E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1880(ACE-inhibitory peptide)
DFBP ID DFBPACEI1880
Peptide sequence AY
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antihypertensive activity [D1], Antioxidative activity [D2], Multifunctional activity [D3]
Calculated physicochemical properties
Three-letter amino acid Ala-Tyr
Single-letter amino acid AY
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 252.26 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
IC50 N.D
pIC50 N.D
GRAVY 0.2500 c
Hydrophilic residue ratio 50% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Amaranth seed proteins
Precursor protein Amaranth glutelins
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0387 ---- Plant protein ---- Alpha purothionin
Source.3: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit
Source.4: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein
Source.5: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.6: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.7: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.8: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.9: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.10: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A
Source.11: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.12: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.13: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.14: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.15: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.16: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.17: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.18: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.19: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.20: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.21: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.22: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.23: DFBPPR0843 ---- Plant proteins ---- MADS-box transcription factor 1
Source.24: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.25: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.26: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.27: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.28: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.29: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.30: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.31: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.32: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.33: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.34: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.35: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.36: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.37: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.38: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.39: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.40: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.41: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.42: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.43: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.44: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.45: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.46: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.47: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.48: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.49: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.50: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.51: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.52: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1
Source.53: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2
Source.54: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.55: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.56: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2
Source.57: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.58: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.59: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.60: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.61: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.62: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.63: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.64: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.65: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1
Source.66: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.67: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.68: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.69: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.70: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.71: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.72: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.73: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.74: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8
Source.75: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.76: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.77: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.78: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.79: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.80: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.81: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.82: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.83: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.84: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.85: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.86: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.87: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.88: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.89: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.90: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.91: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.92: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.93: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog
Source.94: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.95: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.96: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.97: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.98: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.99: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.100: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.101: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.102: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7
Source.103: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.104: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.105: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.106: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.107: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.108: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.109: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.110: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.111: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.112: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.113: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.114: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.115: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.116: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.117: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.118: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.119: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.120: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.121: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.122: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.123: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.124: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1
Source.125: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.126: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.127: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.128: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.129: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4
Source.130: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.131: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.132: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.133: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.134: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.135: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.136: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.137: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.138: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5
Source.139: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.140: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.141: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.142: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.143: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.144: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.145: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.146: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.147: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.148: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.149: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.150: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.151: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.152: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.153: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.154: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.155: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.156: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.157: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2
Source.158: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.159: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.160: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.161: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.162: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.163: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.164: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.165: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.166: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.167: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.168: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.169: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.170: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.171: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13
Source.172: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.173: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.174: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.175: DFBPPR1101 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 2
Source.176: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3
Source.177: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.178: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.179: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.180: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.181: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.182: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.183: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.184: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.185: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.186: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.187: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.188: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.189: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.190: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.191: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.192: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.193: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.194: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.195: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.196: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.197: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.198: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.199: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.200: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.201: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.202: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.203: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.204: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.205: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.206: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.207: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.208: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17
Source.209: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.210: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.211: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.212: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.213: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.214: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic
Source.215: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.216: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.217: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.218: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.219: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.220: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.221: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic
Source.222: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.223: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.224: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.225: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.226: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.227: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.228: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.229: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.230: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.231: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.232: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.233: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.234: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.235: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.236: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.237: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.238: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.239: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.240: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.241: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.242: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.243: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.244: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.245: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.246: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.247: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.248: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.249: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.250: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.251: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.252: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.253: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.254: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.255: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.256: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.257: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.258: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.259: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.260: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.261: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.262: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.263: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.264: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.265: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.266: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.267: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8
Source.268: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.269: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.270: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.271: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.272: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.273: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.274: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.275: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.276: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.277: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.278: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.279: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.280: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.281: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.282: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.283: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.284: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.285: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.286: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.287: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.288: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.289: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.290: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.291: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.292: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.293: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.294: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.295: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.296: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.297: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.298: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.299: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.300: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.301: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.302: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.303: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.304: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.305: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.306: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.307: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.308: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.309: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.310: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.311: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.312: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.313: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.314: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3
Source.315: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.316: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.317: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.318: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.319: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.320: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.321: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.322: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.323: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.324: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.325: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.326: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.327: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.328: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.329: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.330: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.331: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.332: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.333: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.334: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.335: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.336: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.337: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.338: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.339: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.340: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.341: DFBPPR1412 ---- Plant proteins ---- Histone H3.3
Source.342: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.343: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.344: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7
Source.345: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.346: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.347: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.348: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.349: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.350: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.351: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.352: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.353: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.354: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.355: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.356: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.357: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.358: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.359: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.360: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.361: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.362: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.363: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.364: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.365: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.366: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.367: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.368: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.369: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.370: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.371: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.372: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.373: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.374: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.375: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.376: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.377: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.378: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.379: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.380: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.381: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.382: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.383: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.384: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.385: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.386: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.387: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.388: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.389: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.390: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.391: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.392: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.393: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.394: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.395: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.396: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.397: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.398: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.399: DFBPPR1497 ---- Plant proteins ---- Chitinase 1
Source.400: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.401: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.402: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.403: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.404: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.405: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.406: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.407: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.408: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.409: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.410: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F
Source.411: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.412: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.413: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.414: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.415: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.416: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.417: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.418: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.419: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.420: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.421: DFBPPR1540 ---- Plant proteins ---- Protein DROOPING LEAF
Source.422: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.423: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.424: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.425: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.426: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.427: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.428: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.429: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.430: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.431: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.432: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.433: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.434: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.435: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A
Source.436: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.437: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.438: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.439: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.440: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.441: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.442: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.443: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.444: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.445: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.446: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.447: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.448: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.449: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.450: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.451: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.452: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.453: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.454: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.455: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5
Source.456: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.457: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.458: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.459: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.460: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.461: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.462: DFBPPR1620 ---- Plant proteins ---- MADS-box transcription factor 29
Source.463: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.464: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.465: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.466: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.467: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.468: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.469: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.470: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.471: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.472: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.473: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.474: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.475: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2
Source.476: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.477: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.478: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.479: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.480: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.481: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.482: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.483: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.484: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.485: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.486: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.487: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.488: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.489: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.490: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.491: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.492: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.493: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.494: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.495: DFBPPR1676 ---- Plant proteins ---- MADS-box transcription factor 55
Source.496: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.497: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.498: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.499: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.500: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.501: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.502: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.503: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.504: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.505: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.506: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.507: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.508: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.509: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.510: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.511: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.512: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.513: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.514: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.515: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.516: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.517: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.518: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.519: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.520: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3
Source.521: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.522: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.523: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.524: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.525: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.526: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.527: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.528: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.529: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.530: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.531: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.532: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.533: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.534: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.535: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.536: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.537: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.538: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.539: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.540: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.541: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.542: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.543: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.544: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.545: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.546: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.547: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.548: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.549: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.550: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.551: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.552: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.553: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.554: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.555: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.556: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.557: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.558: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.559: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.560: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.561: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.562: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.563: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.564: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.565: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.566: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4
Source.567: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.568: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.569: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.570: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.571: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.572: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic
Source.573: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1
Source.574: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.575: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.576: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.577: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.578: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1
Source.579: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.580: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1
Source.581: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.582: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.583: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.584: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.585: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.586: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.587: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.588: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.589: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.590: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.591: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.592: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.593: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.594: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.595: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.596: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.597: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.598: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.599: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.600: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.601: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.602: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.603: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.604: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.605: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.606: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.607: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.608: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.609: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.610: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.611: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.612: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.613: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.614: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.615: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.616: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.617: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.618: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.619: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.620: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.621: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.622: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.623: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2
Source.624: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.625: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.626: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.627: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.628: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.629: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.630: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.631: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.632: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.633: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.634: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.635: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.636: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.637: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.638: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.639: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.640: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.641: DFBPPR1940 ---- Plant proteins ---- Histone H3.2
Source.642: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.643: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.644: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.645: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.646: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.647: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.648: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.649: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.650: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.651: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.652: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.653: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.654: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.655: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.656: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.657: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.658: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.659: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1
Source.660: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.661: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.662: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.663: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.664: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2
Source.665: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.666: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.667: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.668: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.669: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.670: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.671: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.672: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.673: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.674: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.675: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.676: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.677: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.678: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.679: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.680: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.681: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.682: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.683: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.684: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.685: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.686: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.687: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.688: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.689: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.690: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.691: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.692: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.693: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.694: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.695: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.696: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.697: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.698: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.699: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.700: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.701: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.702: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.703: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.704: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.705: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.706: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.707: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.708: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.709: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.710: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.711: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.712: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.713: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.714: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.715: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.716: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.717: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.718: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.719: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2
Source.720: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.721: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.722: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.723: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.724: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.725: DFBPPR2085 ---- Plant proteins ---- Protein LOL5
Source.726: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.727: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.728: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.729: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.730: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.731: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.732: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.733: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.734: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.735: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.736: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.737: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.738: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.739: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.740: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1
Source.741: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.742: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.743: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.744: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.745: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.746: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.747: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.748: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.749: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5
Source.750: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.751: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.752: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.753: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.754: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.755: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic
Source.756: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.757: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.758: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.759: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.760: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.761: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.762: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.763: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.764: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.765: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.766: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.767: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.768: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.769: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.770: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.771: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.772: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.773: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.774: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.775: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.776: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.777: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.778: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.779: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.780: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.781: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.782: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.783: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.784: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.785: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.786: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C
Source.787: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.788: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.789: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1
Source.790: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.791: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.792: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.793: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.794: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.795: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.796: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.797: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1
Source.798: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.799: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.800: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein
Source.801: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.802: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.803: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.804: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.805: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.806: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.807: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.808: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.809: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.810: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.811: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.812: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.813: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.814: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.815: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.816: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.817: DFBPPR2223 ---- Plant proteins ---- Urease
Source.818: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.819: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.820: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.821: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.822: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.823: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.824: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.825: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.826: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.827: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.828: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76
Source.829: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.830: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.831: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.832: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.833: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.834: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.835: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.836: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.837: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.838: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.839: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.840: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.841: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.842: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.843: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.844: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.845: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.846: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.847: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3
Source.848: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.849: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.850: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.851: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.852: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.853: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.854: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.855: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.856: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.857: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.858: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.859: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.860: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.861: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.862: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.863: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.864: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.865: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.866: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.867: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.868: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.869: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.870: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.871: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.872: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.873: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.874: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.875: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.876: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.877: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.878: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic
Source.879: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.880: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.881: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.882: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.883: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.884: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.885: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.886: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.887: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.888: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.889: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.890: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.891: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.892: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.893: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.894: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.895: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.896: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6
Source.897: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.898: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.899: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.900: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.901: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.902: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.903: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.904: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.905: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.906: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.907: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.908: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.909: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.910: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.911: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.912: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1
Source.913: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.914: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.915: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.916: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.917: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.918: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.919: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.920: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.921: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.922: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.923: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.924: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.925: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.926: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.927: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.928: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.929: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.930: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.931: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.932: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.933: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.934: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.935: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.936: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.937: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73
Source.938: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.939: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.940: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.941: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.942: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.943: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9
Source.944: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.945: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.946: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.947: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.948: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.949: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56
Source.950: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.951: DFBPPR2460 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.952: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.953: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.954: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34
Source.955: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.956: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.957: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.958: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.959: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.960: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.961: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.962: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.963: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.964: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2
Source.965: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.966: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.967: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.968: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.969: DFBPPR2497 ---- Plant proteins ---- Thioredoxin-like protein HCF164, chloroplastic
Source.970: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.971: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.972: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B
Source.973: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4
Source.974: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.975: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.976: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.977: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.978: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.979: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.980: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.981: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.982: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.983: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.984: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.985: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.986: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.987: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.988: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.989: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.990: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.991: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.992: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.993: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.994: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.995: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.996: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.997: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.998: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.999: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.1000: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1001: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.1002: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.1003: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.1004: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.1005: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.1006: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.1007: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.1008: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4
Source.1009: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.1010: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.1011: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.1012: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.1013: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.1014: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.1015: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.1016: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.1017: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1
Source.1018: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.1019: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.1020: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.1021: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.1022: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.1023: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.1024: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.1025: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.1026: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.1027: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.1028: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1029: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.1030: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.1031: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.1032: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.1033: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.1034: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.1035: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.1036: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1037: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.1038: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.1039: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1040: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.1041: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.1042: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.1043: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.1044: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.1045: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.1046: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.1047: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.1048: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.1049: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.1050: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.1051: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.1052: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.1053: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.1054: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.1055: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.1056: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.1057: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.1058: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.1059: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2
Source.1060: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.1061: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.1062: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.1063: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.1064: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.1065: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.1066: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.1067: DFBPPR2684 ---- Plant proteins ---- Arabinogalactan peptide 3
Source.1068: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.1069: DFBPPR2689 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.1070: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.1071: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.1072: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.1073: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic
Source.1074: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.1075: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.1076: DFBPPR2698 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.1077: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1078: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.1079: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.1080: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.1081: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.1082: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1
Source.1083: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.1084: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.1085: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.1086: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.1087: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.1088: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.1089: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.1090: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.1091: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.1092: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.1093: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1094: DFBPPR2732 ---- Plant proteins ---- Small ubiquitin-related modifier 1
Source.1095: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.1096: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.1097: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.1098: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.1099: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.1100: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.1101: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.1102: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.1103: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.1104: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.1105: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.1106: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.1107: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.1108: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.1109: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.1110: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.1111: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.1112: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.1113: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1114: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.1115: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.1116: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.1117: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.1118: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.1119: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1120: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.1121: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1122: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.1123: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1124: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic
Source.1125: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.1126: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12
Source.1127: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.1128: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.1129: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.1130: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.1131: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.1132: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.1133: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1134: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.1135: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.1136: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.1137: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.1138: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.1139: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.1140: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.1141: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.1142: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.1143: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.1144: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.1145: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.1146: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.1147: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.1148: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.1149: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.1150: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.1151: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.1152: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.1153: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.1154: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.1155: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.1156: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.1157: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1158: DFBPPR2849 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 3
Source.1159: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.1160: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.1161: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.1162: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.1163: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1164: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.1165: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.1166: DFBPPR2860 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 3
Source.1167: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.1168: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.1169: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.1170: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.1171: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.1172: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.1173: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.1174: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.1175: DFBPPR2880 ---- Plant proteins ---- Nuclear cap-binding protein subunit 2
Source.1176: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.1177: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.1178: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.1179: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.1180: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1181: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.1182: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.1183: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A
Source.1184: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.1185: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.1186: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.1187: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.1188: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.1189: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.1190: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.1191: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.1192: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.1193: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.1194: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.1195: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1
Source.1196: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.1197: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.1198: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.1199: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.1200: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.1201: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.1202: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.1203: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.1204: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.1205: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.1206: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.1207: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.1208: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.1209: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.1210: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1211: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.1212: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.1213: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.1214: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.1215: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.1216: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.1217: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1218: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.1219: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.1220: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.1221: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.1222: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.1223: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.1224: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.1225: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.1226: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.1227: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.1228: DFBPPR2987 ---- Plant proteins ---- 1-Cys peroxiredoxin B
Source.1229: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.1230: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.1231: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.1232: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.1233: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.1234: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.1235: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.1236: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.1237: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.1238: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.1239: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.1240: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.1241: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.1242: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.1243: DFBPPR3015 ---- Plant proteins ---- Expansin-A13
Source.1244: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.1245: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.1246: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.1247: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.1248: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.1249: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.1250: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.1251: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.1252: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.1253: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein
Source.1254: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.1255: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b
Source.1256: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.1257: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.1258: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.1259: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.1260: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.1261: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.1262: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.1263: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.1264: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8
Source.1265: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.1266: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.1267: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.1268: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.1269: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.1270: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.1271: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.1272: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.1273: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1274: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.1275: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.1276: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.1277: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.1278: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.1279: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.1280: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.1281: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.1282: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.1283: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.1284: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.1285: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.1286: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.1287: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3
Source.1288: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.1289: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.1290: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.1291: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.1292: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.1293: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.1294: DFBPPR3095 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 4
Source.1295: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1296: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.1297: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.1298: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.1299: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.1300: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.1301: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.1302: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.1303: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.1304: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.1305: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.1306: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.1307: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.1308: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.1309: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.1310: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.1311: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7
Source.1312: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.1313: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.1314: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.1315: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1316: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.1317: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1318: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1319: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.1320: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.1321: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.1322: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.1323: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.1324: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.1325: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1326: DFBPPR3143 ---- Plant proteins ---- Protein OS-9 homolog
Source.1327: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.1328: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.1329: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1330: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.1331: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.1332: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1333: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.1334: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.1335: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.1336: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.1337: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1338: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1339: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.1340: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1341: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.1342: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.1343: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic
Source.1344: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.1345: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1346: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.1347: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1348: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.1349: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1350: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1351: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1352: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1353: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.1354: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1355: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1356: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1357: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1358: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1359: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.1360: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.1361: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1362: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1363: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.1364: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1365: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.1366: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.1367: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.1368: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.1369: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.1370: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.1371: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.1372: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.1373: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.1374: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.1375: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1376: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.1377: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.1378: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1379: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.1380: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.1381: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1382: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.1383: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.1384: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.1385: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.1386: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1387: DFBPPR3257 ---- Plant proteins ---- Ras-related protein RIC2
Source.1388: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.1389: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.1390: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1391: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.1392: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.1393: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1394: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.1395: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.1396: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.1397: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.1398: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1399: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1400: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.1401: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.1402: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.1403: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.1404: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.1405: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4
Source.1406: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.1407: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1408: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E
Source.1409: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.1410: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.1411: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.1412: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1413: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.1414: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.1415: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.1416: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.1417: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.1418: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.1419: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.1420: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8
Source.1421: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.1422: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.1423: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.1424: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.1425: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.1426: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10
Source.1427: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.1428: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.1429: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1430: DFBPPR3336 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.1431: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.1432: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1433: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.1434: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.1435: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.1436: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.1437: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.1438: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1439: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.1440: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.1441: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1442: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.1443: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1444: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1445: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1446: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1447: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.1448: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.1449: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1450: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.1451: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1452: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.1453: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.1454: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.1455: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1456: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.1457: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.1458: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.1459: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.1460: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.1461: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1462: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1463: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1464: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1465: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.1466: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.1467: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1468: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1469: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.1470: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.1471: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.1472: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1473: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1474: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.1475: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.1476: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.1477: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.1478: DFBPPR3418 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 3
Source.1479: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.1480: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1481: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1482: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1483: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.1484: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.1485: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3
Source.1486: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.1487: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.1488: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.1489: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.1490: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.1491: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1492: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.1493: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.1494: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1495: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1496: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1497: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44
Source.1498: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.1499: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.1500: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.1501: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.1502: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.1503: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.1504: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.1505: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.1506: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.1507: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.1508: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1509: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.1510: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.1511: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1512: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.1513: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1514: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.1515: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.1516: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1517: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1518: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.1519: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.1520: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1521: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.1522: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.1523: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1524: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.1525: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1526: DFBPPR3510 ---- Plant proteins ---- Thioredoxin-like protein Clot
Source.1527: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.1528: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.1529: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.1530: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.1531: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.1532: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.1533: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1534: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1535: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1536: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.1537: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.1538: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1539: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2
Source.1540: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1541: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.1542: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1543: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.1544: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.1545: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.1546: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.1547: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.1548: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1549: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.1550: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.1551: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1552: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.1553: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.1554: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.1555: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1556: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1557: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.1558: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1559: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.1560: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1561: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1562: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1563: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.1564: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.1565: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial
Source.1566: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1567: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.1568: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1
Source.1569: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.1570: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1571: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.1572: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1573: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.1574: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.1575: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1576: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.1577: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1578: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.1579: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1580: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.1581: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1582: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.1583: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1584: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.1585: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1586: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.1587: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1588: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.1589: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1590: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.1591: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.1592: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1593: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.1594: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.1595: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.1596: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.1597: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1598: DFBPPR3653 ---- Plant proteins ---- Protein YABBY 7
Source.1599: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1600: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.1601: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.1602: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1603: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.1604: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.1605: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.1606: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1607: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1608: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1609: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.1610: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1611: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.1612: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1613: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1614: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.1615: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.1616: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.1617: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.1618: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7
Source.1619: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.1620: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.1621: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.1622: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3
Source.1623: DFBPPR3701 ---- Plant proteins ---- Non-specific lipid-transfer protein C4
Source.1624: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.1625: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.1626: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.1627: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.1628: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.1629: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.1630: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.1631: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.1632: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.1633: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1634: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.1635: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.1636: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.1637: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.1638: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin
Source.1639: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.1640: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.1641: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1642: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.1643: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.1644: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.1645: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.1646: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.1647: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.1648: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.1649: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.1650: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.1651: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.1652: DFBPPR3763 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.1653: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.1654: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1655: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.1656: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.1657: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.1658: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.1659: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.1660: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.1661: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.1662: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.1663: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.1664: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial
Source.1665: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1666: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.1667: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42
Source.1668: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.1669: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1670: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.1671: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.1672: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.1673: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6
Source.1674: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.1675: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.1676: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.1677: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1678: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.1679: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.1680: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.1681: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.1682: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.1683: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.1684: DFBPPR3826 ---- Plant proteins ---- Profilin LP04
Source.1685: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.1686: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.1687: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.1688: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.1689: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.1690: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.1691: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.1692: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.1693: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.1694: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.1695: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.1696: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62
Source.1697: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.1698: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.1699: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.1700: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.1701: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.1702: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.1703: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.1704: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.1705: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1706: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.1707: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.1708: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.1709: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.1710: DFBPPR3884 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.1711: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.1712: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.1713: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.1714: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.1715: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.1716: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.1717: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.1718: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.1719: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.1720: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.1721: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.1722: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.1723: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.1724: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1725: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1726: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.1727: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.1728: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.1729: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.1730: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.1731: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.1732: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1733: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1734: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.1735: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.1736: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.1737: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.1738: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.1739: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3
Source.1740: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.1741: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.1742: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.1743: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.1744: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial
Source.1745: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.1746: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.1747: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.1748: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.1749: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.1750: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.1751: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial
Source.1752: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.1753: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1754: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1755: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.1756: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4
Source.1757: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.1758: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1759: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.1760: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.1761: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.1762: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1763: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.1764: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.1765: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.1766: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.1767: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.1768: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.1769: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1770: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.1771: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.1772: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.1773: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.1774: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.1775: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.1776: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.1777: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.1778: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1779: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.1780: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.1781: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5
Source.1782: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.1783: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1784: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.1785: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.1786: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.1787: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.1788: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.1789: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.1790: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.1791: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1792: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.1793: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.1794: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.1795: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1796: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.1797: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.1798: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.1799: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.1800: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.1801: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.1802: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.1803: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.1804: DFBPPR4051 ---- Plant proteins ---- 40S ribosomal protein S3a
Source.1805: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.1806: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.1807: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.1808: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25
Source.1809: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.1810: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.1811: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.1812: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1813: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.1814: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.1815: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.1816: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.1817: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.1818: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.1819: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.1820: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1821: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.1822: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.1823: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.1824: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.1825: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.1826: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.1827: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.1828: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.1829: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.1830: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1831: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.1832: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1833: DFBPPR4101 ---- Plant proteins ---- Succinate dehydrogenase subunit 7, mitochondrial
Source.1834: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.1835: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.1836: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1837: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.1838: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.1839: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.1840: DFBPPR4112 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.1841: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.1842: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.1843: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.1844: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.1845: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.1846: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.1847: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.1848: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.1849: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1850: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.1851: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7
Source.1852: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.1853: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1854: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.1855: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1856: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1857: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1858: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1859: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.1860: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.1861: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.1862: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1863: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6
Source.1864: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.1865: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1
Source.1866: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1867: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1868: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.1869: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3
Source.1870: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4
Source.1871: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1872: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.1873: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1874: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.1875: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.1876: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1877: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1878: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.1879: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1880: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3
Source.1881: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1882: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1883: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1
Source.1884: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.1885: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1886: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.1887: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1888: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.1889: DFBPPR4207 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4B
Source.1890: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1891: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.1892: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1893: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.1894: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1895: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.1896: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1897: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.1898: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1899: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1900: DFBPPR4223 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim13
Source.1901: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.1902: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.1903: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.1904: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.1905: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.1906: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.1907: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1908: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.1909: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1910: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.1911: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.1912: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1913: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1914: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.1915: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.1916: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.1917: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.1918: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.1919: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.1920: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.1921: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.1922: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1923: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1924: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.1925: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1926: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1927: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.1928: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.1929: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.1930: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.1931: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.1932: DFBPPR4282 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.1933: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.1934: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1935: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.1936: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1937: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.1938: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.1939: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.1940: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.1941: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.1942: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1943: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.1944: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.1945: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.1946: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1947: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1948: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.1949: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1950: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.1951: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.1952: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.1953: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.1954: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.1955: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.1956: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1957: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.1958: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.1959: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1960: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.1961: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.1962: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.1963: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.1964: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.1965: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic
Source.1966: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.1967: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.1968: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.1969: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1970: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.1971: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.1972: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.1973: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.1974: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.1975: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.1976: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.1977: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.1978: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1979: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.1980: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.1981: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1982: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.1983: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14
Source.1984: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.1985: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.1986: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.1987: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.1988: DFBPPR4398 ---- Plant proteins ---- 40S ribosomal protein S16
Source.1989: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25
Source.1990: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.1991: DFBPPR4405 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4A
Source.1992: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D
Source.1993: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1994: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.1995: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.1996: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.1997: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1998: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.1999: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.2000: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.2001: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.2002: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.2003: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.2004: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.2005: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.2006: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.2007: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.2008: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2
Source.2009: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.2010: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.2011: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.2012: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.2013: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.2014: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.2015: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.2016: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.2017: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.2018: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.2019: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.2020: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.2021: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.2022: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.2023: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.2024: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.2025: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.2026: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.2027: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.2028: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.2029: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.2030: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.2031: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.2032: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.2033: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.2034: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.2035: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B
Source.2036: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.2037: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.2038: DFBPPR4509 ---- Plant proteins ---- Putative glycine-rich cell wall structural protein 1
Source.2039: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.2040: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.2041: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.2042: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.2043: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.2044: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.2045: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.2046: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.2047: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.2048: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.2049: DFBPPR4530 ---- Plant proteins ---- Water stress-inducible protein Rab21
Source.2050: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.2051: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2
Source.2052: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.2053: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.2054: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.2055: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.2056: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.2057: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.2058: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.2059: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.2060: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.2061: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.2062: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.2063: DFBPPR4558 ---- Plant proteins ---- 40S ribosomal protein S20
Source.2064: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.2065: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1
Source.2066: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.2067: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.2068: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.2069: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.2070: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.2071: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.2072: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.2073: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.2074: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.2075: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.2076: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.2077: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.2078: DFBPPR4599 ---- Plant proteins ---- 60S ribosomal protein L37a-1
Source.2079: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.2080: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.2081: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.2082: DFBPPR4612 ---- Plant proteins ---- 60S ribosomal protein L37a-2
Source.2083: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.2084: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.2085: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.2086: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.2087: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2088: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.2089: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19
Source.2090: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.2091: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.2092: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.2093: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.2094: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.2095: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.2096: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2097: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.2098: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.2099: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.2100: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.2101: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.2102: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.2103: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.2104: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.2105: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.2106: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.2107: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.2108: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.2109: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.2110: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.2111: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.2112: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1
Source.2113: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.2114: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.2115: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.2116: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.2117: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.2118: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.2119: DFBPPR4687 ---- Plant proteins ---- Dehydrin Rab16D
Source.2120: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.2121: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4
Source.2122: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.2123: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2
Source.2124: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.2125: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1
Source.2126: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6
Source.2127: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.2128: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.2129: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.2130: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.2131: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.2132: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.2133: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.2134: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.2135: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.2136: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.2137: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.2138: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.2139: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.2140: DFBPPR4738 ---- Plant proteins ---- Putative yippee-like protein Os10g0369500
Source.2141: DFBPPR4740 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 2
Source.2142: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.2143: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.2144: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.2145: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.2146: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.2147: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.2148: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.2149: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.2150: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.2151: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.2152: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.2153: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.2154: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.2155: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.2156: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.2157: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.2158: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A
Source.2159: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.2160: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G
Source.2161: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.2162: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H
Source.2163: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.2164: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.2165: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.2166: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31
Source.2167: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.2168: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2169: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.2170: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2
Source.2171: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100
Source.2172: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.2173: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.2174: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.2175: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.2176: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.2177: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.2178: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1
Source.2179: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.2180: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.2181: DFBPPR4820 ---- Plant proteins ---- B3 domain-containing protein Os10g0323000
Source.2182: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.2183: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.2184: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.2185: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.2186: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.2187: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.2188: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.2189: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.2190: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2
Source.2191: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400
Source.2192: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.2193: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.2194: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.2195: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1
Source.2196: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.2197: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.2198: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500
Source.2199: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.2200: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.2201: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.2202: DFBPPR4872 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0158600
Source.2203: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.2204: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.2205: DFBPPR4883 ---- Plant proteins ---- Uncharacterized protein Os02g0798400
Source.2206: DFBPPR4884 ---- Plant proteins ---- Uncharacterized protein Os02g0798501
Source.2207: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.2208: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.2209: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.2210: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.2211: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.2212: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1
Source.2213: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.2214: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.2215: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.2216: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.2217: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.2218: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.2219: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.2220: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.2221: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.2222: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.2223: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.2224: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.2225: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.2226: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.2227: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.2228: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.2229: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.2230: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.2231: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.2232: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.2233: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.2234: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.2235: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.2236: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.2237: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.2238: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.2239: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.2240: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.2241: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.2242: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.2243: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic
Source.2244: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2245: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.2246: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.2247: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.2248: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.2249: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.2250: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.2251: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.2252: DFBPPR4964 ---- Plant proteins ---- Soybean toxin 27 kDa chain
Source.2253: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.2254: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.2255: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.2256: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.2257: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.2258: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.2259: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.2260: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.2261: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.2262: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2263: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.2264: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.2265: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.2266: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1
Source.2267: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.2268: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2269: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.2270: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.2271: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.2272: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.2273: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.2274: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.2275: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2276: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.2277: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2278: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.2279: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2280: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.2281: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.2282: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.2283: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.2284: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.2285: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.2286: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.2287: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.2288: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.2289: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2290: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.2291: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2292: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.2293: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.2294: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.2295: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.2296: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.2297: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.2298: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.2299: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2300: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2301: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.2302: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.2303: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A
Source.2304: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.2305: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2306: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.2307: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.2308: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.2309: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2
Source.2310: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.2311: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2
Source.2312: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein
Source.2313: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.2314: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2315: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic
Source.2316: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2317: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.2318: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.2319: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2320: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3
Source.2321: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.2322: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.2323: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2324: DFBPPR5071 ---- Plant proteins ---- Leghemoglobin C1
Source.2325: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.2326: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.2327: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.2328: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.2329: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.2330: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.2331: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.2332: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.2333: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.2334: DFBPPR5087 ---- Plant proteins ---- Photosystem I iron-sulfur center
Source.2335: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.2336: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.2337: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.2338: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.2339: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2340: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.2341: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.2342: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2343: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.2344: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.2345: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22
Source.2346: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.2347: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.2348: DFBPPR5114 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.2349: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.2350: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2351: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.2352: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2353: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.2354: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.2355: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.2356: DFBPPR5134 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.2357: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.2358: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.2359: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.2360: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.2361: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.2362: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2363: DFBPPR5146 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.2364: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.2365: DFBPPR5150 ---- Plant proteins ---- Profilin-2
Source.2366: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2367: DFBPPR5154 ---- Plant proteins ---- Profilin-1
Source.2368: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.2369: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2370: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2371: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2372: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2373: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.2374: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.2375: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2376: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2377: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.2378: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.2379: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.2380: DFBPPR5191 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.2381: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.2382: DFBPPR5198 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.2383: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.2384: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2385: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.2386: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.2387: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.2388: DFBPPR5205 ---- Plant proteins ---- Urease
Source.2389: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.2390: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.2391: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.2392: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.2393: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.2394: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.2395: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.2396: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.2397: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.2398: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2399: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2400: DFBPPR5232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.2401: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.2402: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2403: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.2404: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic
Source.2405: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.2406: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein
Source.2407: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.2408: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.2409: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.2410: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic
Source.2411: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2412: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.2413: DFBPPR5281 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2414: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.2415: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.2416: DFBPPR5290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.2417: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2418: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.2419: DFBPPR5301 ---- Plant proteins ---- DNA-binding protein DRP90
Source.2420: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.2421: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2422: DFBPPR5311 ---- Plant proteins ---- Nodulin-20
Source.2423: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.2424: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.2425: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.2426: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.2427: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.2428: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.2429: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1
Source.2430: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.2431: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.2432: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1
Source.2433: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.2434: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.2435: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2436: DFBPPR5341 ---- Plant proteins ---- HMG1/2-like protein
Source.2437: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.2438: DFBPPR5344 ---- Plant proteins ---- Nodulin-16
Source.2439: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.2440: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.2441: DFBPPR5355 ---- Plant proteins ---- Early nodulin-93
Source.2442: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.2443: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D
Source.2444: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A
Source.2445: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B
Source.2446: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C
Source.2447: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.2448: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.2449: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.2450: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.2451: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.2452: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.2453: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.2454: DFBPPR5385 ---- Plant proteins ---- Profilin-5
Source.2455: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.2456: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2457: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.2458: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.2459: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2460: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.2461: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.2462: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.2463: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.2464: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.2465: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2466: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.2467: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2468: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.2469: DFBPPR5407 ---- Plant proteins ---- Profilin-2
Source.2470: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.2471: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.2472: DFBPPR5410 ---- Plant proteins ---- Profilin-4
Source.2473: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.2474: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.2475: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.2476: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.2477: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.2478: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.2479: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.2480: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.2481: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.2482: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.2483: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.2484: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.2485: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.2486: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase
Source.2487: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.2488: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.2489: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.2490: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.2491: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.2492: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.2493: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.2494: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.2495: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.2496: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2497: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.2498: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial
Source.2499: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.2500: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.2501: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.2502: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.2503: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.2504: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2505: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.2506: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.2507: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.2508: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.2509: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.2510: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.2511: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.2512: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2513: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.2514: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.2515: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.2516: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.2517: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.2518: DFBPPR5489 ---- Plant proteins ---- Histone H3.2
Source.2519: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.2520: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.2521: DFBPPR5494 ---- Plant proteins ---- Peroxidase 70
Source.2522: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.2523: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.2524: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66
Source.2525: DFBPPR5499 ---- Plant proteins ---- Dehydrin DHN1
Source.2526: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.2527: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2528: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.2529: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.2530: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme
Source.2531: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic
Source.2532: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.2533: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2534: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.2535: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.2536: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42
Source.2537: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2538: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.2539: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.2540: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic
Source.2541: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.2542: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.2543: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.2544: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.2545: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.2546: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase
Source.2547: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase
Source.2548: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2549: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase
Source.2550: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.2551: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.2552: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2553: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.2554: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.2555: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.2556: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.2557: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.2558: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.2559: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.2560: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.2561: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.2562: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.2563: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.2564: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.2565: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.2566: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.2567: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.2568: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.2569: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.2570: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.2571: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2572: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.2573: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.2574: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.2575: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.2576: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.2577: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.2578: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2579: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.2580: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2581: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.2582: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A
Source.2583: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.2584: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2585: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.2586: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.2587: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.2588: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.2589: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.2590: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.2591: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.2592: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.2593: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.2594: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.2595: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2596: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.2597: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.2598: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.2599: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.2600: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.2601: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.2602: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2603: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.2604: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6
Source.2605: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2606: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.2607: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2608: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.2609: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial
Source.2610: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.2611: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.2612: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2613: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.2614: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2615: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.2616: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2617: DFBPPR5648 ---- Plant proteins ---- AP-2 complex subunit sigma
Source.2618: DFBPPR5651 ---- Plant proteins ---- Cytochrome c
Source.2619: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.2620: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.2621: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.2622: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.2623: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.2624: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.2625: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2626: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.2627: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2628: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.2629: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial
Source.2630: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.2631: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial
Source.2632: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.2633: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.2634: DFBPPR5689 ---- Plant proteins ---- Profilin-9
Source.2635: DFBPPR5690 ---- Plant proteins ---- Profilin-7
Source.2636: DFBPPR5691 ---- Plant proteins ---- Profilin-10
Source.2637: DFBPPR5693 ---- Plant proteins ---- Profilin-11
Source.2638: DFBPPR5694 ---- Plant proteins ---- Profilin-8
Source.2639: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.2640: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2641: DFBPPR5697 ---- Plant proteins ---- Profilin-12
Source.2642: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.2643: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.2644: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.2645: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.2646: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2647: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2648: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.2649: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.2650: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.2651: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.2652: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.2653: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.2654: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2655: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2656: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.2657: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.2658: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2659: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.2660: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2661: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.2662: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.2663: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.2664: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2665: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.2666: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.2667: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.2668: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.2669: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.2670: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2671: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.2672: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.2673: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.2674: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17
Source.2675: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2676: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2677: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic
Source.2678: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.2679: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.2680: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.2681: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.2682: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.2683: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2684: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.2685: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.2686: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.2687: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2688: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.2689: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.2690: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.2691: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2692: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.2693: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2694: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.2695: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.2696: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2697: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.2698: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2699: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.2700: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.2701: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.2702: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.2703: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.2704: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.2705: DFBPPR5827 ---- Plant proteins ---- 60S acidic ribosomal protein P2B
Source.2706: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.2707: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.2708: DFBPPR5830 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.2709: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.2710: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.2711: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.2712: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.2713: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.2714: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.2715: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.2716: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12
Source.2717: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.2718: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.2719: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2720: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4
Source.2721: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.2722: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.2723: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6
Source.2724: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.2725: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2726: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.2727: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.2728: DFBPPR5865 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.2729: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16
Source.2730: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.2731: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2732: DFBPPR5877 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.2733: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.2734: DFBPPR5884 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.2735: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.2736: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.2737: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B
Source.2738: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.2739: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.2740: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.2741: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B
Source.2742: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1
Source.2743: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.2744: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A
Source.2745: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.2746: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.2747: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.2748: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.2749: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.2750: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.2751: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.2752: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.2753: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.2754: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.2755: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.2756: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.2757: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.2758: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.2759: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2760: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.2761: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2762: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.2763: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.2764: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.2765: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.2766: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.2767: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.2768: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2769: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.2770: DFBPPR5953 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.2771: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2
Source.2772: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.2773: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein
Source.2774: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2775: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.2776: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.2777: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.2778: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.2779: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.2780: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.2781: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.2782: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.2783: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.2784: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38
Source.2785: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.2786: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.2787: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.2788: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.2789: DFBPPR5997 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.2790: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.2791: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.2792: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.2793: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1
Source.2794: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.2795: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1
Source.2796: DFBPPR6007 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2797: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2798: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.2799: DFBPPR6024 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.2800: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2801: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.2802: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.2803: DFBPPR6031 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.2804: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.2805: DFBPPR6037 ---- Plant proteins ---- 19 kDa alpha-zein 19C2
Source.2806: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.2807: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.2808: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.2809: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1
Source.2810: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.2811: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2
Source.2812: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.2813: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.2814: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.2815: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.2816: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2817: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.2818: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2819: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.2820: DFBPPR6074 ---- Plant proteins ---- Trypsin inhibitor
Source.2821: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.2822: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.2823: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.2824: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1
Source.2825: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.2826: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.2827: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99
Source.2828: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.2829: DFBPPR6093 ---- Plant proteins ---- Zein-alpha 19C1
Source.2830: DFBPPR6094 ---- Plant proteins ---- Zein-alpha PZ19.1
Source.2831: DFBPPR6095 ---- Plant proteins ---- Zein-alpha A20
Source.2832: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.2833: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.2834: DFBPPR6101 ---- Plant proteins ---- Zein-alpha M6
Source.2835: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3
Source.2836: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1
Source.2837: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.2838: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2839: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1
Source.2840: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4
Source.2841: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.2842: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.2843: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.2844: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2845: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.2846: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.2847: DFBPPR6128 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2848: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13
Source.2849: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49
Source.2850: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.2851: DFBPPR6151 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.2852: DFBPPR6159 ---- Plant proteins ---- MFS14 protein
Source.2853: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B
Source.2854: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.2855: DFBPPR6172 ---- Plant proteins ---- Unknown protein from spot 207 of 2D-PAGE of etiolated coleoptile
Source.2856: DFBPPR6176 ---- Plant proteins ---- Unknown protein from spot 146 of 2D-PAGE of etiolated coleoptile
Source.2857: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile
Source.2858: DFBPPR6181 ---- Plant proteins ---- Unknown protein from spot 154 of 2D-PAGE of etiolated coleoptile
Source.2859: DFBPPR6204 ---- Plant proteins ---- Unknown protein from spot 258 of 2D-PAGE of etiolated coleoptile
Source.2860: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.2861: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2862: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2863: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.2864: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34
Source.2865: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.2866: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.2867: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.2868: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.2869: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.2870: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.2871: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2872: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.2873: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.2874: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.2875: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2876: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2877: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.2878: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.2879: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.2880: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.2881: DFBPPR6254 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.2882: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.2883: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.2884: DFBPPR6258 ---- Plant proteins ---- Histone H3.2
Source.2885: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.2886: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.2887: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2888: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.2889: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.2890: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.2891: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.2892: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic
Source.2893: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1
Source.2894: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2895: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.2896: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.2897: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1
Source.2898: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic
Source.2899: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2900: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.2901: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2902: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.2903: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.2904: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.2905: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2906: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.2907: DFBPPR6299 ---- Plant proteins ---- Photosystem I iron-sulfur center
Source.2908: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3
Source.2909: DFBPPR6301 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.2910: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.2911: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2912: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.2913: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.2914: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.2915: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.2916: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2917: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.2918: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2919: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.2920: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.2921: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2922: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2923: DFBPPR6331 ---- Plant proteins ---- Rac-like GTP-binding protein RHO1
Source.2924: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.2925: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2926: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.2927: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1
Source.2928: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.2929: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.2930: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2931: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.2932: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.2933: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.2934: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.2935: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic
Source.2936: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.2937: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.2938: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.2939: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.2940: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.2941: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.2942: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2943: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.2944: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.2945: DFBPPR6368 ---- Plant proteins ---- Provicilin
Source.2946: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.2947: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2948: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2949: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.2950: DFBPPR6381 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor IVB
Source.2951: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2952: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2953: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.2954: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.2955: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.2956: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2
Source.2957: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.2958: DFBPPR6397 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2959: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2960: DFBPPR6399 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor IVA
Source.2961: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.2962: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.2963: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.2964: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.2965: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.2966: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2967: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2968: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.2969: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.2970: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.2971: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.2972: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.2973: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2974: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2975: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2976: DFBPPR6427 ---- Plant proteins ---- MADS-box transcription factor 1
Source.2977: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206
Source.2978: DFBPPR6444 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.2979: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.2980: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.2981: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.2982: DFBPPR6461 ---- Plant proteins ---- Leghemoglobin Lb5-10
Source.2983: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.2984: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2985: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.2986: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.2987: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.2988: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.2989: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.2990: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic
Source.2991: DFBPPR6481 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.2992: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.2993: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.2994: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.2995: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.2996: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.2997: DFBPPR6495 ---- Plant proteins ---- Leghemoglobin Lb120-34
Source.2998: DFBPPR6496 ---- Plant proteins ---- Leghemoglobin Lb120-1
Source.2999: DFBPPR6497 ---- Plant proteins ---- Leghemoglobin Lb120-8
Source.3000: DFBPPR6498 ---- Plant proteins ---- Leghemoglobin Lb120-29
Source.3001: DFBPPR6502 ---- Plant proteins ---- Early light-induced protein, chloroplastic
Source.3002: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A
Source.3003: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.3004: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.3005: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.3006: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.3007: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.3008: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.3009: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3010: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.3011: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49
Source.3012: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.3013: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.3014: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.3015: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3016: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3017: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.3018: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.3019: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.3020: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4
Source.3021: DFBPPR6584 ---- Plant proteins ---- Organ-specific protein S2
Source.3022: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34
Source.3023: DFBPPR6594 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.3024: DFBPPR6595 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.3025: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein
Source.3026: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176
Source.3027: DFBPPR6619 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.3028: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28
Source.3029: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3030: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.3031: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.3032: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.3033: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.3034: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.3035: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3036: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.3037: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1
Source.3038: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.3039: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3040: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3041: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.3042: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.3043: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.3044: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.3045: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3046: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.3047: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.3048: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.3049: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.3050: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.3051: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.3052: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.3053: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.3054: DFBPPR6667 ---- Plant proteins ---- Cytochrome c
Source.3055: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3056: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.3057: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.3058: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.3059: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3060: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.3061: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.3062: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.3063: DFBPPR6686 ---- Plant proteins ---- Histone H3.2
Source.3064: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.3065: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.3066: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.3067: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3068: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.3069: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.3070: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.3071: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.3072: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2
Source.3073: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.3074: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.3075: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3076: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.3077: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.3078: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.3079: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.3080: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.3081: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3082: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.3083: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.3084: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3085: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.3086: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.3087: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.3088: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.3089: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.3090: DFBPPR6742 ---- Plant proteins ---- Alpha-1-purothionin
Source.3091: DFBPPR6752 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 3
Source.3092: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic
Source.3093: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.3094: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3095: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.3096: DFBPPR6766 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3097: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.3098: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3099: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3100: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.3101: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3102: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.3103: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3104: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3105: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.3106: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.3107: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.3108: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.3109: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.3110: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.3111: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3112: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.3113: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3114: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3115: DFBPPR6808 ---- Plant proteins ---- Profilin-2
Source.3116: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3117: DFBPPR6813 ---- Plant proteins ---- Profilin-3
Source.3118: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.3119: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.3120: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3121: DFBPPR6819 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3122: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3123: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.3124: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.3125: DFBPPR6829 ---- Plant proteins ---- Cold-shock protein CS120
Source.3126: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3127: DFBPPR6832 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.3128: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512
Source.3129: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3130: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.3131: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.3132: DFBPPR6848 ---- Plant proteins ---- Cold shock protein CS66
Source.3133: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3134: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1
Source.3135: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1
Source.3136: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3137: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.3138: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.3139: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.3140: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A
Source.3141: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3142: DFBPPR6869 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.3143: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3144: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3145: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.3146: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3147: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3148: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.3149: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor
Source.3150: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1
Source.3151: DFBPPR6892 ---- Plant proteins ---- 60S acidic ribosomal protein P2
Source.3152: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial
Source.3153: DFBPPR6896 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.3154: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3155: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3156: DFBPPR6946 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3157: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.3158: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3159: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.3160: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I
Source.3161: DFBPPR6973 ---- Plant proteins ---- Avenin-like a6
Source.3162: DFBPPR6975 ---- Plant proteins ---- Gamma-gliadin
Source.3163: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3164: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2
Source.3165: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.3166: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.3167: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.3168: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.3169: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.3170: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3171: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3172: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.3173: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3174: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.3175: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3176: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.3177: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3178: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.3179: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.3180: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.3181: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.3182: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.3183: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1
Source.3184: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe
Source.3185: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.3186: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.3187: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3188: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.3189: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.3190: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.3191: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.3192: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.3193: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.3194: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3195: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.3196: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.3197: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3198: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.3199: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.3200: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.3201: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3202: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.3203: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3204: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.3205: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3206: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3207: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.3208: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.3209: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.3210: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.3211: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3212: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3213: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.3214: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.3215: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3216: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3217: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.3218: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3219: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3220: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.3221: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.3222: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.3223: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.3224: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.3225: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.3226: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.3227: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.3228: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3229: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.3230: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.3231: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3232: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.3233: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.3234: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.3235: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.3236: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3237: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.3238: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.3239: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3240: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.3241: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.3242: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.3243: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.3244: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.3245: DFBPPR7137 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3246: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.3247: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.3248: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.3249: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.3250: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.3251: DFBPPR7146 ---- Plant proteins ---- Non-specific lipid-transfer protein Cw18
Source.3252: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.3253: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3254: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3255: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.3256: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.3257: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.3258: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3259: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.3260: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.3261: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.3262: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3263: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.3264: DFBPPR7172 ---- Plant proteins ---- Barwin
Source.3265: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.3266: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.3267: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.3268: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3269: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.3270: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.3271: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.3272: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3273: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic
Source.3274: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3275: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc
Source.3276: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.3277: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.3278: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.3279: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.3280: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.3281: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.3282: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.3283: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.3284: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3285: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic
Source.3286: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.3287: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.3288: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.3289: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3290: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.3291: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.3292: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3293: DFBPPR7217 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.3294: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3295: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.3296: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3297: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.3298: DFBPPR7223 ---- Plant proteins ---- Ferredoxin
Source.3299: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3300: DFBPPR7229 ---- Plant proteins ---- Histone H3.3
Source.3301: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.3302: DFBPPR7232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.3303: DFBPPR7234 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3304: DFBPPR7235 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD2
Source.3305: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.3306: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.3307: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3308: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3309: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.3310: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.3311: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.3312: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.3313: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.3314: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.3315: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.3316: DFBPPR7281 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3317: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1
Source.3318: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.3319: DFBPPR7312 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3320: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3321: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3322: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.3323: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C
Source.3324: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B
Source.3325: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A
Source.3326: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B
Source.3327: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.3328: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.3329: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.3330: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.3331: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.3332: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.3333: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.3334: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.3335: DFBPPR7406 ---- Plant proteins ---- Cytochrome c
Source.3336: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.3337: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.3338: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.3339: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.3340: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.3341: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.3342: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.3343: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.3344: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.3345: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.3346: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.3347: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.3348: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.3349: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.3350: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3351: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3352: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.3353: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.3354: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.3355: DFBPPR7448 ---- Plant proteins ---- Histone H3.2
Source.3356: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3357: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.3358: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase
Source.3359: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.3360: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3361: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.3362: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.3363: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.3364: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.3365: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3366: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.3367: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.3368: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.3369: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.3370: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.3371: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25
Source.3372: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.3373: DFBPPR7481 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.3374: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.3375: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.3376: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.3377: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.3378: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.3379: DFBPPR7499 ---- Plant proteins ---- Ferredoxin
Source.3380: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.3381: DFBPPR7502 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3382: DFBPPR7508 ---- Plant proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5
Source.3383: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.3384: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.3385: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.3386: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3387: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.3388: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.3389: DFBPPR7547 ---- Plant proteins ---- 60S ribosomal protein L13-2
Source.3390: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.3391: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.3392: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.3393: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.3394: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.3395: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.3396: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2
Source.3397: DFBPPR7606 ---- Milk proteins ---- Osteopontin
Source.3398: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.3399: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.3400: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.3401: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.3402: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.3403: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.3404: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.3405: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.3406: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.3407: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.3408: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.3409: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator
Source.3410: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.3411: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.3412: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.3413: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.3414: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.3415: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6
Source.3416: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.3417: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3418: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.3419: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.3420: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.3421: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.3422: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.3423: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.3424: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.3425: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein
Source.3426: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein
Source.3427: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.3428: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.3429: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein
Source.3430: DFBPPR7690 ---- Milk proteins ---- Lactadherin
Source.3431: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein
Source.3432: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.3433: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein
Source.3434: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.3435: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.3436: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.3437: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.3438: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.3439: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.3440: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.3441: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.3442: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.3443: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.3444: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3445: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.3446: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.3447: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2
Source.3448: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1
Source.3449: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.3450: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.3451: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4
Source.3452: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.3453: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.3454: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.3455: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.3456: DFBPPR8187 ---- Plant proteins ---- Cytochrome c
Source.3457: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3458: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.3459: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.3460: DFBPPR8192 ---- Plant proteins ---- 2S albumin
Source.3461: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.3462: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.3463: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.3464: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.3465: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.3466: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.3467: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3468: DFBPPR8358 ---- Plant proteins ---- Cytochrome c
Source.3469: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.3470: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3471: DFBPPR8377 ---- Plant proteins ---- Profilin
Source.3472: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1
Source.3473: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2
Source.3474: DFBPPR8382 ---- Plant proteins ---- Cationic peroxidase 1
Source.3475: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.3476: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.3477: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.3478: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.3479: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.3480: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.3481: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.3482: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.3483: DFBPPR8423 ---- Plant proteins ---- Cytochrome c
Source.3484: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3485: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3486: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.3487: DFBPPR8436 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor
Source.3488: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.3489: DFBPPR8439 ---- Plant proteins ---- Albumin-2
Source.3490: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.3491: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase
Source.3492: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.3493: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.3494: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.3495: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.3496: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3497: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.3498: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3499: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.3500: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.3501: DFBPPR8465 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3502: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.3503: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.3504: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.3505: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3506: DFBPPR8482 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3507: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein
Source.3508: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.3509: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.3510: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.3511: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.3512: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.3513: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.3514: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.3515: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.3516: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.3517: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.3518: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.3519: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.3520: DFBPPR8509 ---- Milk proteins ---- Angiogenin-2
Source.3521: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3522: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.3523: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.3524: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.3525: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.3526: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.3527: DFBPPR8525 ---- Milk proteins ---- Glycolactin
Source.3528: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.3529: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.3530: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.3531: DFBPPR15938 ---- Animal proteins ---- Apolipoprotein A-II
Source.3532: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.3533: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.3534: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.3535: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.3536: DFBPPR15944 ---- Animal proteins ---- Ras-related protein Rab-13
Source.3537: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3538: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.3539: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.3540: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.3541: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.3542: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.3543: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.3544: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.3545: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.3546: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3547: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.3548: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.3549: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3550: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.3551: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.3552: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.3553: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.3554: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.3555: DFBPPR15977 ---- Animal proteins ---- Cytochrome c
Source.3556: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.3557: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.3558: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.3559: DFBPPR15982 ---- Animal proteins ---- Triadin
Source.3560: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.3561: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.3562: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.3563: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.3564: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.3565: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3566: DFBPPR15998 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.3567: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.3568: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.3569: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3570: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.3571: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.3572: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.3573: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.3574: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3575: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3576: DFBPPR16013 ---- Animal proteins ---- Osteocalcin
Source.3577: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3578: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.3579: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3580: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.3581: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.3582: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.3583: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3584: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3585: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.3586: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.3587: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.3588: DFBPPR16036 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.3589: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.3590: DFBPPR16042 ---- Animal proteins ---- Caveolin-2
Source.3591: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.3592: DFBPPR16044 ---- Animal proteins ---- High mobility group protein B1
Source.3593: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.3594: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3595: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3596: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.3597: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3598: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.3599: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.3600: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.3601: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.3602: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.3603: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.3604: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.3605: DFBPPR16065 ---- Animal proteins ---- Caspase-3
Source.3606: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.3607: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.3608: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.3609: DFBPPR16078 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.3610: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3611: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.3612: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.3613: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.3614: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.3615: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.3616: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.3617: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.3618: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.3619: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.3620: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3621: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.3622: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3623: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.3624: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.3625: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.3626: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3627: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.3628: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.3629: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.3630: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.3631: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.3632: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.3633: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.3634: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.3635: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.3636: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.3637: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.3638: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.3639: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.3640: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.3641: DFBPPR16139 ---- Animal proteins ---- Lipocalin Can f 6.0101
Source.3642: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.3643: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.3644: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.3645: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.3646: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3647: DFBPPR16154 ---- Animal proteins ---- Apolipoprotein C-II
Source.3648: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.3649: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.3650: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.3651: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.3652: DFBPPR16166 ---- Animal proteins ---- Ras-related protein Rab-12
Source.3653: DFBPPR16168 ---- Animal proteins ---- Annexin A2
Source.3654: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.3655: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.3656: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.3657: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.3658: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.3659: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.3660: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.3661: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.3662: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.3663: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.3664: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.3665: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.3666: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3667: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.3668: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.3669: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.3670: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.3671: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3672: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.3673: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3674: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3675: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3676: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.3677: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.3678: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.3679: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3680: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.3681: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.3682: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3683: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.3684: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.3685: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.3686: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.3687: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.3688: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.3689: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.3690: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.3691: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.3692: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.3693: DFBPPR16235 ---- Animal proteins ---- Serum amyloid A protein
Source.3694: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.3695: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.3696: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.3697: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3698: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.3699: DFBPPR16247 ---- Animal proteins ---- Recoverin
Source.3700: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3701: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.3702: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.3703: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3704: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.3705: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.3706: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3707: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.3708: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.3709: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.3710: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3711: DFBPPR16267 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.3712: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3713: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.3714: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.3715: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta
Source.3716: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.3717: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.3718: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3719: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.3720: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.3721: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.3722: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3723: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.3724: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2
Source.3725: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3726: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.3727: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3728: DFBPPR16301 ---- Animal proteins ---- Major allergen Can f 1
Source.3729: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.3730: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.3731: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25
Source.3732: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.3733: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3734: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.3735: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.3736: DFBPPR16315 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3737: DFBPPR16316 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3738: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.3739: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.3740: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.3741: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.3742: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.3743: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.3744: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3745: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.3746: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.3747: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.3748: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.3749: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3750: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.3751: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.3752: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.3753: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.3754: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3755: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3756: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.3757: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.3758: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.3759: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.3760: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.3761: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.3762: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.3763: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.3764: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.3765: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.3766: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3767: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.3768: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.3769: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.3770: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.3771: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.3772: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.3773: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.3774: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.3775: DFBPPR16494 ---- Animal proteins ---- C-C motif chemokine 25
Source.3776: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.3777: DFBPPR16497 ---- Animal proteins ---- Interleukin-5
Source.3778: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.3779: DFBPPR16500 ---- Animal proteins ---- C-C motif chemokine 5
Source.3780: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3781: DFBPPR16505 ---- Animal proteins ---- Agouti-signaling protein
Source.3782: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.3783: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.3784: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.3785: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.3786: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.3787: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.3788: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.3789: DFBPPR16524 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.3790: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3791: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.3792: DFBPPR16528 ---- Animal proteins ---- Signal recognition particle 14 kDa protein
Source.3793: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.3794: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.3795: DFBPPR16531 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.3796: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.3797: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.3798: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.3799: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3800: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83
Source.3801: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.3802: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.3803: DFBPPR16549 ---- Animal proteins ---- Interleukin-1 alpha
Source.3804: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.3805: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.3806: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3807: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.3808: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.3809: DFBPPR16558 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.3810: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.3811: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.3812: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2
Source.3813: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.3814: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3815: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3816: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.3817: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.3818: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.3819: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3820: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.3821: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.3822: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.3823: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.3824: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.3825: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.3826: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.3827: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.3828: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.3829: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.3830: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.3831: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.3832: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4
Source.3833: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.3834: DFBPPR16621 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3835: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.3836: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.3837: DFBPPR16627 ---- Animal proteins ---- 60S ribosomal protein L15
Source.3838: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.3839: DFBPPR16638 ---- Animal proteins ---- Synapsin-1
Source.3840: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.3841: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.3842: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3843: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.3844: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.3845: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.3846: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.3847: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.3848: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1
Source.3849: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.3850: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3
Source.3851: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.3852: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.3853: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.3854: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3
Source.3855: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.3856: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.3857: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.3858: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3859: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.3860: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.3861: DFBPPR16723 ---- Animal proteins ---- Ig heavy chain V region GOM
Source.3862: DFBPPR16734 ---- Animal proteins ---- 40S ribosomal protein S11
Source.3863: DFBPPR16747 ---- Animal proteins ---- Pleckstrin
Source.3864: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3865: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.3866: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.3867: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.3868: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.3869: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.3870: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.3871: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.3872: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.3873: DFBPPR16768 ---- Animal proteins ---- Cytochrome c
Source.3874: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.3875: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.3876: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.3877: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.3878: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.3879: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3880: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3881: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.3882: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.3883: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.3884: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3885: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.3886: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.3887: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3888: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3889: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3890: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.3891: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.3892: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II
Source.3893: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.3894: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3895: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.3896: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.3897: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3898: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6
Source.3899: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.3900: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.3901: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.3902: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.3903: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.3904: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.3905: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.3906: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.3907: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial
Source.3908: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.3909: DFBPPR16865 ---- Animal proteins ---- Apolipoprotein E
Source.3910: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.3911: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.3912: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.3913: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.3914: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3915: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3916: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.3917: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.3918: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3919: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.3920: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.3921: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.3922: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.3923: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein
Source.3924: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.3925: DFBPPR16906 ---- Animal proteins ---- High mobility group protein B1
Source.3926: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3927: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.3928: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3929: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.3930: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.3931: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.3932: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3933: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.3934: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.3935: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.3936: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3937: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.3938: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.3939: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3940: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.3941: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.3942: DFBPPR16937 ---- Animal proteins ---- GTP:AMP phosphotransferase AK3, mitochondrial
Source.3943: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3944: DFBPPR16939 ---- Animal proteins ---- Histone H3.3
Source.3945: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.3946: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.3947: DFBPPR16946 ---- Animal proteins ---- Recoverin
Source.3948: DFBPPR16947 ---- Animal proteins ---- Polyadenylate-binding protein 2
Source.3949: DFBPPR16952 ---- Animal proteins ---- Annexin A2
Source.3950: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.3951: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.3952: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3953: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.3954: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3955: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.3956: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.3957: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.3958: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.3959: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.3960: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.3961: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.3962: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3963: DFBPPR16972 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-2
Source.3964: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.3965: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.3966: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3967: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.3968: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.3969: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.3970: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.3971: DFBPPR16988 ---- Animal proteins ---- Protachykinin-1
Source.3972: DFBPPR16989 ---- Animal proteins ---- Cytochrome c
Source.3973: DFBPPR16991 ---- Animal proteins ---- Osteocalcin
Source.3974: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.3975: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1
Source.3976: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3977: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.3978: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3979: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.3980: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.3981: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.3982: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.3983: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.3984: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3985: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.3986: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.3987: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.3988: DFBPPR17023 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.3989: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.3990: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.3991: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3992: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.3993: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.3994: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2
Source.3995: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3996: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.3997: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3998: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.3999: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.4000: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.4001: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.4002: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.4003: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4004: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.4005: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.4006: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.4007: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.4008: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.4009: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.4010: DFBPPR17058 ---- Animal proteins ---- Ras-related protein Rab-13
Source.4011: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.4012: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.4013: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4014: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.4015: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.4016: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.4017: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.4018: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.4019: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4020: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.4021: DFBPPR17076 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.4022: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.4023: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.4024: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.4025: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.4026: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.4027: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.4028: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.4029: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.4030: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.4031: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.4032: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.4033: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4034: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4035: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.4036: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4037: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4038: DFBPPR17116 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.4039: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.4040: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.4041: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.4042: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2
Source.4043: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.4044: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.4045: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.4046: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4047: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.4048: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.4049: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4050: DFBPPR17132 ---- Animal proteins ---- Apolipoprotein A-II
Source.4051: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.4052: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.4053: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.4054: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.4055: DFBPPR17140 ---- Animal proteins ---- Adiponectin
Source.4056: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.4057: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4058: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.4059: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1
Source.4060: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1
Source.4061: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1
Source.4062: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.4063: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.4064: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.4065: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.4066: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.4067: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.4068: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.4069: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.4070: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.4071: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.4072: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.4073: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.4074: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.4075: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.4076: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.4077: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.4078: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.4079: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4080: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4081: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.4082: DFBPPR17245 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.4083: DFBPPR17254 ---- Animal proteins ---- Zinc finger protein SNAI2
Source.4084: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.4085: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.4086: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.4087: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.4088: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.4089: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.4090: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.4091: DFBPPR17276 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.4092: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.4093: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.4094: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.4095: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.4096: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.4097: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.4098: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.4099: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.4100: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.4101: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.4102: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.4103: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.4104: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.4105: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.4106: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.4107: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.4108: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.4109: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.4110: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.4111: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.4112: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.4113: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.4114: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.4115: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.4116: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.4117: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.4118: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.4119: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.4120: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.4121: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.4122: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.4123: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.4124: DFBPPR17334 ---- Animal proteins ---- Prohibitin
Source.4125: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.4126: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.4127: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.4128: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.4129: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.4130: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1
Source.4131: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.4132: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.4133: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.4134: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.4135: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.4136: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.4137: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.4138: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.4139: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.4140: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.4141: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1
Source.4142: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.4143: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.4144: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.4145: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.4146: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.4147: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.4148: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.4149: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.4150: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.4151: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.4152: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.4153: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.4154: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.4155: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.4156: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.4157: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.4158: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.4159: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.4160: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.4161: DFBPPR17402 ---- Animal proteins ---- High mobility group protein B2
Source.4162: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.4163: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.4164: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.4165: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.4166: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.4167: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.4168: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.4169: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.4170: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.4171: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1
Source.4172: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.4173: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.4174: DFBPPR17420 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.4175: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.4176: DFBPPR17423 ---- Animal proteins ---- Furin
Source.4177: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.4178: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.4179: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.4180: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.4181: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.4182: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4183: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.4184: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.4185: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.4186: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1
Source.4187: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.4188: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.4189: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.4190: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.4191: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.4192: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.4193: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.4194: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.4195: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.4196: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4197: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.4198: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.4199: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.4200: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.4201: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.4202: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.4203: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.4204: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.4205: DFBPPR17466 ---- Animal proteins ---- N-alpha-acetyltransferase 50
Source.4206: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.4207: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.4208: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.4209: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.4210: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.4211: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.4212: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.4213: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.4214: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.4215: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.4216: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.4217: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.4218: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.4219: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.4220: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.4221: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.4222: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.4223: DFBPPR17500 ---- Animal proteins ---- Lecithin retinol acyltransferase
Source.4224: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.4225: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.4226: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.4227: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.4228: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.4229: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.4230: DFBPPR17517 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.4231: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.4232: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.4233: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.4234: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1
Source.4235: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.4236: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.4237: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.4238: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.4239: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.4240: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.4241: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.4242: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3
Source.4243: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.4244: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.4245: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.4246: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.4247: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.4248: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.4249: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.4250: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.4251: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.4252: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.4253: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.4254: DFBPPR17577 ---- Animal proteins ---- Interleukin-1 alpha
Source.4255: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.4256: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.4257: DFBPPR17581 ---- Animal proteins ---- Histone H3.1
Source.4258: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.4259: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.4260: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.4261: DFBPPR17588 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.4262: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.4263: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.4264: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.4265: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.4266: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4267: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.4268: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.4269: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.4270: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.4271: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.4272: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.4273: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.4274: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.4275: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.4276: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.4277: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.4278: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.4279: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.4280: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.4281: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.4282: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial
Source.4283: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.4284: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.4285: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.4286: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.4287: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.4288: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.4289: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.4290: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.4291: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.4292: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.4293: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.4294: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.4295: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.4296: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.4297: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.4298: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.4299: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4300: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.4301: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.4302: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.4303: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.4304: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10
Source.4305: DFBPPR17752 ---- Animal proteins ---- Follistatin
Source.4306: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.4307: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1
Source.4308: DFBPPR17756 ---- Animal proteins ---- Ras-related protein Rab-3B
Source.4309: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.4310: DFBPPR17758 ---- Animal proteins ---- Matrix Gla protein
Source.4311: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.4312: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.4313: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.4314: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4
Source.4315: DFBPPR17765 ---- Animal proteins ---- Ras-related protein Rab-27B
Source.4316: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.4317: DFBPPR17769 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.4318: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.4319: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.4320: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.4321: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.4322: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.4323: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.4324: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.4325: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.4326: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.4327: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.4328: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.4329: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.4330: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.4331: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.4332: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.4333: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.4334: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.4335: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.4336: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1
Source.4337: DFBPPR17817 ---- Animal proteins ---- Peroxiredoxin-2
Source.4338: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.4339: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.4340: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.4341: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.4342: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.4343: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.4344: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.4345: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.4346: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.4347: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.4348: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.4349: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.4350: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4351: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.4352: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.4353: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.4354: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.4355: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.4356: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.4357: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.4358: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.4359: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.4360: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.4361: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.4362: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1
Source.4363: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase
Source.4364: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.4365: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.4366: DFBPPR17871 ---- Animal proteins ---- Ras-related protein Rab-11B
Source.4367: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.4368: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.4369: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.4370: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor
Source.4371: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.4372: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.4373: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.4374: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.4375: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.4376: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.4377: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.4378: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4379: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.4380: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.4381: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.4382: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.4383: DFBPPR17912 ---- Animal proteins ---- Histone H3.2
Source.4384: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.4385: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.4386: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.4387: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.4388: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.4389: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P
Source.4390: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.4391: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.4392: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.4393: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.4394: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.4395: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.4396: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.4397: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.4398: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.4399: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.4400: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9
Source.4401: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.4402: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.4403: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.4404: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.4405: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.4406: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.4407: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.4408: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.4409: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.4410: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.4411: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.4412: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.4413: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.4414: DFBPPR17970 ---- Animal proteins ---- Profilin-2
Source.4415: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.4416: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.4417: DFBPPR17974 ---- Animal proteins ---- Mimecan
Source.4418: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.4419: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.4420: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.4421: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.4422: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.4423: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.4424: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.4425: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.4426: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.4427: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.4428: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase
Source.4429: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.4430: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.4431: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.4432: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.4433: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.4434: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.4435: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.4436: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.4437: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.4438: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.4439: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.4440: DFBPPR18022 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.4441: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.4442: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.4443: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.4444: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.4445: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.4446: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4447: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1
Source.4448: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial
Source.4449: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.4450: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4451: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8
Source.4452: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.4453: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.4454: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.4455: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.4456: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.4457: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.4458: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.4459: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.4460: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.4461: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta
Source.4462: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta
Source.4463: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.4464: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.4465: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4466: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.4467: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.4468: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.4469: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.4470: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4471: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.4472: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.4473: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.4474: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.4475: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.4476: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.4477: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.4478: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.4479: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29
Source.4480: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.4481: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.4482: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a
Source.4483: DFBPPR18118 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 8
Source.4484: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.4485: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.4486: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1
Source.4487: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.4488: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.4489: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.4490: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.4491: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.4492: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.4493: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.4494: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.4495: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.4496: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.4497: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.4498: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.4499: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.4500: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.4501: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.4502: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.4503: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.4504: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.4505: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.4506: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.4507: DFBPPR18172 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.4508: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.4509: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.4510: DFBPPR18187 ---- Animal proteins ---- Lithostathine
Source.4511: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.4512: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.4513: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2
Source.4514: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4515: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.4516: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.4517: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.4518: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.4519: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.4520: DFBPPR18207 ---- Animal proteins ---- Interleukin-7
Source.4521: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4
Source.4522: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.4523: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.4524: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.4525: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.4526: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.4527: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B
Source.4528: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.4529: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.4530: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4531: DFBPPR18232 ---- Animal proteins ---- Ragulator complex protein LAMTOR1
Source.4532: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.4533: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.4534: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.4535: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.4536: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.4537: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.4538: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.4539: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a
Source.4540: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3
Source.4541: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.4542: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.4543: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.4544: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.4545: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.4546: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41
Source.4547: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.4548: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.4549: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.4550: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.4551: DFBPPR18274 ---- Animal proteins ---- Histone deacetylase 8
Source.4552: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.4553: DFBPPR18280 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.4554: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.4555: DFBPPR18284 ---- Animal proteins ---- ATP synthase subunit epsilon, mitochondrial
Source.4556: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.4557: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.4558: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.4559: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.4560: DFBPPR18292 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 11
Source.4561: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.4562: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.4563: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.4564: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.4565: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.4566: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.4567: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.4568: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.4569: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7
Source.4570: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.4571: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.4572: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.4573: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1
Source.4574: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.4575: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.4576: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.4577: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.4578: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.4579: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.4580: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.4581: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.4582: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.4583: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.4584: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.4585: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.4586: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.4587: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.4588: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4589: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.4590: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.4591: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.4592: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.4593: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.4594: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.4595: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.4596: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.4597: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.4598: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.4599: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.4600: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.4601: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.4602: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.4603: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.4604: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.4605: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4606: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4607: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1
Source.4608: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.4609: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.4610: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.4611: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.4612: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.4613: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.4614: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.4615: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.4616: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.4617: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.4618: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen
Source.4619: DFBPPR18407 ---- Animal proteins ---- DNA damage-inducible transcript 4 protein
Source.4620: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.4621: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.4622: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.4623: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.4624: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.4625: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.4626: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.4627: DFBPPR18427 ---- Animal proteins ---- Cystatin-C
Source.4628: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.4629: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.4630: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.4631: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.4632: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.4633: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.4634: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12
Source.4635: DFBPPR18441 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.4636: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.4637: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.4638: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.4639: DFBPPR18451 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.4640: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.4641: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.4642: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.4643: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.4644: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.4645: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.4646: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.4647: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.4648: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.4649: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.4650: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.4651: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.4652: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.4653: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.4654: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.4655: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.4656: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.4657: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.4658: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.4659: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.4660: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.4661: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.4662: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.4663: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.4664: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6
Source.4665: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.4666: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.4667: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial
Source.4668: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.4669: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.4670: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.4671: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C
Source.4672: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.4673: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1
Source.4674: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.4675: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.4676: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.4677: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.4678: DFBPPR18528 ---- Animal proteins ---- 14-3-3 protein sigma
Source.4679: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.4680: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.4681: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.4682: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.4683: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.4684: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.4685: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.4686: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.4687: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.4688: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.4689: DFBPPR18544 ---- Animal proteins ---- ATP synthase subunit e, mitochondrial
Source.4690: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.4691: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.4692: DFBPPR18549 ---- Animal proteins ---- Serum amyloid A protein
Source.4693: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.4694: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.4695: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.4696: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22
Source.4697: DFBPPR18563 ---- Animal proteins ---- Collectin-43
Source.4698: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal
Source.4699: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.4700: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.4701: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.4702: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.4703: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1
Source.4704: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.4705: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.4706: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.4707: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.4708: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.4709: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.4710: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.4711: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.4712: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.4713: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.4714: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.4715: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.4716: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.4717: DFBPPR18623 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.4718: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.4719: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.4720: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.4721: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.4722: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.4723: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.4724: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB
Source.4725: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.4726: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.4727: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.4728: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.4729: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.4730: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.4731: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.4732: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.4733: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.4734: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.4735: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.4736: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.4737: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.4738: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5
Source.4739: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.4740: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.4741: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.4742: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.4743: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.4744: DFBPPR18728 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5
Source.4745: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.4746: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.4747: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.4748: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.4749: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.4750: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.4751: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.4752: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.4753: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.4754: DFBPPR18753 ---- Animal proteins ---- Endosome-associated-trafficking regulator 1
Source.4755: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.4756: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.4757: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.4758: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.4759: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.4760: DFBPPR18769 ---- Animal proteins ---- Histone H3.3C
Source.4761: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.4762: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1
Source.4763: DFBPPR18775 ---- Animal proteins ---- tRNA methyltransferase 10 homolog A
Source.4764: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.4765: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.4766: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.4767: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone
Source.4768: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.4769: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein
Source.4770: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.4771: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C
Source.4772: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.4773: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.4774: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A
Source.4775: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.4776: DFBPPR18801 ---- Animal proteins ---- Mitochondrial pyruvate carrier 1
Source.4777: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.4778: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.4779: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.4780: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.4781: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.4782: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.4783: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.4784: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.4785: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.4786: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.4787: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.4788: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.4789: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.4790: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.4791: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.4792: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.4793: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2
Source.4794: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.4795: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.4796: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.4797: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.4798: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.4799: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.4800: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.4801: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.4802: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.4803: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.4804: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.4805: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.4806: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.4807: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.4808: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.4809: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.4810: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.4811: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.4812: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.4813: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.4814: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.4815: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.4816: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.4817: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.4818: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.4819: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.4820: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.4821: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.4822: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.4823: DFBPPR18889 ---- Animal proteins ---- Achaete-scute homolog 2
Source.4824: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.4825: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.4826: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.4827: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.4828: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.4829: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.4830: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.4831: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.4832: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.4833: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.4834: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.4835: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.4836: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.4837: DFBPPR18920 ---- Animal proteins ---- Profilin-1
Source.4838: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.4839: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.4840: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10
Source.4841: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.4842: DFBPPR18931 ---- Animal proteins ---- Ficolin-2
Source.4843: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.4844: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.4845: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.4846: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial
Source.4847: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.4848: DFBPPR18942 ---- Animal proteins ---- Four and a half LIM domains protein 2
Source.4849: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.4850: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.4851: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.4852: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.4853: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.4854: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.4855: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.4856: DFBPPR18958 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein
Source.4857: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.4858: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.4859: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.4860: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.4861: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.4862: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.4863: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.4864: DFBPPR18980 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.4865: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.4866: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.4867: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.4868: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.4869: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.4870: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.4871: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.4872: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.4873: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.4874: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.4875: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.4876: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.4877: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.4878: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.4879: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.4880: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1
Source.4881: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.4882: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.4883: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.4884: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.4885: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.4886: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.4887: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.4888: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.4889: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.4890: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.4891: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.4892: DFBPPR19042 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 2
Source.4893: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.4894: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase
Source.4895: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.4896: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.4897: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.4898: DFBPPR19051 ---- Animal proteins ---- Pro-neuropeptide Y
Source.4899: DFBPPR19053 ---- Animal proteins ---- Transmembrane protein 100
Source.4900: DFBPPR19056 ---- Animal proteins ---- Gastrin
Source.4901: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.4902: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.4903: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.4904: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.4905: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.4906: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.4907: DFBPPR19066 ---- Animal proteins ---- Agouti-signaling protein
Source.4908: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.4909: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.4910: DFBPPR19071 ---- Animal proteins ---- Collectrin
Source.4911: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4912: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2
Source.4913: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.4914: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.4915: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.4916: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.4917: DFBPPR19096 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.4918: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.4919: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.4920: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.4921: DFBPPR19102 ---- Animal proteins ---- Cytoplasmic FMR1-interacting protein 1
Source.4922: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa
Source.4923: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.4924: DFBPPR19106 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.4925: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.4926: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.4927: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3
Source.4928: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.4929: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.4930: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.4931: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.4932: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.4933: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.4934: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.4935: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.4936: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.4937: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.4938: DFBPPR19131 ---- Animal proteins ---- Nectin-4
Source.4939: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.4940: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.4941: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.4942: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.4943: DFBPPR19139 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2
Source.4944: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.4945: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.4946: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.4947: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.4948: DFBPPR19164 ---- Animal proteins ---- RNA-binding protein with serine-rich domain 1
Source.4949: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.4950: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.4951: DFBPPR19170 ---- Animal proteins ---- Isoaspartyl peptidase/L-asparaginase
Source.4952: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.4953: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.4954: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4955: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.4956: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33
Source.4957: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.4958: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.4959: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.4960: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.4961: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.4962: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.4963: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.4964: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.4965: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.4966: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.4967: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.4968: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.4969: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2
Source.4970: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.4971: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.4972: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.4973: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.4974: DFBPPR19219 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A2, mitochondrial
Source.4975: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.4976: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.4977: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.4978: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.4979: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.4980: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.4981: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.4982: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.4983: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.4984: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.4985: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.4986: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.4987: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.4988: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.4989: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.4990: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.4991: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.4992: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.4993: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.4994: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.4995: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.4996: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.4997: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.4998: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.4999: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.5000: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.5001: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.5002: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.5003: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.5004: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.5005: DFBPPR19280 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF183
Source.5006: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.5007: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.5008: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.5009: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.5010: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.5011: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.5012: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.5013: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.5014: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.5015: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.5016: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.5017: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.5018: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.5019: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.5020: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.5021: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.5022: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.5023: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.5024: DFBPPR19317 ---- Animal proteins ---- AP-1 complex subunit sigma-1A
Source.5025: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1
Source.5026: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.5027: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.5028: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.5029: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.5030: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.5031: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.5032: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.5033: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.5034: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.5035: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.5036: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.5037: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.5038: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.5039: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.5040: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.5041: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.5042: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3
Source.5043: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.5044: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.5045: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.5046: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3
Source.5047: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.5048: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.5049: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.5050: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.5051: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.5052: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.5053: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A
Source.5054: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.5055: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.5056: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.5057: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.5058: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.5059: DFBPPR19383 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 1
Source.5060: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.5061: DFBPPR19389 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.5062: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.5063: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.5064: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.5065: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.5066: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.5067: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.5068: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.5069: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.5070: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.5071: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.5072: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.5073: DFBPPR19417 ---- Animal proteins ---- L-xylulose reductase
Source.5074: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22
Source.5075: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.5076: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.5077: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.5078: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.5079: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.5080: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.5081: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial
Source.5082: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.5083: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.5084: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.5085: DFBPPR19443 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.5086: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.5087: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.5088: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.5089: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.5090: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.5091: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.5092: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.5093: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.5094: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.5095: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.5096: DFBPPR19456 ---- Animal proteins ---- Ly-6/neurotoxin-like protein 1
Source.5097: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.5098: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B
Source.5099: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.5100: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.5101: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.5102: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2
Source.5103: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.5104: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.5105: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.5106: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.5107: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.5108: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.5109: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.5110: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.5111: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.5112: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.5113: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.5114: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.5115: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.5116: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.5117: DFBPPR19496 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.5118: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2
Source.5119: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.5120: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.5121: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.5122: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.5123: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.5124: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.5125: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.5126: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.5127: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta
Source.5128: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.5129: DFBPPR19530 ---- Animal proteins ---- Tuftelin
Source.5130: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.5131: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.5132: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.5133: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.5134: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.5135: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.5136: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.5137: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein
Source.5138: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial
Source.5139: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.5140: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.5141: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.5142: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.5143: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.5144: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.5145: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.5146: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.5147: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.5148: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.5149: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4
Source.5150: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.5151: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.5152: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5153: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.5154: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.5155: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.5156: DFBPPR19574 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit 2
Source.5157: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.5158: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.5159: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.5160: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.5161: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.5162: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.5163: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.5164: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.5165: DFBPPR19594 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1
Source.5166: DFBPPR19595 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1
Source.5167: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.5168: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.5169: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.5170: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.5171: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.5172: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.5173: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.5174: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.5175: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.5176: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.5177: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.5178: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.5179: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.5180: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.5181: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.5182: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.5183: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.5184: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.5185: DFBPPR19645 ---- Animal proteins ---- Barrier-to-autointegration factor
Source.5186: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.5187: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.5188: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.5189: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.5190: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.5191: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.5192: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.5193: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.5194: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.5195: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.5196: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2
Source.5197: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.5198: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.5199: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.5200: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.5201: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.5202: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.5203: DFBPPR19678 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 5
Source.5204: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.5205: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.5206: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.5207: DFBPPR19686 ---- Animal proteins ---- Spindle and kinetochore-associated protein 1
Source.5208: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.5209: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5
Source.5210: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.5211: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.5212: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.5213: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.5214: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.5215: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.5216: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.5217: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.5218: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.5219: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.5220: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.5221: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.5222: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.5223: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1
Source.5224: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.5225: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.5226: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.5227: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1
Source.5228: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.5229: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.5230: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.5231: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.5232: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2
Source.5233: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.5234: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.5235: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5
Source.5236: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.5237: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.5238: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.5239: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.5240: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein
Source.5241: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.5242: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.5243: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.5244: DFBPPR19758 ---- Animal proteins ---- MICOS complex subunit MIC25
Source.5245: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.5246: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2
Source.5247: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.5248: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.5249: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.5250: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH
Source.5251: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.5252: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog
Source.5253: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.5254: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit
Source.5255: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.5256: DFBPPR19783 ---- Animal proteins ---- Syndecan-1
Source.5257: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.5258: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.5259: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.5260: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.5261: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.5262: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.5263: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.5264: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.5265: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3
Source.5266: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.5267: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.5268: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.5269: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.5270: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.5271: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.5272: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.5273: DFBPPR19820 ---- Animal proteins ---- Septin-10
Source.5274: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.5275: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.5276: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.5277: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.5278: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.5279: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.5280: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.5281: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.5282: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.5283: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.5284: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.5285: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.5286: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.5287: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.5288: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.5289: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.5290: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.5291: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.5292: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.5293: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.5294: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.5295: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.5296: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.5297: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.5298: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.5299: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.5300: DFBPPR19877 ---- Animal proteins ---- Histone H3-like centromeric protein A
Source.5301: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.5302: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.5303: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.5304: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.5305: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.5306: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2
Source.5307: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.5308: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.5309: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.5310: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.5311: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.5312: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.5313: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.5314: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.5315: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.5316: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.5317: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.5318: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.5319: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.5320: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.5321: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.5322: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.5323: DFBPPR19929 ---- Animal proteins ---- Ermin
Source.5324: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial
Source.5325: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.5326: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.5327: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.5328: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.5329: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.5330: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2
Source.5331: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.5332: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.5333: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.5334: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.5335: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.5336: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.5337: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.5338: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.5339: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.5340: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.5341: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.5342: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma
Source.5343: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.5344: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.5345: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.5346: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.5347: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.5348: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.5349: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.5350: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.5351: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.5352: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.5353: DFBPPR19992 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm3
Source.5354: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein
Source.5355: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.5356: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1
Source.5357: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.5358: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.5359: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.5360: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.5361: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.5362: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.5363: DFBPPR20019 ---- Animal proteins ---- 28S ribosomal protein S16, mitochondrial
Source.5364: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.5365: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.5366: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.5367: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.5368: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.5369: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.5370: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.5371: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.5372: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9
Source.5373: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.5374: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.5375: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.5376: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.5377: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.5378: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.5379: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.5380: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.5381: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.5382: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.5383: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.5384: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.5385: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.5386: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8
Source.5387: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.5388: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.5389: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.5390: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.5391: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.5392: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.5393: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.5394: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.5395: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2
Source.5396: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.5397: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.5398: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.5399: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.5400: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial
Source.5401: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.5402: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.5403: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.5404: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.5405: DFBPPR20102 ---- Animal proteins ---- Cylicin-2
Source.5406: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.5407: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.5408: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.5409: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.5410: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.5411: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.5412: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.5413: DFBPPR20124 ---- Animal proteins ---- Serine palmitoyltransferase small subunit B
Source.5414: DFBPPR20125 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 2
Source.5415: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23
Source.5416: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.5417: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.5418: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.5419: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.5420: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.5421: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma
Source.5422: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.5423: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.5424: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.5425: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.5426: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.5427: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.5428: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.5429: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.5430: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.5431: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.5432: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.5433: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.5434: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.5435: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein
Source.5436: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3
Source.5437: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.5438: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.5439: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein
Source.5440: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.5441: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.5442: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.5443: DFBPPR20203 ---- Animal proteins ---- Calcitonin
Source.5444: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.5445: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.5446: DFBPPR20215 ---- Animal proteins ---- Caspase-3
Source.5447: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.5448: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.5449: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.5450: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.5451: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.5452: DFBPPR20225 ---- Animal proteins ---- Claudin-2
Source.5453: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.5454: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.5455: DFBPPR20231 ---- Animal proteins ---- Dynein light chain 2, cytoplasmic
Source.5456: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.5457: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.5458: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.5459: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.5460: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.5461: DFBPPR20241 ---- Animal proteins ---- Ras-related protein Rab-8B
Source.5462: DFBPPR20242 ---- Animal proteins ---- Coactosin-like protein
Source.5463: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.5464: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.5465: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.5466: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.5467: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.5468: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.5469: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.5470: DFBPPR20262 ---- Animal proteins ---- DNA-directed RNA polymerase I subunit RPA12
Source.5471: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.5472: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.5473: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4
Source.5474: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.5475: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.5476: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.5477: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.5478: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.5479: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.5480: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1
Source.5481: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.5482: DFBPPR20295 ---- Animal proteins ---- Protein dpy-30 homolog
Source.5483: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.5484: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.5485: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.5486: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3
Source.5487: DFBPPR20311 ---- Animal proteins ---- Peroxisomal membrane protein 11B
Source.5488: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.5489: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.5490: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.5491: DFBPPR20326 ---- Animal proteins ---- Survival of motor neuron-related-splicing factor 30
Source.5492: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.5493: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.5494: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.5495: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.5496: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.5497: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.5498: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial
Source.5499: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.5500: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.5501: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.5502: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.5503: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.5504: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2
Source.5505: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.5506: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2
Source.5507: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.5508: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.5509: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.5510: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.5511: DFBPPR20363 ---- Animal proteins ---- F-box/LRR-repeat protein 2
Source.5512: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.5513: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.5514: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.5515: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.5516: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.5517: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.5518: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.5519: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.5520: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.5521: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.5522: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2
Source.5523: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.5524: DFBPPR20404 ---- Animal proteins ---- Protein tilB homolog
Source.5525: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.5526: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.5527: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.5528: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.5529: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.5530: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.5531: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.5532: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.5533: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.5534: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.5535: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.5536: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.5537: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.5538: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.5539: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.5540: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.5541: DFBPPR20438 ---- Animal proteins ---- Small ubiquitin-related modifier 3
Source.5542: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.5543: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5
Source.5544: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.5545: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5
Source.5546: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.5547: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.5548: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.5549: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.5550: DFBPPR20453 ---- Animal proteins ---- Cysteine dioxygenase type 1
Source.5551: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.5552: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.5553: DFBPPR20458 ---- Animal proteins ---- Putative transcription factor Ovo-like 1
Source.5554: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.5555: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.5556: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.5557: DFBPPR20467 ---- Animal proteins ---- Tetranectin
Source.5558: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.5559: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.5560: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.5561: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.5562: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.5563: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.5564: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.5565: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.5566: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.5567: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog
Source.5568: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.5569: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.5570: DFBPPR20504 ---- Animal proteins ---- 28S ribosomal protein S18c, mitochondrial
Source.5571: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.5572: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.5573: DFBPPR20510 ---- Animal proteins ---- Josephin-1
Source.5574: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.5575: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.5576: DFBPPR20518 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5
Source.5577: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6
Source.5578: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.5579: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.5580: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.5581: DFBPPR20530 ---- Animal proteins ---- Protein HEXIM2
Source.5582: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.5583: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16
Source.5584: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.5585: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.5586: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.5587: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.5588: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.5589: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.5590: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26
Source.5591: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.5592: DFBPPR20569 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 10
Source.5593: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.5594: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.5595: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a
Source.5596: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.5597: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.5598: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.5599: DFBPPR20585 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 3
Source.5600: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.5601: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.5602: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein
Source.5603: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.5604: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.5605: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.5606: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.5607: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.5608: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.5609: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.5610: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.5611: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.5612: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.5613: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.5614: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.5615: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.5616: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.5617: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.5618: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.5619: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.5620: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.5621: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.5622: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.5623: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.5624: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.5625: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.5626: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.5627: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.5628: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.5629: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.5630: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.5631: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.5632: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.5633: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial
Source.5634: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.5635: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog
Source.5636: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.5637: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1
Source.5638: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.5639: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2
Source.5640: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.5641: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.5642: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.5643: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.5644: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase
Source.5645: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.5646: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.5647: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.5648: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.5649: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.5650: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.5651: DFBPPR20735 ---- Animal proteins ---- Microtubule-associated tumor suppressor 1 homolog
Source.5652: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.5653: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.5654: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.5655: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.5656: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.5657: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.5658: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.5659: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B
Source.5660: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.5661: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.5662: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.5663: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf
Source.5664: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.5665: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.5666: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.5667: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.5668: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14
Source.5669: DFBPPR20768 ---- Animal proteins ---- Lysozyme-like protein 1
Source.5670: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.5671: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.5672: DFBPPR20775 ---- Animal proteins ---- Colipase
Source.5673: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.5674: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.5675: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.5676: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.5677: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.5678: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.5679: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.5680: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.5681: DFBPPR20799 ---- Animal proteins ---- F-box/LRR-repeat protein 20
Source.5682: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.5683: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.5684: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.5685: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.5686: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.5687: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.5688: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.5689: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.5690: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.5691: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1
Source.5692: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT
Source.5693: DFBPPR20824 ---- Animal proteins ---- CD151 antigen
Source.5694: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.5695: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.5696: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.5697: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.5698: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.5699: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.5700: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.5701: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.5702: DFBPPR20841 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.5703: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.5704: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.5705: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.5706: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.5707: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.5708: DFBPPR20852 ---- Animal proteins ---- 28S ribosomal protein S21, mitochondrial
Source.5709: DFBPPR20863 ---- Animal proteins ---- LIM and senescent cell antigen-like-containing domain protein 2
Source.5710: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.5711: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.5712: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.5713: DFBPPR20877 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD5
Source.5714: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.5715: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.5716: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.5717: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.5718: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.5719: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2
Source.5720: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.5721: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.5722: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.5723: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.5724: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143
Source.5725: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.5726: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.5727: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.5728: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.5729: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.5730: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.5731: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.5732: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.5733: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.5734: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8
Source.5735: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.5736: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.5737: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A
Source.5738: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.5739: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.5740: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B
Source.5741: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.5742: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.5743: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial
Source.5744: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.5745: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.5746: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17
Source.5747: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.5748: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.5749: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.5750: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.5751: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.5752: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.5753: DFBPPR20978 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10 B
Source.5754: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.5755: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.5756: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.5757: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.5758: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.5759: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2
Source.5760: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.5761: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.5762: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.5763: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.5764: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.5765: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.5766: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.5767: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.5768: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.5769: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.5770: DFBPPR21023 ---- Animal proteins ---- Ribosome biogenesis protein NSA2 homolog
Source.5771: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.5772: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.5773: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.5774: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.5775: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.5776: DFBPPR21040 ---- Animal proteins ---- Neuritin
Source.5777: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.5778: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.5779: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.5780: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.5781: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.5782: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.5783: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.5784: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.5785: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.5786: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.5787: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.5788: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.5789: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial
Source.5790: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.5791: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.5792: DFBPPR21092 ---- Animal proteins ---- Calponin-1
Source.5793: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.5794: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.5795: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.5796: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.5797: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.5798: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.5799: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.5800: DFBPPR21118 ---- Animal proteins ---- NADH-cytochrome b5 reductase 1
Source.5801: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog
Source.5802: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.5803: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.5804: DFBPPR21129 ---- Animal proteins ---- 60S ribosomal protein L15
Source.5805: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.5806: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7
Source.5807: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.5808: DFBPPR21145 ---- Animal proteins ---- Transcription elongation factor SPT4
Source.5809: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.5810: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.5811: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.5812: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.5813: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1
Source.5814: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor
Source.5815: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.5816: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22
Source.5817: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.5818: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.5819: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52
Source.5820: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.5821: DFBPPR21179 ---- Animal proteins ---- Eukaryotic translation initiation factor 4H
Source.5822: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7
Source.5823: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.5824: DFBPPR21183 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.5825: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.5826: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.5827: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.5828: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.5829: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.5830: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2
Source.5831: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.5832: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.5833: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6
Source.5834: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.5835: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.5836: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.5837: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.5838: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.5839: DFBPPR21229 ---- Animal proteins ---- Neurexophilin-2
Source.5840: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.5841: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.5842: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2
Source.5843: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1
Source.5844: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.5845: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1
Source.5846: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.5847: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.5848: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2
Source.5849: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3
Source.5850: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.5851: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.5852: DFBPPR21267 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.5853: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.5854: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.5855: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.5856: DFBPPR21274 ---- Animal proteins ---- 39S ribosomal protein L48, mitochondrial
Source.5857: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.5858: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.5859: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.5860: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2
Source.5861: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.5862: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.5863: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.5864: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.5865: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58
Source.5866: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.5867: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.5868: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.5869: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.5870: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.5871: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.5872: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.5873: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.5874: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.5875: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner
Source.5876: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha
Source.5877: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.5878: DFBPPR21320 ---- Animal proteins ---- Sjoegren syndrome nuclear autoantigen 1 homolog
Source.5879: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.5880: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma
Source.5881: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.5882: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3
Source.5883: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.5884: DFBPPR21335 ---- Animal proteins ---- Coiled-coil domain-containing protein 124
Source.5885: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.5886: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.5887: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.5888: DFBPPR21345 ---- Animal proteins ---- XIAP-associated factor 1
Source.5889: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.5890: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397
Source.5891: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.5892: DFBPPR21351 ---- Animal proteins ---- Protein kish-A
Source.5893: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.5894: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.5895: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.5896: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.5897: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.5898: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.5899: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.5900: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.5901: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.5902: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.5903: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.5904: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.5905: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.5906: DFBPPR21381 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A-related protein, mitochondrial
Source.5907: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.5908: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.5909: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.5910: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.5911: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.5912: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1
Source.5913: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.5914: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.5915: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.5916: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37
Source.5917: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.5918: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.5919: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1
Source.5920: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.5921: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.5922: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.5923: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.5924: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.5925: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.5926: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.5927: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.5928: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.5929: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.5930: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.5931: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207
Source.5932: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.5933: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.5934: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.5935: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.5936: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2
Source.5937: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.5938: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.5939: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.5940: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.5941: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.5942: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.5943: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.5944: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.5945: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial
Source.5946: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.5947: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.5948: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.5949: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.5950: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.5951: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.5952: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.5953: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18
Source.5954: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.5955: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2
Source.5956: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.5957: DFBPPR21499 ---- Animal proteins ---- Barrier-to-autointegration factor-like protein
Source.5958: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.5959: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.5960: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.5961: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.5962: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.5963: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.5964: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20
Source.5965: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.5966: DFBPPR21520 ---- Animal proteins ---- LYR motif-containing protein 4
Source.5967: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.5968: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.5969: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.5970: DFBPPR21542 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6c
Source.5971: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.5972: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.5973: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.5974: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1
Source.5975: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.5976: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.5977: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.5978: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.5979: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B
Source.5980: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.5981: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.5982: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.5983: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.5984: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19
Source.5985: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.5986: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.5987: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.5988: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.5989: DFBPPR21599 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.5990: DFBPPR21600 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit H
Source.5991: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1
Source.5992: DFBPPR21604 ---- Animal proteins ---- Zinc finger protein 345
Source.5993: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.5994: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.5995: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.5996: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.5997: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.5998: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.5999: DFBPPR21628 ---- Animal proteins ---- G patch domain-containing protein 11
Source.6000: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.6001: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.6002: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19
Source.6003: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.6004: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.6005: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.6006: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.6007: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26
Source.6008: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6
Source.6009: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.6010: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.6011: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.6012: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.6013: DFBPPR21664 ---- Animal proteins ---- Signal recognition particle 14 kDa protein
Source.6014: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.6015: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.6016: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4
Source.6017: DFBPPR21677 ---- Animal proteins ---- Dolichol phosphate-mannose biosynthesis regulatory protein
Source.6018: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A
Source.6019: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26
Source.6020: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.6021: DFBPPR21687 ---- Animal proteins ---- Ropporin-1-like protein
Source.6022: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.6023: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.6024: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.6025: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.6026: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.6027: DFBPPR21702 ---- Animal proteins ---- Rhombotin-2
Source.6028: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.6029: DFBPPR21708 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.6030: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.6031: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.6032: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.6033: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.6034: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.6035: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.6036: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.6037: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.6038: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.6039: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.6040: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.6041: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.6042: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.6043: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.6044: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta
Source.6045: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.6046: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1
Source.6047: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.6048: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.6049: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.6050: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.6051: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6
Source.6052: DFBPPR21762 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 28
Source.6053: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.6054: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.6055: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.6056: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.6057: DFBPPR21771 ---- Animal proteins ---- RAD9, HUS1, RAD1-interacting nuclear orphan protein 1
Source.6058: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.6059: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6
Source.6060: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.6061: DFBPPR21780 ---- Animal proteins ---- 40S ribosomal protein S11
Source.6062: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.6063: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.6064: DFBPPR21789 ---- Animal proteins ---- Protein kish-B
Source.6065: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.6066: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.6067: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.6068: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.6069: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.6070: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.6071: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.6072: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.6073: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.6074: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1
Source.6075: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6076: DFBPPR21811 ---- Animal proteins ---- Coiled-coil domain-containing protein 89
Source.6077: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog
Source.6078: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2
Source.6079: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.6080: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.6081: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.6082: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.6083: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.6084: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.6085: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.6086: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.6087: DFBPPR21840 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.6088: DFBPPR21842 ---- Animal proteins ---- Transmembrane protein 14A
Source.6089: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.6090: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17
Source.6091: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.6092: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.6093: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.6094: DFBPPR21856 ---- Animal proteins ---- Protein FAM32A
Source.6095: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.6096: DFBPPR21861 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 3, mitochondrial
Source.6097: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3
Source.6098: DFBPPR21869 ---- Animal proteins ---- Centromere protein O
Source.6099: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.6100: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.6101: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.6102: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.6103: DFBPPR21878 ---- Animal proteins ---- Statherin
Source.6104: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.6105: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1
Source.6106: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.6107: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.6108: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.6109: DFBPPR21904 ---- Animal proteins ---- Protein TBATA
Source.6110: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.6111: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.6112: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.6113: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.6114: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4
Source.6115: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.6116: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.6117: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.6118: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.6119: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.6120: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.6121: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.6122: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.6123: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.6124: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.6125: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.6126: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.6127: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3
Source.6128: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.6129: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.6130: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.6131: DFBPPR21964 ---- Animal proteins ---- Protein yippee-like 3
Source.6132: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.6133: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.6134: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.6135: DFBPPR21971 ---- Animal proteins ---- Chemokine-like protein TAFA-5
Source.6136: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.6137: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.6138: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.6139: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.6140: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.6141: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.6142: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8
Source.6143: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.6144: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2
Source.6145: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1
Source.6146: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.6147: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3
Source.6148: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.6149: DFBPPR22004 ---- Animal proteins ---- 60S ribosomal protein L35a
Source.6150: DFBPPR22007 ---- Animal proteins ---- Protein C8orf37 homolog
Source.6151: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.6152: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2
Source.6153: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial
Source.6154: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.6155: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.6156: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1
Source.6157: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.6158: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.6159: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.6160: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.6161: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1
Source.6162: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.6163: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A
Source.6164: DFBPPR22063 ---- Animal proteins ---- 60S ribosomal protein L29
Source.6165: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein
Source.6166: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.6167: DFBPPR22071 ---- Animal proteins ---- Neuromedin-S
Source.6168: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.6169: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.6170: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6
Source.6171: DFBPPR22084 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 49
Source.6172: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.6173: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.6174: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.6175: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.6176: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.6177: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.6178: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.6179: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.6180: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.6181: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4
Source.6182: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.6183: DFBPPR22105 ---- Animal proteins ---- Centromere protein L
Source.6184: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.6185: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1
Source.6186: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.6187: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.6188: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.6189: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.6190: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.6191: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.6192: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.6193: DFBPPR22125 ---- Animal proteins ---- 40S ribosomal protein S16
Source.6194: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.6195: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.6196: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.6197: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.6198: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.6199: DFBPPR22138 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 7
Source.6200: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.6201: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.6202: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.6203: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.6204: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1
Source.6205: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1
Source.6206: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.6207: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.6208: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1
Source.6209: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.6210: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.6211: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.6212: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.6213: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.6214: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.6215: DFBPPR22169 ---- Animal proteins ---- Transmembrane protein 256
Source.6216: DFBPPR22172 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX14
Source.6217: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.6218: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.6219: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.6220: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.6221: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.6222: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.6223: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.6224: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5
Source.6225: DFBPPR22194 ---- Animal proteins ---- Cystatin-9
Source.6226: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.6227: DFBPPR22202 ---- Animal proteins ---- Protein FMC1 homolog
Source.6228: DFBPPR22203 ---- Animal proteins ---- Serum amyloid A-4 protein
Source.6229: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.6230: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1
Source.6231: DFBPPR22208 ---- Animal proteins ---- Protein yippee-like 2
Source.6232: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.6233: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.6234: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.6235: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.6236: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.6237: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.6238: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.6239: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.6240: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.6241: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A
Source.6242: DFBPPR22234 ---- Animal proteins ---- COMM domain-containing protein 3
Source.6243: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.6244: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5
Source.6245: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.6246: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.6247: DFBPPR22250 ---- Animal proteins ---- Tetratricopeptide repeat protein 23-like
Source.6248: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1
Source.6249: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2
Source.6250: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5
Source.6251: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.6252: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.6253: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.6254: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog
Source.6255: DFBPPR22269 ---- Animal proteins ---- Protein preY, mitochondrial
Source.6256: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.6257: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.6258: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.6259: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.6260: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.6261: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.6262: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.6263: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.6264: DFBPPR22297 ---- Animal proteins ---- Histatherin
Source.6265: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.6266: DFBPPR22303 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 4
Source.6267: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.6268: DFBPPR22307 ---- Animal proteins ---- MORF4 family-associated protein 1
Source.6269: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein
Source.6270: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2
Source.6271: DFBPPR22315 ---- Animal proteins ---- Probable cystatin-15
Source.6272: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.6273: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.6274: DFBPPR22323 ---- Animal proteins ---- Meiosis expressed gene 1 protein homolog
Source.6275: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.6276: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.6277: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.6278: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.6279: DFBPPR22338 ---- Animal proteins ---- Probable cystatin-16
Source.6280: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.6281: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.6282: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.6283: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.6284: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.6285: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.6286: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.6287: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.6288: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.6289: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.6290: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.6291: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.6292: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.6293: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.6294: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.6295: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.6296: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.6297: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.6298: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.6299: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.6300: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.6301: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.6302: DFBPPR22413 ---- Animal proteins ---- Protein LSM12 homolog
Source.6303: DFBPPR22414 ---- Animal proteins ---- Protein C10
Source.6304: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.6305: DFBPPR22425 ---- Animal proteins ---- Protein THEM6
Source.6306: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.6307: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.6308: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.6309: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11
Source.6310: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.6311: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.6312: DFBPPR22454 ---- Animal proteins ---- R3H domain-containing protein 4
Source.6313: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.6314: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137
Source.6315: DFBPPR22471 ---- Animal proteins ---- Protein shisa-like-2B
Source.6316: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.6317: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.6318: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog
Source.6319: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.6320: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.6321: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.6322: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.6323: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.6324: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.6325: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.6326: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.6327: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.6328: DFBPPR22498 ---- Animal proteins ---- Protein NATD1
Source.6329: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1
Source.6330: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46
Source.6331: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.6332: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog
Source.6333: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.6334: DFBPPR22515 ---- Animal proteins ---- Small integral membrane protein 8
Source.6335: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.6336: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.6337: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.6338: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.6339: DFBPPR22530 ---- Animal proteins ---- Coiled-coil domain-containing protein 167
Source.6340: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.6341: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25
Source.6342: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.6343: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.6344: DFBPPR22550 ---- Animal proteins ---- Leucine-rich repeat-containing protein 23
Source.6345: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.6346: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1
Source.6347: DFBPPR22555 ---- Animal proteins ---- Bcl-2-like protein 15
Source.6348: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.6349: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.6350: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.6351: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.6352: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.6353: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.6354: DFBPPR22581 ---- Animal proteins ---- UPF0690 protein C1orf52 homolog
Source.6355: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.6356: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.6357: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.6358: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26
Source.6359: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.6360: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.6361: DFBPPR22605 ---- Animal proteins ---- Transmembrane protein 254
Source.6362: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.6363: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36
Source.6364: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105
Source.6365: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.6366: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.6367: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.6368: DFBPPR22620 ---- Animal proteins ---- Cysteine-rich tail protein 1
Source.6369: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.6370: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253
Source.6371: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.6372: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270
Source.6373: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30
Source.6374: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.6375: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.6376: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1
Source.6377: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.6378: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.6379: DFBPPR22665 ---- Animal proteins ---- UPF0686 protein C11orf1 homolog
Source.6380: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.6381: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89
Source.6382: DFBPPR22675 ---- Animal proteins ---- UPF0711 protein C18orf21 homolog
Source.6383: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.6384: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A
Source.6385: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.6386: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.6387: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2
Source.6388: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D
Source.6389: DFBPPR22713 ---- Animal proteins ---- UPF0728 protein C10orf53 homolog
Source.6390: DFBPPR22715 ---- Animal proteins ---- Spermatogenesis-associated protein 45
Source.6391: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.6392: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.6393: DFBPPR22730 ---- Animal proteins ---- UPF0545 protein C22orf39 homolog
Source.6394: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1
Source.6395: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1
Source.6396: DFBPPR22739 ---- Animal proteins ---- Testis, prostate and placenta-expressed protein
Source.6397: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog
Source.6398: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog
Source.6399: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.6400: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog
Source.6401: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog
Source.6402: DFBPPR22757 ---- Animal proteins ---- Uncharacterized protein CXorf65 homolog
Source.6403: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog
Source.6404: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog
Source.6405: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog
Source.6406: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.6407: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.6408: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.6409: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.6410: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6411: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.6412: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.6413: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6414: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.6415: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.6416: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.6417: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.6418: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.6419: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.6420: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.6421: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.6422: DFBPPR8553 ---- Animal proteins ---- Protein AMBP
Source.6423: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.6424: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.6425: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.6426: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.6427: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.6428: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.6429: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.6430: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.6431: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.6432: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.6433: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.6434: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.6435: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.6436: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.6437: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.6438: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.6439: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.6440: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.6441: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.6442: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.6443: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.6444: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.6445: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.6446: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2
Source.6447: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein
Source.6448: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.6449: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6
Source.6450: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.6451: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.6452: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.6453: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.6454: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.6455: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.6456: DFBPPR8623 ---- Animal proteins ---- High mobility group protein B1
Source.6457: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.6458: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.6459: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.6460: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.6461: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.6462: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.6463: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.6464: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.6465: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.6466: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.6467: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.6468: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.6469: DFBPPR8655 ---- Animal proteins ---- Azurocidin
Source.6470: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.6471: DFBPPR8657 ---- Animal proteins ---- Annexin A2
Source.6472: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.6473: DFBPPR8666 ---- Animal proteins ---- Histone H3.3
Source.6474: DFBPPR8667 ---- Animal proteins ---- High mobility group protein B2
Source.6475: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.6476: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.6477: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.6478: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.6479: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.6480: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.6481: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.6482: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.6483: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.6484: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.6485: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.6486: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.6487: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.6488: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.6489: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.6490: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.6491: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.6492: DFBPPR8697 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.6493: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.6494: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.6495: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.6496: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.6497: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.6498: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.6499: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.6500: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.6501: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.6502: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.6503: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.6504: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.6505: DFBPPR8718 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.6506: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.6507: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.6508: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.6509: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.6510: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.6511: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.6512: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase
Source.6513: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.6514: DFBPPR8733 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.6515: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.6516: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6517: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.6518: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.6519: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.6520: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.6521: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.6522: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.6523: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.6524: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.6525: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.6526: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.6527: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.6528: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.6529: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.6530: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.6531: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.6532: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.6533: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6534: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.6535: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.6536: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.6537: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.6538: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.6539: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.6540: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.6541: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.6542: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.6543: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.6544: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6545: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.6546: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.6547: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.6548: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.6549: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.6550: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II
Source.6551: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.6552: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.6553: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.6554: DFBPPR8810 ---- Animal proteins ---- Follistatin
Source.6555: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.6556: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.6557: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.6558: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.6559: DFBPPR8827 ---- Animal proteins ---- Guanylate kinase
Source.6560: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.6561: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.6562: DFBPPR8832 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.6563: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.6564: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.6565: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.6566: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.6567: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.6568: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.6569: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.6570: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.6571: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.6572: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.6573: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.6574: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.6575: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.6576: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.6577: DFBPPR8859 ---- Animal proteins ---- Interleukin-1 alpha
Source.6578: DFBPPR8861 ---- Animal proteins ---- Colipase
Source.6579: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.6580: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.6581: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.6582: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.6583: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.6584: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.6585: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.6586: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.6587: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.6588: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.6589: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.6590: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.6591: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.6592: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.6593: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.6594: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.6595: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.6596: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.6597: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.6598: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.6599: DFBPPR8926 ---- Animal proteins ---- Osteocalcin
Source.6600: DFBPPR8927 ---- Animal proteins ---- Pro-neuropeptide Y
Source.6601: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.6602: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.6603: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.6604: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.6605: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.6606: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.6607: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.6608: DFBPPR8973 ---- Animal proteins ---- Caspase-3
Source.6609: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.6610: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.6611: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.6612: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.6613: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.6614: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.6615: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.6616: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.6617: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.6618: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.6619: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic
Source.6620: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.6621: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.6622: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.6623: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.6624: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.6625: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.6626: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.6627: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.6628: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.6629: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.6630: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.6631: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.6632: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.6633: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.6634: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.6635: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3
Source.6636: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.6637: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B
Source.6638: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.6639: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.6640: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.6641: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.6642: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.6643: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.6644: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.6645: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.6646: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.6647: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.6648: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.6649: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.6650: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.6651: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.6652: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.6653: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.6654: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.6655: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.6656: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.6657: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.6658: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.6659: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.6660: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.6661: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.6662: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.6663: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.6664: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.6665: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.6666: DFBPPR9123 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.6667: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.6668: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.6669: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.6670: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.6671: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.6672: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.6673: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.6674: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.6675: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.6676: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.6677: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.6678: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.6679: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.6680: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.6681: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.6682: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.6683: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.6684: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.6685: DFBPPR9173 ---- Animal proteins ---- Neurotrophin-3
Source.6686: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.6687: DFBPPR9176 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.6688: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.6689: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.6690: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.6691: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.6692: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.6693: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.6694: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2
Source.6695: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.6696: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.6697: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.6698: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.6699: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.6700: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.6701: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.6702: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.6703: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.6704: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.6705: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.6706: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.6707: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.6708: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.6709: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.6710: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.6711: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C
Source.6712: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.6713: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.6714: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.6715: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.6716: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.6717: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9
Source.6718: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.6719: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.6720: DFBPPR9249 ---- Animal proteins ---- 5-hydroxytryptamine receptor 4
Source.6721: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.6722: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.6723: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4
Source.6724: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.6725: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.6726: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.6727: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.6728: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.6729: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.6730: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.6731: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.6732: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.6733: DFBPPR9272 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.6734: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.6735: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.6736: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.6737: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.6738: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.6739: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.6740: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6741: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.6742: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.6743: DFBPPR9304 ---- Animal proteins ---- Peroxiredoxin-2
Source.6744: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.6745: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.6746: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.6747: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.6748: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.6749: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.6750: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.6751: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.6752: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.6753: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6754: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.6755: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.6756: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.6757: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.6758: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.6759: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.6760: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.6761: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.6762: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.6763: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.6764: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.6765: DFBPPR9374 ---- Animal proteins ---- Casein kinase II subunit beta
Source.6766: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6767: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.6768: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.6769: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.6770: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.6771: DFBPPR9402 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.6772: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.6773: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.6774: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6775: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6776: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6777: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.6778: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.6779: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.6780: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.6781: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.6782: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.6783: DFBPPR9422 ---- Animal proteins ---- C-C motif chemokine 25
Source.6784: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.6785: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.6786: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.6787: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.6788: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.6789: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.6790: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.6791: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.6792: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.6793: DFBPPR9448 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.6794: DFBPPR9449 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.6795: DFBPPR9456 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.6796: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.6797: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.6798: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.6799: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.6800: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.6801: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.6802: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.6803: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain
Source.6804: DFBPPR9518 ---- Animal proteins ---- Interleukin-5
Source.6805: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.6806: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.6807: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.6808: DFBPPR9523 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.6809: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.6810: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.6811: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1
Source.6812: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.6813: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.6814: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.6815: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.6816: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.6817: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.6818: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.6819: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.6820: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.6821: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.6822: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.6823: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.6824: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.6825: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.6826: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.6827: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.6828: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.6829: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.6830: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.6831: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26
Source.6832: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.6833: DFBPPR9578 ---- Animal proteins ---- Biglycan
Source.6834: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.6835: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.6836: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6837: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.6838: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.6839: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.6840: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.6841: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.6842: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.6843: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6844: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.6845: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.6846: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.6847: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.6848: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.6849: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.6850: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.6851: DFBPPR9622 ---- Animal proteins ---- Calcitonin
Source.6852: DFBPPR9624 ---- Animal proteins ---- Cadherin-3
Source.6853: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.6854: DFBPPR9630 ---- Animal proteins ---- Calponin-1
Source.6855: DFBPPR9631 ---- Animal proteins ---- Lithostathine
Source.6856: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.6857: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.6858: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.6859: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561
Source.6860: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.6861: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein
Source.6862: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.6863: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1
Source.6864: DFBPPR9647 ---- Animal proteins ---- ATP synthase subunit e, mitochondrial
Source.6865: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.6866: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.6867: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.6868: DFBPPR9656 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.6869: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.6870: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.6871: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.6872: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.6873: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.6874: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.6875: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.6876: DFBPPR9681 ---- Animal proteins ---- Complement C5a anaphylatoxin
Source.6877: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.6878: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2
Source.6879: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.6880: DFBPPR9693 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.6881: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.6882: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.6883: DFBPPR9698 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.6884: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.6885: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.6886: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.6887: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.6888: DFBPPR9710 ---- Animal proteins ---- Gastricsin
Source.6889: DFBPPR9711 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.6890: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.6891: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.6892: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.6893: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2
Source.6894: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.6895: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.6896: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.6897: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.6898: DFBPPR9749 ---- Animal proteins ---- Guanylin
Source.6899: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.6900: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.6901: DFBPPR9759 ---- Animal proteins ---- Palmdelphin
Source.6902: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.6903: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.6904: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1
Source.6905: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A
Source.6906: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.6907: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.6908: DFBPPR9780 ---- Animal proteins ---- Small ubiquitin-related modifier 4
Source.6909: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.6910: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.6911: DFBPPR9800 ---- Animal proteins ---- Glycophorin-A
Source.6912: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.6913: DFBPPR9810 ---- Animal proteins ---- 40S ribosomal protein S16
Source.6914: DFBPPR9812 ---- Animal proteins ---- 60S ribosomal protein L29
Source.6915: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.6916: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.6917: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.6918: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.6919: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.6920: DFBPPR9826 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.6921: DFBPPR9829 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.6922: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.6923: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.6924: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.6925: DFBPPR9841 ---- Animal proteins ---- Interleukin-10
Source.6926: DFBPPR9843 ---- Animal proteins ---- P protein
Source.6927: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase
Source.6928: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C
Source.6929: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.6930: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.6931: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.6932: DFBPPR9872 ---- Animal proteins ---- Transmembrane protein 14A
Source.6933: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6934: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.6935: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.6936: DFBPPR9896 ---- Animal proteins ---- Pepsin B
Source.6937: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.6938: DFBPPR9910 ---- Animal proteins ---- Serum amyloid A-2 protein
Source.6939: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.6940: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.6941: DFBPPR9929 ---- Animal proteins ---- Tuftelin
Source.6942: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.6943: DFBPPR9936 ---- Animal proteins ---- Serum amyloid A-4 protein
Source.6944: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.6945: DFBPPR9940 ---- Animal proteins ---- Neuronatin
Source.6946: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1
Source.6947: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.6948: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.6949: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.6950: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.6951: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.6952: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor
Source.6953: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.6954: DFBPPR9960 ---- Animal proteins ---- Histone H3.2
Source.6955: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.6956: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.6957: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.6958: DFBPPR9973 ---- Animal proteins ---- High mobility group protein B1
Source.6959: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.6960: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.6961: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.6962: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.6963: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.6964: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.6965: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.6966: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.6967: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.6968: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.6969: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.6970: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.6971: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.6972: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.6973: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.6974: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.6975: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.6976: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.6977: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.6978: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.6979: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2
Source.6980: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.6981: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides
Source.6982: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.6983: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.6984: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.6985: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.6986: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2
Source.6987: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.6988: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.6989: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.6990: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.6991: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.6992: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.6993: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.6994: DFBPPR10053 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.6995: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.6996: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.6997: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.6998: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.6999: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.7000: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6
Source.7001: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.7002: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.7003: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.7004: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.7005: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7006: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.7007: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.7008: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.7009: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.7010: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.7011: DFBPPR10088 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.7012: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.7013: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.7014: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.7015: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4
Source.7016: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.7017: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.7018: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.7019: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.7020: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.7021: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.7022: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.7023: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.7024: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.7025: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.7026: DFBPPR10115 ---- Animal proteins ---- Annexin A1
Source.7027: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.7028: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.7029: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.7030: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.7031: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.7032: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.7033: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.7034: DFBPPR10130 ---- Animal proteins ---- Histone H3.3
Source.7035: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.7036: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.7037: DFBPPR10136 ---- Animal proteins ---- Annexin A2
Source.7038: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.7039: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.7040: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.7041: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.7042: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.7043: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.7044: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.7045: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.7046: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.7047: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.7048: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.7049: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2
Source.7050: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.7051: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.7052: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.7053: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.7054: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.7055: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.7056: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3
Source.7057: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.7058: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.7059: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II
Source.7060: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.7061: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.7062: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.7063: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.7064: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.7065: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.7066: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.7067: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.7068: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.7069: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.7070: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.7071: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.7072: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.7073: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.7074: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.7075: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.7076: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.7077: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.7078: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.7079: DFBPPR10195 ---- Animal proteins ---- SUMO-conjugating enzyme UBC9
Source.7080: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.7081: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.7082: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.7083: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.7084: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.7085: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.7086: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.7087: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.7088: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.7089: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.7090: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.7091: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.7092: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.7093: DFBPPR10217 ---- Animal proteins ---- Follistatin
Source.7094: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.7095: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.7096: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.7097: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.7098: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.7099: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.7100: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.7101: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.7102: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.7103: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.7104: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.7105: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.7106: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.7107: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.7108: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.7109: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.7110: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.7111: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein
Source.7112: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.7113: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.7114: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.7115: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.7116: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.7117: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.7118: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.7119: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.7120: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.7121: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.7122: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.7123: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.7124: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.7125: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.7126: DFBPPR10276 ---- Animal proteins ---- Adapter molecule crk
Source.7127: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.7128: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.7129: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.7130: DFBPPR10280 ---- Animal proteins ---- Cytochrome c
Source.7131: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.7132: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.7133: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.7134: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.7135: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.7136: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.7137: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.7138: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.7139: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.7140: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.7141: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.7142: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.7143: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.7144: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.7145: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.7146: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.7147: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.7148: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.7149: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.7150: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.7151: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.7152: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.7153: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.7154: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.7155: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.7156: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1
Source.7157: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.7158: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.7159: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.7160: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.7161: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.7162: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.7163: DFBPPR10339 ---- Animal proteins ---- Osteocalcin
Source.7164: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.7165: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.7166: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.7167: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.7168: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.7169: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.7170: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.7171: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.7172: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.7173: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.7174: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.7175: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.7176: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.7177: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.7178: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.7179: DFBPPR10391 ---- Animal proteins ---- Annexin A5
Source.7180: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.7181: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.7182: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.7183: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.7184: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.7185: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.7186: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.7187: DFBPPR10405 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.7188: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.7189: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.7190: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.7191: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.7192: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.7193: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.7194: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.7195: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.7196: DFBPPR10428 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.7197: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.7198: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.7199: DFBPPR10434 ---- Animal proteins ---- Parathyroid hormone
Source.7200: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.7201: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.7202: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.7203: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.7204: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.7205: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.7206: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.7207: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.7208: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.7209: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.7210: DFBPPR10453 ---- Animal proteins ---- Neurotrophin-3
Source.7211: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.7212: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.7213: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.7214: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.7215: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7216: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.7217: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.7218: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.7219: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.7220: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.7221: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.7222: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.7223: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.7224: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.7225: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.7226: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.7227: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.7228: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.7229: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.7230: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.7231: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.7232: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.7233: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.7234: DFBPPR10509 ---- Animal proteins ---- Calponin-1
Source.7235: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.7236: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.7237: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.7238: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.7239: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.7240: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.7241: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.7242: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.7243: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.7244: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.7245: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.7246: DFBPPR10530 ---- Animal proteins ---- Osteopontin
Source.7247: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.7248: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.7249: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain
Source.7250: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.7251: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.7252: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.7253: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.7254: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.7255: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.7256: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.7257: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.7258: DFBPPR10563 ---- Animal proteins ---- Optineurin
Source.7259: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.7260: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.7261: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.7262: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.7263: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.7264: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.7265: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.7266: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.7267: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.7268: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.7269: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.7270: DFBPPR10583 ---- Animal proteins ---- Gallinacin-9
Source.7271: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.7272: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.7273: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.7274: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.7275: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.7276: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.7277: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.7278: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.7279: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.7280: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.7281: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.7282: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.7283: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.7284: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.7285: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.7286: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.7287: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.7288: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.7289: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.7290: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b
Source.7291: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.7292: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.7293: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.7294: DFBPPR10627 ---- Animal proteins ---- Apovitellenin-1
Source.7295: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.7296: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.7297: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.7298: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.7299: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.7300: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.7301: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.7302: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.7303: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.7304: DFBPPR10647 ---- Animal proteins ---- Gallinacin-4
Source.7305: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.7306: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.7307: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.7308: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.7309: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.7310: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.7311: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.7312: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.7313: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.7314: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.7315: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.7316: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.7317: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.7318: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.7319: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.7320: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.7321: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.7322: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.7323: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.7324: DFBPPR10680 ---- Animal proteins ---- Hemoglobin subunit pi
Source.7325: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.7326: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.7327: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.7328: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.7329: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a
Source.7330: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.7331: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.7332: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.7333: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.7334: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.7335: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.7336: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.7337: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.7338: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.7339: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.7340: DFBPPR10710 ---- Animal proteins ---- Linker for activation of T-cells family member 2
Source.7341: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.7342: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7343: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.7344: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.7345: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.7346: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.7347: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.7348: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.7349: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.7350: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor
Source.7351: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.7352: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.7353: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.7354: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.7355: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.7356: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.7357: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.7358: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.7359: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.7360: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.7361: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.7362: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.7363: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.7364: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.7365: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.7366: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.7367: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.7368: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.7369: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6
Source.7370: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.7371: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.7372: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7373: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.7374: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.7375: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein
Source.7376: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1
Source.7377: DFBPPR10780 ---- Animal proteins ---- Caspase-2
Source.7378: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b
Source.7379: DFBPPR10783 ---- Animal proteins ---- Fructose-bisphosphate aldolase C
Source.7380: DFBPPR10787 ---- Animal proteins ---- Angiogenin
Source.7381: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.7382: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.7383: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.7384: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.7385: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.7386: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.7387: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.7388: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.7389: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.7390: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.7391: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.7392: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.7393: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.7394: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.7395: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.7396: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.7397: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.7398: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.7399: DFBPPR10831 ---- Animal proteins ---- Early growth response protein 1
Source.7400: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.7401: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.7402: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.7403: DFBPPR10838 ---- Animal proteins ---- Protein lin-28 homolog A
Source.7404: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.7405: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.7406: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.7407: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.7408: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.7409: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.7410: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.7411: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.7412: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.7413: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.7414: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.7415: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.7416: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.7417: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.7418: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase
Source.7419: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.7420: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2
Source.7421: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.7422: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.7423: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.7424: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.7425: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.7426: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.7427: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.7428: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.7429: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.7430: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.7431: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.7432: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.7433: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.7434: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.7435: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.7436: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.7437: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.7438: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2
Source.7439: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.7440: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.7441: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.7442: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.7443: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.7444: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.7445: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.7446: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.7447: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.7448: DFBPPR10923 ---- Animal proteins ---- Ras-related protein Rab-5B
Source.7449: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.7450: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.7451: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.7452: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.7453: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.7454: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.7455: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.7456: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.7457: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.7458: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.7459: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.7460: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.7461: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.7462: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.7463: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.7464: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.7465: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.7466: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.7467: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2
Source.7468: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho
Source.7469: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.7470: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.7471: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.7472: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.7473: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.7474: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.7475: DFBPPR10970 ---- Animal proteins ---- Prohibitin
Source.7476: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.7477: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.7478: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.7479: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.7480: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.7481: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.7482: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.7483: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.7484: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.7485: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.7486: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.7487: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.7488: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.7489: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.7490: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.7491: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.7492: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.7493: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.7494: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.7495: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.7496: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.7497: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.7498: DFBPPR11011 ---- Animal proteins ---- Epigen
Source.7499: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.7500: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.7501: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.7502: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.7503: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.7504: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.7505: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.7506: DFBPPR11031 ---- Animal proteins ---- Ribonuclease homolog
Source.7507: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.7508: DFBPPR11034 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.7509: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.7510: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.7511: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.7512: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.7513: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.7514: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.7515: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.7516: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.7517: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.7518: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.7519: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.7520: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.7521: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.7522: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.7523: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.7524: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.7525: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.7526: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.7527: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.7528: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.7529: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.7530: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.7531: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.7532: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.7533: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.7534: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.7535: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.7536: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.7537: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.7538: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.7539: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.7540: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.7541: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.7542: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.7543: DFBPPR11091 ---- Animal proteins ---- Pro-neuropeptide Y
Source.7544: DFBPPR11092 ---- Animal proteins ---- Ataxin-3
Source.7545: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.7546: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.7547: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.7548: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.7549: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.7550: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.7551: DFBPPR11113 ---- Animal proteins ---- POU domain, class 4, transcription factor 1
Source.7552: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.7553: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.7554: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.7555: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.7556: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.7557: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.7558: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.7559: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.7560: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.7561: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.7562: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.7563: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.7564: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.7565: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.7566: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3
Source.7567: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.7568: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.7569: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.7570: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.7571: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.7572: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.7573: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.7574: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.7575: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.7576: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.7577: DFBPPR11169 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.7578: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.7579: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.7580: DFBPPR11178 ---- Animal proteins ---- Gallinacin-3
Source.7581: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.7582: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.7583: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.7584: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.7585: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.7586: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.7587: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.7588: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.7589: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.7590: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.7591: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.7592: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.7593: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.7594: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.7595: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.7596: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.7597: DFBPPR11208 ---- Animal proteins ---- Transcription factor MafF
Source.7598: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.7599: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.7600: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.7601: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.7602: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.7603: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.7604: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.7605: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.7606: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.7607: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.7608: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.7609: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.7610: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.7611: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.7612: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.7613: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.7614: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.7615: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.7616: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.7617: DFBPPR11243 ---- Animal proteins ---- Epiphycan
Source.7618: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.7619: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.7620: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.7621: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3
Source.7622: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.7623: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.7624: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7
Source.7625: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B
Source.7626: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.7627: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.7628: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.7629: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.7630: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.7631: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES
Source.7632: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.7633: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.7634: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.7635: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein
Source.7636: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.7637: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.7638: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.7639: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.7640: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.7641: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.7642: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.7643: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.7644: DFBPPR11299 ---- Animal proteins ---- Casein kinase II subunit beta
Source.7645: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.7646: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.7647: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.7648: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.7649: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.7650: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.7651: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.7652: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.7653: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.7654: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.7655: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.7656: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.7657: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.7658: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.7659: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.7660: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.7661: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.7662: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.7663: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.7664: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.7665: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.7666: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13
Source.7667: DFBPPR11351 ---- Animal proteins ---- Small ubiquitin-related modifier 3
Source.7668: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.7669: DFBPPR11354 ---- Animal proteins ---- Centromere protein O
Source.7670: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR
Source.7671: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.7672: DFBPPR11358 ---- Animal proteins ---- Lysozyme g
Source.7673: DFBPPR11359 ---- Animal proteins ---- Mesogenin-1
Source.7674: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.7675: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.7676: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.7677: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.7678: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.7679: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.7680: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.7681: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.7682: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.7683: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.7684: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.7685: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.7686: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.7687: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.7688: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.7689: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.7690: DFBPPR11388 ---- Animal proteins ---- Matrilin-3
Source.7691: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.7692: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.7693: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.7694: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.7695: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.7696: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.7697: DFBPPR11401 ---- Animal proteins ---- Inhibitor of growth protein 3
Source.7698: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.7699: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.7700: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.7701: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.7702: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.7703: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.7704: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.7705: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.7706: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.7707: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.7708: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.7709: DFBPPR11426 ---- Animal proteins ---- Glutathione S-transferase 5
Source.7710: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.7711: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.7712: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.7713: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7714: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.7715: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.7716: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.7717: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.7718: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.7719: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.7720: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.7721: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.7722: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.7723: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.7724: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.7725: DFBPPR11475 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-B
Source.7726: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.7727: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.7728: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.7729: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.7730: DFBPPR11488 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.7731: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.7732: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.7733: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.7734: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.7735: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.7736: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.7737: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.7738: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.7739: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.7740: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.7741: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.7742: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.7743: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.7744: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.7745: DFBPPR11525 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.7746: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform
Source.7747: DFBPPR11528 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.7748: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.7749: DFBPPR11533 ---- Animal proteins ---- Mimecan
Source.7750: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.7751: DFBPPR11543 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.7752: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.7753: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.7754: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.7755: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.7756: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.7757: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.7758: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.7759: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.7760: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.7761: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.7762: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.7763: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.7764: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.7765: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.7766: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.7767: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.7768: DFBPPR11580 ---- Animal proteins ---- Cilia- and flagella-associated protein 20
Source.7769: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.7770: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.7771: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.7772: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.7773: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.7774: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.7775: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.7776: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.7777: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.7778: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230
Source.7779: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.7780: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.7781: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.7782: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.7783: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.7784: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.7785: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein
Source.7786: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.7787: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.7788: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.7789: DFBPPR11618 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.7790: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.7791: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.7792: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.7793: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.7794: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.7795: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.7796: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.7797: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.7798: DFBPPR11630 ---- Animal proteins ---- Protein kish-A
Source.7799: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.7800: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.7801: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.7802: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.7803: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon
Source.7804: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.7805: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.7806: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.7807: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.7808: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.7809: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.7810: DFBPPR11652 ---- Animal proteins ---- Stathmin-3
Source.7811: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.7812: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.7813: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.7814: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.7815: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1
Source.7816: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.7817: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.7818: DFBPPR11670 ---- Animal proteins ---- Snurportin-1
Source.7819: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.7820: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.7821: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.7822: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.7823: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.7824: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1
Source.7825: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta
Source.7826: DFBPPR11685 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.7827: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4
Source.7828: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.7829: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.7830: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.7831: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.7832: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.7833: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.7834: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.7835: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.7836: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.7837: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.7838: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.7839: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.7840: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.7841: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.7842: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.7843: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.7844: DFBPPR11723 ---- Animal proteins ---- Visinin
Source.7845: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.7846: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.7847: DFBPPR11734 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.7848: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.7849: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.7850: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.7851: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.7852: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.7853: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.7854: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.7855: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.7856: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.7857: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.7858: DFBPPR11765 ---- Animal proteins ---- Peptide YY-like
Source.7859: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.7860: DFBPPR11768 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.7861: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.7862: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.7863: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.7864: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.7865: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3
Source.7866: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.7867: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.7868: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.7869: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.7870: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.7871: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.7872: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.7873: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.7874: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.7875: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.7876: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.7877: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.7878: DFBPPR11799 ---- Animal proteins ---- Homeobox protein Hox-B5
Source.7879: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.7880: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.7881: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.7882: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.7883: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.7884: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.7885: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.7886: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.7887: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.7888: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.7889: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.7890: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.7891: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog
Source.7892: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.7893: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.7894: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.7895: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.7896: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.7897: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.7898: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.7899: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.7900: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7
Source.7901: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.7902: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.7903: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.7904: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.7905: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.7906: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.7907: DFBPPR11865 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8
Source.7908: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.7909: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.7910: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.7911: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.7912: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.7913: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.7914: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.7915: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.7916: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.7917: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.7918: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.7919: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.7920: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.7921: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.7922: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.7923: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.7924: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.7925: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.7926: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.7927: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.7928: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.7929: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.7930: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.7931: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.7932: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna
Source.7933: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.7934: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.7935: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.7936: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.7937: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.7938: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.7939: DFBPPR11925 ---- Animal proteins ---- GSK3-beta interaction protein
Source.7940: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta
Source.7941: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.7942: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.7943: DFBPPR11936 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.7944: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.7945: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.7946: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.7947: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog
Source.7948: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.7949: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.7950: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.7951: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.7952: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.7953: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.7954: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.7955: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.7956: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.7957: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.7958: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4
Source.7959: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.7960: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.7961: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.7962: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.7963: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.7964: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog
Source.7965: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.7966: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.7967: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.7968: DFBPPR11997 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.7969: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.7970: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.7971: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.7972: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.7973: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.7974: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.7975: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.7976: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.7977: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.7978: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.7979: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.7980: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.7981: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.7982: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.7983: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.7984: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.7985: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.7986: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.7987: DFBPPR12063 ---- Animal proteins ---- Centromere protein M
Source.7988: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.7989: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.7990: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.7991: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.7992: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.7993: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.7994: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma
Source.7995: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.7996: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.7997: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.7998: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.7999: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.8000: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.8001: DFBPPR12089 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein
Source.8002: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.8003: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.8004: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.8005: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.8006: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.8007: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2
Source.8008: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.8009: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.8010: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.8011: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.8012: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.8013: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.8014: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.8015: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.8016: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.8017: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.8018: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.8019: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.8020: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.8021: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.8022: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.8023: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.8024: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.8025: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.8026: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.8027: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.8028: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.8029: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.8030: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.8031: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.8032: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.8033: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.8034: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.8035: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.8036: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.8037: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.8038: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.8039: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme
Source.8040: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.8041: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.8042: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1
Source.8043: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.8044: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10
Source.8045: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.8046: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog
Source.8047: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.8048: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.8049: DFBPPR12210 ---- Animal proteins ---- Protein NATD1
Source.8050: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.8051: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.8052: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.8053: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.8054: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.8055: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.8056: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.8057: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.8058: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.8059: DFBPPR12236 ---- Animal proteins ---- Protein FAM133
Source.8060: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.8061: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.8062: DFBPPR12240 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.8063: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog
Source.8064: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.8065: DFBPPR12247 ---- Animal proteins ---- Uncharacterized protein KIAA1671 homolog
Source.8066: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A
Source.8067: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.8068: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.8069: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.8070: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.8071: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.8072: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.8073: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.8074: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.8075: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.8076: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.8077: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.8078: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.8079: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.8080: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.8081: DFBPPR12278 ---- Animal proteins ---- Major prion protein
Source.8082: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.8083: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.8084: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.8085: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.8086: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.8087: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.8088: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.8089: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.8090: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.8091: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.8092: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.8093: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8094: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.8095: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.8096: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.8097: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.8098: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.8099: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.8100: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8101: DFBPPR12308 ---- Animal proteins ---- Phospholipase A2, membrane associated
Source.8102: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.8103: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8104: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.8105: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.8106: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.8107: DFBPPR12318 ---- Animal proteins ---- Endothelin-1
Source.8108: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.8109: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.8110: DFBPPR12322 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.8111: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.8112: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.8113: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.8114: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.8115: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.8116: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.8117: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.8118: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.8119: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.8120: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.8121: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.8122: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.8123: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.8124: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.8125: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.8126: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.8127: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.8128: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.8129: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.8130: DFBPPR12361 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.8131: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.8132: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.8133: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.8134: DFBPPR12366 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.8135: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.8136: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.8137: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.8138: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.8139: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.8140: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8141: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.8142: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.8143: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.8144: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.8145: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.8146: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.8147: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.8148: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.8149: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.8150: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.8151: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.8152: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.8153: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.8154: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.8155: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.8156: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.8157: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.8158: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.8159: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.8160: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.8161: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.8162: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.8163: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.8164: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.8165: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.8166: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8167: DFBPPR12424 ---- Animal proteins ---- Protein phosphatase inhibitor 2
Source.8168: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.8169: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.8170: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.8171: DFBPPR12435 ---- Animal proteins ---- Cytochrome c
Source.8172: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.8173: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.8174: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.8175: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.8176: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8177: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.8178: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.8179: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.8180: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.8181: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.8182: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.8183: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.8184: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.8185: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8186: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.8187: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.8188: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.8189: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.8190: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.8191: DFBPPR12471 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.8192: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.8193: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.8194: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.8195: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.8196: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.8197: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8198: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.8199: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.8200: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.8201: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.8202: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.8203: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.8204: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.8205: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.8206: DFBPPR12496 ---- Animal proteins ---- Protachykinin-1
Source.8207: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.8208: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.8209: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.8210: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.8211: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.8212: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.8213: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.8214: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.8215: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.8216: DFBPPR12510 ---- Animal proteins ---- Phospholemman
Source.8217: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.8218: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase
Source.8219: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.8220: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.8221: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.8222: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.8223: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.8224: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.8225: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.8226: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.8227: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.8228: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.8229: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.8230: DFBPPR12543 ---- Animal proteins ---- Serine/threonine-protein phosphatase 5
Source.8231: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.8232: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.8233: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.8234: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.8235: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.8236: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8237: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.8238: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.8239: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.8240: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.8241: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.8242: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.8243: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.8244: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.8245: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.8246: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.8247: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.8248: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.8249: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.8250: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.8251: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.8252: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.8253: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.8254: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.8255: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.8256: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.8257: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.8258: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.8259: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.8260: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.8261: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.8262: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.8263: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.8264: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.8265: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.8266: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.8267: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.8268: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.8269: DFBPPR12621 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8270: DFBPPR12622 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8271: DFBPPR12623 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8272: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.8273: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase
Source.8274: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.8275: DFBPPR12632 ---- Animal proteins ---- Caveolin-2
Source.8276: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.8277: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.8278: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.8279: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.8280: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8281: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.8282: DFBPPR12662 ---- Animal proteins ---- Interferon gamma
Source.8283: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.8284: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.8285: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.8286: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.8287: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.8288: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.8289: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8290: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.8291: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.8292: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.8293: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.8294: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.8295: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.8296: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.8297: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.8298: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.8299: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.8300: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.8301: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8302: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86
Source.8303: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.8304: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.8305: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.8306: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.8307: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25
Source.8308: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.8309: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.8310: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.8311: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.8312: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.8313: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.8314: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.8315: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.8316: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.8317: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.8318: DFBPPR12761 ---- Animal proteins ---- Trichohyalin
Source.8319: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.8320: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.8321: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.8322: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.8323: DFBPPR12770 ---- Animal proteins ---- Filamin-B
Source.8324: DFBPPR12772 ---- Animal proteins ---- Colipase
Source.8325: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.8326: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8327: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.8328: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.8329: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.8330: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.8331: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.8332: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.8333: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.8334: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.8335: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.8336: DFBPPR12796 ---- Animal proteins ---- Caspase-3
Source.8337: DFBPPR12797 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 1
Source.8338: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.8339: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.8340: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.8341: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.8342: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.8343: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.8344: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2
Source.8345: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.8346: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.8347: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.8348: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.8349: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.8350: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.8351: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.8352: DFBPPR12827 ---- Animal proteins ---- Matrix Gla protein
Source.8353: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.8354: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.8355: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.8356: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.8357: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8358: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.8359: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.8360: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.8361: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.8362: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.8363: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.8364: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.8365: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.8366: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.8367: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.8368: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.8369: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.8370: DFBPPR12863 ---- Animal proteins ---- Casein kinase II subunit beta
Source.8371: DFBPPR12865 ---- Animal proteins ---- Sperm surface protein Sp17
Source.8372: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.8373: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.8374: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.8375: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.8376: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.8377: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.8378: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.8379: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.8380: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.8381: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.8382: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.8383: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2
Source.8384: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.8385: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.8386: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.8387: DFBPPR12929 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.8388: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.8389: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.8390: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.8391: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.8392: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.8393: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.8394: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.8395: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8396: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.8397: DFBPPR12952 ---- Animal proteins ---- Serum amyloid A-1 protein
Source.8398: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.8399: DFBPPR12954 ---- Animal proteins ---- Apolipoprotein B
Source.8400: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.8401: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.8402: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.8403: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.8404: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.8405: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.8406: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.8407: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.8408: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.8409: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.8410: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.8411: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.8412: DFBPPR12974 ---- Animal proteins ---- Serum amyloid A-3 protein
Source.8413: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.8414: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.8415: DFBPPR12984 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.8416: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.8417: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.8418: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.8419: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.8420: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A
Source.8421: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.8422: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.8423: DFBPPR12992 ---- Animal proteins ---- Mimecan
Source.8424: DFBPPR12993 ---- Animal proteins ---- Tumor protein D52
Source.8425: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.8426: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8427: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.8428: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.8429: DFBPPR13014 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.8430: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform
Source.8431: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.8432: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.8433: DFBPPR13025 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.8434: DFBPPR13028 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.8435: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.8436: DFBPPR13034 ---- Animal proteins ---- Sarcospan
Source.8437: DFBPPR13035 ---- Animal proteins ---- Chymase
Source.8438: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.8439: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.8440: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein
Source.8441: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.8442: DFBPPR13055 ---- Animal proteins ---- Serum amyloid A-2 protein
Source.8443: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.8444: DFBPPR13061 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.8445: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.8446: DFBPPR13068 ---- Animal proteins ---- Biglycan
Source.8447: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.8448: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.8449: DFBPPR13075 ---- Animal proteins ---- 60S ribosomal protein L5
Source.8450: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.8451: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.8452: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207
Source.8453: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta
Source.8454: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.8455: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.8456: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2
Source.8457: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.8458: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8459: DFBPPR13125 ---- Animal proteins ---- Ig kappa chain V region 3547
Source.8460: DFBPPR13141 ---- Animal proteins ---- Cytochrome c
Source.8461: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8462: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.8463: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.8464: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.8465: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5
Source.8466: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.8467: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.8468: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8469: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.8470: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.8471: DFBPPR13169 ---- Animal proteins ---- High mobility group protein B1
Source.8472: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8473: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.8474: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.8475: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.8476: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8477: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.8478: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.8479: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.8480: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.8481: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.8482: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.8483: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8484: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.8485: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.8486: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.8487: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.8488: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.8489: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.8490: DFBPPR13203 ---- Animal proteins ---- Follistatin
Source.8491: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.8492: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8493: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.8494: DFBPPR13211 ---- Animal proteins ---- Colipase B
Source.8495: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.8496: DFBPPR13216 ---- Animal proteins ---- Colipase A
Source.8497: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.8498: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.8499: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.8500: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.8501: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8502: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.8503: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.8504: DFBPPR13232 ---- Animal proteins ---- Osteocalcin
Source.8505: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.8506: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2
Source.8507: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8508: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.8509: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.8510: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.8511: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.8512: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.8513: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.8514: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.8515: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.8516: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.8517: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8518: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.8519: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.8520: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.8521: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.8522: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.8523: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.8524: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8525: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.8526: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.8527: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.8528: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.8529: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.8530: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.8531: DFBPPR13299 ---- Animal proteins ---- Interleukin-1 alpha
Source.8532: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8533: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.8534: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.8535: DFBPPR13308 ---- Animal proteins ---- Interleukin-10
Source.8536: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.8537: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.8538: DFBPPR13311 ---- Animal proteins ---- Agouti-signaling protein
Source.8539: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.8540: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.8541: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.8542: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8543: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.8544: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8545: DFBPPR13325 ---- Animal proteins ---- Serum amyloid A protein
Source.8546: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.8547: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.8548: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.8549: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.8550: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.8551: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.8552: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.8553: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.8554: DFBPPR13348 ---- Animal proteins ---- Calcitonin
Source.8555: DFBPPR13349 ---- Animal proteins ---- Cysteine-rich secretory protein 3
Source.8556: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8557: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.8558: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.8559: DFBPPR13364 ---- Animal proteins ---- Glycophorin-A
Source.8560: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8561: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.8562: DFBPPR13371 ---- Animal proteins ---- Calcitonin gene-related peptide 2
Source.8563: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.8564: DFBPPR13376 ---- Animal proteins ---- Interleukin-5
Source.8565: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.8566: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.8567: DFBPPR13387 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.8568: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.8569: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.8570: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.8571: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22
Source.8572: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.8573: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.8574: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8575: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.8576: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.8577: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.8578: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8579: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.8580: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.8581: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.8582: DFBPPR13433 ---- Animal proteins ---- Major prion protein
Source.8583: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.8584: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.8585: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.8586: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8587: DFBPPR13445 ---- Animal proteins ---- Interleukin-1 alpha
Source.8588: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.8589: DFBPPR13448 ---- Animal proteins ---- Osteocalcin
Source.8590: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8591: DFBPPR13455 ---- Animal proteins ---- Glutathione S-transferase P
Source.8592: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3
Source.8593: DFBPPR13462 ---- Animal proteins ---- Fatty acid synthase
Source.8594: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8595: DFBPPR13468 ---- Animal proteins ---- Hemoglobin subunit alpha-1
Source.8596: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.8597: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8598: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.8599: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8600: DFBPPR13476 ---- Animal proteins ---- Hemoglobin subunit alpha-2
Source.8601: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta
Source.8602: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.8603: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.8604: DFBPPR13485 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.8605: DFBPPR13491 ---- Animal proteins ---- Gastrin
Source.8606: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.8607: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.8608: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8609: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.8610: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.8611: DFBPPR13530 ---- Animal proteins ---- Major prion protein
Source.8612: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8613: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.8614: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8615: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.8616: DFBPPR13538 ---- Animal proteins ---- Apolipoprotein E
Source.8617: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1
Source.8618: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.8619: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.8620: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8621: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.8622: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.8623: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.8624: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.8625: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.8626: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.8627: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.8628: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.8629: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.8630: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.8631: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.8632: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.8633: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8634: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8635: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.8636: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8637: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.8638: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.8639: DFBPPR13606 ---- Animal proteins ---- Estrogen receptor
Source.8640: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.8641: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8642: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.8643: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.8644: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II
Source.8645: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.8646: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.8647: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.8648: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8649: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8650: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.8651: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.8652: DFBPPR13631 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8653: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.8654: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.8655: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.8656: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.8657: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.8658: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.8659: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8660: DFBPPR13661 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2
Source.8661: DFBPPR13663 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.8662: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.8663: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.8664: DFBPPR13671 ---- Animal proteins ---- Interleukin-7
Source.8665: DFBPPR13672 ---- Animal proteins ---- Annexin A2
Source.8666: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.8667: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8668: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.8669: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.8670: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.8671: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.8672: DFBPPR13683 ---- Animal proteins ---- 14-3-3 protein sigma
Source.8673: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.8674: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen
Source.8675: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8676: DFBPPR13692 ---- Animal proteins ---- Pro-neuropeptide Y
Source.8677: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.8678: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1
Source.8679: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.8680: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.8681: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.8682: DFBPPR13704 ---- Animal proteins ---- Osteopontin
Source.8683: DFBPPR13708 ---- Animal proteins ---- Renin
Source.8684: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta
Source.8685: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.8686: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.8687: DFBPPR13723 ---- Animal proteins ---- Cytochrome c
Source.8688: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.8689: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.8690: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8691: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.8692: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.8693: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.8694: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.8695: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.8696: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.8697: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.8698: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8699: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.8700: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.8701: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.8702: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.8703: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.8704: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.8705: DFBPPR13773 ---- Animal proteins ---- Interleukin-1 alpha
Source.8706: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.8707: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.8708: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.8709: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.8710: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.8711: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.8712: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.8713: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.8714: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.8715: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.8716: DFBPPR13805 ---- Animal proteins ---- Serum amyloid A protein
Source.8717: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.8718: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma
Source.8719: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.8720: DFBPPR13821 ---- Animal proteins ---- Calcitonin
Source.8721: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.8722: DFBPPR13824 ---- Animal proteins ---- Adrenodoxin
Source.8723: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.8724: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.8725: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.8726: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.8727: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.8728: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.8729: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.8730: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.8731: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8732: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.8733: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.8734: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.8735: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.8736: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.8737: DFBPPR13864 ---- Animal proteins ---- Interleukin-5
Source.8738: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9
Source.8739: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.8740: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.8741: DFBPPR13876 ---- Animal proteins ---- Follistatin
Source.8742: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8743: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.8744: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.8745: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8746: DFBPPR13893 ---- Animal proteins ---- Calponin-1
Source.8747: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.8748: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.8749: DFBPPR13901 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.8750: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.8751: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.8752: DFBPPR13916 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.8753: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.8754: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.8755: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon
Source.8756: DFBPPR13928 ---- Animal proteins ---- Keratin, type II microfibrillar
Source.8757: DFBPPR13929 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.8758: DFBPPR13931 ---- Animal proteins ---- Homeobox protein Hox-B5
Source.8759: DFBPPR13935 ---- Animal proteins ---- Major centromere autoantigen B
Source.8760: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.8761: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.8762: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.8763: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26
Source.8764: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2
Source.8765: DFBPPR13958 ---- Animal proteins ---- Homeobox protein Hox-D3
Source.8766: DFBPPR13960 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.8767: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8768: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.8769: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.8770: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.8771: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2
Source.8772: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8773: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.8774: DFBPPR13991 ---- Animal proteins ---- Osteocalcin
Source.8775: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.8776: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.8777: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog
Source.8778: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.8779: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.8780: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.8781: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1
Source.8782: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.8783: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.8784: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8785: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.8786: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2
Source.8787: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8788: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.8789: DFBPPR14020 ---- Animal proteins ---- Parvalbumin alpha
Source.8790: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.8791: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.8792: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8793: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.8794: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.8795: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.8796: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.8797: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.8798: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.8799: DFBPPR14050 ---- Animal proteins ---- Somatoliberin
Source.8800: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.8801: DFBPPR14065 ---- Animal proteins ---- Lysozyme g
Source.8802: DFBPPR14070 ---- Animal proteins ---- 60S ribosomal protein L15
Source.8803: DFBPPR14073 ---- Marine protein ---- Elastase-1
Source.8804: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.8805: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.8806: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.8807: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.8808: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.8809: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.8810: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta
Source.8811: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha
Source.8812: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.8813: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.8814: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.8815: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.8816: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.8817: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.8818: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.8819: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.8820: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.8821: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9
Source.8822: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.8823: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.8824: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial
Source.8825: DFBPPR14116 ---- Marine protein ---- Ferritin, heavy subunit
Source.8826: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.8827: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.8828: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.8829: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.8830: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.8831: DFBPPR14134 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2B
Source.8832: DFBPPR14135 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2A
Source.8833: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.8834: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.8835: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H
Source.8836: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.8837: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.8838: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.8839: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.8840: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.8841: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2
Source.8842: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog
Source.8843: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.8844: DFBPPR14172 ---- Marine protein ---- Homeobox protein Hox-B2
Source.8845: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.8846: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.8847: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.8848: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1
Source.8849: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.8850: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.8851: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.8852: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.8853: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.8854: DFBPPR14211 ---- Marine protein ---- WASH complex subunit 3
Source.8855: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.8856: DFBPPR14228 ---- Marine protein ---- UPF0691 protein C9orf116 homolog
Source.8857: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.8858: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.8859: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.8860: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.8861: DFBPPR14243 ---- Marine protein ---- Glycoprotein hormones alpha chain 2
Source.8862: DFBPPR14246 ---- Marine protein ---- Glycoprotein hormones alpha chain 1
Source.8863: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3
Source.8864: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1
Source.8865: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2
Source.8866: DFBPPR14268 ---- Marine protein ---- Cytochrome c oxidase subunit 6C-1
Source.8867: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.8868: DFBPPR14271 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.8869: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain
Source.8870: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.8871: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain
Source.8872: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.8873: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.8874: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase
Source.8875: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.8876: DFBPPR14295 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain
Source.8877: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.8878: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.8879: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.8880: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.8881: DFBPPR14310 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.8882: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.8883: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.8884: DFBPPR14315 ---- Marine protein ---- Protein CfxQ homolog
Source.8885: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.8886: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain
Source.8887: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.8888: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.8889: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.8890: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.8891: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.8892: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.8893: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.8894: DFBPPR14337 ---- Marine protein ---- Photosystem I iron-sulfur center
Source.8895: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.8896: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.8897: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.8898: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.8899: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.8900: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.8901: DFBPPR14346 ---- Marine protein ---- R-phycoerythrin alpha chain
Source.8902: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.8903: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.8904: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.8905: DFBPPR14357 ---- Marine protein ---- Ferredoxin
Source.8906: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.8907: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit
Source.8908: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.8909: DFBPPR14363 ---- Marine protein ---- Putative peroxiredoxin ycf42
Source.8910: DFBPPR14364 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain
Source.8911: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.8912: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.8913: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.8914: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.8915: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha
Source.8916: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha
Source.8917: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.8918: DFBPPR14378 ---- Marine protein ---- Probable replicative DNA helicase
Source.8919: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha
Source.8920: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.8921: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.8922: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain
Source.8923: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.8924: DFBPPR14391 ---- Marine protein ---- Cytochrome b6-f complex subunit 5
Source.8925: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.8926: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.8927: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.8928: DFBPPR14400 ---- Marine protein ---- Heme oxygenase
Source.8929: DFBPPR14403 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.8930: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.8931: DFBPPR14419 ---- Marine protein ---- Photosystem II reaction center protein K
Source.8932: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK
Source.8933: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.8934: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.8935: DFBPPR14423 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic
Source.8936: DFBPPR14430 ---- Marine protein ---- 30S ribosomal protein S12, chloroplastic
Source.8937: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.8938: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic
Source.8939: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.8940: DFBPPR14455 ---- Marine protein ---- 30S ribosomal protein S10, chloroplastic
Source.8941: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29
Source.8942: DFBPPR14472 ---- Marine protein ---- Photosystem I reaction center subunit XI
Source.8943: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.8944: DFBPPR14475 ---- Marine protein ---- Photosystem I reaction center subunit VIII
Source.8945: DFBPPR14476 ---- Marine protein ---- Protein CfxQ homolog
Source.8946: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.8947: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.8948: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28
Source.8949: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.8950: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.8951: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.8952: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.8953: DFBPPR14522 ---- Marine protein ---- Uncharacterized protein ycf20
Source.8954: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35
Source.8955: DFBPPR14529 ---- Marine protein ---- Uncharacterized protein ycf22
Source.8956: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.8957: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.8958: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.8959: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.8960: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.8961: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.8962: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8963: DFBPPR14560 ---- Marine protein ---- Histone H3.2
Source.8964: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.8965: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.8966: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.8967: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.8968: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.8969: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.8970: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.8971: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1
Source.8972: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.8973: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.8974: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.8975: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4
Source.8976: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.8977: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.8978: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.8979: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.8980: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein
Source.8981: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.8982: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9
Source.8983: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.8984: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a
Source.8985: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.8986: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.8987: DFBPPR14620 ---- Marine protein ---- GTP cyclohydrolase 1
Source.8988: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.8989: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.8990: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.8991: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.8992: DFBPPR14643 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2B
Source.8993: DFBPPR14644 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2A
Source.8994: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B
Source.8995: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.8996: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.8997: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.8998: DFBPPR14666 ---- Marine protein ---- High mobility group-T protein
Source.8999: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.9000: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.9001: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.9002: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.9003: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.9004: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.9005: DFBPPR14686 ---- Marine protein ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.9006: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.9007: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.9008: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.9009: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1
Source.9010: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.9011: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog
Source.9012: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.9013: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2
Source.9014: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1
Source.9015: DFBPPR14720 ---- Marine protein ---- Transcription initiation factor IIA subunit 2
Source.9016: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.9017: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B
Source.9018: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.9019: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1
Source.9020: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.9021: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.9022: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.9023: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.9024: DFBPPR14759 ---- Marine protein ---- Tachystatin-A2
Source.9025: DFBPPR14760 ---- Marine protein ---- Big defensin
Source.9026: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.9027: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.9028: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.9029: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.9030: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.9031: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.9032: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.9033: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.9034: DFBPPR14791 ---- Marine protein ---- Guanine nucleotide-binding protein G(i) subunit alpha
Source.9035: DFBPPR14793 ---- Marine protein ---- Panulirin
Source.9036: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.9037: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.9038: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.9039: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.9040: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.9041: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.9042: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.9043: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.9044: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.9045: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.9046: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial
Source.9047: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.9048: DFBPPR14818 ---- Marine protein ---- Tropomyosin
Source.9049: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.9050: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1
Source.9051: DFBPPR14828 ---- Marine protein ---- Tropomyosin
Source.9052: DFBPPR14838 ---- Marine protein ---- Hemocyanin subunit 4
Source.9053: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.9054: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.9055: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.9056: DFBPPR14857 ---- Marine protein ---- Hemoglobin anodic subunit alpha
Source.9057: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.9058: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta
Source.9059: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.9060: DFBPPR14864 ---- Marine protein ---- Hemoglobin anodic subunit beta
Source.9061: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.9062: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.9063: DFBPPR14869 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.9064: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.9065: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.9066: DFBPPR14881 ---- Microorganism protein ---- Decapping and exoribonuclease protein 1
Source.9067: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.9068: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.9069: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.9070: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.9071: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.9072: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.9073: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.9074: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.9075: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.9076: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.9077: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.9078: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.9079: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.9080: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.9081: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.9082: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.9083: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.9084: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.9085: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.9086: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8
Source.9087: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.9088: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.9089: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.9090: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.9091: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.9092: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.9093: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.9094: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.9095: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.9096: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1
Source.9097: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.9098: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.9099: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.9100: DFBPPR14936 ---- Microorganism protein ---- Inner kinetochore subunit MCM21
Source.9101: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase
Source.9102: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.9103: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.9104: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.9105: DFBPPR14944 ---- Microorganism protein ---- Histone H3
Source.9106: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.9107: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.9108: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.9109: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.9110: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial
Source.9111: DFBPPR14952 ---- Microorganism protein ---- Histone H2B.1
Source.9112: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.9113: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.9114: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.9115: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.9116: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.9117: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.9118: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.9119: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.9120: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.9121: DFBPPR14967 ---- Microorganism protein ---- Histone H2B.2
Source.9122: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.9123: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.9124: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.9125: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.9126: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.9127: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.9128: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.9129: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.9130: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.9131: DFBPPR14990 ---- Microorganism protein ---- Nuclear distribution protein PAC1
Source.9132: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.9133: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.9134: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.9135: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.9136: DFBPPR14999 ---- Microorganism protein ---- Histone H3-like centromeric protein CSE4
Source.9137: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.9138: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.9139: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.9140: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.9141: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.9142: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.9143: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.9144: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.9145: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.9146: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.9147: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.9148: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.9149: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.9150: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.9151: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.9152: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.9153: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.9154: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.9155: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.9156: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.9157: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.9158: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.9159: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.9160: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.9161: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.9162: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.9163: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial
Source.9164: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.9165: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.9166: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.9167: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.9168: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.9169: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.9170: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.9171: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.9172: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.9173: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.9174: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.9175: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.9176: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.9177: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.9178: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.9179: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor
Source.9180: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12
Source.9181: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.9182: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.9183: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.9184: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase
Source.9185: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.9186: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.9187: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.9188: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial
Source.9189: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.9190: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.9191: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.9192: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.9193: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6
Source.9194: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.9195: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.9196: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.9197: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.9198: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.9199: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.9200: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.9201: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.9202: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.9203: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.9204: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.9205: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G
Source.9206: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.9207: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.9208: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase
Source.9209: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.9210: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.9211: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.9212: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6
Source.9213: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.9214: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.9215: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.9216: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.9217: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.9218: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic
Source.9219: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.9220: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.9221: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.9222: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.9223: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.9224: DFBPPR15159 ---- Microorganism protein ---- Centromere-binding protein 1
Source.9225: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.9226: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.9227: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.9228: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2
Source.9229: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.9230: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.9231: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.9232: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.9233: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.9234: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.9235: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.9236: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.9237: DFBPPR15185 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 8
Source.9238: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.9239: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.9240: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.9241: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I
Source.9242: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.9243: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.9244: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.9245: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13
Source.9246: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.9247: DFBPPR15204 ---- Microorganism protein ---- FK506-binding protein 1
Source.9248: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.9249: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.9250: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.9251: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.9252: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1
Source.9253: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.9254: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.9255: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.9256: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.9257: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.9258: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.9259: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4
Source.9260: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.9261: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.9262: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.9263: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.9264: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.9265: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.9266: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.9267: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.9268: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.9269: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a
Source.9270: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase
Source.9271: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.9272: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.9273: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.9274: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.9275: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1
Source.9276: DFBPPR15265 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM14
Source.9277: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.9278: DFBPPR15267 ---- Microorganism protein ---- Cofilin
Source.9279: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.9280: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.9281: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.9282: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.9283: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.9284: DFBPPR15281 ---- Microorganism protein ---- Cytochrome c oxidase subunit 9, mitochondrial
Source.9285: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.9286: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase
Source.9287: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.9288: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D
Source.9289: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.9290: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.9291: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.9292: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase
Source.9293: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.9294: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.9295: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1
Source.9296: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.9297: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.9298: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.9299: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.9300: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.9301: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.9302: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.9303: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.9304: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.9305: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.9306: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.9307: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.9308: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.9309: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.9310: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.9311: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.9312: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.9313: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.9314: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3
Source.9315: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.9316: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.9317: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1
Source.9318: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.9319: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.9320: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.9321: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.9322: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.9323: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase
Source.9324: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.9325: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.9326: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.9327: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.9328: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.9329: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.9330: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.9331: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial
Source.9332: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.9333: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.9334: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.9335: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.9336: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.9337: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.9338: DFBPPR15403 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM13
Source.9339: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.9340: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3
Source.9341: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.9342: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.9343: DFBPPR15424 ---- Microorganism protein ---- Diphthamide biosynthesis protein 4
Source.9344: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.9345: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.9346: DFBPPR15441 ---- Microorganism protein ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.9347: DFBPPR15442 ---- Microorganism protein ---- Type 1 phosphatases regulator YPI1
Source.9348: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.9349: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.9350: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.9351: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.9352: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial
Source.9353: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.9354: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.9355: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121
Source.9356: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.9357: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.9358: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.9359: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.9360: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.9361: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.9362: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.9363: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.9364: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.9365: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.9366: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.9367: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.9368: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.9369: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.9370: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123
Source.9371: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.9372: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.9373: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.9374: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.9375: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.9376: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.9377: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.9378: DFBPPR15528 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC23
Source.9379: DFBPPR15530 ---- Microorganism protein ---- Translationally-controlled tumor protein homolog
Source.9380: DFBPPR15533 ---- Microorganism protein ---- Non-histone chromosomal protein 6
Source.9381: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.9382: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.9383: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.9384: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.9385: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.9386: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.9387: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14
Source.9388: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.9389: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.9390: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.9391: DFBPPR15561 ---- Microorganism protein ---- Ribosome biogenesis protein SLX9
Source.9392: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2
Source.9393: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.9394: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein
Source.9395: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.9396: DFBPPR15571 ---- Microorganism protein ---- Mating-type protein ALPHA2
Source.9397: DFBPPR15572 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 2, mitochondrial
Source.9398: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381
Source.9399: DFBPPR15576 ---- Microorganism protein ---- Cytochrome c oxidase-assembly factor COX23, mitochondrial
Source.9400: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.9401: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.9402: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.9403: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.9404: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.9405: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.9406: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28
Source.9407: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.9408: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4
Source.9409: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.9410: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.9411: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial
Source.9412: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.9413: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13
Source.9414: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.9415: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.9416: DFBPPR15614 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX16, mitochondrial
Source.9417: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.9418: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.9419: DFBPPR15620 ---- Microorganism protein ---- Autophagy-related protein 23
Source.9420: DFBPPR15622 ---- Microorganism protein ---- Mitochondrial zinc maintenance protein 1, mitochondrial
Source.9421: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.9422: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.9423: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12
Source.9424: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.9425: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.9426: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.9427: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.9428: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1
Source.9429: DFBPPR15634 ---- Microorganism protein ---- Hsp70 nucleotide exchange factor FES1
Source.9430: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.9431: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16
Source.9432: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3
Source.9433: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.9434: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.9435: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.9436: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22
Source.9437: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.9438: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.9439: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.9440: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25
Source.9441: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1
Source.9442: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial
Source.9443: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.9444: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.9445: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1
Source.9446: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.9447: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.9448: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.9449: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.9450: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.9451: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.9452: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1
Source.9453: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.9454: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45
Source.9455: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.9456: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.9457: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.9458: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.9459: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.9460: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.9461: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.9462: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.9463: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.9464: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1
Source.9465: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.9466: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.9467: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.9468: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.9469: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.9470: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.9471: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19
Source.9472: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.9473: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.9474: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.9475: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.9476: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.9477: DFBPPR15760 ---- Microorganism protein ---- 40S ribosomal protein S16
Source.9478: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.9479: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3
Source.9480: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11
Source.9481: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.9482: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.9483: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.9484: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4
Source.9485: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.9486: DFBPPR15781 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 5
Source.9487: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1
Source.9488: DFBPPR15785 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 7
Source.9489: DFBPPR15786 ---- Microorganism protein ---- Stationary phase protein 4
Source.9490: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.9491: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.9492: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.9493: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.9494: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase
Source.9495: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.9496: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component
Source.9497: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.9498: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.9499: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.9500: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.9501: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.9502: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD
Source.9503: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.9504: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.9505: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.9506: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.9507: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.9508: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR
Source.9509: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.9510: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase
Source.9511: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.9512: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.9513: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.9514: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.9515: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.9516: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.9517: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.9518: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.9519: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.9520: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.9521: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.9522: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.9523: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.9524: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.9525: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.9526: DFBPPR15867 ---- Microorganism protein ---- Superoxide dismutase [Mn], mitochondrial
Source.9527: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase
Source.9528: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.9529: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.9530: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.9531: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.9532: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.9533: DFBPPR15889 ---- Marine protein ---- Ferredoxin
Source.9534: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.9535: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.9536: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.9537: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9538: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.9539: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.9540: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.9541: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.9542: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.9543: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.9544: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9545: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.9546: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.9547: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.9548: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.9549: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.9550: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.9551: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.9552: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.9553: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.9554: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9555: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.9556: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.9557: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.9558: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9559: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.9560: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.9561: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.9562: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.9563: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.9564: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.9565: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.9566: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9567: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9568: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.9569: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.9570: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.9571: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9572: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.9573: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9574: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.9575: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9576: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.9577: DFBPPR7812 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.9578: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.9579: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9580: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9581: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9582: DFBPPR7824 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.9583: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.9584: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.9585: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9586: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.9587: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.9588: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.9589: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.9590: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.9591: DFBPPR7843 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.9592: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.9593: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.9594: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.9595: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.9596: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9597: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.9598: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.9599: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.9600: DFBPPR7866 ---- Plant protein ---- Photosystem II reaction center protein K
Source.9601: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.9602: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3
Source.9603: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1
Source.9604: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1
Source.9605: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.9606: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.9607: DFBPPR7894 ---- Plant protein ---- CASP-like protein 2C2
Source.9608: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.9609: DFBPPR7897 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic
Source.9610: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.9611: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.9612: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.9613: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1
Source.9614: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.9615: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1
Source.9616: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.9617: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.9618: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1
Source.9619: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2
Source.9620: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1
Source.9621: DFBPPR7926 ---- Plant protein ---- Kafirin PSK8
Source.9622: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.9623: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.9624: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.9625: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.9626: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.9627: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.9628: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.9629: DFBPPR7939 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase FKBP12
Source.9630: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1
Source.9631: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.9632: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9633: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.9634: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.9635: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.9636: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.9637: DFBPPR7959 ---- Plant protein ---- Leghemoglobin 49
Source.9638: DFBPPR7963 ---- Plant protein ---- Leghemoglobin 29
Source.9639: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.9640: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.9641: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.9642: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.9643: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein
Source.9644: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.9645: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.9646: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A
Source.9647: DFBPPR7987 ---- Plant protein ---- Antifungal protein ginkbilobin-2
Source.9648: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.9649: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9650: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9651: DFBPPR7996 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.9652: DFBPPR8000 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.9653: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.9654: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.9655: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.9656: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.9657: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.9658: DFBPPR8030 ---- Plant protein ---- Arcelin-5A
Source.9659: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.9660: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1
Source.9661: DFBPPR8033 ---- Plant protein ---- Uricase-2
Source.9662: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.9663: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.9664: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.9665: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.9666: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9667: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.9668: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.9669: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.9670: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.9671: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9672: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.9673: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.9674: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.9675: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.9676: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.9677: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic
Source.9678: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9679: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.9680: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.9681: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9682: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.9683: DFBPPR8061 ---- Plant protein ---- Photosystem I iron-sulfur center
Source.9684: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.9685: DFBPPR8063 ---- Plant protein ---- Leghemoglobin A
Source.9686: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9687: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.9688: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9689: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9690: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.9691: DFBPPR8073 ---- Plant protein ---- Arcelin-5B
Source.9692: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.9693: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.9694: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.9695: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.9696: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9697: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.9698: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9699: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.9700: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.9701: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.9702: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.9703: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9704: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.9705: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.9706: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9707: DFBPPR8106 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9708: DFBPPR8107 ---- Plant protein ---- Stress-related protein
Source.9709: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1
Source.9710: DFBPPR8110 ---- Plant protein ---- Leghemoglobin
Source.9711: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.9712: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.9713: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9714: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.9715: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.9716: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8
Source.9717: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.9718: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.9719: DFBPPR8126 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.9720: DFBPPR8127 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.9721: DFBPPR8128 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.9722: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.9723: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.9724: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.9725: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2
Source.9726: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.9727: DFBPPR8156 ---- Plant protein ---- Nodulin-30
Source.9728: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.9729: DFBPPR8174 ---- Plant protein ---- 60 kDa cell wall protein
Source.9730: DFBPPR8181 ---- Plant protein ---- 33 kDa cell wall protein
Source.9731: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.9732: DFBPPR8214 ---- Plant protein ---- Cytochrome c
Source.9733: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.9734: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.9735: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.9736: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9737: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.9738: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.9739: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.9740: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9741: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.9742: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9743: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.9744: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.9745: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.9746: DFBPPR8233 ---- Plant protein ---- Photosystem I iron-sulfur center
Source.9747: DFBPPR8235 ---- Plant protein ---- Catalase
Source.9748: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9749: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase
Source.9750: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.9751: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9752: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3
Source.9753: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.9754: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.9755: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9756: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9757: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9758: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.9759: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.9760: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.9761: DFBPPR8258 ---- Plant protein ---- Ribosomal protein S12, mitochondrial
Source.9762: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.9763: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9764: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.9765: DFBPPR8267 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.9766: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.9767: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9768: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9769: DFBPPR8277 ---- Plant protein ---- Profilin
Source.9770: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase
Source.9771: DFBPPR8281 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.9772: DFBPPR8282 ---- Plant protein ---- Isocitrate lyase
Source.9773: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9774: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.9775: DFBPPR8292 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.9776: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9777: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.9778: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K
Source.9779: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.9780: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.9781: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.9782: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Source.9783: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.9784: DFBPPR8337 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic
Source.9785: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3
Source.9786: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein
Source.9787: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein
Source.9788: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Source.9789: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research
Link 1: DFBPACEI0616----Corn----Corn wet milling byproduct hydrolysates
Link 2: DFBPACEI1229----Soybean and Wheat----Soy sauce
Link 3: DFBPACEI1594----Maize protein----α-Zein
Link 4: DFBPACEI1660----Buckwheat----Buckwheat protein hydrolysates
Link 5: DFBPACEI1853----Milk protein----Multiple milk proteins
Biological/Functional activity & target protein
ACE-inhibitory activity

Amaranth trypsin-digested glutelins induce endothelial NO production and consequent vasodilation through their ACE-inhibitory activity. The peptide AY was isolated from the highest active fraction, so the peptide was a potential Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory peptide (No valid IC50 value was determined in this study).

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Native amaranth glutelins were digested with trypsin (Sigma-Aldrich, St. Louis, MO, USA) at an enzyme/substrate ratio of 1:10 (w/w) for 10 h at 37 ℃.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

Amaranth trypsin-digested glutelins have a high potential as a nutraceutical food in prevention of cardiovascular diseases.

Database cross-references
DFBP
[D1] DFBPANHY0455, DFBPANHY0656, DFBPANHY0945
[D2] DFBPANOX0047, DFBPANOX0775
[D3] DFBPMUFU0141
BIOPEP-UWM [D4] 3563, 7866, 8765
APD [D5] -
BioPepDB [D6] -
MBPDB [D7] -
Reference(s)
Primary literature de la Rosa AP, Montoya AB, Martínez-Cuevas P, Hernández-Ledesma B, León-Galván MF, De León-Rodríguez A, González C. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides. Nitric Oxide. 2010 Sep 15;23(2):106-11.
PMID: 20435155
Other literature(s)

[1] Cushman D. W., 1981. Angiotensin converting enzyme inhibitors: Evolution of a new class of antihypertensive drugs (page 19). in: Horovitz Z. P. (Ed.)(1981), Mechanisms of action and clinical implications, Urban & Schwarzenberg.
[2] Yano S, Suzuki K, Funatsu G. Isolation from alpha-zein of thermolysin peptides with angiotensin I-converting enzyme inhibitory activity[J]. Bioscience Biotechnology & Biochemistry, 1996, 60(4):661-3.
[3] Yokomizo A, Takenaka Y, Takenaka T. Antioxidative Activity of Peptides Prepared from Okara Protein[J]. Food Science & Technology International Tokyo, 2002, 8(4):357-359.
[4] Lin F, Chen L, Liang R, et al. Pilot-scale production of low molecular weight peptides from corn wet milling byproducts and the antihypertensive effects in vivo and in vitro[J]. Food Chemistry, 2011, 124(3):801-807.

PubDate 2010
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214