E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1560(ACE-inhibitory peptide)
DFBP ID DFBPACEI1560
Peptide sequence PY
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Pro-Tyr
Single-letter amino acid PY
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 278.30 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
IC50 2380 uM
pIC50 -3.377
GRAVY -1.4500 c
Hydrophilic residue ratio 50% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine
Precursor protein Bovine hide collagen
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin
Source.2: DFBPPR0380 ---- Plant protein ---- Alpha-gliadin
Source.3: DFBPPR0381 ---- Plant protein ---- Alpha-gliadin
Source.4: DFBPPR0382 ---- Plant protein ---- Alpha-gliadin
Source.5: DFBPPR0383 ---- Plant protein ---- Alpha-gliadin
Source.6: DFBPPR0384 ---- Plant protein ---- Alpha-gliadin
Source.7: DFBPPR0385 ---- Plant protein ---- Alpha-gliadin
Source.8: DFBPPR0389 ---- Plant protein ---- Alpha-gliadin
Source.9: DFBPPR0390 ---- Plant protein ---- B3144=ALPHA-gliadin derived CELIAC active peptide
Source.10: DFBPPR0391 ---- Plant protein ---- B3143=ALPHA-gliadin derived CELIAC active peptide
Source.11: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.12: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.13: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.14: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.15: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.16: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.17: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.18: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.19: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.20: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.21: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.22: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.23: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.24: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.25: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.26: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.27: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.28: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.29: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.30: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.31: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.32: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.33: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.34: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.35: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.36: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.37: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.38: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.39: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.40: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.41: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.42: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.43: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.44: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.45: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.46: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.47: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.48: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.49: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.50: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.51: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.52: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.53: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.54: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.55: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.56: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1
Source.57: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.58: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.59: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.60: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.61: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.62: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.63: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.64: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.65: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.66: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a
Source.67: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.68: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.69: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.70: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.71: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.72: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.73: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.74: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.75: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.76: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.77: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.78: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3
Source.79: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.80: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.81: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.82: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.83: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.84: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.85: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.86: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.87: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.88: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.89: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.90: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.91: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.92: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.93: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.94: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.95: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.96: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.97: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.98: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.99: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.100: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.101: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.102: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.103: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.104: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.105: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.106: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.107: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.108: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.109: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.110: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.111: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.112: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.113: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.114: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.115: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.116: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.117: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.118: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.119: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.120: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.121: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.122: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.123: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.124: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.125: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.126: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.127: DFBPPR1050 ---- Plant proteins ---- Mitogen-activated protein kinase kinase 1
Source.128: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.129: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.130: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.131: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.132: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.133: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.134: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.135: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.136: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.137: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.138: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.139: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.140: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.141: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.142: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.143: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.144: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.145: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.146: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE
Source.147: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.148: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.149: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.150: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.151: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.152: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.153: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.154: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.155: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.156: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.157: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.158: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.159: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.160: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.161: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B
Source.162: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.163: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.164: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.165: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.166: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.167: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.168: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.169: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.170: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.171: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.172: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.173: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.174: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.175: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.176: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.177: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.178: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.179: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.180: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.181: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.182: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.183: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.184: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.185: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.186: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.187: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.188: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.189: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.190: DFBPPR1176 ---- Plant proteins ---- Chitinase 12
Source.191: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.192: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.193: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.194: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3
Source.195: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.196: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.197: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.198: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.199: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.200: DFBPPR1223 ---- Plant proteins ---- Elicitor-responsive protein 1
Source.201: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.202: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.203: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.204: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.205: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.206: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.207: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.208: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.209: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.210: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.211: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.212: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.213: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.214: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.215: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.216: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.217: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.218: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.219: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.220: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.221: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.222: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1
Source.223: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.224: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.225: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.226: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.227: DFBPPR1310 ---- Plant proteins ---- Rac-like GTP-binding protein 6
Source.228: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.229: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.230: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.231: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.232: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.233: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.234: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.235: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.236: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.237: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.238: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.239: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.240: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.241: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.242: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.243: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.244: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.245: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.246: DFBPPR1361 ---- Plant proteins ---- Anthranilate synthase beta subunit 2, chloroplastic
Source.247: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.248: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.249: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.250: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.251: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.252: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.253: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.254: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.255: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.256: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.257: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.258: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.259: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.260: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.261: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.262: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.263: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.264: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.265: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.266: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.267: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.268: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.269: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.270: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.271: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.272: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.273: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.274: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.275: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.276: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.277: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.278: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.279: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.280: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.281: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.282: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.283: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.284: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.285: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.286: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.287: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.288: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.289: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.290: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.291: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.292: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.293: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.294: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.295: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.296: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.297: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.298: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.299: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.300: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.301: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.302: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.303: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.304: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.305: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.306: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.307: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.308: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.309: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.310: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.311: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.312: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.313: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.314: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.315: DFBPPR1497 ---- Plant proteins ---- Chitinase 1
Source.316: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.317: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1
Source.318: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.319: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.320: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.321: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.322: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.323: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.324: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.325: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.326: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.327: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.328: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.329: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.330: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.331: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.332: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.333: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.334: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.335: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.336: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.337: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.338: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.339: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.340: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.341: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.342: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.343: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A
Source.344: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.345: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.346: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.347: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.348: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.349: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.350: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.351: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic
Source.352: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.353: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.354: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.355: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.356: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.357: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.358: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.359: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.360: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.361: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.362: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.363: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.364: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase
Source.365: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.366: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.367: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.368: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.369: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.370: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.371: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.372: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.373: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.374: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.375: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.376: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.377: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.378: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.379: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.380: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.381: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.382: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.383: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.384: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.385: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.386: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.387: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.388: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.389: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.390: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.391: DFBPPR1675 ---- Plant proteins ---- Protein LSD1
Source.392: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.393: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.394: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.395: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.396: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.397: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3
Source.398: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.399: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062
Source.400: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.401: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.402: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.403: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.404: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.405: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.406: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.407: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.408: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.409: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.410: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.411: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.412: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.413: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.414: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.415: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.416: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.417: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.418: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.419: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.420: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.421: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.422: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.423: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.424: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.425: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.426: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.427: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.428: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.429: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.430: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.431: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57
Source.432: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.433: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.434: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.435: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.436: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.437: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2
Source.438: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.439: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.440: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.441: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.442: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.443: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.444: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.445: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.446: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.447: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.448: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.449: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.450: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22
Source.451: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.452: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.453: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.454: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.455: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.456: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.457: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.458: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.459: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.460: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.461: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.462: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic
Source.463: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.464: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.465: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.466: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.467: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.468: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.469: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1
Source.470: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.471: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1
Source.472: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.473: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.474: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.475: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.476: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.477: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.478: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.479: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.480: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.481: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.482: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.483: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.484: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.485: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.486: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.487: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.488: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.489: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.490: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.491: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.492: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.493: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.494: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.495: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.496: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.497: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.498: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B
Source.499: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.500: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.501: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.502: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d
Source.503: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.504: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.505: DFBPPR1887 ---- Plant proteins ---- Probable glutathione S-transferase DHAR2, chloroplastic
Source.506: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.507: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.508: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.509: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.510: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.511: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.512: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.513: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.514: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.515: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.516: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.517: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.518: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.519: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.520: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.521: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.522: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.523: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.524: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.525: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.526: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.527: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.528: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.529: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.530: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A
Source.531: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.532: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4
Source.533: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.534: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B
Source.535: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.536: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.537: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.538: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1
Source.539: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.540: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4
Source.541: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.542: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.543: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1
Source.544: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.545: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.546: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.547: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.548: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.549: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.550: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.551: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.552: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.553: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.554: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.555: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.556: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38
Source.557: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.558: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.559: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.560: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.561: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1
Source.562: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.563: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.564: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.565: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.566: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.567: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.568: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.569: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.570: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.571: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.572: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.573: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.574: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.575: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.576: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.577: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.578: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.579: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.580: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.581: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.582: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.583: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23
Source.584: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.585: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.586: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.587: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.588: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.589: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.590: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.591: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.592: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.593: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.594: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.595: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.596: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.597: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.598: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.599: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.600: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.601: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.602: DFBPPR2085 ---- Plant proteins ---- Protein LOL5
Source.603: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.604: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.605: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.606: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.607: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.608: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.609: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.610: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.611: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.612: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.613: DFBPPR2101 ---- Plant proteins ---- Cupincin
Source.614: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.615: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.616: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.617: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.618: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.619: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.620: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.621: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.622: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.623: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.624: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.625: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.626: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.627: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.628: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.629: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.630: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.631: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.632: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.633: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A
Source.634: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.635: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.636: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.637: DFBPPR2159 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.638: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.639: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.640: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.641: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.642: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.643: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.644: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.645: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.646: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.647: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.648: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.649: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.650: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.651: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.652: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.653: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.654: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.655: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.656: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.657: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.658: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.659: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.660: DFBPPR2223 ---- Plant proteins ---- Urease
Source.661: DFBPPR2226 ---- Plant proteins ---- Two-component response regulator ORR7
Source.662: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.663: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.664: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.665: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.666: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.667: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.668: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.669: DFBPPR2241 ---- Plant proteins ---- Nitrogen regulatory protein P-II homolog
Source.670: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.671: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.672: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.673: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.674: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.675: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3
Source.676: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.677: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.678: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.679: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.680: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.681: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.682: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.683: DFBPPR2272 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 2
Source.684: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.685: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.686: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.687: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.688: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.689: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.690: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.691: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.692: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.693: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.694: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.695: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.696: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.697: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.698: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.699: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.700: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.701: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.702: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.703: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.704: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.705: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.706: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.707: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.708: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.709: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.710: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.711: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.712: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b
Source.713: DFBPPR2344 ---- Plant proteins ---- Calcineurin B-like protein 8
Source.714: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.715: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.716: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.717: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.718: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6
Source.719: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11
Source.720: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.721: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.722: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.723: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.724: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.725: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.726: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.727: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.728: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.729: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.730: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.731: DFBPPR2381 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.732: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.733: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.734: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.735: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.736: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.737: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.738: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.739: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.740: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089
Source.741: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.742: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.743: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.744: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.745: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.746: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.747: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.748: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.749: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.750: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.751: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.752: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.753: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.754: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.755: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.756: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.757: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.758: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.759: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.760: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.761: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73
Source.762: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.763: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.764: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.765: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.766: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.767: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.768: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9
Source.769: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.770: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.771: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.772: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.773: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.774: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.775: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.776: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.777: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.778: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.779: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.780: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.781: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.782: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.783: DFBPPR2497 ---- Plant proteins ---- Thioredoxin-like protein HCF164, chloroplastic
Source.784: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.785: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.786: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b
Source.787: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.788: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.789: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.790: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.791: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.792: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9
Source.793: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.794: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.795: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.796: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.797: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.798: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.799: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.800: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.801: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.802: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.803: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.804: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.805: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.806: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.807: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.808: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.809: DFBPPR2555 ---- Plant proteins ---- Elicitor-responsive protein 3
Source.810: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.811: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.812: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.813: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.814: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.815: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.816: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.817: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.818: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9
Source.819: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.820: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.821: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1
Source.822: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic
Source.823: DFBPPR2584 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.824: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.825: DFBPPR2586 ---- Plant proteins ---- Probable protein-S-isoprenylcysteine O-methyltransferase
Source.826: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.827: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.828: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.829: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.830: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.831: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2
Source.832: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.833: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.834: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.835: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.836: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.837: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.838: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.839: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1
Source.840: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.841: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.842: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.843: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.844: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.845: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3
Source.846: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.847: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.848: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.849: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.850: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.851: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.852: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.853: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2
Source.854: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.855: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.856: DFBPPR2675 ---- Plant proteins ---- Anamorsin homolog 2
Source.857: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.858: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.859: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.860: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.861: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.862: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.863: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.864: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.865: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.866: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.867: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.868: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.869: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.870: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.871: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.872: DFBPPR2712 ---- Plant proteins ---- Expansin-A20
Source.873: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.874: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.875: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.876: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.877: DFBPPR2721 ---- Plant proteins ---- Expansin-A18
Source.878: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.879: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.880: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.881: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.882: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.883: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.884: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.885: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.886: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.887: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.888: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.889: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.890: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.891: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.892: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.893: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.894: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.895: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.896: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.897: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A
Source.898: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.899: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.900: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.901: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.902: DFBPPR2784 ---- Plant proteins ---- Chitinase 11
Source.903: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.904: DFBPPR2791 ---- Plant proteins ---- Calcineurin B-like protein 7
Source.905: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.906: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.907: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.908: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.909: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.910: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2
Source.911: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.912: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.913: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.914: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.915: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.916: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.917: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.918: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.919: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.920: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.921: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.922: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.923: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.924: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.925: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.926: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.927: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.928: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.929: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.930: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.931: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.932: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.933: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.934: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.935: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.936: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.937: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B
Source.938: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.939: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.940: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.941: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.942: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.943: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.944: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.945: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.946: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.947: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.948: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.949: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.950: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.951: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.952: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.953: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21
Source.954: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.955: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.956: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.957: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.958: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.959: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.960: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.961: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.962: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.963: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28
Source.964: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.965: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.966: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.967: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.968: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.969: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.970: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1
Source.971: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.972: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.973: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.974: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.975: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.976: DFBPPR2952 ---- Plant proteins ---- Expansin-A17
Source.977: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.978: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.979: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.980: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.981: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.982: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.983: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.984: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.985: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.986: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.987: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.988: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.989: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.990: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.991: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.992: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.993: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.994: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.995: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.996: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.997: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.998: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.999: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase
Source.1000: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.1001: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.1002: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.1003: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.1004: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.1005: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.1006: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.1007: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.1008: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.1009: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.1010: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.1011: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1
Source.1012: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b
Source.1013: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.1014: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.1015: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.1016: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.1017: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10
Source.1018: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.1019: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.1020: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.1021: DFBPPR3052 ---- Plant proteins ---- MADS-box transcription factor 31
Source.1022: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.1023: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.1024: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.1025: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1
Source.1026: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.1027: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.1028: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1029: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.1030: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.1031: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1032: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.1033: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.1034: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.1035: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.1036: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.1037: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.1038: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.1039: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.1040: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.1041: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.1042: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.1043: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.1044: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.1045: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.1046: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.1047: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.1048: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.1049: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.1050: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.1051: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.1052: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.1053: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.1054: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.1055: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.1056: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.1057: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.1058: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.1059: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.1060: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.1061: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.1062: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1063: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.1064: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.1065: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1066: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1067: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.1068: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.1069: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.1070: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1071: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.1072: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.1073: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1
Source.1074: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.1075: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.1076: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1077: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.1078: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.1079: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.1080: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.1081: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.1082: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1083: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1084: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.1085: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.1086: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.1087: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1088: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.1089: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1090: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.1091: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1092: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1093: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1094: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.1095: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1096: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1097: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.1098: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.1099: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.1100: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1101: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.1102: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1103: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.1104: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.1105: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.1106: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1107: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.1108: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.1109: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.1110: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.1111: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.1112: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.1113: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.1114: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.1115: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.1116: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1117: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.1118: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.1119: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.1120: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1121: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.1122: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.1123: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1124: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1125: DFBPPR3276 ---- Plant proteins ---- MADS-box transcription factor 27
Source.1126: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.1127: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1128: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1129: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21
Source.1130: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.1131: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.1132: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.1133: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b
Source.1134: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.1135: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4
Source.1136: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1137: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9
Source.1138: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.1139: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.1140: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.1141: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1142: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.1143: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.1144: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.1145: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.1146: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.1147: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.1148: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8
Source.1149: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.1150: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.1151: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.1152: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.1153: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.1154: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1155: DFBPPR3336 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.1156: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.1157: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.1158: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1159: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.1160: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.1161: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.1162: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.1163: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.1164: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1165: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1166: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.1167: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1168: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1169: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.1170: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.1171: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1172: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.1173: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19
Source.1174: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1
Source.1175: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1176: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.1177: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.1178: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.1179: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1180: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1181: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20
Source.1182: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.1183: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1184: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12
Source.1185: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.1186: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3
Source.1187: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.1188: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1189: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1190: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.1191: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.1192: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.1193: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase
Source.1194: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1195: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1196: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1197: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1198: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.1199: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.1200: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.1201: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.1202: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.1203: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1204: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1205: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1206: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.1207: DFBPPR3452 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.1208: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.1209: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.1210: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1211: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.1212: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.1213: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.1214: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.1215: DFBPPR3471 ---- Plant proteins ---- Monothiol glutaredoxin-S6
Source.1216: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.1217: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.1218: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1219: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.1220: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1221: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5
Source.1222: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31
Source.1223: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1224: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.1225: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1226: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32
Source.1227: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1228: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.1229: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.1230: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1231: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1232: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.1233: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.1234: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.1235: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.1236: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.1237: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.1238: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1239: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1240: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1241: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.1242: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1243: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1244: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.1245: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1246: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.1247: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.1248: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.1249: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.1250: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1251: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.1252: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.1253: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.1254: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1
Source.1255: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1256: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1257: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.1258: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.1259: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1260: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17
Source.1261: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1262: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1263: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1264: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial
Source.1265: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1266: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.1267: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.1268: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.1269: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1270: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.1271: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1272: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.1273: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e
Source.1274: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1275: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1276: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.1277: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.1278: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1279: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b
Source.1280: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1281: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.1282: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.1283: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.1284: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.1285: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1286: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.1287: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1288: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2
Source.1289: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1290: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.1291: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1292: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e
Source.1293: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.1294: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.1295: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.1296: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1297: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1298: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.1299: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1300: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5
Source.1301: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.1302: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.1303: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6
Source.1304: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1305: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1306: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.1307: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.1308: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1309: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.1310: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1311: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1312: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.1313: DFBPPR3687 ---- Plant proteins ---- Two-component response regulator ORR41
Source.1314: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.1315: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.1316: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.1317: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.1318: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.1319: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.1320: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.1321: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.1322: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.1323: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.1324: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.1325: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.1326: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1327: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.1328: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.1329: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.1330: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin
Source.1331: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.1332: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.1333: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.1334: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.1335: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1336: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.1337: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.1338: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1339: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.1340: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.1341: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30
Source.1342: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.1343: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.1344: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.1345: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1346: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.1347: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.1348: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.1349: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.1350: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.1351: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.1352: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.1353: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.1354: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1355: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1
Source.1356: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1357: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.1358: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.1359: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6
Source.1360: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic
Source.1361: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.1362: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.1363: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1364: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.1365: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.1366: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.1367: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.1368: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.1369: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.1370: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.1371: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.1372: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.1373: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.1374: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.1375: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.1376: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.1377: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13
Source.1378: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.1379: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.1380: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.1381: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.1382: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.1383: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.1384: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1385: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.1386: DFBPPR3882 ---- Plant proteins ---- Squamosa promoter-binding-like protein 7
Source.1387: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.1388: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.1389: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.1390: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.1391: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.1392: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.1393: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.1394: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.1395: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.1396: DFBPPR3909 ---- Plant proteins ---- LIM domain-containing protein PLIM2b
Source.1397: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1398: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.1399: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.1400: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.1401: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.1402: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.1403: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1404: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.1405: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1406: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.1407: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.1408: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.1409: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.1410: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.1411: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.1412: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.1413: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.1414: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial
Source.1415: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.1416: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.1417: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1
Source.1418: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.1419: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8
Source.1420: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.1421: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.1422: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial
Source.1423: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.1424: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.1425: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1426: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1427: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4
Source.1428: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.1429: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1430: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.1431: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.1432: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1433: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.1434: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.1435: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.1436: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.1437: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.1438: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1439: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.1440: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.1441: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.1442: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.1443: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.1444: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1445: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.1446: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.1447: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.1448: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.1449: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.1450: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.1451: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.1452: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A
Source.1453: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1454: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.1455: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.1456: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.1457: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.1458: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.1459: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.1460: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.1461: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.1462: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.1463: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.1464: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.1465: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.1466: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1467: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1468: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1469: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.1470: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.1471: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.1472: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.1473: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4
Source.1474: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.1475: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.1476: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.1477: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.1478: DFBPPR4128 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 2
Source.1479: DFBPPR4129 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 1
Source.1480: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1481: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.1482: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1483: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.1484: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.1485: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1486: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.1487: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.1488: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1489: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1490: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1491: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1492: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.1493: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.1494: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1495: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1
Source.1496: DFBPPR4166 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.1497: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.1498: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1499: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.1500: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.1501: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.1502: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.1503: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1504: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.1505: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1506: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.1507: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1508: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1509: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1510: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1511: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.1512: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1513: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.1514: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P
Source.1515: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.1516: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1517: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.1518: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1519: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.1520: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1521: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.1522: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1523: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1524: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.1525: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.1526: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.1527: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1528: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1529: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1530: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.1531: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1532: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.1533: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.1534: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.1535: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.1536: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1
Source.1537: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1538: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1539: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.1540: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.1541: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.1542: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.1543: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.1544: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.1545: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.1546: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1547: DFBPPR4320 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.1548: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.1549: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.1550: DFBPPR4331 ---- Plant proteins ---- 60S ribosomal protein L10-2
Source.1551: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.1552: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.1553: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.1554: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.1555: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11
Source.1556: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.1557: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.1558: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.1559: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.1560: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.1561: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.1562: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.1563: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.1564: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.1565: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1566: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2
Source.1567: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.1568: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.1569: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1570: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.1571: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.1572: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.1573: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.1574: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.1575: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25
Source.1576: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.1577: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1578: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.1579: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.1580: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.1581: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1582: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.1583: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.1584: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.1585: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.1586: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1587: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.1588: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.1589: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1590: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.1591: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.1592: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.1593: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.1594: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.1595: DFBPPR4451 ---- Plant proteins ---- Mini zinc finger protein 2
Source.1596: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.1597: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.1598: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1599: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.1600: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.1601: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1602: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.1603: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.1604: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.1605: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.1606: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.1607: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.1608: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.1609: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.1610: DFBPPR4504 ---- Plant proteins ---- 60S ribosomal protein L10-1
Source.1611: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.1612: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.1613: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.1614: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.1615: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.1616: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1617: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.1618: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.1619: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1620: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.1621: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1622: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.1623: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.1624: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.1625: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.1626: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.1627: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.1628: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.1629: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.1630: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.1631: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.1632: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1
Source.1633: DFBPPR4564 ---- Plant proteins ---- Mini zinc finger protein 1
Source.1634: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5
Source.1635: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1
Source.1636: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.1637: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.1638: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.1639: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.1640: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.1641: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.1642: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1643: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.1644: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.1645: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.1646: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.1647: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.1648: DFBPPR4607 ---- Plant proteins ---- Protein LOL2
Source.1649: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16
Source.1650: DFBPPR4610 ---- Plant proteins ---- Protein LOL3
Source.1651: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.1652: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.1653: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1654: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.1655: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.1656: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19
Source.1657: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.1658: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.1659: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.1660: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.1661: DFBPPR4646 ---- Plant proteins ---- 40S ribosomal protein S13-1
Source.1662: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.1663: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.1664: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.1665: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.1666: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.1667: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.1668: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.1669: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.1670: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.1671: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1672: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.1673: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.1674: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.1675: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4
Source.1676: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.1677: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2
Source.1678: DFBPPR4704 ---- Plant proteins ---- 60S ribosomal protein L39-1
Source.1679: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.1680: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.1681: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.1682: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.1683: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.1684: DFBPPR4730 ---- Plant proteins ---- 40S ribosomal protein S13-2
Source.1685: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.1686: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.1687: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.1688: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400
Source.1689: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.1690: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.1691: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.1692: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.1693: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1694: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1695: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.1696: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.1697: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.1698: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.1699: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.1700: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.1701: DFBPPR4773 ---- Plant proteins ---- 60S ribosomal protein L39-3
Source.1702: DFBPPR4777 ---- Plant proteins ---- 60S ribosomal protein L39-2
Source.1703: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.1704: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19
Source.1705: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.1706: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1
Source.1707: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.1708: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300
Source.1709: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850
Source.1710: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34
Source.1711: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.1712: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.1713: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2
Source.1714: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.1715: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.1716: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.1717: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1718: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5
Source.1719: DFBPPR4838 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 4
Source.1720: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.1721: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.1722: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.1723: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.1724: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.1725: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.1726: DFBPPR4863 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 1
Source.1727: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.1728: DFBPPR4876 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 3
Source.1729: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.1730: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.1731: DFBPPR4880 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 29
Source.1732: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.1733: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1734: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.1735: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.1736: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.1737: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.1738: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.1739: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.1740: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1741: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.1742: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.1743: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.1744: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1745: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.1746: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.1747: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.1748: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.1749: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1750: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.1751: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.1752: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.1753: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1
Source.1754: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1755: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.1756: DFBPPR4943 ---- Plant proteins ---- Transcription repressor OFP8
Source.1757: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.1758: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.1759: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.1760: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.1761: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.1762: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.1763: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1764: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.1765: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.1766: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.1767: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.1768: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.1769: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.1770: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.1771: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.1772: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.1773: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.1774: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.1775: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.1776: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease
Source.1777: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.1778: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1779: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.1780: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.1781: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.1782: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1783: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.1784: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.1785: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1786: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1787: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.1788: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.1789: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A
Source.1790: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase
Source.1791: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1792: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1793: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.1794: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.1795: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1796: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.1797: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1
Source.1798: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.1799: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1800: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.1801: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.1802: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.1803: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1804: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1805: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.1806: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1807: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.1808: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.1809: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1810: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.1811: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.1812: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.1813: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.1814: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.1815: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.1816: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1817: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.1818: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.1819: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.1820: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1821: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1822: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1823: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3
Source.1824: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.1825: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.1826: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.1827: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.1828: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1829: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1830: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.1831: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.1832: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1833: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1834: DFBPPR5122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1835: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1836: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.1837: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.1838: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1839: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.1840: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1841: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1842: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1843: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.1844: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1845: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1846: DFBPPR5164 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 2
Source.1847: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1848: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1849: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.1850: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.1851: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.1852: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.1853: DFBPPR5177 ---- Plant proteins ---- Anamorsin homolog
Source.1854: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.1855: DFBPPR5182 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 1
Source.1856: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.1857: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.1858: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A
Source.1859: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1860: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.1861: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1862: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1863: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.1864: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1865: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.1866: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.1867: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.1868: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.1869: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1870: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.1871: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.1872: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.1873: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1874: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.1875: DFBPPR5233 ---- Plant proteins ---- Ras-related protein Rab7
Source.1876: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.1877: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.1878: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.1879: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein
Source.1880: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.1881: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.1882: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1883: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.1884: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.1885: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28
Source.1886: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.1887: DFBPPR5274 ---- Plant proteins ---- Early nodulin-75
Source.1888: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.1889: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.1890: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1891: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.1892: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.1893: DFBPPR5287 ---- Plant proteins ---- Nodulin-24
Source.1894: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1895: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1896: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.1897: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1898: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.1899: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.1900: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.1901: DFBPPR5333 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 3
Source.1902: DFBPPR5338 ---- Plant proteins ---- 40S ribosomal protein S13
Source.1903: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.1904: DFBPPR5341 ---- Plant proteins ---- HMG1/2-like protein
Source.1905: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.1906: DFBPPR5347 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.1907: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein
Source.1908: DFBPPR5368 ---- Plant proteins ---- Desiccation protectant protein Lea14 homolog
Source.1909: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.1910: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1911: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1912: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1913: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.1914: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1915: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.1916: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.1917: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.1918: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1919: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.1920: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1921: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1922: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1923: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1924: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1925: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.1926: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.1927: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.1928: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.1929: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.1930: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.1931: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.1932: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1933: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1934: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.1935: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A
Source.1936: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.1937: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.1938: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.1939: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.1940: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.1941: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1942: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1943: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha
Source.1944: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.1945: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1946: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.1947: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1948: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.1949: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.1950: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1951: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.1952: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1953: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic
Source.1954: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1955: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.1956: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1957: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.1958: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1959: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.1960: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1961: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.1962: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.1963: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.1964: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.1965: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.1966: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.1967: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.1968: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1969: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1970: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic
Source.1971: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.1972: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1973: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.1974: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1975: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.1976: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.1977: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1978: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1979: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.1980: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1981: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase
Source.1982: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.1983: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.1984: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.1985: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.1986: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.1987: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.1988: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.1989: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.1990: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1991: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1992: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1993: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.1994: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.1995: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.1996: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1997: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1998: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1999: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.2000: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.2001: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.2002: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.2003: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.2004: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.2005: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.2006: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.2007: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.2008: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.2009: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.2010: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.2011: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.2012: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2013: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.2014: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.2015: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.2016: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.2017: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.2018: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.2019: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.2020: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.2021: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.2022: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2023: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.2024: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.2025: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.2026: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.2027: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.2028: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.2029: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.2030: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.2031: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6
Source.2032: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2033: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.2034: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.2035: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.2036: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2037: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.2038: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2039: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.2040: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2041: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.2042: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.2043: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.2044: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.2045: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1
Source.2046: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.2047: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.2048: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.2049: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.2050: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.2051: DFBPPR5665 ---- Plant proteins ---- Extensin
Source.2052: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.2053: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2054: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2055: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.2056: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2057: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.2058: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.2059: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.2060: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.2061: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.2062: DFBPPR5683 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.2063: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.2064: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.2065: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.2066: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.2067: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2068: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.2069: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.2070: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.2071: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2072: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.2073: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.2074: DFBPPR5706 ---- Plant proteins ---- Glutelin-2
Source.2075: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.2076: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.2077: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.2078: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.2079: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.2080: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.2081: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2082: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2083: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.2084: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.2085: DFBPPR5722 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.2086: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.2087: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2088: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2089: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.2090: DFBPPR5729 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.2091: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.2092: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2093: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.2094: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.2095: DFBPPR5736 ---- Plant proteins ---- Histone H1
Source.2096: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.2097: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2098: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.2099: DFBPPR5741 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2100: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.2101: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.2102: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.2103: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.2104: DFBPPR5751 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein 2-B
Source.2105: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.2106: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.2107: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.2108: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.2109: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.2110: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.2111: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.2112: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2113: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2114: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic
Source.2115: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.2116: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.2117: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.2118: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.2119: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.2120: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2121: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.2122: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.2123: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase
Source.2124: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.2125: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.2126: DFBPPR5794 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2
Source.2127: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2128: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.2129: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.2130: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2131: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2132: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.2133: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog
Source.2134: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.2135: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.2136: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2
Source.2137: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.2138: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2139: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.2140: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4
Source.2141: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.2142: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.2143: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2144: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.2145: DFBPPR5863 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2-C
Source.2146: DFBPPR5864 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.2147: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5
Source.2148: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16
Source.2149: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2150: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1
Source.2151: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.2152: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.2153: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.2154: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.2155: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.2156: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic
Source.2157: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.2158: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.2159: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.2160: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2161: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.2162: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase
Source.2163: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.2164: DFBPPR5924 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.2165: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.2166: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein
Source.2167: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.2168: DFBPPR5933 ---- Plant proteins ---- Pathogenesis-related protein PRMS
Source.2169: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.2170: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.2171: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.2172: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.2173: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2174: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.2175: DFBPPR5954 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.2176: DFBPPR5955 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-2, chloroplastic
Source.2177: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2
Source.2178: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.2179: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.2180: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.2181: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5
Source.2182: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.2183: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.2184: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.2185: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.2186: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.2187: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.2188: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3
Source.2189: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.2190: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2191: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2192: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2193: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2194: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.2195: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.2196: DFBPPR6031 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.2197: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.2198: DFBPPR6037 ---- Plant proteins ---- 19 kDa alpha-zein 19C2
Source.2199: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.2200: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4
Source.2201: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.2202: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.2203: DFBPPR6059 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.2204: DFBPPR6060 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.2205: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.2206: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.2207: DFBPPR6064 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.2208: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2209: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.2210: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.2211: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.2212: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1
Source.2213: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.2214: DFBPPR6087 ---- Plant proteins ---- 40S ribosomal protein S14
Source.2215: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99
Source.2216: DFBPPR6090 ---- Plant proteins ---- 40S ribosomal protein S14
Source.2217: DFBPPR6093 ---- Plant proteins ---- Zein-alpha 19C1
Source.2218: DFBPPR6094 ---- Plant proteins ---- Zein-alpha PZ19.1
Source.2219: DFBPPR6095 ---- Plant proteins ---- Zein-alpha A20
Source.2220: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.2221: DFBPPR6101 ---- Plant proteins ---- Zein-alpha M6
Source.2222: DFBPPR6103 ---- Plant proteins ---- 60S ribosomal protein L10
Source.2223: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2224: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4
Source.2225: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.2226: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2227: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.2228: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2229: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.2230: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.2231: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13
Source.2232: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49
Source.2233: DFBPPR6133 ---- Plant proteins ---- 40S ribosomal protein S13
Source.2234: DFBPPR6141 ---- Plant proteins ---- 60S ribosomal protein L39
Source.2235: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17
Source.2236: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.2237: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.2238: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.2239: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.2240: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.2241: DFBPPR6178 ---- Plant proteins ---- Unknown protein from spot 67 of 2D-PAGE of etiolated coleoptile
Source.2242: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.2243: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.2244: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.2245: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2246: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.2247: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34
Source.2248: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.2249: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.2250: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2251: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.2252: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.2253: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.2254: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.2255: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.2256: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.2257: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.2258: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.2259: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2260: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.2261: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.2262: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2263: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.2264: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2265: DFBPPR6249 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.2266: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.2267: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.2268: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2269: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2270: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.2271: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.2272: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.2273: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2274: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.2275: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.2276: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2277: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2278: DFBPPR6285 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.2279: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2
Source.2280: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.2281: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta
Source.2282: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.2283: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3
Source.2284: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.2285: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2286: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.2287: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.2288: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.2289: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.2290: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.2291: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.2292: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.2293: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2294: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.2295: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.2296: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.2297: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.2298: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2299: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.2300: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2301: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2302: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.2303: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.2304: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.2305: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2306: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.2307: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.2308: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.2309: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.2310: DFBPPR6355 ---- Plant proteins ---- Endochitinase
Source.2311: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2312: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2313: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2314: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2315: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2316: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.2317: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.2318: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2319: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2320: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C
Source.2321: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.2322: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2323: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.2324: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4
Source.2325: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.2326: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.2327: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2328: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.2329: DFBPPR6401 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.2330: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.2331: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.2332: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.2333: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2334: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2335: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.2336: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.2337: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.2338: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.2339: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.2340: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2341: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2342: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.2343: DFBPPR6430 ---- Plant proteins ---- Legumin J
Source.2344: DFBPPR6438 ---- Plant proteins ---- Ferredoxin-2
Source.2345: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206
Source.2346: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.2347: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.2348: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.2349: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.2350: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.2351: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.2352: DFBPPR6455 ---- Plant proteins ---- Legumin K
Source.2353: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.2354: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.2355: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.2356: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.2357: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.2358: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.2359: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.2360: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.2361: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.2362: DFBPPR6501 ---- Plant proteins ---- Photosystem I reaction center subunit VI
Source.2363: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A
Source.2364: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.2365: DFBPPR6507 ---- Plant proteins ---- Ribosomal protein S10, mitochondrial
Source.2366: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6
Source.2367: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.2368: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.2369: DFBPPR6532 ---- Plant proteins ---- 22.7 kDa class IV heat shock protein
Source.2370: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2371: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin
Source.2372: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.2373: DFBPPR6545 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.2374: DFBPPR6547 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.2375: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.2376: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27
Source.2377: DFBPPR6584 ---- Plant proteins ---- Organ-specific protein S2
Source.2378: DFBPPR6585 ---- Plant proteins ---- 40S ribosomal protein S13
Source.2379: DFBPPR6587 ---- Plant proteins ---- Unknown protein from spot 103 of 2D-PAGE of thylakoid
Source.2380: DFBPPR6599 ---- Plant proteins ---- Unknown protein from spot 115 of 2D-PAGE of thylakoid
Source.2381: DFBPPR6613 ---- Plant proteins ---- Ras-related protein Rab7
Source.2382: DFBPPR6614 ---- Plant proteins ---- Early nodulin-75
Source.2383: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.2384: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.2385: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.2386: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.2387: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.2388: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.2389: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2390: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.2391: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.2392: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.2393: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.2394: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.2395: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.2396: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.2397: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.2398: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.2399: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.2400: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.2401: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.2402: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.2403: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2404: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.2405: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.2406: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.2407: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.2408: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2409: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.2410: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.2411: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.2412: DFBPPR6712 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM16
Source.2413: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.2414: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2415: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3
Source.2416: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.2417: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.2418: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.2419: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2420: DFBPPR6733 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2421: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2422: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.2423: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2424: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.2425: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2426: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.2427: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2428: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.2429: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic
Source.2430: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2431: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.2432: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.2433: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.2434: DFBPPR6761 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM1
Source.2435: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.2436: DFBPPR6765 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.2437: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2438: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2439: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2440: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.2441: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2442: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.2443: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI
Source.2444: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.2445: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.2446: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2447: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.2448: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2449: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2450: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.2451: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.2452: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2453: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.2454: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C
Source.2455: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.2456: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.2457: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.2458: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.2459: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.2460: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2461: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2
Source.2462: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.2463: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2464: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.2465: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2466: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.2467: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2468: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10
Source.2469: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1
Source.2470: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2471: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic
Source.2472: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic
Source.2473: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12
Source.2474: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.2475: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2476: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.2477: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.2478: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor
Source.2479: DFBPPR6887 ---- Plant proteins ---- Glutenin, low molecular weight subunit
Source.2480: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.2481: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2482: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2483: DFBPPR6924 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC256
Source.2484: DFBPPR6928 ---- Plant proteins ---- Avenin-like a5
Source.2485: DFBPPR6930 ---- Plant proteins ---- Alpha/beta-gliadin
Source.2486: DFBPPR6934 ---- Plant proteins ---- Alpha/beta-gliadin clone PW1215
Source.2487: DFBPPR6936 ---- Plant proteins ---- Alpha/beta-gliadin A-II
Source.2488: DFBPPR6937 ---- Plant proteins ---- Alpha/beta-gliadin A-IV
Source.2489: DFBPPR6938 ---- Plant proteins ---- Alpha/beta-gliadin clone PW8142
Source.2490: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V
Source.2491: DFBPPR6940 ---- Plant proteins ---- Alpha/beta-gliadin A-III
Source.2492: DFBPPR6941 ---- Plant proteins ---- Alpha/beta-gliadin A-I
Source.2493: DFBPPR6954 ---- Plant proteins ---- Alpha/beta-gliadin clone PTO-A10
Source.2494: DFBPPR6955 ---- Plant proteins ---- Protein WIR1A
Source.2495: DFBPPR6957 ---- Plant proteins ---- Protein WIR1B
Source.2496: DFBPPR6958 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.2497: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin
Source.2498: DFBPPR6961 ---- Plant proteins ---- Avenin-like a2
Source.2499: DFBPPR6964 ---- Plant proteins ---- Avenin-like a3
Source.2500: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B
Source.2501: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin
Source.2502: DFBPPR6971 ---- Plant proteins ---- Avenin-like a7
Source.2503: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2504: DFBPPR6978 ---- Plant proteins ---- Cyclic phosphodiesterase
Source.2505: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2506: DFBPPR6983 ---- Plant proteins ---- Avenin-like a4
Source.2507: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.2508: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.2509: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2510: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.2511: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.2512: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2513: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.2514: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2515: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.2516: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.2517: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.2518: DFBPPR7030 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.2519: DFBPPR7031 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMb
Source.2520: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.2521: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.2522: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.2523: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.2524: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.2525: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.2526: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.2527: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.2528: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.2529: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2530: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.2531: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2532: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa
Source.2533: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.2534: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.2535: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.2536: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2537: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2538: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2539: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.2540: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2541: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2542: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.2543: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase
Source.2544: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4
Source.2545: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2546: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2547: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.2548: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.2549: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2550: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.2551: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2552: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2553: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2554: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.2555: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.2556: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2557: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2558: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2559: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.2560: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.2561: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2562: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.2563: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.2564: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.2565: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.2566: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.2567: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.2568: DFBPPR7133 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2569: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.2570: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.2571: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.2572: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.2573: DFBPPR7146 ---- Plant proteins ---- Non-specific lipid-transfer protein Cw18
Source.2574: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.2575: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.2576: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.2577: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2578: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.2579: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.2580: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.2581: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.2582: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.2583: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2
Source.2584: DFBPPR7167 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.2585: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.2586: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.2587: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.2588: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2589: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.2590: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.2591: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2592: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2593: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2594: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.2595: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.2596: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.2597: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3
Source.2598: DFBPPR7200 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.1
Source.2599: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.2600: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.2601: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2602: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2603: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.2604: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.2605: DFBPPR7217 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.2606: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2607: DFBPPR7223 ---- Plant proteins ---- Ferredoxin
Source.2608: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2609: DFBPPR7227 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.2
Source.2610: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.2611: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1
Source.2612: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2
Source.2613: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.2614: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.2615: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.2616: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.2617: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.2618: DFBPPR7261 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.3
Source.2619: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3
Source.2620: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.2621: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic
Source.2622: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.2623: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic
Source.2624: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2625: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.2626: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2627: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.2628: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.2629: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.2630: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.2631: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.2632: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.2633: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.2634: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2635: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1
Source.2636: DFBPPR7318 ---- Plant proteins ---- B3-hordein
Source.2637: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.2638: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2639: DFBPPR7327 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.2640: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1
Source.2641: DFBPPR7333 ---- Plant proteins ---- C-hordein
Source.2642: DFBPPR7334 ---- Plant proteins ---- C-hordein
Source.2643: DFBPPR7335 ---- Plant proteins ---- C-hordein
Source.2644: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24
Source.2645: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2646: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2
Source.2647: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2
Source.2648: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein
Source.2649: DFBPPR7353 ---- Plant proteins ---- Unknown endosperm protein E-15/E-16/E-17
Source.2650: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.2651: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.2652: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.2653: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.2654: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.2655: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.2656: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2657: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.2658: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.2659: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.2660: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.2661: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.2662: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.2663: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.2664: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.2665: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.2666: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2667: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2668: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2669: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.2670: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.2671: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2672: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2673: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.2674: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2675: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.2676: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.2677: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.2678: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2679: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.2680: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25
Source.2681: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.2682: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.2683: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.2684: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.2685: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.2686: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2687: DFBPPR7499 ---- Plant proteins ---- Ferredoxin
Source.2688: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.2689: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.2690: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.2691: DFBPPR7517 ---- Plant proteins ---- Uncharacterized mitochondrial protein ORF138
Source.2692: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial
Source.2693: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.2694: DFBPPR7523 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.2695: DFBPPR7524 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.2696: DFBPPR7525 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.2697: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2698: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.2699: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.2700: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.2701: DFBPPR7542 ---- Plant proteins ---- 60S ribosomal protein L5, mitochondrial
Source.2702: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.2703: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.2704: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.2705: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.2706: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.2707: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.2708: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.2709: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.2710: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.2711: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.2712: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.2713: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.2714: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.2715: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.2716: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.2717: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.2718: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.2719: DFBPPR7622 ---- Milk proteins ---- Mucin-1
Source.2720: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.2721: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2722: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.2723: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.2724: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.2725: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.2726: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.2727: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.2728: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.2729: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.2730: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator
Source.2731: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.2732: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.2733: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6
Source.2734: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.2735: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.2736: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.2737: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.2738: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2739: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.2740: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2741: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.2742: DFBPPR7663 ---- Milk proteins ---- Kappa-casein
Source.2743: DFBPPR7665 ---- Milk proteins ---- Beta-casein
Source.2744: DFBPPR7668 ---- Milk proteins ---- Beta-casein
Source.2745: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.2746: DFBPPR7673 ---- Milk proteins ---- Kappa-casein
Source.2747: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.2748: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein
Source.2749: DFBPPR7681 ---- Milk proteins ---- Beta-casein
Source.2750: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.2751: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.2752: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.2753: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein
Source.2754: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.2755: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.2756: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein
Source.2757: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.2758: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein
Source.2759: DFBPPR7710 ---- Milk proteins ---- Beta-lactoglobulin, Beta-LG
Source.2760: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.2761: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.2762: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.2763: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.2764: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.2765: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.2766: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.2767: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.2768: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.2769: DFBPPR7725 ---- Plant proteins ---- Avenin-3
Source.2770: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.2771: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.2772: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.2773: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2774: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.2775: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2
Source.2776: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1
Source.2777: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.2778: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.2779: DFBPPR7739 ---- Plant proteins ---- Avenin-E
Source.2780: DFBPPR7741 ---- Plant proteins ---- Avenin-F
Source.2781: DFBPPR7742 ---- Plant proteins ---- Avenin-A
Source.2782: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.2783: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.2784: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.2785: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2786: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.2787: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.2788: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.2789: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.2790: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.2791: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.2792: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1
Source.2793: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.2794: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.2795: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.2796: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.2797: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.2798: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2799: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.2800: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.2801: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.2802: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.2803: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.2804: DFBPPR8369 ---- Plant proteins ---- Thioredoxin H-type
Source.2805: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.2806: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.2807: DFBPPR8381 ---- Plant proteins ---- Conglutin-7
Source.2808: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.2809: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.2810: DFBPPR8401 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor A-II
Source.2811: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.2812: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.2813: DFBPPR8415 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor B-II
Source.2814: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.2815: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.2816: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.2817: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.2818: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2819: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2820: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2821: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.2822: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.2823: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.2824: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.2825: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6
Source.2826: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5
Source.2827: DFBPPR8443 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.2828: DFBPPR8444 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.2829: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.2830: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.2831: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.2832: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.2833: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.2834: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2835: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2836: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.2837: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2838: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2839: DFBPPR8468 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2840: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2841: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein
Source.2842: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.2843: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.2844: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.2845: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.2846: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein
Source.2847: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1
Source.2848: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.2849: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.2850: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.2851: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.2852: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.2853: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.2854: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.2855: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.2856: DFBPPR8509 ---- Milk proteins ---- Angiogenin-2
Source.2857: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.2858: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.2859: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.2860: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.2861: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.2862: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.2863: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.2864: DFBPPR15934 ---- Animal proteins ---- Apolipoprotein A-I
Source.2865: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.2866: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.2867: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.2868: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.2869: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2870: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2871: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.2872: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.2873: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.2874: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.2875: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2876: DFBPPR15956 ---- Animal proteins ---- Phospholipase A2
Source.2877: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2878: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.2879: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.2880: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.2881: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.2882: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.2883: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.2884: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.2885: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2886: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.2887: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.2888: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.2889: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.2890: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.2891: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.2892: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.2893: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.2894: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.2895: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.2896: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2897: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.2898: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2899: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2900: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.2901: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.2902: DFBPPR16002 ---- Animal proteins ---- Podoplanin
Source.2903: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.2904: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2905: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.2906: DFBPPR16006 ---- Animal proteins ---- Leptin
Source.2907: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.2908: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.2909: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2910: DFBPPR16013 ---- Animal proteins ---- Osteocalcin
Source.2911: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.2912: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.2913: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2914: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.2915: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.2916: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.2917: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.2918: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2919: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2920: DFBPPR16032 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.2921: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.2922: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2923: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2924: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2925: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.2926: DFBPPR16044 ---- Animal proteins ---- High mobility group protein B1
Source.2927: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.2928: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.2929: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.2930: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2931: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.2932: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.2933: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.2934: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.2935: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.2936: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.2937: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.2938: DFBPPR16072 ---- Animal proteins ---- Clusterin
Source.2939: DFBPPR16073 ---- Animal proteins ---- Endothelin-1
Source.2940: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.2941: DFBPPR16075 ---- Animal proteins ---- Hematopoietic progenitor cell antigen CD34
Source.2942: DFBPPR16078 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.2943: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.2944: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.2945: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.2946: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.2947: DFBPPR16093 ---- Animal proteins ---- Menin
Source.2948: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.2949: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.2950: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.2951: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.2952: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.2953: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2954: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.2955: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.2956: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.2957: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.2958: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.2959: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.2960: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2961: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.2962: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.2963: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.2964: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.2965: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.2966: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2967: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.2968: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.2969: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.2970: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.2971: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.2972: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.2973: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.2974: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.2975: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.2976: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.2977: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.2978: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.2979: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.2980: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2981: DFBPPR16168 ---- Animal proteins ---- Annexin A2
Source.2982: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.2983: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.2984: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.2985: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.2986: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.2987: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.2988: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.2989: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.2990: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.2991: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.2992: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.2993: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.2994: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2995: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.2996: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.2997: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.2998: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2999: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.3000: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.3001: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.3002: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.3003: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.3004: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.3005: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.3006: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.3007: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.3008: DFBPPR16240 ---- Animal proteins ---- Fibronectin
Source.3009: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3010: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.3011: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.3012: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3013: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain
Source.3014: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3015: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.3016: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.3017: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3018: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.3019: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.3020: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.3021: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.3022: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3023: DFBPPR16285 ---- Animal proteins ---- Chymase
Source.3024: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3025: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.3026: DFBPPR16292 ---- Animal proteins ---- Protein unc-119 homolog A
Source.3027: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.3028: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.3029: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.3030: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.3031: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3032: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.3033: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.3034: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.3035: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3036: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.3037: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.3038: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.3039: DFBPPR16325 ---- Animal proteins ---- Peripherin-2
Source.3040: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.3041: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.3042: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3043: DFBPPR16338 ---- Animal proteins ---- Endothelin-2
Source.3044: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.3045: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.3046: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.3047: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.3048: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.3049: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3050: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3051: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.3052: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.3053: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.3054: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.3055: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.3056: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin
Source.3057: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin
Source.3058: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.3059: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.3060: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.3061: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.3062: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.3063: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.3064: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.3065: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.3066: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.3067: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.3068: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.3069: DFBPPR16483 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.3070: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.3071: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.3072: DFBPPR16492 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.3073: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.3074: DFBPPR16500 ---- Animal proteins ---- C-C motif chemokine 5
Source.3075: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3076: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.3077: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.3078: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.3079: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.3080: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.3081: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.3082: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.3083: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.3084: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.3085: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.3086: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3087: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.3088: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.3089: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.3090: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.3091: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.3092: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.3093: DFBPPR16571 ---- Animal proteins ---- Pro-MCH
Source.3094: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.3095: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.3096: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3097: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.3098: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20
Source.3099: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.3100: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.3101: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.3102: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9
Source.3103: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.3104: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.3105: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.3106: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.3107: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3108: DFBPPR16621 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3109: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.3110: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.3111: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3112: DFBPPR16643 ---- Animal proteins ---- Ribosomal protein L18
Source.3113: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.3114: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.3115: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3116: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27
Source.3117: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1
Source.3118: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4
Source.3119: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.3120: DFBPPR16660 ---- Animal proteins ---- Gamma-crystallin C
Source.3121: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.3122: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.3123: DFBPPR16669 ---- Animal proteins ---- C-C motif chemokine 28
Source.3124: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.3125: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.3126: DFBPPR16673 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.3127: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.3128: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.3129: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.3130: DFBPPR16689 ---- Animal proteins ---- Gamma-crystallin B
Source.3131: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor
Source.3132: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.3133: DFBPPR16703 ---- Animal proteins ---- Beta-defensin 119
Source.3134: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.3135: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3136: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.3137: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.3138: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.3139: DFBPPR16718 ---- Animal proteins ---- Zinc finger protein 331
Source.3140: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.3141: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.3142: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.3143: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.3144: DFBPPR16745 ---- Animal proteins ---- Ig kappa chain V region GOM
Source.3145: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3146: DFBPPR16751 ---- Animal proteins ---- Small integral membrane protein 12
Source.3147: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.3148: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.3149: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.3150: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.3151: DFBPPR16786 ---- Animal proteins ---- Ubiquitin-fold modifier 1
Source.3152: DFBPPR16787 ---- Animal proteins ---- Histone H5
Source.3153: DFBPPR16788 ---- Animal proteins ---- Alpha-crystallin A chain
Source.3154: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.3155: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.3156: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.3157: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3158: DFBPPR16804 ---- Animal proteins ---- Pancreatic trypsin inhibitor
Source.3159: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.3160: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.3161: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.3162: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.3163: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3164: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.3165: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.3166: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3167: DFBPPR16822 ---- Animal proteins ---- Kininogen-2
Source.3168: DFBPPR16823 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.3169: DFBPPR16826 ---- Animal proteins ---- Phospholipase A2
Source.3170: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.3171: DFBPPR16830 ---- Animal proteins ---- Kininogen-1
Source.3172: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.3173: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3174: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.3175: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.3176: DFBPPR16838 ---- Animal proteins ---- Leptin
Source.3177: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.3178: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.3179: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.3180: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.3181: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.3182: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial
Source.3183: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15
Source.3184: DFBPPR16862 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.3185: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.3186: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.3187: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.3188: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.3189: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.3190: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.3191: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.3192: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3193: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3194: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.3195: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.3196: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3197: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.3198: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.3199: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain
Source.3200: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.3201: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.3202: DFBPPR16906 ---- Animal proteins ---- High mobility group protein B1
Source.3203: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3204: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3205: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.3206: DFBPPR16919 ---- Animal proteins ---- VIP peptides
Source.3207: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3208: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.3209: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.3210: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.3211: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3212: DFBPPR16928 ---- Animal proteins ---- Endothelin-1
Source.3213: DFBPPR16930 ---- Animal proteins ---- Apolipoprotein A-I
Source.3214: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.3215: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3216: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.3217: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.3218: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.3219: DFBPPR16947 ---- Animal proteins ---- Polyadenylate-binding protein 2
Source.3220: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.3221: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3222: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3223: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.3224: DFBPPR16952 ---- Animal proteins ---- Annexin A2
Source.3225: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.3226: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.3227: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3228: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.3229: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.3230: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.3231: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.3232: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.3233: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3234: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.3235: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.3236: DFBPPR16981 ---- Animal proteins ---- Clusterin
Source.3237: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.3238: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.3239: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.3240: DFBPPR16991 ---- Animal proteins ---- Osteocalcin
Source.3241: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.3242: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3243: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.3244: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.3245: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3246: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.3247: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.3248: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.3249: DFBPPR17015 ---- Animal proteins ---- Microfibrillar-associated protein 2
Source.3250: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3251: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3252: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.3253: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.3254: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.3255: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.3256: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.3257: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.3258: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.3259: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3260: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.3261: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.3262: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.3263: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.3264: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta
Source.3265: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3266: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.3267: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.3268: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.3269: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.3270: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.3271: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.3272: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.3273: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.3274: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.3275: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.3276: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.3277: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.3278: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.3279: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168
Source.3280: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.3281: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3282: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3283: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.3284: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.3285: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.3286: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.3287: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.3288: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.3289: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.3290: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.3291: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.3292: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3293: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.3294: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.3295: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.3296: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.3297: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.3298: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.3299: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.3300: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.3301: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.3302: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.3303: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.3304: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.3305: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.3306: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.3307: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.3308: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3309: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3310: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3311: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.3312: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.3313: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.3314: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.3315: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.3316: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.3317: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.3318: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.3319: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.3320: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.3321: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6
Source.3322: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.3323: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.3324: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.3325: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.3326: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.3327: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.3328: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.3329: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.3330: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.3331: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.3332: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.3333: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.3334: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.3335: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.3336: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.3337: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.3338: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.3339: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.3340: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3341: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.3342: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.3343: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.3344: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.3345: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.3346: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.3347: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.3348: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.3349: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.3350: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.3351: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.3352: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.3353: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.3354: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.3355: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.3356: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.3357: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.3358: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.3359: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.3360: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3361: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.3362: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3363: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.3364: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.3365: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.3366: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.3367: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1
Source.3368: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.3369: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3370: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.3371: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.3372: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.3373: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.3374: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.3375: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.3376: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.3377: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.3378: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.3379: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3380: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.3381: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1
Source.3382: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.3383: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.3384: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.3385: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.3386: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.3387: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.3388: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.3389: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.3390: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.3391: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.3392: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.3393: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.3394: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.3395: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4
Source.3396: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.3397: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.3398: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.3399: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.3400: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.3401: DFBPPR17402 ---- Animal proteins ---- High mobility group protein B2
Source.3402: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.3403: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.3404: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.3405: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.3406: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.3407: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.3408: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.3409: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.3410: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.3411: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.3412: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3413: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.3414: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.3415: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.3416: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.3417: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.3418: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.3419: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.3420: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.3421: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.3422: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.3423: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.3424: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.3425: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.3426: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.3427: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3428: DFBPPR17454 ---- Animal proteins ---- Peripherin-2
Source.3429: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.3430: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.3431: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.3432: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.3433: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3434: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.3435: DFBPPR17466 ---- Animal proteins ---- N-alpha-acetyltransferase 50
Source.3436: DFBPPR17469 ---- Animal proteins ---- Cofilin-1
Source.3437: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.3438: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.3439: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.3440: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.3441: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.3442: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3443: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.3444: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.3445: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.3446: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.3447: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.3448: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.3449: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.3450: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.3451: DFBPPR17500 ---- Animal proteins ---- Lecithin retinol acyltransferase
Source.3452: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.3453: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.3454: DFBPPR17504 ---- Animal proteins ---- Duodenase-1
Source.3455: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.3456: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.3457: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.3458: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.3459: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.3460: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.3461: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.3462: DFBPPR17521 ---- Animal proteins ---- Transforming growth factor beta-1-induced transcript 1 protein
Source.3463: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3464: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1
Source.3465: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.3466: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.3467: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.3468: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.3469: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.3470: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.3471: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.3472: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.3473: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.3474: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.3475: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.3476: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1
Source.3477: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.3478: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.3479: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.3480: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.3481: DFBPPR17577 ---- Animal proteins ---- Interleukin-1 alpha
Source.3482: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.3483: DFBPPR17586 ---- Animal proteins ---- Dermatopontin
Source.3484: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.3485: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.3486: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.3487: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.3488: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.3489: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.3490: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.3491: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7
Source.3492: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.3493: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.3494: DFBPPR17610 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A2, mitochondrial
Source.3495: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3496: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.3497: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.3498: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial
Source.3499: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.3500: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.3501: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.3502: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.3503: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.3504: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.3505: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.3506: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.3507: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.3508: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.3509: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.3510: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.3511: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.3512: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6
Source.3513: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.3514: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3515: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.3516: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.3517: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0
Source.3518: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.3519: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.3520: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.3521: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.3522: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.3523: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.3524: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.3525: DFBPPR17765 ---- Animal proteins ---- Ras-related protein Rab-27B
Source.3526: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3527: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.3528: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.3529: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.3530: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.3531: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.3532: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.3533: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.3534: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.3535: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.3536: DFBPPR17790 ---- Animal proteins ---- Interleukin-15
Source.3537: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.3538: DFBPPR17795 ---- Animal proteins ---- Acyl-coenzyme A thioesterase THEM4
Source.3539: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.3540: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.3541: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.3542: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.3543: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.3544: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.3545: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.3546: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.3547: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3548: DFBPPR17820 ---- Animal proteins ---- Osteomodulin
Source.3549: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.3550: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3551: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.3552: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.3553: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.3554: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D
Source.3555: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.3556: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.3557: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3
Source.3558: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.3559: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.3560: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3561: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.3562: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.3563: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.3564: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3565: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.3566: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.3567: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.3568: DFBPPR17865 ---- Animal proteins ---- Protein phosphatase 1A
Source.3569: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.3570: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.3571: DFBPPR17879 ---- Animal proteins ---- Menin
Source.3572: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV
Source.3573: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.3574: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.3575: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.3576: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.3577: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.3578: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3579: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3580: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.3581: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.3582: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.3583: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.3584: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.3585: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.3586: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.3587: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial
Source.3588: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.3589: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.3590: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.3591: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P
Source.3592: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.3593: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.3594: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.3595: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.3596: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.3597: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.3598: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.3599: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.3600: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38
Source.3601: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.3602: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.3603: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.3604: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.3605: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.3606: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.3607: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.3608: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.3609: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.3610: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.3611: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.3612: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.3613: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.3614: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1
Source.3615: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.3616: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.3617: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.3618: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.3619: DFBPPR17978 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial
Source.3620: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.3621: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.3622: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.3623: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.3624: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.3625: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.3626: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.3627: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.3628: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3629: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.3630: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.3631: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase
Source.3632: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.3633: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.3634: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.3635: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.3636: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.3637: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.3638: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.3639: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.3640: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.3641: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.3642: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.3643: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.3644: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3645: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.3646: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain
Source.3647: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.3648: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.3649: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.3650: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S
Source.3651: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3652: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1
Source.3653: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.3654: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.3655: DFBPPR18050 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.3656: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3657: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3658: DFBPPR18054 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 9
Source.3659: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.3660: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T
Source.3661: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.3662: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.3663: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.3664: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.3665: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.3666: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3667: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.3668: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.3669: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.3670: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.3671: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.3672: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.3673: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.3674: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.3675: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.3676: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.3677: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4
Source.3678: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.3679: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.3680: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.3681: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.3682: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.3683: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.3684: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.3685: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.3686: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.3687: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.3688: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3689: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3690: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.3691: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.3692: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.3693: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.3694: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.3695: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1
Source.3696: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.3697: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.3698: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.3699: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.3700: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.3701: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.3702: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.3703: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.3704: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.3705: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.3706: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.3707: DFBPPR18166 ---- Animal proteins ---- Selenoprotein P
Source.3708: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin
Source.3709: DFBPPR18172 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3710: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.3711: DFBPPR18187 ---- Animal proteins ---- Lithostathine
Source.3712: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.3713: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.3714: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3715: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3716: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.3717: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.3718: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4
Source.3719: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.3720: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta
Source.3721: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.3722: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.3723: DFBPPR18221 ---- Animal proteins ---- Gamma-crystallin B
Source.3724: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.3725: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B
Source.3726: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.3727: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3728: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.3729: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.3730: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.3731: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.3732: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.3733: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3
Source.3734: DFBPPR18247 ---- Animal proteins ---- Interferon regulatory factor 1
Source.3735: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.3736: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.3737: DFBPPR18254 ---- Animal proteins ---- C-type lectin domain family 6 member A
Source.3738: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.3739: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.3740: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta
Source.3741: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.3742: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.3743: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.3744: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.3745: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3746: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.3747: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.3748: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.3749: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.3750: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3751: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.3752: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.3753: DFBPPR18307 ---- Animal proteins ---- Claudin-4
Source.3754: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.3755: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.3756: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3757: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.3758: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.3759: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.3760: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial
Source.3761: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.3762: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.3763: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.3764: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.3765: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.3766: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.3767: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.3768: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2
Source.3769: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.3770: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.3771: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3772: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.3773: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.3774: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.3775: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.3776: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.3777: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.3778: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.3779: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.3780: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.3781: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.3782: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3783: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.3784: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.3785: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.3786: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.3787: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.3788: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.3789: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.3790: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.3791: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.3792: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.3793: DFBPPR18416 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.3794: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.3795: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.3796: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.3797: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.3798: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.3799: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.3800: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.3801: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.3802: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.3803: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.3804: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12
Source.3805: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.3806: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.3807: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.3808: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.3809: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.3810: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.3811: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.3812: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.3813: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.3814: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.3815: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.3816: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.3817: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.3818: DFBPPR18480 ---- Animal proteins ---- Casein kinase I isoform gamma-3
Source.3819: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.3820: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.3821: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1
Source.3822: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.3823: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.3824: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.3825: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3826: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.3827: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.3828: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.3829: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.3830: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.3831: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.3832: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.3833: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.3834: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3835: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.3836: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.3837: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.3838: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.3839: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1
Source.3840: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.3841: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.3842: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.3843: DFBPPR18543 ---- Animal proteins ---- Proproteinase E
Source.3844: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.3845: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.3846: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.3847: DFBPPR18552 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 8
Source.3848: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.3849: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.3850: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.3851: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22
Source.3852: DFBPPR18564 ---- Animal proteins ---- BRISC and BRCA1-A complex member 1
Source.3853: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.3854: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.3855: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.3856: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.3857: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.3858: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.3859: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.3860: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1
Source.3861: DFBPPR18581 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 7
Source.3862: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.3863: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.3864: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.3865: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.3866: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1
Source.3867: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.3868: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor
Source.3869: DFBPPR18597 ---- Animal proteins ---- Telethonin
Source.3870: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.3871: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2
Source.3872: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.3873: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.3874: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26
Source.3875: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3876: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.3877: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.3878: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.3879: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.3880: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.3881: DFBPPR18619 ---- Animal proteins ---- Ras-related protein Rab-7b
Source.3882: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.3883: DFBPPR18622 ---- Animal proteins ---- CYFIP-related Rac1 interactor B
Source.3884: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.3885: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.3886: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.3887: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.3888: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.3889: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.3890: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.3891: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.3892: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.3893: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.3894: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.3895: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.3896: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.3897: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.3898: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor
Source.3899: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5
Source.3900: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.3901: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.3902: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3903: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.3904: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.3905: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.3906: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.3907: DFBPPR18734 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF114
Source.3908: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.3909: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.3910: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.3911: DFBPPR18746 ---- Animal proteins ---- Anamorsin
Source.3912: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.3913: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.3914: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.3915: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.3916: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.3917: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.3918: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9
Source.3919: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.3920: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1
Source.3921: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.3922: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.3923: DFBPPR18779 ---- Animal proteins ---- Mucin-15
Source.3924: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.3925: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.3926: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C
Source.3927: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.3928: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.3929: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.3930: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.3931: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.3932: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.3933: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.3934: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.3935: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.3936: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.3937: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.3938: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.3939: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.3940: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.3941: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3942: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.3943: DFBPPR18825 ---- Animal proteins ---- Glutaredoxin-1
Source.3944: DFBPPR18829 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 10
Source.3945: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.3946: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.3947: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.3948: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.3949: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.3950: DFBPPR18839 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 12
Source.3951: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.3952: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.3953: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.3954: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.3955: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.3956: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.3957: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.3958: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.3959: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.3960: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.3961: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.3962: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.3963: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.3964: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.3965: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.3966: DFBPPR18873 ---- Animal proteins ---- Proteasome subunit beta type-3
Source.3967: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.3968: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.3969: DFBPPR18882 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.3970: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.3971: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.3972: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.3973: DFBPPR18899 ---- Animal proteins ---- Cofilin-2
Source.3974: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.3975: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.3976: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.3977: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1
Source.3978: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.3979: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.3980: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.3981: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.3982: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.3983: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.3984: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.3985: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.3986: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial
Source.3987: DFBPPR18942 ---- Animal proteins ---- Four and a half LIM domains protein 2
Source.3988: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.3989: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.3990: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.3991: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.3992: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.3993: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.3994: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.3995: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.3996: DFBPPR18958 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein
Source.3997: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.3998: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.3999: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.4000: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.4001: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.4002: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.4003: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.4004: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.4005: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.4006: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.4007: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.4008: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.4009: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.4010: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.4011: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.4012: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.4013: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.4014: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.4015: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.4016: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.4017: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.4018: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.4019: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.4020: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.4021: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.4022: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.4023: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.4024: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.4025: DFBPPR19032 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.4026: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.4027: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.4028: DFBPPR19037 ---- Animal proteins ---- Transthyretin
Source.4029: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.4030: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.4031: DFBPPR19042 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 2
Source.4032: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.4033: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase
Source.4034: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.4035: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.4036: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.4037: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.4038: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.4039: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.4040: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.4041: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4042: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2
Source.4043: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.4044: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.4045: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.4046: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.4047: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa
Source.4048: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1
Source.4049: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.4050: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.4051: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.4052: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.4053: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.4054: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.4055: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.4056: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.4057: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.4058: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.4059: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.4060: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.4061: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.4062: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.4063: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.4064: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.4065: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.4066: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.4067: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.4068: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.4069: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain
Source.4070: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.4071: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.4072: DFBPPR19185 ---- Animal proteins ---- Partner of Y14 and mago
Source.4073: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.4074: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.4075: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.4076: DFBPPR19191 ---- Animal proteins ---- Protein unc-119 homolog A
Source.4077: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.4078: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.4079: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.4080: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A
Source.4081: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.4082: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.4083: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639
Source.4084: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.4085: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.4086: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.4087: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.4088: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.4089: DFBPPR19225 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.4090: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.4091: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.4092: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.4093: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.4094: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.4095: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.4096: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.4097: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit
Source.4098: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.4099: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.4100: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.4101: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.4102: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.4103: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.4104: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.4105: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.4106: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.4107: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4108: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.4109: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.4110: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2
Source.4111: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.4112: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6
Source.4113: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.4114: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.4115: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.4116: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.4117: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.4118: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.4119: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.4120: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.4121: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.4122: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.4123: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.4124: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.4125: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.4126: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.4127: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.4128: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.4129: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.4130: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.4131: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.4132: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.4133: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.4134: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.4135: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.4136: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.4137: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.4138: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.4139: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.4140: DFBPPR19346 ---- Animal proteins ---- Cylicin-1
Source.4141: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.4142: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.4143: DFBPPR19356 ---- Animal proteins ---- Protamine-2
Source.4144: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.4145: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.4146: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.4147: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.4148: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.4149: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.4150: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.4151: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.4152: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.4153: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.4154: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.4155: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.4156: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.4157: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3
Source.4158: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.4159: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.4160: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.4161: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.4162: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.4163: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.4164: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.4165: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.4166: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.4167: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.4168: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.4169: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.4170: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2
Source.4171: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial
Source.4172: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.4173: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.4174: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.4175: DFBPPR19442 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit G
Source.4176: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.4177: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.4178: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.4179: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.4180: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.4181: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.4182: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.4183: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.4184: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.4185: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.4186: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.4187: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.4188: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.4189: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.4190: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase
Source.4191: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3
Source.4192: DFBPPR19490 ---- Animal proteins ---- GTPase RhebL1
Source.4193: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.4194: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.4195: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.4196: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.4197: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.4198: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.4199: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.4200: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.4201: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.4202: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.4203: DFBPPR19521 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12
Source.4204: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.4205: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.4206: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.4207: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase
Source.4208: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.4209: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.4210: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.4211: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4
Source.4212: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.4213: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.4214: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.4215: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.4216: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.4217: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.4218: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.4219: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.4220: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.4221: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.4222: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.4223: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.4224: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.4225: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.4226: DFBPPR19574 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit 2
Source.4227: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.4228: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.4229: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.4230: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.4231: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.4232: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.4233: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.4234: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.4235: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.4236: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.4237: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.4238: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.4239: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.4240: DFBPPR19610 ---- Animal proteins ---- RING finger protein 11
Source.4241: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.4242: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.4243: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.4244: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.4245: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.4246: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog
Source.4247: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.4248: DFBPPR19623 ---- Animal proteins ---- Spermadhesin Z13
Source.4249: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.4250: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.4251: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.4252: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.4253: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.4254: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.4255: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.4256: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.4257: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.4258: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.4259: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.4260: DFBPPR19662 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1
Source.4261: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.4262: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.4263: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.4264: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E
Source.4265: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.4266: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.4267: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5
Source.4268: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.4269: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.4270: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.4271: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.4272: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.4273: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.4274: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.4275: DFBPPR19707 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.4276: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.4277: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.4278: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1
Source.4279: DFBPPR19717 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM14
Source.4280: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.4281: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.4282: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.4283: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.4284: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.4285: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.4286: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2
Source.4287: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.4288: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.4289: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.4290: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1
Source.4291: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.4292: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.4293: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog
Source.4294: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.4295: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.4296: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.4297: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.4298: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1
Source.4299: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1
Source.4300: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.4301: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.4302: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.4303: DFBPPR19798 ---- Animal proteins ---- Uricase
Source.4304: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1
Source.4305: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.4306: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2
Source.4307: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.4308: DFBPPR19806 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.4309: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.4310: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.4311: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4
Source.4312: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.4313: DFBPPR19812 ---- Animal proteins ---- Probable inactive serine protease 37
Source.4314: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.4315: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.4316: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.4317: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B
Source.4318: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.4319: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.4320: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.4321: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.4322: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.4323: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30
Source.4324: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.4325: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.4326: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.4327: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial
Source.4328: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.4329: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.4330: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.4331: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.4332: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.4333: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A
Source.4334: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.4335: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.4336: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.4337: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.4338: DFBPPR19894 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.4339: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30
Source.4340: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.4341: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.4342: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial
Source.4343: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.4344: DFBPPR19921 ---- Animal proteins ---- Histone deacetylase complex subunit SAP18
Source.4345: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.4346: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.4347: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.4348: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.4349: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.4350: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.4351: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.4352: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.4353: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.4354: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.4355: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.4356: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.4357: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.4358: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.4359: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.4360: DFBPPR19958 ---- Animal proteins ---- 60S ribosomal protein L10
Source.4361: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.4362: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.4363: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial
Source.4364: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.4365: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.4366: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.4367: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.4368: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.4369: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.4370: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.4371: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.4372: DFBPPR19996 ---- Animal proteins ---- Interleukin-3
Source.4373: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.4374: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1
Source.4375: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.4376: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR
Source.4377: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.4378: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.4379: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4380: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.4381: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.4382: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.4383: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.4384: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9
Source.4385: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.4386: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.4387: DFBPPR20045 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 2, mitochondrial
Source.4388: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2
Source.4389: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.4390: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.4391: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.4392: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.4393: DFBPPR20057 ---- Animal proteins ---- AP-3 complex subunit sigma-1
Source.4394: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.4395: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.4396: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8
Source.4397: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.4398: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.4399: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.4400: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.4401: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.4402: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.4403: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.4404: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1
Source.4405: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.4406: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O
Source.4407: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.4408: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.4409: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.4410: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1
Source.4411: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.4412: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.4413: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.4414: DFBPPR20127 ---- Animal proteins ---- Protein BTG1
Source.4415: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.4416: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.4417: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.4418: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.4419: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.4420: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.4421: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.4422: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.4423: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4
Source.4424: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.4425: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.4426: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2
Source.4427: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.4428: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.4429: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.4430: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.4431: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.4432: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein
Source.4433: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4
Source.4434: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.4435: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.4436: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.4437: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.4438: DFBPPR20212 ---- Animal proteins ---- Outer dense fiber protein 1
Source.4439: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.4440: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.4441: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9
Source.4442: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.4443: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.4444: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.4445: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.4446: DFBPPR20235 ---- Animal proteins ---- Gamma-crystallin A
Source.4447: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.4448: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.4449: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.4450: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.4451: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.4452: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.4453: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.4454: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.4455: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1
Source.4456: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4457: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14
Source.4458: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.4459: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.4460: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.4461: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.4462: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.4463: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.4464: DFBPPR20283 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 1
Source.4465: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.4466: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.4467: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.4468: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.4469: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.4470: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.4471: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9
Source.4472: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.4473: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.4474: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.4475: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.4476: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.4477: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.4478: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.4479: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.4480: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.4481: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.4482: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.4483: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.4484: DFBPPR20348 ---- Animal proteins ---- V-type proton ATPase subunit F
Source.4485: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.4486: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7
Source.4487: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.4488: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.4489: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.4490: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.4491: DFBPPR20369 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1
Source.4492: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.4493: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.4494: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.4495: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.4496: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog
Source.4497: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.4498: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.4499: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.4500: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.4501: DFBPPR20391 ---- Animal proteins ---- Fibronectin type III domain-containing protein 4
Source.4502: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.4503: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.4504: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.4505: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.4506: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.4507: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.4508: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.4509: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2
Source.4510: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A
Source.4511: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.4512: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.4513: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.4514: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.4515: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.4516: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.4517: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.4518: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.4519: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.4520: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.4521: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.4522: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.4523: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.4524: DFBPPR20458 ---- Animal proteins ---- Putative transcription factor Ovo-like 1
Source.4525: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.4526: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.4527: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38
Source.4528: DFBPPR20467 ---- Animal proteins ---- Tetranectin
Source.4529: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.4530: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP
Source.4531: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.4532: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1
Source.4533: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.4534: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.4535: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.4536: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.4537: DFBPPR20502 ---- Animal proteins ---- COP9 signalosome complex subunit 9
Source.4538: DFBPPR20504 ---- Animal proteins ---- 28S ribosomal protein S18c, mitochondrial
Source.4539: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.4540: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein
Source.4541: DFBPPR20509 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 1
Source.4542: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.4543: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.4544: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2
Source.4545: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.4546: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6
Source.4547: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.4548: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.4549: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.4550: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.4551: DFBPPR20530 ---- Animal proteins ---- Protein HEXIM2
Source.4552: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.4553: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.4554: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.4555: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial
Source.4556: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.4557: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.4558: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1
Source.4559: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.4560: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.4561: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.4562: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.4563: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201
Source.4564: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.4565: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.4566: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.4567: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.4568: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.4569: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1
Source.4570: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.4571: DFBPPR20598 ---- Animal proteins ---- Oncostatin-M
Source.4572: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.4573: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.4574: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.4575: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.4576: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.4577: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.4578: DFBPPR20613 ---- Animal proteins ---- Gamma-crystallin D
Source.4579: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.4580: DFBPPR20634 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.4581: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.4582: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.4583: DFBPPR20643 ---- Animal proteins ---- Fibrinogen-like protein 1
Source.4584: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.4585: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.4586: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.4587: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.4588: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.4589: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.4590: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.4591: DFBPPR20677 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.4592: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.4593: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.4594: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.4595: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.4596: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial
Source.4597: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.4598: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.4599: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.4600: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.4601: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.4602: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta
Source.4603: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.4604: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.4605: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.4606: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.4607: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.4608: DFBPPR20730 ---- Animal proteins ---- Gamma-crystallin F
Source.4609: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.4610: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6
Source.4611: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.4612: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.4613: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.4614: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.4615: DFBPPR20750 ---- Animal proteins ---- 40S ribosomal protein S8
Source.4616: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.4617: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.4618: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.4619: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.4620: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14
Source.4621: DFBPPR20767 ---- Animal proteins ---- GTP cyclohydrolase 1 feedback regulatory protein
Source.4622: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.4623: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.4624: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.4625: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.4626: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.4627: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.4628: DFBPPR20795 ---- Animal proteins ---- Four and a half LIM domains protein 3
Source.4629: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.4630: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.4631: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.4632: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.4633: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.4634: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.4635: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.4636: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.4637: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.4638: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.4639: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT
Source.4640: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2
Source.4641: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.4642: DFBPPR20821 ---- Animal proteins ---- Prefoldin subunit 4
Source.4643: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.4644: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.4645: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.4646: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.4647: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.4648: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.4649: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.4650: DFBPPR20841 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.4651: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.4652: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.4653: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.4654: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.4655: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase
Source.4656: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.4657: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.4658: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5
Source.4659: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.4660: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.4661: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.4662: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.4663: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.4664: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.4665: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.4666: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.4667: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143
Source.4668: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator
Source.4669: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.4670: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.4671: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.4672: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.4673: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.4674: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.4675: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8
Source.4676: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.4677: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.4678: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.4679: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.4680: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.4681: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.4682: DFBPPR20953 ---- Animal proteins ---- Ubiquitin-fold modifier 1
Source.4683: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.4684: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.4685: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.4686: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.4687: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.4688: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.4689: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.4690: DFBPPR20986 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC2
Source.4691: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.4692: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27
Source.4693: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.4694: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181
Source.4695: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.4696: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.4697: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.4698: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.4699: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.4700: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.4701: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.4702: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.4703: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.4704: DFBPPR21020 ---- Animal proteins ---- 60S ribosomal protein L18
Source.4705: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.4706: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.4707: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.4708: DFBPPR21032 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 2
Source.4709: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.4710: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.4711: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.4712: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B
Source.4713: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.4714: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.4715: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.4716: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.4717: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.4718: DFBPPR21063 ---- Animal proteins ---- Zinc finger protein 691
Source.4719: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog
Source.4720: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.4721: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial
Source.4722: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.4723: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22
Source.4724: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.4725: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.4726: DFBPPR21090 ---- Animal proteins ---- Developmental pluripotency-associated protein 3
Source.4727: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.4728: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.4729: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.4730: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.4731: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.4732: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.4733: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7
Source.4734: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.4735: DFBPPR21118 ---- Animal proteins ---- NADH-cytochrome b5 reductase 1
Source.4736: DFBPPR21123 ---- Animal proteins ---- 39S ribosomal protein L14, mitochondrial
Source.4737: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.4738: DFBPPR21132 ---- Animal proteins ---- Regulator of G-protein signaling 7-binding protein
Source.4739: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.4740: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.4741: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.4742: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.4743: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.4744: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.4745: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.4746: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.4747: DFBPPR21165 ---- Animal proteins ---- Protein canopy homolog 3
Source.4748: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.4749: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52
Source.4750: DFBPPR21179 ---- Animal proteins ---- Eukaryotic translation initiation factor 4H
Source.4751: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.4752: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.4753: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.4754: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.4755: DFBPPR21188 ---- Animal proteins ---- High mobility group protein B4
Source.4756: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.4757: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.4758: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.4759: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.4760: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.4761: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4
Source.4762: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.4763: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.4764: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.4765: DFBPPR21223 ---- Animal proteins ---- Serum basic protease inhibitor
Source.4766: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.4767: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2
Source.4768: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.4769: DFBPPR21229 ---- Animal proteins ---- Neurexophilin-2
Source.4770: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.4771: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.4772: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2
Source.4773: DFBPPR21239 ---- Animal proteins ---- Coordinator of PRMT5 and differentiation stimulator
Source.4774: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.4775: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.4776: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.4777: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.4778: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.4779: DFBPPR21254 ---- Animal proteins ---- Zinc finger protein 567
Source.4780: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.4781: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.4782: DFBPPR21263 ---- Animal proteins ---- Enhancer of rudimentary homolog
Source.4783: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.4784: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21
Source.4785: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.4786: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.4787: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.4788: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.4789: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.4790: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.4791: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.4792: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.4793: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.4794: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58
Source.4795: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.4796: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.4797: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.4798: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial
Source.4799: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.4800: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.4801: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.4802: DFBPPR21308 ---- Animal proteins ---- Cysteine-rich protein 1
Source.4803: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.4804: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.4805: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.4806: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.4807: DFBPPR21322 ---- Animal proteins ---- Zinc finger protein 227
Source.4808: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.4809: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.4810: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.4811: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.4812: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397
Source.4813: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.4814: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.4815: DFBPPR21351 ---- Animal proteins ---- Protein kish-A
Source.4816: DFBPPR21353 ---- Animal proteins ---- Zinc finger protein OZF
Source.4817: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.4818: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.4819: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.4820: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.4821: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.4822: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.4823: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.4824: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2
Source.4825: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.4826: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.4827: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.4828: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.4829: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.4830: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial
Source.4831: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4832: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1
Source.4833: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.4834: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.4835: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.4836: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.4837: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.4838: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.4839: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.4840: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.4841: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.4842: DFBPPR21427 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 2
Source.4843: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.4844: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.4845: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.4846: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207
Source.4847: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.4848: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.4849: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.4850: DFBPPR21448 ---- Animal proteins ---- Protein N-lysine methyltransferase METTL21A
Source.4851: DFBPPR21454 ---- Animal proteins ---- Cyclin-dependent kinase 2-interacting protein
Source.4852: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.4853: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.4854: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.4855: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.4856: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.4857: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.4858: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.4859: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2
Source.4860: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.4861: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.4862: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.4863: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.4864: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.4865: DFBPPR21494 ---- Animal proteins ---- Spleen trypsin inhibitor I
Source.4866: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.4867: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.4868: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40
Source.4869: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.4870: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.4871: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.4872: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.4873: DFBPPR21509 ---- Animal proteins ---- Myoneurin
Source.4874: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.4875: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1
Source.4876: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.4877: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.4878: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.4879: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.4880: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.4881: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.4882: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.4883: DFBPPR21546 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 29
Source.4884: DFBPPR21548 ---- Animal proteins ---- Cornifelin
Source.4885: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.4886: DFBPPR21555 ---- Animal proteins ---- Zinc finger and SCAN domain-containing protein 26
Source.4887: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma
Source.4888: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c
Source.4889: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3
Source.4890: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.4891: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.4892: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.4893: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.4894: DFBPPR21579 ---- Animal proteins ---- Protein phosphatase inhibitor 2
Source.4895: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.4896: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.4897: DFBPPR21586 ---- Animal proteins ---- Cyclin-C
Source.4898: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.4899: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like
Source.4900: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.4901: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2
Source.4902: DFBPPR21603 ---- Animal proteins ---- Beta-defensin 119
Source.4903: DFBPPR21604 ---- Animal proteins ---- Zinc finger protein 345
Source.4904: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.4905: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.4906: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.4907: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.4908: DFBPPR21620 ---- Animal proteins ---- Claudin-12
Source.4909: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.4910: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.4911: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.4912: DFBPPR21631 ---- Animal proteins ---- 39S ribosomal protein L49, mitochondrial
Source.4913: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta
Source.4914: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.4915: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.4916: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.4917: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.4918: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.4919: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.4920: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.4921: DFBPPR21667 ---- Animal proteins ---- Four and a half LIM domains protein 5
Source.4922: DFBPPR21669 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 3
Source.4923: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4
Source.4924: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.4925: DFBPPR21681 ---- Animal proteins ---- Protein FAM110A
Source.4926: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.4927: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.4928: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.4929: DFBPPR21706 ---- Animal proteins ---- Small membrane A-kinase anchor protein
Source.4930: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23
Source.4931: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog
Source.4932: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.4933: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.4934: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.4935: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.4936: DFBPPR21717 ---- Animal proteins ---- Transmembrane protein 134
Source.4937: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.4938: DFBPPR21719 ---- Animal proteins ---- Protein reprimo
Source.4939: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.4940: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.4941: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.4942: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A
Source.4943: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.4944: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.4945: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.4946: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.4947: DFBPPR21740 ---- Animal proteins ---- 60S ribosomal protein L36
Source.4948: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.4949: DFBPPR21744 ---- Animal proteins ---- Anaphase-promoting complex subunit 13
Source.4950: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.4951: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.4952: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.4953: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.4954: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.4955: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6
Source.4956: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.4957: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.4958: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.4959: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.4960: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6
Source.4961: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.4962: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.4963: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.4964: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.4965: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.4966: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.4967: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.4968: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.4969: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial
Source.4970: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.4971: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.4972: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.4973: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.4974: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.4975: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.4976: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.4977: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog
Source.4978: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.4979: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24
Source.4980: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.4981: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.4982: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.4983: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.4984: DFBPPR21824 ---- Animal proteins ---- Transcription factor Spi-C
Source.4985: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1
Source.4986: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2
Source.4987: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD
Source.4988: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.4989: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.4990: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.4991: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.4992: DFBPPR21840 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.4993: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1
Source.4994: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.4995: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS
Source.4996: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.4997: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.4998: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19
Source.4999: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.5000: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.5001: DFBPPR21878 ---- Animal proteins ---- Statherin
Source.5002: DFBPPR21880 ---- Animal proteins ---- Zinc finger protein 22
Source.5003: DFBPPR21882 ---- Animal proteins ---- Insulin-like peptide INSL6
Source.5004: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial
Source.5005: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.5006: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.5007: DFBPPR21899 ---- Animal proteins ---- Gametocyte-specific factor 1
Source.5008: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.5009: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.5010: DFBPPR21904 ---- Animal proteins ---- Protein TBATA
Source.5011: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.5012: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.5013: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.5014: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.5015: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13
Source.5016: DFBPPR21920 ---- Animal proteins ---- Protein DPCD
Source.5017: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2
Source.5018: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4
Source.5019: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.5020: DFBPPR21934 ---- Animal proteins ---- Transcription elongation factor A protein-like 8
Source.5021: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.5022: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.5023: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.5024: DFBPPR21942 ---- Animal proteins ---- Neurexophilin-1
Source.5025: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.5026: DFBPPR21947 ---- Animal proteins ---- rRNA-processing protein UTP23 homolog
Source.5027: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.5028: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.5029: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.5030: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1
Source.5031: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.5032: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.5033: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.5034: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.5035: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.5036: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6
Source.5037: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.5038: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.5039: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1
Source.5040: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.5041: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.5042: DFBPPR21991 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC7-like
Source.5043: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.5044: DFBPPR22000 ---- Animal proteins ---- Protein LDOC1
Source.5045: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.5046: DFBPPR22003 ---- Animal proteins ---- 40S ribosomal protein S13
Source.5047: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.5048: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.5049: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.5050: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial
Source.5051: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.5052: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1
Source.5053: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.5054: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.5055: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.5056: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.5057: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.5058: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.5059: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.5060: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.5061: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.5062: DFBPPR22065 ---- Animal proteins ---- 60S ribosomal protein L10-like
Source.5063: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.5064: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.5065: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.5066: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.5067: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8
Source.5068: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.5069: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.5070: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein
Source.5071: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.5072: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.5073: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.5074: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.5075: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.5076: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.5077: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog
Source.5078: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1
Source.5079: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1
Source.5080: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.5081: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.5082: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4
Source.5083: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.5084: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.5085: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.5086: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B
Source.5087: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.5088: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.5089: DFBPPR22141 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.5090: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.5091: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1
Source.5092: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.5093: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.5094: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.5095: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.5096: DFBPPR22164 ---- Animal proteins ---- Complex III assembly factor LYRM7
Source.5097: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.5098: DFBPPR22170 ---- Animal proteins ---- Transmembrane protein 106C
Source.5099: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog
Source.5100: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.5101: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.5102: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.5103: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.5104: DFBPPR22202 ---- Animal proteins ---- Protein FMC1 homolog
Source.5105: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1
Source.5106: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.5107: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.5108: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog
Source.5109: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.5110: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.5111: DFBPPR22223 ---- Animal proteins ---- Calretinin
Source.5112: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.5113: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22
Source.5114: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.5115: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.5116: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.5117: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.5118: DFBPPR22248 ---- Animal proteins ---- rRNA-processing protein FCF1 homolog
Source.5119: DFBPPR22253 ---- Animal proteins ---- Inhibitory synaptic factor 1
Source.5120: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.5121: DFBPPR22261 ---- Animal proteins ---- Coiled-coil-helix-coiled-coil-helix domain-containing protein 7
Source.5122: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.5123: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.5124: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17
Source.5125: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.5126: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.5127: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.5128: DFBPPR22286 ---- Animal proteins ---- Oxidoreductase NAD-binding domain-containing protein 1
Source.5129: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.5130: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.5131: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B
Source.5132: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.5133: DFBPPR22297 ---- Animal proteins ---- Histatherin
Source.5134: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein
Source.5135: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.5136: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.5137: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.5138: DFBPPR22309 ---- Animal proteins ---- Spermatogenesis-associated protein 9
Source.5139: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.5140: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.5141: DFBPPR22319 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.5142: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.5143: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.5144: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.5145: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.5146: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.5147: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.5148: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.5149: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.5150: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.5151: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.5152: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.5153: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2
Source.5154: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.5155: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.5156: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.5157: DFBPPR22374 ---- Animal proteins ---- Cysteine-rich protein 2
Source.5158: DFBPPR22376 ---- Animal proteins ---- 60S ribosomal protein L31
Source.5159: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.5160: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5
Source.5161: DFBPPR22392 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1A
Source.5162: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein
Source.5163: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.5164: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog
Source.5165: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.5166: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.5167: DFBPPR22413 ---- Animal proteins ---- Protein LSM12 homolog
Source.5168: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.5169: DFBPPR22416 ---- Animal proteins ---- Gametocyte-specific factor 1-like
Source.5170: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.5171: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1
Source.5172: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B
Source.5173: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog
Source.5174: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18
Source.5175: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2
Source.5176: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.5177: DFBPPR22443 ---- Animal proteins ---- Stromal cell-derived factor 2
Source.5178: DFBPPR22446 ---- Animal proteins ---- Tektin-5
Source.5179: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2
Source.5180: DFBPPR22462 ---- Animal proteins ---- Protein FAM76A
Source.5181: DFBPPR22471 ---- Animal proteins ---- Protein shisa-like-2B
Source.5182: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.5183: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.5184: DFBPPR22475 ---- Animal proteins ---- Small integral membrane protein 12
Source.5185: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.5186: DFBPPR22479 ---- Animal proteins ---- Transcription elongation factor A protein-like 1
Source.5187: DFBPPR22484 ---- Animal proteins ---- Zinc finger matrin-type protein 4
Source.5188: DFBPPR22491 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1B
Source.5189: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.5190: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C
Source.5191: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.5192: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.5193: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.5194: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.5195: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C
Source.5196: DFBPPR22514 ---- Animal proteins ---- Transmembrane protein 205
Source.5197: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141
Source.5198: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.5199: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.5200: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251
Source.5201: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.5202: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.5203: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1
Source.5204: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B
Source.5205: DFBPPR22550 ---- Animal proteins ---- Leucine-rich repeat-containing protein 23
Source.5206: DFBPPR22556 ---- Animal proteins ---- Protein maestro
Source.5207: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.5208: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein
Source.5209: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.5210: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.5211: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog
Source.5212: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.5213: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.5214: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171
Source.5215: DFBPPR22605 ---- Animal proteins ---- Transmembrane protein 254
Source.5216: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36
Source.5217: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.5218: DFBPPR22618 ---- Animal proteins ---- BSD domain-containing protein 1
Source.5219: DFBPPR22620 ---- Animal proteins ---- Cysteine-rich tail protein 1
Source.5220: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.5221: DFBPPR22623 ---- Animal proteins ---- Lysine-rich coiled-coil protein 1
Source.5222: DFBPPR22635 ---- Animal proteins ---- Translation machinery-associated protein 16
Source.5223: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.5224: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.5225: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.5226: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.5227: DFBPPR22659 ---- Animal proteins ---- Testis-expressed protein 35
Source.5228: DFBPPR22665 ---- Animal proteins ---- UPF0686 protein C11orf1 homolog
Source.5229: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.5230: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9
Source.5231: DFBPPR22675 ---- Animal proteins ---- UPF0711 protein C18orf21 homolog
Source.5232: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.5233: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.5234: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.5235: DFBPPR22687 ---- Animal proteins ---- Putative UPF0730 protein encoded by LINC00643 homolog
Source.5236: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.5237: DFBPPR22693 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1
Source.5238: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.5239: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8
Source.5240: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.5241: DFBPPR22713 ---- Animal proteins ---- UPF0728 protein C10orf53 homolog
Source.5242: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein
Source.5243: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.5244: DFBPPR22722 ---- Animal proteins ---- Uncharacterized protein C11orf91 homolog
Source.5245: DFBPPR22732 ---- Animal proteins ---- Uncharacterized protein C3orf22 homolog
Source.5246: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1
Source.5247: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.5248: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.5249: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog
Source.5250: DFBPPR22744 ---- Animal proteins ---- Uncharacterized protein C10orf82 homolog
Source.5251: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog
Source.5252: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.5253: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.5254: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog
Source.5255: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog
Source.5256: DFBPPR22756 ---- Animal proteins ---- Uncharacterized protein C1orf189 homolog
Source.5257: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog
Source.5258: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog
Source.5259: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog
Source.5260: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.5261: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.5262: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.5263: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.5264: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.5265: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.5266: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.5267: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.5268: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.5269: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.5270: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.5271: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.5272: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.5273: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.5274: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.5275: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.5276: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.5277: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.5278: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.5279: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.5280: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.5281: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.5282: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.5283: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.5284: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.5285: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.5286: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.5287: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.5288: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.5289: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.5290: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.5291: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.5292: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.5293: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.5294: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.5295: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.5296: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.5297: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.5298: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.5299: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.5300: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.5301: DFBPPR8588 ---- Animal proteins ---- Leptin
Source.5302: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.5303: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.5304: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.5305: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2
Source.5306: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.5307: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.5308: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.5309: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.5310: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.5311: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.5312: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.5313: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5314: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.5315: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.5316: DFBPPR8623 ---- Animal proteins ---- High mobility group protein B1
Source.5317: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.5318: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.5319: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.5320: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.5321: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.5322: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.5323: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.5324: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.5325: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.5326: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.5327: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.5328: DFBPPR8643 ---- Animal proteins ---- Phospholipase A2, major isoenzyme
Source.5329: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.5330: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.5331: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.5332: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.5333: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.5334: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.5335: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.5336: DFBPPR8657 ---- Animal proteins ---- Annexin A2
Source.5337: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.5338: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.5339: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.5340: DFBPPR8667 ---- Animal proteins ---- High mobility group protein B2
Source.5341: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.5342: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.5343: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.5344: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.5345: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.5346: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.5347: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.5348: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.5349: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.5350: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.5351: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.5352: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.5353: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.5354: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.5355: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.5356: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.5357: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.5358: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.5359: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.5360: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.5361: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.5362: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.5363: DFBPPR8718 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.5364: DFBPPR8721 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.5365: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.5366: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.5367: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.5368: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.5369: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.5370: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.5371: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.5372: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.5373: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.5374: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.5375: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.5376: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.5377: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.5378: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.5379: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.5380: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.5381: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.5382: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.5383: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.5384: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.5385: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.5386: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.5387: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.5388: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.5389: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.5390: DFBPPR8771 ---- Animal proteins ---- Cofilin-1
Source.5391: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.5392: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.5393: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.5394: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.5395: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.5396: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.5397: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.5398: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.5399: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.5400: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.5401: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.5402: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.5403: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.5404: DFBPPR8813 ---- Animal proteins ---- Apolipoprotein A-IV
Source.5405: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.5406: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.5407: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.5408: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.5409: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.5410: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.5411: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.5412: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.5413: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.5414: DFBPPR8836 ---- Animal proteins ---- Myogenin
Source.5415: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.5416: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.5417: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.5418: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.5419: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.5420: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.5421: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.5422: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.5423: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.5424: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.5425: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.5426: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.5427: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.5428: DFBPPR8870 ---- Animal proteins ---- Ribonuclease K3
Source.5429: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.5430: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.5431: DFBPPR8880 ---- Animal proteins ---- Apolipoprotein A-I
Source.5432: DFBPPR8883 ---- Animal proteins ---- Apolipoprotein A-I
Source.5433: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.5434: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.5435: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.5436: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.5437: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.5438: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.5439: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.5440: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.5441: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.5442: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.5443: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.5444: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.5445: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.5446: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.5447: DFBPPR8926 ---- Animal proteins ---- Osteocalcin
Source.5448: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.5449: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.5450: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.5451: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.5452: DFBPPR8974 ---- Animal proteins ---- ADM5
Source.5453: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.5454: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.5455: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.5456: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.5457: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.5458: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.5459: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.5460: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.5461: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.5462: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.5463: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.5464: DFBPPR9018 ---- Animal proteins ---- Transthyretin
Source.5465: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.5466: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.5467: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.5468: DFBPPR9040 ---- Animal proteins ---- Angiogenin
Source.5469: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.5470: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.5471: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.5472: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.5473: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.5474: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.5475: DFBPPR9057 ---- Animal proteins ---- Phospholipase A2, minor isoenzyme
Source.5476: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain
Source.5477: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.5478: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.5479: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.5480: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.5481: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.5482: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.5483: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5484: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.5485: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.5486: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.5487: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.5488: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.5489: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.5490: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.5491: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.5492: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.5493: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.5494: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.5495: DFBPPR9116 ---- Animal proteins ---- Cathepsin B
Source.5496: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.5497: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.5498: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.5499: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.5500: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.5501: DFBPPR9134 ---- Animal proteins ---- Ras-related protein Rab-14
Source.5502: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.5503: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5504: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.5505: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II
Source.5506: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.5507: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.5508: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.5509: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.5510: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.5511: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.5512: DFBPPR9166 ---- Animal proteins ---- Uricase
Source.5513: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.5514: DFBPPR9171 ---- Animal proteins ---- Sorbin and SH3 domain-containing protein 2
Source.5515: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase
Source.5516: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.5517: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.5518: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.5519: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.5520: DFBPPR9188 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.5521: DFBPPR9192 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.5522: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.5523: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.5524: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.5525: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.5526: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.5527: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.5528: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.5529: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.5530: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.5531: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.5532: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.5533: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.5534: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.5535: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.5536: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.5537: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.5538: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.5539: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.5540: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.5541: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.5542: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.5543: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.5544: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9
Source.5545: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.5546: DFBPPR9249 ---- Animal proteins ---- 5-hydroxytryptamine receptor 4
Source.5547: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.5548: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.5549: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.5550: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.5551: DFBPPR9256 ---- Animal proteins ---- Antibacterial protein PR-39
Source.5552: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.5553: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.5554: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.5555: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.5556: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.5557: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.5558: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27
Source.5559: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.5560: DFBPPR9294 ---- Animal proteins ---- 60S ribosomal protein L10
Source.5561: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1
Source.5562: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.5563: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.5564: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.5565: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.5566: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.5567: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.5568: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.5569: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.5570: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.5571: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.5572: DFBPPR9328 ---- Animal proteins ---- Cofilin-2
Source.5573: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.5574: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.5575: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.5576: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.5577: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.5578: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.5579: DFBPPR9345 ---- Animal proteins ---- Relaxin-3
Source.5580: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.5581: DFBPPR9348 ---- Animal proteins ---- 60S ribosomal protein L18
Source.5582: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.5583: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.5584: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.5585: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.5586: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.5587: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.5588: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.5589: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.5590: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.5591: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.5592: DFBPPR9404 ---- Animal proteins ---- Tryptase
Source.5593: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.5594: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.5595: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.5596: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.5597: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.5598: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.5599: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.5600: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.5601: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.5602: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.5603: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.5604: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.5605: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.5606: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.5607: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.5608: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.5609: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.5610: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.5611: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.5612: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.5613: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.5614: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.5615: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.5616: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.5617: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.5618: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.5619: DFBPPR9495 ---- Animal proteins ---- Complement factor B
Source.5620: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.5621: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.5622: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.5623: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.5624: DFBPPR9521 ---- Animal proteins ---- Endothelin-3
Source.5625: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.5626: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.5627: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.5628: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE
Source.5629: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.5630: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.5631: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.5632: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.5633: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.5634: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.5635: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.5636: DFBPPR9558 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.5637: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.5638: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.5639: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.5640: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.5641: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.5642: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.5643: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.5644: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.5645: DFBPPR9585 ---- Animal proteins ---- Uterine plasmin/trypsin inhibitor
Source.5646: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.5647: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.5648: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.5649: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.5650: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.5651: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.5652: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.5653: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.5654: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.5655: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.5656: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.5657: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.5658: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561
Source.5659: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.5660: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.5661: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1
Source.5662: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.5663: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.5664: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1
Source.5665: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.5666: DFBPPR9656 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.5667: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.5668: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.5669: DFBPPR9665 ---- Animal proteins ---- 60S ribosomal protein L21
Source.5670: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.5671: DFBPPR9668 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.5672: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.5673: DFBPPR9678 ---- Animal proteins ---- Neuropeptide W
Source.5674: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.5675: DFBPPR9688 ---- Animal proteins ---- Outer dense fiber protein 1
Source.5676: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.5677: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.5678: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial
Source.5679: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.5680: DFBPPR9706 ---- Animal proteins ---- Homeobox protein Hox-B8
Source.5681: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.5682: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.5683: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.5684: DFBPPR9730 ---- Animal proteins ---- Urotensin-2
Source.5685: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.5686: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.5687: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.5688: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2
Source.5689: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide
Source.5690: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.5691: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.5692: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.5693: DFBPPR9767 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.5694: DFBPPR9768 ---- Animal proteins ---- Protein canopy homolog 3
Source.5695: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.5696: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.5697: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.5698: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.5699: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.5700: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.5701: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2
Source.5702: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.5703: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.5704: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.5705: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8
Source.5706: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.5707: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.5708: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.5709: DFBPPR9823 ---- Animal proteins ---- Enhancer of rudimentary homolog
Source.5710: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.5711: DFBPPR9829 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.5712: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.5713: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.5714: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1
Source.5715: DFBPPR9843 ---- Animal proteins ---- P protein
Source.5716: DFBPPR9845 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.5717: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.5718: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.5719: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.5720: DFBPPR9881 ---- Animal proteins ---- 60S ribosomal protein L31
Source.5721: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.5722: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.5723: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.5724: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1
Source.5725: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.5726: DFBPPR9900 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.5727: DFBPPR9901 ---- Animal proteins ---- 40S ribosomal protein S14
Source.5728: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19
Source.5729: DFBPPR9903 ---- Animal proteins ---- Cyclin-G1
Source.5730: DFBPPR9920 ---- Animal proteins ---- 60S ribosomal protein L4
Source.5731: DFBPPR9921 ---- Animal proteins ---- 40S ribosomal protein S13
Source.5732: DFBPPR9926 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.5733: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.5734: DFBPPR9932 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.5735: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1
Source.5736: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.5737: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1
Source.5738: DFBPPR9942 ---- Animal proteins ---- Proline-rich protein 3
Source.5739: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251
Source.5740: DFBPPR9947 ---- Animal proteins ---- Hypothalamic tetradecapeptide
Source.5741: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.5742: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.5743: DFBPPR9953 ---- Animal proteins ---- Gallinacin-1 alpha
Source.5744: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.5745: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.5746: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.5747: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor
Source.5748: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.5749: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.5750: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.5751: DFBPPR9973 ---- Animal proteins ---- High mobility group protein B1
Source.5752: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.5753: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.5754: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.5755: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.5756: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.5757: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.5758: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.5759: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.5760: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.5761: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein
Source.5762: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.5763: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.5764: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.5765: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.5766: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.5767: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.5768: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2
Source.5769: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.5770: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.5771: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.5772: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.5773: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.5774: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I
Source.5775: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.5776: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.5777: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.5778: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.5779: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.5780: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.5781: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.5782: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.5783: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.5784: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.5785: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.5786: DFBPPR10052 ---- Animal proteins ---- Protein Wnt-11
Source.5787: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.5788: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.5789: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.5790: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7
Source.5791: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.5792: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.5793: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.5794: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.5795: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.5796: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.5797: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.5798: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.5799: DFBPPR10082 ---- Animal proteins ---- Pinopsin
Source.5800: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.5801: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.5802: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.5803: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.5804: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.5805: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.5806: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.5807: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5808: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.5809: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.5810: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.5811: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.5812: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.5813: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.5814: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.5815: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.5816: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.5817: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.5818: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.5819: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.5820: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.5821: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.5822: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.5823: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.5824: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.5825: DFBPPR10136 ---- Animal proteins ---- Annexin A2
Source.5826: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.5827: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.5828: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.5829: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.5830: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.5831: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.5832: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.5833: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.5834: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2
Source.5835: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.5836: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.5837: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.5838: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3
Source.5839: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.5840: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.5841: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.5842: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.5843: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.5844: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.5845: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.5846: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.5847: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.5848: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.5849: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.5850: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3
Source.5851: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.5852: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.5853: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.5854: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.5855: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.5856: DFBPPR10187 ---- Animal proteins ---- Myogenin
Source.5857: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.5858: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.5859: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.5860: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.5861: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.5862: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.5863: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.5864: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.5865: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1
Source.5866: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.5867: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.5868: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.5869: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.5870: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.5871: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.5872: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.5873: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.5874: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.5875: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.5876: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.5877: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.5878: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.5879: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.5880: DFBPPR10226 ---- Animal proteins ---- GTPase HRas
Source.5881: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.5882: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.5883: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.5884: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.5885: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.5886: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.5887: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.5888: DFBPPR10240 ---- Animal proteins ---- Cerberus
Source.5889: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.5890: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.5891: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.5892: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1
Source.5893: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.5894: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.5895: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.5896: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.5897: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.5898: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.5899: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.5900: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.5901: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.5902: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.5903: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.5904: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.5905: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.5906: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.5907: DFBPPR10276 ---- Animal proteins ---- Adapter molecule crk
Source.5908: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.5909: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.5910: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.5911: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.5912: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.5913: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.5914: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.5915: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.5916: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5917: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.5918: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.5919: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.5920: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.5921: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.5922: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.5923: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.5924: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.5925: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.5926: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.5927: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.5928: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.5929: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.5930: DFBPPR10326 ---- Animal proteins ---- Alpha-crystallin A chain
Source.5931: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.5932: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.5933: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.5934: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5935: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.5936: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.5937: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.5938: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.5939: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.5940: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.5941: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.5942: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.5943: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.5944: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.5945: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.5946: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.5947: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.5948: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.5949: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.5950: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.5951: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.5952: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.5953: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.5954: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.5955: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.5956: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.5957: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.5958: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.5959: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.5960: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.5961: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.5962: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.5963: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.5964: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.5965: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.5966: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.5967: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.5968: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.5969: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.5970: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.5971: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.5972: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.5973: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.5974: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.5975: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.5976: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.5977: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.5978: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.5979: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.5980: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.5981: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.5982: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.5983: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.5984: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.5985: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.5986: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.5987: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.5988: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.5989: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.5990: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.5991: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.5992: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.5993: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.5994: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.5995: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.5996: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.5997: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.5998: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.5999: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.6000: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.6001: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.6002: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.6003: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.6004: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.6005: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.6006: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.6007: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.6008: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1
Source.6009: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1
Source.6010: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.6011: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.6012: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.6013: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.6014: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.6015: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros
Source.6016: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.6017: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.6018: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.6019: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.6020: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.6021: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.6022: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.6023: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.6024: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.6025: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.6026: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.6027: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.6028: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.6029: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.6030: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain
Source.6031: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.6032: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.6033: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.6034: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.6035: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.6036: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.6037: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.6038: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.6039: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.6040: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.6041: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.6042: DFBPPR10570 ---- Animal proteins ---- Protein atonal homolog 7
Source.6043: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.6044: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.6045: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.6046: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.6047: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.6048: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.6049: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.6050: DFBPPR10592 ---- Animal proteins ---- Ras-related protein Rab-14
Source.6051: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.6052: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.6053: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.6054: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.6055: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.6056: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.6057: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.6058: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.6059: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.6060: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.6061: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.6062: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.6063: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.6064: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.6065: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.6066: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.6067: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.6068: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.6069: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.6070: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.6071: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.6072: DFBPPR10634 ---- Animal proteins ---- Procathepsin L
Source.6073: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.6074: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.6075: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.6076: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.6077: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.6078: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.6079: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.6080: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.6081: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.6082: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.6083: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.6084: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.6085: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.6086: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.6087: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.6088: DFBPPR10660 ---- Animal proteins ---- Tsukushin
Source.6089: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.6090: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.6091: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.6092: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.6093: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.6094: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.6095: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.6096: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.6097: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.6098: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.6099: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.6100: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.6101: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.6102: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.6103: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.6104: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.6105: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.6106: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.6107: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.6108: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.6109: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.6110: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.6111: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.6112: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.6113: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.6114: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.6115: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.6116: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.6117: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.6118: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.6119: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.6120: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.6121: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.6122: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.6123: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.6124: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.6125: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.6126: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.6127: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.6128: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.6129: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.6130: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.6131: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6132: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.6133: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.6134: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.6135: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.6136: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.6137: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.6138: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.6139: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.6140: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.6141: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.6142: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.6143: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6
Source.6144: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.6145: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.6146: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6147: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.6148: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b
Source.6149: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.6150: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2
Source.6151: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.6152: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.6153: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.6154: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.6155: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.6156: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.6157: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.6158: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.6159: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.6160: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.6161: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.6162: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.6163: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.6164: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.6165: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.6166: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.6167: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.6168: DFBPPR10826 ---- Animal proteins ---- Cofilin-2
Source.6169: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.6170: DFBPPR10830 ---- Animal proteins ---- Gallinacin-7
Source.6171: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.6172: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1
Source.6173: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.6174: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.6175: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.6176: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.6177: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.6178: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.6179: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.6180: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.6181: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.6182: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.6183: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.6184: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.6185: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.6186: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.6187: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.6188: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3
Source.6189: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.6190: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.6191: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.6192: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.6193: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.6194: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.6195: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.6196: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.6197: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.6198: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.6199: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.6200: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.6201: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.6202: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.6203: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.6204: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.6205: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.6206: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.6207: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6208: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.6209: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.6210: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.6211: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.6212: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.6213: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.6214: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.6215: DFBPPR10939 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.6216: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.6217: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.6218: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.6219: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.6220: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.6221: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.6222: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.6223: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2
Source.6224: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.6225: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.6226: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type
Source.6227: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.6228: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.6229: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.6230: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.6231: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.6232: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.6233: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.6234: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.6235: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.6236: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.6237: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.6238: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.6239: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.6240: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.6241: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.6242: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.6243: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.6244: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.6245: DFBPPR11007 ---- Animal proteins ---- Anamorsin
Source.6246: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.6247: DFBPPR11011 ---- Animal proteins ---- Epigen
Source.6248: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.6249: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.6250: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.6251: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.6252: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.6253: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.6254: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.6255: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.6256: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.6257: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.6258: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.6259: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.6260: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.6261: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.6262: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.6263: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.6264: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.6265: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.6266: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.6267: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.6268: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.6269: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.6270: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.6271: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.6272: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.6273: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.6274: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.6275: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6276: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.6277: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.6278: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.6279: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.6280: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.6281: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.6282: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.6283: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.6284: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.6285: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.6286: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.6287: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.6288: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.6289: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.6290: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.6291: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.6292: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.6293: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.6294: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.6295: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.6296: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.6297: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.6298: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.6299: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.6300: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.6301: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.6302: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.6303: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.6304: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.6305: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.6306: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.6307: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.6308: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.6309: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.6310: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.6311: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.6312: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.6313: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.6314: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.6315: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.6316: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.6317: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.6318: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.6319: DFBPPR11174 ---- Animal proteins ---- Gallinacin-6
Source.6320: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.6321: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b
Source.6322: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.6323: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.6324: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.6325: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.6326: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.6327: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.6328: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.6329: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.6330: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.6331: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.6332: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.6333: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.6334: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.6335: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.6336: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.6337: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.6338: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.6339: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.6340: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.6341: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.6342: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.6343: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.6344: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.6345: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.6346: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.6347: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.6348: DFBPPR11243 ---- Animal proteins ---- Epiphycan
Source.6349: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.6350: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.6351: DFBPPR11248 ---- Animal proteins ---- Myelin protein P0
Source.6352: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.6353: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.6354: DFBPPR11253 ---- Animal proteins ---- Peripherin-2
Source.6355: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.6356: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.6357: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.6358: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.6359: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.6360: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.6361: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.6362: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.6363: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.6364: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.6365: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES
Source.6366: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.6367: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.6368: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2
Source.6369: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.6370: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.6371: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.6372: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.6373: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.6374: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.6375: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.6376: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.6377: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.6378: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.6379: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.6380: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.6381: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.6382: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.6383: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.6384: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.6385: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.6386: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.6387: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.6388: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.6389: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.6390: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.6391: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.6392: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.6393: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.6394: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.6395: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.6396: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.6397: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13
Source.6398: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.6399: DFBPPR11359 ---- Animal proteins ---- Mesogenin-1
Source.6400: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.6401: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.6402: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.6403: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.6404: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.6405: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.6406: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.6407: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.6408: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.6409: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.6410: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.6411: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6412: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.6413: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.6414: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.6415: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.6416: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.6417: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.6418: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.6419: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.6420: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.6421: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.6422: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.6423: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.6424: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.6425: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.6426: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.6427: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.6428: DFBPPR11432 ---- Animal proteins ---- Homeobox protein Hox-D9
Source.6429: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6
Source.6430: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.6431: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.6432: DFBPPR11447 ---- Animal proteins ---- Translationally-controlled tumor protein homolog
Source.6433: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.6434: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2
Source.6435: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.6436: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.6437: DFBPPR11463 ---- Animal proteins ---- Ubiquitin-fold modifier 1
Source.6438: DFBPPR11464 ---- Animal proteins ---- Homeobox protein Hox-D10
Source.6439: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.6440: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.6441: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.6442: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.6443: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.6444: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.6445: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.6446: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.6447: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2
Source.6448: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.6449: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.6450: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.6451: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.6452: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.6453: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.6454: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.6455: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.6456: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.6457: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.6458: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.6459: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.6460: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.6461: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b
Source.6462: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.6463: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.6464: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.6465: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.6466: DFBPPR11524 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF166
Source.6467: DFBPPR11526 ---- Animal proteins ---- Fibromodulin
Source.6468: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.6469: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.6470: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.6471: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.6472: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.6473: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.6474: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.6475: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.6476: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.6477: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.6478: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.6479: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.6480: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.6481: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.6482: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.6483: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.6484: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.6485: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.6486: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.6487: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.6488: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.6489: DFBPPR11584 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.6490: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230
Source.6491: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.6492: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.6493: DFBPPR11599 ---- Animal proteins ---- Homeobox protein Hox-A9
Source.6494: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.6495: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.6496: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.6497: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.6498: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.6499: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.6500: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6501: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.6502: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.6503: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6504: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.6505: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.6506: DFBPPR11630 ---- Animal proteins ---- Protein kish-A
Source.6507: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.6508: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.6509: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.6510: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.6511: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.6512: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.6513: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.6514: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.6515: DFBPPR11649 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.6516: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.6517: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6518: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10
Source.6519: DFBPPR11657 ---- Animal proteins ---- Protein BTG1
Source.6520: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.6521: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.6522: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.6523: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.6524: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.6525: DFBPPR11670 ---- Animal proteins ---- Snurportin-1
Source.6526: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.6527: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.6528: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.6529: DFBPPR11687 ---- Animal proteins ---- Antithrombin-III
Source.6530: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.6531: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.6532: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.6533: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.6534: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.6535: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.6536: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.6537: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.6538: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.6539: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.6540: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.6541: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8
Source.6542: DFBPPR11719 ---- Animal proteins ---- Protein RER1
Source.6543: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.6544: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.6545: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.6546: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.6547: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.6548: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.6549: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.6550: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1
Source.6551: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.6552: DFBPPR11746 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.6553: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.6554: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta
Source.6555: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.6556: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1
Source.6557: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.6558: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.6559: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.6560: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.6561: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3
Source.6562: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.6563: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.6564: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.6565: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.6566: DFBPPR11784 ---- Animal proteins ---- Homeobox protein Hox-B8
Source.6567: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.6568: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.6569: DFBPPR11790 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.6570: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.6571: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.6572: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.6573: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.6574: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1
Source.6575: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.6576: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.6577: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27
Source.6578: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.6579: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.6580: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.6581: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.6582: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.6583: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.6584: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.6585: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.6586: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.6587: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1
Source.6588: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.6589: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.6590: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.6591: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.6592: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.6593: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.6594: DFBPPR11865 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8
Source.6595: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.6596: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.6597: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.6598: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.6599: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.6600: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.6601: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.6602: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.6603: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.6604: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.6605: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.6606: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.6607: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant
Source.6608: DFBPPR11894 ---- Animal proteins ---- Centromere protein K
Source.6609: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.6610: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.6611: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.6612: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.6613: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.6614: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.6615: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.6616: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.6617: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.6618: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.6619: DFBPPR11922 ---- Animal proteins ---- Neurotensin
Source.6620: DFBPPR11925 ---- Animal proteins ---- GSK3-beta interaction protein
Source.6621: DFBPPR11928 ---- Animal proteins ---- Cyclin-C
Source.6622: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.6623: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.6624: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.6625: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.6626: DFBPPR11942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.6627: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.6628: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.6629: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.6630: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog
Source.6631: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.6632: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.6633: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.6634: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.6635: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.6636: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.6637: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.6638: DFBPPR11966 ---- Animal proteins ---- Protein CREG1
Source.6639: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.6640: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.6641: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.6642: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.6643: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.6644: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.6645: DFBPPR11980 ---- Animal proteins ---- 40S ribosomal protein S13
Source.6646: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.6647: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.6648: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.6649: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog
Source.6650: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.6651: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.6652: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.6653: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.6654: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.6655: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.6656: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.6657: DFBPPR12007 ---- Animal proteins ---- Feather keratin 4
Source.6658: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein
Source.6659: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.6660: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1
Source.6661: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.6662: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog
Source.6663: DFBPPR12022 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.6664: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.6665: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.6666: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.6667: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.6668: DFBPPR12038 ---- Animal proteins ---- Scale keratin
Source.6669: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.6670: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.6671: DFBPPR12049 ---- Animal proteins ---- 60S ribosomal protein L36
Source.6672: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.6673: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.6674: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.6675: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.6676: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.6677: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.6678: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.6679: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.6680: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.6681: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.6682: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.6683: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.6684: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.6685: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.6686: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.6687: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.6688: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.6689: DFBPPR12089 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein
Source.6690: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.6691: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.6692: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.6693: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.6694: DFBPPR12097 ---- Animal proteins ---- Photoreceptor outer segment membrane glycoprotein 2
Source.6695: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.6696: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.6697: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.6698: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2
Source.6699: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.6700: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.6701: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.6702: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.6703: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.6704: DFBPPR12118 ---- Animal proteins ---- Protein EURL
Source.6705: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.6706: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.6707: DFBPPR12121 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.6708: DFBPPR12125 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8
Source.6709: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.6710: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.6711: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.6712: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.6713: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.6714: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.6715: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.6716: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.6717: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.6718: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.6719: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.6720: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.6721: DFBPPR12162 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.6722: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.6723: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.6724: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.6725: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.6726: DFBPPR12178 ---- Animal proteins ---- SRY-related protein CH32
Source.6727: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme
Source.6728: DFBPPR12181 ---- Animal proteins ---- Small integral membrane protein 15
Source.6729: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251
Source.6730: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.6731: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.6732: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.6733: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.6734: DFBPPR12213 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.6735: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.6736: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.6737: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.6738: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.6739: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.6740: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.6741: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.6742: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog
Source.6743: DFBPPR12244 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1
Source.6744: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.6745: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.6746: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.6747: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.6748: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.6749: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.6750: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.6751: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.6752: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin
Source.6753: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.6754: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.6755: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.6756: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.6757: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.6758: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.6759: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.6760: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.6761: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.6762: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.6763: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.6764: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.6765: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.6766: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.6767: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.6768: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.6769: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.6770: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.6771: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.6772: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.6773: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.6774: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.6775: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.6776: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.6777: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.6778: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.6779: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.6780: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.6781: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.6782: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.6783: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.6784: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.6785: DFBPPR12318 ---- Animal proteins ---- Endothelin-1
Source.6786: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.6787: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.6788: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.6789: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.6790: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.6791: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.6792: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.6793: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.6794: DFBPPR12333 ---- Animal proteins ---- Angiogenin
Source.6795: DFBPPR12336 ---- Animal proteins ---- Apolipoprotein D
Source.6796: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.6797: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.6798: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.6799: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.6800: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.6801: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.6802: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.6803: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.6804: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.6805: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.6806: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.6807: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.6808: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.6809: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.6810: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.6811: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.6812: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.6813: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.6814: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.6815: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1
Source.6816: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.6817: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.6818: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.6819: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.6820: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.6821: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.6822: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.6823: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.6824: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.6825: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.6826: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.6827: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.6828: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.6829: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.6830: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.6831: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.6832: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.6833: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6834: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.6835: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.6836: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.6837: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.6838: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.6839: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.6840: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.6841: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.6842: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.6843: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.6844: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.6845: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.6846: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.6847: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.6848: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.6849: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.6850: DFBPPR12419 ---- Animal proteins ---- Phospholipase A2
Source.6851: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.6852: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6853: DFBPPR12424 ---- Animal proteins ---- Protein phosphatase inhibitor 2
Source.6854: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.6855: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.6856: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.6857: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I
Source.6858: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.6859: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.6860: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.6861: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.6862: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.6863: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.6864: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.6865: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.6866: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.6867: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.6868: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.6869: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.6870: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.6871: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6872: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.6873: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.6874: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.6875: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.6876: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.6877: DFBPPR12463 ---- Animal proteins ---- Interleukin-15
Source.6878: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.6879: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.6880: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.6881: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.6882: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.6883: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.6884: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.6885: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.6886: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.6887: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A
Source.6888: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.6889: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.6890: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.6891: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.6892: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.6893: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.6894: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.6895: DFBPPR12499 ---- Animal proteins ---- Interleukin-1 alpha
Source.6896: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.6897: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.6898: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.6899: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.6900: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.6901: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.6902: DFBPPR12517 ---- Animal proteins ---- 5-formyltetrahydrofolate cyclo-ligase
Source.6903: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.6904: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.6905: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.6906: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.6907: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.6908: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.6909: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.6910: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.6911: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.6912: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.6913: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.6914: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.6915: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.6916: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.6917: DFBPPR12554 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.6918: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.6919: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6920: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.6921: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.6922: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.6923: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.6924: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.6925: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.6926: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.6927: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.6928: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.6929: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.6930: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.6931: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.6932: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.6933: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.6934: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.6935: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.6936: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.6937: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase
Source.6938: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.6939: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.6940: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.6941: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.6942: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.6943: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.6944: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.6945: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.6946: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.6947: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.6948: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.6949: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.6950: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.6951: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.6952: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.6953: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.6954: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.6955: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.6956: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.6957: DFBPPR12725 ---- Animal proteins ---- Uricase
Source.6958: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.6959: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.6960: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.6961: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.6962: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.6963: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.6964: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.6965: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.6966: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.6967: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.6968: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.6969: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.6970: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.6971: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.6972: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.6973: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.6974: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.6975: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.6976: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.6977: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.6978: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.6979: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.6980: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.6981: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.6982: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.6983: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.6984: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.6985: DFBPPR12809 ---- Animal proteins ---- Glutaredoxin-1
Source.6986: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.6987: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2
Source.6988: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.6989: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.6990: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.6991: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.6992: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.6993: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.6994: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.6995: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain
Source.6996: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.6997: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.6998: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.6999: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.7000: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.7001: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.7002: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.7003: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.7004: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.7005: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.7006: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.7007: DFBPPR12879 ---- Animal proteins ---- Endothelin-2
Source.7008: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.7009: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.7010: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.7011: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.7012: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.7013: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.7014: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.7015: DFBPPR12909 ---- Animal proteins ---- Antimicrobial protein CAP18
Source.7016: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.7017: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.7018: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2
Source.7019: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30
Source.7020: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.7021: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.7022: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.7023: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.7024: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.7025: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.7026: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.7027: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.7028: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.7029: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.7030: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.7031: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.7032: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.7033: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.7034: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.7035: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.7036: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.7037: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.7038: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.7039: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.7040: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.7041: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.7042: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7043: DFBPPR13007 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 2
Source.7044: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.7045: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.7046: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.7047: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.7048: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7049: DFBPPR13028 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.7050: DFBPPR13034 ---- Animal proteins ---- Sarcospan
Source.7051: DFBPPR13035 ---- Animal proteins ---- Chymase
Source.7052: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein
Source.7053: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.7054: DFBPPR13067 ---- Animal proteins ---- Beta-casein
Source.7055: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.7056: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.7057: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207
Source.7058: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.7059: DFBPPR13092 ---- Animal proteins ---- Testin
Source.7060: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.7061: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region
Source.7062: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7063: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region
Source.7064: DFBPPR13142 ---- Animal proteins ---- Phospholipase A2
Source.7065: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.7066: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7067: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.7068: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.7069: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.7070: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.7071: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5
Source.7072: DFBPPR13156 ---- Animal proteins ---- Leptin
Source.7073: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.7074: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.7075: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.7076: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.7077: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.7078: DFBPPR13169 ---- Animal proteins ---- High mobility group protein B1
Source.7079: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.7080: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.7081: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7082: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.7083: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.7084: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.7085: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.7086: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.7087: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.7088: DFBPPR13210 ---- Animal proteins ---- Angiogenin
Source.7089: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.7090: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.7091: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.7092: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.7093: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.7094: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7095: DFBPPR13232 ---- Animal proteins ---- Osteocalcin
Source.7096: DFBPPR13233 ---- Animal proteins ---- Fibronectin
Source.7097: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain
Source.7098: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.7099: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.7100: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.7101: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.7102: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.7103: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7104: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.7105: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.7106: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.7107: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.7108: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.7109: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.7110: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.7111: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.7112: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.7113: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.7114: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.7115: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.7116: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.7117: DFBPPR13302 ---- Animal proteins ---- Endothelin-2
Source.7118: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.7119: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.7120: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.7121: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0
Source.7122: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.7123: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.7124: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.7125: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.7126: DFBPPR13349 ---- Animal proteins ---- Cysteine-rich secretory protein 3
Source.7127: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.7128: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.7129: DFBPPR13357 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.7130: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.7131: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7132: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.7133: DFBPPR13378 ---- Animal proteins ---- Neutrophil elastase 2A
Source.7134: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7135: DFBPPR13387 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.7136: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.7137: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.7138: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.7139: DFBPPR13413 ---- Animal proteins ---- Antimicrobial peptide eNAP-1
Source.7140: DFBPPR13414 ---- Animal proteins ---- Melanotropin beta
Source.7141: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7142: DFBPPR13420 ---- Animal proteins ---- Small integral membrane protein 12
Source.7143: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.7144: DFBPPR13424 ---- Animal proteins ---- Leptin
Source.7145: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.7146: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7147: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7148: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.7149: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.7150: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.7151: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.7152: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.7153: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.7154: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7155: DFBPPR13445 ---- Animal proteins ---- Interleukin-1 alpha
Source.7156: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.7157: DFBPPR13448 ---- Animal proteins ---- Osteocalcin
Source.7158: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7159: DFBPPR13450 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.7160: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.7161: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.7162: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.7163: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.7164: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.7165: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.7166: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.7167: DFBPPR13520 ---- Animal proteins ---- 60S ribosomal protein L21
Source.7168: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.7169: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.7170: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.7171: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7172: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.7173: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.7174: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.7175: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.7176: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.7177: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.7178: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.7179: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.7180: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.7181: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.7182: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.7183: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.7184: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.7185: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.7186: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.7187: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.7188: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.7189: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.7190: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.7191: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.7192: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.7193: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.7194: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.7195: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7196: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.7197: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.7198: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.7199: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7200: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.7201: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.7202: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.7203: DFBPPR13613 ---- Animal proteins ---- Phospholipase A2
Source.7204: DFBPPR13615 ---- Animal proteins ---- Cofilin-1
Source.7205: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.7206: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.7207: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.7208: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.7209: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.7210: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.7211: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.7212: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.7213: DFBPPR13646 ---- Animal proteins ---- Procathepsin L
Source.7214: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.7215: DFBPPR13652 ---- Animal proteins ---- Interleukin-3
Source.7216: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7217: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain
Source.7218: DFBPPR13672 ---- Animal proteins ---- Annexin A2
Source.7219: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.7220: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.7221: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.7222: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.7223: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.7224: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.7225: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.7226: DFBPPR13708 ---- Animal proteins ---- Renin
Source.7227: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX
Source.7228: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.7229: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.7230: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.7231: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.7232: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.7233: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.7234: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.7235: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.7236: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.7237: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic
Source.7238: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.7239: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.7240: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.7241: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.7242: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.7243: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A
Source.7244: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.7245: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.7246: DFBPPR13773 ---- Animal proteins ---- Interleukin-1 alpha
Source.7247: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.7248: DFBPPR13777 ---- Animal proteins ---- Centromere protein C
Source.7249: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.7250: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.7251: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.7252: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.7253: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.7254: DFBPPR13789 ---- Animal proteins ---- Tryptase-2
Source.7255: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.7256: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.7257: DFBPPR13810 ---- Animal proteins ---- Transthyretin
Source.7258: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.7259: DFBPPR13817 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.7260: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5
Source.7261: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.7262: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.7263: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.7264: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.7265: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.7266: DFBPPR13838 ---- Animal proteins ---- Endothelin-1
Source.7267: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.7268: DFBPPR13843 ---- Animal proteins ---- 60S ribosomal protein L10
Source.7269: DFBPPR13850 ---- Animal proteins ---- Interleukin-15
Source.7270: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.7271: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.7272: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.7273: DFBPPR13872 ---- Animal proteins ---- Keratin, high sulfur matrix protein, IIIB3
Source.7274: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.7275: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.7276: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7277: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3
Source.7278: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.7279: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7280: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.7281: DFBPPR13901 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.7282: DFBPPR13902 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.7283: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.7284: DFBPPR13909 ---- Animal proteins ---- Homeobox protein Hox-C9
Source.7285: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.7286: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.7287: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.7288: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.7289: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.7290: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.7291: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7292: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.7293: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.7294: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7295: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.7296: DFBPPR13991 ---- Animal proteins ---- Osteocalcin
Source.7297: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.7298: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.7299: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.7300: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.7301: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.7302: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.7303: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.7304: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.7305: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin
Source.7306: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.7307: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.7308: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.7309: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.7310: DFBPPR14025 ---- Animal proteins ---- Granulin-1
Source.7311: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.7312: DFBPPR14029 ---- Animal proteins ---- Gamma-crystallin M1
Source.7313: DFBPPR14030 ---- Animal proteins ---- Prepro-urotensin II-gamma
Source.7314: DFBPPR14031 ---- Animal proteins ---- Prepro-urotensin II-alpha
Source.7315: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7316: DFBPPR14041 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.7317: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7318: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.7319: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.7320: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.7321: DFBPPR14056 ---- Animal proteins ---- Gamma-crystallin M3
Source.7322: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog
Source.7323: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.7324: DFBPPR14071 ---- Marine protein ---- Somatotropin
Source.7325: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.7326: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.7327: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.7328: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.7329: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.7330: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.7331: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1
Source.7332: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.7333: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.7334: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.7335: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.7336: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.7337: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.7338: DFBPPR14102 ---- Marine protein ---- Anamorsin-B
Source.7339: DFBPPR14104 ---- Marine protein ---- Anamorsin-A
Source.7340: DFBPPR14108 ---- Marine protein ---- 6-pyruvoyl tetrahydrobiopterin synthase
Source.7341: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.7342: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.7343: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.7344: DFBPPR14125 ---- Marine protein ---- Partner of Y14 and mago B
Source.7345: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.7346: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.7347: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.7348: DFBPPR14137 ---- Marine protein ---- Partner of Y14 and mago A
Source.7349: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.7350: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.7351: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.7352: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.7353: DFBPPR14153 ---- Marine protein ---- Progonadoliberin-3
Source.7354: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E
Source.7355: DFBPPR14158 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.7356: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.7357: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.7358: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial
Source.7359: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.7360: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.7361: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.7362: DFBPPR14174 ---- Marine protein ---- Ubiquitin-fold modifier 1
Source.7363: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.7364: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.7365: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.7366: DFBPPR14186 ---- Marine protein ---- 60S ribosomal protein L18
Source.7367: DFBPPR14188 ---- Marine protein ---- DNA repair protein SWI5 homolog
Source.7368: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.7369: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor
Source.7370: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.7371: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.7372: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.7373: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.7374: DFBPPR14225 ---- Marine protein ---- LYR motif-containing protein 1
Source.7375: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin
Source.7376: DFBPPR14231 ---- Marine protein ---- Somatotropin
Source.7377: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.7378: DFBPPR14241 ---- Marine protein ---- Cystatin
Source.7379: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.7380: DFBPPR14252 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.7381: DFBPPR14253 ---- Marine protein ---- Vasotocin-neurophysin VT 1
Source.7382: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.7383: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.7384: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a
Source.7385: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.7386: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.7387: DFBPPR14279 ---- Marine protein ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.7388: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.7389: DFBPPR14287 ---- Marine protein ---- C-phycocyanin alpha chain
Source.7390: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.7391: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.7392: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.7393: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.7394: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.7395: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.7396: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.7397: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.7398: DFBPPR14306 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.7399: DFBPPR14308 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic
Source.7400: DFBPPR14320 ---- Marine protein ---- Photosystem I assembly protein Ycf3
Source.7401: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region
Source.7402: DFBPPR14324 ---- Marine protein ---- Uncharacterized protein ycf19
Source.7403: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.7404: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.7405: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7406: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.7407: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.7408: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.7409: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7410: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.7411: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.7412: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.7413: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.7414: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.7415: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.7416: DFBPPR14355 ---- Marine protein ---- ATP synthase subunit c, chloroplastic
Source.7417: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.7418: DFBPPR14357 ---- Marine protein ---- Ferredoxin
Source.7419: DFBPPR14358 ---- Marine protein ---- Thiazole synthase
Source.7420: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.7421: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.7422: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.7423: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.7424: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.7425: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.7426: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.7427: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.7428: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.7429: DFBPPR14383 ---- Marine protein ---- C-phycocyanin alpha chain
Source.7430: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.7431: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.7432: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain
Source.7433: DFBPPR14403 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.7434: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.7435: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain
Source.7436: DFBPPR14411 ---- Marine protein ---- 50S ribosomal protein L22, chloroplastic
Source.7437: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.7438: DFBPPR14423 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic
Source.7439: DFBPPR14434 ---- Marine protein ---- 50S ribosomal protein L6, chloroplastic
Source.7440: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY
Source.7441: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic
Source.7442: DFBPPR14472 ---- Marine protein ---- Photosystem I reaction center subunit XI
Source.7443: DFBPPR14476 ---- Marine protein ---- Protein CfxQ homolog
Source.7444: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.7445: DFBPPR14481 ---- Marine protein ---- 50S ribosomal protein L13, chloroplastic
Source.7446: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.7447: DFBPPR14494 ---- Marine protein ---- 50S ribosomal protein L35, chloroplastic
Source.7448: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.7449: DFBPPR14499 ---- Marine protein ---- Photosystem I assembly protein Ycf3
Source.7450: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.7451: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.7452: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92
Source.7453: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.7454: DFBPPR14513 ---- Marine protein ---- Uncharacterized protein ycf19
Source.7455: DFBPPR14528 ---- Marine protein ---- Uracil phosphoribosyltransferase homolog
Source.7456: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.7457: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.7458: DFBPPR14541 ---- Marine protein ---- Somatotropin-1
Source.7459: DFBPPR14542 ---- Marine protein ---- Somatotropin-2
Source.7460: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor
Source.7461: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B
Source.7462: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.7463: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.7464: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.7465: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.7466: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7467: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.7468: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.7469: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.7470: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.7471: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.7472: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.7473: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.7474: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.7475: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.7476: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.7477: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.7478: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.7479: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.7480: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.7481: DFBPPR14602 ---- Marine protein ---- Proteasome subunit beta type-3
Source.7482: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.7483: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.7484: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.7485: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.7486: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.7487: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.7488: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.7489: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.7490: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.7491: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc
Source.7492: DFBPPR14666 ---- Marine protein ---- High mobility group-T protein
Source.7493: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.7494: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.7495: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.7496: DFBPPR14672 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.7497: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.7498: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.7499: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.7500: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.7501: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.7502: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.7503: DFBPPR14697 ---- Marine protein ---- Progonadoliberin-3
Source.7504: DFBPPR14698 ---- Marine protein ---- Cystatin
Source.7505: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.7506: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.7507: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.7508: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.7509: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2
Source.7510: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.7511: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.7512: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.7513: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.7514: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.7515: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.7516: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.7517: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.7518: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.7519: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.7520: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.7521: DFBPPR14798 ---- Marine protein ---- Panusin
Source.7522: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.7523: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.7524: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.7525: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.7526: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.7527: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.7528: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.7529: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.7530: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.7531: DFBPPR14812 ---- Marine protein ---- Alpha-2-macroglobulin homolog
Source.7532: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.7533: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.7534: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.7535: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.7536: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.7537: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.7538: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7539: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.7540: DFBPPR14862 ---- Marine protein ---- Insulin
Source.7541: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.7542: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.7543: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.7544: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2
Source.7545: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.7546: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.7547: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.7548: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.7549: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.7550: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.7551: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.7552: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.7553: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.7554: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.7555: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.7556: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.7557: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.7558: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.7559: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.7560: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.7561: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.7562: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4
Source.7563: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.7564: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3
Source.7565: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.7566: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.7567: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.7568: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8
Source.7569: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.7570: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.7571: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.7572: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.7573: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.7574: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.7575: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.7576: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.7577: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.7578: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.7579: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.7580: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.7581: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.7582: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.7583: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.7584: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32
Source.7585: DFBPPR14950 ---- Microorganism protein ---- 5'-AMP-activated protein kinase subunit gamma
Source.7586: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.7587: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.7588: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.7589: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.7590: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.7591: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.7592: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.7593: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.7594: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.7595: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.7596: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.7597: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.7598: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.7599: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.7600: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.7601: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.7602: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.7603: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.7604: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.7605: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1
Source.7606: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.7607: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.7608: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.7609: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.7610: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.7611: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6
Source.7612: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.7613: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.7614: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.7615: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.7616: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.7617: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.7618: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1
Source.7619: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.7620: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.7621: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.7622: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.7623: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.7624: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.7625: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.7626: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.7627: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.7628: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.7629: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.7630: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.7631: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.7632: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.7633: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.7634: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.7635: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.7636: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.7637: DFBPPR15076 ---- Microorganism protein ---- Fe-S cluster assembly protein DRE2
Source.7638: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.7639: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.7640: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.7641: DFBPPR15082 ---- Microorganism protein ---- Cytochrome c
Source.7642: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.7643: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.7644: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.7645: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.7646: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.7647: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.7648: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.7649: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.7650: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.7651: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.7652: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.7653: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.7654: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.7655: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.7656: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.7657: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G
Source.7658: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.7659: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.7660: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.7661: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.7662: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.7663: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.7664: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.7665: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.7666: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.7667: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.7668: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.7669: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase
Source.7670: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.7671: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.7672: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.7673: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.7674: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.7675: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.7676: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.7677: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.7678: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1
Source.7679: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.7680: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.7681: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.7682: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.7683: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.7684: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.7685: DFBPPR15185 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 8
Source.7686: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.7687: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.7688: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.7689: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.7690: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.7691: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.7692: DFBPPR15204 ---- Microorganism protein ---- FK506-binding protein 1
Source.7693: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.7694: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.7695: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.7696: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.7697: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1
Source.7698: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.7699: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.7700: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.7701: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.7702: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.7703: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.7704: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.7705: DFBPPR15222 ---- Microorganism protein ---- DASH complex subunit ASK1
Source.7706: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.7707: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.7708: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.7709: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.7710: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.7711: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2
Source.7712: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.7713: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a
Source.7714: DFBPPR15251 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP38
Source.7715: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase
Source.7716: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.7717: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.7718: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.7719: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.7720: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.7721: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1
Source.7722: DFBPPR15265 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM14
Source.7723: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.7724: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.7725: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.7726: DFBPPR15276 ---- Microorganism protein ---- Guanine nucleotide-binding protein subunit gamma
Source.7727: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.7728: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.7729: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80
Source.7730: DFBPPR15297 ---- Microorganism protein ---- Transcriptional activator HAP2
Source.7731: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase
Source.7732: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.7733: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1
Source.7734: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.7735: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.7736: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.7737: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase
Source.7738: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.7739: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.7740: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.7741: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.7742: DFBPPR15328 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 31
Source.7743: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.7744: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.7745: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.7746: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1
Source.7747: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.7748: DFBPPR15350 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 7
Source.7749: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.7750: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.7751: DFBPPR15361 ---- Microorganism protein ---- DASH complex subunit DAD4
Source.7752: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.7753: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.7754: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.7755: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.7756: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.7757: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.7758: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog
Source.7759: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.7760: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.7761: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.7762: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.7763: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.7764: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17
Source.7765: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.7766: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.7767: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.7768: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.7769: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.7770: DFBPPR15403 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM13
Source.7771: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.7772: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71
Source.7773: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4
Source.7774: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34
Source.7775: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.7776: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.7777: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82
Source.7778: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.7779: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3
Source.7780: DFBPPR15432 ---- Microorganism protein ---- Pre-rRNA-processing protein ESF2
Source.7781: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.7782: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.7783: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1
Source.7784: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.7785: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.7786: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.7787: DFBPPR15448 ---- Microorganism protein ---- 40S ribosomal protein S0
Source.7788: DFBPPR15456 ---- Microorganism protein ---- RNA polymerase II holoenzyme cyclin-like subunit
Source.7789: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter
Source.7790: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.7791: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.7792: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121
Source.7793: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.7794: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.7795: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.7796: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2
Source.7797: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.7798: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.7799: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.7800: DFBPPR15484 ---- Microorganism protein ---- Protein TOS6
Source.7801: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.7802: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.7803: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.7804: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1
Source.7805: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.7806: DFBPPR15495 ---- Microorganism protein ---- DNA replication complex GINS protein PSF2
Source.7807: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.7808: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.7809: DFBPPR15506 ---- Microorganism protein ---- Cytochrome c oxidase assembly factor 3, mitochondrial
Source.7810: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3
Source.7811: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.7812: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.7813: DFBPPR15515 ---- Microorganism protein ---- Tethering factor for nuclear proteasome STS1
Source.7814: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101
Source.7815: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3
Source.7816: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.7817: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5
Source.7818: DFBPPR15533 ---- Microorganism protein ---- Non-histone chromosomal protein 6
Source.7819: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.7820: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.7821: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.7822: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.7823: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.7824: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.7825: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.7826: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.7827: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2
Source.7828: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.7829: DFBPPR15571 ---- Microorganism protein ---- Mating-type protein ALPHA2
Source.7830: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.7831: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.7832: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.7833: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.7834: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.7835: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.7836: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.7837: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4
Source.7838: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.7839: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.7840: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1
Source.7841: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.7842: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.7843: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.7844: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2
Source.7845: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.7846: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.7847: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.7848: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.7849: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.7850: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.7851: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.7852: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.7853: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.7854: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.7855: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1
Source.7856: DFBPPR15664 ---- Microorganism protein ---- Spindle pole body component SPC42
Source.7857: DFBPPR15669 ---- Microorganism protein ---- Serine palmitoyltransferase-regulating protein TSC3
Source.7858: DFBPPR15670 ---- Microorganism protein ---- Imidazoleglycerol-phosphate dehydratase
Source.7859: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.7860: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.7861: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.7862: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.7863: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14
Source.7864: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.7865: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.7866: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4
Source.7867: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.7868: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial
Source.7869: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.7870: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1
Source.7871: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.7872: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.7873: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.7874: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.7875: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.7876: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.7877: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2
Source.7878: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.7879: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.7880: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.7881: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.7882: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.7883: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.7884: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.7885: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.7886: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3
Source.7887: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.7888: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial
Source.7889: DFBPPR15766 ---- Microorganism protein ---- Protein ATC1/LIC4
Source.7890: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.7891: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.7892: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.7893: DFBPPR15780 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 8
Source.7894: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.7895: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.7896: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2
Source.7897: DFBPPR15789 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 4
Source.7898: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.7899: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.7900: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.7901: DFBPPR15793 ---- Microorganism protein ---- Uncharacterized protein KLLA0D02464g
Source.7902: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.7903: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase
Source.7904: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.7905: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component
Source.7906: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.7907: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.7908: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.7909: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.7910: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.7911: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.7912: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.7913: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase
Source.7914: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.7915: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.7916: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.7917: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.7918: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.7919: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.7920: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.7921: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.7922: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.7923: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.7924: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.7925: DFBPPR15867 ---- Microorganism protein ---- Superoxide dismutase [Mn], mitochondrial
Source.7926: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.7927: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.7928: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.7929: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.7930: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.7931: DFBPPR15880 ---- Microorganism protein ---- 40S ribosomal protein S13
Source.7932: DFBPPR15886 ---- Microorganism protein ---- Capsid protein
Source.7933: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.7934: DFBPPR15889 ---- Marine protein ---- Ferredoxin
Source.7935: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.7936: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.7937: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.7938: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.7939: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.7940: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.7941: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.7942: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.7943: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.7944: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.7945: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.7946: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.7947: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.7948: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.7949: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.7950: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.7951: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.7952: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A
Source.7953: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.7954: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.7955: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.7956: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7957: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic
Source.7958: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.7959: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.7960: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7961: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.7962: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.7963: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.7964: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.7965: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.7966: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.7967: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.7968: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.7969: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.7970: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.7971: DFBPPR7795 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.7972: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.7973: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.7974: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.7975: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.7976: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.7977: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.7978: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.7979: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.7980: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.7981: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.7982: DFBPPR7813 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.7983: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.7984: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.7985: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.7986: DFBPPR7819 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.7987: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.7988: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.7989: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.7990: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase
Source.7991: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.7992: DFBPPR7832 ---- Plant protein ---- Extensin
Source.7993: DFBPPR7834 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase homolog 2
Source.7994: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.7995: DFBPPR7847 ---- Plant protein ---- Non-specific lipid-transfer protein 1
Source.7996: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.7997: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.7998: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.7999: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.8000: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Source.8001: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.8002: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4
Source.8003: DFBPPR7869 ---- Plant protein ---- Alpha-amylase inhibitor 5
Source.8004: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1
Source.8005: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.8006: DFBPPR7883 ---- Plant protein ---- Non-specific lipid-transfer protein 2
Source.8007: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.8008: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.8009: DFBPPR7920 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.8010: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.8011: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.8012: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.8013: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.8014: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.8015: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.8016: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.8017: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a
Source.8018: DFBPPR7947 ---- Plant protein ---- Legumin type B
Source.8019: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.8020: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.8021: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.8022: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.8023: DFBPPR7956 ---- Plant protein ---- Legumin type B
Source.8024: DFBPPR7957 ---- Plant protein ---- Legumin type B
Source.8025: DFBPPR7958 ---- Plant protein ---- Legumin type B
Source.8026: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.8027: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.8028: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.8029: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.8030: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.8031: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein
Source.8032: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.8033: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.8034: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1
Source.8035: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.8036: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.8037: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.8038: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.8039: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.8040: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.8041: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.8042: DFBPPR8029 ---- Plant protein ---- Vignain
Source.8043: DFBPPR8030 ---- Plant protein ---- Arcelin-5A
Source.8044: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.8045: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.8046: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.8047: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.8048: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.8049: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.8050: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1
Source.8051: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.8052: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.8053: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1
Source.8054: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.8055: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.8056: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.8057: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.8058: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.8059: DFBPPR8066 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.8060: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.8061: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.8062: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.8063: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.8064: DFBPPR8073 ---- Plant protein ---- Arcelin-5B
Source.8065: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.8066: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.8067: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.8068: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.8069: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.8070: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.8071: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase
Source.8072: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.8073: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.8074: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.8075: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.8076: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.8077: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.8078: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.8079: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.8080: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.8081: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.8082: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.8083: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.8084: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.8085: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.8086: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.8087: DFBPPR8136 ---- Plant protein ---- 136 kDa hydroxyproline-rich cell wall glycoprotein, major component
Source.8088: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.8089: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.8090: DFBPPR8153 ---- Plant protein ---- Thaumatin-like protein
Source.8091: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.8092: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.8093: DFBPPR8163 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.8094: DFBPPR8185 ---- Plant protein ---- Uncharacterized basic polypeptide
Source.8095: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.8096: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.8097: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.8098: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.8099: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.8100: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.8101: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.8102: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.8103: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.8104: DFBPPR8225 ---- Plant protein ---- Non-specific lipid-transfer protein AP10
Source.8105: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.8106: DFBPPR8228 ---- Plant protein ---- Albumin-8
Source.8107: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.8108: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.8109: DFBPPR8235 ---- Plant protein ---- Catalase
Source.8110: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.8111: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.8112: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase
Source.8113: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.8114: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.8115: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.8116: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.8117: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.8118: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.8119: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.8120: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.8121: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.8122: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.8123: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.8124: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.8125: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.8126: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.8127: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.8128: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein
Source.8129: DFBPPR8296 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.8130: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.8131: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.8132: DFBPPR8308 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.8133: DFBPPR8309 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic
Source.8134: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Source.8135: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.8136: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.8137: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Source.8138: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein
Source.8139: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.8140: DFBPPR8347 ---- Plant protein ---- 50S ribosomal protein L33, chloroplastic
Source.8141: DFBPPR8349 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.8142: DFBPPR8356 ---- Plant protein ---- Unknown protein 1
Link-research
Link 1: DFBPACEI2430----Wheat----Wheat gluten oligopeptide
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited very low Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 2380 uM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Bovine hide gelatin hydrolysate was hydrolyzed with thermolysin.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The bovine gelatin hydrolysate could be used as a blood pressure lowering ingredient in functional foods, but only under the condition of an appropriate hydrolysis.

Database cross-references
BIOPEP-UWM [D1] 8866
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Herregods G, Van Camp J, Morel N, Ghesquière B, Gevaert K, Vercruysse L, Dierckx S, Quanten E, Smagghe G. Angiotensin I-converting enzyme inhibitory activity of gelatin hydrolysates and identification of bioactive peptides. J Agric Food Chem. 2011 Jan 26;59(2):552-8.
PMID: 21174470
Other literature(s) N.D
PubDate 2011
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214