549: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10 Source.550: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.551: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.552: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5 Source.553: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.554: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.555: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.556: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.557: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.558: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.559: DFBPPR2555 ---- Plant proteins ---- Elicitor-responsive protein 3 Source.560: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.561: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.562: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.563: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.564: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.565: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.566: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.567: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.568: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1 Source.569: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.570: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a Source.571: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4 Source.572: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.573: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9 Source.574: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.575: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5 Source.576: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.577: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.578: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2 Source.579: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.580: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.581: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.582: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.583: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.584: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.585: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1 Source.586: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.587: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.588: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24 Source.589: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.590: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1 Source.591: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2 Source.592: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.593: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic Source.594: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.595: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.596: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.597: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.598: DFBPPR2673 ---- Plant proteins ---- Expansin-B13 Source.599: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.600: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30 Source.601: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.602: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1 Source.603: DFBPPR2697 ---- Plant proteins ---- Calcineurin B-like protein 2 Source.604: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.605: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9 Source.606: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77 Source.607: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.608: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.609: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.610: DFBPPR2758 ---- Plant proteins ---- Expansin-B17 Source.611: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.612: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.613: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.614: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.615: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.616: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.617: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.618: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.619: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.620: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.621: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.622: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.623: DFBPPR2791 ---- Plant proteins ---- Calcineurin B-like protein 7 Source.624: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.625: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.626: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic Source.627: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.628: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.629: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.630: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.631: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.632: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3 Source.633: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.634: DFBPPR2825 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.635: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.636: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.637: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.638: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.639: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.640: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.641: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.642: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.643: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D Source.644: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.645: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103 Source.646: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131 Source.647: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like Source.648: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.649: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.650: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.651: DFBPPR2888 ---- Plant proteins ---- Expansin-B10 Source.652: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6 Source.653: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.654: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.655: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2 Source.656: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.657: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.658: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.659: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5 Source.660: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.661: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.662: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4 Source.663: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.664: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.665: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.666: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.667: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.668: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.669: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.670: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.671: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.672: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.673: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.674: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.675: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.676: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic Source.677: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic Source.678: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.679: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.680: DFBPPR2982 ---- Plant proteins ---- SKP1-like protein 5 Source.681: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.682: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.683: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1 Source.684: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1 Source.685: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.686: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.687: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a Source.688: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.689: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.690: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.691: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.692: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.693: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.694: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.695: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.696: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.697: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.698: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.699: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic Source.700: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.701: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.702: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.703: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.704: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.705: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2 Source.706: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.707: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.708: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34 Source.709: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.710: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.711: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.712: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.713: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.714: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.715: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.716: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.717: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.718: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1 Source.719: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6 Source.720: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial Source.721: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1 Source.722: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.723: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.724: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.725: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.726: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.727: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.728: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3 Source.729: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.730: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.731: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.732: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.733: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic Source.734: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.735: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.736: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.737: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.738: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B Source.739: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.740: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.741: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.742: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.743: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic Source.744: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.745: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.746: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit Source.747: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.748: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.749: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.750: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b Source.751: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta Source.752: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.753: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1 Source.754: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9 Source.755: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.756: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26 Source.757: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.758: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a Source.759: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13 Source.760: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.761: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.762: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.763: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial Source.764: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.765: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.766: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.767: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.768: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.769: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38 Source.770: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.771: DFBPPR3372 ---- Plant proteins ---- Calcineurin B-like protein 3 Source.772: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.773: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.774: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.775: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.776: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.777: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.778: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.779: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2 Source.780: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1 Source.781: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.782: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.783: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.784: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11 Source.785: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.786: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.787: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.788: DFBPPR3437 ---- Plant proteins ---- Putative acetyl-coenzyme A carboxylase carboxyl transferase subunit beta-like protein Source.789: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.790: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.791: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.792: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.793: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.794: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.795: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.796: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.797: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.798: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.799: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73 Source.800: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16 Source.801: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34 Source.802: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.803: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68 Source.804: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.805: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.806: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1 Source.807: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.808: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.809: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1 Source.810: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.811: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.812: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.813: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4 Source.814: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.815: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial Source.816: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.817: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3 Source.818: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1 Source.819: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.820: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.821: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3 Source.822: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.823: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.824: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.825: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.826: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2 Source.827: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.828: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial Source.829: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1 Source.830: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1 Source.831: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6 Source.832: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.833: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.834: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.835: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.836: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.837: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.838: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2 Source.839: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.840: DFBPPR3649 ---- Plant proteins ---- Cyclin-dependent kinases regulatory subunit 1 Source.841: DFBPPR3652 ---- Plant proteins ---- Nucleosome assembly protein 1;3 Source.842: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.843: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.844: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.845: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5 Source.846: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6 Source.847: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10 Source.848: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic Source.849: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.850: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.851: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.852: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.853: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.854: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67 Source.855: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.856: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15 Source.857: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4 Source.858: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5 Source.859: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.860: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.861: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.862: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.863: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.864: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.865: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.866: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.867: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.868: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.869: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial Source.870: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1 Source.871: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic Source.872: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2 Source.873: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.874: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.875: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.876: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12 Source.877: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit Source.878: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic Source.879: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14 Source.880: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.881: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.882: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic Source.883: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.884: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.885: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.886: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8 Source.887: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.888: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.889: DFBPPR3914 ---- Plant proteins ---- Derlin-2 Source.890: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1 Source.891: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.892: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.893: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.894: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.895: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.896: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.897: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.898: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.899: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19 Source.900: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.901: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2 Source.902: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.903: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.904: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.905: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4 Source.906: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.907: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3 Source.908: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.909: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.910: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.911: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6 Source.912: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.913: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.914: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.915: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.916: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.917: DFBPPR4068 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 6 Source.918: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.919: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.920: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.921: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.922: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.923: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.924: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.925: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1 Source.926: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.927: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.928: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.929: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3 Source.930: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.931: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.932: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.933: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.934: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.935: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.936: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.937: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.938: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.939: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.940: DFBPPR4166 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.941: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.942: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.943: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.944: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1 Source.945: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3 Source.946: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.947: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1 Source.948: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.949: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.950: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.951: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.952: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.953: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.954: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.955: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.956: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.957: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1 Source.958: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.959: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.960: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.961: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6 Source.962: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.963: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.964: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16 Source.965: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.966: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1 Source.967: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.968: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.969: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.970: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.971: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.972: DFBPPR4294 ---- Plant proteins ---- Nucleosome assembly protein 1-like 4 Source.973: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.974: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.975: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1 Source.976: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1 Source.977: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3 Source.978: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2 Source.979: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.980: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic Source.981: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E Source.982: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.983: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.984: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.985: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic Source.986: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8 Source.987: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.988: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.989: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.990: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.991: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.992: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.993: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic Source.994: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.995: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2 Source.996: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8 Source.997: DFBPPR4407 ---- Plant proteins ---- Mini zinc finger protein 4 Source.998: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.999: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog Source.1000: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4 Source.1001: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.1002: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.1003: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.1004: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.1005: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.1006: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.1007: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1 Source.1008: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.1009: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.1010: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.1011: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.1012: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic Source.1013: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.1014: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.1015: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.1016: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.1017: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.1018: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.1019: DFBPPR4496 ---- Plant proteins ---- Transcription elongation factor 1 homolog Source.1020: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.1021: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic Source.1022: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.1023: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.1024: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme Source.1025: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.1026: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3 Source.1027: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2 Source.1028: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.1029: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.1030: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.1031: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.1032: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.1033: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3 Source.1034: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.1035: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.1036: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.1037: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5 Source.1038: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.1039: DFBPPR4576 ---- Plant proteins ---- Probable calcium-binding protein CML7 Source.1040: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.1041: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.1042: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.1043: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.1044: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.1045: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19 Source.1046: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11 Source.1047: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1 Source.1048: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.1049: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3 Source.1050: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1 Source.1051: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4 Source.1052: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.1053: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000 Source.1054: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.1055: DFBPPR4663 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 6 Source.1056: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.1057: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.1058: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.1059: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.1060: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2 Source.1061: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6 Source.1062: DFBPPR4701 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 15 Source.1063: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.1064: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.1065: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.1066: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5 Source.1067: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.1068: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.1069: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1 Source.1070: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2 Source.1071: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.1072: DFBPPR4783 ---- Plant proteins ---- Putative ripening-related protein 7 Source.1073: DFBPPR4786 ---- Plant proteins ---- B3 domain-containing protein Os12g0592300 Source.1074: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200 Source.1075: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100 Source.1076: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.1077: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.1078: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.1079: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a Source.1080: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48 Source.1081: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800 Source.1082: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5 Source.1083: DFBPPR4863 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 1 Source.1084: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1 Source.1085: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10 Source.1086: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.1087: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.1088: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.1089: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.1090: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.1091: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.1092: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.1093: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.1094: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.1095: DFBPPR4915 ---- Plant proteins ---- Chitinase 2 Source.1096: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.1097: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.1098: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8 Source.1099: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.1100: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.1101: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.1102: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.1103: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.1104: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.1105: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1 Source.1106: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic Source.1107: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.1108: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.1109: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23 Source.1110: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.1111: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.1112: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.1113: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1114: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.1115: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.1116: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.1117: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1 Source.1118: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.1119: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.1120: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.1121: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.1122: DFBPPR4995 ---- Plant proteins ---- Glycinin G4 Source.1123: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease Source.1124: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.1125: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.1126: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.1127: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.1128: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.1129: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.1130: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.1131: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.1132: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.1133: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.1134: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.1135: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.1136: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A Source.1137: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB Source.1138: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase Source.1139: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.1140: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.1141: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.1142: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.1143: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.1144: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1145: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.1146: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.1147: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.1148: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2 Source.1149: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.1150: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.1151: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog Source.1152: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1153: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.1154: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.1155: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.1156: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1157: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.1158: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.1159: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.1160: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.1161: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.1162: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2 Source.1163: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.1164: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1 Source.1165: DFBPPR5100 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase 1 Source.1166: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.1167: DFBPPR5111 ---- Plant proteins ---- Lectin Source.1168: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1169: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.1170: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.1171: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7 Source.1172: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1173: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.1174: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1175: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1176: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1 Source.1177: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.1178: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1179: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.1180: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.1181: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1 Source.1182: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.1183: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.1184: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum Source.1185: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.1186: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.1187: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.1188: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.1189: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.1190: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.1191: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.1192: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein Source.1193: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.1194: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.1195: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1196: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.1197: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B Source.1198: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1199: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1 Source.1200: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.1201: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.1202: DFBPPR5249 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1203: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1204: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.1205: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.1206: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3 Source.1207: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.1208: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.1209: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.1210: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.1211: DFBPPR5287 ---- Plant proteins ---- Nodulin-24 Source.1212: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.1213: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.1214: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3 Source.1215: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.1216: DFBPPR5369 ---- Plant proteins ---- Early nodulin-36A Source.1217: DFBPPR5370 ---- Plant proteins ---- Early nodulin-36B Source.1218: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.1219: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.1220: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.1221: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.1222: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.1223: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.1224: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.1225: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.1226: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.1227: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.1228: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2 Source.1229: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.1230: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1231: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.1232: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1233: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.1234: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.1235: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.1236: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.1237: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.1238: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.1239: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.1240: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.1241: DFBPPR5432 ---- Plant proteins ---- Expansin-B1 Source.1242: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.1243: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.1244: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.1245: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.1246: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.1247: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.1248: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.1249: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1250: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.1251: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.1252: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.1253: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.1254: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.1255: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.1256: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic Source.1257: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.1258: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.1259: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.1260: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.1261: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.1262: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.1263: DFBPPR5508 ---- Plant proteins ---- Expansin-B9 Source.1264: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.1265: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase Source.1266: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.1267: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1 Source.1268: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase Source.1269: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.1270: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.1271: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.1272: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1 Source.1273: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.1274: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.1275: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.1276: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.1277: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7 Source.1278: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1279: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.1280: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.1281: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.1282: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1283: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.1284: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.1285: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.1286: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.1287: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.1288: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.1289: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.1290: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3 Source.1291: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.1292: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.1293: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.1294: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic Source.1295: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9 Source.1296: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1297: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.1298: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1299: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.1300: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.1301: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1302: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.1303: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.1304: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.1305: DFBPPR5661 ---- Plant proteins ---- Albumin b-32 Source.1306: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.1307: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.1308: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.1309: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein Source.1310: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.1311: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.1312: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.1313: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.1314: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.1315: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.1316: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.1317: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.1318: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.1319: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.1320: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.1321: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1322: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.1323: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.1324: DFBPPR5728 ---- Plant proteins ---- Calreticulin Source.1325: DFBPPR5729 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.1326: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.1327: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.1328: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23 Source.1329: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1330: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1 Source.1331: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.1332: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.1333: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.1334: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1335: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.1336: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A Source.1337: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2 Source.1338: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.1339: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.1340: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.1341: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.1342: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1343: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase Source.1344: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.1345: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.1346: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1347: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.1348: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.1349: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.1350: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.1351: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.1352: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.1353: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic Source.1354: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2 Source.1355: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.1356: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.1357: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.1358: DFBPPR5837 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1359: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.1360: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1361: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3 Source.1362: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.1363: DFBPPR5864 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.1364: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin Source.1365: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5 Source.1366: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.1367: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.1368: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1369: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1370: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.1371: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.1372: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2 Source.1373: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3 Source.1374: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.1375: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.1376: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.1377: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.1378: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein Source.1379: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.1380: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.1381: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.1382: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.1383: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3 Source.1384: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.1385: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.1386: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2 Source.1387: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.1388: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4 Source.1389: DFBPPR6117 ---- Plant proteins ---- Putative uncharacterized protein ycf15 Source.1390: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3 Source.1391: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13 Source.1392: DFBPPR6136 ---- Plant proteins ---- Cell number regulator 11 Source.1393: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.1394: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B Source.1395: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA Source.1396: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile Source.1397: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein Source.1398: DFBPPR6191 ---- Plant proteins ---- Unknown protein from spot 502 of 2D-PAGE of etiolated coleoptile Source.1399: DFBPPR6204 ---- Plant proteins ---- Unknown protein from spot 258 of 2D-PAGE of etiolated coleoptile Source.1400: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34 Source.1401: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.1402: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1403: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1 Source.1404: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.1405: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.1406: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.1407: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.1408: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.1409: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.1410: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic Source.1411: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.1412: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.1413: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.1414: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.1415: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.1416: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.1417: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.1418: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.1419: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1 Source.1420: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic Source.1421: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic Source.1422: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1423: DFBPPR6285 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.1424: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta Source.1425: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.1426: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.1427: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.1428: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.1429: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.1430: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1431: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.1432: DFBPPR6310 ---- Plant proteins ---- Catalase Source.1433: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.1434: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.1435: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic Source.1436: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2 Source.1437: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.1438: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.1439: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.1440: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.1441: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing] Source.1442: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing] Source.1443: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.1444: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.1445: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic Source.1446: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.1447: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.1448: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.1449: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.1450: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1451: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.1452: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.1453: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.1454: DFBPPR6377 ---- Plant proteins ---- Lectin Source.1455: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1456: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1457: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3 Source.1458: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.1459: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.1460: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.1461: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.1462: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin Source.1463: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.1464: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.1465: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.1466: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.1467: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.1468: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.1469: DFBPPR6453 ---- Plant proteins ---- Convicilin Source.1470: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.1471: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase Source.1472: DFBPPR6458 ---- Plant proteins ---- Convicilin Source.1473: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.1474: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.1475: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1 Source.1476: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.1477: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic Source.1478: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1479: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1480: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1481: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase Source.1482: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.1483: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A Source.1484: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28 Source.1485: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic Source.1486: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic Source.1487: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.1488: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.1489: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1490: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.1491: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.1492: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.1493: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8 Source.1494: DFBPPR6656 ---- Plant proteins ---- Catalase Source.1495: DFBPPR6667 ---- Plant proteins ---- Cytochrome c Source.1496: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.1497: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.1498: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.1499: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19 Source.1500: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8 Source.1501: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.1502: DFBPPR6684 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor WSCI Source.1503: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10 Source.1504: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.1505: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.1506: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1507: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.1508: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3 Source.1509: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1510: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.1511: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1512: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.1513: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.1514: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.1515: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.1516: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.1517: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.1518: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.1519: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.1520: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.1521: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.1522: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.1523: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.1524: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.1525: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1526: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7 Source.1527: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.1528: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1529: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1530: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1531: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.1532: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.1533: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.1534: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1535: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1536: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.1537: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1538: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1539: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.1540: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1541: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor Source.1542: DFBPPR6897 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1543: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.1544: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1545: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.1546: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1 Source.1547: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.1548: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1549: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.1550: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1 Source.1551: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.1552: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic Source.1553: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1 Source.1554: DFBPPR7031 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMb Source.1555: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2 Source.1556: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.1557: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.1558: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.1559: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd Source.1560: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.1561: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1562: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1563: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1564: DFBPPR7078 ---- Plant proteins ---- Alpha-amylase inhibitor BDAI-1 Source.1565: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1566: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.1567: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1568: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1569: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1570: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1571: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.1572: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.1573: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.1574: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.1575: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.1576: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.1577: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.1578: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.1579: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A Source.1580: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B Source.1581: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.1582: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase Source.1583: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.1584: DFBPPR7168 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1585: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1586: DFBPPR7175 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2A Source.1587: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.1588: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1589: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.1590: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.1591: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.1592: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.1593: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.1594: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1595: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.1596: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.1597: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1598: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2 Source.1599: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic Source.1600: DFBPPR7277 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2B Source.1601: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.1602: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic Source.1603: DFBPPR7340 ---- Plant proteins ---- 40S ribosomal protein S12 Source.1604: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein Source.1605: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.1606: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor Source.1607: DFBPPR7406 ---- Plant proteins ---- Cytochrome c Source.1608: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1609: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.1610: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase Source.1611: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.1612: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.1613: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1 Source.1614: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1615: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1616: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1617: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic Source.1618: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.1619: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25 Source.1620: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1621: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.1622: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.1623: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1624: DFBPPR7549 ---- Plant proteins ---- Plastidial lipid-associated protein Source.1625: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.1626: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.1627: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b Source.1628: DFBPPR7618 ---- Milk proteins ---- Plasminogen Source.1629: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.1630: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.1631: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.1632: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1633: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.1634: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.1635: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.1636: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A Source.1637: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin Source.1638: DFBPPR7660 ---- Milk proteins ---- Alpha-lactalbumin Source.1639: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.1640: DFBPPR7670 ---- Milk proteins ---- Alpha-lactalbumin B/C Source.1641: DFBPPR7671 ---- Milk proteins ---- Alpha-lactalbumin A Source.1642: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin Source.1643: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein Source.1644: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin Source.1645: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin Source.1646: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin Source.1647: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin Source.1648: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.1649: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.1650: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1 Source.1651: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.1652: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.1653: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.1654: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.1655: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.1656: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.1657: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.1658: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.1659: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1660: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1661: DFBPPR8357 ---- Plant proteins ---- 2S albumin Source.1662: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1 Source.1663: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.1664: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3 Source.1665: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.1666: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.1667: DFBPPR8369 ---- Plant proteins ---- Thioredoxin H-type Source.1668: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1669: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase Source.1670: DFBPPR8378 ---- Plant proteins ---- Allergen Api g 5 Source.1671: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin Source.1672: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.1673: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.1674: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.1675: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.1676: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.1677: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B Source.1678: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17 Source.1679: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3 Source.1680: DFBPPR8420 ---- Plant proteins ---- Peroxygenase Source.1681: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.1682: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.1683: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1 Source.1684: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2 Source.1685: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2 Source.1686: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1687: DFBPPR8434 ---- Plant proteins ---- Lectin Source.1688: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1689: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.1690: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.1691: DFBPPR8458 ---- Plant proteins ---- Catalase Source.1692: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.1693: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.1694: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein Source.1695: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.1696: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin Source.1697: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.1698: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.1699: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.1700: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase Source.1701: DFBPPR8523 ---- Milk proteins ---- Perilipin-2 Source.1702: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.1703: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1704: DFBPPR15953 ---- Animal proteins ---- Occludin Source.1705: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.1706: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1707: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.1708: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.1709: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1710: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.1711: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1 Source.1712: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.1713: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1714: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.1715: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1716: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1717: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14 Source.1718: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1719: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1720: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1721: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.1722: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1723: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36 Source.1724: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.1725: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1726: DFBPPR16028 ---- Animal proteins ---- Presenilin-1 Source.1727: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1728: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1729: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.1730: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.1731: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1732: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1733: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3 Source.1734: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1735: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1736: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase Source.1737: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type Source.1738: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.1739: DFBPPR16071 ---- Animal proteins ---- CD44 antigen Source.1740: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1741: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.1742: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1743: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO Source.1744: DFBPPR16103 ---- Animal proteins ---- Laforin Source.1745: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.1746: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4 Source.1747: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1748: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.1749: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1750: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor Source.1751: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.1752: DFBPPR16142 ---- Animal proteins ---- Procathepsin L Source.1753: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1754: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.1755: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.1756: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone Source.1757: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1758: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1759: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1760: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1761: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.1762: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1763: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor Source.1764: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1765: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.1766: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.1767: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.1768: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1769: DFBPPR16235 ---- Animal proteins ---- Serum amyloid A protein Source.1770: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.1771: DFBPPR16240 ---- Animal proteins ---- Fibronectin Source.1772: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1773: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1774: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta Source.1775: DFBPPR16247 ---- Animal proteins ---- Recoverin Source.1776: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1777: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1778: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1779: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.1780: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.1781: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.1782: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone Source.1783: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.1784: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin Source.1785: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.1786: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1787: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1788: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.1789: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.1790: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.1791: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.1792: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1793: DFBPPR16326 ---- Animal proteins ---- Desmin Source.1794: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1795: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.1796: DFBPPR16341 ---- Animal proteins ---- Calmegin Source.1797: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype Source.1798: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5 Source.1799: DFBPPR16378 ---- Animal proteins ---- Arginine esterase Source.1800: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.1801: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.1802: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1803: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.1804: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1805: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor Source.1806: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1807: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1808: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4 Source.1809: DFBPPR16474 ---- Animal proteins ---- Pinin Source.1810: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B Source.1811: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2 Source.1812: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1813: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.1814: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1 Source.1815: DFBPPR16497 ---- Animal proteins ---- Interleukin-5 Source.1816: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.1817: DFBPPR16501 ---- Animal proteins ---- F-box/LRR-repeat protein 15 Source.1818: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.1819: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.1820: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1821: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.1822: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.1823: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.1824: DFBPPR16534 ---- Animal proteins ---- Myoglobin Source.1825: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.1826: DFBPPR16538 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 1B Source.1827: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.1828: DFBPPR16553 ---- Animal proteins ---- Tapasin Source.1829: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2 Source.1830: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1831: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2 Source.1832: DFBPPR16566 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta Source.1833: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1834: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20 Source.1835: DFBPPR16593 ---- Animal proteins ---- Calcyphosin Source.1836: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A Source.1837: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9 Source.1838: DFBPPR16599 ---- Animal proteins ---- Receptor-binding cancer antigen expressed on SiSo cells Source.1839: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.1840: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1 Source.1841: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain Source.1842: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.1843: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.1844: DFBPPR16613 ---- Animal proteins ---- Ferritin light chain Source.1845: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.1846: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4 Source.1847: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1 Source.1848: DFBPPR16621 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1849: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.1850: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.1851: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein Source.1852: DFBPPR16693 ---- Animal proteins ---- Cingulin Source.1853: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein Source.1854: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.1855: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog Source.1856: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.1857: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.1858: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252 Source.1859: DFBPPR16718 ---- Animal proteins ---- Zinc finger protein 331 Source.1860: DFBPPR16721 ---- Animal proteins ---- Testin Source.1861: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.1862: DFBPPR16746 ---- Animal proteins ---- Tektin-1 Source.1863: DFBPPR16747 ---- Animal proteins ---- Pleckstrin Source.1864: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.1865: DFBPPR16751 ---- Animal proteins ---- Small integral membrane protein 12 Source.1866: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.1867: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region Source.1868: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase Source.1869: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.1870: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.1871: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A Source.1872: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.1873: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1 Source.1874: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1875: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1876: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.1877: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1878: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1879: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1880: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1881: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.1882: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain Source.1883: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.1884: DFBPPR16852 ---- Animal proteins ---- Cytochrome b Source.1885: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.1886: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor Source.1887: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.1888: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.1889: DFBPPR16887 ---- Animal proteins ---- Pleiotrophin Source.1890: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.1891: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.1892: DFBPPR16894 ---- Animal proteins ---- Procathepsin L Source.1893: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.1894: DFBPPR16905 ---- Animal proteins ---- Fatty acid-binding protein 5 Source.1895: DFBPPR16909 ---- Animal proteins ---- Calreticulin Source.1896: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.1897: DFBPPR16918 ---- Animal proteins ---- Spastin Source.1898: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase Source.1899: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1900: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor Source.1901: DFBPPR16933 ---- Animal proteins ---- Proenkephalin-A Source.1902: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.1903: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1904: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1905: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic Source.1906: DFBPPR16946 ---- Animal proteins ---- Recoverin Source.1907: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1908: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin Source.1909: DFBPPR16956 ---- Animal proteins ---- Interleukin-6 Source.1910: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.1911: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.1912: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.1913: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.1914: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1915: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.1916: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1917: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1918: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.1919: DFBPPR17000 ---- Animal proteins ---- Vimentin Source.1920: DFBPPR17010 ---- Animal proteins ---- Sestrin-2 Source.1921: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.1922: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.1923: DFBPPR17013 ---- Animal proteins ---- Presenilin-1 Source.1924: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1925: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1926: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.1927: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.1928: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1929: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain Source.1930: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.1931: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1932: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1933: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.1934: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin Source.1935: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.1936: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.1937: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1938: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.1939: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.1940: DFBPPR17067 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.1941: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168 Source.1942: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.1943: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2 Source.1944: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.1945: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.1946: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase Source.1947: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1948: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1949: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.1950: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1 Source.1951: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.1952: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.1953: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.1954: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1955: DFBPPR17108 ---- Animal proteins ---- Coronin-1A Source.1956: DFBPPR17115 ---- Animal proteins ---- CD44 antigen Source.1957: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.1958: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1959: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.1960: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1961: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.1962: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1963: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1 Source.1964: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1 Source.1965: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1 Source.1966: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.1967: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog Source.1968: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.1969: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1970: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1971: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.1972: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.1973: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.1974: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1975: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1976: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1977: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1978: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1979: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.1980: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1 Source.1981: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1982: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.1983: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1984: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2 Source.1985: DFBPPR17294 ---- Animal proteins ---- Ezrin Source.1986: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1987: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.1988: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha Source.1989: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.1990: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.1991: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta Source.1992: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.1993: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.1994: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.1995: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.1996: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase Source.1997: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.1998: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1999: DFBPPR17327 ---- Animal proteins ---- Myotubularin Source.2000: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.2001: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.2002: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.2003: DFBPPR17341 ---- Animal proteins ---- Radixin Source.2004: DFBPPR17343 ---- Animal proteins ---- Receptor of activated protein C kinase 1 Source.2005: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.2006: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1 Source.2007: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.2008: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.2009: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2 Source.2010: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2 Source.2011: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.2012: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.2013: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.2014: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1 Source.2015: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.2016: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.2017: DFBPPR17379 ---- Animal proteins ---- Dematin Source.2018: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.2019: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.2020: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.2021: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4 Source.2022: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.2023: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1 Source.2024: DFBPPR17401 ---- Animal proteins ---- Moesin Source.2025: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.2026: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.2027: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.2028: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.2029: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.2030: DFBPPR17423 ---- Animal proteins ---- Furin Source.2031: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.2032: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.2033: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.2034: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.2035: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.2036: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.2037: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.2038: DFBPPR17443 ---- Animal proteins ---- Beclin-1 Source.2039: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2040: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3 Source.2041: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2042: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.2043: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase Source.2044: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N Source.2045: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.2046: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.2047: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.2048: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.2049: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.2050: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain Source.2051: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.2052: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.2053: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.2054: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5 Source.2055: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.2056: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.2057: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.2058: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E Source.2059: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.2060: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.2061: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.2062: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3 Source.2063: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.2064: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.2065: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.2066: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.2067: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B Source.2068: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase Source.2069: DFBPPR17584 ---- Animal proteins ---- Cytochrome c oxidase subunit 7B, mitochondrial Source.2070: DFBPPR17586 ---- Animal proteins ---- Dermatopontin Source.2071: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial Source.2072: DFBPPR17594 ---- Animal proteins ---- E-selectin Source.2073: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2074: DFBPPR17599 ---- Animal proteins ---- Tissue factor Source.2075: DFBPPR17600 ---- Animal proteins ---- Tissue factor Source.2076: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.2077: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2 Source.2078: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta Source.2079: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2 Source.2080: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16 Source.2081: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.2082: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.2083: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0 Source.2084: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta Source.2085: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.2086: DFBPPR17752 ---- Animal proteins ---- Follistatin Source.2087: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.2088: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.2089: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.2090: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5 Source.2091: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.2092: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.2093: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.2094: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.2095: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.2096: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.2097: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6 Source.2098: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.2099: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1 Source.2100: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA Source.2101: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.2102: DFBPPR17820 ---- Animal proteins ---- Osteomodulin Source.2103: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.2104: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.2105: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B Source.2106: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13 Source.2107: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.2108: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B Source.2109: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.2110: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.2111: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1 Source.2112: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.2113: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1 Source.2114: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.2115: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.2116: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.2117: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.2118: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.2119: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.2120: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.2121: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.2122: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.2123: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.2124: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.2125: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.2126: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein Source.2127: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.2128: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.2129: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.2130: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.2131: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial Source.2132: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.2133: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.2134: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.2135: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.2136: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT Source.2137: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.2138: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.2139: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.2140: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.2141: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1 Source.2142: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A Source.2143: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.2144: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.2145: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.2146: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3 Source.2147: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN Source.2148: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein Source.2149: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.2150: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2151: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.2152: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.2153: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.2154: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.2155: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.2156: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein Source.2157: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.2158: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2 Source.2159: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.2160: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.2161: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.2162: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.2163: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta Source.2164: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.2165: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase Source.2166: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.2167: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2168: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2169: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8 Source.2170: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2 Source.2171: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.2172: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.2173: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.2174: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.2175: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.2176: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.2177: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.2178: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta Source.2179: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.2180: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase Source.2181: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.2182: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.2183: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.2184: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.2185: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.2186: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.2187: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.2188: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a Source.2189: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4 Source.2190: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1 Source.2191: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2192: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1 Source.2193: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1 Source.2194: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.2195: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.2196: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.2197: DFBPPR18172 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.2198: DFBPPR18187 ---- Animal proteins ---- Lithostathine Source.2199: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.2200: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.2201: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.2202: DFBPPR18227 ---- Animal proteins ---- Desmin Source.2203: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.2204: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.2205: DFBPPR18242 ---- Animal proteins ---- Heparanase Source.2206: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.2207: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.2208: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.2209: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.2210: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta Source.2211: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.2212: DFBPPR18268 ---- Animal proteins ---- Myoglobin Source.2213: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.2214: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.2215: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3 Source.2216: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.2217: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.2218: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2 Source.2219: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase Source.2220: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.2221: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.2222: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.2223: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.2224: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.2225: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1 Source.2226: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.2227: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.2228: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2229: DFBPPR18339 ---- Animal proteins ---- SPARC Source.2230: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.2231: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B Source.2232: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.2233: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1 Source.2234: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.2235: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.2236: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.2237: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.2238: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1 Source.2239: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.2240: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.2241: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.2242: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.2243: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.2244: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.2245: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.2246: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.2247: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.2248: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.2249: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1 Source.2250: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.2251: DFBPPR18441 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.2252: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.2253: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1 Source.2254: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.2255: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.2256: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.2257: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.2258: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.2259: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.2260: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.2261: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.2262: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3 Source.2263: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.2264: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.2265: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1 Source.2266: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase Source.2267: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.2268: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.2269: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130 Source.2270: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.2271: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.2272: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial Source.2273: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.2274: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.2275: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial Source.2276: DFBPPR18549 ---- Animal proteins ---- Serum amyloid A protein Source.2277: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.2278: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.2279: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1 Source.2280: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5 Source.2281: DFBPPR18581 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 7 Source.2282: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor Source.2283: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.2284: DFBPPR18597 ---- Animal proteins ---- Telethonin Source.2285: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.2286: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.2287: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.2288: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.2289: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4 Source.2290: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2 Source.2291: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase Source.2292: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14 Source.2293: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.2294: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3 Source.2295: DFBPPR18643 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III Source.2296: DFBPPR18651 ---- Animal proteins ---- Allergen Bos d 2 Source.2297: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.2298: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.2299: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.2300: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D Source.2301: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase Source.2302: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2 Source.2303: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.2304: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.2305: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.2306: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3 Source.2307: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.2308: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.2309: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.2310: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.2311: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.2312: DFBPPR18762 ---- Animal proteins ---- DDRGK domain-containing protein 1 Source.2313: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.2314: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein Source.2315: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.2316: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.2317: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone Source.2318: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A Source.2319: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.2320: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.2321: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.2322: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.2323: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.2324: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.2325: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1 Source.2326: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.2327: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.2328: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase Source.2329: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.2330: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1 Source.2331: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2 Source.2332: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma Source.2333: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.2334: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B Source.2335: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.2336: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.2337: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein Source.2338: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3 Source.2339: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin Source.2340: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2 Source.2341: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.2342: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.2343: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.2344: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.2345: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.2346: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1 Source.2347: DFBPPR18882 ---- Animal proteins ---- Bisphosphoglycerate mutase Source.2348: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.2349: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5 Source.2350: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.2351: DFBPPR18899 ---- Animal proteins ---- Cofilin-2 Source.2352: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.2353: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.2354: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.2355: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.2356: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10 Source.2357: DFBPPR18927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 5 Source.2358: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.2359: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Source.2360: DFBPPR18936 ---- Animal proteins ---- S-methyl-5'-thioadenosine phosphorylase Source.2361: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial Source.2362: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13 Source.2363: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.2364: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.2365: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 Source.2366: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.2367: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.2368: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7 Source.2369: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog Source.2370: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3 Source.2371: DFBPPR18977 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 1 Source.2372: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.2373: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.2374: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.2375: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.2376: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I Source.2377: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.2378: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.2379: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.2380: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19 Source.2381: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D Source.2382: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3 Source.2383: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.2384: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.2385: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.2386: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.2387: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.2388: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.2389: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11 Source.2390: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic Source.2391: DFBPPR19045 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta Source.2392: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.2393: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.2394: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.2395: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.2396: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.2397: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.2398: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.2399: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2 Source.2400: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.2401: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2 Source.2402: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.2403: DFBPPR19100 ---- Animal proteins ---- Interleukin-34 Source.2404: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.2405: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.2406: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.2407: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2 Source.2408: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.2409: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3 Source.2410: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1 Source.2411: DFBPPR19137 ---- Animal proteins ---- Serpin H1 Source.2412: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.2413: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.2414: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.2415: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2 Source.2416: DFBPPR19161 ---- Animal proteins ---- Anaphase-promoting complex subunit 11 Source.2417: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma Source.2418: DFBPPR19170 ---- Animal proteins ---- Isoaspartyl peptidase/L-asparaginase Source.2419: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.2420: DFBPPR19188 ---- Animal proteins ---- Centromere protein S Source.2421: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.2422: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.2423: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.2424: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.2425: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.2426: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1 Source.2427: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.2428: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.2429: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.2430: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1 Source.2431: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.2432: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Source.2433: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.2434: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.2435: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit Source.2436: DFBPPR19247 ---- Animal proteins ---- Calmegin Source.2437: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B Source.2438: DFBPPR19253 ---- Animal proteins ---- Limbin Source.2439: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2 Source.2440: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.2441: DFBPPR19278 ---- Animal proteins ---- R-spondin-3 Source.2442: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1 Source.2443: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.2444: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.2445: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1 Source.2446: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.2447: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220 Source.2448: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3 Source.2449: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.2450: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.2451: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.2452: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3 Source.2453: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.2454: DFBPPR19317 ---- Animal proteins ---- AP-1 complex subunit sigma-1A Source.2455: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.2456: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.2457: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.2458: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.2459: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.2460: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.2461: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1 Source.2462: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.2463: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3 Source.2464: DFBPPR19359 ---- Animal proteins ---- Spartin Source.2465: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.2466: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.2467: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.2468: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.2469: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog Source.2470: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.2471: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor Source.2472: DFBPPR19384 ---- Animal proteins ---- Complement component C9 Source.2473: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.2474: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1 Source.2475: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein Source.2476: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6 Source.2477: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.2478: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.2479: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.2480: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase Source.2481: DFBPPR19418 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase Source.2482: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22 Source.2483: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1 Source.2484: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1 Source.2485: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.2486: DFBPPR19442 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit G Source.2487: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.2488: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.2489: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial Source.2490: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.2491: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase Source.2492: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.2493: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.2494: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.2495: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12 Source.2496: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.2497: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.2498: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.2499: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.2500: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain Source.2501: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5 Source.2502: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase Source.2503: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.2504: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2 Source.2505: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.2506: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5 Source.2507: DFBPPR19508 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 2 Source.2508: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.2509: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.2510: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.2511: DFBPPR19520 ---- Animal proteins ---- Ferritin light chain Source.2512: DFBPPR19521 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12 Source.2513: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.2514: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.2515: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase Source.2516: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog Source.2517: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.2518: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.2519: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.2520: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.2521: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.2522: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.2523: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.2524: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.2525: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.2526: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1 Source.2527: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C Source.2528: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1 Source.2529: DFBPPR19594 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1 Source.2530: DFBPPR19595 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1 Source.2531: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin Source.2532: DFBPPR19607 ---- Animal proteins ---- Obg-like ATPase 1 Source.2533: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.2534: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.2535: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.2536: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.2537: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.2538: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.2539: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25 Source.2540: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.2541: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein Source.2542: DFBPPR19645 ---- Animal proteins ---- Barrier-to-autointegration factor Source.2543: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4 Source.2544: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2 Source.2545: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.2546: DFBPPR19668 ---- Animal proteins ---- Calicin Source.2547: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.2548: DFBPPR19671 ---- Animal proteins ---- C-X-C motif chemokine 9 Source.2549: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.2550: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2 Source.2551: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.2552: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4 Source.2553: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.2554: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.2555: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.2556: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.2557: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.2558: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1 Source.2559: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2 Source.2560: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog Source.2561: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5 Source.2562: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase Source.2563: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.2564: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1 Source.2565: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.2566: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1 Source.2567: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2 Source.2568: DFBPPR19767 ---- Animal proteins ---- F-box/LRR-repeat protein 15 Source.2569: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.2570: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.2571: DFBPPR19781 ---- Animal proteins ---- Secretory carrier-associated membrane protein 5 Source.2572: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.2573: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog Source.2574: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.2575: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.2576: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.2577: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2 Source.2578: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.2579: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.2580: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.2581: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4 Source.2582: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.2583: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a Source.2584: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC Source.2585: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.2586: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.2587: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3 Source.2588: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.2589: DFBPPR19888 ---- Animal proteins ---- Splicing factor 3B subunit 5 Source.2590: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta Source.2591: DFBPPR19895 ---- Animal proteins ---- 39S ribosomal protein L24, mitochondrial Source.2592: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase Source.2593: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.2594: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3 Source.2595: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.2596: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.2597: DFBPPR19929 ---- Animal proteins ---- Ermin Source.2598: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1 Source.2599: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2 Source.2600: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog Source.2601: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.2602: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.2603: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.2604: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.2605: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein Source.2606: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2 Source.2607: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.2608: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1 Source.2609: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.2610: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20 Source.2611: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.2612: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.2613: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.2614: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit Source.2615: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17 Source.2616: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7 Source.2617: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.2618: DFBPPR20030 ---- Animal proteins ---- Calumenin Source.2619: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9 Source.2620: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.2621: DFBPPR20038 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 20 Source.2622: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1 Source.2623: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.2624: DFBPPR20044 ---- Animal proteins ---- Secernin-1 Source.2625: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.2626: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.2627: DFBPPR20056 ---- Animal proteins ---- Cyclin-dependent kinases regulatory subunit 1 Source.2628: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.2629: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.2630: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1 Source.2631: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.2632: DFBPPR20089 ---- Animal proteins ---- Fascin-2 Source.2633: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O Source.2634: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial Source.2635: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.2636: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.2637: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.2638: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial Source.2639: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1 Source.2640: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2 Source.2641: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.2642: DFBPPR20125 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 2 Source.2643: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a Source.2644: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.2645: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A Source.2646: DFBPPR20159 ---- Animal proteins ---- Cyclin-dependent kinases regulatory subunit 2 Source.2647: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein Source.2648: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog Source.2649: DFBPPR20164 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 2 Source.2650: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2 Source.2651: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4 Source.2652: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.2653: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2 Source.2654: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog Source.2655: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.2656: DFBPPR20189 ---- Animal proteins ---- Protein disulfide isomerase CRELD2 Source.2657: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial Source.2658: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1 Source.2659: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein Source.2660: DFBPPR20210 ---- Animal proteins ---- Exonuclease V Source.2661: DFBPPR20217 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 8 Source.2662: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9 Source.2663: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.2664: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.2665: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12 Source.2666: DFBPPR20223 ---- Animal proteins ---- Protein cereblon Source.2667: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase Source.2668: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1 Source.2669: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.2670: DFBPPR20249 ---- Animal proteins ---- Ras-related protein Rab-30 Source.2671: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A Source.2672: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog Source.2673: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial Source.2674: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1 Source.2675: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.2676: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.2677: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1 Source.2678: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.2679: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN Source.2680: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.2681: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.2682: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.2683: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.2684: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.2685: DFBPPR20340 ---- Animal proteins ---- Peripherin Source.2686: DFBPPR20342 ---- Animal proteins ---- Nucleosome assembly protein 1-like 4 Source.2687: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.2688: DFBPPR20350 ---- Animal proteins ---- Pinin Source.2689: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.2690: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.2691: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1 Source.2692: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial Source.2693: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4 Source.2694: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog Source.2695: DFBPPR20383 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 7, mitochondrial Source.2696: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.2697: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.2698: DFBPPR20401 ---- Animal proteins ---- Bystin Source.2699: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma Source.2700: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2 Source.2701: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.2702: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.2703: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase Source.2704: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog Source.2705: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.2706: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1 Source.2707: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.2708: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.2709: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.2710: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.2711: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3 Source.2712: DFBPPR20453 ---- Animal proteins ---- Cysteine dioxygenase type 1 Source.2713: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2 Source.2714: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.2715: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C Source.2716: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.2717: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.2718: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.2719: DFBPPR20481 ---- Animal proteins ---- Ropporin-1 Source.2720: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1 Source.2721: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein Source.2722: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.2723: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2 Source.2724: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.2725: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein Source.2726: DFBPPR20510 ---- Animal proteins ---- Josephin-1 Source.2727: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.2728: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6 Source.2729: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.2730: DFBPPR20529 ---- Animal proteins ---- Transgelin Source.2731: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.2732: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16 Source.2733: DFBPPR20540 ---- Animal proteins ---- Structure-specific endonuclease subunit SLX1 Source.2734: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.2735: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.2736: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2737: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1 Source.2738: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog Source.2739: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein Source.2740: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Source.2741: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.2742: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.2743: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6 Source.2744: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.2745: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.2746: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10 Source.2747: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.2748: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.2749: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.2750: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1 Source.2751: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.2752: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52 Source.2753: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91 Source.2754: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa Source.2755: DFBPPR20656 ---- Animal proteins ---- Protein archease Source.2756: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.2757: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain Source.2758: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.2759: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11 Source.2760: DFBPPR20692 ---- Animal proteins ---- ELMO domain-containing protein 3 Source.2761: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.2762: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.2763: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A Source.2764: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain Source.2765: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.2766: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1 Source.2767: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B Source.2768: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.2769: DFBPPR20768 ---- Animal proteins ---- Lysozyme-like protein 1 Source.2770: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain Source.2771: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.2772: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial Source.2773: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.2774: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.2775: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT Source.2776: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.2777: DFBPPR20824 ---- Animal proteins ---- CD151 antigen Source.2778: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.2779: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2 Source.2780: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12 Source.2781: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.2782: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.2783: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.2784: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.2785: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.2786: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135 Source.2787: DFBPPR20866 ---- Animal proteins ---- PRKR-interacting protein 1 Source.2788: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2 Source.2789: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.2790: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B Source.2791: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1 Source.2792: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.2793: DFBPPR20897 ---- Animal proteins ---- Polyadenylate-binding protein-interacting protein 2 Source.2794: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog Source.2795: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.2796: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.2797: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2798: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A Source.2799: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A Source.2800: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.2801: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog Source.2802: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.2803: DFBPPR20969 ---- Animal proteins ---- Sperm acrosome-associated protein 5 Source.2804: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor Source.2805: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.2806: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.2807: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7 Source.2808: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181 Source.2809: DFBPPR21003 ---- Animal proteins ---- Protein BCAP Source.2810: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase Source.2811: DFBPPR21019 ---- Animal proteins ---- Thioredoxin domain-containing protein 9 Source.2812: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1 Source.2813: DFBPPR21034 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 25 Source.2814: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial Source.2815: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.2816: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.2817: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.2818: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.2819: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.2820: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5 Source.2821: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.2822: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7 Source.2823: DFBPPR21083 ---- Animal proteins ---- TRAF-interacting protein with FHA domain-containing protein A Source.2824: DFBPPR21092 ---- Animal proteins ---- Calponin-1 Source.2825: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4 Source.2826: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.2827: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2 Source.2828: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2 Source.2829: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.2830: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16 Source.2831: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog Source.2832: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.2833: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350 Source.2834: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel Source.2835: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.2836: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor Source.2837: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.2838: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52 Source.2839: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5 Source.2840: DFBPPR21183 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1 Source.2841: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24 Source.2842: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2 Source.2843: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.2844: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin Source.2845: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4 Source.2846: DFBPPR21201 ---- Animal proteins ---- mRNA turnover protein 4 homolog Source.2847: DFBPPR21204 ---- Animal proteins ---- ADP-ribosylation factor-like protein 5A Source.2848: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2 Source.2849: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.2850: DFBPPR21209 ---- Animal proteins ---- 40S ribosomal protein S6 Source.2851: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog Source.2852: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6 Source.2853: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1 Source.2854: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2 Source.2855: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial Source.2856: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1 Source.2857: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.2858: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36 Source.2859: DFBPPR21254 ---- Animal proteins ---- Zinc finger protein 567 Source.2860: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.2861: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B Source.2862: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.2863: DFBPPR21272 ---- Animal proteins ---- Testin Source.2864: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2 Source.2865: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.2866: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.2867: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial Source.2868: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.2869: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b Source.2870: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.2871: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein Source.2872: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184 Source.2873: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.2874: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H Source.2875: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34 Source.2876: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.2877: DFBPPR21335 ---- Animal proteins ---- Coiled-coil domain-containing protein 124 Source.2878: DFBPPR21342 ---- Animal proteins ---- G kinase-anchoring protein 1 Source.2879: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397 Source.2880: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.2881: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.2882: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.2883: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420 Source.2884: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2 Source.2885: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.2886: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.2887: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4 Source.2888: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.2889: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.2890: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.2891: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.2892: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.2893: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.2894: DFBPPR21415 ---- Animal proteins ---- Leucine-rich repeat-containing protein 39 Source.2895: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.2896: DFBPPR21424 ---- Animal proteins ---- Chromosome transmission fidelity protein 8 homolog Source.2897: DFBPPR21427 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 2 Source.2898: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.2899: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5 Source.2900: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2 Source.2901: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B Source.2902: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4 Source.2903: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2 Source.2904: DFBPPR21451 ---- Animal proteins ---- Nurim Source.2905: DFBPPR21455 ---- Animal proteins ---- Apolipoprotein C-IV Source.2906: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A Source.2907: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.2908: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.2909: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.2910: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8 Source.2911: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1 Source.2912: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3 Source.2913: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1 Source.2914: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.2915: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like Source.2916: DFBPPR21499 ---- Animal proteins ---- Barrier-to-autointegration factor-like protein Source.2917: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.2918: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.2919: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1 Source.2920: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20 Source.2921: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1 Source.2922: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225 Source.2923: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19 Source.2924: DFBPPR21534 ---- Animal proteins ---- 39S ribosomal protein L46, mitochondrial Source.2925: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.2926: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22 Source.2927: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4 Source.2928: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.2929: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.2930: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2931: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein Source.2932: DFBPPR21581 ---- Animal proteins ---- T-cell leukemia translocation-altered gene protein homolog Source.2933: DFBPPR21582 ---- Animal proteins ---- MORN repeat-containing protein 4 Source.2934: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.2935: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.2936: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.2937: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.2938: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.2939: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog Source.2940: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10 Source.2941: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4 Source.2942: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like Source.2943: DFBPPR21687 ---- Animal proteins ---- Ropporin-1-like protein Source.2944: DFBPPR21702 ---- Animal proteins ---- Rhombotin-2 Source.2945: DFBPPR21703 ---- Animal proteins ---- RRP15-like protein Source.2946: DFBPPR21712 ---- Animal proteins ---- Serpin E3 Source.2947: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.2948: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2 Source.2949: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.2950: DFBPPR21738 ---- Animal proteins ---- Bcl-2-related protein A1 Source.2951: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog Source.2952: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6 Source.2953: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.2954: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.2955: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25 Source.2956: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.2957: DFBPPR21768 ---- Animal proteins ---- Tektin-4 Source.2958: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.2959: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6 Source.2960: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.2961: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog Source.2962: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.2963: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3 Source.2964: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like Source.2965: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.2966: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.2967: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10 Source.2968: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.2969: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2970: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.2971: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.2972: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1 Source.2973: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1 Source.2974: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2 Source.2975: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.2976: DFBPPR21843 ---- Animal proteins ---- Tektin-1 Source.2977: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.2978: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.2979: DFBPPR21861 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 3, mitochondrial Source.2980: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS Source.2981: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3 Source.2982: DFBPPR21864 ---- Animal proteins ---- Arpin Source.2983: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC Source.2984: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.2985: DFBPPR21871 ---- Animal proteins ---- Serpin B10 Source.2986: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19 Source.2987: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein Source.2988: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B Source.2989: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.2990: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2 Source.2991: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial Source.2992: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein Source.2993: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.2994: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1 Source.2995: DFBPPR21901 ---- Animal proteins ---- Calcyphosin Source.2996: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.2997: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog Source.2998: DFBPPR21912 ---- Animal proteins ---- Death-associated protein 1 Source.2999: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2 Source.3000: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.3001: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.3002: DFBPPR21959 ---- Animal proteins ---- DDB1- and CUL4-associated factor 16 Source.3003: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog Source.3004: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6 Source.3005: DFBPPR21977 ---- Animal proteins ---- Protein ARV1 Source.3006: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3007: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like Source.3008: DFBPPR21994 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial Source.3009: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3 Source.3010: DFBPPR22000 ---- Animal proteins ---- Protein LDOC1 Source.3011: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.3012: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1 Source.3013: DFBPPR22011 ---- Animal proteins ---- 40S ribosomal protein S12 Source.3014: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.3015: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2 Source.3016: DFBPPR22029 ---- Animal proteins ---- COMM domain-containing protein 7 Source.3017: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.3018: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.3019: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2 Source.3020: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B Source.3021: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.3022: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.3023: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B Source.3024: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase Source.3025: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.3026: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.3027: DFBPPR22068 ---- Animal proteins ---- Protein GPR108 Source.3028: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.3029: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.3030: DFBPPR22084 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 49 Source.3031: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.3032: DFBPPR22086 ---- Animal proteins ---- Trafficking protein particle complex subunit 1 Source.3033: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1 Source.3034: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.3035: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1 Source.3036: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4 Source.3037: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog Source.3038: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572 Source.3039: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2 Source.3040: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.3041: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2 Source.3042: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.3043: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.3044: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1 Source.3045: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.3046: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.3047: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog Source.3048: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.3049: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.3050: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.3051: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5 Source.3052: DFBPPR22203 ---- Animal proteins ---- Serum amyloid A-4 protein Source.3053: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.3054: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1 Source.3055: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.3056: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3 Source.3057: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300 Source.3058: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.3059: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.3060: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.3061: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3 Source.3062: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5 Source.3063: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3 Source.3064: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.3065: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.3066: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222 Source.3067: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2 Source.3068: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16 Source.3069: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70 Source.3070: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.3071: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.3072: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1 Source.3073: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.3074: DFBPPR22352 ---- Animal proteins ---- Protein C19orf12 homolog Source.3075: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.3076: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.3077: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23 Source.3078: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2 Source.3079: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4 Source.3080: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A Source.3081: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5 Source.3082: DFBPPR22392 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1A Source.3083: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.3084: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.3085: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.3086: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.3087: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18 Source.3088: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2 Source.3089: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2 Source.3090: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.3091: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.3092: DFBPPR22475 ---- Animal proteins ---- Small integral membrane protein 12 Source.3093: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.3094: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog Source.3095: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.3096: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2 Source.3097: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.3098: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.3099: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2 Source.3100: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1 Source.3101: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.3102: DFBPPR22550 ---- Animal proteins ---- Leucine-rich repeat-containing protein 23 Source.3103: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2 Source.3104: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1 Source.3105: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog Source.3106: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein Source.3107: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.3108: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.3109: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1 Source.3110: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog Source.3111: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A Source.3112: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26 Source.3113: DFBPPR22598 ---- Animal proteins ---- UPF0488 protein C8orf33 homolog Source.3114: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.3115: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128 Source.3116: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.3117: DFBPPR22618 ---- Animal proteins ---- BSD domain-containing protein 1 Source.3118: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1 Source.3119: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61 Source.3120: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B Source.3121: DFBPPR22635 ---- Animal proteins ---- Translation machinery-associated protein 16 Source.3122: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175 Source.3123: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5 Source.3124: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1 Source.3125: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32 Source.3126: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.3127: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9 Source.3128: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3 Source.3129: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.3130: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A Source.3131: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C Source.3132: DFBPPR22695 ---- Animal proteins ---- MORN repeat-containing protein 5 Source.3133: DFBPPR22696 ---- Animal proteins ---- Protein FAM228B Source.3134: DFBPPR22697 ---- Animal proteins ---- MORN repeat-containing protein 2 Source.3135: DFBPPR22702 ---- Animal proteins ---- Coiled-coil domain-containing protein 83 Source.3136: DFBPPR22703 ---- Animal proteins ---- Arrestin domain-containing protein 5 Source.3137: DFBPPR22706 ---- Animal proteins ---- Uncharacterized protein C3orf38 homolog Source.3138: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.3139: DFBPPR22730 ---- Animal proteins ---- UPF0545 protein C22orf39 homolog Source.3140: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1 Source.3141: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog Source.3142: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog Source.3143: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog Source.3144: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog Source.3145: DFBPPR22755 ---- Animal proteins ---- Uncharacterized protein C11orf86 homolog Source.3146: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.3147: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog Source.3148: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6 Source.3149: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.3150: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.3151: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3152: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3153: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.3154: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.3155: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.3156: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.3157: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.3158: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.3159: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.3160: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.3161: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.3162: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.3163: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3164: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.3165: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.3166: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.3167: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1 Source.3168: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.3169: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.3170: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1 Source.3171: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.3172: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.3173: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.3174: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1 Source.3175: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.3176: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.3177: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.3178: DFBPPR8616 ---- Animal proteins ---- Pleiotrophin Source.3179: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.3180: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.3181: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.3182: DFBPPR8647 ---- Animal proteins ---- Beclin-1 Source.3183: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.3184: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A Source.3185: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta Source.3186: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.3187: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.3188: DFBPPR8673 ---- Animal proteins ---- Calreticulin Source.3189: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.3190: DFBPPR8675 ---- Animal proteins ---- Receptor of activated protein C kinase 1 Source.3191: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.3192: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.3193: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog Source.3194: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.3195: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.3196: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.3197: DFBPPR8694 ---- Animal proteins ---- Spastin Source.3198: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.3199: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.3200: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.3201: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.3202: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.3203: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.3204: DFBPPR8721 ---- Animal proteins ---- NF-kappa-B inhibitor alpha Source.3205: DFBPPR8723 ---- Animal proteins ---- Platelet factor 4 Source.3206: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.3207: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.3208: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.3209: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.3210: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.3211: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.3212: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.3213: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3214: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.3215: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.3216: DFBPPR8760 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.3217: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.3218: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3219: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.3220: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.3221: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.3222: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.3223: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.3224: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.3225: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.3226: DFBPPR8792 ---- Animal proteins ---- Plasminogen Source.3227: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.3228: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone Source.3229: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase Source.3230: DFBPPR8810 ---- Animal proteins ---- Follistatin Source.3231: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2 Source.3232: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA Source.3233: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.3234: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.3235: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.3236: DFBPPR8831 ---- Animal proteins ---- Interferon regulatory factor 1 Source.3237: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5 Source.3238: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1 Source.3239: DFBPPR8836 ---- Animal proteins ---- Myogenin Source.3240: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.3241: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4 Source.3242: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase Source.3243: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1 Source.3244: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.3245: DFBPPR8851 ---- Animal proteins ---- Vimentin Source.3246: DFBPPR8852 ---- Animal proteins ---- Vimentin Source.3247: DFBPPR8854 ---- Animal proteins ---- Vimentin Source.3248: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide Source.3249: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.3250: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.3251: DFBPPR8897 ---- Animal proteins ---- Cytochrome b Source.3252: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.3253: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.3254: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.3255: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.3256: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.3257: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.3258: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.3259: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.3260: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.3261: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.3262: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.3263: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1 Source.3264: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B Source.3265: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha Source.3266: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III Source.3267: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.3268: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.3269: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.3270: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3 Source.3271: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.3272: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.3273: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.3274: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.3275: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.3276: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.3277: DFBPPR9039 ---- Animal proteins ---- Desmin Source.3278: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.3279: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3 Source.3280: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.3281: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4 Source.3282: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.3283: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.3284: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide Source.3285: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.3286: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.3287: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase Source.3288: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.3289: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.3290: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.3291: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.3292: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.3293: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.3294: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.3295: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.3296: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.3297: DFBPPR9154 ---- Animal proteins ---- Interleukin-6 Source.3298: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.3299: DFBPPR9160 ---- Animal proteins ---- Acylphosphatase-1 Source.3300: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.3301: DFBPPR9173 ---- Animal proteins ---- Neurotrophin-3 Source.3302: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.3303: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.3304: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein Source.3305: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.3306: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.3307: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain Source.3308: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.3309: DFBPPR9223 ---- Animal proteins ---- Protransforming growth factor alpha Source.3310: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.3311: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.3312: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.3313: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.3314: DFBPPR9236 ---- Animal proteins ---- Radixin Source.3315: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B Source.3316: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29 Source.3317: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.3318: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin Source.3319: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor Source.3320: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.3321: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.3322: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase Source.3323: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.3324: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.3325: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2 Source.3326: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4 Source.3327: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.3328: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.3329: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.3330: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3 Source.3331: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.3332: DFBPPR9328 ---- Animal proteins ---- Cofilin-2 Source.3333: DFBPPR9338 ---- Animal proteins ---- SPARC Source.3334: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.3335: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.3336: DFBPPR9345 ---- Animal proteins ---- Relaxin-3 Source.3337: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.3338: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.3339: DFBPPR9363 ---- Animal proteins ---- Moesin Source.3340: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.3341: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.3342: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.3343: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.3344: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase Source.3345: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase Source.3346: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase Source.3347: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.3348: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.3349: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.3350: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.3351: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.3352: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.3353: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.3354: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.3355: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.3356: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.3357: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.3358: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.3359: DFBPPR9497 ---- Animal proteins ---- Myoglobin Source.3360: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.3361: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.3362: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a Source.3363: DFBPPR9518 ---- Animal proteins ---- Interleukin-5 Source.3364: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.3365: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.3366: DFBPPR9539 ---- Animal proteins ---- Neurofilament heavy polypeptide Source.3367: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.3368: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.3369: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.3370: DFBPPR9559 ---- Animal proteins ---- CD302 antigen Source.3371: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.3372: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C Source.3373: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.3374: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.3375: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.3376: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.3377: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.3378: DFBPPR9630 ---- Animal proteins ---- Calponin-1 Source.3379: DFBPPR9631 ---- Animal proteins ---- Lithostathine Source.3380: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog Source.3381: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.3382: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.3383: DFBPPR9656 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.3384: DFBPPR9664 ---- Animal proteins ---- Perilipin-2 Source.3385: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1 Source.3386: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1 Source.3387: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.3388: DFBPPR9693 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1 Source.3389: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.3390: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.3391: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain Source.3392: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.3393: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.3394: DFBPPR9741 ---- Animal proteins ---- Syndecan-4 Source.3395: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain Source.3396: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B Source.3397: DFBPPR9751 ---- Animal proteins ---- Perilipin-3 Source.3398: DFBPPR9753 ---- Animal proteins ---- Syntaxin-binding protein 2 Source.3399: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.3400: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.3401: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.3402: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.3403: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A Source.3404: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.3405: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2 Source.3406: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.3407: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H Source.3408: DFBPPR9814 ---- Animal proteins ---- Testin Source.3409: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.3410: DFBPPR9843 ---- Animal proteins ---- P protein Source.3411: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.3412: DFBPPR9867 ---- Animal proteins ---- Phostensin Source.3413: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.3414: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.3415: DFBPPR9895 ---- Animal proteins ---- 40S ribosomal protein S12 Source.3416: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.3417: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19 Source.3418: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3 Source.3419: DFBPPR9910 ---- Animal proteins ---- Serum amyloid A-2 protein Source.3420: DFBPPR9912 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial Source.3421: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B Source.3422: DFBPPR9936 ---- Animal proteins ---- Serum amyloid A-4 protein Source.3423: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3424: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1 Source.3425: DFBPPR9950 ---- Animal proteins ---- 20 kDa neutrophil cationic protein Source.3426: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.3427: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.3428: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.3429: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.3430: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin Source.3431: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput Source.3432: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.3433: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.3434: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.3435: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.3436: DFBPPR9992 ---- Animal proteins ---- Receptor of activated protein C kinase 1 Source.3437: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.3438: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.3439: DFBPPR10004 ---- Animal proteins ---- Spastin Source.3440: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.3441: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.3442: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.3443: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.3444: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src Source.3445: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.3446: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.3447: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.3448: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2 Source.3449: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.3450: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.3451: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.3452: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.3453: DFBPPR10064 ---- Animal proteins ---- Pleiotrophin Source.3454: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.3455: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.3456: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.3457: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.3458: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor Source.3459: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.3460: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.3461: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog Source.3462: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.3463: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.3464: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.3465: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.3466: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.3467: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.3468: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase Source.3469: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.3470: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.3471: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.3472: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase Source.3473: DFBPPR10139 ---- Animal proteins ---- Cytochrome b Source.3474: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.3475: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.3476: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.3477: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.3478: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.3479: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.3480: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.3481: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.3482: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.3483: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.3484: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.3485: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT Source.3486: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.3487: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.3488: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5 Source.3489: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.3490: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3 Source.3491: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.3492: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.3493: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1 Source.3494: DFBPPR10187 ---- Animal proteins ---- Myogenin Source.3495: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk Source.3496: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.3497: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.3498: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.3499: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.3500: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.3501: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.3502: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.3503: DFBPPR10217 ---- Animal proteins ---- Follistatin Source.3504: DFBPPR10218 ---- Animal proteins ---- Occludin Source.3505: DFBPPR10219 ---- Animal proteins ---- Presenilin-1 Source.3506: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.3507: DFBPPR10228 ---- Animal proteins ---- Presenilin-2 Source.3508: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.3509: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4 Source.3510: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2 Source.3511: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.3512: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1 Source.3513: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.3514: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.3515: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.3516: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.3517: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.3518: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3519: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.3520: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.3521: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.3522: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.3523: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.3524: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.3525: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.3526: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2 Source.3527: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.3528: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.3529: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.3530: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.3531: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.3532: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.3533: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.3534: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.3535: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.3536: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.3537: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.3538: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.3539: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK Source.3540: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.3541: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.3542: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.3543: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.3544: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase Source.3545: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.3546: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.3547: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.3548: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.3549: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.3550: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.3551: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.3552: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.3553: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.3554: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2 Source.3555: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.3556: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.3557: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.3558: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.3559: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3 Source.3560: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.3561: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.3562: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.3563: DFBPPR10408 ---- Animal proteins ---- Beta-galactoside-binding lectin Source.3564: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3565: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.3566: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.3567: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.3568: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.3569: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.3570: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.3571: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.3572: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.3573: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.3574: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.3575: DFBPPR10452 ---- Animal proteins ---- Desmin Source.3576: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.3577: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.3578: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.3579: DFBPPR10459 ---- Animal proteins ---- Reelin Source.3580: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.3581: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3582: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.3583: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.3584: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3585: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.3586: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.3587: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.3588: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.3589: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.3590: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.3591: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1 Source.3592: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor Source.3593: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2 Source.3594: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta Source.3595: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3 Source.3596: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.3597: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.3598: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.3599: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9 Source.3600: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta Source.3601: DFBPPR10531 ---- Animal proteins ---- Serpin H1 Source.3602: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase Source.3603: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.3604: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.3605: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.3606: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.3607: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.3608: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.3609: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.3610: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.3611: DFBPPR10563 ---- Animal proteins ---- Optineurin Source.3612: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.3613: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.3614: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.3615: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.3616: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.3617: DFBPPR10570 ---- Animal proteins ---- Protein atonal homolog 7 Source.3618: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.3619: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6 Source.3620: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.3621: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1 Source.3622: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.3623: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.3624: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.3625: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1 Source.3626: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.3627: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.3628: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.3629: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.3630: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.3631: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.3632: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4 Source.3633: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.3634: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.3635: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.3636: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b Source.3637: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.3638: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA Source.3639: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.3640: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.3641: DFBPPR10643 ---- Animal proteins ---- Sclerostin domain-containing protein 1 Source.3642: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.3643: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5 Source.3644: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.3645: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.3646: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.3647: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.3648: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.3649: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.3650: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.3651: DFBPPR10662 ---- Animal proteins ---- CCN family member 3 Source.3652: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase Source.3653: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.3654: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.3655: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.3656: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.3657: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.3658: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.3659: DFBPPR10691 ---- Animal proteins ---- Beclin-1 Source.3660: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.3661: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2 Source.3662: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.3663: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.3664: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.3665: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.3666: DFBPPR10709 ---- Animal proteins ---- Docking protein 3 Source.3667: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.3668: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9 Source.3669: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.3670: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.3671: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.3672: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.3673: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.3674: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.3675: DFBPPR10731 ---- Animal proteins ---- Protein cereblon Source.3676: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.3677: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14 Source.3678: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3679: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.3680: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.3681: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.3682: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3683: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.3684: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.3685: DFBPPR10778 ---- Animal proteins ---- Avidin-related protein 2 Source.3686: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.3687: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2 Source.3688: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.3689: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.3690: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.3691: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1 Source.3692: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.3693: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.3694: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.3695: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide Source.3696: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.3697: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.3698: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.3699: DFBPPR10826 ---- Animal proteins ---- Cofilin-2 Source.3700: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Source.3701: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.3702: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa Source.3703: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.3704: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A Source.3705: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.3706: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.3707: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.3708: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.3709: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.3710: DFBPPR10865 ---- Animal proteins ---- Transgelin Source.3711: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase Source.3712: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2 Source.3713: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.3714: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.3715: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.3716: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1 Source.3717: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain Source.3718: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.3719: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.3720: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2 Source.3721: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.3722: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.3723: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1 Source.3724: DFBPPR10915 ---- Animal proteins ---- Hepatic lectin Source.3725: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.3726: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase Source.3727: DFBPPR10934 ---- Animal proteins ---- Glutathione S-transferase theta-1 Source.3728: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.3729: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.3730: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.3731: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.3732: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.3733: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.3734: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.3735: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y Source.3736: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor Source.3737: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like Source.3738: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2 Source.3739: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.3740: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.3741: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.3742: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.3743: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C Source.3744: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20 Source.3745: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.3746: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase Source.3747: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2 Source.3748: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.3749: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.3750: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.3751: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.3752: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.3753: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.3754: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1 Source.3755: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.3756: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.3757: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2 Source.3758: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.3759: DFBPPR11035 ---- Animal proteins ---- Protein Dr1 Source.3760: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.3761: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.3762: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.3763: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.3764: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.3765: DFBPPR11052 ---- Animal proteins ---- Protein cornichon homolog 2 Source.3766: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase Source.3767: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.3768: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13 Source.3769: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.3770: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.3771: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1 Source.3772: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.3773: DFBPPR11076 ---- Animal proteins ---- Myoglobin Source.3774: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.3775: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.3776: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1 Source.3777: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.3778: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.3779: DFBPPR11099 ---- Animal proteins ---- Acylphosphatase-1 Source.3780: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin Source.3781: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.3782: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase Source.3783: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.3784: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.3785: DFBPPR11118 ---- Animal proteins ---- Filensin Source.3786: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.3787: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.3788: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.3789: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit Source.3790: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.3791: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3 Source.3792: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.3793: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.3794: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.3795: DFBPPR11151 ---- Animal proteins ---- SPARC Source.3796: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein Source.3797: DFBPPR11156 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase Source.3798: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.3799: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta Source.3800: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.3801: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.3802: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta Source.3803: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.3804: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b Source.3805: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase Source.3806: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.3807: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.3808: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.3809: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.3810: DFBPPR11208 ---- Animal proteins ---- Transcription factor MafF Source.3811: DFBPPR11214 ---- Animal proteins ---- Homeodomain-only protein Source.3812: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.3813: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.3814: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.3815: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1 Source.3816: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2 Source.3817: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.3818: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.3819: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.3820: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2 Source.3821: DFBPPR11248 ---- Animal proteins ---- Myelin protein P0 Source.3822: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4 Source.3823: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3 Source.3824: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1 Source.3825: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7 Source.3826: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.3827: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.3828: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3 Source.3829: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES Source.3830: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.3831: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog Source.3832: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.3833: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.3834: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.3835: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2 Source.3836: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.3837: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.3838: DFBPPR11354 ---- Animal proteins ---- Centromere protein O Source.3839: DFBPPR11355 ---- Animal proteins ---- Collectin-10 Source.3840: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.3841: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2 Source.3842: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1 Source.3843: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.3844: DFBPPR11387 ---- Animal proteins ---- Amphiphysin Source.3845: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.3846: DFBPPR11401 ---- Animal proteins ---- Inhibitor of growth protein 3 Source.3847: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.3848: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.3849: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.3850: DFBPPR11412 ---- Animal proteins ---- Hyaluronan synthase 3 Source.3851: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.3852: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.3853: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6 Source.3854: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.3855: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.3856: DFBPPR11444 ---- Animal proteins ---- Troponin T, cardiac muscle isoforms Source.3857: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.3858: DFBPPR11448 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase 2 Source.3859: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2 Source.3860: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.3861: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11 Source.3862: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein Source.3863: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase Source.3864: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1 Source.3865: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2 Source.3866: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.3867: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X Source.3868: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein Source.3869: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.3870: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog Source.3871: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1 Source.3872: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3873: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.3874: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.3875: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.3876: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.3877: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.3878: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD Source.3879: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.3880: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.3881: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.3882: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC Source.3883: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.3884: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg Source.3885: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.3886: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.3887: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.3888: DFBPPR11578 ---- Animal proteins ---- Lymphocyte antigen 86 Source.3889: DFBPPR11581 ---- Animal proteins ---- PRKR-interacting protein 1 homolog Source.3890: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.3891: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.3892: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.3893: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.3894: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.3895: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3 Source.3896: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.3897: DFBPPR11623 ---- Animal proteins ---- Polyadenylate-binding protein-interacting protein 2 Source.3898: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.3899: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4 Source.3900: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.3901: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2 Source.3902: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4 Source.3903: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.3904: DFBPPR11649 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.3905: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase Source.3906: DFBPPR11660 ---- Animal proteins ---- Cathepsin K Source.3907: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.3908: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein Source.3909: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein Source.3910: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.3911: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.3912: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.3913: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H Source.3914: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4 Source.3915: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7 Source.3916: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.3917: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.3918: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.3919: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.3920: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.3921: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.3922: DFBPPR11723 ---- Animal proteins ---- Visinin Source.3923: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor Source.3924: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.3925: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3 Source.3926: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.3927: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1 Source.3928: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta Source.3929: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.3930: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.3931: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2 Source.3932: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.3933: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1 Source.3934: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4 Source.3935: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91 Source.3936: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.3937: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z Source.3938: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B Source.3939: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.3940: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.3941: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.3942: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.3943: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2 Source.3944: DFBPPR11856 ---- Animal proteins ---- Spindlin-W Source.3945: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82 Source.3946: DFBPPR11864 ---- Animal proteins ---- Radixin Source.3947: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.3948: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region Source.3949: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.3950: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.3951: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.3952: DFBPPR11895 ---- Animal proteins ---- 40S ribosomal protein S12 Source.3953: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.3954: DFBPPR11906 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 1 Source.3955: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A Source.3956: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.3957: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.3958: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3 Source.3959: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.3960: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.3961: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.3962: DFBPPR11924 ---- Animal proteins ---- Centromere protein P Source.3963: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.3964: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.3965: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.3966: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.3967: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog Source.3968: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor Source.3969: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.3970: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein Source.3971: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.3972: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.3973: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.3974: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.3975: DFBPPR12001 ---- Animal proteins ---- Pleckstrin homology domain-containing family F member 2 Source.3976: DFBPPR12002 ---- Animal proteins ---- Avidin-related protein 6 Source.3977: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.3978: DFBPPR12006 ---- Animal proteins ---- Avidin-related protein 7 Source.3979: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein Source.3980: DFBPPR12024 ---- Animal proteins ---- 40S ribosomal protein S6 Source.3981: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.3982: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.3983: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.3984: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein Source.3985: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.3986: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.3987: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.3988: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.3989: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.3990: DFBPPR12065 ---- Animal proteins ---- Testin Source.3991: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.3992: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129 Source.3993: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.3994: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.3995: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.3996: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.3997: DFBPPR12091 ---- Animal proteins ---- Neurofibromin Source.3998: DFBPPR12096 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 4 Source.3999: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.4000: DFBPPR12105 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1 Source.4001: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.4002: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1 Source.4003: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1 Source.4004: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.4005: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.4006: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.4007: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.4008: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6 Source.4009: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2 Source.4010: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.4011: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.4012: DFBPPR12162 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2 Source.4013: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45 Source.4014: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog Source.4015: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1 Source.4016: DFBPPR12178 ---- Animal proteins ---- SRY-related protein CH32 Source.4017: DFBPPR12179 ---- Animal proteins ---- SRY-related protein CH31 Source.4018: DFBPPR12181 ---- Animal proteins ---- Small integral membrane protein 15 Source.4019: DFBPPR12182 ---- Animal proteins ---- SRY-related protein CH1 Source.4020: DFBPPR12183 ---- Animal proteins ---- SRY-related protein CH4 Source.4021: DFBPPR12185 ---- Animal proteins ---- SRY-related protein CH2 Source.4022: DFBPPR12186 ---- Animal proteins ---- SRY-related protein CH7 Source.4023: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1 Source.4024: DFBPPR12202 ---- Animal proteins ---- Protein chibby homolog 2 Source.4025: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog Source.4026: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.4027: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.4028: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.4029: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174 Source.4030: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68 Source.4031: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog Source.4032: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.4033: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.4034: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.4035: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.4036: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1 Source.4037: DFBPPR12251 ---- Animal proteins ---- Serotransferrin Source.4038: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.4039: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.4040: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin Source.4041: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.4042: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.4043: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.4044: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.4045: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.4046: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.4047: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.4048: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.4049: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.4050: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.4051: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.4052: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.4053: DFBPPR12309 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.4054: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.4055: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4056: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.4057: DFBPPR12319 ---- Animal proteins ---- Calreticulin Source.4058: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.4059: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.4060: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.4061: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.4062: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.4063: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.4064: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2 Source.4065: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.4066: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.4067: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.4068: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.4069: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.4070: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.4071: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.4072: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.4073: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.4074: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.4075: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.4076: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.4077: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.4078: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.4079: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.4080: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.4081: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.4082: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.4083: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.4084: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.4085: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.4086: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A Source.4087: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.4088: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.4089: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.4090: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.4091: DFBPPR12439 ---- Animal proteins ---- Tissue factor Source.4092: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.4093: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4094: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.4095: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.4096: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.4097: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.4098: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.4099: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.4100: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.4101: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.4102: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.4103: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.4104: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.4105: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.4106: DFBPPR12501 ---- Animal proteins ---- Ezrin Source.4107: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.4108: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.4109: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.4110: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin Source.4111: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.4112: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase Source.4113: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.4114: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.4115: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.4116: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.4117: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4118: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.4119: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.4120: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2 Source.4121: DFBPPR12560 ---- Animal proteins ---- Calumenin Source.4122: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1 Source.4123: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.4124: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2 Source.4125: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.4126: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.4127: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase Source.4128: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.4129: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.4130: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20 Source.4131: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.4132: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.4133: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.4134: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.4135: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.4136: DFBPPR12626 ---- Animal proteins ---- E-selectin Source.4137: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide Source.4138: DFBPPR12636 ---- Animal proteins ---- Complement component C9 Source.4139: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain Source.4140: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.4141: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.4142: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.4143: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.4144: DFBPPR12681 ---- Animal proteins ---- Myosin-7 Source.4145: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.4146: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.4147: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.4148: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.4149: DFBPPR12728 ---- Animal proteins ---- Cytochrome b Source.4150: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.4151: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.4152: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3 Source.4153: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.4154: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.4155: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.4156: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.4157: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.4158: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin Source.4159: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.4160: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.4161: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor Source.4162: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2 Source.4163: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.4164: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4 Source.4165: DFBPPR12833 ---- Animal proteins ---- Cullin-5 Source.4166: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.4167: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.4168: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.4169: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain Source.4170: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.4171: DFBPPR12865 ---- Animal proteins ---- Sperm surface protein Sp17 Source.4172: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.4173: DFBPPR12878 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.4174: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1 Source.4175: DFBPPR12888 ---- Animal proteins ---- Myoglobin Source.4176: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.4177: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.4178: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.4179: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.4180: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.4181: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase Source.4182: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.4183: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1 Source.4184: DFBPPR12952 ---- Animal proteins ---- Serum amyloid A-1 protein Source.4185: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.4186: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12 Source.4187: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.4188: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain Source.4189: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.4190: DFBPPR12974 ---- Animal proteins ---- Serum amyloid A-3 protein Source.4191: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.4192: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.4193: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.4194: DFBPPR13003 ---- Animal proteins ---- Calcyphosin Source.4195: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A Source.4196: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.4197: DFBPPR13021 ---- Animal proteins ---- Ferritin light chain Source.4198: DFBPPR13028 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.4199: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.4200: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.4201: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein Source.4202: DFBPPR13050 ---- Animal proteins ---- Odorant-binding protein 3 Source.4203: DFBPPR13054 ---- Animal proteins ---- Relaxin-like protein SQ10 Source.4204: DFBPPR13055 ---- Animal proteins ---- Serum amyloid A-2 protein Source.4205: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2 Source.4206: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.4207: DFBPPR13084 ---- Animal proteins ---- Ig heavy chain V-A2 region K-25 Source.4208: DFBPPR13092 ---- Animal proteins ---- Testin Source.4209: DFBPPR13094 ---- Animal proteins ---- Atherin Source.4210: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region Source.4211: DFBPPR13112 ---- Animal proteins ---- Ig heavy chain V-A1 region BS-5 Source.4212: DFBPPR13114 ---- Animal proteins ---- Ig heavy chain V-A2 region BS-1 Source.4213: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.4214: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region Source.4215: DFBPPR13121 ---- Animal proteins ---- Ig heavy chain V-A2 region P-MU-3 Source.4216: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4217: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.4218: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.4219: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.4220: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.4221: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4222: DFBPPR13166 ---- Animal proteins ---- CD44 antigen Source.4223: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1 Source.4224: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.4225: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.4226: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase Source.4227: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.4228: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.4229: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.4230: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A Source.4231: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.4232: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.4233: DFBPPR13201 ---- Animal proteins ---- Major allergen Equ c 1 Source.4234: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.4235: DFBPPR13203 ---- Animal proteins ---- Follistatin Source.4236: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.4237: DFBPPR13209 ---- Animal proteins ---- Parathyroid hormone Source.4238: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2 Source.4239: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.4240: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.4241: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.4242: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.4243: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.4244: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4245: DFBPPR13233 ---- Animal proteins ---- Fibronectin Source.4246: DFBPPR13242 ---- Animal proteins ---- E-selectin Source.4247: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.4248: DFBPPR13252 ---- Animal proteins ---- Ferritin light chain Source.4249: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.4250: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.4251: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.4252: DFBPPR13275 ---- Animal proteins ---- Interleukin-6 Source.4253: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.4254: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.4255: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.4256: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.4257: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.4258: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.4259: DFBPPR13296 ---- Animal proteins ---- Complement component C9 Source.4260: DFBPPR13297 ---- Animal proteins ---- Plasminogen Source.4261: DFBPPR13305 ---- Animal proteins ---- Cytochrome b Source.4262: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.4263: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0 Source.4264: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.4265: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.4266: DFBPPR13323 ---- Animal proteins ---- Myoglobin Source.4267: DFBPPR13325 ---- Animal proteins ---- Serum amyloid A protein Source.4268: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.4269: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.4270: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.4271: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.4272: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta Source.4273: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4 Source.4274: DFBPPR13376 ---- Animal proteins ---- Interleukin-5 Source.4275: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein Source.4276: DFBPPR13387 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.4277: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.4278: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.4279: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22 Source.4280: DFBPPR13409 ---- Animal proteins ---- Testin Source.4281: DFBPPR13411 ---- Animal proteins ---- Dander allergen Equ c 2.0102 Source.4282: DFBPPR13412 ---- Animal proteins ---- Dander allergen Equ c 2.0101 Source.4283: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.4284: DFBPPR13420 ---- Animal proteins ---- Small integral membrane protein 12 Source.4285: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.4286: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.4287: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.4288: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.4289: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.4290: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.4291: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4292: DFBPPR13452 ---- Animal proteins ---- Interleukin-6 Source.4293: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase Source.4294: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.4295: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein Source.4296: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta Source.4297: DFBPPR13511 ---- Animal proteins ---- Myoglobin Source.4298: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.4299: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.4300: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4301: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.4302: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.4303: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.4304: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.4305: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.4306: DFBPPR13577 ---- Animal proteins ---- Interleukin-6 Source.4307: DFBPPR13584 ---- Animal proteins ---- Calpain-3 Source.4308: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.4309: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.4310: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4311: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.4312: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4313: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.4314: DFBPPR13602 ---- Animal proteins ---- Acrosin Source.4315: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.4316: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.4317: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.4318: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.4319: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.4320: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta Source.4321: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.4322: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6 Source.4323: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2 Source.4324: DFBPPR13646 ---- Animal proteins ---- Procathepsin L Source.4325: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA Source.4326: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.4327: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2 Source.4328: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.4329: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.4330: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.4331: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.4332: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.4333: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.4334: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.4335: DFBPPR13708 ---- Animal proteins ---- Renin Source.4336: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.4337: DFBPPR13713 ---- Animal proteins ---- Plasminogen Source.4338: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.4339: DFBPPR13716 ---- Animal proteins ---- Trichohyalin Source.4340: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.4341: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase Source.4342: DFBPPR13735 ---- Animal proteins ---- Thyroid hormone receptor beta Source.4343: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.4344: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic Source.4345: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21 Source.4346: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.4347: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.4348: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1 Source.4349: DFBPPR13805 ---- Animal proteins ---- Serum amyloid A protein Source.4350: DFBPPR13812 ---- Animal proteins ---- Myoglobin Source.4351: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.4352: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.4353: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein Source.4354: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.4355: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.4356: DFBPPR13864 ---- Animal proteins ---- Interleukin-5 Source.4357: DFBPPR13876 ---- Animal proteins ---- Follistatin Source.4358: DFBPPR13877 ---- Animal proteins ---- Sialin Source.4359: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.4360: DFBPPR13893 ---- Animal proteins ---- Calponin-1 Source.4361: DFBPPR13901 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.4362: DFBPPR13918 ---- Animal proteins ---- Testin Source.4363: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.4364: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.4365: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.4366: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.4367: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B Source.4368: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A Source.4369: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4370: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B Source.4371: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.4372: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.4373: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog Source.4374: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B Source.4375: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A Source.4376: DFBPPR14002 ---- Animal proteins ---- Cytochrome b Source.4377: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.4378: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase Source.4379: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1 Source.4380: DFBPPR14019 ---- Animal proteins ---- Vimentin Source.4381: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.4382: DFBPPR14041 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.4383: DFBPPR14051 ---- Animal proteins ---- Pro-thyrotropin-releasing hormone Source.4384: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.4385: DFBPPR14083 ---- Marine protein ---- RING-box protein 1 Source.4386: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III Source.4387: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A Source.4388: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B Source.4389: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA Source.4390: DFBPPR14100 ---- Marine protein ---- Cytochrome b Source.4391: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha Source.4392: DFBPPR14116 ---- Marine protein ---- Ferritin, heavy subunit Source.4393: DFBPPR14117 ---- Marine protein ---- Ferritin, middle subunit Source.4394: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.4395: DFBPPR14128 ---- Marine protein ---- F-box/LRR-repeat protein 15 Source.4396: DFBPPR14133 ---- Marine protein ---- Calumenin-B Source.4397: DFBPPR14135 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2A Source.4398: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.4399: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.4400: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.4401: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12 Source.4402: DFBPPR14158 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 3 Source.4403: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.4404: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.4405: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein Source.4406: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein Source.4407: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A Source.4408: DFBPPR14206 ---- Marine protein ---- Intraflagellar transport protein 43 homolog B Source.4409: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9 Source.4410: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.4411: DFBPPR14239 ---- Marine protein ---- Gonadotropin subunit beta-1 Source.4412: DFBPPR14241 ---- Marine protein ---- Cystatin Source.4413: DFBPPR14242 ---- Marine protein ---- Cytochrome b Source.4414: DFBPPR14252 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 3 Source.4415: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial Source.4416: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial Source.4417: DFBPPR14271 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.4418: DFBPPR14273 ---- Marine protein ---- Cytochrome c oxidase subunit 6B Source.4419: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.4420: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.4421: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.4422: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4423: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B Source.4424: DFBPPR14346 ---- Marine protein ---- R-phycoerythrin alpha chain Source.4425: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha Source.4426: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta' Source.4427: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.4428: DFBPPR14378 ---- Marine protein ---- Probable replicative DNA helicase Source.4429: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic Source.4430: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4 Source.4431: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.4432: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.4433: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic Source.4434: DFBPPR14440 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic Source.4435: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39 Source.4436: DFBPPR14528 ---- Marine protein ---- Uracil phosphoribosyltransferase homolog Source.4437: DFBPPR14547 ---- Marine protein ---- Interleukin-6 Source.4438: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.4439: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.4440: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.4441: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.4442: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1 Source.4443: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1 Source.4444: DFBPPR14590 ---- Marine protein ---- Cytochrome b Source.4445: DFBPPR14592 ---- Marine protein ---- Intelectin Source.4446: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2 Source.4447: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2 Source.4448: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein Source.4449: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing] Source.4450: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.4451: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.4452: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.4453: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.4454: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2 Source.4455: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.4456: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A Source.4457: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.4458: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B Source.4459: DFBPPR14672 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 3 Source.4460: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II Source.4461: DFBPPR14698 ---- Marine protein ---- Cystatin Source.4462: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3 Source.4463: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4 Source.4464: DFBPPR14725 ---- Marine protein ---- 40S ribosomal protein S6 Source.4465: DFBPPR14755 ---- Marine protein ---- Techylectin-5A Source.4466: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.4467: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2 Source.4468: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.4469: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain Source.4470: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain Source.4471: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.4472: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.4473: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4474: DFBPPR14861 ---- Marine protein ---- Cytochrome b Source.4475: DFBPPR14864 ---- Marine protein ---- Hemoglobin anodic subunit beta Source.4476: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta Source.4477: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle Source.4478: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.4479: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.4480: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.4481: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1 Source.4482: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.4483: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.4484: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.4485: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.4486: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.4487: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase Source.4488: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.4489: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5 Source.4490: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.4491: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase Source.4492: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.4493: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.4494: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1 Source.4495: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.4496: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.4497: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB Source.4498: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.4499: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1 Source.4500: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.4501: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.4502: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase Source.4503: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2 Source.4504: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.4505: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2 Source.4506: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.4507: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.4508: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.4509: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.4510: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.4511: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.4512: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1 Source.4513: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.4514: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.4515: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6 Source.4516: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.4517: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1 Source.4518: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b Source.4519: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase Source.4520: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.4521: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.4522: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.4523: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.4524: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.4525: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.4526: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.4527: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1 Source.4528: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9 Source.4529: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.4530: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.4531: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.4532: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.4533: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.4534: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.4535: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)] Source.4536: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.4537: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase Source.4538: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase Source.4539: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.4540: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.4541: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.4542: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.4543: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.4544: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase Source.4545: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2 Source.4546: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial Source.4547: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.4548: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1 Source.4549: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G Source.4550: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.4551: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.4552: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.4553: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4 Source.4554: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.4555: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2 Source.4556: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.4557: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.4558: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3 Source.4559: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.4560: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.4561: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2 Source.4562: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.4563: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.4564: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1 Source.4565: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.4566: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.4567: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase Source.4568: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1 Source.4569: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase Source.4570: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.4571: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.4572: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.4573: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1 Source.4574: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1 Source.4575: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4 Source.4576: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8 Source.4577: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.4578: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.4579: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3 Source.4580: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.4581: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.4582: DFBPPR15258 ---- Microorganism protein ---- Invertase Source.4583: DFBPPR15262 ---- Microorganism protein ---- Inner kinetochore subunit NKP1 Source.4584: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1 Source.4585: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.4586: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase Source.4587: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.4588: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.4589: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4 Source.4590: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21 Source.4591: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.4592: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.4593: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase Source.4594: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10 Source.4595: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10 Source.4596: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.4597: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2 Source.4598: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.4599: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.4600: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase Source.4601: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.4602: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.4603: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase Source.4604: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5 Source.4605: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1 Source.4606: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80 Source.4607: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.4608: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.4609: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.4610: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1 Source.4611: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59 Source.4612: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4 Source.4613: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1 Source.4614: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.4615: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.4616: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82 Source.4617: DFBPPR15440 ---- Microorganism protein ---- Mitochondrial homologous recombination protein 1 Source.4618: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2 Source.4619: DFBPPR15448 ---- Microorganism protein ---- 40S ribosomal protein S0 Source.4620: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22 Source.4621: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1 Source.4622: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.4623: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.4624: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.4625: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4 Source.4626: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2 Source.4627: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.4628: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.4629: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1 Source.4630: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.4631: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1 Source.4632: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.4633: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.4634: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.4635: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32 Source.4636: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.4637: DFBPPR15505 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC15 Source.4638: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3 Source.4639: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.4640: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1 Source.4641: DFBPPR15515 ---- Microorganism protein ---- Tethering factor for nuclear proteasome STS1 Source.4642: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14 Source.4643: DFBPPR15523 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 3, mitochondrial Source.4644: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10 Source.4645: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3 Source.4646: DFBPPR15528 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC23 Source.4647: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.4648: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.4649: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6 Source.4650: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase Source.4651: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.4652: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4 Source.4653: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.4654: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.4655: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.4656: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2 Source.4657: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6 Source.4658: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1 Source.4659: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.4660: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4 Source.4661: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27 Source.4662: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.4663: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.4664: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2 Source.4665: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase Source.4666: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2 Source.4667: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.4668: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.4669: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial Source.4670: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.4671: DFBPPR15627 ---- Microorganism protein ---- Multiprotein-bridging factor 1 Source.4672: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11 Source.4673: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.4674: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.4675: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11 Source.4676: DFBPPR15642 ---- Microorganism protein ---- Spindle pole component 29 Source.4677: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial Source.4678: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3 Source.4679: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25 Source.4680: DFBPPR15672 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit BLI1 Source.4681: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1 Source.4682: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.4683: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1 Source.4684: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8 Source.4685: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.4686: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.4687: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.4688: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1 Source.4689: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.4690: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.4691: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial Source.4692: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.4693: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.4694: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1 Source.4695: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1 Source.4696: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.4697: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.4698: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111 Source.4699: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial Source.4700: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6 Source.4701: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.4702: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9 Source.4703: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial Source.4704: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.4705: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase Source.4706: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase Source.4707: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase Source.4708: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.4709: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.4710: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase Source.4711: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain Source.4712: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.4713: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.4714: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.4715: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3 Source.4716: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase Source.4717: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.4718: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase Source.4719: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.4720: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.4721: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.4722: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.4723: DFBPPR15856 ---- Microorganism protein ---- Laccase-2 Source.4724: DFBPPR15857 ---- Microorganism protein ---- Laccase-1 Source.4725: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.4726: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase Source.4727: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.4728: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4729: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4730: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.4731: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.4732: DFBPPR15890 ---- Marine protein ---- 50S ribosomal protein L31, chloroplastic Source.4733: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.4734: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1 Source.4735: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2 Source.4736: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.4737: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.4738: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.4739: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.4740: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase Source.4741: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.4742: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.4743: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.4744: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.4745: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.4746: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.4747: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.4748: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.4749: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4750: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.4751: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.4752: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3 Source.4753: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.4754: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.4755: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.4756: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4757: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4758: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.4759: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.4760: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.4761: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.4762: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.4763: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.4764: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.4765: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.4766: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.4767: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.4768: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.4769: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.4770: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.4771: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.4772: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.4773: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1 Source.4774: DFBPPR7859 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.4775: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1 Source.4776: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.4777: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1 Source.4778: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1 Source.4779: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.4780: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.4781: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.4782: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.4783: DFBPPR7954 ---- Plant protein ---- Favin Source.4784: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.4785: DFBPPR7975 ---- Plant protein ---- Protein Ycf2 Source.4786: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein Source.4787: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.4788: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.4789: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B Source.4790: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.4791: DFBPPR8007 ---- Plant protein ---- Maturase K Source.4792: DFBPPR8029 ---- Plant protein ---- Vignain Source.4793: DFBPPR8030 ---- Plant protein ---- Arcelin-5A Source.4794: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.4795: DFBPPR8033 ---- Plant protein ---- Uricase-2 Source.4796: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.4797: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.4798: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.4799: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.4800: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.4801: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4802: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin Source.4803: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.4804: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4805: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4806: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.4807: DFBPPR8073 ---- Plant protein ---- Arcelin-5B Source.4808: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.4809: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1 Source.4810: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.4811: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase Source.4812: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.4813: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.4814: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin Source.4815: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.4816: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.4817: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.4818: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin Source.4819: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.4820: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.4821: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase Source.4822: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase Source.4823: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.4824: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic Source.4825: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1 Source.4826: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.4827: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4828: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.4829: DFBPPR8235 ---- Plant protein ---- Catalase Source.4830: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase Source.4831: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.4832: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4833: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4834: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3 Source.4835: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.4836: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.4837: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.4838: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.4839: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5 Source.4840: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.4841: DFBPPR8308 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.4842: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.4843: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited an Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibition of 65.1% at 20 uM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)O

Preparation method

Mode of preparation	Two-dimensional liquid chromatography-mass spectrometry separation
Enzyme(s)/starter culture	Two-dimensional liquid chromatography in combination with mass spectrometry was used for identification of poorly retained peptides present in enzymatically hydrolysed milk protein.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	van Platerink CJ, Janssen HG, Haverkamp J. Application of at-line two-dimensional liquid chromatography-mass spectrometry for identification of small hydrophilic angiotensin I-inhibiting peptides in milk hydrolysates. Anal Bioanal Chem. 2008 May;391(1):299-307. PMID: 18392815 DOI: 10.1007/s00216-008-1990-3
Other literature(s)	N.D
PubDate	2008