Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1224(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1224
Peptide sequence	YYA
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	Antihypertensive activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Tyr-Tyr-Ala

Single-letter amino acid

YYA

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	415.44 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.87 ^c

IC₅₀

2.80 uM

pIC₅₀

-0.447

GRAVY

-0.2667^c

Hydrophilic residue ratio

33.33%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Marine
Organism/Source	Jellyfish (Stomolophus nomurai)
Precursor protein	Jellyfish powder
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.2: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.3: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.4: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.5: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.6: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.7: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.8: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.9: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.10: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.11: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.12: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.13: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.14: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.15: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.16: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.17: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.18: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.19: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.20: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.21: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14 Source.22: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.23: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.24: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.25: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.26: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.27: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.28: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.29: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.30: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic Source.31: DFBPPR1782 ---- Plant proteins ---- Transcription factor BHLH133 Source.32: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.33: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.34: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B Source.35: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.36: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.37: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2 Source.38: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.39: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A Source.40: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.41: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12 Source.42: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.43: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1 Source.44: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.45: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.46: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.47: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.48: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.49: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.50: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.51: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.52: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.53: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.54: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.55: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.56: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.57: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.58: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30 Source.59: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16 Source.60: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4 Source.61: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.62: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15 Source.63: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.64: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.65: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1 Source.66: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1 Source.67: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.68: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.69: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.70: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic Source.71: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog Source.72: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.73: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.74: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.75: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.76: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.77: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.78: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.79: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.80: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.81: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.82: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.83: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.84: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35 Source.85: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400 Source.86: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.87: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A Source.88: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.89: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.90: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.91: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.92: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600 Source.93: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.94: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.95: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36 Source.96: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.97: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.98: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.99: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.100: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.101: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2 Source.102: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1 Source.103: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9 Source.104: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.105: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.106: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.107: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.108: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.109: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.110: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic Source.111: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.112: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.113: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.114: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1 Source.115: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.116: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.117: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.118: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.119: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.120: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.121: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H Source.122: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.123: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.124: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.125: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.126: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.127: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.128: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.129: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5 Source.130: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.131: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.132: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.133: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.134: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.135: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.136: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.137: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.138: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.139: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial Source.140: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.141: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.142: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.143: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.144: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.145: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.146: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.147: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic Source.148: DFBPPR4790 ---- Plant proteins ---- 60S ribosomal protein L30 Source.149: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.150: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.151: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.152: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.153: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic Source.154: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.155: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.156: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.157: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.158: DFBPPR5492 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit Source.159: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase Source.160: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.161: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.162: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.163: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.164: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.165: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.166: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A Source.167: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.168: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.169: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.170: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1 Source.171: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2 Source.172: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.173: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1 Source.174: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1 Source.175: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.176: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8 Source.177: DFBPPR6152 ---- Plant proteins ---- 60S ribosomal protein L30 Source.178: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.179: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.180: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.181: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.182: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.183: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.184: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.185: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.186: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.187: DFBPPR6526 ---- Plant proteins ---- Albumin-2 Source.188: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.189: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.190: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.191: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.192: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.193: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.194: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.195: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.196: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.197: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.198: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.199: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.200: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin Source.201: DFBPPR7608 ---- Milk proteins ---- Kappa-casein Source.202: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin Source.203: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.204: DFBPPR7673 ---- Milk proteins ---- Kappa-casein Source.205: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin Source.206: DFBPPR7686 ---- Milk proteins ---- Kappa-casein Source.207: DFBPPR7695 ---- Milk proteins ---- Kappa-casein Source.208: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein Source.209: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.210: DFBPPR7715 ---- Milk proteins ---- Kappa-casein Source.211: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.212: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33 Source.213: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein Source.214: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.215: DFBPPR8492 ---- Milk proteins ---- Kappa-casein Source.216: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.217: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.218: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase Source.219: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.220: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.221: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.222: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.223: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.224: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor Source.225: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A Source.226: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.227: DFBPPR16189 ---- Animal proteins ---- Albumin Source.228: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.229: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.230: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type Source.231: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.232: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.233: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase Source.234: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1 Source.235: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator Source.236: DFBPPR16582 ---- Animal proteins ---- Pepsin A Source.237: DFBPPR16588 ---- Animal proteins ---- Peptide YY Source.238: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.239: DFBPPR16722 ---- Animal proteins ---- Ig heavy chain V region MOO Source.240: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.241: DFBPPR16797 ---- Animal proteins ---- Albumin Source.242: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.243: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.244: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.245: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.246: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.247: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.248: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.249: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase Source.250: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.251: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase Source.252: DFBPPR17101 ---- Animal proteins ---- Annexin A5 Source.253: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.254: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.255: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.256: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 Source.257: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.258: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1 Source.259: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.260: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.261: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.262: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.263: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10 Source.264: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.265: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.266: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20 Source.267: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.268: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.269: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.270: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.271: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.272: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.273: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.274: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.275: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.276: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.277: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.278: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.279: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.280: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1 Source.281: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type Source.282: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.283: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.284: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.285: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.286: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.287: DFBPPR18952 ---- Animal proteins ---- Serotransferrin Source.288: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.289: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.290: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase Source.291: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.292: DFBPPR19145 ---- Animal proteins ---- Pepsin A Source.293: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.294: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain Source.295: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.296: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1 Source.297: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1 Source.298: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J Source.299: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.300: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.301: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.302: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.303: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.304: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1 Source.305: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.306: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.307: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3 Source.308: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.309: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6 Source.310: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1 Source.311: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.312: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.313: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1 Source.314: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase Source.315: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor Source.316: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.317: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.318: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.319: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230 Source.320: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.321: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.322: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.323: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216 Source.324: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.325: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.326: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.327: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.328: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.329: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7 Source.330: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.331: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.332: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3 Source.333: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.334: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11 Source.335: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A Source.336: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.337: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.338: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.339: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.340: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1 Source.341: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2 Source.342: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.343: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.344: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.345: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B Source.346: DFBPPR22274 ---- Animal proteins ---- 60S ribosomal protein L30 Source.347: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A Source.348: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80 Source.349: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein Source.350: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.351: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.352: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187 Source.353: DFBPPR22663 ---- Animal proteins ---- Erythrodihydroneopterin triphosphate synthetase Source.354: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.355: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog Source.356: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.357: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.358: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.359: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.360: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.361: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.362: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.363: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.364: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.365: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.366: DFBPPR8843 ---- Animal proteins ---- Pepsin A Source.367: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.368: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.369: DFBPPR9015 ---- Animal proteins ---- Serotransferrin Source.370: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.371: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.372: DFBPPR9044 ---- Animal proteins ---- Albumin Source.373: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.374: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase Source.375: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.376: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.377: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.378: DFBPPR9367 ---- Animal proteins ---- Peptide YY Source.379: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.380: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type Source.381: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type Source.382: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.383: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.384: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase Source.385: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha Source.386: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2 Source.387: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.388: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5 Source.389: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.390: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.391: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin Source.392: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.393: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type Source.394: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.395: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.396: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1 Source.397: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.398: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6 Source.399: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.400: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.401: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.402: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.403: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.404: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1 Source.405: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.406: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.407: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.408: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2 Source.409: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.410: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3 Source.411: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase Source.412: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.413: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.414: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2 Source.415: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.416: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6 Source.417: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12 Source.418: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5 Source.419: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.420: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.421: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.422: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.423: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.424: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.425: DFBPPR11011 ---- Animal proteins ---- Epigen Source.426: DFBPPR11077 ---- Animal proteins ---- Tyrosinase Source.427: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.428: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.429: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.430: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.431: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.432: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.433: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.434: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.435: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase Source.436: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230 Source.437: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.438: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.439: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.440: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.441: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.442: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1 Source.443: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.444: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.445: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.446: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.447: DFBPPR11815 ---- Animal proteins ---- 60S ribosomal protein L30 Source.448: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A Source.449: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11 Source.450: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.451: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog Source.452: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.453: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2 Source.454: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.455: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.456: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.457: DFBPPR12251 ---- Animal proteins ---- Serotransferrin Source.458: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.459: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.460: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.461: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.462: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.463: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.464: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A Source.465: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.466: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.467: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.468: DFBPPR12536 ---- Animal proteins ---- Albumin Source.469: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.470: DFBPPR12710 ---- Animal proteins ---- Endoplasmin Source.471: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.472: DFBPPR12761 ---- Animal proteins ---- Trichohyalin Source.473: DFBPPR12768 ---- Animal proteins ---- Pepsin-3 Source.474: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin Source.475: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2 Source.476: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.477: DFBPPR12914 ---- Animal proteins ---- Lipase member H Source.478: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.479: DFBPPR12933 ---- Animal proteins ---- Peptide YY Source.480: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.481: DFBPPR13075 ---- Animal proteins ---- 60S ribosomal protein L5 Source.482: DFBPPR13084 ---- Animal proteins ---- Ig heavy chain V-A2 region K-25 Source.483: DFBPPR13112 ---- Animal proteins ---- Ig heavy chain V-A1 region BS-5 Source.484: DFBPPR13114 ---- Animal proteins ---- Ig heavy chain V-A2 region BS-1 Source.485: DFBPPR13130 ---- Animal proteins ---- Ig kappa chain V region AH80-5 Source.486: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.487: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.488: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.489: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.490: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.491: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.492: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.493: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.494: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.495: DFBPPR13716 ---- Animal proteins ---- Trichohyalin Source.496: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.497: DFBPPR13788 ---- Animal proteins ---- Albumin Source.498: DFBPPR13851 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2A Source.499: DFBPPR13911 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2C Source.500: DFBPPR13949 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2B Source.501: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.502: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1 Source.503: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2 Source.504: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.505: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase Source.506: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.507: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein Source.508: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.509: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.510: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.511: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme Source.512: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.513: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.514: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1 Source.515: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.516: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.517: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.518: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40 Source.519: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.520: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.521: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1 Source.522: DFBPPR15258 ---- Microorganism protein ---- Invertase Source.523: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase Source.524: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.525: DFBPPR15281 ---- Microorganism protein ---- Cytochrome c oxidase subunit 9, mitochondrial Source.526: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone Source.527: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12 Source.528: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.529: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.530: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.531: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.532: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34 Source.533: DFBPPR15534 ---- Microorganism protein ---- 60S ribosomal protein L30 Source.534: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13 Source.535: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.536: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.537: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain Source.538: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1 Source.539: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.540: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1 Source.541: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.542: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase Source.543: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.544: DFBPPR8007 ---- Plant protein ---- Maturase K Source.545: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic Source.546: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.547: DFBPPR8122 ---- Plant protein ---- Arcelin-4 Source.548: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited strong Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 2.80 uM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C)C(=O)O

Preparation method

Mode of preparation	Synthesis
Enzyme(s)/starter culture	The synthetic peptide YYA was purchased from Peptide Institute Inc. (Osaka).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

DFBP

[D1]	DFBPANHY0684
[D2]	DFBPMUFU0262

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	Morinaga, Y., Iwai, K., Tomita, H., Takaya, Y., Naraoka, T., Matsue, H. Chemical Nature of a New Antihypertensive Peptide Derived from Jellyfish. Food Science and Technology Research. 2010, 16, 333-40. DOI: 10.3136/fstr.16.333
Other literature(s)	N.D
PubDate	2010