E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1638(ACE-inhibitory peptide)
DFBP ID DFBPACEI1638
Peptide sequence GM
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Gly-Met
Single-letter amino acid GM
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 206.26 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 1400 μM
pIC50 -3.146
GRAVY 0.7500 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Synthesis
Organism/Source Synthesis peptide
Precursor protein Synthesis peptide
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.3: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.4: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.5: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.6: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2
Source.7: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.8: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.9: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.10: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.11: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.12: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.13: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.14: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.15: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.16: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.17: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.18: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.19: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.20: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.21: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.22: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.23: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.24: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.25: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.26: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.27: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.28: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.29: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.30: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A
Source.31: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.32: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.33: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.34: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.35: DFBPPR0876 ---- Plant proteins ---- Protein BZR1 homolog 1
Source.36: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.37: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.38: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.39: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.40: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.41: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.42: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.43: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic
Source.44: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.45: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.46: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.47: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.48: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.49: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.50: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.51: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.52: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.53: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a
Source.54: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.55: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.56: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.57: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.58: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.59: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.60: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.61: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.62: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8
Source.63: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.64: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.65: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.66: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.67: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.68: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3
Source.69: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.70: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.71: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.72: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.73: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.74: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.75: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.76: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.77: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.78: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.79: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.80: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.81: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.82: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.83: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.84: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.85: DFBPPR0971 ---- Plant proteins ---- Protein STAR1
Source.86: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.87: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.88: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.89: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.90: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.91: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.92: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.93: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.94: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.95: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.96: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.97: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.98: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.99: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.100: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.101: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1
Source.102: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.103: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.104: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.105: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.106: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.107: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.108: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.109: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.110: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.111: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.112: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.113: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.114: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.115: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.116: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.117: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.118: DFBPPR1028 ---- Plant proteins ---- Defensin-like protein CAL1
Source.119: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.120: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.121: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.122: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.123: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.124: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.125: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.126: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.127: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.128: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.129: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.130: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.131: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.132: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.133: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.134: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.135: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.136: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.137: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.138: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.139: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.140: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.141: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.142: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.143: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.144: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.145: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.146: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.147: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.148: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.149: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.150: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.151: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.152: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.153: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.154: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.155: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.156: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.157: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.158: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.159: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.160: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.161: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.162: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.163: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.164: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.165: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.166: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.167: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.168: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.169: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.170: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.171: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.172: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.173: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.174: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.175: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.176: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.177: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.178: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.179: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.180: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog
Source.181: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.182: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.183: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.184: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.185: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.186: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.187: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.188: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.189: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1
Source.190: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.191: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.192: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.193: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic
Source.194: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.195: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.196: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.197: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.198: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.199: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.200: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.201: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.202: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic
Source.203: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial
Source.204: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.205: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.206: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3
Source.207: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.208: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.209: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.210: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.211: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.212: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.213: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial
Source.214: DFBPPR1223 ---- Plant proteins ---- Elicitor-responsive protein 1
Source.215: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.216: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.217: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.218: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.219: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.220: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.221: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.222: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.223: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic
Source.224: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.225: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.226: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.227: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.228: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.229: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.230: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.231: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.232: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.233: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.234: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.235: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.236: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.237: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.238: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.239: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.240: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.241: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.242: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.243: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.244: DFBPPR1301 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.245: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.246: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.247: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.248: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.249: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.250: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.251: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.252: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.253: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.254: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.255: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.256: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.257: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.258: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.259: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.260: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.261: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.262: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.263: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.264: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.265: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.266: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.267: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5
Source.268: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.269: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.270: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.271: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.272: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.273: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.274: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.275: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.276: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.277: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.278: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.279: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.280: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.281: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.282: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.283: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.284: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.285: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.286: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.287: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.288: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.289: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.290: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.291: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.292: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.293: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.294: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.295: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.296: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.297: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.298: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.299: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.300: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.301: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.302: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.303: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.304: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.305: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.306: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.307: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.308: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.309: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.310: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.311: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.312: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.313: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.314: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.315: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.316: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3
Source.317: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.318: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.319: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.320: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.321: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.322: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.323: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.324: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.325: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.326: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.327: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.328: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.329: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.330: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.331: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.332: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.333: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.334: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic
Source.335: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.336: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.337: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.338: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.339: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.340: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.341: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.342: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.343: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.344: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.345: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.346: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.347: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.348: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.349: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.350: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.351: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.352: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.353: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.354: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.355: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.356: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.357: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.358: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.359: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.360: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.361: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.362: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.363: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.364: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.365: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5
Source.366: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.367: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.368: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.369: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.370: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.371: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.372: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.373: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.374: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.375: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.376: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8
Source.377: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.378: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.379: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.380: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.381: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.382: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.383: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.384: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.385: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.386: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.387: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.388: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51
Source.389: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.390: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.391: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.392: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.393: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.394: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.395: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.396: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.397: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic
Source.398: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.399: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.400: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.401: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.402: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.403: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.404: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.405: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.406: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.407: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.408: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.409: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.410: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.411: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.412: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.413: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.414: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.415: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.416: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.417: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.418: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.419: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a
Source.420: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.421: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.422: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.423: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.424: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.425: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.426: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.427: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.428: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.429: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.430: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.431: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.432: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.433: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.434: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.435: DFBPPR1648 ---- Plant proteins ---- Transcription factor ILI4
Source.436: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.437: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.438: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.439: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.440: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.441: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.442: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.443: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.444: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.445: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.446: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.447: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.448: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.449: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.450: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.451: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.452: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.453: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.454: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.455: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.456: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.457: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.458: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.459: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.460: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.461: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.462: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.463: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.464: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.465: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.466: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.467: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.468: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.469: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.470: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.471: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.472: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.473: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.474: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.475: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.476: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.477: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.478: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.479: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.480: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.481: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.482: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.483: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.484: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.485: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.486: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.487: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.488: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.489: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.490: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.491: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.492: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.493: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.494: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.495: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.496: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.497: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.498: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22
Source.499: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.500: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.501: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.502: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.503: DFBPPR1796 ---- Plant proteins ---- Fibrillin protein 5 homolog
Source.504: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1
Source.505: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.506: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.507: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.508: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.509: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.510: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.511: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.512: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.513: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.514: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.515: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.516: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.517: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.518: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.519: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.520: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.521: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.522: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.523: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.524: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.525: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.526: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2
Source.527: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.528: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.529: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.530: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.531: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.532: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.533: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.534: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.535: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.536: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.537: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.538: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.539: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.540: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.541: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.542: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.543: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.544: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3
Source.545: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.546: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.547: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.548: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.549: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.550: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.551: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.552: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.553: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.554: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.555: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.556: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.557: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.558: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.559: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.560: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.561: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.562: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.563: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.564: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.565: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.566: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.567: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.568: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.569: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.570: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.571: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.572: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.573: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.574: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2
Source.575: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.576: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.577: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.578: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.579: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.580: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1
Source.581: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.582: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.583: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.584: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1
Source.585: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.586: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.587: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.588: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.589: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.590: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.591: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.592: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.593: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.594: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30
Source.595: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.596: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.597: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.598: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.599: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.600: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38
Source.601: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.602: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.603: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.604: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.605: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.606: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.607: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.608: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.609: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.610: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.611: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.612: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.613: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.614: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.615: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.616: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.617: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.618: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.619: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.620: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.621: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.622: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.623: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.624: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.625: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.626: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.627: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.628: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.629: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.630: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.631: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.632: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.633: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.634: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.635: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.636: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.637: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.638: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.639: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.640: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.641: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.642: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.643: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.644: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.645: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2
Source.646: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.647: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.648: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.649: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.650: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.651: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.652: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.653: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.654: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.655: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.656: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.657: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80
Source.658: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.659: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.660: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.661: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.662: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.663: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.664: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.665: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.666: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.667: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.668: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.669: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.670: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.671: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.672: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.673: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.674: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic
Source.675: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.676: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.677: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.678: DFBPPR2137 ---- Plant proteins ---- Metallothionein-like protein 2C
Source.679: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.680: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.681: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.682: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.683: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.684: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.685: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.686: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.687: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.688: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.689: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.690: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.691: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.692: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.693: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.694: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.695: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.696: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.697: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.698: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.699: DFBPPR2176 ---- Plant proteins ---- Expansin-B11
Source.700: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2
Source.701: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.702: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.703: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.704: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1
Source.705: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.706: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.707: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.708: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.709: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.710: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.711: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.712: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.713: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.714: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.715: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.716: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.717: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.718: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.719: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.720: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.721: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21
Source.722: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.723: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.724: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.725: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.726: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.727: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.728: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.729: DFBPPR2223 ---- Plant proteins ---- Urease
Source.730: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.731: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.732: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.733: DFBPPR2230 ---- Plant proteins ---- Proteasome subunit alpha type-2
Source.734: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.735: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.736: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.737: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.738: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.739: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.740: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.741: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.742: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.743: DFBPPR2245 ---- Plant proteins ---- Expansin-A26
Source.744: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.745: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.746: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.747: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.748: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.749: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.750: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.751: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.752: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3
Source.753: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.754: DFBPPR2272 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 2
Source.755: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.756: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.757: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.758: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.759: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.760: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.761: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.762: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.763: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1
Source.764: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.765: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.766: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.767: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.768: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.769: DFBPPR2309 ---- Plant proteins ---- Two-component response regulator ORR6
Source.770: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.771: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.772: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.773: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.774: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.775: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.776: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.777: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.778: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.779: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.780: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.781: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b
Source.782: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.783: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.784: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.785: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.786: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.787: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.788: DFBPPR2352 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-4
Source.789: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.790: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.791: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11
Source.792: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.793: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.794: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.795: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.796: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.797: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.798: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.799: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.800: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.801: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.802: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.803: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.804: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.805: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.806: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.807: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.808: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase
Source.809: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.810: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.811: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.812: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.813: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.814: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.815: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.816: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.817: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.818: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.819: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.820: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.821: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.822: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.823: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.824: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1
Source.825: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.826: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.827: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.828: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.829: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.830: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.831: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.832: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.833: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.834: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9
Source.835: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.836: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.837: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.838: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.839: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3
Source.840: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.841: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.842: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.843: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26
Source.844: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.845: DFBPPR2474 ---- Plant proteins ---- Two-component response regulator ORR10
Source.846: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.847: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.848: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.849: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.850: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.851: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.852: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.853: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.854: DFBPPR2491 ---- Plant proteins ---- Expansin-A10
Source.855: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.856: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.857: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.858: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.859: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.860: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.861: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.862: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.863: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.864: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.865: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.866: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.867: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.868: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.869: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.870: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.871: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.872: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.873: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.874: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.875: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.876: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.877: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein
Source.878: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.879: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.880: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.881: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.882: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.883: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.884: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.885: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.886: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.887: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.888: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.889: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.890: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.891: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4
Source.892: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.893: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.894: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.895: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9
Source.896: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.897: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.898: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.899: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.900: DFBPPR2584 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.901: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.902: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.903: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.904: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.905: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.906: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.907: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.908: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.909: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.910: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.911: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.912: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.913: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2
Source.914: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.915: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.916: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.917: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.918: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.919: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.920: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.921: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2
Source.922: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.923: DFBPPR2624 ---- Plant proteins ---- Transcription initiation factor IIA subunit 2
Source.924: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.925: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.926: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34
Source.927: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.928: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.929: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.930: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.931: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.932: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.933: DFBPPR2638 ---- Plant proteins ---- Two-component response regulator ORR9
Source.934: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2
Source.935: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.936: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.937: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.938: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.939: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.940: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.941: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.942: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.943: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.944: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.945: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1
Source.946: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.947: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.948: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.949: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.950: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.951: DFBPPR2675 ---- Plant proteins ---- Anamorsin homolog 2
Source.952: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.953: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.954: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.955: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.956: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.957: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.958: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.959: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.960: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.961: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.962: DFBPPR2697 ---- Plant proteins ---- Calcineurin B-like protein 2
Source.963: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.964: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.965: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.966: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.967: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.968: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.969: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.970: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.971: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.972: DFBPPR2724 ---- Plant proteins ---- Putative germin-like protein 8-1
Source.973: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.974: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.975: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2
Source.976: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.977: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.978: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.979: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.980: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.981: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500
Source.982: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.983: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.984: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.985: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.986: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2
Source.987: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.988: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.989: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.990: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.991: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.992: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.993: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.994: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.995: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.996: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.997: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.998: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.999: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.1000: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.1001: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.1002: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.1003: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.1004: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.1005: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.1006: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1007: DFBPPR2784 ---- Plant proteins ---- Chitinase 11
Source.1008: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.1009: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1010: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.1011: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.1012: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1013: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.1014: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.1015: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.1016: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.1017: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.1018: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.1019: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.1020: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.1021: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.1022: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.1023: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.1024: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.1025: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.1026: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.1027: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.1028: DFBPPR2825 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.1029: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.1030: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.1031: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.1032: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.1033: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.1034: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.1035: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.1036: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.1037: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.1038: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.1039: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.1040: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.1041: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.1042: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.1043: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.1044: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic
Source.1045: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1046: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.1047: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.1048: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.1049: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.1050: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1051: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.1052: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.1053: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1
Source.1054: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.1055: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.1056: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase
Source.1057: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.1058: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.1059: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.1060: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.1061: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1062: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1063: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.1064: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.1065: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.1066: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.1067: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1068: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.1069: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.1070: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.1071: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.1072: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.1073: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.1074: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.1075: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.1076: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.1077: DFBPPR2908 ---- Plant proteins ---- Auxin-responsive protein IAA8
Source.1078: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.1079: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.1080: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.1081: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.1082: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1
Source.1083: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.1084: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.1085: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.1086: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.1087: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.1088: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.1089: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.1090: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.1091: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.1092: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.1093: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.1094: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.1095: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.1096: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1097: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.1098: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.1099: DFBPPR2952 ---- Plant proteins ---- Expansin-A17
Source.1100: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1101: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.1102: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21
Source.1103: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.1104: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.1105: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.1106: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.1107: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.1108: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.1109: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.1110: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.1111: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.1112: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3
Source.1113: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.1114: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.1115: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.1116: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.1117: DFBPPR2994 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.1118: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.1119: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.1120: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.1121: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.1122: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.1123: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.1124: DFBPPR3020 ---- Plant proteins ---- Polyubiquitin 3
Source.1125: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.1126: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.1127: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.1128: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.1129: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.1130: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1
Source.1131: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.1132: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.1133: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.1134: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.1135: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.1136: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.1137: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.1138: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.1139: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.1140: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.1141: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.1142: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.1143: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.1144: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.1145: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.1146: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.1147: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.1148: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.1149: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.1150: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.1151: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.1152: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3
Source.1153: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.1154: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.1155: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.1156: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.1157: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.1158: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.1159: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1160: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.1161: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.1162: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.1163: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.1164: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.1165: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.1166: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.1167: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.1168: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20
Source.1169: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1170: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.1171: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.1172: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1173: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1174: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.1175: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.1176: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1177: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.1178: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.1179: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.1180: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.1181: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1182: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.1183: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.1184: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.1185: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.1186: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.1187: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.1188: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.1189: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1190: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.1191: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.1192: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.1193: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1194: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.1195: DFBPPR3177 ---- Plant proteins ---- Two-component response regulator ORR4
Source.1196: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic
Source.1197: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1198: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1199: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.1200: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1201: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1202: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1203: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.1204: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1205: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.1206: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1207: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.1208: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1209: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.1210: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1211: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1212: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.1213: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1214: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.1215: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.1216: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1217: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.1218: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.1219: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.1220: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.1221: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.1222: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.1223: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.1224: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.1225: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1226: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.1227: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.1228: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1229: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.1230: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.1231: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.1232: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1233: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.1234: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.1235: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1236: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.1237: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1238: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.1239: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1240: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.1241: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.1242: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1243: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1244: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta
Source.1245: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.1246: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.1247: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.1248: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1249: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.1250: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.1251: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.1252: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1253: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.1254: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.1255: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.1256: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.1257: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.1258: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8
Source.1259: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.1260: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.1261: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.1262: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1263: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1264: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.1265: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.1266: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.1267: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.1268: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.1269: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2
Source.1270: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.1271: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1272: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.1273: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1274: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1275: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.1276: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1277: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1278: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.1279: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.1280: DFBPPR3372 ---- Plant proteins ---- Calcineurin B-like protein 3
Source.1281: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.1282: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19
Source.1283: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.1284: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1285: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.1286: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.1287: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.1288: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.1289: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.1290: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1291: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1292: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1293: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.1294: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7
Source.1295: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.1296: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.1297: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1298: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1299: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.1300: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.1301: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.1302: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1303: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.1304: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.1305: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1306: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.1307: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5
Source.1308: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.1309: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1310: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1311: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1312: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1313: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.1314: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3
Source.1315: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1
Source.1316: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.1317: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.1318: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.1319: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1320: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1321: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1322: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1323: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.1324: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.1325: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.1326: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1327: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.1328: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.1329: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.1330: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.1331: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.1332: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3
Source.1333: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1334: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.1335: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.1336: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1337: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8
Source.1338: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5
Source.1339: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1340: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.1341: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9
Source.1342: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1343: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1344: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.1345: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6
Source.1346: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.1347: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1348: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1349: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.1350: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.1351: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.1352: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.1353: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.1354: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.1355: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1356: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.1357: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1358: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1359: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.1360: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.1361: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1362: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1363: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.1364: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1365: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.1366: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4
Source.1367: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.1368: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.1369: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.1370: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.1371: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1372: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1373: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.1374: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1375: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.1376: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1377: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1378: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1379: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1380: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1381: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.1382: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1383: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1384: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1
Source.1385: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.1386: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1387: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1388: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.1389: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1390: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.1391: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1392: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.1393: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1394: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.1395: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1396: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1397: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.1398: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial
Source.1399: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.1400: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1401: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1402: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.1403: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.1404: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1405: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.1406: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1
Source.1407: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.1408: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.1409: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2
Source.1410: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1411: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin
Source.1412: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1413: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.1414: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.1415: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.1416: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.1417: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6
Source.1418: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.1419: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1420: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1421: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.1422: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1423: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.1424: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.1425: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.1426: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.1427: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1428: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.1429: DFBPPR3687 ---- Plant proteins ---- Two-component response regulator ORR41
Source.1430: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.1431: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.1432: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.1433: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7
Source.1434: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.1435: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.1436: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.1437: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.1438: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.1439: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.1440: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.1441: DFBPPR3708 ---- Plant proteins ---- Late embryogenesis abundant protein 19
Source.1442: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.1443: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.1444: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.1445: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4
Source.1446: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.1447: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.1448: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.1449: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1450: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.1451: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.1452: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.1453: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.1454: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin
Source.1455: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.1456: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1
Source.1457: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.1458: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.1459: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1460: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1461: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.1462: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.1463: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.1464: DFBPPR3750 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic
Source.1465: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.1466: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30
Source.1467: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.1468: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.1469: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.1470: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.1471: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1472: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.1473: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.1474: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.1475: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.1476: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.1477: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.1478: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.1479: DFBPPR3795 ---- Plant proteins ---- NRR repressor homolog 1
Source.1480: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1481: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.1482: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.1483: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic
Source.1484: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8
Source.1485: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1486: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.1487: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.1488: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.1489: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.1490: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.1491: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.1492: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.1493: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.1494: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.1495: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.1496: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.1497: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1498: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.1499: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.1500: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.1501: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54
Source.1502: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.1503: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.1504: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.1505: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13
Source.1506: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.1507: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.1508: DFBPPR3854 ---- Plant proteins ---- Glutaredoxin-C10
Source.1509: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.1510: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.1511: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.1512: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.1513: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.1514: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.1515: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.1516: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.1517: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.1518: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.1519: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1520: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.1521: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.1522: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2
Source.1523: DFBPPR3882 ---- Plant proteins ---- Squamosa promoter-binding-like protein 7
Source.1524: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.1525: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.1526: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.1527: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.1528: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.1529: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.1530: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.1531: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1532: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1533: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.1534: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.1535: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.1536: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.1537: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1538: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.1539: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1540: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.1541: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.1542: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.1543: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.1544: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.1545: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.1546: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.1547: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.1548: DFBPPR3960 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1549: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.1550: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.1551: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.1552: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.1553: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19
Source.1554: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1555: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1556: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.1557: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1558: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.1559: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.1560: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.1561: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.1562: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1563: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.1564: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.1565: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1566: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.1567: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.1568: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7
Source.1569: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.1570: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1571: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5
Source.1572: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.1573: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1574: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.1575: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.1576: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.1577: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.1578: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.1579: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1580: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.1581: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.1582: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.1583: DFBPPR4045 ---- Plant proteins ---- 60S ribosomal protein L11
Source.1584: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.1585: DFBPPR4050 ---- Plant proteins ---- Cysteine proteinase inhibitor 8
Source.1586: DFBPPR4051 ---- Plant proteins ---- 40S ribosomal protein S3a
Source.1587: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.1588: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.1589: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.1590: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.1591: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1592: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.1593: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.1594: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.1595: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.1596: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.1597: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.1598: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.1599: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.1600: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1601: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.1602: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.1603: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.1604: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.1605: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.1606: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1607: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.1608: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.1609: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1610: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.1611: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.1612: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.1613: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.1614: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.1615: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.1616: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.1617: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.1618: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.1619: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1620: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.1621: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1622: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.1623: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1624: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.1625: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1626: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.1627: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1628: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1629: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1630: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.1631: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.1632: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.1633: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1634: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.1635: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1
Source.1636: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1637: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.1638: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1639: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.1640: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4
Source.1641: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1642: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.1643: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.1644: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1645: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.1646: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.1647: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.1648: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.1649: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.1650: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1651: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1652: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1653: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1654: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.1655: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.1656: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1657: DFBPPR4213 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim9
Source.1658: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1659: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1660: DFBPPR4218 ---- Plant proteins ---- Glycine-rich cell wall structural protein 2
Source.1661: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.1662: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.1663: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1664: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1665: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.1666: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2
Source.1667: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.1668: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1669: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2
Source.1670: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.1671: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.1672: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1673: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.1674: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1675: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1676: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.1677: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.1678: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.1679: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2
Source.1680: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.1681: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.1682: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.1683: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6
Source.1684: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.1685: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.1686: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1687: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.1688: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.1689: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1690: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.1691: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63
Source.1692: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1693: DFBPPR4266 ---- Plant proteins ---- Probable protein BRICK1
Source.1694: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.1695: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.1696: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.1697: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.1698: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.1699: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.1700: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.1701: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.1702: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.1703: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1704: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.1705: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20
Source.1706: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1707: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.1708: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.1709: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.1710: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.1711: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.1712: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1713: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.1714: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.1715: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.1716: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.1717: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.1718: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6
Source.1719: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1720: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.1721: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1722: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.1723: DFBPPR4320 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.1724: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.1725: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.1726: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.1727: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.1728: DFBPPR4331 ---- Plant proteins ---- 60S ribosomal protein L10-2
Source.1729: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.1730: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.1731: DFBPPR4339 ---- Plant proteins ---- Protein LHCP TRANSLOCATION DEFECT
Source.1732: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.1733: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1734: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.1735: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11
Source.1736: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1737: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.1738: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic
Source.1739: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.1740: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.1741: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1742: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.1743: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.1744: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1745: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2
Source.1746: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.1747: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.1748: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.1749: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1750: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.1751: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.1752: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.1753: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.1754: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1755: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14
Source.1756: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.1757: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.1758: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.1759: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.1760: DFBPPR4400 ---- Plant proteins ---- Putative calmodulin-like protein 6
Source.1761: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.1762: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.1763: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.1764: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.1765: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1766: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.1767: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.1768: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1769: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1770: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.1771: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.1772: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.1773: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.1774: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1775: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.1776: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1777: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.1778: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.1779: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1780: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.1781: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.1782: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.1783: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.1784: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.1785: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.1786: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.1787: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.1788: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.1789: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.1790: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.1791: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28
Source.1792: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.1793: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1794: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.1795: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17
Source.1796: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.1797: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.1798: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.1799: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.1800: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.1801: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.1802: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.1803: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1804: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.1805: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.1806: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.1807: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.1808: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.1809: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.1810: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1811: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.1812: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.1813: DFBPPR4502 ---- Plant proteins ---- Actin-depolymerizing factor 7
Source.1814: DFBPPR4504 ---- Plant proteins ---- 60S ribosomal protein L10-1
Source.1815: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.1816: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.1817: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.1818: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.1819: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.1820: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.1821: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.1822: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.1823: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.1824: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1825: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.1826: DFBPPR4530 ---- Plant proteins ---- Water stress-inducible protein Rab21
Source.1827: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1828: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.1829: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1830: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.1831: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1832: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.1833: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31
Source.1834: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.1835: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.1836: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.1837: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16
Source.1838: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.1839: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.1840: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.1841: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.1842: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.1843: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.1844: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.1845: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.1846: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.1847: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.1848: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.1849: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.1850: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.1851: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1852: DFBPPR4607 ---- Plant proteins ---- Protein LOL2
Source.1853: DFBPPR4610 ---- Plant proteins ---- Protein LOL3
Source.1854: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.1855: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.1856: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1857: DFBPPR4621 ---- Plant proteins ---- Actin-depolymerizing factor 6
Source.1858: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.1859: DFBPPR4625 ---- Plant proteins ---- Actin-depolymerizing factor 2
Source.1860: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.1861: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.1862: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.1863: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.1864: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.1865: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4
Source.1866: DFBPPR4642 ---- Plant proteins ---- Actin-depolymerizing factor 1
Source.1867: DFBPPR4644 ---- Plant proteins ---- Nuclear transport factor 2
Source.1868: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.1869: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.1870: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.1871: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.1872: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.1873: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.1874: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.1875: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.1876: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.1877: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1878: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.1879: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.1880: DFBPPR4683 ---- Plant proteins ---- DNA-binding protein S1FA2
Source.1881: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.1882: DFBPPR4687 ---- Plant proteins ---- Dehydrin Rab16D
Source.1883: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2
Source.1884: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.1885: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1
Source.1886: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.1887: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.1888: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.1889: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.1890: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1891: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.1892: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.1893: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.1894: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.1895: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.1896: DFBPPR4722 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 10
Source.1897: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.1898: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.1899: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.1900: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.1901: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.1902: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.1903: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.1904: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.1905: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1906: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.1907: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.1908: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.1909: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.1910: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.1911: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13
Source.1912: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.1913: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4
Source.1914: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.1915: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19
Source.1916: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.1917: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600
Source.1918: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.1919: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100
Source.1920: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.1921: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.1922: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.1923: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.1924: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.1925: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.1926: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.1927: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.1928: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1929: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1
Source.1930: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.1931: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800
Source.1932: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.1933: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.1934: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.1935: DFBPPR4854 ---- Plant proteins ---- Putative ripening-related protein 6
Source.1936: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500
Source.1937: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.1938: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900
Source.1939: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.1940: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.1941: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.1942: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.1943: DFBPPR4876 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 3
Source.1944: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.1945: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.1946: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.1947: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.1948: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4
Source.1949: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1950: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.1951: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1952: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1953: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.1954: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1955: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.1956: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1957: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.1958: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.1959: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.1960: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.1961: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.1962: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1963: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1964: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.1965: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.1966: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.1967: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1968: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic
Source.1969: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1970: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.1971: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.1972: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1973: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.1974: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.1975: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.1976: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1977: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.1978: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.1979: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.1980: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.1981: DFBPPR4980 ---- Plant proteins ---- Lactoylglutathione lyase
Source.1982: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.1983: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.1984: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.1985: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1986: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.1987: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.1988: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.1989: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease
Source.1990: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.1991: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.1992: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.1993: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.1994: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1995: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.1996: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1997: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.1998: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1999: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.2000: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.2001: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.2002: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2003: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1
Source.2004: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.2005: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.2006: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2007: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.2008: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.2009: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.2010: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2011: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2012: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.2013: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2014: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.2015: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.2016: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.2017: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.2018: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.2019: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.2020: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.2021: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.2022: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.2023: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2024: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2025: DFBPPR5091 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2026: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3
Source.2027: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.2028: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.2029: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.2030: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.2031: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.2032: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2033: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.2034: DFBPPR5105 ---- Plant proteins ---- Probable bifunctional TENA-E protein
Source.2035: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.2036: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.2037: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.2038: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.2039: DFBPPR5114 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.2040: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2041: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.2042: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.2043: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.2044: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.2045: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.2046: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2047: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.2048: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.2049: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.2050: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2051: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.2052: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase
Source.2053: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2054: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.2055: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2056: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.2057: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2058: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2059: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.2060: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.2061: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2062: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2063: DFBPPR5175 ---- Plant proteins ---- Polyubiquitin
Source.2064: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.2065: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.2066: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.2067: DFBPPR5187 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.2068: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2069: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.2070: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.2071: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2072: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.2073: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.2074: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2075: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.2076: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.2077: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.2078: DFBPPR5222 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.2079: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.2080: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.2081: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2082: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.2083: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.2084: DFBPPR5249 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.2085: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.2086: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.2087: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.2088: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.2089: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28
Source.2090: DFBPPR5272 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.2091: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.2092: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.2093: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.2094: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.2095: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6
Source.2096: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.2097: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2098: DFBPPR5293 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic
Source.2099: DFBPPR5296 ---- Plant proteins ---- 18 kDa seed maturation protein
Source.2100: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.2101: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1
Source.2102: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.2103: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2104: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.2105: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.2106: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1
Source.2107: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.2108: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2109: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2110: DFBPPR5347 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.2111: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11
Source.2112: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.2113: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.2114: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.2115: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.2116: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.2117: DFBPPR5385 ---- Plant proteins ---- Profilin-5
Source.2118: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2119: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.2120: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2121: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.2122: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.2123: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2124: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.2125: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.2126: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.2127: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.2128: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2129: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.2130: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2131: DFBPPR5401 ---- Plant proteins ---- Profilin-1
Source.2132: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.2133: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.2134: DFBPPR5407 ---- Plant proteins ---- Profilin-2
Source.2135: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.2136: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.2137: DFBPPR5410 ---- Plant proteins ---- Profilin-4
Source.2138: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.2139: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.2140: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.2141: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.2142: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1
Source.2143: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.2144: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.2145: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.2146: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.2147: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A
Source.2148: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.2149: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.2150: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.2151: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.2152: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.2153: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.2154: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2
Source.2155: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1
Source.2156: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.2157: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.2158: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.2159: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha
Source.2160: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.2161: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.2162: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.2163: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.2164: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.2165: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.2166: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.2167: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2168: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.2169: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic
Source.2170: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.2171: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.2172: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.2173: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.2174: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.2175: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2176: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.2177: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.2178: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.2179: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.2180: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.2181: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.2182: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.2183: DFBPPR5499 ---- Plant proteins ---- Dehydrin DHN1
Source.2184: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.2185: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.2186: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.2187: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.2188: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.2189: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2190: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.2191: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2192: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.2193: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.2194: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.2195: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.2196: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II
Source.2197: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1
Source.2198: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2199: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2200: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.2201: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.2202: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.2203: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.2204: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.2205: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.2206: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.2207: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.2208: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.2209: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.2210: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.2211: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2212: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.2213: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.2214: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.2215: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.2216: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.2217: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2218: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.2219: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.2220: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2221: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.2222: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.2223: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.2224: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.2225: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.2226: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.2227: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.2228: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.2229: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.2230: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.2231: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.2232: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.2233: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.2234: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.2235: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.2236: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.2237: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.2238: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.2239: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.2240: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.2241: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.2242: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.2243: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2244: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2245: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2246: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.2247: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.2248: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.2249: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2250: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.2251: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.2252: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.2253: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.2254: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.2255: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.2256: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.2257: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.2258: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.2259: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2260: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2261: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.2262: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.2263: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4
Source.2264: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.2265: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.2266: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.2267: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.2268: DFBPPR5689 ---- Plant proteins ---- Profilin-9
Source.2269: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.2270: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2271: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.2272: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.2273: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.2274: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2275: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.2276: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.2277: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.2278: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.2279: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.2280: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.2281: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.2282: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.2283: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2284: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2285: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.2286: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.2287: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.2288: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2289: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.2290: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.2291: DFBPPR5722 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.2292: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.2293: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2294: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.2295: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.2296: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.2297: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2298: DFBPPR5739 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR1
Source.2299: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.2300: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.2301: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.2302: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.2303: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.2304: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.2305: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.2306: DFBPPR5751 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein 2-B
Source.2307: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.2308: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.2309: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.2310: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2311: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2312: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.2313: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.2314: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.2315: DFBPPR5779 ---- Plant proteins ---- Protein BRICK1
Source.2316: DFBPPR5781 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR3
Source.2317: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2318: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.2319: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.2320: DFBPPR5794 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2
Source.2321: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2322: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.2323: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.2324: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.2325: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.2326: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF
Source.2327: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.2328: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2329: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a
Source.2330: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.2331: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.2332: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2333: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.2334: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1
Source.2335: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2336: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.2337: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.2338: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.2339: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.2340: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.2341: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.2342: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.2343: DFBPPR5837 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.2344: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.2345: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2346: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.2347: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.2348: DFBPPR5850 ---- Plant proteins ---- ATP synthase subunit epsilon, mitochondrial
Source.2349: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.2350: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.2351: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2352: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.2353: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.2354: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.2355: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.2356: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.2357: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2358: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2359: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.2360: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.2361: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.2362: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.2363: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B
Source.2364: DFBPPR5892 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.2365: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.2366: DFBPPR5898 ---- Plant proteins ---- ATP synthase protein MI25
Source.2367: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2368: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.2369: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.2370: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.2371: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.2372: DFBPPR5914 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase, variable chain
Source.2373: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.2374: DFBPPR5919 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic
Source.2375: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.2376: DFBPPR5933 ---- Plant proteins ---- Pathogenesis-related protein PRMS
Source.2377: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2378: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.2379: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.2380: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.2381: DFBPPR5944 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.2382: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.2383: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.2384: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.2385: DFBPPR5954 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.2386: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2
Source.2387: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.2388: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.2389: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein
Source.2390: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.2391: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.2392: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.2393: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.2394: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.2395: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.2396: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.2397: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.2398: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.2399: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.2400: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38
Source.2401: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.2402: DFBPPR6004 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.2403: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.2404: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2405: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.2406: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2407: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.2408: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2409: DFBPPR6031 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.2410: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.2411: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2
Source.2412: DFBPPR6052 ---- Plant proteins ---- Cystatin-1
Source.2413: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.2414: DFBPPR6056 ---- Plant proteins ---- Bowman-Birk type wound-induced proteinase inhibitor WIP1
Source.2415: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.2416: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.2417: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2
Source.2418: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.2419: DFBPPR6075 ---- Plant proteins ---- MFS18 protein
Source.2420: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.2421: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.2422: DFBPPR6087 ---- Plant proteins ---- 40S ribosomal protein S14
Source.2423: DFBPPR6090 ---- Plant proteins ---- 40S ribosomal protein S14
Source.2424: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.2425: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1
Source.2426: DFBPPR6099 ---- Plant proteins ---- CASP-like protein 16
Source.2427: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3
Source.2428: DFBPPR6103 ---- Plant proteins ---- 60S ribosomal protein L10
Source.2429: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.2430: DFBPPR6108 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 5
Source.2431: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1
Source.2432: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.2433: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.2434: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2435: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.2436: DFBPPR6129 ---- Plant proteins ---- DNA-binding protein S1FA
Source.2437: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.2438: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.2439: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2
Source.2440: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4
Source.2441: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.2442: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3
Source.2443: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid
Source.2444: DFBPPR6168 ---- Plant proteins ---- Late embryogenesis abundant protein, group 3
Source.2445: DFBPPR6169 ---- Plant proteins ---- Uncharacterized 2.5 kDa protein in tRNA-Arg-tRNA-Asn intergenic region
Source.2446: DFBPPR6172 ---- Plant proteins ---- Unknown protein from spot 207 of 2D-PAGE of etiolated coleoptile
Source.2447: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.2448: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase
Source.2449: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2450: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.2451: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.2452: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2453: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.2454: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.2455: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.2456: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.2457: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.2458: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.2459: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2460: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.2461: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.2462: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2463: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.2464: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.2465: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.2466: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.2467: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.2468: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.2469: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.2470: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2471: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.2472: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.2473: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2474: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.2475: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2476: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.2477: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta
Source.2478: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2479: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.2480: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2481: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.2482: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3
Source.2483: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2484: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.2485: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.2486: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.2487: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.2488: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.2489: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.2490: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2491: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.2492: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.2493: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F
Source.2494: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.2495: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.2496: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2497: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.2498: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.2499: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.2500: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.2501: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.2502: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.2503: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2504: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2505: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2506: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.2507: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2508: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2509: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D
Source.2510: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C
Source.2511: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.2512: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2513: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2514: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.2515: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2516: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.2517: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.2518: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.2519: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2520: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2521: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2522: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.2523: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2524: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic
Source.2525: DFBPPR6432 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.2526: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2527: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B
Source.2528: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A
Source.2529: DFBPPR6440 ---- Plant proteins ---- Cell division control protein 2 homolog 2
Source.2530: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.2531: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.2532: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.2533: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.2534: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.2535: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein
Source.2536: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a
Source.2537: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic
Source.2538: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.2539: DFBPPR6483 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.2540: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.2541: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.2542: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E
Source.2543: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.2544: DFBPPR6495 ---- Plant proteins ---- Leghemoglobin Lb120-34
Source.2545: DFBPPR6496 ---- Plant proteins ---- Leghemoglobin Lb120-1
Source.2546: DFBPPR6497 ---- Plant proteins ---- Leghemoglobin Lb120-8
Source.2547: DFBPPR6498 ---- Plant proteins ---- Leghemoglobin Lb120-29
Source.2548: DFBPPR6508 ---- Plant proteins ---- Polyubiquitin
Source.2549: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.2550: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.2551: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.2552: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2553: DFBPPR6548 ---- Plant proteins ---- Dehydrin DHN1
Source.2554: DFBPPR6549 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.2555: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.2556: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.2557: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.2558: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.2559: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.2560: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.2561: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.2562: DFBPPR6561 ---- Plant proteins ---- Blue copper protein
Source.2563: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2564: DFBPPR6621 ---- Plant proteins ---- Dehydrin DHN3
Source.2565: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2566: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.2567: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.2568: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.2569: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.2570: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.2571: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.2572: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2573: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.2574: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2575: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.2576: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.2577: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.2578: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.2579: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.2580: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.2581: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.2582: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.2583: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.2584: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.2585: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1
Source.2586: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.2587: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2
Source.2588: DFBPPR6661 ---- Plant proteins ---- Agglutinin isolectin 3
Source.2589: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.2590: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.2591: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.2592: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.2593: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.2594: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.2595: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.2596: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8
Source.2597: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.2598: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2599: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.2600: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.2601: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.2602: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.2603: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.2604: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.2605: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.2606: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2607: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G
Source.2608: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.2609: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.2610: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7
Source.2611: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.2612: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.2613: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.2614: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.2615: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.2616: DFBPPR6724 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.2617: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2618: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.2619: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2620: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.2621: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2622: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.2623: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.2624: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.2625: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2626: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.2627: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2628: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.2629: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2630: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.2631: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2632: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.2633: DFBPPR6761 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM1
Source.2634: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.2635: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.2636: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.2637: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2638: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.2639: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.2640: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2641: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2642: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.2643: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.2644: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2645: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.2646: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.2647: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.2648: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2649: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2650: DFBPPR6808 ---- Plant proteins ---- Profilin-2
Source.2651: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2652: DFBPPR6810 ---- Plant proteins ---- Profilin-1
Source.2653: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.2654: DFBPPR6813 ---- Plant proteins ---- Profilin-3
Source.2655: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.2656: DFBPPR6817 ---- Plant proteins ---- Phosphomannomutase
Source.2657: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.2658: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2659: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.2660: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.2661: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.2662: DFBPPR6829 ---- Plant proteins ---- Cold-shock protein CS120
Source.2663: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2664: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2665: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic
Source.2666: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2
Source.2667: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2668: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.2669: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2670: DFBPPR6848 ---- Plant proteins ---- Cold shock protein CS66
Source.2671: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2672: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2673: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic
Source.2674: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic
Source.2675: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.2676: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.2677: DFBPPR6866 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.2678: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.2679: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410
Source.2680: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.2681: DFBPPR6897 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.2682: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2683: DFBPPR6912 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.2684: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2685: DFBPPR6920 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic
Source.2686: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.2687: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.2688: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.2689: DFBPPR6956 ---- Plant proteins ---- Late embryogenesis abundant protein, group 3
Source.2690: DFBPPR6958 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.2691: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin
Source.2692: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.2693: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.2694: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.2695: DFBPPR6973 ---- Plant proteins ---- Avenin-like a6
Source.2696: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2697: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.2698: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.2699: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.2700: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.2701: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.2702: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.2703: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3
Source.2704: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.2705: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.2706: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.2707: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2708: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.2709: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.2710: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.2711: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.2712: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2713: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.2714: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2715: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.2716: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1
Source.2717: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.2718: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.2719: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.2720: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.2721: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2722: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.2723: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.2724: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.2725: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.2726: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.2727: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.2728: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.2729: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa
Source.2730: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.2731: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2732: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2733: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2734: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.2735: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2736: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2737: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.2738: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.2739: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2740: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.2741: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.2742: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2743: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.2744: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2745: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2746: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.2747: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.2748: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.2749: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.2750: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2751: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.2752: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2753: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.2754: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.2755: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2756: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.2757: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.2758: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.2759: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.2760: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.2761: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.2762: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2763: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.2764: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.2765: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.2766: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.2767: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.2768: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.2769: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.2770: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2771: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.2772: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.2773: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.2774: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.2775: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.2776: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.2777: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.2778: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.2779: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.2780: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.2781: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.2782: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2783: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.2784: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.2785: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.2786: DFBPPR7164 ---- Plant proteins ---- Probable non-specific lipid-transfer protein
Source.2787: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.2788: DFBPPR7168 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.2789: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.2790: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.2791: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2792: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2793: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.2794: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.2795: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin
Source.2796: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2797: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2798: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2799: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc
Source.2800: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2801: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.2802: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.2803: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2804: DFBPPR7207 ---- Plant proteins ---- Profilin-1
Source.2805: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.2806: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.2807: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.2808: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.2809: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.2810: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2811: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2812: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.2813: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.2814: DFBPPR7250 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.2815: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.2816: DFBPPR7257 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.2817: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.2818: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.2819: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3
Source.2820: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.2821: DFBPPR7274 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1B
Source.2822: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C
Source.2823: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2824: DFBPPR7287 ---- Plant proteins ---- Dehydrin DHN3
Source.2825: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4
Source.2826: DFBPPR7292 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic
Source.2827: DFBPPR7293 ---- Plant proteins ---- Cytochrome c oxidase subunit 5C
Source.2828: DFBPPR7294 ---- Plant proteins ---- Polyubiquitin
Source.2829: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2830: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.2831: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.2832: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.2833: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.2834: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.2835: DFBPPR7310 ---- Plant proteins ---- ABA-inducible protein PHV A1
Source.2836: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.2837: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2838: DFBPPR7327 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.2839: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1
Source.2840: DFBPPR7331 ---- Plant proteins ---- Dehydrin DHN2
Source.2841: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2
Source.2842: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.2843: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.2844: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.2845: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.2846: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor
Source.2847: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.2848: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.2849: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.2850: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.2851: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2852: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.2853: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.2854: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.2855: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.2856: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.2857: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6
Source.2858: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase
Source.2859: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.2860: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.2861: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.2862: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.2863: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.2864: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.2865: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.2866: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.2867: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.2868: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2869: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2870: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.2871: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.2872: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2
Source.2873: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2874: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.2875: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.2876: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.2877: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.2878: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.2879: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2880: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.2881: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.2882: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.2883: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2884: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.2885: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.2886: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.2887: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.2888: DFBPPR7494 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.2889: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.2890: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.2891: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.2892: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2893: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial
Source.2894: DFBPPR7522 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.2895: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2896: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.2897: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.2898: DFBPPR7534 ---- Plant proteins ---- Acyl-CoA-binding protein
Source.2899: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76
Source.2900: DFBPPR7542 ---- Plant proteins ---- 60S ribosomal protein L5, mitochondrial
Source.2901: DFBPPR7551 ---- Plant proteins ---- Protein BP4A
Source.2902: DFBPPR7552 ---- Plant proteins ---- Protein BP4C
Source.2903: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.2904: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.2905: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.2906: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.2907: DFBPPR7609 ---- Milk proteins ---- Lysozyme C
Source.2908: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.2909: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.2910: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.2911: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.2912: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.2913: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.2914: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.2915: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.2916: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.2917: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.2918: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.2919: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.2920: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.2921: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.2922: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.2923: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.2924: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.2925: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.2926: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.2927: DFBPPR7667 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.2928: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2
Source.2929: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.2930: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.2931: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2932: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.2933: DFBPPR7702 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.2934: DFBPPR7703 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.2935: DFBPPR7708 ---- Milk proteins ---- Late lactation protein B, LLP-B
Source.2936: DFBPPR7710 ---- Milk proteins ---- Beta-lactoglobulin, Beta-LG
Source.2937: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.2938: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.2939: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.2940: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.2941: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.2942: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.2943: DFBPPR7725 ---- Plant proteins ---- Avenin-3
Source.2944: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.2945: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2946: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.2947: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2948: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.2949: DFBPPR7732 ---- Plant proteins ---- Plasma membrane ATPase
Source.2950: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.2951: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.2952: DFBPPR7739 ---- Plant proteins ---- Avenin-E
Source.2953: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.2954: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2955: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.2956: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.2957: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.2958: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.2959: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1
Source.2960: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.2961: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.2962: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.2963: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.2964: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.2965: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2966: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2967: DFBPPR8359 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2968: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.2969: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.2970: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2971: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.2972: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.2973: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.2974: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1
Source.2975: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2976: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2977: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2
Source.2978: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2979: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.2980: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6
Source.2981: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.2982: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.2983: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.2984: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2985: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2986: DFBPPR8468 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2987: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.2988: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.2989: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.2990: DFBPPR8481 ---- Plant proteins ---- Granule-bound starch synthase 1
Source.2991: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.2992: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.2993: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.2994: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.2995: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.2996: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.2997: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.2998: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.2999: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.3000: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.3001: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2
Source.3002: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor
Source.3003: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.3004: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.3005: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein
Source.3006: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.3007: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.3008: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.3009: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.3010: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.3011: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3012: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.3013: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.3014: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3015: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.3016: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.3017: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.3018: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.3019: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3020: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.3021: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.3022: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.3023: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.3024: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase
Source.3025: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.3026: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.3027: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.3028: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.3029: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.3030: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3031: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.3032: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.3033: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3034: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3035: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3036: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3037: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3038: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.3039: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.3040: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3041: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.3042: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.3043: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.3044: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3045: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3046: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.3047: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.3048: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.3049: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3050: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.3051: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.3052: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3053: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3054: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.3055: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.3056: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.3057: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.3058: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3059: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.3060: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.3061: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.3062: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.3063: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.3064: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.3065: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.3066: DFBPPR16065 ---- Animal proteins ---- Caspase-3
Source.3067: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3068: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.3069: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3070: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.3071: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.3072: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.3073: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.3074: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.3075: DFBPPR16093 ---- Animal proteins ---- Menin
Source.3076: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.3077: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.3078: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.3079: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.3080: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.3081: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3082: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.3083: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.3084: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3085: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.3086: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.3087: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.3088: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.3089: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.3090: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.3091: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.3092: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.3093: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.3094: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3095: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.3096: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.3097: DFBPPR16139 ---- Animal proteins ---- Lipocalin Can f 6.0101
Source.3098: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.3099: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.3100: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.3101: DFBPPR16148 ---- Animal proteins ---- Haptoglobin
Source.3102: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.3103: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3104: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.3105: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.3106: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta
Source.3107: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.3108: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.3109: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.3110: DFBPPR16166 ---- Animal proteins ---- Ras-related protein Rab-12
Source.3111: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.3112: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.3113: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.3114: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.3115: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.3116: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.3117: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.3118: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.3119: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.3120: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3121: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.3122: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.3123: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.3124: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3125: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.3126: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.3127: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.3128: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.3129: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3130: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.3131: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.3132: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3133: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.3134: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.3135: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.3136: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.3137: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.3138: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.3139: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.3140: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.3141: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.3142: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3143: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.3144: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3145: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain
Source.3146: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.3147: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.3148: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.3149: DFBPPR16258 ---- Animal proteins ---- Decorin
Source.3150: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.3151: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.3152: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.3153: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.3154: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.3155: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.3156: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.3157: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3158: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.3159: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3160: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.3161: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.3162: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3163: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.3164: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2
Source.3165: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.3166: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3167: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.3168: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.3169: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.3170: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.3171: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.3172: DFBPPR16325 ---- Animal proteins ---- Peripherin-2
Source.3173: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.3174: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.3175: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.3176: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.3177: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.3178: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.3179: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.3180: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.3181: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.3182: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.3183: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3184: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.3185: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.3186: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.3187: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.3188: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.3189: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.3190: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.3191: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.3192: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.3193: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3194: DFBPPR16469 ---- Animal proteins ---- Lysozyme C, milk isozyme
Source.3195: DFBPPR16475 ---- Animal proteins ---- Transmembrane protein 258
Source.3196: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.3197: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.3198: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.3199: DFBPPR16483 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.3200: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.3201: DFBPPR16487 ---- Animal proteins ---- Claudin-2
Source.3202: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.3203: DFBPPR16490 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.3204: DFBPPR16494 ---- Animal proteins ---- C-C motif chemokine 25
Source.3205: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.3206: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.3207: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.3208: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.3209: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.3210: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.3211: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.3212: DFBPPR16520 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.3213: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.3214: DFBPPR16524 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.3215: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.3216: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.3217: DFBPPR16531 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.3218: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.3219: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.3220: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3221: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.3222: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83
Source.3223: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3224: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.3225: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.3226: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.3227: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.3228: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.3229: DFBPPR16570 ---- Animal proteins ---- V-type proton ATPase subunit G 1
Source.3230: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan
Source.3231: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3232: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.3233: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3234: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.3235: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3236: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.3237: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.3238: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.3239: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.3240: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.3241: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.3242: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.3243: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.3244: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.3245: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.3246: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3247: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.3248: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3249: DFBPPR16638 ---- Animal proteins ---- Synapsin-1
Source.3250: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.3251: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.3252: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3253: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1
Source.3254: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.3255: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.3256: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2
Source.3257: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3
Source.3258: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.3259: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.3260: DFBPPR16704 ---- Animal proteins ---- Retbindin
Source.3261: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.3262: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.3263: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.3264: DFBPPR16721 ---- Animal proteins ---- Testin
Source.3265: DFBPPR16722 ---- Animal proteins ---- Ig heavy chain V region MOO
Source.3266: DFBPPR16733 ---- Animal proteins ---- 40S ribosomal protein S17
Source.3267: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.3268: DFBPPR16747 ---- Animal proteins ---- Pleckstrin
Source.3269: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.3270: DFBPPR16755 ---- Animal proteins ---- Glyoxalase domain-containing protein 5
Source.3271: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.3272: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.3273: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.3274: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.3275: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.3276: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.3277: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3278: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3279: DFBPPR16788 ---- Animal proteins ---- Alpha-crystallin A chain
Source.3280: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.3281: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.3282: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.3283: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3284: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.3285: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.3286: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.3287: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.3288: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.3289: DFBPPR16816 ---- Animal proteins ---- Decorin
Source.3290: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3291: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta
Source.3292: DFBPPR16826 ---- Animal proteins ---- Phospholipase A2
Source.3293: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3294: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.3295: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6
Source.3296: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.3297: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.3298: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.3299: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.3300: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.3301: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.3302: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.3303: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.3304: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.3305: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.3306: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3307: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3308: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3309: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial
Source.3310: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3311: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.3312: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.3313: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.3314: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain
Source.3315: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.3316: DFBPPR16905 ---- Animal proteins ---- Fatty acid-binding protein 5
Source.3317: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3318: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3319: DFBPPR16917 ---- Animal proteins ---- Polyubiquitin-B
Source.3320: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.3321: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.3322: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.3323: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3324: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.3325: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3326: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.3327: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3328: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.3329: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.3330: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.3331: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.3332: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3333: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3334: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.3335: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.3336: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3337: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.3338: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.3339: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.3340: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.3341: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.3342: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.3343: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3344: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.3345: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.3346: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3347: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.3348: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.3349: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.3350: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.3351: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.3352: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3353: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.3354: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.3355: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.3356: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.3357: DFBPPR17014 ---- Animal proteins ---- Microtubule-associated proteins 1A/1B light chain 3B
Source.3358: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3359: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3360: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.3361: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.3362: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3363: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3364: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.3365: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.3366: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.3367: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta
Source.3368: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.3369: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.3370: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.3371: DFBPPR17055 ---- Animal proteins ---- Phospholipase A2, membrane associated
Source.3372: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.3373: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.3374: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.3375: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.3376: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.3377: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.3378: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.3379: DFBPPR17067 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.3380: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.3381: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.3382: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.3383: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.3384: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.3385: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.3386: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.3387: DFBPPR17090 ---- Animal proteins ---- Phakinin
Source.3388: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.3389: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.3390: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3391: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.3392: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.3393: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.3394: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.3395: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.3396: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.3397: DFBPPR17116 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.3398: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.3399: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2
Source.3400: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.3401: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3402: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.3403: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3404: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3405: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.3406: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.3407: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3408: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3409: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.3410: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.3411: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1
Source.3412: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1
Source.3413: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1
Source.3414: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.3415: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.3416: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.3417: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.3418: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.3419: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.3420: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.3421: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.3422: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6
Source.3423: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3424: DFBPPR17192 ---- Animal proteins ---- Kit ligand
Source.3425: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.3426: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.3427: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.3428: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.3429: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.3430: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.3431: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.3432: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.3433: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.3434: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.3435: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.3436: DFBPPR17274 ---- Animal proteins ---- U8 snoRNA-decapping enzyme
Source.3437: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.3438: DFBPPR17276 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.3439: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.3440: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.3441: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.3442: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3443: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.3444: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.3445: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.3446: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.3447: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.3448: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.3449: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.3450: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.3451: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.3452: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.3453: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.3454: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.3455: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.3456: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.3457: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.3458: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.3459: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.3460: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.3461: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.3462: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.3463: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.3464: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3465: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3466: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.3467: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.3468: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.3469: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.3470: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.3471: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3472: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3473: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.3474: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.3475: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.3476: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.3477: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1
Source.3478: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.3479: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.3480: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.3481: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.3482: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.3483: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.3484: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.3485: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3486: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.3487: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.3488: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.3489: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.3490: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.3491: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.3492: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.3493: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.3494: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.3495: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.3496: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.3497: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.3498: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.3499: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.3500: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.3501: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.3502: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.3503: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.3504: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.3505: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.3506: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.3507: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.3508: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.3509: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.3510: DFBPPR17420 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.3511: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.3512: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.3513: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.3514: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.3515: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3516: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.3517: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.3518: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.3519: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.3520: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.3521: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.3522: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.3523: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.3524: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3525: DFBPPR17454 ---- Animal proteins ---- Peripherin-2
Source.3526: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.3527: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.3528: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.3529: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.3530: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3531: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.3532: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.3533: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.3534: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.3535: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.3536: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3537: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.3538: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.3539: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.3540: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.3541: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.3542: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.3543: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.3544: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.3545: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.3546: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.3547: DFBPPR17504 ---- Animal proteins ---- Duodenase-1
Source.3548: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3549: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b
Source.3550: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.3551: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.3552: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.3553: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3554: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.3555: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.3556: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.3557: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3558: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1
Source.3559: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.3560: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.3561: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.3562: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.3563: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.3564: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3565: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.3566: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.3567: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.3568: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.3569: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.3570: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.3571: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.3572: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.3573: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.3574: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.3575: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.3576: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.3577: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.3578: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.3579: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.3580: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.3581: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.3582: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.3583: DFBPPR17580 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5
Source.3584: DFBPPR17586 ---- Animal proteins ---- Dermatopontin
Source.3585: DFBPPR17588 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.3586: DFBPPR17594 ---- Animal proteins ---- E-selectin
Source.3587: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3588: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.3589: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.3590: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.3591: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3592: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1
Source.3593: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.3594: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.3595: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.3596: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.3597: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.3598: DFBPPR17646 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial
Source.3599: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.3600: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.3601: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.3602: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.3603: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.3604: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.3605: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta
Source.3606: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.3607: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.3608: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.3609: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.3610: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.3611: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.3612: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.3613: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B
Source.3614: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.3615: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.3616: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.3617: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.3618: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.3619: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.3620: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3621: DFBPPR17749 ---- Animal proteins ---- CD9 antigen
Source.3622: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.3623: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4
Source.3624: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.3625: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.3626: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.3627: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.3628: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.3629: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.3630: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.3631: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.3632: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.3633: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.3634: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.3635: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.3636: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.3637: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.3638: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.3639: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.3640: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.3641: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.3642: DFBPPR17809 ---- Animal proteins ---- Polyubiquitin-C
Source.3643: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.3644: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.3645: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3646: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.3647: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.3648: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.3649: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3650: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.3651: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.3652: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3
Source.3653: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.3654: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.3655: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.3656: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3
Source.3657: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3658: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.3659: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3660: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.3661: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.3662: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.3663: DFBPPR17868 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma
Source.3664: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.3665: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.3666: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.3667: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.3668: DFBPPR17877 ---- Animal proteins ---- Syntaxin-7
Source.3669: DFBPPR17879 ---- Animal proteins ---- Menin
Source.3670: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1
Source.3671: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.3672: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor
Source.3673: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.3674: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.3675: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.3676: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.3677: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3678: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.3679: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3680: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.3681: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.3682: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.3683: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.3684: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.3685: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.3686: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.3687: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial
Source.3688: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.3689: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.3690: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.3691: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.3692: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.3693: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.3694: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.3695: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.3696: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.3697: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.3698: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.3699: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.3700: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9
Source.3701: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.3702: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.3703: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.3704: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.3705: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.3706: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.3707: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.3708: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG
Source.3709: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.3710: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.3711: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.3712: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.3713: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.3714: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.3715: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.3716: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3
Source.3717: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.3718: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.3719: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.3720: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3721: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.3722: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.3723: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.3724: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.3725: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3726: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.3727: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.3728: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.3729: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.3730: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.3731: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.3732: DFBPPR18025 ---- Animal proteins ---- Small ubiquitin-related modifier 1
Source.3733: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.3734: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3735: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain
Source.3736: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.3737: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2
Source.3738: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.3739: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.3740: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.3741: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.3742: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.3743: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3744: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3745: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T
Source.3746: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.3747: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.3748: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.3749: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.3750: DFBPPR18071 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte
Source.3751: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.3752: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.3753: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.3754: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.3755: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.3756: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.3757: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.3758: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.3759: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3760: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.3761: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.3762: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.3763: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.3764: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.3765: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.3766: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.3767: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.3768: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3769: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3770: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.3771: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.3772: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.3773: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.3774: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.3775: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.3776: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.3777: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.3778: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.3779: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.3780: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.3781: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.3782: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.3783: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.3784: DFBPPR18168 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 W
Source.3785: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B
Source.3786: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A
Source.3787: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.3788: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.3789: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.3790: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.3791: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3792: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3793: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.3794: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.3795: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.3796: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.3797: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4
Source.3798: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.3799: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta
Source.3800: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.3801: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.3802: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.3803: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40
Source.3804: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.3805: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.3806: DFBPPR18232 ---- Animal proteins ---- Ragulator complex protein LAMTOR1
Source.3807: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.3808: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.3809: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.3810: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.3811: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a
Source.3812: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.3813: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.3814: DFBPPR18254 ---- Animal proteins ---- C-type lectin domain family 6 member A
Source.3815: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.3816: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.3817: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.3818: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.3819: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.3820: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.3821: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.3822: DFBPPR18274 ---- Animal proteins ---- Histone deacetylase 8
Source.3823: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial
Source.3824: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.3825: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.3826: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.3827: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3828: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.3829: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.3830: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.3831: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.3832: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.3833: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.3834: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7
Source.3835: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.3836: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.3837: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.3838: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.3839: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.3840: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.3841: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.3842: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.3843: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.3844: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.3845: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.3846: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.3847: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.3848: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.3849: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.3850: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.3851: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.3852: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3853: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.3854: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.3855: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.3856: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.3857: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.3858: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.3859: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.3860: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.3861: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.3862: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.3863: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.3864: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.3865: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.3866: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.3867: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.3868: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.3869: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.3870: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.3871: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.3872: DFBPPR18427 ---- Animal proteins ---- Cystatin-C
Source.3873: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.3874: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.3875: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3876: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.3877: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.3878: DFBPPR18451 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.3879: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.3880: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.3881: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.3882: DFBPPR18458 ---- Animal proteins ---- Fatty acid-binding protein, liver
Source.3883: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.3884: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.3885: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.3886: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.3887: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.3888: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.3889: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.3890: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.3891: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.3892: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.3893: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.3894: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.3895: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.3896: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3
Source.3897: DFBPPR18490 ---- Animal proteins ---- N-terminal Xaa-Pro-Lys N-methyltransferase 1
Source.3898: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.3899: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.3900: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.3901: DFBPPR18501 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.3902: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.3903: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.3904: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.3905: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5
Source.3906: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.3907: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1
Source.3908: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.3909: DFBPPR18526 ---- Animal proteins ---- Beta-defensin 4
Source.3910: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.3911: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.3912: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.3913: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.3914: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.3915: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.3916: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.3917: DFBPPR18544 ---- Animal proteins ---- ATP synthase subunit e, mitochondrial
Source.3918: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.3919: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.3920: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.3921: DFBPPR18563 ---- Animal proteins ---- Collectin-43
Source.3922: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.3923: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.3924: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.3925: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.3926: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.3927: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6
Source.3928: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.3929: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.3930: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2
Source.3931: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.3932: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.3933: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3934: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.3935: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.3936: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.3937: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3938: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.3939: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.3940: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase
Source.3941: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.3942: DFBPPR18632 ---- Animal proteins ---- Syntaxin-4
Source.3943: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.3944: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.3945: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.3946: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.3947: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.3948: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.3949: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.3950: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.3951: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.3952: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.3953: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.3954: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.3955: DFBPPR18705 ---- Animal proteins ---- Small nuclear ribonucleoprotein G
Source.3956: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.3957: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.3958: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.3959: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.3960: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3961: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.3962: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.3963: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial
Source.3964: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.3965: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.3966: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.3967: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.3968: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.3969: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.3970: DFBPPR18746 ---- Animal proteins ---- Anamorsin
Source.3971: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.3972: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.3973: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.3974: DFBPPR18769 ---- Animal proteins ---- Histone H3.3C
Source.3975: DFBPPR18770 ---- Animal proteins ---- Small nuclear ribonucleoprotein F
Source.3976: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.3977: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.3978: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.3979: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.3980: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.3981: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.3982: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.3983: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C
Source.3984: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.3985: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.3986: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A
Source.3987: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.3988: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.3989: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.3990: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.3991: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.3992: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.3993: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.3994: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.3995: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.3996: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.3997: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.3998: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.3999: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.4000: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.4001: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.4002: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.4003: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.4004: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.4005: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15
Source.4006: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.4007: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.4008: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.4009: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.4010: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.4011: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.4012: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.4013: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.4014: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.4015: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.4016: DFBPPR18873 ---- Animal proteins ---- Proteasome subunit beta type-3
Source.4017: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.4018: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.4019: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.4020: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.4021: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.4022: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.4023: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.4024: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.4025: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2
Source.4026: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.4027: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.4028: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.4029: DFBPPR18898 ---- Animal proteins ---- Complexin-3
Source.4030: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.4031: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.4032: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.4033: DFBPPR18908 ---- Animal proteins ---- Proteasome subunit alpha type-6
Source.4034: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1
Source.4035: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.4036: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.4037: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.4038: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.4039: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.4040: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.4041: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.4042: DFBPPR18920 ---- Animal proteins ---- Profilin-1
Source.4043: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.4044: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.4045: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.4046: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.4047: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.4048: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.4049: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.4050: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.4051: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.4052: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1
Source.4053: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.4054: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.4055: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.4056: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.4057: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.4058: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.4059: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.4060: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.4061: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.4062: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein
Source.4063: DFBPPR18972 ---- Animal proteins ---- Lysozyme-like protein 6
Source.4064: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.4065: DFBPPR18977 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 1
Source.4066: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.4067: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.4068: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.4069: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1
Source.4070: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.4071: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.4072: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.4073: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.4074: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.4075: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19
Source.4076: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.4077: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.4078: DFBPPR19023 ---- Animal proteins ---- Cellular nucleic acid-binding protein
Source.4079: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.4080: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.4081: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.4082: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.4083: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.4084: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.4085: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.4086: DFBPPR19046 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 1
Source.4087: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.4088: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.4089: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial
Source.4090: DFBPPR19059 ---- Animal proteins ---- Lysozyme C, non-stomach isozyme
Source.4091: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.4092: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.4093: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.4094: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.4095: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.4096: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.4097: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.4098: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.4099: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.4100: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.4101: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.4102: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.4103: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.4104: DFBPPR19099 ---- Animal proteins ---- Dr1-associated corepressor
Source.4105: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.4106: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.4107: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1
Source.4108: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.4109: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.4110: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.4111: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.4112: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.4113: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.4114: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.4115: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.4116: DFBPPR19139 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2
Source.4117: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11
Source.4118: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.4119: DFBPPR19148 ---- Animal proteins ---- Ribonuclease 4
Source.4120: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.4121: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.4122: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.4123: DFBPPR19165 ---- Animal proteins ---- Tropomyosin beta chain
Source.4124: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.4125: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma
Source.4126: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.4127: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.4128: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4129: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain
Source.4130: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.4131: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.4132: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.4133: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.4134: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.4135: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.4136: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.4137: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.4138: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.4139: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.4140: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.4141: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.4142: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.4143: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha
Source.4144: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.4145: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.4146: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.4147: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.4148: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.4149: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.4150: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.4151: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.4152: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.4153: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.4154: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.4155: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.4156: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.4157: DFBPPR19262 ---- Animal proteins ---- Spermatid nuclear transition protein 1
Source.4158: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.4159: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.4160: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.4161: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.4162: DFBPPR19273 ---- Animal proteins ---- Protein BEX3
Source.4163: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.4164: DFBPPR19278 ---- Animal proteins ---- R-spondin-3
Source.4165: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.4166: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.4167: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.4168: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.4169: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7
Source.4170: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.4171: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.4172: DFBPPR19304 ---- Animal proteins ---- Retinal cone rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma
Source.4173: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.4174: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.4175: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.4176: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.4177: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.4178: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.4179: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.4180: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.4181: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.4182: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.4183: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.4184: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.4185: DFBPPR19332 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.4186: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.4187: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.4188: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.4189: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.4190: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.4191: DFBPPR19342 ---- Animal proteins ---- Calcium load-activated calcium channel
Source.4192: DFBPPR19343 ---- Animal proteins ---- Interferon alpha-inducible protein 6
Source.4193: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.4194: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.4195: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.4196: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.4197: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.4198: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.4199: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.4200: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.4201: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.4202: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.4203: DFBPPR19383 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 1
Source.4204: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.4205: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.4206: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.4207: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.4208: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.4209: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.4210: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.4211: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog
Source.4212: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.4213: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.4214: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.4215: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.4216: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.4217: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.4218: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2
Source.4219: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.4220: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.4221: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.4222: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.4223: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.4224: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.4225: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.4226: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.4227: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.4228: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.4229: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.4230: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4
Source.4231: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.4232: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2
Source.4233: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.4234: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.4235: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.4236: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.4237: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.4238: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.4239: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.4240: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.4241: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.4242: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.4243: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.4244: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.4245: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.4246: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5
Source.4247: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N
Source.4248: DFBPPR19508 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 2
Source.4249: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.4250: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.4251: DFBPPR19514 ---- Animal proteins ---- tRNA (cytosine(38)-C(5))-methyltransferase
Source.4252: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.4253: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.4254: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.4255: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.4256: DFBPPR19530 ---- Animal proteins ---- Tuftelin
Source.4257: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.4258: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.4259: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.4260: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.4261: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase
Source.4262: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.4263: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.4264: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.4265: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.4266: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.4267: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.4268: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.4269: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.4270: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.4271: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.4272: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.4273: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.4274: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.4275: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.4276: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.4277: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.4278: DFBPPR19590 ---- Animal proteins ---- Norrin
Source.4279: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.4280: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.4281: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.4282: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.4283: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.4284: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.4285: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.4286: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.4287: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.4288: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.4289: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.4290: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.4291: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.4292: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.4293: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.4294: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.4295: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B
Source.4296: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.4297: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.4298: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial
Source.4299: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.4300: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.4301: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.4302: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.4303: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.4304: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.4305: DFBPPR19671 ---- Animal proteins ---- C-X-C motif chemokine 9
Source.4306: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.4307: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.4308: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.4309: DFBPPR19678 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 5
Source.4310: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.4311: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3
Source.4312: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.4313: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.4314: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.4315: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7
Source.4316: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.4317: DFBPPR19702 ---- Animal proteins ---- Placental prolactin-related protein 4
Source.4318: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.4319: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.4320: DFBPPR19707 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.4321: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.4322: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.4323: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.4324: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.4325: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.4326: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.4327: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2
Source.4328: DFBPPR19734 ---- Animal proteins ---- CDC42 small effector protein 2
Source.4329: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.4330: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.4331: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.4332: DFBPPR19745 ---- Animal proteins ---- Collectin-46
Source.4333: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.4334: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.4335: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein
Source.4336: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase
Source.4337: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.4338: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.4339: DFBPPR19758 ---- Animal proteins ---- MICOS complex subunit MIC25
Source.4340: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.4341: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.4342: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.4343: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.4344: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.4345: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.4346: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.4347: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.4348: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.4349: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.4350: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.4351: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2
Source.4352: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2
Source.4353: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.4354: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.4355: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.4356: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.4357: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.4358: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.4359: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.4360: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.4361: DFBPPR19828 ---- Animal proteins ---- Transmembrane protein 14C
Source.4362: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.4363: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.4364: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.4365: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.4366: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.4367: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.4368: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.4369: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.4370: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.4371: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.4372: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.4373: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC
Source.4374: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.4375: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.4376: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.4377: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.4378: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.4379: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.4380: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.4381: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8
Source.4382: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.4383: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.4384: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.4385: DFBPPR19893 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.4386: DFBPPR19894 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.4387: DFBPPR19895 ---- Animal proteins ---- 39S ribosomal protein L24, mitochondrial
Source.4388: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.4389: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30
Source.4390: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.4391: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.4392: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.4393: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.4394: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.4395: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.4396: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.4397: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.4398: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.4399: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.4400: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.4401: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial
Source.4402: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.4403: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.4404: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.4405: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.4406: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.4407: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.4408: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.4409: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.4410: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.4411: DFBPPR19956 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.4412: DFBPPR19958 ---- Animal proteins ---- 60S ribosomal protein L10
Source.4413: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B
Source.4414: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.4415: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.4416: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.4417: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1
Source.4418: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.4419: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.4420: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.4421: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.4422: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.4423: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.4424: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.4425: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein
Source.4426: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.4427: DFBPPR19995 ---- Animal proteins ---- 39S ribosomal protein L55, mitochondrial
Source.4428: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1
Source.4429: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.4430: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.4431: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit
Source.4432: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1
Source.4433: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.4434: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.4435: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.4436: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.4437: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.4438: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.4439: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.4440: DFBPPR20030 ---- Animal proteins ---- Calumenin
Source.4441: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.4442: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.4443: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.4444: DFBPPR20044 ---- Animal proteins ---- Secernin-1
Source.4445: DFBPPR20045 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 2, mitochondrial
Source.4446: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.4447: DFBPPR20051 ---- Animal proteins ---- 28S ribosomal protein S18a, mitochondrial
Source.4448: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.4449: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.4450: DFBPPR20057 ---- Animal proteins ---- AP-3 complex subunit sigma-1
Source.4451: DFBPPR20067 ---- Animal proteins ---- Glutaredoxin-2, mitochondrial
Source.4452: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.4453: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2
Source.4454: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.4455: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.4456: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1
Source.4457: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1
Source.4458: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.4459: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O
Source.4460: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial
Source.4461: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.4462: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.4463: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.4464: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.4465: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4466: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.4467: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.4468: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.4469: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.4470: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.4471: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.4472: DFBPPR20139 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm4
Source.4473: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.4474: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.4475: DFBPPR20143 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.4476: DFBPPR20144 ---- Animal proteins ---- Destrin
Source.4477: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.4478: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.4479: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.4480: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.4481: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.4482: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.4483: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.4484: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.4485: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.4486: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.4487: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.4488: DFBPPR20189 ---- Animal proteins ---- Protein disulfide isomerase CRELD2
Source.4489: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.4490: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.4491: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.4492: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.4493: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.4494: DFBPPR20203 ---- Animal proteins ---- Calcitonin
Source.4495: DFBPPR20204 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.4496: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.4497: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1
Source.4498: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.4499: DFBPPR20215 ---- Animal proteins ---- Caspase-3
Source.4500: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9
Source.4501: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.4502: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2
Source.4503: DFBPPR20225 ---- Animal proteins ---- Claudin-2
Source.4504: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.4505: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.4506: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.4507: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.4508: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.4509: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.4510: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.4511: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.4512: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53
Source.4513: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.4514: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog
Source.4515: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.4516: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial
Source.4517: DFBPPR20262 ---- Animal proteins ---- DNA-directed RNA polymerase I subunit RPA12
Source.4518: DFBPPR20264 ---- Animal proteins ---- AP-3 complex subunit sigma-2
Source.4519: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.4520: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4521: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.4522: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.4523: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.4524: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.4525: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6
Source.4526: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4
Source.4527: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.4528: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.4529: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.4530: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.4531: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.4532: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.4533: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.4534: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan
Source.4535: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B
Source.4536: DFBPPR20312 ---- Animal proteins ---- 39S ribosomal protein L52, mitochondrial
Source.4537: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3
Source.4538: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.4539: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.4540: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.4541: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.4542: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.4543: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4544: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial
Source.4545: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.4546: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.4547: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.4548: DFBPPR20348 ---- Animal proteins ---- V-type proton ATPase subunit F
Source.4549: DFBPPR20350 ---- Animal proteins ---- Pinin
Source.4550: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase
Source.4551: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.4552: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.4553: DFBPPR20369 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1
Source.4554: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.4555: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.4556: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.4557: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.4558: DFBPPR20383 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 7, mitochondrial
Source.4559: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.4560: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.4561: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.4562: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.4563: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.4564: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.4565: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.4566: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.4567: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2
Source.4568: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.4569: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.4570: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.4571: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.4572: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.4573: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.4574: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.4575: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.4576: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.4577: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4
Source.4578: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.4579: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.4580: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.4581: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.4582: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.4583: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.4584: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.4585: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.4586: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.4587: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.4588: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.4589: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.4590: DFBPPR20476 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.4591: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.4592: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.4593: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan
Source.4594: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.4595: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.4596: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.4597: DFBPPR20506 ---- Animal proteins ---- Akirin-2
Source.4598: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.4599: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.4600: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2
Source.4601: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.4602: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.4603: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.4604: DFBPPR20522 ---- Animal proteins ---- Serine palmitoyltransferase small subunit A
Source.4605: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.4606: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.4607: DFBPPR20528 ---- Animal proteins ---- Thiamin pyrophosphokinase 1
Source.4608: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.4609: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.4610: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.4611: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.4612: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.4613: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.4614: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.4615: DFBPPR20557 ---- Animal proteins ---- Asporin
Source.4616: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.4617: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26
Source.4618: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.4619: DFBPPR20567 ---- Animal proteins ---- Prokineticin-2
Source.4620: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.4621: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.4622: DFBPPR20580 ---- Animal proteins ---- BET1-like protein
Source.4623: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.4624: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.4625: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.4626: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.4627: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.4628: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.4629: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.4630: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.4631: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.4632: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.4633: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.4634: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.4635: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.4636: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.4637: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.4638: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.4639: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.4640: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3
Source.4641: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.4642: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.4643: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C
Source.4644: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47
Source.4645: DFBPPR20634 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.4646: DFBPPR20635 ---- Animal proteins ---- Transcription elongation factor A protein 1
Source.4647: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.4648: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.4649: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog
Source.4650: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.4651: DFBPPR20651 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 2, mitochondrial
Source.4652: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1
Source.4653: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.4654: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.4655: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.4656: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2
Source.4657: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.4658: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.4659: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.4660: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.4661: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.4662: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.4663: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.4664: DFBPPR20679 ---- Animal proteins ---- Ragulator complex protein LAMTOR4
Source.4665: DFBPPR20682 ---- Animal proteins ---- 26S proteasome regulatory subunit 10B
Source.4666: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.4667: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.4668: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog
Source.4669: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.4670: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.4671: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta
Source.4672: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.4673: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.4674: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.4675: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.4676: DFBPPR20725 ---- Animal proteins ---- RBPJ-interacting and tubulin-associated protein 1
Source.4677: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.4678: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.4679: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.4680: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.4681: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B
Source.4682: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1
Source.4683: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.4684: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.4685: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.4686: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.4687: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.4688: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.4689: DFBPPR20768 ---- Animal proteins ---- Lysozyme-like protein 1
Source.4690: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.4691: DFBPPR20774 ---- Animal proteins ---- Ankyrin repeat family A protein 2
Source.4692: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.4693: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.4694: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.4695: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.4696: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.4697: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.4698: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.4699: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.4700: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.4701: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.4702: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.4703: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.4704: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.4705: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1
Source.4706: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.4707: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2
Source.4708: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.4709: DFBPPR20824 ---- Animal proteins ---- CD151 antigen
Source.4710: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.4711: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.4712: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.4713: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.4714: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.4715: DFBPPR20841 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.4716: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein
Source.4717: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.4718: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.4719: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.4720: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.4721: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase
Source.4722: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase
Source.4723: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.4724: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.4725: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.4726: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.4727: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.4728: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.4729: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3
Source.4730: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.4731: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.4732: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.4733: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.4734: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.4735: DFBPPR20894 ---- Animal proteins ---- THAP domain-containing protein 11
Source.4736: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.4737: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B
Source.4738: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12
Source.4739: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.4740: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.4741: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143
Source.4742: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.4743: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.4744: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2
Source.4745: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.4746: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.4747: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.4748: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.4749: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.4750: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.4751: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.4752: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.4753: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.4754: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18
Source.4755: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.4756: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.4757: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.4758: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.4759: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.4760: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9
Source.4761: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.4762: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.4763: DFBPPR20964 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP2
Source.4764: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.4765: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.4766: DFBPPR20969 ---- Animal proteins ---- Sperm acrosome-associated protein 5
Source.4767: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.4768: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.4769: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.4770: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.4771: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.4772: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.4773: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial
Source.4774: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.4775: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.4776: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.4777: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.4778: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.4779: DFBPPR21014 ---- Animal proteins ---- Transmembrane protein 258
Source.4780: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.4781: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.4782: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.4783: DFBPPR21026 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog
Source.4784: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.4785: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.4786: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.4787: DFBPPR21032 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 2
Source.4788: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.4789: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.4790: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.4791: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.4792: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.4793: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.4794: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.4795: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.4796: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.4797: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog
Source.4798: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.4799: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.4800: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22
Source.4801: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.4802: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.4803: DFBPPR21092 ---- Animal proteins ---- Calponin-1
Source.4804: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.4805: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.4806: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.4807: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.4808: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.4809: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.4810: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.4811: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.4812: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.4813: DFBPPR21117 ---- Animal proteins ---- Spindlin-2
Source.4814: DFBPPR21118 ---- Animal proteins ---- NADH-cytochrome b5 reductase 1
Source.4815: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.4816: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.4817: DFBPPR21128 ---- Animal proteins ---- Stefin-C
Source.4818: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.4819: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7
Source.4820: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B
Source.4821: DFBPPR21137 ---- Animal proteins ---- Thioredoxin domain-containing protein 12
Source.4822: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.4823: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.4824: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.4825: DFBPPR21153 ---- Animal proteins ---- Resistin
Source.4826: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor
Source.4827: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.4828: DFBPPR21165 ---- Animal proteins ---- Protein canopy homolog 3
Source.4829: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.4830: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.4831: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.4832: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7
Source.4833: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.4834: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.4835: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24
Source.4836: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.4837: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.4838: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.4839: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4
Source.4840: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.4841: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4
Source.4842: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.4843: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.4844: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.4845: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.4846: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.4847: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.4848: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.4849: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2
Source.4850: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.4851: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.4852: DFBPPR21239 ---- Animal proteins ---- Coordinator of PRMT5 and differentiation stimulator
Source.4853: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.4854: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.4855: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.4856: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.4857: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog
Source.4858: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.4859: DFBPPR21272 ---- Animal proteins ---- Testin
Source.4860: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.4861: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.4862: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.4863: DFBPPR21286 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM7 homolog
Source.4864: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.4865: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.4866: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.4867: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.4868: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.4869: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.4870: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.4871: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3
Source.4872: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.4873: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.4874: DFBPPR21336 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.4875: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.4876: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.4877: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.4878: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.4879: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.4880: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.4881: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.4882: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.4883: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.4884: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.4885: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.4886: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.4887: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.4888: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.4889: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.4890: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.4891: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.4892: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial
Source.4893: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A
Source.4894: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2
Source.4895: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.4896: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.4897: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.4898: DFBPPR21414 ---- Animal proteins ---- Neuromedin-B
Source.4899: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.4900: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.4901: DFBPPR21426 ---- Animal proteins ---- ORM1-like protein 3
Source.4902: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.4903: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5
Source.4904: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.4905: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2
Source.4906: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.4907: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A
Source.4908: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.4909: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.4910: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.4911: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.4912: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.4913: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.4914: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.4915: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.4916: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.4917: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1
Source.4918: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.4919: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.4920: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.4921: DFBPPR21510 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.4922: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.4923: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20
Source.4924: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2
Source.4925: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1
Source.4926: DFBPPR21525 ---- Animal proteins ---- AN1-type zinc finger protein 6
Source.4927: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.4928: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.4929: DFBPPR21531 ---- Animal proteins ---- 60S ribosomal protein L13
Source.4930: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.4931: DFBPPR21548 ---- Animal proteins ---- Cornifelin
Source.4932: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.4933: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.4934: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.4935: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.4936: DFBPPR21564 ---- Animal proteins ---- HORMA domain-containing protein 2
Source.4937: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3
Source.4938: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.4939: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.4940: DFBPPR21578 ---- Animal proteins ---- Calcium-binding protein 5
Source.4941: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4942: DFBPPR21588 ---- Animal proteins ---- Diazepam-binding inhibitor-like 5
Source.4943: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10
Source.4944: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.4945: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2
Source.4946: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1
Source.4947: DFBPPR21604 ---- Animal proteins ---- Zinc finger protein 345
Source.4948: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.4949: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.4950: DFBPPR21620 ---- Animal proteins ---- Claudin-12
Source.4951: DFBPPR21625 ---- Animal proteins ---- 40S ribosomal protein S24
Source.4952: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.4953: DFBPPR21639 ---- Animal proteins ---- Elongator complex protein 4
Source.4954: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.4955: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.4956: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.4957: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2
Source.4958: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.4959: DFBPPR21676 ---- Animal proteins ---- ER membrane protein complex subunit 6
Source.4960: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.4961: DFBPPR21687 ---- Animal proteins ---- Ropporin-1-like protein
Source.4962: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.4963: DFBPPR21699 ---- Animal proteins ---- Transmembrane protein 208
Source.4964: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.4965: DFBPPR21702 ---- Animal proteins ---- Rhombotin-2
Source.4966: DFBPPR21703 ---- Animal proteins ---- RRP15-like protein
Source.4967: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23
Source.4968: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.4969: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.4970: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.4971: DFBPPR21719 ---- Animal proteins ---- Protein reprimo
Source.4972: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2
Source.4973: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.4974: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.4975: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.4976: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A
Source.4977: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.4978: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.4979: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.4980: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.4981: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.4982: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.4983: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.4984: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6
Source.4985: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.4986: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.4987: DFBPPR21762 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 28
Source.4988: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2
Source.4989: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12
Source.4990: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.4991: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.4992: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.4993: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.4994: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.4995: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.4996: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.4997: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.4998: DFBPPR21782 ---- Animal proteins ---- Surfactant-associated protein 2
Source.4999: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.5000: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2
Source.5001: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.5002: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.5003: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.5004: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.5005: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.5006: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.5007: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.5008: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1
Source.5009: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.5010: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.5011: DFBPPR21848 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 39
Source.5012: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.5013: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.5014: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.5015: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.5016: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.5017: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.5018: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.5019: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.5020: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.5021: DFBPPR21880 ---- Animal proteins ---- Zinc finger protein 22
Source.5022: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.5023: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.5024: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.5025: DFBPPR21899 ---- Animal proteins ---- Gametocyte-specific factor 1
Source.5026: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.5027: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.5028: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.5029: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.5030: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1
Source.5031: DFBPPR21912 ---- Animal proteins ---- Death-associated protein 1
Source.5032: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.5033: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4
Source.5034: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2
Source.5035: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.5036: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14
Source.5037: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.5038: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.5039: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.5040: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.5041: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.5042: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.5043: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.5044: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.5045: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1
Source.5046: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.5047: DFBPPR21957 ---- Animal proteins ---- LIM domain transcription factor LMO4
Source.5048: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.5049: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.5050: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.5051: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.5052: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6
Source.5053: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.5054: DFBPPR22004 ---- Animal proteins ---- 60S ribosomal protein L35a
Source.5055: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81
Source.5056: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.5057: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.5058: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.5059: DFBPPR22022 ---- Animal proteins ---- SRA stem-loop-interacting RNA-binding protein, mitochondrial
Source.5060: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.5061: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.5062: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.5063: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.5064: DFBPPR22033 ---- Animal proteins ---- FXYD domain-containing ion transport regulator 7
Source.5065: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.5066: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.5067: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.5068: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.5069: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.5070: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.5071: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1
Source.5072: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.5073: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.5074: DFBPPR22062 ---- Animal proteins ---- Protein FAM72A
Source.5075: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.5076: DFBPPR22065 ---- Animal proteins ---- 60S ribosomal protein L10-like
Source.5077: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein
Source.5078: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.5079: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.5080: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein
Source.5081: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.5082: DFBPPR22086 ---- Animal proteins ---- Trafficking protein particle complex subunit 1
Source.5083: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.5084: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.5085: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.5086: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.5087: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.5088: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog
Source.5089: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.5090: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.5091: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.5092: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.5093: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B
Source.5094: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2
Source.5095: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.5096: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.5097: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.5098: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.5099: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.5100: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.5101: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.5102: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.5103: DFBPPR22200 ---- Animal proteins ---- Profilin-4
Source.5104: DFBPPR22201 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1
Source.5105: DFBPPR22206 ---- Animal proteins ---- Promotilin
Source.5106: DFBPPR22212 ---- Animal proteins ---- Protein Asterix
Source.5107: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.5108: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.5109: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.5110: DFBPPR22221 ---- Animal proteins ---- Ubiquitin-like protein 5
Source.5111: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.5112: DFBPPR22223 ---- Animal proteins ---- Calretinin
Source.5113: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2
Source.5114: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.5115: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.5116: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.5117: DFBPPR22242 ---- Animal proteins ---- Neuropeptide S
Source.5118: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.5119: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.5120: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1
Source.5121: DFBPPR22266 ---- Animal proteins ---- Vexin
Source.5122: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.5123: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17
Source.5124: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.5125: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.5126: DFBPPR22280 ---- Animal proteins ---- 60S ribosomal protein L27a
Source.5127: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2
Source.5128: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.5129: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.5130: DFBPPR22293 ---- Animal proteins ---- Nutritionally-regulated adipose and cardiac-enriched protein homolog
Source.5131: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.5132: DFBPPR22295 ---- Animal proteins ---- Protein PROCA1
Source.5133: DFBPPR22298 ---- Animal proteins ---- 40S ribosomal protein S17
Source.5134: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.5135: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.5136: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.5137: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.5138: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.5139: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.5140: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1
Source.5141: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.5142: DFBPPR22338 ---- Animal proteins ---- Probable cystatin-16
Source.5143: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.5144: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.5145: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.5146: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.5147: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.5148: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.5149: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.5150: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.5151: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.5152: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.5153: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.5154: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.5155: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2
Source.5156: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.5157: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.5158: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein
Source.5159: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.5160: DFBPPR22380 ---- Animal proteins ---- G patch domain-containing protein 4
Source.5161: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.5162: DFBPPR22386 ---- Animal proteins ---- DPY30 domain-containing protein 2
Source.5163: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.5164: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.5165: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.5166: DFBPPR22399 ---- Animal proteins ---- Transgelin-3
Source.5167: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1
Source.5168: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.5169: DFBPPR22411 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 2
Source.5170: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog
Source.5171: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3
Source.5172: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B
Source.5173: DFBPPR22436 ---- Animal proteins ---- Transmembrane protein 263
Source.5174: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.5175: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.5176: DFBPPR22443 ---- Animal proteins ---- Stromal cell-derived factor 2
Source.5177: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11
Source.5178: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.5179: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.5180: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97
Source.5181: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.5182: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.5183: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog
Source.5184: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.5185: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.5186: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1
Source.5187: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.5188: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.5189: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.5190: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.5191: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183
Source.5192: DFBPPR22505 ---- Animal proteins ---- Protein HP-20 homolog
Source.5193: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.5194: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234
Source.5195: DFBPPR22514 ---- Animal proteins ---- Transmembrane protein 205
Source.5196: DFBPPR22518 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 4-like 2
Source.5197: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2
Source.5198: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.5199: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.5200: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.5201: DFBPPR22533 ---- Animal proteins ---- Coiled-coil domain-containing protein 160
Source.5202: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.5203: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.5204: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.5205: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.5206: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1
Source.5207: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1
Source.5208: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.5209: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.5210: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.5211: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.5212: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.5213: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171
Source.5214: DFBPPR22590 ---- Animal proteins ---- Transmembrane protein 267
Source.5215: DFBPPR22599 ---- Animal proteins ---- Tetratricopeptide repeat protein 9C
Source.5216: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.5217: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.5218: DFBPPR22612 ---- Animal proteins ---- Glutamate-rich protein 5
Source.5219: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.5220: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.5221: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.5222: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.5223: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.5224: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157
Source.5225: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.5226: DFBPPR22646 ---- Animal proteins ---- Coiled-coil domain-containing protein 184
Source.5227: DFBPPR22656 ---- Animal proteins ---- Putative coiled-coil domain-containing protein 196
Source.5228: DFBPPR22666 ---- Animal proteins ---- Uncharacterized protein C12orf50 homolog
Source.5229: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.5230: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.5231: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.5232: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.5233: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.5234: DFBPPR22687 ---- Animal proteins ---- Putative UPF0730 protein encoded by LINC00643 homolog
Source.5235: DFBPPR22695 ---- Animal proteins ---- MORN repeat-containing protein 5
Source.5236: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8
Source.5237: DFBPPR22704 ---- Animal proteins ---- Uncharacterized protein C17orf64 homolog
Source.5238: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.5239: DFBPPR22708 ---- Animal proteins ---- Pregnancy-associated protein bPAP
Source.5240: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.5241: DFBPPR22723 ---- Animal proteins ---- Testis-expressed protein 43
Source.5242: DFBPPR22731 ---- Animal proteins ---- Uncharacterized protein C12orf54 homolog
Source.5243: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.5244: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.5245: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.5246: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.5247: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.5248: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.5249: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.5250: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.5251: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.5252: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.5253: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.5254: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.5255: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.5256: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.5257: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.5258: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.5259: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.5260: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.5261: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.5262: DFBPPR8553 ---- Animal proteins ---- Protein AMBP
Source.5263: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.5264: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.5265: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.5266: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.5267: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.5268: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.5269: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.5270: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.5271: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5272: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.5273: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.5274: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.5275: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.5276: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.5277: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.5278: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase
Source.5279: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.5280: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.5281: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.5282: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.5283: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.5284: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.5285: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.5286: DFBPPR8607 ---- Animal proteins ---- Prolactin
Source.5287: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.5288: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6
Source.5289: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.5290: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.5291: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.5292: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5293: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.5294: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.5295: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.5296: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.5297: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.5298: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.5299: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.5300: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.5301: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.5302: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.5303: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.5304: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.5305: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.5306: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.5307: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.5308: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.5309: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.5310: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.5311: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.5312: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.5313: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.5314: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.5315: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.5316: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.5317: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.5318: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.5319: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.5320: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.5321: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.5322: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.5323: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.5324: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.5325: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.5326: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.5327: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.5328: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.5329: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.5330: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.5331: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.5332: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.5333: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.5334: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.5335: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.5336: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.5337: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.5338: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.5339: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.5340: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.5341: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9
Source.5342: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.5343: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.5344: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.5345: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.5346: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.5347: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.5348: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.5349: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.5350: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.5351: DFBPPR8760 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.5352: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.5353: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.5354: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1
Source.5355: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5356: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.5357: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.5358: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.5359: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.5360: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.5361: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.5362: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.5363: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.5364: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.5365: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.5366: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.5367: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.5368: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.5369: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.5370: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.5371: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.5372: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.5373: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.5374: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.5375: DFBPPR8803 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte
Source.5376: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.5377: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.5378: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.5379: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.5380: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.5381: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.5382: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.5383: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.5384: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.5385: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.5386: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.5387: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.5388: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.5389: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.5390: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.5391: DFBPPR8859 ---- Animal proteins ---- Interleukin-1 alpha
Source.5392: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.5393: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.5394: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.5395: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.5396: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.5397: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.5398: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.5399: DFBPPR8879 ---- Animal proteins ---- Glandular kallikrein
Source.5400: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.5401: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.5402: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.5403: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.5404: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.5405: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.5406: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.5407: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.5408: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.5409: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.5410: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.5411: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.5412: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.5413: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.5414: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.5415: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.5416: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.5417: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.5418: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.5419: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.5420: DFBPPR8941 ---- Animal proteins ---- Small ubiquitin-related modifier 1
Source.5421: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.5422: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.5423: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.5424: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.5425: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.5426: DFBPPR8973 ---- Animal proteins ---- Caspase-3
Source.5427: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.5428: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.5429: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.5430: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.5431: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.5432: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.5433: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.5434: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.5435: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.5436: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.5437: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.5438: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.5439: DFBPPR9017 ---- Animal proteins ---- Mannose-binding protein C
Source.5440: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.5441: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.5442: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.5443: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.5444: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.5445: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.5446: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.5447: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.5448: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.5449: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.5450: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.5451: DFBPPR9045 ---- Animal proteins ---- Ferritin heavy chain
Source.5452: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3
Source.5453: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.5454: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.5455: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain
Source.5456: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.5457: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.5458: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.5459: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.5460: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.5461: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.5462: DFBPPR9072 ---- Animal proteins ---- CD9 antigen
Source.5463: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5464: DFBPPR9076 ---- Animal proteins ---- Histone H1t
Source.5465: DFBPPR9077 ---- Animal proteins ---- Lysozyme C-2
Source.5466: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.5467: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.5468: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.5469: DFBPPR9099 ---- Animal proteins ---- Lysozyme C-3
Source.5470: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.5471: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.5472: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.5473: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.5474: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.5475: DFBPPR9106 ---- Animal proteins ---- Polyubiquitin-C
Source.5476: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.5477: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.5478: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.5479: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.5480: DFBPPR9123 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.5481: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.5482: DFBPPR9129 ---- Animal proteins ---- Spermatid nuclear transition protein 1
Source.5483: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.5484: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.5485: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5486: DFBPPR9143 ---- Animal proteins ---- NKG2-D type II integral membrane protein
Source.5487: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.5488: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.5489: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.5490: DFBPPR9158 ---- Animal proteins ---- Interferon-stimulated gene 20 kDa protein
Source.5491: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.5492: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.5493: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.5494: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.5495: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.5496: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.5497: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5498: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.5499: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.5500: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.5501: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.5502: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.5503: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.5504: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D
Source.5505: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.5506: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.5507: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.5508: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.5509: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.5510: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.5511: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.5512: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.5513: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.5514: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.5515: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C
Source.5516: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.5517: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.5518: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.5519: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.5520: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.5521: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.5522: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.5523: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.5524: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.5525: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.5526: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.5527: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.5528: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.5529: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.5530: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.5531: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.5532: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.5533: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.5534: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.5535: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.5536: DFBPPR9285 ---- Animal proteins ---- Saposin-B-Val
Source.5537: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.5538: DFBPPR9291 ---- Animal proteins ---- Lysozyme C-1
Source.5539: DFBPPR9293 ---- Animal proteins ---- Calcium load-activated calcium channel
Source.5540: DFBPPR9294 ---- Animal proteins ---- 60S ribosomal protein L10
Source.5541: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.5542: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.5543: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.5544: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.5545: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.5546: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.5547: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.5548: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.5549: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.5550: DFBPPR9311 ---- Animal proteins ---- Beta-defensin 1
Source.5551: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.5552: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.5553: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.5554: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.5555: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.5556: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.5557: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.5558: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.5559: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.5560: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.5561: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.5562: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.5563: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.5564: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.5565: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.5566: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.5567: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.5568: DFBPPR9366 ---- Animal proteins ---- Decorin
Source.5569: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.5570: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.5571: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.5572: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.5573: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.5574: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon
Source.5575: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.5576: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.5577: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.5578: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.5579: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.5580: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.5581: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.5582: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.5583: DFBPPR9408 ---- Animal proteins ---- CD70 antigen
Source.5584: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.5585: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.5586: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.5587: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.5588: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.5589: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.5590: DFBPPR9422 ---- Animal proteins ---- C-C motif chemokine 25
Source.5591: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.5592: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.5593: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.5594: DFBPPR9444 ---- Animal proteins ---- Calcitonin gene-related peptide
Source.5595: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.5596: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.5597: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.5598: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.5599: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.5600: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.5601: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.5602: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.5603: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.5604: DFBPPR9485 ---- Animal proteins ---- Destrin
Source.5605: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.5606: DFBPPR9496 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.5607: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.5608: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.5609: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.5610: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.5611: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.5612: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.5613: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.5614: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain
Source.5615: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.5616: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.5617: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.5618: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.5619: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1
Source.5620: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.5621: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.5622: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.5623: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.5624: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.5625: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.5626: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.5627: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.5628: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.5629: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.5630: DFBPPR9555 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.5631: DFBPPR9556 ---- Animal proteins ---- N(4)-(Beta-N-acetylglucosaminyl)-L-asparaginase
Source.5632: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.5633: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.5634: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.5635: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.5636: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.5637: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.5638: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.5639: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.5640: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.5641: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.5642: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.5643: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.5644: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.5645: DFBPPR9622 ---- Animal proteins ---- Calcitonin
Source.5646: DFBPPR9628 ---- Animal proteins ---- Mineralocorticoid receptor
Source.5647: DFBPPR9630 ---- Animal proteins ---- Calponin-1
Source.5648: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.5649: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.5650: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase
Source.5651: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.5652: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.5653: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.5654: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.5655: DFBPPR9665 ---- Animal proteins ---- 60S ribosomal protein L21
Source.5656: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.5657: DFBPPR9668 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.5658: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.5659: DFBPPR9683 ---- Animal proteins ---- Calpastatin
Source.5660: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.5661: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2
Source.5662: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.5663: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.5664: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.5665: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.5666: DFBPPR9708 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.5667: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.5668: DFBPPR9713 ---- Animal proteins ---- Hepcidin
Source.5669: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.5670: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.5671: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.5672: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.5673: DFBPPR9722 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog
Source.5674: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.5675: DFBPPR9730 ---- Animal proteins ---- Urotensin-2
Source.5676: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.5677: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.5678: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B
Source.5679: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.5680: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2
Source.5681: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.5682: DFBPPR9768 ---- Animal proteins ---- Protein canopy homolog 3
Source.5683: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.5684: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.5685: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.5686: DFBPPR9787 ---- Animal proteins ---- V-type proton ATPase subunit G 2
Source.5687: DFBPPR9795 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5
Source.5688: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.5689: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.5690: DFBPPR9802 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM7 homolog
Source.5691: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.5692: DFBPPR9814 ---- Animal proteins ---- Testin
Source.5693: DFBPPR9817 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 3
Source.5694: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.5695: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.5696: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.5697: DFBPPR9829 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.5698: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.5699: DFBPPR9833 ---- Animal proteins ---- Acetyl-CoA acetyltransferase
Source.5700: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1
Source.5701: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.5702: DFBPPR9843 ---- Animal proteins ---- P protein
Source.5703: DFBPPR9855 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.5704: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.5705: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.5706: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.5707: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2
Source.5708: DFBPPR9870 ---- Animal proteins ---- 40S ribosomal protein S17
Source.5709: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.5710: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.5711: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.5712: DFBPPR9885 ---- Animal proteins ---- B-cell CLL/lymphoma 9 protein
Source.5713: DFBPPR9892 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog
Source.5714: DFBPPR9901 ---- Animal proteins ---- 40S ribosomal protein S14
Source.5715: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.5716: DFBPPR9911 ---- Animal proteins ---- Protein Asterix
Source.5717: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.5718: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin
Source.5719: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.5720: DFBPPR9929 ---- Animal proteins ---- Tuftelin
Source.5721: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1
Source.5722: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.5723: DFBPPR9944 ---- Animal proteins ---- 60S ribosomal protein L27a
Source.5724: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.5725: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.5726: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.5727: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.5728: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.5729: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.5730: DFBPPR9965 ---- Animal proteins ---- Lysozyme C
Source.5731: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.5732: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.5733: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.5734: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.5735: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.5736: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.5737: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.5738: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.5739: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.5740: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.5741: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.5742: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.5743: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.5744: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.5745: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.5746: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.5747: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.5748: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.5749: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.5750: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.5751: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.5752: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.5753: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.5754: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.5755: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.5756: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.5757: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.5758: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.5759: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.5760: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.5761: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.5762: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.5763: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.5764: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.5765: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.5766: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.5767: DFBPPR10053 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.5768: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.5769: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.5770: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.5771: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.5772: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6
Source.5773: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.5774: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.5775: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.5776: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.5777: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.5778: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.5779: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.5780: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.5781: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.5782: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.5783: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.5784: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.5785: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5786: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.5787: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.5788: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.5789: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.5790: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.5791: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.5792: DFBPPR10108 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase
Source.5793: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.5794: DFBPPR10113 ---- Animal proteins ---- Cysteine and glycine-rich protein 1
Source.5795: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.5796: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.5797: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.5798: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.5799: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.5800: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.5801: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.5802: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.5803: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.5804: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.5805: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.5806: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.5807: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.5808: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5809: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.5810: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.5811: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.5812: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.5813: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.5814: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.5815: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.5816: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.5817: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.5818: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.5819: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.5820: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.5821: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.5822: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.5823: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.5824: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.5825: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3
Source.5826: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.5827: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.5828: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.5829: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.5830: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.5831: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.5832: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.5833: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.5834: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.5835: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.5836: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.5837: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.5838: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.5839: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.5840: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.5841: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.5842: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.5843: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.5844: DFBPPR10217 ---- Animal proteins ---- Follistatin
Source.5845: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.5846: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.5847: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.5848: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.5849: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.5850: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.5851: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.5852: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.5853: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.5854: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.5855: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.5856: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.5857: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.5858: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.5859: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.5860: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1
Source.5861: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.5862: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein
Source.5863: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.5864: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.5865: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.5866: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.5867: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.5868: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.5869: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.5870: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.5871: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.5872: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.5873: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.5874: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.5875: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.5876: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.5877: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.5878: DFBPPR10276 ---- Animal proteins ---- Adapter molecule crk
Source.5879: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.5880: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.5881: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.5882: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.5883: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.5884: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.5885: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5886: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.5887: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.5888: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.5889: DFBPPR10298 ---- Animal proteins ---- Caldesmon
Source.5890: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.5891: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.5892: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.5893: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.5894: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.5895: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.5896: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.5897: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.5898: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.5899: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.5900: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.5901: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.5902: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.5903: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.5904: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.5905: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.5906: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.5907: DFBPPR10326 ---- Animal proteins ---- Alpha-crystallin A chain
Source.5908: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.5909: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.5910: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.5911: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5912: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.5913: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.5914: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.5915: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.5916: DFBPPR10346 ---- Animal proteins ---- Polyubiquitin-B
Source.5917: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.5918: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.5919: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.5920: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.5921: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.5922: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.5923: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.5924: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.5925: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.5926: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.5927: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.5928: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.5929: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.5930: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.5931: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.5932: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.5933: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.5934: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.5935: DFBPPR10391 ---- Animal proteins ---- Annexin A5
Source.5936: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.5937: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.5938: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.5939: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.5940: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.5941: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.5942: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.5943: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.5944: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.5945: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.5946: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.5947: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.5948: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.5949: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.5950: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.5951: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.5952: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.5953: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.5954: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.5955: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.5956: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.5957: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.5958: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.5959: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.5960: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.5961: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.5962: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.5963: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.5964: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.5965: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.5966: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.5967: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.5968: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.5969: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.5970: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.5971: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.5972: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.5973: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.5974: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.5975: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.5976: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.5977: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.5978: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.5979: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.5980: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.5981: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.5982: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.5983: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.5984: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.5985: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.5986: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.5987: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.5988: DFBPPR10509 ---- Animal proteins ---- Calponin-1
Source.5989: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.5990: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.5991: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.5992: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.5993: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.5994: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.5995: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta
Source.5996: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.5997: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.5998: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.5999: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.6000: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.6001: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog
Source.6002: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.6003: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.6004: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.6005: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.6006: DFBPPR10549 ---- Animal proteins ---- Interferon type B
Source.6007: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.6008: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.6009: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1
Source.6010: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.6011: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.6012: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.6013: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.6014: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.6015: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.6016: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.6017: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.6018: DFBPPR10563 ---- Animal proteins ---- Optineurin
Source.6019: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.6020: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.6021: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.6022: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.6023: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.6024: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.6025: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.6026: DFBPPR10586 ---- Animal proteins ---- Troponin I, fast skeletal muscle
Source.6027: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.6028: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.6029: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.6030: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.6031: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.6032: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B
Source.6033: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.6034: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.6035: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.6036: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.6037: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.6038: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.6039: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.6040: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.6041: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.6042: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.6043: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.6044: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6
Source.6045: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.6046: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.6047: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.6048: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.6049: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.6050: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.6051: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.6052: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.6053: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.6054: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.6055: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.6056: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.6057: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.6058: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.6059: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.6060: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.6061: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.6062: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.6063: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.6064: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.6065: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.6066: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.6067: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.6068: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.6069: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.6070: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.6071: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a
Source.6072: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.6073: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.6074: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.6075: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.6076: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.6077: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.6078: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.6079: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.6080: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.6081: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.6082: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.6083: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.6084: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.6085: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.6086: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.6087: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.6088: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A
Source.6089: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.6090: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.6091: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6092: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.6093: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.6094: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.6095: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.6096: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.6097: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.6098: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.6099: DFBPPR10756 ---- Animal proteins ---- Ferritin heavy chain
Source.6100: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.6101: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.6102: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6103: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.6104: DFBPPR10779 ---- Animal proteins ---- Natriuretic peptides A
Source.6105: DFBPPR10780 ---- Animal proteins ---- Caspase-2
Source.6106: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.6107: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2
Source.6108: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.6109: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.6110: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.6111: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.6112: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.6113: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.6114: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.6115: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.6116: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.6117: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.6118: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.6119: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.6120: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.6121: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.6122: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.6123: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.6124: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.6125: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.6126: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.6127: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.6128: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.6129: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain
Source.6130: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.6131: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.6132: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.6133: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1
Source.6134: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.6135: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.6136: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.6137: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.6138: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.6139: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.6140: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.6141: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.6142: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.6143: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.6144: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.6145: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.6146: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.6147: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.6148: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.6149: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.6150: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.6151: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.6152: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.6153: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.6154: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.6155: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.6156: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.6157: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.6158: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.6159: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.6160: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.6161: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.6162: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.6163: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.6164: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.6165: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.6166: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.6167: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.6168: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.6169: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.6170: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.6171: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.6172: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.6173: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.6174: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.6175: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.6176: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.6177: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.6178: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.6179: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.6180: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.6181: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.6182: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.6183: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.6184: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.6185: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.6186: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.6187: DFBPPR10952 ---- Animal proteins ---- Protein XRP2
Source.6188: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2
Source.6189: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.6190: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.6191: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.6192: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.6193: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.6194: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.6195: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.6196: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.6197: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.6198: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.6199: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.6200: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.6201: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.6202: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.6203: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.6204: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.6205: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.6206: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.6207: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.6208: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.6209: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.6210: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.6211: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.6212: DFBPPR11000 ---- Animal proteins ---- Tropomyosin beta chain
Source.6213: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.6214: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.6215: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.6216: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.6217: DFBPPR11011 ---- Animal proteins ---- Epigen
Source.6218: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.6219: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.6220: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1
Source.6221: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.6222: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.6223: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.6224: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.6225: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.6226: DFBPPR11031 ---- Animal proteins ---- Ribonuclease homolog
Source.6227: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.6228: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.6229: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.6230: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.6231: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.6232: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.6233: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.6234: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.6235: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.6236: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.6237: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.6238: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.6239: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.6240: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.6241: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.6242: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.6243: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.6244: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6245: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.6246: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.6247: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.6248: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.6249: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.6250: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.6251: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.6252: DFBPPR11092 ---- Animal proteins ---- Ataxin-3
Source.6253: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.6254: DFBPPR11098 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.6255: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.6256: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.6257: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.6258: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.6259: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.6260: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.6261: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.6262: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.6263: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.6264: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.6265: DFBPPR11137 ---- Animal proteins ---- Small ubiquitin-related modifier 1
Source.6266: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.6267: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.6268: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.6269: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.6270: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.6271: DFBPPR11160 ---- Animal proteins ---- 16 kDa beta-galactoside-binding lectin
Source.6272: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.6273: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.6274: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.6275: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.6276: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.6277: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.6278: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.6279: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.6280: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.6281: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.6282: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.6283: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.6284: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.6285: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.6286: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.6287: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.6288: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.6289: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.6290: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.6291: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.6292: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.6293: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.6294: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.6295: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.6296: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.6297: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.6298: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.6299: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.6300: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.6301: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.6302: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.6303: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.6304: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.6305: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.6306: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.6307: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3
Source.6308: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.6309: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.6310: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.6311: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.6312: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.6313: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.6314: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.6315: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.6316: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2
Source.6317: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.6318: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.6319: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.6320: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.6321: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.6322: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.6323: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.6324: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.6325: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.6326: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.6327: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.6328: DFBPPR11306 ---- Animal proteins ---- Transcription factor 15
Source.6329: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.6330: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.6331: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.6332: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.6333: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.6334: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.6335: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.6336: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.6337: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.6338: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.6339: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.6340: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.6341: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.6342: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.6343: DFBPPR11355 ---- Animal proteins ---- Collectin-10
Source.6344: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.6345: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.6346: DFBPPR11364 ---- Animal proteins ---- Interleukin-18
Source.6347: DFBPPR11371 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.6348: DFBPPR11373 ---- Animal proteins ---- Decorin
Source.6349: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.6350: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.6351: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.6352: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.6353: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.6354: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.6355: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6356: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.6357: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.6358: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.6359: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.6360: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.6361: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.6362: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.6363: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.6364: DFBPPR11412 ---- Animal proteins ---- Hyaluronan synthase 3
Source.6365: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.6366: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.6367: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.6368: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.6369: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.6370: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.6371: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.6372: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.6373: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6374: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.6375: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.6376: DFBPPR11447 ---- Animal proteins ---- Translationally-controlled tumor protein homolog
Source.6377: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.6378: DFBPPR11455 ---- Animal proteins ---- Growth factor receptor-bound protein 2
Source.6379: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.6380: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.6381: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.6382: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.6383: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.6384: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.6385: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.6386: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.6387: DFBPPR11484 ---- Animal proteins ---- Prolactin
Source.6388: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.6389: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.6390: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.6391: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.6392: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.6393: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X
Source.6394: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.6395: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.6396: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.6397: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.6398: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.6399: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.6400: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.6401: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.6402: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12
Source.6403: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.6404: DFBPPR11549 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.6405: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.6406: DFBPPR11552 ---- Animal proteins ---- RecQ-mediated genome instability protein 2
Source.6407: DFBPPR11554 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.6408: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.6409: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.6410: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.6411: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.6412: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.6413: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.6414: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.6415: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.6416: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.6417: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.6418: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.6419: DFBPPR11597 ---- Animal proteins ---- Trypsin inhibitor ClTI-1
Source.6420: DFBPPR11598 ---- Animal proteins ---- Cellular nucleic acid-binding protein
Source.6421: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.6422: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.6423: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13
Source.6424: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.6425: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6426: DFBPPR11613 ---- Animal proteins ---- Transmembrane protein 258
Source.6427: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.6428: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6429: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.6430: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.6431: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.6432: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.6433: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.6434: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.6435: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.6436: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.6437: DFBPPR11648 ---- Animal proteins ---- Mineralocorticoid receptor
Source.6438: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.6439: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6440: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10
Source.6441: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.6442: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.6443: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog
Source.6444: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein
Source.6445: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.6446: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.6447: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.6448: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.6449: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1
Source.6450: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.6451: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.6452: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.6453: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.6454: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.6455: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.6456: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.6457: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.6458: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.6459: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.6460: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.6461: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.6462: DFBPPR11725 ---- Animal proteins ---- D-dopachrome decarboxylase
Source.6463: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.6464: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.6465: DFBPPR11734 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.6466: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.6467: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.6468: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.6469: DFBPPR11741 ---- Animal proteins ---- Parvalbumin, thymic CPV3
Source.6470: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.6471: DFBPPR11746 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.6472: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.6473: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.6474: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.6475: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1
Source.6476: DFBPPR11758 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17B
Source.6477: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.6478: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.6479: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.6480: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3
Source.6481: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.6482: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.6483: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3
Source.6484: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.6485: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.6486: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.6487: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.6488: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.6489: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.6490: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.6491: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.6492: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.6493: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.6494: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1
Source.6495: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.6496: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.6497: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.6498: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.6499: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.6500: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.6501: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13
Source.6502: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.6503: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z
Source.6504: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.6505: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.6506: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.6507: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.6508: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.6509: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.6510: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7
Source.6511: DFBPPR11847 ---- Animal proteins ---- Borealin-2
Source.6512: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.6513: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.6514: DFBPPR11852 ---- Animal proteins ---- Endothelial differentiation-related factor 1 homolog
Source.6515: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.6516: DFBPPR11854 ---- Animal proteins ---- Claw keratin
Source.6517: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.6518: DFBPPR11856 ---- Animal proteins ---- Spindlin-W
Source.6519: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82
Source.6520: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.6521: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.6522: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1
Source.6523: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.6524: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.6525: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.6526: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.6527: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.6528: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.6529: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.6530: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.6531: DFBPPR11896 ---- Animal proteins ---- Sentan
Source.6532: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.6533: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.6534: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.6535: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.6536: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.6537: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.6538: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.6539: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.6540: DFBPPR11936 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.6541: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.6542: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.6543: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.6544: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.6545: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.6546: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog
Source.6547: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.6548: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.6549: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.6550: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.6551: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.6552: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.6553: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.6554: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.6555: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.6556: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.6557: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.6558: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.6559: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.6560: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.6561: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog
Source.6562: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.6563: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.6564: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.6565: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.6566: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.6567: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.6568: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.6569: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.6570: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.6571: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.6572: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein
Source.6573: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.6574: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.6575: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.6576: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.6577: DFBPPR12025 ---- Animal proteins ---- Transmembrane protein 18
Source.6578: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.6579: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.6580: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2
Source.6581: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.6582: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.6583: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.6584: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.6585: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.6586: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.6587: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.6588: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.6589: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.6590: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.6591: DFBPPR12065 ---- Animal proteins ---- Testin
Source.6592: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.6593: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.6594: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.6595: DFBPPR12072 ---- Animal proteins ---- 40S ribosomal protein S17
Source.6596: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.6597: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.6598: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.6599: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.6600: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.6601: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.6602: DFBPPR12096 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 4
Source.6603: DFBPPR12097 ---- Animal proteins ---- Photoreceptor outer segment membrane glycoprotein 2
Source.6604: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.6605: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.6606: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.6607: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.6608: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.6609: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.6610: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.6611: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.6612: DFBPPR12118 ---- Animal proteins ---- Protein EURL
Source.6613: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.6614: DFBPPR12122 ---- Animal proteins ---- Fibroblast growth factor-binding protein 2
Source.6615: DFBPPR12123 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.6616: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.6617: DFBPPR12133 ---- Animal proteins ---- Protein Asterix
Source.6618: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.6619: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.6620: DFBPPR12138 ---- Animal proteins ---- Protein LZIC
Source.6621: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.6622: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.6623: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.6624: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.6625: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.6626: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.6627: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.6628: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.6629: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.6630: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.6631: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.6632: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.6633: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.6634: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A
Source.6635: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1
Source.6636: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.6637: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.6638: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.6639: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.6640: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.6641: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.6642: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.6643: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.6644: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.6645: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.6646: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like
Source.6647: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.6648: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.6649: DFBPPR12247 ---- Animal proteins ---- Uncharacterized protein KIAA1671 homolog
Source.6650: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.6651: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.6652: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.6653: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.6654: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.6655: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin
Source.6656: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.6657: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor
Source.6658: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.6659: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.6660: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.6661: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.6662: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.6663: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.6664: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.6665: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.6666: DFBPPR12276 ---- Animal proteins ---- Protein S100-A9
Source.6667: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.6668: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.6669: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.6670: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.6671: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.6672: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.6673: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.6674: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.6675: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.6676: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.6677: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.6678: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.6679: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.6680: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.6681: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.6682: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.6683: DFBPPR12309 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.6684: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.6685: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.6686: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.6687: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.6688: DFBPPR12322 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.6689: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.6690: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.6691: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.6692: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.6693: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.6694: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.6695: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.6696: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.6697: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.6698: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.6699: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.6700: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.6701: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.6702: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.6703: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.6704: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.6705: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.6706: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.6707: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.6708: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.6709: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.6710: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a
Source.6711: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.6712: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.6713: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.6714: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.6715: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.6716: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.6717: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.6718: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.6719: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.6720: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.6721: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.6722: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.6723: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.6724: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.6725: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.6726: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.6727: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.6728: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6729: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.6730: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.6731: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.6732: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.6733: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.6734: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.6735: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.6736: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.6737: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.6738: DFBPPR12419 ---- Animal proteins ---- Phospholipase A2
Source.6739: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3
Source.6740: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.6741: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6742: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.6743: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.6744: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.6745: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.6746: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.6747: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.6748: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.6749: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.6750: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.6751: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.6752: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.6753: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.6754: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.6755: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.6756: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6757: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.6758: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.6759: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.6760: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.6761: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.6762: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.6763: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.6764: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.6765: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6766: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.6767: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.6768: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.6769: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.6770: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.6771: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.6772: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14
Source.6773: DFBPPR12490 ---- Animal proteins ---- Uteroglobin
Source.6774: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.6775: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.6776: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.6777: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.6778: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.6779: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.6780: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.6781: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.6782: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.6783: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.6784: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.6785: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.6786: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.6787: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.6788: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.6789: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.6790: DFBPPR12535 ---- Animal proteins ---- Troponin I, fast skeletal muscle
Source.6791: DFBPPR12542 ---- Animal proteins ---- Decorin
Source.6792: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.6793: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.6794: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.6795: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.6796: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.6797: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.6798: DFBPPR12551 ---- Animal proteins ---- C-reactive protein
Source.6799: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.6800: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.6801: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.6802: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.6803: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6804: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.6805: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.6806: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.6807: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.6808: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.6809: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.6810: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.6811: DFBPPR12579 ---- Animal proteins ---- Troponin I, slow skeletal muscle
Source.6812: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.6813: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.6814: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.6815: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.6816: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.6817: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.6818: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.6819: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14
Source.6820: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.6821: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.6822: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.6823: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.6824: DFBPPR12621 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.6825: DFBPPR12622 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.6826: DFBPPR12623 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.6827: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.6828: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.6829: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.6830: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.6831: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.6832: DFBPPR12642 ---- Animal proteins ---- Haptoglobin
Source.6833: DFBPPR12643 ---- Animal proteins ---- Haptoglobin
Source.6834: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.6835: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.6836: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.6837: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.6838: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.6839: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.6840: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.6841: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.6842: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.6843: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.6844: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.6845: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.6846: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.6847: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.6848: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.6849: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.6850: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.6851: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.6852: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.6853: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.6854: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.6855: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.6856: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.6857: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.6858: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.6859: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.6860: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.6861: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.6862: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.6863: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.6864: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.6865: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.6866: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.6867: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.6868: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.6869: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.6870: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.6871: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.6872: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.6873: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.6874: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.6875: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.6876: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.6877: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.6878: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.6879: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.6880: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.6881: DFBPPR12796 ---- Animal proteins ---- Caspase-3
Source.6882: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.6883: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.6884: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.6885: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.6886: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.6887: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.6888: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.6889: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.6890: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.6891: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.6892: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain
Source.6893: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.6894: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.6895: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.6896: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.6897: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.6898: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.6899: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.6900: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.6901: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.6902: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.6903: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.6904: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.6905: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.6906: DFBPPR12871 ---- Animal proteins ---- Tropomyosin beta chain
Source.6907: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.6908: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.6909: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.6910: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.6911: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.6912: DFBPPR12908 ---- Animal proteins ---- Ferritin heavy chain
Source.6913: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.6914: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.6915: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.6916: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2
Source.6917: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30
Source.6918: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.6919: DFBPPR12929 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.6920: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.6921: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.6922: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6923: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.6924: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.6925: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.6926: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.6927: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.6928: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.6929: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.6930: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.6931: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.6932: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5
Source.6933: DFBPPR12967 ---- Animal proteins ---- Beta-sarcoglycan
Source.6934: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.6935: DFBPPR12969 ---- Animal proteins ---- Prolactin
Source.6936: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.6937: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.6938: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.6939: DFBPPR12981 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-4
Source.6940: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.6941: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.6942: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.6943: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.6944: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein
Source.6945: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.6946: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6947: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.6948: DFBPPR13007 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 2
Source.6949: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6950: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.6951: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.6952: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.6953: DFBPPR13025 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.6954: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.6955: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.6956: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6957: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.6958: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.6959: DFBPPR13083 ---- Animal proteins ---- Promotilin
Source.6960: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207
Source.6961: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.6962: DFBPPR13092 ---- Animal proteins ---- Testin
Source.6963: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.6964: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.6965: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6966: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.6967: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.6968: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.6969: DFBPPR13152 ---- Animal proteins ---- Interleukin-4
Source.6970: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.6971: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.6972: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.6973: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.6974: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6975: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.6976: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.6977: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.6978: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.6979: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.6980: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6981: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.6982: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.6983: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.6984: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.6985: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.6986: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.6987: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.6988: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.6989: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.6990: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.6991: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.6992: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.6993: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.6994: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain
Source.6995: DFBPPR13240 ---- Animal proteins ---- Decorin
Source.6996: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.6997: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.6998: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.6999: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.7000: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.7001: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.7002: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.7003: DFBPPR13257 ---- Animal proteins ---- Prolactin
Source.7004: DFBPPR13260 ---- Animal proteins ---- Polyubiquitin-B
Source.7005: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.7006: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.7007: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.7008: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.7009: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.7010: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.7011: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.7012: DFBPPR13286 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.7013: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.7014: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.7015: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.7016: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.7017: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.7018: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.7019: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.7020: DFBPPR13306 ---- Animal proteins ---- Tropomyosin alpha-4 chain
Source.7021: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.7022: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.7023: DFBPPR13319 ---- Animal proteins ---- Ferritin heavy chain
Source.7024: DFBPPR13330 ---- Animal proteins ---- Uterocalin
Source.7025: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.7026: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.7027: DFBPPR13339 ---- Animal proteins ---- Runt-related transcription factor 2
Source.7028: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.7029: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.7030: DFBPPR13343 ---- Animal proteins ---- Interferon omega-1
Source.7031: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.7032: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7033: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.7034: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.7035: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.7036: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.7037: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7038: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.7039: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.7040: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.7041: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.7042: DFBPPR13409 ---- Animal proteins ---- Testin
Source.7043: DFBPPR13417 ---- Animal proteins ---- Promotilin
Source.7044: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.7045: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7046: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.7047: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.7048: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7049: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A
Source.7050: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.7051: DFBPPR13443 ---- Animal proteins ---- Kit ligand
Source.7052: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7053: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7054: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.7055: DFBPPR13478 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.7056: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.7057: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.7058: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.7059: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.7060: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.7061: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.7062: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.7063: DFBPPR13520 ---- Animal proteins ---- 60S ribosomal protein L21
Source.7064: DFBPPR13521 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.7065: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.7066: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.7067: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7068: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.7069: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.7070: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.7071: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1
Source.7072: DFBPPR13544 ---- Animal proteins ---- U8 snoRNA-decapping enzyme
Source.7073: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.7074: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.7075: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.7076: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.7077: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.7078: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.7079: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.7080: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.7081: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.7082: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.7083: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.7084: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.7085: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.7086: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.7087: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.7088: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.7089: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.7090: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.7091: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7092: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor
Source.7093: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.7094: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.7095: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.7096: DFBPPR13613 ---- Animal proteins ---- Phospholipase A2
Source.7097: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.7098: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.7099: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta
Source.7100: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.7101: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.7102: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.7103: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.7104: DFBPPR13628 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.7105: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.7106: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.7107: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7108: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.7109: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.7110: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.7111: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7112: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain
Source.7113: DFBPPR13665 ---- Animal proteins ---- Kit ligand
Source.7114: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.7115: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.7116: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.7117: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.7118: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.7119: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.7120: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.7121: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.7122: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.7123: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.7124: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.7125: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.7126: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.7127: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.7128: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.7129: DFBPPR13708 ---- Animal proteins ---- Renin
Source.7130: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.7131: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.7132: DFBPPR13721 ---- Animal proteins ---- Polyubiquitin-B
Source.7133: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.7134: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.7135: DFBPPR13735 ---- Animal proteins ---- Thyroid hormone receptor beta
Source.7136: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.7137: DFBPPR13739 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.7138: DFBPPR13740 ---- Animal proteins ---- Lysozyme C, kidney isozyme
Source.7139: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.7140: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.7141: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.7142: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.7143: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.7144: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A
Source.7145: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.7146: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.7147: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.7148: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.7149: DFBPPR13778 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.7150: DFBPPR13782 ---- Animal proteins ---- BMP and activin membrane-bound inhibitor homolog
Source.7151: DFBPPR13783 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.7152: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.7153: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.7154: DFBPPR13793 ---- Animal proteins ---- Decorin
Source.7155: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.7156: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.7157: DFBPPR13805 ---- Animal proteins ---- Serum amyloid A protein
Source.7158: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.7159: DFBPPR13821 ---- Animal proteins ---- Calcitonin
Source.7160: DFBPPR13824 ---- Animal proteins ---- Adrenodoxin
Source.7161: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.7162: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.7163: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.7164: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.7165: DFBPPR13843 ---- Animal proteins ---- 60S ribosomal protein L10
Source.7166: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.7167: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.7168: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.7169: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.7170: DFBPPR13855 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.7171: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.7172: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.7173: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor
Source.7174: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.7175: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7176: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7177: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7178: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3
Source.7179: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.7180: DFBPPR13893 ---- Animal proteins ---- Calponin-1
Source.7181: DFBPPR13918 ---- Animal proteins ---- Testin
Source.7182: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.7183: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.7184: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.7185: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.7186: DFBPPR13948 ---- Animal proteins ---- Calcium and integrin-binding family member 4
Source.7187: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.7188: DFBPPR13953 ---- Animal proteins ---- Tetraspanin-9
Source.7189: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.7190: DFBPPR13957 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.7191: DFBPPR13959 ---- Animal proteins ---- Calpastatin
Source.7192: DFBPPR13966 ---- Animal proteins ---- Promotilin
Source.7193: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.7194: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7195: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.7196: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.7197: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.7198: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.7199: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.7200: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.7201: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.7202: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.7203: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.7204: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.7205: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.7206: DFBPPR14007 ---- Animal proteins ---- Cystatin
Source.7207: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.7208: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.7209: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.7210: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.7211: DFBPPR14029 ---- Animal proteins ---- Gamma-crystallin M1
Source.7212: DFBPPR14035 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.7213: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7214: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7215: DFBPPR14050 ---- Animal proteins ---- Somatoliberin
Source.7216: DFBPPR14056 ---- Animal proteins ---- Gamma-crystallin M3
Source.7217: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2
Source.7218: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.7219: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.7220: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.7221: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.7222: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.7223: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha
Source.7224: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.7225: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.7226: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1
Source.7227: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.7228: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.7229: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.7230: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.7231: DFBPPR14102 ---- Marine protein ---- Anamorsin-B
Source.7232: DFBPPR14104 ---- Marine protein ---- Anamorsin-A
Source.7233: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1
Source.7234: DFBPPR14112 ---- Marine protein ---- Proteasome subunit beta type-6-A like protein
Source.7235: DFBPPR14114 ---- Marine protein ---- Proteasome subunit beta type-6-B like protein
Source.7236: DFBPPR14116 ---- Marine protein ---- Ferritin, heavy subunit
Source.7237: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.7238: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.7239: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.7240: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.7241: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.7242: DFBPPR14125 ---- Marine protein ---- Partner of Y14 and mago B
Source.7243: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.7244: DFBPPR14132 ---- Marine protein ---- Calumenin-A
Source.7245: DFBPPR14133 ---- Marine protein ---- Calumenin-B
Source.7246: DFBPPR14137 ---- Marine protein ---- Partner of Y14 and mago A
Source.7247: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.7248: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.7249: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.7250: DFBPPR14147 ---- Marine protein ---- Parvalbumin beta 2
Source.7251: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.7252: DFBPPR14152 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.7253: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.7254: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.7255: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2
Source.7256: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.7257: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A
Source.7258: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.7259: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase
Source.7260: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.7261: DFBPPR14185 ---- Marine protein ---- Parvalbumin beta 1
Source.7262: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.7263: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.7264: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.7265: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.7266: DFBPPR14207 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.7267: DFBPPR14208 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.7268: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.7269: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9
Source.7270: DFBPPR14214 ---- Marine protein ---- Pancreatic progenitor cell differentiation and proliferation factor
Source.7271: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.7272: DFBPPR14228 ---- Marine protein ---- UPF0691 protein C9orf116 homolog
Source.7273: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.7274: DFBPPR14237 ---- Marine protein ---- Stanniocalcin
Source.7275: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.7276: DFBPPR14241 ---- Marine protein ---- Cystatin
Source.7277: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.7278: DFBPPR14247 ---- Marine protein ---- Pro-MCH 2
Source.7279: DFBPPR14251 ---- Marine protein ---- Isotocin-neurophysin IT 1
Source.7280: DFBPPR14253 ---- Marine protein ---- Vasotocin-neurophysin VT 1
Source.7281: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.7282: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a
Source.7283: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.7284: DFBPPR14271 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.7285: DFBPPR14274 ---- Marine protein ---- Cytochrome c oxidase subunit 7B-heart, mitochondrial
Source.7286: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.7287: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.7288: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase
Source.7289: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.7290: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.7291: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.7292: DFBPPR14320 ---- Marine protein ---- Photosystem I assembly protein Ycf3
Source.7293: DFBPPR14324 ---- Marine protein ---- Uncharacterized protein ycf19
Source.7294: DFBPPR14327 ---- Marine protein ---- Allophycocyanin beta chain
Source.7295: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.7296: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.7297: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7298: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.7299: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.7300: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.7301: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7302: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.7303: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.7304: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.7305: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase
Source.7306: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.7307: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.7308: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.7309: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.7310: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.7311: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.7312: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.7313: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.7314: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.7315: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha
Source.7316: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.7317: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.7318: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain
Source.7319: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.7320: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.7321: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.7322: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic
Source.7323: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic
Source.7324: DFBPPR14403 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.7325: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.7326: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain
Source.7327: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.7328: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4
Source.7329: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.7330: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.7331: DFBPPR14423 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic
Source.7332: DFBPPR14424 ---- Marine protein ---- Nitrogen regulatory protein P-II
Source.7333: DFBPPR14433 ---- Marine protein ---- 50S ribosomal protein L14, chloroplastic
Source.7334: DFBPPR14439 ---- Marine protein ---- 50S ribosomal protein L5, chloroplastic
Source.7335: DFBPPR14442 ---- Marine protein ---- 50S ribosomal protein L18, chloroplastic
Source.7336: DFBPPR14446 ---- Marine protein ---- 50S ribosomal protein L20, chloroplastic
Source.7337: DFBPPR14456 ---- Marine protein ---- Uncharacterized protein ycf17
Source.7338: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29
Source.7339: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic
Source.7340: DFBPPR14466 ---- Marine protein ---- 30S ribosomal protein S11, chloroplastic
Source.7341: DFBPPR14471 ---- Marine protein ---- Uncharacterized protein ycf83
Source.7342: DFBPPR14472 ---- Marine protein ---- Photosystem I reaction center subunit XI
Source.7343: DFBPPR14473 ---- Marine protein ---- Photosystem II reaction center Psb28 protein
Source.7344: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.7345: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.7346: DFBPPR14481 ---- Marine protein ---- 50S ribosomal protein L13, chloroplastic
Source.7347: DFBPPR14485 ---- Marine protein ---- Uncharacterized N-acetyltransferase ycf52
Source.7348: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.7349: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.7350: DFBPPR14499 ---- Marine protein ---- Photosystem I assembly protein Ycf3
Source.7351: DFBPPR14513 ---- Marine protein ---- Uncharacterized protein ycf19
Source.7352: DFBPPR14531 ---- Marine protein ---- Protein PYP1
Source.7353: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.7354: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.7355: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.7356: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.7357: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.7358: DFBPPR14546 ---- Marine protein ---- Stanniocalcin
Source.7359: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor
Source.7360: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.7361: DFBPPR14552 ---- Marine protein ---- Lysozyme C II
Source.7362: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.7363: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.7364: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.7365: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.7366: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.7367: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.7368: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.7369: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.7370: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.7371: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.7372: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.7373: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.7374: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1
Source.7375: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.7376: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.7377: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.7378: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.7379: DFBPPR14596 ---- Marine protein ---- Parvalbumin beta 2
Source.7380: DFBPPR14597 ---- Marine protein ---- Parvalbumin beta 1
Source.7381: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein
Source.7382: DFBPPR14602 ---- Marine protein ---- Proteasome subunit beta type-3
Source.7383: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.7384: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.7385: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1
Source.7386: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.7387: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.7388: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.7389: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.7390: DFBPPR14620 ---- Marine protein ---- GTP cyclohydrolase 1
Source.7391: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.7392: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.7393: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.7394: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.7395: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.7396: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18
Source.7397: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.7398: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin
Source.7399: DFBPPR14655 ---- Marine protein ---- Small ubiquitin-related modifier 1
Source.7400: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.7401: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.7402: DFBPPR14659 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.7403: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.7404: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2
Source.7405: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.7406: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.7407: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.7408: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.7409: DFBPPR14670 ---- Marine protein ---- Fatty acid-binding protein, heart
Source.7410: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.7411: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.7412: DFBPPR14680 ---- Marine protein ---- Steroidogenic acute regulatory protein, mitochondrial
Source.7413: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.7414: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.7415: DFBPPR14684 ---- Marine protein ---- Pro-MCH 2
Source.7416: DFBPPR14698 ---- Marine protein ---- Cystatin
Source.7417: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.7418: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.7419: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.7420: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.7421: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.7422: DFBPPR14731 ---- Marine protein ---- Cytochrome c oxidase polypeptide VIIc
Source.7423: DFBPPR14737 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.7424: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.7425: DFBPPR14739 ---- Marine protein ---- Interleukin-1 receptor-associated kinase 1-binding protein 1 homolog
Source.7426: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.7427: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.7428: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.7429: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.7430: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.7431: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2
Source.7432: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.7433: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.7434: DFBPPR14774 ---- Marine protein ---- Hemocyanin alpha chain
Source.7435: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.7436: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.7437: DFBPPR14783 ---- Marine protein ---- Enolase
Source.7438: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.7439: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.7440: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.7441: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.7442: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.7443: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.7444: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.7445: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.7446: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.7447: DFBPPR14805 ---- Marine protein ---- Probable molt-inhibiting hormone
Source.7448: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.7449: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.7450: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.7451: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.7452: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1
Source.7453: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.7454: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.7455: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7456: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.7457: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.7458: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.7459: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.7460: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.7461: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.7462: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.7463: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.7464: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.7465: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.7466: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.7467: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.7468: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.7469: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.7470: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.7471: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.7472: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4
Source.7473: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.7474: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3
Source.7475: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.7476: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.7477: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8
Source.7478: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.7479: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.7480: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.7481: DFBPPR14919 ---- Microorganism protein ---- Transcription elongation factor SPT4
Source.7482: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.7483: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.7484: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.7485: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.7486: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.7487: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.7488: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.7489: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.7490: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.7491: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.7492: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.7493: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.7494: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.7495: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.7496: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial
Source.7497: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.7498: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.7499: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.7500: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.7501: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.7502: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.7503: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.7504: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.7505: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.7506: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.7507: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.7508: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.7509: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.7510: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.7511: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.7512: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1
Source.7513: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.7514: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.7515: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.7516: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.7517: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.7518: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.7519: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.7520: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.7521: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.7522: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.7523: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.7524: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.7525: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.7526: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.7527: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.7528: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.7529: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.7530: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.7531: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.7532: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.7533: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12
Source.7534: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.7535: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.7536: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.7537: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.7538: DFBPPR15081 ---- Microorganism protein ---- Polyubiquitin
Source.7539: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase
Source.7540: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.7541: DFBPPR15089 ---- Microorganism protein ---- F-actin-capping protein subunit beta
Source.7542: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.7543: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.7544: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.7545: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.7546: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.7547: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.7548: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.7549: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1
Source.7550: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.7551: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.7552: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.7553: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.7554: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.7555: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.7556: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.7557: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.7558: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.7559: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.7560: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.7561: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.7562: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.7563: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.7564: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.7565: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.7566: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.7567: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.7568: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.7569: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.7570: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.7571: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.7572: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.7573: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13
Source.7574: DFBPPR15200 ---- Microorganism protein ---- Protein SPT3
Source.7575: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.7576: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.7577: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1
Source.7578: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.7579: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.7580: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.7581: DFBPPR15223 ---- Microorganism protein ---- FK506-binding protein 2
Source.7582: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.7583: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.7584: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2
Source.7585: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.7586: DFBPPR15265 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM14
Source.7587: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.7588: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.7589: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.7590: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.7591: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.7592: DFBPPR15277 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 20
Source.7593: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.7594: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.7595: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase
Source.7596: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.7597: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.7598: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.7599: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.7600: DFBPPR15297 ---- Microorganism protein ---- Transcriptional activator HAP2
Source.7601: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14
Source.7602: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.7603: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.7604: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.7605: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.7606: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.7607: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.7608: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3
Source.7609: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.7610: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.7611: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.7612: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.7613: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.7614: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.7615: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.7616: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.7617: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.7618: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.7619: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.7620: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.7621: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.7622: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.7623: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.7624: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.7625: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.7626: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.7627: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.7628: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.7629: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.7630: DFBPPR15418 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 4
Source.7631: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.7632: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.7633: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.7634: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.7635: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.7636: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10
Source.7637: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.7638: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1
Source.7639: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.7640: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.7641: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4
Source.7642: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.7643: DFBPPR15474 ---- Microorganism protein ---- GPN-loop GTPase 3
Source.7644: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.7645: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.7646: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.7647: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.7648: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1
Source.7649: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.7650: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.7651: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.7652: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.7653: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.7654: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.7655: DFBPPR15522 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 3
Source.7656: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.7657: DFBPPR15530 ---- Microorganism protein ---- Translationally-controlled tumor protein homolog
Source.7658: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.7659: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.7660: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.7661: DFBPPR15551 ---- Microorganism protein ---- Mitochondrial morphogenesis protein SLD7
Source.7662: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14
Source.7663: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.7664: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial
Source.7665: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.7666: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.7667: DFBPPR15562 ---- Microorganism protein ---- Mitotic spindle-associated protein SHE1
Source.7668: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.7669: DFBPPR15579 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit CNL1
Source.7670: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.7671: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1
Source.7672: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.7673: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.7674: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.7675: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.7676: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.7677: DFBPPR15608 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP2
Source.7678: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.7679: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.7680: DFBPPR15624 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit VAB2
Source.7681: DFBPPR15627 ---- Microorganism protein ---- Multiprotein-bridging factor 1
Source.7682: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.7683: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.7684: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22
Source.7685: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.7686: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18
Source.7687: DFBPPR15661 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 2
Source.7688: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.7689: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1
Source.7690: DFBPPR15665 ---- Microorganism protein ---- Ribosome biogenesis protein ALB1
Source.7691: DFBPPR15671 ---- Microorganism protein ---- Outer spore wall protein 5
Source.7692: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1
Source.7693: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.7694: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.7695: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1
Source.7696: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.7697: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.7698: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14
Source.7699: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.7700: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.7701: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.7702: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4
Source.7703: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial
Source.7704: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2
Source.7705: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.7706: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.7707: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.7708: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.7709: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.7710: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.7711: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.7712: DFBPPR15722 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 18, mitochondrial
Source.7713: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.7714: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.7715: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2
Source.7716: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.7717: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.7718: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.7719: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19
Source.7720: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.7721: DFBPPR15743 ---- Microorganism protein ---- Damage-regulated import facilitator 1
Source.7722: DFBPPR15746 ---- Microorganism protein ---- Topoisomerase I damage affected protein 11
Source.7723: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.7724: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.7725: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.7726: DFBPPR15786 ---- Microorganism protein ---- Stationary phase protein 4
Source.7727: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.7728: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.7729: DFBPPR15802 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurQ
Source.7730: DFBPPR15803 ---- Microorganism protein ---- Galactokinase
Source.7731: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.7732: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.7733: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.7734: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.7735: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component
Source.7736: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.7737: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.7738: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.7739: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase
Source.7740: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.7741: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.7742: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.7743: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.7744: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase
Source.7745: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.7746: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.7747: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.7748: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.7749: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.7750: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.7751: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.7752: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.7753: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.7754: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.7755: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.7756: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.7757: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.7758: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.7759: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.7760: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.7761: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1
Source.7762: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.7763: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.7764: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.7765: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.7766: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7767: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.7768: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.7769: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.7770: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase
Source.7771: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog
Source.7772: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.7773: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.7774: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.7775: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.7776: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.7777: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.7778: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.7779: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.7780: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7781: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.7782: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.7783: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.7784: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A
Source.7785: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.7786: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.7787: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.7788: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.7789: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.7790: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7791: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic
Source.7792: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.7793: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.7794: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7795: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.7796: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.7797: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.7798: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.7799: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.7800: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.7801: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7802: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.7803: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.7804: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.7805: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.7806: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.7807: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.7808: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.7809: DFBPPR7813 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.7810: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.7811: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.7812: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.7813: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.7814: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.7815: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.7816: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2
Source.7817: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1
Source.7818: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.7819: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.7820: DFBPPR7834 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase homolog 2
Source.7821: DFBPPR7837 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.7822: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.7823: DFBPPR7859 ---- Plant protein ---- Cytochrome b6-f complex subunit 4
Source.7824: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.7825: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.7826: DFBPPR7870 ---- Plant protein ---- Translation initiation factor IF-1, chloroplastic
Source.7827: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.7828: DFBPPR7878 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic
Source.7829: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.7830: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.7831: DFBPPR7894 ---- Plant protein ---- CASP-like protein 2C2
Source.7832: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.7833: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1
Source.7834: DFBPPR7911 ---- Plant protein ---- Glycine-rich RNA-binding protein 1
Source.7835: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.7836: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.7837: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.7838: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.7839: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.7840: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.7841: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.7842: DFBPPR7933 ---- Plant protein ---- FK506-binding protein 2
Source.7843: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.7844: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.7845: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.7846: DFBPPR7939 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase FKBP12
Source.7847: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1
Source.7848: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.7849: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a
Source.7850: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7851: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1
Source.7852: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.7853: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.7854: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.7855: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.7856: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha
Source.7857: DFBPPR7959 ---- Plant protein ---- Leghemoglobin 49
Source.7858: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.7859: DFBPPR7967 ---- Plant protein ---- Plastocyanin
Source.7860: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.7861: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.7862: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.7863: DFBPPR7985 ---- Plant protein ---- Uncharacterized 9.9 kDa protein
Source.7864: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7865: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7866: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.7867: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.7868: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.7869: DFBPPR8002 ---- Plant protein ---- Plastocyanin
Source.7870: DFBPPR8008 ---- Plant protein ---- CASP-like protein 5A2
Source.7871: DFBPPR8009 ---- Plant protein ---- CASP-like protein 5B1
Source.7872: DFBPPR8012 ---- Plant protein ---- CASP-like protein 5A1
Source.7873: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.7874: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.7875: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.7876: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7877: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.7878: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.7879: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.7880: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7881: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.7882: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.7883: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7884: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.7885: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.7886: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.7887: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.7888: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.7889: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.7890: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.7891: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.7892: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.7893: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.7894: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.7895: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.7896: DFBPPR8082 ---- Plant protein ---- Plastocyanin
Source.7897: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase
Source.7898: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7899: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.7900: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.7901: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.7902: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.7903: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.7904: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.7905: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.7906: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.7907: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.7908: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.7909: DFBPPR8115 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.7910: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.7911: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.7912: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.7913: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.7914: DFBPPR8135 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic
Source.7915: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.7916: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.7917: DFBPPR8151 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Source.7918: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.7919: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.7920: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.7921: DFBPPR8163 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.7922: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.7923: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.7924: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.7925: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.7926: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7927: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.7928: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.7929: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7930: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7931: DFBPPR8228 ---- Plant protein ---- Albumin-8
Source.7932: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.7933: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.7934: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.7935: DFBPPR8235 ---- Plant protein ---- Catalase
Source.7936: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.7937: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.7938: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.7939: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.7940: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.7941: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7942: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.7943: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.7944: DFBPPR8262 ---- Plant protein ---- ATP-dependent zinc metalloprotease FTSH, chloroplastic
Source.7945: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.7946: DFBPPR8266 ---- Plant protein ---- Putative ATP synthase protein YMF19
Source.7947: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.7948: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.7949: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.7950: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.7951: DFBPPR8277 ---- Plant protein ---- Profilin
Source.7952: DFBPPR8282 ---- Plant protein ---- Isocitrate lyase
Source.7953: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.7954: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.7955: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.7956: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4
Source.7957: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.7958: DFBPPR8306 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.7959: DFBPPR8309 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic
Source.7960: DFBPPR8312 ---- Plant protein ---- Translation initiation factor IF-1, chloroplastic
Source.7961: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.7962: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein
Source.7963: DFBPPR8325 ---- Plant protein ---- 11 kDa late embryogenesis abundant protein
Source.7964: DFBPPR8328 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Source.7965: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a
Source.7966: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.7967: DFBPPR8349 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.7968: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited very low Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 1400 μM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES NCC(=O)N[C@@]([H])(CCSC)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

Dipeptides were purchased from either Vega-Fox or Chemical DYnamics.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

Although the peptide is a synthetic peptide, it is present in many food-source proteins.

Database cross-references
BIOPEP-UWM [D1] 7597
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Cheung HS, Wang FL, Ondetti MA, Sabo EF, Cushman DW. Binding of peptide substrates and inhibitors of angiotensin-converting enzyme. Importance of the COOH-terminal dipeptide sequence. J Biol Chem. 1980 Jan 25;255(2):401-7.
PMID: 6243277
Other literature(s) N.D
PubDate 1980
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214