Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1896(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1896
Peptide sequence	VF
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	Antihypertensive activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Val-Phe

Single-letter amino acid

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	264.32 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

53 uM ^[1]

pIC₅₀

-1.724

GRAVY

3.5000^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Plant
Organism/Source	Amaranth seed proteins
Precursor protein	Amaranth glutelins
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.3: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit Source.4: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein Source.5: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein Source.6: DFBPPR0748 ---- Plant proteins ---- Agglutinin Source.7: DFBPPR0776 ---- Plant proteins ---- 11S globulin Source.8: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.9: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.10: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.11: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.12: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1 Source.13: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.14: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.15: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.16: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.17: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.18: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.19: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.20: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.21: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.22: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.23: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.24: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.25: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic Source.26: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.27: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.28: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic Source.29: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.30: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A Source.31: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.32: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5 Source.33: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.34: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.35: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.36: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.37: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.38: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.39: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.40: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.41: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.42: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.43: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.44: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.45: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.46: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.47: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.48: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.49: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A Source.50: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.51: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.52: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6 Source.53: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.54: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.55: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.56: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic Source.57: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1 Source.58: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.59: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.60: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.61: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.62: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.63: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.64: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1 Source.65: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.66: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.67: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.68: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1 Source.69: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.70: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.71: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase Source.72: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.73: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.74: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.75: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.76: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.77: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.78: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.79: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.80: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.81: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.82: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.83: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.84: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial Source.85: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.86: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.87: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.88: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1 Source.89: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.90: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.91: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.92: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.93: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.94: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A Source.95: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.96: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.97: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.98: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.99: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.100: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.101: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.102: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.103: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.104: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.105: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.106: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.107: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic Source.108: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.109: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.110: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.111: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.112: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.113: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.114: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.115: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.116: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.117: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.118: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.119: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.120: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.121: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185 Source.122: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.123: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.124: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.125: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase Source.126: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1 Source.127: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.128: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.129: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1 Source.130: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.131: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.132: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.133: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.134: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.135: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.136: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.137: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.138: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.139: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.140: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1 Source.141: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.142: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.143: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.144: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.145: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.146: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic Source.147: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.148: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A Source.149: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.150: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.151: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.152: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.153: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.154: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.155: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.156: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.157: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.158: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.159: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.160: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.161: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5 Source.162: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.163: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.164: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.165: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.166: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.167: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10 Source.168: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5 Source.169: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.170: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1 Source.171: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.172: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.173: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3 Source.174: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c Source.175: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.176: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.177: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.178: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.179: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2 Source.180: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.181: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.182: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.183: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.184: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5 Source.185: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46 Source.186: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.187: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.188: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.189: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.190: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.191: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1 Source.192: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13 Source.193: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB Source.194: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic Source.195: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.196: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.197: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.198: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.199: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.200: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.201: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.202: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.203: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic Source.204: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic Source.205: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B Source.206: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.207: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.208: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.209: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.210: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.211: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.212: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.213: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.214: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.215: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.216: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog Source.217: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3 Source.218: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.219: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog Source.220: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.221: DFBPPR1142 ---- Plant proteins ---- Calreticulin Source.222: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13 Source.223: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4 Source.224: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.225: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.226: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.227: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.228: DFBPPR1151 ---- Plant proteins ---- Cytochrome c Source.229: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2 Source.230: DFBPPR1154 ---- Plant proteins ---- MADS-box transcription factor 22 Source.231: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13 Source.232: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.233: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1 Source.234: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.235: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.236: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.237: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.238: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.239: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.240: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic Source.241: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23 Source.242: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.243: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.244: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.245: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2 Source.246: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.247: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic Source.248: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.249: DFBPPR1183 ---- Plant proteins ---- MADS-box transcription factor 18 Source.250: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.251: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.252: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.253: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.254: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.255: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.256: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase Source.257: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4 Source.258: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic Source.259: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.260: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.261: DFBPPR1223 ---- Plant proteins ---- Elicitor-responsive protein 1 Source.262: DFBPPR1224 ---- Plant proteins ---- MADS-box transcription factor 50 Source.263: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.264: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.265: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.266: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.267: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58 Source.268: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.269: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial Source.270: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.271: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10 Source.272: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.273: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.274: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24 Source.275: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.276: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.277: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.278: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.279: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.280: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.281: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.282: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic Source.283: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.284: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.285: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23 Source.286: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15 Source.287: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.288: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.289: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.290: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.291: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.292: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.293: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a Source.294: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2 Source.295: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.296: DFBPPR1283 ---- Plant proteins ---- Arsenate reductase 2.1 Source.297: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.298: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.299: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic Source.300: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.301: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.302: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.303: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.304: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.305: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.306: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic Source.307: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1 Source.308: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.309: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic Source.310: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22 Source.311: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.312: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.313: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.314: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B Source.315: DFBPPR1310 ---- Plant proteins ---- Rac-like GTP-binding protein 6 Source.316: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.317: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.318: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.319: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.320: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2 Source.321: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.322: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.323: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.324: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7 Source.325: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.326: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.327: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d Source.328: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.329: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.330: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.331: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B Source.332: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.333: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.334: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.335: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12 Source.336: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.337: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.338: DFBPPR1340 ---- Plant proteins ---- F-box protein GID2 Source.339: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.340: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1 Source.341: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.342: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.343: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.344: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.345: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.346: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.347: DFBPPR1351 ---- Plant proteins ---- Probable phospholipase A2 homolog 2 Source.348: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.349: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.350: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1 Source.351: DFBPPR1357 ---- Plant proteins ---- MADS-box transcription factor 47 Source.352: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.353: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.354: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.355: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A Source.356: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.357: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1 Source.358: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.359: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.360: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.361: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.362: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3 Source.363: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.364: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.365: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2 Source.366: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.367: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.368: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog Source.369: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.370: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.371: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.372: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.373: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.374: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.375: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.376: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.377: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.378: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.379: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.380: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.381: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B Source.382: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.383: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.384: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.385: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.386: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.387: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.388: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.389: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7 Source.390: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.391: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A Source.392: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.393: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.394: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.395: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1 Source.396: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.397: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.398: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14 Source.399: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.400: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.401: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.402: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3 Source.403: DFBPPR1431 ---- Plant proteins ---- Glutaredoxin-C6 Source.404: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.405: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2 Source.406: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29 Source.407: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic Source.408: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14 Source.409: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.410: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.411: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.412: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.413: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.414: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.415: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.416: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37 Source.417: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.418: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.419: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.420: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8 Source.421: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.422: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.423: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.424: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.425: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.426: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.427: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.428: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c Source.429: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2 Source.430: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.431: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.432: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.433: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.434: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic Source.435: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.436: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.437: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.438: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.439: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.440: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.441: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.442: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.443: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.444: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.445: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.446: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.447: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.448: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.449: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.450: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.451: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1 Source.452: DFBPPR1491 ---- Plant proteins ---- Rac-like GTP-binding protein 4 Source.453: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.454: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.455: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.456: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.457: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.458: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.459: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1 Source.460: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.461: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5 Source.462: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.463: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.464: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.465: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.466: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.467: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.468: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F Source.469: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.470: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.471: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.472: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.473: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.474: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.475: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.476: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.477: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1 Source.478: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.479: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.480: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.481: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.482: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39 Source.483: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.484: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.485: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.486: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.487: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8 Source.488: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.489: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.490: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.491: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.492: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.493: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.494: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.495: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.496: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.497: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2 Source.498: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.499: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.500: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.501: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.502: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.503: DFBPPR1561 ---- Plant proteins ---- Chitinase 4 Source.504: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.505: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A Source.506: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.507: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.508: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.509: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.510: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF Source.511: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2 Source.512: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.513: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.514: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.515: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2 Source.516: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic Source.517: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.518: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.519: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.520: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.521: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.522: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.523: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.524: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.525: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.526: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.527: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.528: DFBPPR1597 ---- Plant proteins ---- MADS-box transcription factor 51 Source.529: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.530: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.531: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5 Source.532: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase Source.533: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.534: DFBPPR1606 ---- Plant proteins ---- 17.4 kDa class I heat shock protein Source.535: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.536: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.537: DFBPPR1610 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.538: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.539: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.540: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase Source.541: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.542: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7 Source.543: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.544: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.545: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.546: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.547: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.548: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.549: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.550: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.551: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.552: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.553: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.554: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2 Source.555: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.556: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.557: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2 Source.558: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.559: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.560: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.561: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3 Source.562: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.563: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.564: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein Source.565: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.566: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.567: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.568: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.569: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1 Source.570: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.571: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal Source.572: DFBPPR1671 ---- Plant proteins ---- MADS-box transcription factor 4 Source.573: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.574: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.575: DFBPPR1676 ---- Plant proteins ---- MADS-box transcription factor 55 Source.576: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic Source.577: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.578: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.579: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.580: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.581: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.582: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.583: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.584: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3 Source.585: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062 Source.586: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic Source.587: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.588: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.589: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.590: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.591: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.592: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1 Source.593: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2 Source.594: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1 Source.595: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.596: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.597: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.598: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.599: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2 Source.600: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.601: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.602: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.603: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.604: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.605: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.606: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.607: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.608: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.609: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.610: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3 Source.611: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.612: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.613: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.614: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.615: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2 Source.616: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.617: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic Source.618: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.619: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1 Source.620: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic Source.621: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.622: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.623: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.624: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.625: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.626: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.627: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein Source.628: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial Source.629: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.630: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.631: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57 Source.632: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.633: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.634: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.635: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1 Source.636: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1 Source.637: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.638: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.639: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.640: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2 Source.641: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B Source.642: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.643: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.644: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.645: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1 Source.646: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.647: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.648: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.649: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.650: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.651: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.652: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.653: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.654: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22 Source.655: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1 Source.656: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.657: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.658: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.659: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.660: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.661: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic Source.662: DFBPPR1798 ---- Plant proteins ---- UMP-CMP kinase 2 Source.663: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1 Source.664: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.665: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4 Source.666: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.667: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.668: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.669: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.670: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.671: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.672: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4 Source.673: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9 Source.674: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.675: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2 Source.676: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.677: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.678: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B Source.679: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1 Source.680: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17 Source.681: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3 Source.682: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.683: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.684: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.685: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1 Source.686: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.687: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1 Source.688: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.689: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.690: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.691: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.692: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.693: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2 Source.694: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.695: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.696: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.697: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.698: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.699: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.700: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.701: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4 Source.702: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.703: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.704: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.705: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.706: DFBPPR1867 ---- Plant proteins ---- Laccase-21 Source.707: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.708: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.709: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.710: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.711: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.712: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4 Source.713: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.714: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B Source.715: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3 Source.716: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.717: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.718: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.719: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.720: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8 Source.721: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.722: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.723: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.724: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.725: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.726: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.727: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.728: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.729: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.730: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.731: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.732: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic Source.733: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8 Source.734: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.735: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.736: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6 Source.737: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.738: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.739: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.740: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial Source.741: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.742: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.743: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.744: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10 Source.745: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.746: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2 Source.747: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A Source.748: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.749: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2 Source.750: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.751: DFBPPR1932 ---- Plant proteins ---- Inactive casein kinase II subunit alpha-2 Source.752: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.753: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.754: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.755: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.756: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2 Source.757: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4 Source.758: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.759: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.760: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.761: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.762: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B Source.763: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.764: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.765: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17 Source.766: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4 Source.767: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.768: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1 Source.769: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.770: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.771: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.772: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.773: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.774: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1 Source.775: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.776: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.777: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.778: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.779: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.780: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4 Source.781: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2 Source.782: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.783: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16 Source.784: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38 Source.785: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2 Source.786: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.787: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.788: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.789: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b Source.790: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.791: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.792: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A Source.793: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.794: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.795: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.796: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33 Source.797: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.798: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.799: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.800: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.801: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.802: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5 Source.803: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain Source.804: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.805: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.806: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.807: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.808: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.809: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.810: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.811: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.812: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5 Source.813: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.814: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.815: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1 Source.816: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.817: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.818: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.819: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.820: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.821: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.822: DFBPPR2045 ---- Plant proteins ---- Expansin-A5 Source.823: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11 Source.824: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein Source.825: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23 Source.826: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.827: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.828: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.829: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.830: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.831: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9 Source.832: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5 Source.833: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3 Source.834: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.835: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.836: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.837: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.838: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.839: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa Source.840: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7 Source.841: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1 Source.842: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.843: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.844: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.845: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.846: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.847: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.848: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.849: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.850: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic Source.851: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.852: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.853: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.854: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.855: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.856: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.857: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.858: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.859: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.860: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.861: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.862: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.863: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1 Source.864: DFBPPR2101 ---- Plant proteins ---- Cupincin Source.865: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12 Source.866: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase Source.867: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.868: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.869: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.870: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.871: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.872: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4 Source.873: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.874: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.875: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.876: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.877: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.878: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.879: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.880: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2 Source.881: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.882: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.883: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.884: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.885: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.886: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.887: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein Source.888: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2 Source.889: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1 Source.890: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.891: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.892: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.893: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.894: DFBPPR2146 ---- Plant proteins ---- Expansin-B4 Source.895: DFBPPR2148 ---- Plant proteins ---- Auxin-responsive protein SAUR36 Source.896: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.897: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A Source.898: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3 Source.899: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.900: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2 Source.901: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2 Source.902: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.903: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.904: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.905: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.906: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.907: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.908: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.909: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.910: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.911: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.912: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.913: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.914: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.915: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2 Source.916: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C Source.917: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.918: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.919: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1 Source.920: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1 Source.921: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.922: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.923: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.924: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.925: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1 Source.926: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.927: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.928: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2 Source.929: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.930: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.931: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.932: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.933: DFBPPR2206 ---- Plant proteins ---- Leucine-rich repeat protein 1 Source.934: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16 Source.935: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21 Source.936: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial Source.937: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32 Source.938: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.939: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.940: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.941: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4 Source.942: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.943: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.944: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.945: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.946: DFBPPR2223 ---- Plant proteins ---- Urease Source.947: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9 Source.948: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.949: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.950: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.951: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1 Source.952: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain Source.953: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.954: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.955: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.956: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.957: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.958: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.959: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21 Source.960: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.961: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.962: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3 Source.963: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.964: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6 Source.965: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.966: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.967: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.968: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2 Source.969: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.970: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8 Source.971: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.972: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.973: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.974: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.975: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.976: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.977: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.978: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa Source.979: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.980: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1 Source.981: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.982: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.983: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3 Source.984: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.985: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.986: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.987: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4 Source.988: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.989: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.990: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.991: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.992: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.993: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b Source.994: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.995: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.996: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.997: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.998: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.999: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.1000: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.1001: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.1002: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.1003: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3 Source.1004: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.1005: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.1006: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4 Source.1007: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.1008: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.1009: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.1010: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b Source.1011: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.1012: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400 Source.1013: DFBPPR2344 ---- Plant proteins ---- Calcineurin B-like protein 8 Source.1014: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial Source.1015: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.1016: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.1017: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.1018: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.1019: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.1020: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1021: DFBPPR2353 ---- Plant proteins ---- Expansin-B12 Source.1022: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.1023: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.1024: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6 Source.1025: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11 Source.1026: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.1027: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1028: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.1029: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.1030: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.1031: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5 Source.1032: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.1033: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1 Source.1034: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.1035: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.1036: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.1037: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1038: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.1039: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase Source.1040: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.1041: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.1042: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.1043: DFBPPR2387 ---- Plant proteins ---- Chitinase 8 Source.1044: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2 Source.1045: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6 Source.1046: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic Source.1047: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.1048: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase Source.1049: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6 Source.1050: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1 Source.1051: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.1052: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.1053: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1054: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.1055: DFBPPR2408 ---- Plant proteins ---- Cytochrome f Source.1056: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3 Source.1057: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B Source.1058: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2 Source.1059: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2 Source.1060: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1061: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.1062: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2 Source.1063: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.1064: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.1065: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.1066: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.1067: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1 Source.1068: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.1069: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1 Source.1070: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.1071: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13 Source.1072: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.1073: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3 Source.1074: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.1075: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.1076: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1 Source.1077: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B Source.1078: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2 Source.1079: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.1080: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c Source.1081: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1082: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3 Source.1083: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9 Source.1084: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.1085: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic Source.1086: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.1087: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial Source.1088: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56 Source.1089: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.1090: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.1091: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3 Source.1092: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.1093: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.1094: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1 Source.1095: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.1096: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.1097: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34 Source.1098: DFBPPR2468 ---- Plant proteins ---- Germin-like protein 8-3 Source.1099: DFBPPR2469 ---- Plant proteins ---- Germin-like protein 8-4 Source.1100: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.1101: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.1102: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.1103: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase Source.1104: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.1105: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1106: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7 Source.1107: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.1108: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.1109: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.1110: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.1111: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1 Source.1112: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.1113: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic Source.1114: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1115: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic Source.1116: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.1117: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.1118: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.1119: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10 Source.1120: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.1121: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.1122: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B Source.1123: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5 Source.1124: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.1125: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4 Source.1126: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.1127: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1128: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.1129: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.1130: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.1131: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.1132: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.1133: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.1134: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.1135: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.1136: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.1137: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10 Source.1138: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24 Source.1139: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.1140: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4 Source.1141: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.1142: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.1143: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.1144: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5 Source.1145: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.1146: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.1147: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.1148: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.1149: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.1150: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.1151: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.1152: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.1153: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.1154: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.1155: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.1156: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic Source.1157: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.1158: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9 Source.1159: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.1160: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.1161: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.1162: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4 Source.1163: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20 Source.1164: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.1165: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.1166: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.1167: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.1168: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9 Source.1169: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.1170: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.1171: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic Source.1172: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.1173: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1 Source.1174: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.1175: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.1176: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4 Source.1177: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1 Source.1178: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.1179: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.1180: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.1181: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.1182: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2 Source.1183: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.1184: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.1185: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.1186: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E Source.1187: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.1188: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2 Source.1189: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57 Source.1190: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.1191: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1 Source.1192: DFBPPR2614 ---- Plant proteins ---- Photosystem II reaction center protein H Source.1193: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.1194: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2 Source.1195: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.1196: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.1197: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1 Source.1198: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3 Source.1199: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1 Source.1200: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a Source.1201: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1 Source.1202: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34 Source.1203: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.1204: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.1205: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.1206: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.1207: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2 Source.1208: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.1209: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.1210: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1 Source.1211: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic Source.1212: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25 Source.1213: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.1214: DFBPPR2648 ---- Plant proteins ---- SKP1-like protein 20 Source.1215: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2 Source.1216: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3 Source.1217: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2 Source.1218: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4 Source.1219: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.1220: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic Source.1221: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.1222: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.1223: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.1224: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.1225: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3 Source.1226: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.1227: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.1228: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1 Source.1229: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.1230: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.1231: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2 Source.1232: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.1233: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.1234: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.1235: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.1236: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1 Source.1237: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30 Source.1238: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.1239: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.1240: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.1241: DFBPPR2689 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.1242: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.1243: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.1244: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1 Source.1245: DFBPPR2697 ---- Plant proteins ---- Calcineurin B-like protein 2 Source.1246: DFBPPR2698 ---- Plant proteins ---- Proteasome subunit alpha type-6 Source.1247: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.1248: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.1249: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18 Source.1250: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72 Source.1251: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.1252: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1 Source.1253: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b Source.1254: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2 Source.1255: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.1256: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.1257: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.1258: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77 Source.1259: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.1260: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.1261: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.1262: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11 Source.1263: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal Source.1264: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.1265: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.1266: DFBPPR2724 ---- Plant proteins ---- Putative germin-like protein 8-1 Source.1267: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.1268: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.1269: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2 Source.1270: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.1271: DFBPPR2732 ---- Plant proteins ---- Small ubiquitin-related modifier 1 Source.1272: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.1273: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.1274: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A Source.1275: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5 Source.1276: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500 Source.1277: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.1278: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.1279: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.1280: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.1281: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6 Source.1282: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15 Source.1283: DFBPPR2751 ---- Plant proteins ---- Actin-7 Source.1284: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5 Source.1285: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.1286: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2 Source.1287: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.1288: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9 Source.1289: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.1290: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.1291: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.1292: DFBPPR2763 ---- Plant proteins ---- Actin-1 Source.1293: DFBPPR2764 ---- Plant proteins ---- MADS-box transcription factor 30 Source.1294: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.1295: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.1296: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.1297: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic Source.1298: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.1299: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1300: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.1301: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.1302: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.1303: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.1304: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.1305: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.1306: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.1307: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.1308: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.1309: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.1310: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.1311: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase Source.1312: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.1313: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a Source.1314: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1315: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1316: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.1317: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.1318: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic Source.1319: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c Source.1320: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.1321: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.1322: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12 Source.1323: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.1324: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.1325: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.1326: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.1327: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.1328: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.1329: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1330: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.1331: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.1332: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.1333: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3 Source.1334: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1 Source.1335: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4 Source.1336: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.1337: DFBPPR2823 ---- Plant proteins ---- Germin-like protein 8-9 Source.1338: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.1339: DFBPPR2825 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1340: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3 Source.1341: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8 Source.1342: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.1343: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.1344: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.1345: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.1346: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.1347: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.1348: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.1349: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.1350: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.1351: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.1352: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.1353: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.1354: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.1355: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.1356: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.1357: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.1358: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic Source.1359: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1360: DFBPPR2849 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 3 Source.1361: DFBPPR2850 ---- Plant proteins ---- Germin-like protein 8-6 Source.1362: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.1363: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.1364: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1365: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.1366: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131 Source.1367: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1 Source.1368: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase Source.1369: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.1370: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX Source.1371: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase Source.1372: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1 Source.1373: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.1374: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.1375: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.1376: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.1377: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.1378: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.1379: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.1380: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.1381: DFBPPR2883 ---- Plant proteins ---- Expansin-B9 Source.1382: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.1383: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1384: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.1385: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6 Source.1386: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2 Source.1387: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c Source.1388: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A Source.1389: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21 Source.1390: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.1391: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1 Source.1392: DFBPPR2900 ---- Plant proteins ---- Expansin-A23 Source.1393: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.1394: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.1395: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.1396: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2 Source.1397: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1398: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.1399: DFBPPR2910 ---- Plant proteins ---- Expansin-B5 Source.1400: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d Source.1401: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.1402: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.1403: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1 Source.1404: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2 Source.1405: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28 Source.1406: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.1407: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5 Source.1408: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3 Source.1409: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.1410: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.1411: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.1412: DFBPPR2925 ---- Plant proteins ---- Two-component response regulator ORR13 Source.1413: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1 Source.1414: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.1415: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein Source.1416: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4 Source.1417: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4 Source.1418: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.1419: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.1420: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.1421: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.1422: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1 Source.1423: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.1424: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.1425: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.1426: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.1427: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2 Source.1428: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.1429: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.1430: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.1431: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5 Source.1432: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.1433: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic Source.1434: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23 Source.1435: DFBPPR2952 ---- Plant proteins ---- Expansin-A17 Source.1436: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1 Source.1437: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1438: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.1439: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.1440: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.1441: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.1442: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.1443: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.1444: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.1445: DFBPPR2964 ---- Plant proteins ---- Expansin-A14 Source.1446: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.1447: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.1448: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.1449: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.1450: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.1451: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.1452: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.1453: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.1454: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.1455: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic Source.1456: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.1457: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.1458: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.1459: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic Source.1460: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.1461: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2 Source.1462: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.1463: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1 Source.1464: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7 Source.1465: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5 Source.1466: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1 Source.1467: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.1468: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.1469: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.1470: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.1471: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20 Source.1472: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.1473: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a Source.1474: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.1475: DFBPPR3007 ---- Plant proteins ---- Thioredoxin H2-2 Source.1476: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.1477: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.1478: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4 Source.1479: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.1480: DFBPPR3015 ---- Plant proteins ---- Expansin-A13 Source.1481: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.1482: DFBPPR3017 ---- Plant proteins ---- Expansin-A12 Source.1483: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit Source.1484: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c Source.1485: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.1486: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.1487: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.1488: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.1489: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.1490: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.1491: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.1492: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.1493: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1 Source.1494: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b Source.1495: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3 Source.1496: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.1497: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.1498: DFBPPR3044 ---- Plant proteins ---- Thioredoxin-like 4, chloroplastic Source.1499: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase Source.1500: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.1501: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10 Source.1502: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.1503: DFBPPR3052 ---- Plant proteins ---- MADS-box transcription factor 31 Source.1504: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.1505: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6 Source.1506: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1 Source.1507: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.1508: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.1509: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2 Source.1510: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.1511: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.1512: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.1513: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.1514: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic Source.1515: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.1516: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.1517: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.1518: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.1519: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3 Source.1520: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.1521: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.1522: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.1523: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2 Source.1524: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.1525: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.1526: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3 Source.1527: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.1528: DFBPPR3087 ---- Plant proteins ---- Actin-3 Source.1529: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34 Source.1530: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.1531: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.1532: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.1533: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.1534: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.1535: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.1536: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.1537: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.1538: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.1539: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.1540: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3 Source.1541: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.1542: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.1543: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1 Source.1544: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5 Source.1545: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6 Source.1546: DFBPPR3113 ---- Plant proteins ---- Putative autophagy-related protein 8E Source.1547: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.1548: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.1549: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.1550: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.1551: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20 Source.1552: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.1553: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.1554: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.1555: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.1556: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6 Source.1557: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.1558: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.1559: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.1560: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.1561: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.1562: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.1563: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.1564: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.1565: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.1566: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1 Source.1567: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.1568: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8 Source.1569: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.1570: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.1571: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.1572: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.1573: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O Source.1574: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2 Source.1575: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.1576: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4 Source.1577: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20 Source.1578: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.1579: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2 Source.1580: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5 Source.1581: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.1582: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.1583: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.1584: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.1585: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2 Source.1586: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.1587: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.1588: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I Source.1589: DFBPPR3176 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.1590: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1 Source.1591: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.1592: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.1593: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.1594: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.1595: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.1596: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.1597: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.1598: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.1599: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.1600: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.1601: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.1602: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1 Source.1603: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59 Source.1604: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.1605: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.1606: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.1607: DFBPPR3203 ---- Plant proteins ---- Monothiol glutaredoxin-S10 Source.1608: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.1609: DFBPPR3205 ---- Plant proteins ---- Monothiol glutaredoxin-S3 Source.1610: DFBPPR3206 ---- Plant proteins ---- Expansin-B15 Source.1611: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B Source.1612: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.1613: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.1614: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.1615: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5 Source.1616: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.1617: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.1618: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.1619: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.1620: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.1621: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.1622: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4 Source.1623: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.1624: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1 Source.1625: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic Source.1626: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3 Source.1627: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1 Source.1628: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.1629: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7 Source.1630: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.1631: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.1632: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic Source.1633: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.1634: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.1635: DFBPPR3238 ---- Plant proteins ---- Hydrophobic protein LTI6A Source.1636: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.1637: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.1638: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2 Source.1639: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1 Source.1640: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.1641: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.1642: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.1643: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.1644: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.1645: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS Source.1646: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.1647: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.1648: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.1649: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.1650: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.1651: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit Source.1652: DFBPPR3261 ---- Plant proteins ---- Autophagy-related protein 8D Source.1653: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.1654: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.1655: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.1656: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.1657: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.1658: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1 Source.1659: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.1660: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase Source.1661: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.1662: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16 Source.1663: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial Source.1664: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b Source.1665: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.1666: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35 Source.1667: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400 Source.1668: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.1669: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.1670: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b Source.1671: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.1672: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4 Source.1673: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4 Source.1674: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4 Source.1675: DFBPPR3298 ---- Plant proteins ---- Hydrophobic protein LTI6B Source.1676: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.1677: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9 Source.1678: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E Source.1679: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.1680: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.1681: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3 Source.1682: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a Source.1683: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.1684: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.1685: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.1686: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.1687: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a Source.1688: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.1689: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.1690: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8 Source.1691: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.1692: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7 Source.1693: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1 Source.1694: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.1695: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.1696: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a Source.1697: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a Source.1698: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.1699: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.1700: DFBPPR3342 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.1701: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.1702: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1 Source.1703: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.1704: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.1705: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.1706: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.1707: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A Source.1708: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22 Source.1709: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.1710: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4 Source.1711: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.1712: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.1713: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.1714: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.1715: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38 Source.1716: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic Source.1717: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.1718: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.1719: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.1720: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.1721: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.1722: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.1723: DFBPPR3372 ---- Plant proteins ---- Calcineurin B-like protein 3 Source.1724: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.1725: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.1726: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.1727: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.1728: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18 Source.1729: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.1730: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.1731: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.1732: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.1733: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.1734: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.1735: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.1736: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.1737: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.1738: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.1739: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.1740: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3 Source.1741: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.1742: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.1743: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.1744: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2 Source.1745: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5 Source.1746: DFBPPR3415 ---- Plant proteins ---- Expansin-A33 Source.1747: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.1748: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.1749: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.1750: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.1751: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.1752: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.1753: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.1754: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.1755: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.1756: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.1757: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.1758: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.1759: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.1760: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1 Source.1761: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2 Source.1762: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.1763: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.1764: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.1765: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C Source.1766: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.1767: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.1768: DFBPPR3456 ---- Plant proteins ---- Maturase K Source.1769: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1770: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.1771: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.1772: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic Source.1773: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1 Source.1774: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1 Source.1775: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73 Source.1776: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.1777: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.1778: DFBPPR3471 ---- Plant proteins ---- Monothiol glutaredoxin-S6 Source.1779: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68 Source.1780: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600 Source.1781: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.1782: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3 Source.1783: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.1784: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.1785: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.1786: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8 Source.1787: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.1788: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5 Source.1789: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.1790: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3 Source.1791: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3 Source.1792: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19 Source.1793: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4 Source.1794: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.1795: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9 Source.1796: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.1797: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.1798: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4 Source.1799: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6 Source.1800: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.1801: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.1802: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9 Source.1803: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1 Source.1804: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.1805: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.1806: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.1807: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.1808: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic Source.1809: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4 Source.1810: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic Source.1811: DFBPPR3521 ---- Plant proteins ---- Photosystem II reaction center W protein, chloroplastic Source.1812: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56 Source.1813: DFBPPR3523 ---- Plant proteins ---- Ubiquitin-like protein ATG12 Source.1814: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.1815: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36 Source.1816: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2 Source.1817: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.1818: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4 Source.1819: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.1820: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.1821: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic Source.1822: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.1823: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.1824: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.1825: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.1826: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.1827: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2 Source.1828: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8 Source.1829: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.1830: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45 Source.1831: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.1832: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.1833: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.1834: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61 Source.1835: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.1836: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.1837: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.1838: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B'' Source.1839: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.1840: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58 Source.1841: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1 Source.1842: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.1843: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.1844: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.1845: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.1846: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.1847: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3 Source.1848: DFBPPR3578 ---- Plant proteins ---- Glutaredoxin-C13 Source.1849: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5 Source.1850: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.1851: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.1852: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.1853: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.1854: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3 Source.1855: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.1856: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.1857: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1 Source.1858: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11 Source.1859: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.1860: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.1861: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.1862: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic Source.1863: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7 Source.1864: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.1865: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1 Source.1866: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.1867: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.1868: DFBPPR3614 ---- Plant proteins ---- Prolamin PPROL 17D Source.1869: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b Source.1870: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A Source.1871: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.1872: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.1873: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1 Source.1874: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.1875: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.1876: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.1877: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.1878: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1 Source.1879: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.1880: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.1881: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.1882: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.1883: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.1884: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5 Source.1885: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.1886: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.1887: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2 Source.1888: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.1889: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2 Source.1890: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.1891: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3 Source.1892: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1 Source.1893: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e Source.1894: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a Source.1895: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.1896: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.1897: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2 Source.1898: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.1899: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin Source.1900: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.1901: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.1902: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.1903: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1904: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3 Source.1905: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5 Source.1906: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3 Source.1907: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J Source.1908: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6 Source.1909: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10 Source.1910: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5 Source.1911: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic Source.1912: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.1913: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41 Source.1914: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.1915: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.1916: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.1917: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2 Source.1918: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.1919: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.1920: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.1921: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.1922: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.1923: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.1924: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.1925: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67 Source.1926: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.1927: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.1928: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d Source.1929: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1 Source.1930: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.1931: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7 Source.1932: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6 Source.1933: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.1934: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.1935: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1936: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.1937: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.1938: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.1939: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15 Source.1940: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.1941: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.1942: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.1943: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1 Source.1944: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5 Source.1945: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36 Source.1946: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.1947: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.1948: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.1949: DFBPPR3725 ---- Plant proteins ---- 60S ribosomal protein L10a Source.1950: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2 Source.1951: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1 Source.1952: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.1953: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.1954: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.1955: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3 Source.1956: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28 Source.1957: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.1958: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.1959: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900 Source.1960: DFBPPR3743 ---- Plant proteins ---- Putative auxin-responsive protein IAA28 Source.1961: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.1962: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.1963: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1 Source.1964: DFBPPR3749 ---- Plant proteins ---- MADS-box transcription factor 25 Source.1965: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.1966: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7 Source.1967: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.1968: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12 Source.1969: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.1970: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8 Source.1971: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.1972: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6 Source.1973: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1 Source.1974: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8 Source.1975: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.1976: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1977: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51 Source.1978: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.1979: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9 Source.1980: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.1981: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.1982: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4 Source.1983: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38 Source.1984: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.1985: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5 Source.1986: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.1987: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.1988: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55 Source.1989: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.1990: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial Source.1991: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.1992: DFBPPR3791 ---- Plant proteins ---- Putative glutaredoxin-C12 Source.1993: DFBPPR3793 ---- Plant proteins ---- Coatomer subunit zeta-2 Source.1994: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1 Source.1995: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7 Source.1996: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.1997: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.1998: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6 Source.1999: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.2000: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic Source.2001: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.2002: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.2003: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8 Source.2004: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.2005: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.2006: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.2007: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.2008: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.2009: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.2010: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G Source.2011: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.2012: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.2013: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.2014: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog Source.2015: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d Source.2016: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12 Source.2017: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial Source.2018: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit Source.2019: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.2020: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.2021: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.2022: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7 Source.2023: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2 Source.2024: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14 Source.2025: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54 Source.2026: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2 Source.2027: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13 Source.2028: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78 Source.2029: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73 Source.2030: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8 Source.2031: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14 Source.2032: DFBPPR3854 ---- Plant proteins ---- Glutaredoxin-C10 Source.2033: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.2034: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.2035: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.2036: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46 Source.2037: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.2038: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.2039: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.2040: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1 Source.2041: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic Source.2042: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.2043: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5 Source.2044: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.2045: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.2046: DFBPPR3871 ---- Plant proteins ---- Putative glutaredoxin-C11 Source.2047: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.2048: DFBPPR3873 ---- Plant proteins ---- Putative glutaredoxin-C14 Source.2049: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.2050: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10 Source.2051: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.2052: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2 Source.2053: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.2054: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.2055: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8 Source.2056: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.2057: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.2058: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.2059: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.2060: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.2061: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3 Source.2062: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1 Source.2063: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.2064: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.2065: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11 Source.2066: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.2067: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.2068: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5 Source.2069: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.2070: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.2071: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.2072: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.2073: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2 Source.2074: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6 Source.2075: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b Source.2076: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b Source.2077: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.2078: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9 Source.2079: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.2080: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13 Source.2081: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.2082: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.2083: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.2084: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.2085: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.2086: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10 Source.2087: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3 Source.2088: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.2089: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein Source.2090: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.2091: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7 Source.2092: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.2093: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1 Source.2094: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10 Source.2095: DFBPPR3947 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.2096: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.2097: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial Source.2098: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA Source.2099: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.2100: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1 Source.2101: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.2102: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.2103: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1 Source.2104: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.2105: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.2106: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8 Source.2107: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.2108: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1 Source.2109: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial Source.2110: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.2111: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.2112: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.2113: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.2114: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.2115: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4 Source.2116: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.2117: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1 Source.2118: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.2119: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.2120: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500 Source.2121: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.2122: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.2123: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2 Source.2124: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.2125: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.2126: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.2127: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.2128: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A Source.2129: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.2130: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2 Source.2131: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.2132: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.2133: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.2134: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5 Source.2135: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.2136: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11 Source.2137: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2 Source.2138: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.2139: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.2140: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1 Source.2141: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3 Source.2142: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f Source.2143: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1 Source.2144: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.2145: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.2146: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.2147: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.2148: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27 Source.2149: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.2150: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G Source.2151: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.2152: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8 Source.2153: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1 Source.2154: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.2155: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.2156: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3 Source.2157: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2 Source.2158: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.2159: DFBPPR4045 ---- Plant proteins ---- 60S ribosomal protein L11 Source.2160: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.2161: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.2162: DFBPPR4051 ---- Plant proteins ---- 40S ribosomal protein S3a Source.2163: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.2164: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.2165: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.2166: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB Source.2167: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11 Source.2168: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.2169: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.2170: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.2171: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F Source.2172: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.2173: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.2174: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C Source.2175: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.2176: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like Source.2177: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.2178: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4 Source.2179: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.2180: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.2181: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.2182: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b Source.2183: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.2184: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.2185: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.2186: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.2187: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.2188: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.2189: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.2190: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.2191: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10 Source.2192: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D Source.2193: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.2194: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29 Source.2195: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.2196: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.2197: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B Source.2198: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic Source.2199: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.2200: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.2201: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.2202: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3 Source.2203: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4 Source.2204: DFBPPR4104 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.2205: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.2206: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.2207: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2 Source.2208: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2 Source.2209: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43 Source.2210: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.2211: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.2212: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4 Source.2213: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.2214: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.2215: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1 Source.2216: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3 Source.2217: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.2218: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2 Source.2219: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75 Source.2220: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5 Source.2221: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.2222: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.2223: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49 Source.2224: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.2225: DFBPPR4134 ---- Plant proteins ---- Glutaredoxin-C1 Source.2226: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.2227: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.2228: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7 Source.2229: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.2230: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.2231: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.2232: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.2233: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2 Source.2234: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.2235: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.2236: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.2237: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.2238: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7 Source.2239: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.2240: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.2241: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1 Source.2242: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.2243: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.2244: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.2245: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.2246: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.2247: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.2248: DFBPPR4164 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 1 Source.2249: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.2250: DFBPPR4166 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.2251: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.2252: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.2253: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.2254: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.2255: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.2256: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40 Source.2257: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.2258: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.2259: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.2260: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.2261: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.2262: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1 Source.2263: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.2264: DFBPPR4198 ---- Plant proteins ---- Glutaredoxin-C15 Source.2265: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.2266: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.2267: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1 Source.2268: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.2269: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.2270: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.2271: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.2272: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P Source.2273: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.2274: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.2275: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.2276: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.2277: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.2278: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A Source.2279: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2 Source.2280: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.2281: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4 Source.2282: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.2283: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2 Source.2284: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.2285: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.2286: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.2287: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.2288: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.2289: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.2290: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3 Source.2291: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.2292: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1 Source.2293: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.2294: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.2295: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600 Source.2296: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1 Source.2297: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1 Source.2298: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6 Source.2299: DFBPPR4255 ---- Plant proteins ---- Photosystem II reaction center protein J Source.2300: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.2301: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.2302: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2 Source.2303: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.2304: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.2305: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13 Source.2306: DFBPPR4266 ---- Plant proteins ---- Probable protein BRICK1 Source.2307: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.2308: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400 Source.2309: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3 Source.2310: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2 Source.2311: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.2312: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.2313: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP Source.2314: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21 Source.2315: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.2316: DFBPPR4282 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.2317: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.2318: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2 Source.2319: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.2320: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20 Source.2321: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.2322: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.2323: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3 Source.2324: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.2325: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.2326: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.2327: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.2328: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like Source.2329: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.2330: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.2331: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.2332: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8 Source.2333: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6 Source.2334: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1 Source.2335: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1 Source.2336: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.2337: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.2338: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.2339: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.2340: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.2341: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.2342: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.2343: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.2344: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.2345: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5 Source.2346: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.2347: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic Source.2348: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5 Source.2349: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.2350: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J Source.2351: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G Source.2352: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2 Source.2353: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.2354: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.2355: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.2356: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9 Source.2357: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3 Source.2358: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.2359: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.2360: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.2361: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic Source.2362: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.2363: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.2364: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2 Source.2365: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.2366: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12 Source.2367: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.2368: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.2369: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.2370: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.2371: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.2372: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1 Source.2373: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.2374: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog Source.2375: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.2376: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.2377: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2 Source.2378: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.2379: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2 Source.2380: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic Source.2381: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.2382: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4 Source.2383: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.2384: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2 Source.2385: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25 Source.2386: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.2387: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D Source.2388: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.2389: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.2390: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.2391: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.2392: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.2393: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.2394: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.2395: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.2396: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.2397: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.2398: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.2399: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.2400: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein Source.2401: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.2402: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.2403: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.2404: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1 Source.2405: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.2406: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.2407: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.2408: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.2409: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.2410: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.2411: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.2412: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.2413: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3 Source.2414: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3 Source.2415: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.2416: DFBPPR4454 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.2417: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13 Source.2418: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28 Source.2419: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2 Source.2420: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1 Source.2421: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.2422: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18 Source.2423: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.2424: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17 Source.2425: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4 Source.2426: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.2427: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.2428: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic Source.2429: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.2430: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.2431: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2 Source.2432: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15 Source.2433: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2 Source.2434: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16 Source.2435: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.2436: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.2437: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.2438: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.2439: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.2440: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.2441: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.2442: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30 Source.2443: DFBPPR4483 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 11 Source.2444: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.2445: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4 Source.2446: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1 Source.2447: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.2448: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.2449: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.2450: DFBPPR4496 ---- Plant proteins ---- Transcription elongation factor 1 homolog Source.2451: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.2452: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2 Source.2453: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.2454: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein Source.2455: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.2456: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.2457: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.2458: DFBPPR4511 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 9 Source.2459: DFBPPR4512 ---- Plant proteins ---- Actin-depolymerizing factor 3 Source.2460: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.2461: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6 Source.2462: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme Source.2463: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.2464: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14 Source.2465: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.2466: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.2467: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26 Source.2468: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.2469: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6 Source.2470: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1 Source.2471: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2 Source.2472: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.2473: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.2474: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.2475: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.2476: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.2477: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27 Source.2478: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.2479: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.2480: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.2481: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.2482: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.2483: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.2484: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.2485: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16 Source.2486: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.2487: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F Source.2488: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1 Source.2489: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1 Source.2490: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.2491: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1 Source.2492: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1 Source.2493: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.2494: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10 Source.2495: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.2496: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.2497: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.2498: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15 Source.2499: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2 Source.2500: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.2501: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.2502: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.2503: DFBPPR4591 ---- Plant proteins ---- Uncharacterized protein ycf76 Source.2504: DFBPPR4592 ---- Plant proteins ---- Ubiquitin-fold modifier 1 Source.2505: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21 Source.2506: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19 Source.2507: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23 Source.2508: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.2509: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.2510: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2 Source.2511: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16 Source.2512: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.2513: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.2514: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.2515: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3 Source.2516: DFBPPR4619 ---- Plant proteins ---- Actin-depolymerizing factor 9 Source.2517: DFBPPR4621 ---- Plant proteins ---- Actin-depolymerizing factor 6 Source.2518: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.2519: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5 Source.2520: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700 Source.2521: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11 Source.2522: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1 Source.2523: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.2524: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.2525: DFBPPR4642 ---- Plant proteins ---- Actin-depolymerizing factor 1 Source.2526: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.2527: DFBPPR4644 ---- Plant proteins ---- Nuclear transport factor 2 Source.2528: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.2529: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.2530: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000 Source.2531: DFBPPR4649 ---- Plant proteins ---- Succinate dehydrogenase subunit 8B, mitochondrial Source.2532: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2 Source.2533: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1 Source.2534: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.2535: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.2536: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.2537: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.2538: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1 Source.2539: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.2540: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.2541: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100 Source.2542: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.2543: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1 Source.2544: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46 Source.2545: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.2546: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17 Source.2547: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1 Source.2548: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3 Source.2549: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2 Source.2550: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.2551: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.2552: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.2553: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.2554: DFBPPR4715 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 2 Source.2555: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.2556: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.2557: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.2558: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.2559: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5 Source.2560: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.2561: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.2562: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.2563: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400 Source.2564: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.2565: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3 Source.2566: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9 Source.2567: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.2568: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.2569: DFBPPR4752 ---- Plant proteins ---- Uncharacterized protein ycf70 Source.2570: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2 Source.2571: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18 Source.2572: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7 Source.2573: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13 Source.2574: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35 Source.2575: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1 Source.2576: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A Source.2577: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.2578: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G Source.2579: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic Source.2580: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H Source.2581: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4 Source.2582: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700 Source.2583: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1 Source.2584: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100 Source.2585: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.2586: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.2587: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10 Source.2588: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900 Source.2589: DFBPPR4786 ---- Plant proteins ---- B3 domain-containing protein Os12g0592300 Source.2590: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.2591: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600 Source.2592: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300 Source.2593: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.2594: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.2595: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200 Source.2596: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100 Source.2597: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800 Source.2598: DFBPPR4810 ---- Plant proteins ---- Hydrophobic protein OSR8 Source.2599: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1 Source.2600: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20 Source.2601: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.2602: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500 Source.2603: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a Source.2604: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1 Source.2605: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.2606: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000 Source.2607: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1 Source.2608: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2 Source.2609: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3 Source.2610: DFBPPR4841 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 5 Source.2611: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400 Source.2612: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400 Source.2613: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48 Source.2614: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.2615: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800 Source.2616: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.2617: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080 Source.2618: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500 Source.2619: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.2620: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600 Source.2621: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400 Source.2622: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090 Source.2623: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.2624: DFBPPR4861 ---- Plant proteins ---- B3 domain-containing protein Os06g0112300 Source.2625: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.2626: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820 Source.2627: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1 Source.2628: DFBPPR4872 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0158600 Source.2629: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.2630: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58 Source.2631: DFBPPR4880 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 29 Source.2632: DFBPPR4883 ---- Plant proteins ---- Uncharacterized protein Os02g0798400 Source.2633: DFBPPR4884 ---- Plant proteins ---- Uncharacterized protein Os02g0798501 Source.2634: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940 Source.2635: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.2636: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.2637: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.2638: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.2639: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.2640: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein Source.2641: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12 Source.2642: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.2643: DFBPPR4896 ---- Plant proteins ---- Thioredoxin H1 Source.2644: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.2645: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.2646: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.2647: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.2648: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic Source.2649: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.2650: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1 Source.2651: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.2652: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.2653: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.2654: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.2655: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.2656: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.2657: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1 Source.2658: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID Source.2659: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.2660: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic Source.2661: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.2662: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.2663: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.2664: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.2665: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.2666: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.2667: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.2668: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.2669: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2 Source.2670: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.2671: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.2672: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic Source.2673: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.2674: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.2675: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G Source.2676: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d Source.2677: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.2678: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.2679: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.2680: DFBPPR4963 ---- Plant proteins ---- Soybean toxin 17 kDa chain Source.2681: DFBPPR4965 ---- Plant proteins ---- Glycinin G1 Source.2682: DFBPPR4966 ---- Plant proteins ---- Glycinin G5 Source.2683: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.2684: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.2685: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.2686: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.2687: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase Source.2688: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.2689: DFBPPR4973 ---- Plant proteins ---- Glycinin G2 Source.2690: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.2691: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.2692: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.2693: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.2694: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1 Source.2695: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.2696: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2697: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.2698: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.2699: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.2700: DFBPPR4992 ---- Plant proteins ---- Glycinin G3 Source.2701: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.2702: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.2703: DFBPPR4995 ---- Plant proteins ---- Glycinin G4 Source.2704: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1 Source.2705: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.2706: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.2707: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.2708: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.2709: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase Source.2710: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.2711: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.2712: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5 Source.2713: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.2714: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.2715: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.2716: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.2717: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.2718: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.2719: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin Source.2720: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.2721: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.2722: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.2723: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.2724: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.2725: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A Source.2726: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB Source.2727: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase Source.2728: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.2729: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.2730: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.2731: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.2732: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.2733: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.2734: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.2735: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D Source.2736: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.2737: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1 Source.2738: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.2739: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A Source.2740: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.2741: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2742: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.2743: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.2744: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.2745: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.2746: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2 Source.2747: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.2748: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog Source.2749: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.2750: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.2751: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.2752: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.2753: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein Source.2754: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.2755: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.2756: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3 Source.2757: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic Source.2758: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic Source.2759: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2760: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic Source.2761: DFBPPR5071 ---- Plant proteins ---- Leghemoglobin C1 Source.2762: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.2763: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.2764: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.2765: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1 Source.2766: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.2767: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.2768: DFBPPR5079 ---- Plant proteins ---- Albumin-1 Source.2769: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.2770: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.2771: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.2772: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.2773: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.2774: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.2775: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.2776: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase Source.2777: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog Source.2778: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic Source.2779: DFBPPR5100 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase 1 Source.2780: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.2781: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.2782: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.2783: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase Source.2784: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial Source.2785: DFBPPR5109 ---- Plant proteins ---- Chalcone--flavonone isomerase 1A Source.2786: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22 Source.2787: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B Source.2788: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.2789: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.2790: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein Source.2791: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.2792: DFBPPR5124 ---- Plant proteins ---- Nodulin-26 Source.2793: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7 Source.2794: DFBPPR5127 ---- Plant proteins ---- Pathogenesis-related protein 10 Source.2795: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.2796: DFBPPR5131 ---- Plant proteins ---- 17.5 kDa class I heat shock protein Source.2797: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein Source.2798: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2 Source.2799: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6 Source.2800: DFBPPR5137 ---- Plant proteins ---- Cytochrome f Source.2801: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580 Source.2802: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.2803: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2 Source.2804: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase Source.2805: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.2806: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein Source.2807: DFBPPR5144 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-A Source.2808: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.2809: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase Source.2810: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.2811: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.2812: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.2813: DFBPPR5157 ---- Plant proteins ---- 17.6 kDa class I heat shock protein Source.2814: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1 Source.2815: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.2816: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.2817: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.2818: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.2819: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein Source.2820: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2821: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.2822: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.2823: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6 Source.2824: DFBPPR5177 ---- Plant proteins ---- Anamorsin homolog Source.2825: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1 Source.2826: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1 Source.2827: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.2828: DFBPPR5185 ---- Plant proteins ---- Actin-1 Source.2829: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.2830: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.2831: DFBPPR5191 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.2832: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.2833: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.2834: DFBPPR5197 ---- Plant proteins ---- Nodulin-21 Source.2835: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.2836: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.2837: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2 Source.2838: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.2839: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.2840: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.2841: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9 Source.2842: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.2843: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.2844: DFBPPR5219 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.2845: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.2846: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein Source.2847: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.2848: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.2849: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.2850: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.2851: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.2852: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.2853: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein Source.2854: DFBPPR5235 ---- Plant proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.2855: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.2856: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B Source.2857: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.2858: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.2859: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1 Source.2860: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2 Source.2861: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1 Source.2862: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2 Source.2863: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.2864: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.2865: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein Source.2866: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.2867: DFBPPR5249 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.2868: DFBPPR5253 ---- Plant proteins ---- CASP-like protein 7 Source.2869: DFBPPR5254 ---- Plant proteins ---- Chalcone--flavonone isomerase 3 Source.2870: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B Source.2871: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.2872: DFBPPR5258 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.2873: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.2874: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.2875: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.2876: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.2877: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.2878: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.2879: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9 Source.2880: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic Source.2881: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.2882: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6 Source.2883: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.2884: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.2885: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2 Source.2886: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1 Source.2887: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.2888: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.2889: DFBPPR5301 ---- Plant proteins ---- DNA-binding protein DRP90 Source.2890: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.2891: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.2892: DFBPPR5305 ---- Plant proteins ---- Defensin-like protein Source.2893: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.2894: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1 Source.2895: DFBPPR5309 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.2896: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1 Source.2897: DFBPPR5317 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.2898: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.2899: DFBPPR5320 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.2900: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.2901: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6 Source.2902: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3 Source.2903: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1 Source.2904: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51 Source.2905: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.2906: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2 Source.2907: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1 Source.2908: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.2909: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.2910: DFBPPR5341 ---- Plant proteins ---- HMG1/2-like protein Source.2911: DFBPPR5342 ---- Plant proteins ---- Nodulin-44 Source.2912: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1 Source.2913: DFBPPR5346 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.2914: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein Source.2915: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11 Source.2916: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.2917: DFBPPR5354 ---- Plant proteins ---- Protein P21 Source.2918: DFBPPR5356 ---- Plant proteins ---- Nodulin-23 Source.2919: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D Source.2920: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A Source.2921: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B Source.2922: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C Source.2923: DFBPPR5365 ---- Plant proteins ---- Auxin-induced protein 6B Source.2924: DFBPPR5366 ---- Plant proteins ---- Auxin-induced protein 15A Source.2925: DFBPPR5367 ---- Plant proteins ---- Auxin-induced protein X15 Source.2926: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.2927: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.2928: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.2929: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.2930: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.2931: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.2932: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.2933: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.2934: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.2935: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.2936: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.2937: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4 Source.2938: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.2939: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.2940: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2 Source.2941: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.2942: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.2943: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.2944: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.2945: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.2946: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.2947: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.2948: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.2949: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.2950: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.2951: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.2952: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.2953: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.2954: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1 Source.2955: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.2956: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.2957: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.2958: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.2959: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.2960: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic Source.2961: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.2962: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1 Source.2963: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit Source.2964: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A Source.2965: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.2966: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.2967: DFBPPR5432 ---- Plant proteins ---- Expansin-B1 Source.2968: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.2969: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.2970: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.2971: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2 Source.2972: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1 Source.2973: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog Source.2974: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.2975: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.2976: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.2977: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.2978: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.2979: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1 Source.2980: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha Source.2981: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.2982: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.2983: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.2984: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.2985: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.2986: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2 Source.2987: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.2988: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.2989: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.2990: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.2991: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.2992: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.2993: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.2994: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.2995: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.2996: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.2997: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.2998: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.2999: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.3000: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein Source.3001: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.3002: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.3003: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.3004: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.3005: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3 Source.3006: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.3007: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic Source.3008: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.3009: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.3010: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.3011: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.3012: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.3013: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic Source.3014: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.3015: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.3016: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.3017: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain Source.3018: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.3019: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.3020: DFBPPR5508 ---- Plant proteins ---- Expansin-B9 Source.3021: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3022: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.3023: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42 Source.3024: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain Source.3025: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.3026: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase Source.3027: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.3028: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.3029: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.3030: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II Source.3031: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1 Source.3032: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3033: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase Source.3034: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.3035: DFBPPR5534 ---- Plant proteins ---- Ubiquitin-40S ribosomal protein S27a Source.3036: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1 Source.3037: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3038: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.3039: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain Source.3040: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain Source.3041: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.3042: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.3043: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.3044: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.3045: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1 Source.3046: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase Source.3047: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.3048: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10 Source.3049: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.3050: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.3051: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7 Source.3052: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.3053: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3054: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.3055: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.3056: DFBPPR5571 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 1 Source.3057: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.3058: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.3059: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.3060: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.3061: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.3062: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3 Source.3063: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.3064: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.3065: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3066: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.3067: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10 Source.3068: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain Source.3069: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1 Source.3070: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1 Source.3071: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.3072: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain Source.3073: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3074: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.3075: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.3076: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6 Source.3077: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.3078: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.3079: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic Source.3080: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.3081: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain Source.3082: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.3083: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I Source.3084: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.3085: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.3086: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1 Source.3087: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3088: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.3089: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.3090: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.3091: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.3092: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic Source.3093: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.3094: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.3095: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6 Source.3096: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.3097: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.3098: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.3099: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.3100: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.3101: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.3102: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.3103: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.3104: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.3105: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.3106: DFBPPR5648 ---- Plant proteins ---- AP-2 complex subunit sigma Source.3107: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.3108: DFBPPR5651 ---- Plant proteins ---- Cytochrome c Source.3109: DFBPPR5652 ---- Plant proteins ---- Expansin-B10 Source.3110: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.3111: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5 Source.3112: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.3113: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.3114: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.3115: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.3116: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3117: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.3118: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.3119: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3120: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.3121: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.3122: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.3123: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4 Source.3124: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.3125: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.3126: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.3127: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3128: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.3129: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.3130: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5 Source.3131: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1 Source.3132: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.3133: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.3134: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase Source.3135: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.3136: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.3137: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.3138: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.3139: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.3140: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.3141: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1 Source.3142: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.3143: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3144: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.3145: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.3146: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase Source.3147: DFBPPR5728 ---- Plant proteins ---- Calreticulin Source.3148: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3 Source.3149: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4 Source.3150: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.3151: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1 Source.3152: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3153: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.3154: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.3155: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.3156: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.3157: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic Source.3158: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B Source.3159: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.3160: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.3161: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.3162: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1 Source.3163: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A Source.3164: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3165: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1 Source.3166: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.3167: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.3168: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.3169: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.3170: DFBPPR5779 ---- Plant proteins ---- Protein BRICK1 Source.3171: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.3172: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.3173: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.3174: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.3175: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.3176: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.3177: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.3178: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.3179: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.3180: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.3181: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.3182: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.3183: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic Source.3184: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.3185: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a Source.3186: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.3187: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.3188: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3189: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.3190: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3191: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.3192: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic Source.3193: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1 Source.3194: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.3195: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.3196: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.3197: DFBPPR5828 ---- Plant proteins ---- Cytochrome f Source.3198: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.3199: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.3200: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.3201: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.3202: DFBPPR5837 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.3203: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19 Source.3204: DFBPPR5841 ---- Plant proteins ---- Actin-1 Source.3205: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.3206: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3 Source.3207: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12 Source.3208: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.3209: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic Source.3210: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.3211: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.3212: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.3213: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.3214: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6 Source.3215: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3216: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.3217: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3218: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.3219: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.3220: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5 Source.3221: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.3222: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3223: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.3224: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor Source.3225: DFBPPR5877 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.3226: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.3227: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.3228: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.3229: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3230: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.3231: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1 Source.3232: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL Source.3233: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.3234: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.3235: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B Source.3236: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2 Source.3237: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3238: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.3239: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A Source.3240: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.3241: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.3242: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.3243: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.3244: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3 Source.3245: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.3246: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4 Source.3247: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1 Source.3248: DFBPPR5921 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.3249: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.3250: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.3251: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.3252: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin Source.3253: DFBPPR5933 ---- Plant proteins ---- Pathogenesis-related protein PRMS Source.3254: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1 Source.3255: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.3256: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.3257: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.3258: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.3259: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.3260: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3 Source.3261: DFBPPR5945 ---- Plant proteins ---- Calmodulin Source.3262: DFBPPR5946 ---- Plant proteins ---- Maturase K Source.3263: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2 Source.3264: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1 Source.3265: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.3266: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B Source.3267: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.3268: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.3269: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.3270: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.3271: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.3272: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.3273: DFBPPR5974 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.3274: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.3275: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.3276: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.3277: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.3278: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.3279: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1 Source.3280: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.3281: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7 Source.3282: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3 Source.3283: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.3284: DFBPPR5987 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.3285: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor Source.3286: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2 Source.3287: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.3288: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.3289: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2 Source.3290: DFBPPR5997 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.3291: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2 Source.3292: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2 Source.3293: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1 Source.3294: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2 Source.3295: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1 Source.3296: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1 Source.3297: DFBPPR6012 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 2 Source.3298: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.3299: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.3300: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.3301: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase Source.3302: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.3303: DFBPPR6021 ---- Plant proteins ---- Actin-depolymerizing factor 2 Source.3304: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.3305: DFBPPR6025 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3306: DFBPPR6026 ---- Plant proteins ---- Actin-depolymerizing factor 1 Source.3307: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.3308: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2 Source.3309: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.3310: DFBPPR6031 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic Source.3311: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2 Source.3312: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1 Source.3313: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4 Source.3314: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.3315: DFBPPR6046 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.3316: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1 Source.3317: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1 Source.3318: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1 Source.3319: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2 Source.3320: DFBPPR6056 ---- Plant proteins ---- Bowman-Birk type wound-induced proteinase inhibitor WIP1 Source.3321: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.3322: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.3323: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1 Source.3324: DFBPPR6065 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3325: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.3326: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.3327: DFBPPR6073 ---- Plant proteins ---- Protein IAL1 Source.3328: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.3329: DFBPPR6078 ---- Plant proteins ---- Putative 18 kDa spermidine-binding protein Source.3330: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1 Source.3331: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5 Source.3332: DFBPPR6087 ---- Plant proteins ---- 40S ribosomal protein S14 Source.3333: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6 Source.3334: DFBPPR6090 ---- Plant proteins ---- 40S ribosomal protein S14 Source.3335: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11 Source.3336: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2 Source.3337: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3 Source.3338: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1 Source.3339: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1 Source.3340: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4 Source.3341: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1 Source.3342: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4 Source.3343: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8 Source.3344: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3345: DFBPPR6117 ---- Plant proteins ---- Putative uncharacterized protein ycf15 Source.3346: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.3347: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11 Source.3348: DFBPPR6122 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 4 Source.3349: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A Source.3350: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.3351: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6 Source.3352: DFBPPR6146 ---- Plant proteins ---- Uncharacterized protein ycf76 Source.3353: DFBPPR6148 ---- Plant proteins ---- Uncharacterized protein ycf70 Source.3354: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.3355: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1 Source.3356: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.3357: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2 Source.3358: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4 Source.3359: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.3360: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3 Source.3361: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid Source.3362: DFBPPR6182 ---- Plant proteins ---- Unknown protein from spot 360 of 2D-PAGE of etiolated coleoptile Source.3363: DFBPPR6185 ---- Plant proteins ---- Unknown protein from spot 415 of 2D-PAGE of etiolated coleoptile Source.3364: DFBPPR6190 ---- Plant proteins ---- Unknown protein from spot 32 of 2D-PAGE of etiolated coleoptile Source.3365: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.3366: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase Source.3367: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.3368: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.3369: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.3370: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1 Source.3371: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic Source.3372: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.3373: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.3374: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.3375: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic Source.3376: DFBPPR6231 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.3377: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein Source.3378: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3379: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.3380: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.3381: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.3382: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.3383: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein Source.3384: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.3385: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.3386: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.3387: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.3388: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.3389: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.3390: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.3391: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.3392: DFBPPR6254 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.3393: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.3394: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.3395: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.3396: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.3397: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.3398: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.3399: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.3400: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.3401: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.3402: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.3403: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1 Source.3404: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1 Source.3405: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3406: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1 Source.3407: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic Source.3408: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic Source.3409: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3410: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor Source.3411: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.3412: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3413: DFBPPR6285 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.3414: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein Source.3415: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.3416: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta Source.3417: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.3418: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.3419: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.3420: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic Source.3421: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3422: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial Source.3423: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.3424: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3 Source.3425: DFBPPR6301 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.3426: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.3427: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3428: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3429: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase Source.3430: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.3431: DFBPPR6310 ---- Plant proteins ---- Catalase Source.3432: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.3433: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.3434: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.3435: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.3436: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic Source.3437: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2 Source.3438: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.3439: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.3440: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.3441: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.3442: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH Source.3443: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2 Source.3444: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F Source.3445: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.3446: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.3447: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.3448: DFBPPR6331 ---- Plant proteins ---- Rac-like GTP-binding protein RHO1 Source.3449: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.3450: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing] Source.3451: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.3452: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3453: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5 Source.3454: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.3455: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.3456: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.3457: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.3458: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.3459: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase Source.3460: DFBPPR6352 ---- Plant proteins ---- Protein TIC 22, chloroplastic Source.3461: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.3462: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.3463: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.3464: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic Source.3465: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.3466: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial Source.3467: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1 Source.3468: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3469: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.3470: DFBPPR6368 ---- Plant proteins ---- Provicilin Source.3471: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.3472: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.3473: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.3474: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.3475: DFBPPR6375 ---- Plant proteins ---- Chlorophyll a-b binding protein 3c, chloroplastic Source.3476: DFBPPR6377 ---- Plant proteins ---- Lectin Source.3477: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D Source.3478: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C Source.3479: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.3480: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3481: DFBPPR6384 ---- Plant proteins ---- Photosystem II reaction center protein H Source.3482: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.3483: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic Source.3484: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.3485: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.3486: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6 Source.3487: DFBPPR6392 ---- Plant proteins ---- Cytochrome f Source.3488: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic Source.3489: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.3490: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3 Source.3491: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3492: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A Source.3493: DFBPPR6401 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3494: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.3495: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.3496: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase Source.3497: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase Source.3498: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.3499: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3500: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.3501: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.3502: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.3503: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.3504: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme Source.3505: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.3506: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B Source.3507: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.3508: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3509: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.3510: DFBPPR6425 ---- Plant proteins ---- Legumin A2 Source.3511: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.3512: DFBPPR6427 ---- Plant proteins ---- MADS-box transcription factor 1 Source.3513: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.3514: DFBPPR6430 ---- Plant proteins ---- Legumin J Source.3515: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.3516: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B Source.3517: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A Source.3518: DFBPPR6440 ---- Plant proteins ---- Cell division control protein 2 homolog 2 Source.3519: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72 Source.3520: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206 Source.3521: DFBPPR6444 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.3522: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic Source.3523: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.3524: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.3525: DFBPPR6455 ---- Plant proteins ---- Legumin K Source.3526: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase Source.3527: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase Source.3528: DFBPPR6459 ---- Plant proteins ---- Legumin B Source.3529: DFBPPR6461 ---- Plant proteins ---- Leghemoglobin Lb5-10 Source.3530: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.3531: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.3532: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.3533: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.3534: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1 Source.3535: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.3536: DFBPPR6470 ---- Plant proteins ---- Vicilin Source.3537: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.3538: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein Source.3539: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.3540: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a Source.3541: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.3542: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic Source.3543: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic Source.3544: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2 Source.3545: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1 Source.3546: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.3547: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.3548: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E Source.3549: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein Source.3550: DFBPPR6495 ---- Plant proteins ---- Leghemoglobin Lb120-34 Source.3551: DFBPPR6496 ---- Plant proteins ---- Leghemoglobin Lb120-1 Source.3552: DFBPPR6497 ---- Plant proteins ---- Leghemoglobin Lb120-8 Source.3553: DFBPPR6498 ---- Plant proteins ---- Leghemoglobin Lb120-29 Source.3554: DFBPPR6499 ---- Plant proteins ---- Provicilin Source.3555: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A Source.3556: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.3557: DFBPPR6512 ---- Plant proteins ---- Photosystem I reaction center subunit V Source.3558: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic Source.3559: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.3560: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3561: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.3562: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.3563: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3564: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.3565: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.3566: DFBPPR6526 ---- Plant proteins ---- Albumin-2 Source.3567: DFBPPR6527 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3568: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3569: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin Source.3570: DFBPPR6542 ---- Plant proteins ---- Maturase K Source.3571: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49 Source.3572: DFBPPR6550 ---- Plant proteins ---- Actin-3 Source.3573: DFBPPR6551 ---- Plant proteins ---- Actin-2 Source.3574: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.3575: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3576: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3577: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.3578: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.3579: DFBPPR6561 ---- Plant proteins ---- Blue copper protein Source.3580: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.3581: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.3582: DFBPPR6572 ---- Plant proteins ---- Photosystem I reaction center subunit N Source.3583: DFBPPR6573 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial Source.3584: DFBPPR6578 ---- Plant proteins ---- 17.1 kDa class II heat shock protein Source.3585: DFBPPR6579 ---- Plant proteins ---- 17.1 kDa class II heat shock protein Source.3586: DFBPPR6580 ---- Plant proteins ---- 17.1 kDa class II heat shock protein Source.3587: DFBPPR6581 ---- Plant proteins ---- Nodulin-3 Source.3588: DFBPPR6608 ---- Plant proteins ---- Unknown protein from spot 19 of 2D-PAGE of thylakoid Source.3589: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein Source.3590: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176 Source.3591: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3592: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28 Source.3593: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3594: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic Source.3595: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic Source.3596: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.3597: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.3598: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.3599: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.3600: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.3601: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1 Source.3602: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3603: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.3604: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.3605: DFBPPR6640 ---- Plant proteins ---- Puroindoline-B Source.3606: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D Source.3607: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.3608: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.3609: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.3610: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.3611: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8 Source.3612: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase Source.3613: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1 Source.3614: DFBPPR6656 ---- Plant proteins ---- Catalase Source.3615: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2 Source.3616: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.3617: DFBPPR6661 ---- Plant proteins ---- Agglutinin isolectin 3 Source.3618: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.3619: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic Source.3620: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1 Source.3621: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.3622: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.3623: DFBPPR6667 ---- Plant proteins ---- Cytochrome c Source.3624: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.3625: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.3626: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.3627: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.3628: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.3629: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8 Source.3630: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3631: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B Source.3632: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.3633: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A Source.3634: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3 Source.3635: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.3636: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.3637: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3638: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.3639: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1 Source.3640: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.3641: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3642: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase Source.3643: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain Source.3644: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2 Source.3645: DFBPPR6705 ---- Plant proteins ---- Calmodulin Source.3646: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.3647: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein Source.3648: DFBPPR6713 ---- Plant proteins ---- Histone H2B.6 Source.3649: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase Source.3650: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.3651: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa Source.3652: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3653: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase Source.3654: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.3655: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3656: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.3657: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase Source.3658: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.3659: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.3660: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.3661: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.3662: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.3663: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.3664: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.3665: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.3666: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1 Source.3667: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase Source.3668: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.3669: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase Source.3670: DFBPPR6761 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM1 Source.3671: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.3672: DFBPPR6766 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.3673: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.3674: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3675: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.3676: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.3677: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6 Source.3678: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.3679: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.3680: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3681: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.3682: DFBPPR6783 ---- Plant proteins ---- Thioredoxin H-type Source.3683: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.3684: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3685: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.3686: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7 Source.3687: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI Source.3688: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta Source.3689: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.3690: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.3691: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.3692: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.3693: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38) Source.3694: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic Source.3695: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic Source.3696: DFBPPR6805 ---- Plant proteins ---- Cytochrome f Source.3697: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3698: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3699: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.3700: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3701: DFBPPR6817 ---- Plant proteins ---- Phosphomannomutase Source.3702: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A Source.3703: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.3704: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3705: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.3706: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.3707: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.3708: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3709: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2 Source.3710: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2 Source.3711: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3712: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.3713: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3714: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3715: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.3716: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.3717: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.3718: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.3719: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta Source.3720: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3721: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1 Source.3722: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3723: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.3724: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.3725: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1 Source.3726: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A Source.3727: DFBPPR6864 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.3728: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3729: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.3730: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3731: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3732: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.3733: DFBPPR6879 ---- Plant proteins ---- Type-5 thionin Source.3734: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.3735: DFBPPR6882 ---- Plant proteins ---- Maturase K Source.3736: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor Source.3737: DFBPPR6887 ---- Plant proteins ---- Glutenin, low molecular weight subunit Source.3738: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3739: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.3740: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1 Source.3741: DFBPPR6893 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.3742: DFBPPR6895 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor Source.3743: DFBPPR6897 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.3744: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.3745: DFBPPR6903 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.3746: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.3747: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.3748: DFBPPR6918 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3749: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.3750: DFBPPR6933 ---- Plant proteins ---- Photosystem II reaction center protein J Source.3751: DFBPPR6946 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.3752: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5 Source.3753: DFBPPR6949 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.3754: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.3755: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3756: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.3757: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2 Source.3758: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6 Source.3759: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7 Source.3760: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I Source.3761: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3762: DFBPPR6975 ---- Plant proteins ---- Gamma-gliadin Source.3763: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3764: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2 Source.3765: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4 Source.3766: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11 Source.3767: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.3768: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10 Source.3769: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9 Source.3770: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8 Source.3771: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3 Source.3772: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2 Source.3773: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3 Source.3774: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein Source.3775: DFBPPR6997 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor I-2B Source.3776: DFBPPR7003 ---- Plant proteins ---- Protein RAFTIN 1C Source.3777: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.3778: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3779: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.3780: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1 Source.3781: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.3782: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.3783: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.3784: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic Source.3785: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.3786: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.3787: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.3788: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1 Source.3789: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.3790: DFBPPR7032 ---- Plant proteins ---- Hordoindoline-B2 Source.3791: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.3792: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.3793: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2 Source.3794: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.3795: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3796: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.3797: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.3798: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.3799: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.3800: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII Source.3801: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.3802: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd Source.3803: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.3804: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase Source.3805: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.3806: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.3807: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa Source.3808: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein Source.3809: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.3810: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.3811: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain Source.3812: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.3813: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain Source.3814: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3815: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.3816: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI Source.3817: DFBPPR7068 ---- Plant proteins ---- Peroxidase 2 Source.3818: DFBPPR7069 ---- Plant proteins ---- Hordoindoline-B1 Source.3819: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase Source.3820: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4 Source.3821: DFBPPR7077 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor Source.3822: DFBPPR7078 ---- Plant proteins ---- Alpha-amylase inhibitor BDAI-1 Source.3823: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.3824: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3825: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.3826: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.3827: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.3828: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.3829: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.3830: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2 Source.3831: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.3832: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.3833: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.3834: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4 Source.3835: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3836: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2 Source.3837: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.3838: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3839: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.3840: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.3841: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3842: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6 Source.3843: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII Source.3844: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.3845: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.3846: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.3847: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.3848: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.3849: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.3850: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.3851: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3852: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.3853: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.3854: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1 Source.3855: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2 Source.3856: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.3857: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.3858: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A Source.3859: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3 Source.3860: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.3861: DFBPPR7137 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.3862: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.3863: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.3864: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B Source.3865: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A Source.3866: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B Source.3867: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.3868: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.3869: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.3870: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.3871: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.3872: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.3873: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3 Source.3874: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9 Source.3875: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.3876: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin Source.3877: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.3878: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8 Source.3879: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase Source.3880: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.3881: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic Source.3882: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2 Source.3883: DFBPPR7168 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.3884: DFBPPR7170 ---- Plant proteins ---- Maturase K Source.3885: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.3886: DFBPPR7172 ---- Plant proteins ---- Barwin Source.3887: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic Source.3888: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.3889: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3890: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.3891: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1 Source.3892: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3893: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin Source.3894: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3895: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3896: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3897: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc Source.3898: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha Source.3899: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3900: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.3901: DFBPPR7194 ---- Plant proteins ---- Cytochrome f Source.3902: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.3903: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.3904: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1 Source.3905: DFBPPR7198 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.3906: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3 Source.3907: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.3908: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.3909: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3910: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic Source.3911: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.3912: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.3913: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.3914: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.3915: DFBPPR7215 ---- Plant proteins ---- Aldose reductase Source.3916: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3917: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.3918: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.3919: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.3920: DFBPPR7228 ---- Plant proteins ---- Calmodulin Source.3921: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.3922: DFBPPR7234 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.3923: DFBPPR7235 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD2 Source.3924: DFBPPR7236 ---- Plant proteins ---- Photosystem II reaction center protein J Source.3925: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1 Source.3926: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2 Source.3927: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2 Source.3928: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.3929: DFBPPR7245 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.3930: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1 Source.3931: DFBPPR7251 ---- Plant proteins ---- Leaf-specific thionin DB4 Source.3932: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.3933: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.3934: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic Source.3935: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic Source.3936: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6 Source.3937: DFBPPR7269 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.3938: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3939: DFBPPR7271 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3940: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A Source.3941: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C Source.3942: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic Source.3943: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.3944: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.3945: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1 Source.3946: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.3947: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.3948: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C Source.3949: DFBPPR7297 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.3950: DFBPPR7299 ---- Plant proteins ---- Low temperature-induced protein lt101.1 Source.3951: DFBPPR7300 ---- Plant proteins ---- 40S ribosomal protein S27 Source.3952: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3 Source.3953: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4 Source.3954: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.3955: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6 Source.3956: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7 Source.3957: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.3958: DFBPPR7312 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.3959: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.3960: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3961: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.3962: DFBPPR7318 ---- Plant proteins ---- B3-hordein Source.3963: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3964: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.3965: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3966: DFBPPR7337 ---- Plant proteins ---- Low temperature-induced protein lt101.2 Source.3967: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24 Source.3968: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C Source.3969: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B Source.3970: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7 Source.3971: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A Source.3972: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B Source.3973: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2 Source.3974: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein Source.3975: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein Source.3976: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.3977: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.3978: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.3979: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.3980: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.3981: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.3982: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor Source.3983: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.3984: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20 Source.3985: DFBPPR7406 ---- Plant proteins ---- Cytochrome c Source.3986: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1 Source.3987: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.3988: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.3989: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.3990: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.3991: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.3992: DFBPPR7415 ---- Plant proteins ---- Co-chaperone protein p23-1 Source.3993: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4 Source.3994: DFBPPR7417 ---- Plant proteins ---- Cruciferin Source.3995: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6 Source.3996: DFBPPR7419 ---- Plant proteins ---- Cytochrome b Source.3997: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase Source.3998: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a Source.3999: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.4000: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.4001: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.4002: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.4003: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.4004: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.4005: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.4006: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.4007: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.4008: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2 Source.4009: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1 Source.4010: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.4011: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase Source.4012: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.4013: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.4014: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase Source.4015: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.4016: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta Source.4017: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.4018: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1 Source.4019: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.4020: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.4021: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.4022: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2 Source.4023: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1 Source.4024: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.4025: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.4026: DFBPPR7480 ---- Plant proteins ---- Defensin-like protein 1 Source.4027: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III Source.4028: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V Source.4029: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II Source.4030: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.4031: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.4032: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.4033: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.4034: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.4035: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.4036: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.4037: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.4038: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1 Source.4039: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.4040: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2 Source.4041: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.4042: DFBPPR7513 ---- Plant proteins ---- Thioredoxin H-type 2 Source.4043: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS Source.4044: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.4045: DFBPPR7516 ---- Plant proteins ---- Defensin-like protein 3 Source.4046: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15 Source.4047: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.4048: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A Source.4049: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.4050: DFBPPR7529 ---- Plant proteins ---- Profilin Source.4051: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C Source.4052: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.4053: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.4054: DFBPPR7537 ---- Plant proteins ---- Actin-depolymerizing factor Source.4055: DFBPPR7540 ---- Plant proteins ---- Ribosomal protein S14, mitochondrial Source.4056: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1 Source.4057: DFBPPR7594 ---- Milk proteins ---- Lactadherin Source.4058: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.4059: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin Source.4060: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.4061: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.4062: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.4063: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.4064: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2 Source.4065: DFBPPR7606 ---- Milk proteins ---- Osteopontin Source.4066: DFBPPR7609 ---- Milk proteins ---- Lysozyme C Source.4067: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2 Source.4068: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.4069: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.4070: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.4071: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase Source.4072: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.4073: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b Source.4074: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.4075: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.4076: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4 Source.4077: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.4078: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein Source.4079: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain Source.4080: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.4081: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain Source.4082: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.4083: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.4084: DFBPPR7634 ---- Milk proteins ---- CD59 glycoprotein Source.4085: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.4086: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.4087: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator Source.4088: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.4089: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.4090: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor Source.4091: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6 Source.4092: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.4093: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.4094: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.4095: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.4096: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.4097: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.4098: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4 Source.4099: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4100: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A Source.4101: DFBPPR7657 ---- Milk proteins ---- Chymosin Source.4102: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin Source.4103: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.4104: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein Source.4105: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein Source.4106: DFBPPR7667 ---- Milk proteins ---- Lysozyme C, milk isozyme Source.4107: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.4108: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1 Source.4109: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2 Source.4110: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin Source.4111: DFBPPR7676 ---- Milk proteins ---- Kappa-casein Source.4112: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A Source.4113: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein Source.4114: DFBPPR7681 ---- Milk proteins ---- Beta-casein Source.4115: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.4116: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin Source.4117: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin Source.4118: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.4119: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.4120: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein Source.4121: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4122: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.4123: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein Source.4124: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin Source.4125: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.4126: DFBPPR7699 ---- Milk proteins ---- Chymosin Source.4127: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein Source.4128: DFBPPR7706 ---- Milk proteins ---- Beta-casein Source.4129: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein Source.4130: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin Source.4131: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.4132: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.4133: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.4134: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein Source.4135: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.4136: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.4137: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.4138: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.4139: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4140: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.4141: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.4142: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain Source.4143: DFBPPR7732 ---- Plant proteins ---- Plasma membrane ATPase Source.4144: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2 Source.4145: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1 Source.4146: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.4147: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.4148: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.4149: DFBPPR7739 ---- Plant proteins ---- Avenin-E Source.4150: DFBPPR7744 ---- Plant proteins ---- Maturase K Source.4151: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4 Source.4152: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2 Source.4153: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1 Source.4154: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3 Source.4155: DFBPPR7749 ---- Plant proteins ---- Avenin Source.4156: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.4157: DFBPPR8187 ---- Plant proteins ---- Cytochrome c Source.4158: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.4159: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.4160: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.4161: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase Source.4162: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33 Source.4163: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.4164: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.4165: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.4166: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2 Source.4167: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.4168: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.4169: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.4170: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.4171: DFBPPR8358 ---- Plant proteins ---- Cytochrome c Source.4172: DFBPPR8359 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.4173: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1 Source.4174: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.4175: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3 Source.4176: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.4177: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.4178: DFBPPR8368 ---- Plant proteins ---- 13S globulin basic chain Source.4179: DFBPPR8370 ---- Plant proteins ---- Maturase K Source.4180: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.4181: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.4182: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4183: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase Source.4184: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase Source.4185: DFBPPR8377 ---- Plant proteins ---- Profilin Source.4186: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2 Source.4187: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2 Source.4188: DFBPPR8388 ---- Plant proteins ---- Oleosin Ara h 14.0101 Source.4189: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102 Source.4190: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin Source.4191: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.4192: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.4193: DFBPPR8395 ---- Plant proteins ---- Oleosin Ara h 14.0103 Source.4194: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.4195: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.4196: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B Source.4197: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17 Source.4198: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3 Source.4199: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic Source.4200: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein Source.4201: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.4202: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.4203: DFBPPR8423 ---- Plant proteins ---- Cytochrome c Source.4204: DFBPPR8424 ---- Plant proteins ---- Oleosin H1 Source.4205: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4206: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.4207: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.4208: DFBPPR8434 ---- Plant proteins ---- Lectin Source.4209: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.4210: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.4211: DFBPPR8445 ---- Plant proteins ---- Maturase K Source.4212: DFBPPR8448 ---- Plant proteins ---- Maturase K Source.4213: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.4214: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.4215: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein Source.4216: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.4217: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.4218: DFBPPR8458 ---- Plant proteins ---- Catalase Source.4219: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.4220: DFBPPR8465 ---- Plant proteins ---- Cytochrome b559 subunit alpha Source.4221: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.4222: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.4223: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.4224: DFBPPR8475 ---- Plant proteins ---- Photosystem II reaction center protein J Source.4225: DFBPPR8481 ---- Plant proteins ---- Granule-bound starch synthase 1 Source.4226: DFBPPR8482 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic Source.4227: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein Source.4228: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.4229: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein Source.4230: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin Source.4231: DFBPPR8491 ---- Milk proteins ---- Osteopontin Source.4232: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.4233: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein Source.4234: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1 Source.4235: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.4236: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.4237: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.4238: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.4239: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.4240: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.4241: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.4242: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase Source.4243: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.4244: DFBPPR8505 ---- Milk proteins ---- Chymosin Source.4245: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4246: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.4247: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.4248: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.4249: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor Source.4250: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.4251: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.4252: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.4253: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase Source.4254: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3 Source.4255: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein Source.4256: DFBPPR8523 ---- Milk proteins ---- Perilipin-2 Source.4257: DFBPPR15935 ---- Animal proteins ---- Catalase Source.4258: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.4259: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.4260: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.4261: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.4262: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.4263: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.4264: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.4265: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.4266: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.4267: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.4268: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.4269: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.4270: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase Source.4271: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.4272: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.4273: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.4274: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1 Source.4275: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.4276: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4277: DFBPPR15967 ---- Animal proteins ---- Interleukin-4 Source.4278: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.4279: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.4280: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.4281: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.4282: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.4283: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta Source.4284: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.4285: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor Source.4286: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.4287: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.4288: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.4289: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.4290: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.4291: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.4292: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase Source.4293: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.4294: DFBPPR16001 ---- Animal proteins ---- Battenin Source.4295: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.4296: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.4297: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein Source.4298: DFBPPR16007 ---- Animal proteins ---- Myocilin Source.4299: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14 Source.4300: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.4301: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.4302: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.4303: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.4304: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.4305: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.4306: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.4307: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.4308: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36 Source.4309: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.4310: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA Source.4311: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.4312: DFBPPR16028 ---- Animal proteins ---- Presenilin-1 Source.4313: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.4314: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.4315: DFBPPR16032 ---- Animal proteins ---- Ras-related protein Rab-7a Source.4316: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.4317: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.4318: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.4319: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.4320: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.4321: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.4322: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.4323: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.4324: DFBPPR16046 ---- Animal proteins ---- C-C motif chemokine 3 Source.4325: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.4326: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.4327: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2 Source.4328: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.4329: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog Source.4330: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3 Source.4331: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4332: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.4333: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.4334: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase Source.4335: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.4336: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor Source.4337: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.4338: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.4339: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX Source.4340: DFBPPR16067 ---- Animal proteins ---- CD40 ligand Source.4341: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1 Source.4342: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4 Source.4343: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.4344: DFBPPR16071 ---- Animal proteins ---- CD44 antigen Source.4345: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.4346: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1 Source.4347: DFBPPR16083 ---- Animal proteins ---- Annexin A13 Source.4348: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.4349: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2 Source.4350: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.4351: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.4352: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.4353: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.4354: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.4355: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.4356: DFBPPR16093 ---- Animal proteins ---- Menin Source.4357: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.4358: DFBPPR16096 ---- Animal proteins ---- Protein CLN8 Source.4359: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.4360: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.4361: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.4362: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.4363: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.4364: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.4365: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.4366: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.4367: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.4368: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1 Source.4369: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.4370: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C Source.4371: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.4372: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor Source.4373: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.4374: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.4375: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.4376: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C Source.4377: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.4378: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein Source.4379: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.4380: DFBPPR16139 ---- Animal proteins ---- Lipocalin Can f 6.0101 Source.4381: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.4382: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.4383: DFBPPR16143 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase Source.4384: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.4385: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.4386: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.4387: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.4388: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8 Source.4389: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta Source.4390: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.4391: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2 Source.4392: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.4393: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.4394: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.4395: DFBPPR16168 ---- Animal proteins ---- Annexin A2 Source.4396: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.4397: DFBPPR16170 ---- Animal proteins ---- Inversin Source.4398: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.4399: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.4400: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.4401: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase Source.4402: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.4403: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A Source.4404: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.4405: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.4406: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.4407: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.4408: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.4409: DFBPPR16189 ---- Animal proteins ---- Albumin Source.4410: DFBPPR16191 ---- Animal proteins ---- Somatotropin Source.4411: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.4412: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.4413: DFBPPR16196 ---- Animal proteins ---- Amyloid-beta A4 protein Source.4414: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4415: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.4416: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.4417: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.4418: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.4419: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.4420: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.4421: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.4422: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.4423: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.4424: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type Source.4425: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.4426: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor Source.4427: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11 Source.4428: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.4429: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.4430: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.4431: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.4432: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.4433: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.4434: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.4435: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24 Source.4436: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.4437: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein Source.4438: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.4439: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.4440: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.4441: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.4442: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.4443: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.4444: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2 Source.4445: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.4446: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4447: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.4448: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.4449: DFBPPR16247 ---- Animal proteins ---- Recoverin Source.4450: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.4451: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.4452: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15 Source.4453: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.4454: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.4455: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.4456: DFBPPR16258 ---- Animal proteins ---- Decorin Source.4457: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.4458: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type Source.4459: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha Source.4460: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.4461: DFBPPR16265 ---- Animal proteins ---- Caspase-1 Source.4462: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.4463: DFBPPR16267 ---- Animal proteins ---- Ras-related protein Rab-2A Source.4464: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.4465: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.4466: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.4467: DFBPPR16273 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor Source.4468: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1 Source.4469: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.4470: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.4471: DFBPPR16285 ---- Animal proteins ---- Chymase Source.4472: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.4473: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21 Source.4474: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.4475: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1 Source.4476: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.4477: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.4478: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.4479: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.4480: DFBPPR16301 ---- Animal proteins ---- Major allergen Can f 1 Source.4481: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.4482: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.4483: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25 Source.4484: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41 Source.4485: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.4486: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.4487: DFBPPR16315 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.4488: DFBPPR16316 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.4489: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.4490: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.4491: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.4492: DFBPPR16322 ---- Animal proteins ---- Interleukin-18 Source.4493: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2 Source.4494: DFBPPR16325 ---- Animal proteins ---- Peripherin-2 Source.4495: DFBPPR16326 ---- Animal proteins ---- Desmin Source.4496: DFBPPR16328 ---- Animal proteins ---- Fibroblast growth factor 8 Source.4497: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.4498: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.4499: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.4500: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.4501: DFBPPR16338 ---- Animal proteins ---- Endothelin-2 Source.4502: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.4503: DFBPPR16341 ---- Animal proteins ---- Calmegin Source.4504: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.4505: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.4506: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype Source.4507: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5 Source.4508: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.4509: DFBPPR16368 ---- Animal proteins ---- Tyrosinase Source.4510: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.4511: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.4512: DFBPPR16429 ---- Animal proteins ---- C-C motif chemokine 4 Source.4513: DFBPPR16435 ---- Animal proteins ---- S-arrestin Source.4514: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.4515: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.4516: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.4517: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.4518: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.4519: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2 Source.4520: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.4521: DFBPPR16444 ---- Animal proteins ---- Interleukin-33 Source.4522: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.4523: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain Source.4524: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor Source.4525: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.4526: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.4527: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.4528: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.4529: DFBPPR16464 ---- Animal proteins ---- Interferon alpha-1/2 Source.4530: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.4531: DFBPPR16471 ---- Animal proteins ---- Interferon alpha-3 Source.4532: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4 Source.4533: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.4534: DFBPPR16475 ---- Animal proteins ---- Transmembrane protein 258 Source.4535: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2 Source.4536: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B Source.4537: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2 Source.4538: DFBPPR16481 ---- Animal proteins ---- Caspase-12 Source.4539: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.4540: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.4541: DFBPPR16487 ---- Animal proteins ---- Claudin-2 Source.4542: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.4543: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha Source.4544: DFBPPR16492 ---- Animal proteins ---- Parathyroid hormone-related protein Source.4545: DFBPPR16494 ---- Animal proteins ---- C-C motif chemokine 25 Source.4546: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.4547: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1 Source.4548: DFBPPR16497 ---- Animal proteins ---- Interleukin-5 Source.4549: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.4550: DFBPPR16500 ---- Animal proteins ---- C-C motif chemokine 5 Source.4551: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.4552: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.4553: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.4554: DFBPPR16508 ---- Animal proteins ---- Protein crumbs homolog 3 Source.4555: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.4556: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.4557: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor Source.4558: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.4559: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.4560: DFBPPR16521 ---- Animal proteins ---- Interleukin-3 Source.4561: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.4562: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.4563: DFBPPR16528 ---- Animal proteins ---- Signal recognition particle 14 kDa protein Source.4564: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.4565: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a Source.4566: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.4567: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.4568: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.4569: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.4570: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83 Source.4571: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.4572: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.4573: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein Source.4574: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.4575: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3 Source.4576: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.4577: DFBPPR16558 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.4578: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.4579: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2 Source.4580: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.4581: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.4582: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2 Source.4583: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.4584: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2 Source.4585: DFBPPR16571 ---- Animal proteins ---- Pro-MCH Source.4586: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.4587: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.4588: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.4589: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a Source.4590: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3 Source.4591: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.4592: DFBPPR16582 ---- Animal proteins ---- Pepsin A Source.4593: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin Source.4594: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2 Source.4595: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20 Source.4596: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c Source.4597: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.4598: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.4599: DFBPPR16594 ---- Animal proteins ---- Macoilin Source.4600: DFBPPR16595 ---- Animal proteins ---- Annexin A4 Source.4601: DFBPPR16599 ---- Animal proteins ---- Receptor-binding cancer antigen expressed on SiSo cells Source.4602: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.4603: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype Source.4604: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.4605: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.4606: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1 Source.4607: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.4608: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.4609: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4 Source.4610: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1 Source.4611: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.4612: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1 Source.4613: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.4614: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.4615: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.4616: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.4617: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6 Source.4618: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.4619: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H Source.4620: DFBPPR16645 ---- Animal proteins ---- Putative protein SCAMPER Source.4621: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.4622: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27 Source.4623: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1 Source.4624: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4 Source.4625: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5 Source.4626: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22 Source.4627: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.4628: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1 Source.4629: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2 Source.4630: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein Source.4631: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.4632: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.4633: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT Source.4634: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4 Source.4635: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein Source.4636: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3 Source.4637: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.4638: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.4639: DFBPPR16706 ---- Animal proteins ---- 60S ribosomal protein L19 Source.4640: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.4641: DFBPPR16710 ---- Animal proteins ---- Translocation protein SEC63 homolog Source.4642: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.4643: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.4644: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.4645: DFBPPR16721 ---- Animal proteins ---- Testin Source.4646: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.4647: DFBPPR16732 ---- Animal proteins ---- HORMA domain-containing protein 2 Source.4648: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.4649: DFBPPR16747 ---- Animal proteins ---- Pleckstrin Source.4650: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.4651: DFBPPR16750 ---- Animal proteins ---- 60S ribosomal protein L23 Source.4652: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.4653: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.4654: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region Source.4655: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.4656: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.4657: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4658: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.4659: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.4660: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37 Source.4661: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.4662: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.4663: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase Source.4664: DFBPPR16772 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.4665: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A Source.4666: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35 Source.4667: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.4668: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8 Source.4669: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.4670: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.4671: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.4672: DFBPPR16786 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.4673: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.4674: DFBPPR16797 ---- Animal proteins ---- Albumin Source.4675: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.4676: DFBPPR16799 ---- Animal proteins ---- Somatotropin Source.4677: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin Source.4678: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.4679: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.4680: DFBPPR16809 ---- Animal proteins ---- Rhodopsin Source.4681: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1 Source.4682: DFBPPR16814 ---- Animal proteins ---- Prothrombin Source.4683: DFBPPR16816 ---- Animal proteins ---- Decorin Source.4684: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4685: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.4686: DFBPPR16823 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase Source.4687: DFBPPR16827 ---- Animal proteins ---- S-arrestin Source.4688: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.4689: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.4690: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.4691: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.4692: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109 Source.4693: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.4694: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein Source.4695: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.4696: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6 Source.4697: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.4698: DFBPPR16843 ---- Animal proteins ---- Calmodulin Source.4699: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.4700: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.4701: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.4702: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.4703: DFBPPR16853 ---- Animal proteins ---- Protein S100-B Source.4704: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.4705: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.4706: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor Source.4707: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor Source.4708: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15 Source.4709: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial Source.4710: DFBPPR16863 ---- Animal proteins ---- Biglycan Source.4711: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.4712: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.4713: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX Source.4714: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.4715: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.4716: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.4717: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.4718: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Source.4719: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2 Source.4720: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.4721: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.4722: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.4723: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.4724: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C Source.4725: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.4726: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial Source.4727: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.4728: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.4729: DFBPPR16893 ---- Animal proteins ---- Annexin A4 Source.4730: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.4731: DFBPPR16897 ---- Animal proteins ---- Interleukin-4 Source.4732: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1 Source.4733: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.4734: DFBPPR16902 ---- Animal proteins ---- Interleukin-8 Source.4735: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.4736: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.4737: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.4738: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.4739: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.4740: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.4741: DFBPPR16919 ---- Animal proteins ---- VIP peptides Source.4742: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.4743: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.4744: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.4745: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.4746: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.4747: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor Source.4748: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.4749: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.4750: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13 Source.4751: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.4752: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.4753: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.4754: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.4755: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic Source.4756: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA Source.4757: DFBPPR16946 ---- Animal proteins ---- Recoverin Source.4758: DFBPPR16952 ---- Animal proteins ---- Annexin A2 Source.4759: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.4760: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.4761: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.4762: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.4763: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.4764: DFBPPR16960 ---- Animal proteins ---- Catalase Source.4765: DFBPPR16962 ---- Animal proteins ---- Interleukin-18 Source.4766: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.4767: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.4768: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.4769: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta Source.4770: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.4771: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.4772: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.4773: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.4774: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8 Source.4775: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos Source.4776: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.4777: DFBPPR16981 ---- Animal proteins ---- Clusterin Source.4778: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase Source.4779: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.4780: DFBPPR16984 ---- Animal proteins ---- Caveolin-2 Source.4781: DFBPPR16985 ---- Animal proteins ---- Filensin Source.4782: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.4783: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.4784: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.4785: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.4786: DFBPPR16994 ---- Animal proteins ---- Somatoliberin Source.4787: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1 Source.4788: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.4789: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.4790: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1 Source.4791: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.4792: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase Source.4793: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.4794: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.4795: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.4796: DFBPPR17010 ---- Animal proteins ---- Sestrin-2 Source.4797: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.4798: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.4799: DFBPPR17013 ---- Animal proteins ---- Presenilin-1 Source.4800: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.4801: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.4802: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.4803: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase Source.4804: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.4805: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.4806: DFBPPR17023 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10 Source.4807: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.4808: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator Source.4809: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.4810: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor Source.4811: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.4812: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.4813: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2 Source.4814: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.4815: DFBPPR17035 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 Source.4816: DFBPPR17037 ---- Animal proteins ---- Annexin A1 Source.4817: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.4818: DFBPPR17040 ---- Animal proteins ---- Myocilin Source.4819: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.4820: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.4821: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.4822: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D Source.4823: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta Source.4824: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.4825: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.4826: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.4827: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.4828: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1 Source.4829: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.4830: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.4831: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Source.4832: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1 Source.4833: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.4834: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.4835: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5 Source.4836: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.4837: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.4838: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.4839: DFBPPR17067 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.4840: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1 Source.4841: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.4842: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.4843: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.4844: DFBPPR17073 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform Source.4845: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2 Source.4846: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21 Source.4847: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.4848: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.4849: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.4850: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.4851: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1 Source.4852: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase Source.4853: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.4854: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog Source.4855: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.4856: DFBPPR17090 ---- Animal proteins ---- Phakinin Source.4857: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.4858: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.4859: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2 Source.4860: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.4861: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1 Source.4862: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.4863: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1 Source.4864: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.4865: DFBPPR17101 ---- Animal proteins ---- Annexin A5 Source.4866: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.4867: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.4868: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.4869: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.4870: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.4871: DFBPPR17108 ---- Animal proteins ---- Coronin-1A Source.4872: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.4873: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2 Source.4874: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.4875: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.4876: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.4877: DFBPPR17115 ---- Animal proteins ---- CD44 antigen Source.4878: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.4879: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.4880: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.4881: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7 Source.4882: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.4883: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.4884: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Source.4885: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.4886: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.4887: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.4888: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein Source.4889: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.4890: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta Source.4891: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2 Source.4892: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.4893: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.4894: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.4895: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.4896: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.4897: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.4898: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1 Source.4899: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1 Source.4900: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1 Source.4901: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.4902: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog Source.4903: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.4904: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.4905: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.4906: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1 Source.4907: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.4908: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein Source.4909: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.4910: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.4911: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.4912: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6 Source.4913: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.4914: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.4915: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha Source.4916: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.4917: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.4918: DFBPPR17196 ---- Animal proteins ---- Histone H4 Source.4919: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.4920: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.4921: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1 Source.4922: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.4923: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.4924: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase Source.4925: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.4926: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.4927: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.4928: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.4929: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial Source.4930: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.4931: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1 Source.4932: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.4933: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.4934: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.4935: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.4936: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3 Source.4937: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.4938: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR Source.4939: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein Source.4940: DFBPPR17280 ---- Animal proteins ---- Serine racemase Source.4941: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.4942: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.4943: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7 Source.4944: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.4945: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.4946: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.4947: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.4948: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.4949: DFBPPR17294 ---- Animal proteins ---- Ezrin Source.4950: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.4951: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.4952: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4953: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 Source.4954: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.4955: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.4956: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.4957: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.4958: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.4959: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1 Source.4960: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.4961: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.4962: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.4963: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta Source.4964: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.4965: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase Source.4966: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.4967: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.4968: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein Source.4969: DFBPPR17324 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.4970: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II Source.4971: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.4972: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.4973: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase Source.4974: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.4975: DFBPPR17334 ---- Animal proteins ---- Prohibitin Source.4976: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.4977: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.4978: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.4979: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.4980: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating Source.4981: DFBPPR17341 ---- Animal proteins ---- Radixin Source.4982: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.4983: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1 Source.4984: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.4985: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal Source.4986: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.4987: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.4988: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.4989: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen Source.4990: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1 Source.4991: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.4992: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.4993: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.4994: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.4995: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.4996: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.4997: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1 Source.4998: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.4999: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.5000: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6 Source.5001: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.5002: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.5003: DFBPPR17376 ---- Animal proteins ---- Flotillin-1 Source.5004: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.5005: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2 Source.5006: DFBPPR17379 ---- Animal proteins ---- Dematin Source.5007: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1 Source.5008: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.5009: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2 Source.5010: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.5011: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2 Source.5012: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.5013: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A Source.5014: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.5015: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD Source.5016: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.5017: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1 Source.5018: DFBPPR17401 ---- Animal proteins ---- Moesin Source.5019: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.5020: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.5021: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.5022: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.5023: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.5024: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.5025: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.5026: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1 Source.5027: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type Source.5028: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.5029: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5 Source.5030: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.5031: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.5032: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1 Source.5033: DFBPPR17423 ---- Animal proteins ---- Furin Source.5034: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.5035: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.5036: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.5037: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.5038: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.5039: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1 Source.5040: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5 Source.5041: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein Source.5042: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.5043: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1 Source.5044: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.5045: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.5046: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.5047: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.5048: DFBPPR17443 ---- Animal proteins ---- Beclin-1 Source.5049: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.5050: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.5051: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1 Source.5052: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein Source.5053: DFBPPR17449 ---- Animal proteins ---- C-C motif chemokine 3 Source.5054: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.5055: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.5056: DFBPPR17452 ---- Animal proteins ---- CD81 antigen Source.5057: DFBPPR17453 ---- Animal proteins ---- Calcium and integrin-binding protein 1 Source.5058: DFBPPR17454 ---- Animal proteins ---- Peripherin-2 Source.5059: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.5060: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.5061: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.5062: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.5063: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.5064: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.5065: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.5066: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.5067: DFBPPR17469 ---- Animal proteins ---- Cofilin-1 Source.5068: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.5069: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase Source.5070: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.5071: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.5072: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.5073: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.5074: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1 Source.5075: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.5076: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.5077: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.5078: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.5079: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.5080: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.5081: DFBPPR17490 ---- Animal proteins ---- TIR domain-containing adapter molecule 2 Source.5082: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1 Source.5083: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.5084: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.5085: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.5086: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.5087: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha Source.5088: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.5089: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.5090: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.5091: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD Source.5092: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.5093: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.5094: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.5095: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.5096: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.5097: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1 Source.5098: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5 Source.5099: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1 Source.5100: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.5101: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1 Source.5102: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 Source.5103: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.5104: DFBPPR17529 ---- Animal proteins ---- C-type lectin domain family 7 member A Source.5105: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2 Source.5106: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.5107: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.5108: DFBPPR17538 ---- Animal proteins ---- Septin-7 Source.5109: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.5110: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.5111: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.5112: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.5113: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.5114: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.5115: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.5116: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4 Source.5117: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog Source.5118: DFBPPR17555 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial Source.5119: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.5120: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.5121: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4 Source.5122: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.5123: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.5124: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.5125: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.5126: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B Source.5127: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.5128: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.5129: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.5130: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.5131: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.5132: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase Source.5133: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.5134: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial Source.5135: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2 Source.5136: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.5137: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.5138: DFBPPR17592 ---- Animal proteins ---- Claudin-3 Source.5139: DFBPPR17593 ---- Animal proteins ---- Claudin-3 Source.5140: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial Source.5141: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.5142: DFBPPR17599 ---- Animal proteins ---- Tissue factor Source.5143: DFBPPR17600 ---- Animal proteins ---- Tissue factor Source.5144: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor Source.5145: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.5146: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.5147: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.5148: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1 Source.5149: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.5150: DFBPPR17618 ---- Animal proteins ---- Synaptophysin Source.5151: DFBPPR17619 ---- Animal proteins ---- Vesicle-associated membrane protein 8 Source.5152: DFBPPR17620 ---- Animal proteins ---- Vesicle-associated membrane protein 8 Source.5153: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A Source.5154: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A Source.5155: DFBPPR17626 ---- Animal proteins ---- Elastin Source.5156: DFBPPR17633 ---- Animal proteins ---- Lysozyme C Source.5157: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.5158: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.5159: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2 Source.5160: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.5161: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.5162: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1 Source.5163: DFBPPR17664 ---- Animal proteins ---- Apolipoprotein C-II Source.5164: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2 Source.5165: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta Source.5166: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2 Source.5167: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.5168: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.5169: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.5170: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2 Source.5171: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase Source.5172: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.5173: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.5174: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase Source.5175: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.5176: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.5177: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6 Source.5178: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.5179: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.5180: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.5181: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.5182: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0 Source.5183: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.5184: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A Source.5185: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.5186: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.5187: DFBPPR17749 ---- Animal proteins ---- CD9 antigen Source.5188: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.5189: DFBPPR17752 ---- Animal proteins ---- Follistatin Source.5190: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1 Source.5191: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.5192: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1 Source.5193: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.5194: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4 Source.5195: DFBPPR17764 ---- Animal proteins ---- L-selectin Source.5196: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.5197: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.5198: DFBPPR17776 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.5199: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.5200: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.5201: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.5202: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.5203: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1 Source.5204: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.5205: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.5206: DFBPPR17790 ---- Animal proteins ---- Interleukin-15 Source.5207: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.5208: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.5209: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.5210: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.5211: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.5212: DFBPPR17799 ---- Animal proteins ---- Gamma-synuclein Source.5213: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13 Source.5214: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.5215: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.5216: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.5217: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2 Source.5218: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.5219: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.5220: DFBPPR17816 ---- Animal proteins ---- Lumican Source.5221: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.5222: DFBPPR17820 ---- Animal proteins ---- Osteomodulin Source.5223: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.5224: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.5225: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.5226: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.5227: DFBPPR17828 ---- Animal proteins ---- Aromatase Source.5228: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.5229: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor Source.5230: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B Source.5231: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1 Source.5232: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.5233: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.5234: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13 Source.5235: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.5236: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1 Source.5237: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B Source.5238: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.5239: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20 Source.5240: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.5241: DFBPPR17849 ---- Animal proteins ---- Fibromodulin Source.5242: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.5243: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.5244: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.5245: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.5246: DFBPPR17855 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1 Source.5247: DFBPPR17856 ---- Animal proteins ---- Selenoprotein S Source.5248: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.5249: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor Source.5250: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.5251: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase Source.5252: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.5253: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.5254: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1 Source.5255: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.5256: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.5257: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.5258: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.5259: DFBPPR17879 ---- Animal proteins ---- Menin Source.5260: DFBPPR17883 ---- Animal proteins ---- Sialidase-1 Source.5261: DFBPPR17885 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 6 Source.5262: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor Source.5263: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.5264: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.5265: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase Source.5266: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.5267: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.5268: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.5269: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.5270: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1 Source.5271: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.5272: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.5273: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.5274: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8 Source.5275: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.5276: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein Source.5277: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.5278: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.5279: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.5280: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.5281: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.5282: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial Source.5283: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.5284: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3 Source.5285: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.5286: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.5287: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.5288: DFBPPR17928 ---- Animal proteins ---- CD40 ligand Source.5289: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2 Source.5290: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.5291: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.5292: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.5293: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.5294: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.5295: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.5296: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.5297: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.5298: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38 Source.5299: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.5300: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9 Source.5301: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.5302: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.5303: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.5304: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 Source.5305: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.5306: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.5307: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.5308: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.5309: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.5310: DFBPPR17954 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member A Source.5311: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase Source.5312: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.5313: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.5314: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG Source.5315: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4 Source.5316: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.5317: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.5318: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.5319: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase Source.5320: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase Source.5321: DFBPPR17970 ---- Animal proteins ---- Profilin-2 Source.5322: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.5323: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.5324: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.5325: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.5326: DFBPPR17977 ---- Animal proteins ---- Collagenase 3 Source.5327: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.5328: DFBPPR17981 ---- Animal proteins ---- Retinol-binding protein 4 Source.5329: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.5330: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.5331: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor Source.5332: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.5333: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3 Source.5334: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN Source.5335: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein Source.5336: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2 Source.5337: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.5338: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.5339: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.5340: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Source.5341: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.5342: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.5343: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase Source.5344: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.5345: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.5346: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.5347: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.5348: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.5349: DFBPPR18011 ---- Animal proteins ---- Afamin Source.5350: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.5351: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.5352: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein Source.5353: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.5354: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2 Source.5355: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.5356: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase Source.5357: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.5358: DFBPPR18022 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial Source.5359: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.5360: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.5361: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.5362: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.5363: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain Source.5364: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta Source.5365: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.5366: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.5367: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 Source.5368: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.5369: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3 Source.5370: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.5371: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S Source.5372: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase Source.5373: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.5374: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5 Source.5375: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1 Source.5376: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial Source.5377: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1 Source.5378: DFBPPR18050 ---- Animal proteins ---- Ras-related protein Rab-7a Source.5379: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1 Source.5380: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.5381: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.5382: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T Source.5383: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A Source.5384: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.5385: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.5386: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2 Source.5387: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.5388: DFBPPR18065 ---- Animal proteins ---- Isopentenyl-diphosphate Delta-isomerase 1 Source.5389: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.5390: DFBPPR18068 ---- Animal proteins ---- Annexin A11 Source.5391: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.5392: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein Source.5393: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.5394: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.5395: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial Source.5396: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.5397: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta Source.5398: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.5399: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.5400: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.5401: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.5402: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor Source.5403: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta Source.5404: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4 Source.5405: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.5406: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.5407: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.5408: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.5409: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.5410: DFBPPR18104 ---- Animal proteins ---- Thioredoxin Source.5411: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.5412: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.5413: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29 Source.5414: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.5415: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.5416: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1 Source.5417: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4 Source.5418: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.5419: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.5420: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.5421: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.5422: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.5423: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.5424: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.5425: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.5426: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.5427: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.5428: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1 Source.5429: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C Source.5430: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1 Source.5431: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.5432: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.5433: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.5434: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.5435: DFBPPR18157 ---- Animal proteins ---- Hematopoietic cell signal transducer Source.5436: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.5437: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.5438: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.5439: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.5440: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.5441: DFBPPR18166 ---- Animal proteins ---- Selenoprotein P Source.5442: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.5443: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.5444: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.5445: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6 Source.5446: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25 Source.5447: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2 Source.5448: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.5449: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1 Source.5450: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5 Source.5451: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.5452: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.5453: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein Source.5454: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein Source.5455: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.5456: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.5457: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta Source.5458: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.5459: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8 Source.5460: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.5461: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.5462: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.5463: DFBPPR18227 ---- Animal proteins ---- Desmin Source.5464: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.5465: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A Source.5466: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3 Source.5467: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.5468: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.5469: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa Source.5470: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.5471: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.5472: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a Source.5473: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.5474: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase Source.5475: DFBPPR18254 ---- Animal proteins ---- C-type lectin domain family 6 member A Source.5476: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.5477: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10 Source.5478: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41 Source.5479: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.5480: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.5481: DFBPPR18262 ---- Animal proteins ---- Claudin-1 Source.5482: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta Source.5483: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.5484: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.5485: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.5486: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein Source.5487: DFBPPR18271 ---- Animal proteins ---- Lysozyme C-2 Source.5488: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.5489: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial Source.5490: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.5491: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.5492: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3 Source.5493: DFBPPR18281 ---- Animal proteins ---- CD63 antigen Source.5494: DFBPPR18285 ---- Animal proteins ---- ADP-ribose glycohydrolase OARD1 Source.5495: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.5496: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56 Source.5497: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.5498: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.5499: DFBPPR18292 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 11 Source.5500: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.5501: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.5502: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase Source.5503: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.5504: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.5505: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1 Source.5506: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.5507: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.5508: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.5509: DFBPPR18307 ---- Animal proteins ---- Claudin-4 Source.5510: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A Source.5511: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain Source.5512: DFBPPR18312 ---- Animal proteins ---- Interleukin-10 Source.5513: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B Source.5514: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.5515: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.5516: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.5517: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1 Source.5518: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial Source.5519: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.5520: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6 Source.5521: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.5522: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial Source.5523: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a Source.5524: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.5525: DFBPPR18340 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2 Source.5526: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2 Source.5527: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1 Source.5528: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase Source.5529: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.5530: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.5531: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog Source.5532: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.5533: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1 Source.5534: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.5535: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase Source.5536: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.5537: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.5538: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.5539: DFBPPR18363 ---- Animal proteins ---- Spexin Source.5540: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.5541: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2 Source.5542: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Source.5543: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.5544: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.5545: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.5546: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.5547: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.5548: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.5549: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.5550: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.5551: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.5552: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.5553: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.5554: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.5555: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.5556: DFBPPR18391 ---- Animal proteins ---- Exosome complex component RRP43 Source.5557: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.5558: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.5559: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase Source.5560: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Source.5561: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.5562: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6 Source.5563: DFBPPR18400 ---- Animal proteins ---- Amyloid-beta A4 protein Source.5564: DFBPPR18401 ---- Animal proteins ---- Protrudin Source.5565: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.5566: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.5567: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10 Source.5568: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen Source.5569: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.5570: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.5571: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain Source.5572: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.5573: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14 Source.5574: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.5575: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.5576: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14 Source.5577: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.5578: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.5579: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16 Source.5580: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.5581: DFBPPR18433 ---- Animal proteins ---- Basigin Source.5582: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.5583: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.5584: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.5585: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.5586: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.5587: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.5588: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2 Source.5589: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.5590: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.5591: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4 Source.5592: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.5593: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1 Source.5594: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.5595: DFBPPR18458 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.5596: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.5597: DFBPPR18462 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.5598: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.5599: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor Source.5600: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.5601: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.5602: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.5603: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A Source.5604: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1 Source.5605: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.5606: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.5607: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.5608: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.5609: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.5610: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.5611: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.5612: DFBPPR18488 ---- Animal proteins ---- Parathyroid hormone-related protein Source.5613: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1 Source.5614: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.5615: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.5616: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.5617: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase Source.5618: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.5619: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.5620: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb Source.5621: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.5622: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial Source.5623: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5 Source.5624: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.5625: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.5626: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.5627: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.5628: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.5629: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C Source.5630: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130 Source.5631: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1 Source.5632: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.5633: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1 Source.5634: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial Source.5635: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain Source.5636: DFBPPR18528 ---- Animal proteins ---- 14-3-3 protein sigma Source.5637: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin Source.5638: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain Source.5639: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain Source.5640: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1 Source.5641: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.5642: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1 Source.5643: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.5644: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.5645: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1 Source.5646: DFBPPR18543 ---- Animal proteins ---- Proproteinase E Source.5647: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu Source.5648: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial Source.5649: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.5650: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.5651: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.5652: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.5653: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.5654: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.5655: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.5656: DFBPPR18560 ---- Animal proteins ---- Rho-related GTP-binding protein RhoF Source.5657: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.5658: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.5659: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.5660: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal Source.5661: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.5662: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1 Source.5663: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.5664: DFBPPR18573 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.5665: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5 Source.5666: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.5667: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.5668: DFBPPR18581 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 7 Source.5669: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.5670: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.5671: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.5672: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.5673: DFBPPR18589 ---- Animal proteins ---- Interleukin-13 Source.5674: DFBPPR18590 ---- Animal proteins ---- Retinol-binding protein 1 Source.5675: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase Source.5676: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.5677: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.5678: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2 Source.5679: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3 Source.5680: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.5681: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.5682: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26 Source.5683: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.5684: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.5685: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3 Source.5686: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial Source.5687: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.5688: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.5689: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.5690: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561 Source.5691: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.5692: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase Source.5693: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.5694: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2 Source.5695: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase Source.5696: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.5697: DFBPPR18632 ---- Animal proteins ---- Syntaxin-4 Source.5698: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14 Source.5699: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.5700: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB Source.5701: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.5702: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4 Source.5703: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3 Source.5704: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.5705: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.5706: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1 Source.5707: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.5708: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type Source.5709: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.5710: DFBPPR18651 ---- Animal proteins ---- Allergen Bos d 2 Source.5711: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21 Source.5712: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.5713: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6 Source.5714: DFBPPR18686 ---- Animal proteins ---- Intraflagellar transport protein 27 homolog Source.5715: DFBPPR18698 ---- Animal proteins ---- ATPase GET3 Source.5716: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4 Source.5717: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D Source.5718: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1 Source.5719: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.5720: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor Source.5721: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3 Source.5722: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase Source.5723: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.5724: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5 Source.5725: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.5726: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Source.5727: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor Source.5728: DFBPPR18719 ---- Animal proteins ---- A-kinase anchor protein 5 Source.5729: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2 Source.5730: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.5731: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.5732: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial Source.5733: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.5734: DFBPPR18734 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF114 Source.5735: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.5736: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.5737: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.5738: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.5739: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II Source.5740: DFBPPR18743 ---- Animal proteins ---- Sperm-egg fusion protein TMEM95 Source.5741: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor Source.5742: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1 Source.5743: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.5744: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase Source.5745: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.5746: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.5747: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.5748: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.5749: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.5750: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.5751: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.5752: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.5753: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9 Source.5754: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.5755: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9 Source.5756: DFBPPR18775 ---- Animal proteins ---- tRNA methyltransferase 10 homolog A Source.5757: DFBPPR18779 ---- Animal proteins ---- Mucin-15 Source.5758: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.5759: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.5760: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A Source.5761: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.5762: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.5763: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU Source.5764: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein Source.5765: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.5766: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.5767: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C Source.5768: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2 Source.5769: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A Source.5770: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.5771: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.5772: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.5773: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2 Source.5774: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha Source.5775: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.5776: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.5777: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.5778: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.5779: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.5780: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.5781: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1 Source.5782: DFBPPR18815 ---- Animal proteins ---- Pantetheinase Source.5783: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.5784: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.5785: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.5786: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2 Source.5787: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase Source.5788: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.5789: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.5790: DFBPPR18825 ---- Animal proteins ---- Glutaredoxin-1 Source.5791: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6 Source.5792: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type Source.5793: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1 Source.5794: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.5795: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2 Source.5796: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor Source.5797: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.5798: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.5799: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B Source.5800: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.5801: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.5802: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.5803: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.5804: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin Source.5805: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.5806: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor Source.5807: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase Source.5808: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.5809: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2 Source.5810: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase Source.5811: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7 Source.5812: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.5813: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.5814: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.5815: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.5816: DFBPPR18869 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit beta Source.5817: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.5818: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.5819: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.5820: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.5821: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.5822: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.5823: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase Source.5824: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1 Source.5825: DFBPPR18882 ---- Animal proteins ---- Bisphosphoglycerate mutase Source.5826: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.5827: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.5828: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.5829: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5 Source.5830: DFBPPR18893 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM20 homolog Source.5831: DFBPPR18894 ---- Animal proteins ---- NEDD8-conjugating enzyme Ubc12 Source.5832: DFBPPR18895 ---- Animal proteins ---- Lysozyme C-1 Source.5833: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.5834: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.5835: DFBPPR18899 ---- Animal proteins ---- Cofilin-2 Source.5836: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.5837: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.5838: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.5839: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.5840: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.5841: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless Source.5842: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.5843: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.5844: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.5845: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.5846: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3 Source.5847: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5 Source.5848: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11 Source.5849: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.5850: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.5851: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.5852: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.5853: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.5854: DFBPPR18931 ---- Animal proteins ---- Ficolin-2 Source.5855: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Source.5856: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.5857: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.5858: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.5859: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13 Source.5860: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.5861: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.5862: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1 Source.5863: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.5864: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6 Source.5865: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1 Source.5866: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.5867: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3 Source.5868: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8 Source.5869: DFBPPR18952 ---- Animal proteins ---- Serotransferrin Source.5870: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha Source.5871: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.5872: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.5873: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A Source.5874: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.5875: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1 Source.5876: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog Source.5877: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.5878: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein Source.5879: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.5880: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.5881: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS Source.5882: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3 Source.5883: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease Source.5884: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.5885: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.5886: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor Source.5887: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.5888: DFBPPR18986 ---- Animal proteins ---- Granzyme A Source.5889: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.5890: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.5891: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5 Source.5892: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.5893: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1 Source.5894: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog Source.5895: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.5896: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I Source.5897: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.5898: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.5899: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1 Source.5900: DFBPPR19011 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF138 Source.5901: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D Source.5902: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3 Source.5903: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.5904: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.5905: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.5906: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.5907: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B Source.5908: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog Source.5909: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase Source.5910: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.5911: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.5912: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.5913: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.5914: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.5915: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.5916: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.5917: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.5918: DFBPPR19037 ---- Animal proteins ---- Transthyretin Source.5919: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.5920: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.5921: DFBPPR19042 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 2 Source.5922: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Source.5923: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.5924: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2 Source.5925: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.5926: DFBPPR19059 ---- Animal proteins ---- Lysozyme C, non-stomach isozyme Source.5927: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.5928: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.5929: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.5930: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.5931: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.5932: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.5933: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.5934: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.5935: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.5936: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.5937: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2 Source.5938: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.5939: DFBPPR19078 ---- Animal proteins ---- Cystatin-B Source.5940: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.5941: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3 Source.5942: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.5943: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.5944: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.5945: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A Source.5946: DFBPPR19094 ---- Animal proteins ---- C-C motif chemokine 4 Source.5947: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase Source.5948: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.5949: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.5950: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.5951: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.5952: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2 Source.5953: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.5954: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2 Source.5955: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.5956: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.5957: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.5958: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3 Source.5959: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.5960: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit Source.5961: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2 Source.5962: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.5963: DFBPPR19137 ---- Animal proteins ---- Serpin H1 Source.5964: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.5965: DFBPPR19140 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 5 Source.5966: DFBPPR19145 ---- Animal proteins ---- Pepsin A Source.5967: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.5968: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.5969: DFBPPR19150 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase H Source.5970: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.5971: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.5972: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2 Source.5973: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.5974: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.5975: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma Source.5976: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.5977: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.5978: DFBPPR19174 ---- Animal proteins ---- Neuroendocrine secretory protein 55 Source.5979: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin Source.5980: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16 Source.5981: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone Source.5982: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33 Source.5983: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.5984: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.5985: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.5986: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.5987: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.5988: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4 Source.5989: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.5990: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.5991: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein Source.5992: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A Source.5993: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.5994: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5 Source.5995: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7 Source.5996: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.5997: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.5998: DFBPPR19211 ---- Animal proteins ---- Beta-synuclein Source.5999: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1 Source.6000: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2 Source.6001: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.6002: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.6003: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B Source.6004: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.6005: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase Source.6006: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.6007: DFBPPR19224 ---- Animal proteins ---- Fetuin-B Source.6008: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.6009: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1 Source.6010: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Source.6011: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.6012: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128 Source.6013: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.6014: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein Source.6015: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase Source.6016: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.6017: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog Source.6018: DFBPPR19247 ---- Animal proteins ---- Calmegin Source.6019: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.6020: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.6021: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.6022: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5 Source.6023: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B Source.6024: DFBPPR19253 ---- Animal proteins ---- Limbin Source.6025: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.6026: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2 Source.6027: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like Source.6028: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3 Source.6029: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28 Source.6030: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial Source.6031: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4 Source.6032: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2 Source.6033: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.6034: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.6035: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.6036: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.6037: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.6038: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2 Source.6039: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.6040: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.6041: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3 Source.6042: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5 Source.6043: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1 Source.6044: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6 Source.6045: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B Source.6046: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.6047: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.6048: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1 Source.6049: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3 Source.6050: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.6051: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1 Source.6052: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.6053: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3 Source.6054: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1 Source.6055: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.6056: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.6057: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial Source.6058: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1 Source.6059: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.6060: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.6061: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.6062: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.6063: DFBPPR19329 ---- Animal proteins ---- CD302 antigen Source.6064: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.6065: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.6066: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9 Source.6067: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4 Source.6068: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.6069: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.6070: DFBPPR19342 ---- Animal proteins ---- Calcium load-activated calcium channel Source.6071: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.6072: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1 Source.6073: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3 Source.6074: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.6075: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.6076: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.6077: DFBPPR19359 ---- Animal proteins ---- Spartin Source.6078: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.6079: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14 Source.6080: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1 Source.6081: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3 Source.6082: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.6083: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.6084: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel Source.6085: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.6086: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.6087: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A Source.6088: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1 Source.6089: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific Source.6090: DFBPPR19377 ---- Animal proteins ---- ER lumen protein-retaining receptor 2 Source.6091: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.6092: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3 Source.6093: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.6094: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2 Source.6095: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.6096: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A Source.6097: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6 Source.6098: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein Source.6099: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.6100: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6 Source.6101: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b Source.6102: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.6103: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4 Source.6104: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein Source.6105: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F Source.6106: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog Source.6107: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.6108: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.6109: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.6110: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.6111: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.6112: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22 Source.6113: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1 Source.6114: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19 Source.6115: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1 Source.6116: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.6117: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase Source.6118: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2 Source.6119: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Source.6120: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.6121: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor Source.6122: DFBPPR19438 ---- Animal proteins ---- Protein Mis18-alpha Source.6123: DFBPPR19439 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.6124: DFBPPR19443 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.6125: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.6126: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.6127: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2 Source.6128: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.6129: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.6130: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.6131: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.6132: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2 Source.6133: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.6134: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4 Source.6135: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.6136: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20 Source.6137: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase Source.6138: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137 Source.6139: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2 Source.6140: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.6141: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.6142: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12 Source.6143: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.6144: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.6145: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.6146: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.6147: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.6148: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.6149: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.6150: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase Source.6151: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.6152: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5 Source.6153: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase Source.6154: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.6155: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3 Source.6156: DFBPPR19489 ---- Animal proteins ---- Keratocan Source.6157: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4 Source.6158: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.6159: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.6160: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72 Source.6161: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5 Source.6162: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.6163: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.6164: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.6165: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2 Source.6166: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.6167: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.6168: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.6169: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta Source.6170: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E Source.6171: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.6172: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.6173: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.6174: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.6175: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog Source.6176: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2 Source.6177: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.6178: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.6179: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3 Source.6180: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1 Source.6181: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.6182: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2 Source.6183: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.6184: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9 Source.6185: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.6186: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.6187: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.6188: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.6189: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2 Source.6190: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.6191: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.6192: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.6193: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.6194: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.6195: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.6196: DFBPPR19575 ---- Animal proteins ---- Acylphosphatase-2 Source.6197: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.6198: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial Source.6199: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.6200: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.6201: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2 Source.6202: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.6203: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1 Source.6204: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1 Source.6205: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C Source.6206: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1 Source.6207: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.6208: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.6209: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin Source.6210: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.6211: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.6212: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C Source.6213: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein Source.6214: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.6215: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.6216: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2 Source.6217: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.6218: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.6219: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.6220: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.6221: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.6222: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase Source.6223: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.6224: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.6225: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.6226: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.6227: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2 Source.6228: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.6229: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase Source.6230: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.6231: DFBPPR19640 ---- Animal proteins ---- Prolargin Source.6232: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.6233: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Source.6234: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4 Source.6235: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit Source.6236: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4 Source.6237: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2 Source.6238: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.6239: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B Source.6240: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.6241: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.6242: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator Source.6243: DFBPPR19662 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1 Source.6244: DFBPPR19668 ---- Animal proteins ---- Calicin Source.6245: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.6246: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein Source.6247: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.6248: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.6249: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3 Source.6250: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.6251: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.6252: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3 Source.6253: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.6254: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5 Source.6255: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.6256: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1 Source.6257: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.6258: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase Source.6259: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4 Source.6260: DFBPPR19696 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.6261: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.6262: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1 Source.6263: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3 Source.6264: DFBPPR19703 ---- Animal proteins ---- Claudin-10 Source.6265: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.6266: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.6267: DFBPPR19709 ---- Animal proteins ---- Centromere protein X Source.6268: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.6269: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2 Source.6270: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1 Source.6271: DFBPPR19717 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM14 Source.6272: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.6273: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4 Source.6274: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1 Source.6275: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3 Source.6276: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2 Source.6277: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B Source.6278: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.6279: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.6280: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.6281: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.6282: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.6283: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5 Source.6284: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1 Source.6285: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.6286: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2 Source.6287: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase Source.6288: DFBPPR19748 ---- Animal proteins ---- 60S ribosomal protein L23 Source.6289: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.6290: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1 Source.6291: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.6292: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.6293: DFBPPR19761 ---- Animal proteins ---- N-chimaerin Source.6294: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2 Source.6295: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.6296: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13 Source.6297: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH Source.6298: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.6299: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.6300: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1 Source.6301: DFBPPR19777 ---- Animal proteins ---- Translin Source.6302: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.6303: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit Source.6304: DFBPPR19781 ---- Animal proteins ---- Secretory carrier-associated membrane protein 5 Source.6305: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.6306: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.6307: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11 Source.6308: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.6309: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2 Source.6310: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.6311: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.6312: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3 Source.6313: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1 Source.6314: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.6315: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.6316: DFBPPR19807 ---- Animal proteins ---- Spermine synthase Source.6317: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2 Source.6318: DFBPPR19810 ---- Animal proteins ---- Seipin Source.6319: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.6320: DFBPPR19812 ---- Animal proteins ---- Probable inactive serine protease 37 Source.6321: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Source.6322: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2 Source.6323: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.6324: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6 Source.6325: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.6326: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B Source.6327: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.6328: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein Source.6329: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.6330: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial Source.6331: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1 Source.6332: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.6333: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.6334: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.6335: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.6336: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.6337: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30 Source.6338: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.6339: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4 Source.6340: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.6341: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.6342: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.6343: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.6344: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.6345: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5 Source.6346: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a Source.6347: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1 Source.6348: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.6349: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.6350: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.6351: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1 Source.6352: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B Source.6353: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.6354: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2 Source.6355: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.6356: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.6357: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.6358: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.6359: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.6360: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3 Source.6361: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1 Source.6362: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14 Source.6363: DFBPPR19880 ---- Animal proteins ---- TATA box-binding protein-like 1 Source.6364: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.6365: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1 Source.6366: DFBPPR19886 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4A Source.6367: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2 Source.6368: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase Source.6369: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta Source.6370: DFBPPR19893 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3 Source.6371: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.6372: DFBPPR19898 ---- Animal proteins ---- Essential MCU regulator, mitochondrial Source.6373: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic Source.6374: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.6375: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.6376: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.6377: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.6378: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.6379: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1 Source.6380: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial Source.6381: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.6382: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.6383: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.6384: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7 Source.6385: DFBPPR19921 ---- Animal proteins ---- Histone deacetylase complex subunit SAP18 Source.6386: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.6387: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.6388: DFBPPR19927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] flavoprotein 3, mitochondrial Source.6389: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6 Source.6390: DFBPPR19935 ---- Animal proteins ---- Reticulon-3 Source.6391: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1 Source.6392: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform Source.6393: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.6394: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B Source.6395: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.6396: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.6397: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.6398: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2 Source.6399: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.6400: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.6401: DFBPPR19956 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.6402: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein Source.6403: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B Source.6404: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24 Source.6405: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.6406: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein Source.6407: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial Source.6408: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2 Source.6409: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.6410: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma Source.6411: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.6412: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor Source.6413: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.6414: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1 Source.6415: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.6416: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.6417: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.6418: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.6419: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1 Source.6420: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39 Source.6421: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7 Source.6422: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2 Source.6423: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.6424: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.6425: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3 Source.6426: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.6427: DFBPPR19996 ---- Animal proteins ---- Interleukin-3 Source.6428: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.6429: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.6430: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C Source.6431: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase Source.6432: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.6433: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.6434: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR Source.6435: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.6436: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1 Source.6437: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2 Source.6438: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7 Source.6439: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.6440: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1 Source.6441: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12 Source.6442: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.6443: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.6444: DFBPPR20034 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C1, mitochondrial Source.6445: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.6446: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.6447: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2 Source.6448: DFBPPR20044 ---- Animal proteins ---- Secernin-1 Source.6449: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B Source.6450: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.6451: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.6452: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase Source.6453: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.6454: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.6455: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.6456: DFBPPR20057 ---- Animal proteins ---- AP-3 complex subunit sigma-1 Source.6457: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.6458: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5 Source.6459: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial Source.6460: DFBPPR20065 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3 Source.6461: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.6462: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.6463: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.6464: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26 Source.6465: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4 Source.6466: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.6467: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.6468: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.6469: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2 Source.6470: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.6471: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.6472: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B Source.6473: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.6474: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.6475: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47 Source.6476: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.6477: DFBPPR20089 ---- Animal proteins ---- Fascin-2 Source.6478: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1 Source.6479: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.6480: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.6481: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.6482: DFBPPR20098 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.6483: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.6484: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.6485: DFBPPR20102 ---- Animal proteins ---- Cylicin-2 Source.6486: DFBPPR20103 ---- Animal proteins ---- Protein MAL2 Source.6487: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease Source.6488: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial Source.6489: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.6490: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1 Source.6491: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.6492: DFBPPR20124 ---- Animal proteins ---- Serine palmitoyltransferase small subunit B Source.6493: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase Source.6494: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.6495: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.6496: DFBPPR20139 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm4 Source.6497: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.6498: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.6499: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.6500: DFBPPR20145 ---- Animal proteins ---- Adipogenin Source.6501: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1 Source.6502: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C Source.6503: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.6504: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a Source.6505: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma Source.6506: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.6507: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.6508: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9 Source.6509: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A Source.6510: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein Source.6511: DFBPPR20161 ---- Animal proteins ---- Calponin-2 Source.6512: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog Source.6513: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2 Source.6514: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.6515: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.6516: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.6517: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein Source.6518: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase Source.6519: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.6520: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.6521: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6 Source.6522: DFBPPR20184 ---- Animal proteins ---- Centromere protein H Source.6523: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7 Source.6524: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3 Source.6525: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.6526: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.6527: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.6528: DFBPPR20194 ---- Animal proteins ---- 28S ribosomal protein S24, mitochondrial Source.6529: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20 Source.6530: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial Source.6531: DFBPPR20204 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.6532: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.6533: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1 Source.6534: DFBPPR20210 ---- Animal proteins ---- Exonuclease V Source.6535: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.6536: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.6537: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12 Source.6538: DFBPPR20225 ---- Animal proteins ---- Claudin-2 Source.6539: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase Source.6540: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7 Source.6541: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.6542: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.6543: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.6544: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1 Source.6545: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase Source.6546: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.6547: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1 Source.6548: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B Source.6549: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein Source.6550: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein Source.6551: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2 Source.6552: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.6553: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan Source.6554: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28 Source.6555: DFBPPR20250 ---- Animal proteins ---- General transcription factor IIH subunit 5 Source.6556: DFBPPR20252 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform Source.6557: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor Source.6558: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1 Source.6559: DFBPPR20262 ---- Animal proteins ---- DNA-directed RNA polymerase I subunit RPA12 Source.6560: DFBPPR20264 ---- Animal proteins ---- AP-3 complex subunit sigma-2 Source.6561: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1 Source.6562: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.6563: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.6564: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3 Source.6565: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.6566: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.6567: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1 Source.6568: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214 Source.6569: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6 Source.6570: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.6571: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2 Source.6572: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.6573: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.6574: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.6575: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like Source.6576: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase Source.6577: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal Source.6578: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN Source.6579: DFBPPR20296 ---- Animal proteins ---- Claudin-18 Source.6580: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.6581: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.6582: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator Source.6583: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3 Source.6584: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3 Source.6585: DFBPPR20305 ---- Animal proteins ---- Nostrin Source.6586: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B Source.6587: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.6588: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3 Source.6589: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.6590: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9 Source.6591: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial Source.6592: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV Source.6593: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.6594: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2 Source.6595: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.6596: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.6597: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3 Source.6598: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.6599: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.6600: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.6601: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.6602: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.6603: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial Source.6604: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1 Source.6605: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3 Source.6606: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial Source.6607: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1 Source.6608: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14 Source.6609: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.6610: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.6611: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.6612: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.6613: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2 Source.6614: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase Source.6615: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.6616: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1 Source.6617: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C Source.6618: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.6619: DFBPPR20363 ---- Animal proteins ---- F-box/LRR-repeat protein 2 Source.6620: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1 Source.6621: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1 Source.6622: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.6623: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2 Source.6624: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.6625: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4 Source.6626: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.6627: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.6628: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.6629: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.6630: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a Source.6631: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.6632: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1 Source.6633: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.6634: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1 Source.6635: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.6636: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.6637: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.6638: DFBPPR20401 ---- Animal proteins ---- Bystin Source.6639: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2 Source.6640: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.6641: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2 Source.6642: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A Source.6643: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.6644: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.6645: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.6646: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.6647: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.6648: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor Source.6649: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.6650: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170 Source.6651: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein Source.6652: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2 Source.6653: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog Source.6654: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog Source.6655: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.6656: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1 Source.6657: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1 Source.6658: DFBPPR20438 ---- Animal proteins ---- Small ubiquitin-related modifier 3 Source.6659: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.6660: DFBPPR20440 ---- Animal proteins ---- 28S ribosomal protein S25, mitochondrial Source.6661: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7 Source.6662: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5 Source.6663: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.6664: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.6665: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1 Source.6666: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1 Source.6667: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.6668: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3 Source.6669: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8 Source.6670: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.6671: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.6672: DFBPPR20461 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm8 Source.6673: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.6674: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79 Source.6675: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C Source.6676: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.6677: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial Source.6678: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.6679: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.6680: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.6681: DFBPPR20478 ---- Animal proteins ---- Macoilin Source.6682: DFBPPR20479 ---- Animal proteins ---- Ribonuclease P protein subunit p29 Source.6683: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54 Source.6684: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1 Source.6685: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.6686: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase Source.6687: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein Source.6688: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.6689: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.6690: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial Source.6691: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan Source.6692: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.6693: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog Source.6694: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog Source.6695: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2 Source.6696: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102 Source.6697: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1 Source.6698: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial Source.6699: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.6700: DFBPPR20509 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 1 Source.6701: DFBPPR20510 ---- Animal proteins ---- Josephin-1 Source.6702: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.6703: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29 Source.6704: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial Source.6705: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.6706: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6 Source.6707: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2 Source.6708: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.6709: DFBPPR20522 ---- Animal proteins ---- Serine palmitoyltransferase small subunit A Source.6710: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36 Source.6711: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6 Source.6712: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.6713: DFBPPR20529 ---- Animal proteins ---- Transgelin Source.6714: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.6715: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2 Source.6716: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.6717: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.6718: DFBPPR20546 ---- Animal proteins ---- Odorant-binding protein Source.6719: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230 Source.6720: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1 Source.6721: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.6722: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.6723: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.6724: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4 Source.6725: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.6726: DFBPPR20557 ---- Animal proteins ---- Asporin Source.6727: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial Source.6728: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase Source.6729: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D Source.6730: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.6731: DFBPPR20570 ---- Animal proteins ---- Intraflagellar transport protein 22 homolog Source.6732: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.6733: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.6734: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a Source.6735: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog Source.6736: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.6737: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.6738: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein Source.6739: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.6740: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.6741: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi Source.6742: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.6743: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein Source.6744: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein Source.6745: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.6746: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2 Source.6747: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1 Source.6748: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.6749: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.6750: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.6751: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.6752: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase Source.6753: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.6754: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13 Source.6755: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.6756: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.6757: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2 Source.6758: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5 Source.6759: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3 Source.6760: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.6761: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5 Source.6762: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C Source.6763: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.6764: DFBPPR20637 ---- Animal proteins ---- Mitochondrial mRNA pseudouridine synthase RPUSD3 Source.6765: DFBPPR20638 ---- Animal proteins ---- DPH3 homolog Source.6766: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.6767: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52 Source.6768: DFBPPR20647 ---- Animal proteins ---- Annexin A8 Source.6769: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog Source.6770: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial Source.6771: DFBPPR20651 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 2, mitochondrial Source.6772: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A Source.6773: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein Source.6774: DFBPPR20656 ---- Animal proteins ---- Protein archease Source.6775: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.6776: DFBPPR20659 ---- Animal proteins ---- Cystinosin Source.6777: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3 Source.6778: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.6779: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein Source.6780: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2 Source.6781: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4 Source.6782: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.6783: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.6784: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.6785: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2 Source.6786: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14 Source.6787: DFBPPR20679 ---- Animal proteins ---- Ragulator complex protein LAMTOR4 Source.6788: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.6789: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.6790: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.6791: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial Source.6792: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial Source.6793: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11 Source.6794: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.6795: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.6796: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.6797: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.6798: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2 Source.6799: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.6800: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.6801: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like Source.6802: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.6803: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial Source.6804: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A Source.6805: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.6806: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase Source.6807: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase Source.6808: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21 Source.6809: DFBPPR20721 ---- Animal proteins ---- Myomesin-1 Source.6810: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.6811: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.6812: DFBPPR20728 ---- Animal proteins ---- Serine protease 45 Source.6813: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6 Source.6814: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2 Source.6815: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.6816: DFBPPR20736 ---- Animal proteins ---- Osteopontin-K Source.6817: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.6818: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial Source.6819: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.6820: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5 Source.6821: DFBPPR20743 ---- Animal proteins ---- Myozenin-1 Source.6822: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.6823: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B Source.6824: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1 Source.6825: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog Source.6826: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33 Source.6827: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.6828: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7 Source.6829: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B Source.6830: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9 Source.6831: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.6832: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2 Source.6833: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin Source.6834: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein Source.6835: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.6836: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.6837: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15 Source.6838: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.6839: DFBPPR20780 ---- Animal proteins ---- Retinol-binding protein 5 Source.6840: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1 Source.6841: DFBPPR20786 ---- Animal proteins ---- 40S ribosomal protein S27 Source.6842: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.6843: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6 Source.6844: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1 Source.6845: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.6846: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171 Source.6847: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.6848: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.6849: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2 Source.6850: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13 Source.6851: DFBPPR20809 ---- Animal proteins ---- F-box and leucine-rich protein 22 Source.6852: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148 Source.6853: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14 Source.6854: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.6855: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1 Source.6856: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3 Source.6857: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT Source.6858: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2 Source.6859: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.6860: DFBPPR20821 ---- Animal proteins ---- Prefoldin subunit 4 Source.6861: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.6862: DFBPPR20824 ---- Animal proteins ---- CD151 antigen Source.6863: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial Source.6864: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.6865: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog Source.6866: DFBPPR20832 ---- Animal proteins ---- Metalloproteinase inhibitor 4 Source.6867: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2 Source.6868: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12 Source.6869: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.6870: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.6871: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2 Source.6872: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.6873: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1 Source.6874: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.6875: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.6876: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.6877: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.6878: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.6879: DFBPPR20853 ---- Animal proteins ---- Hemopexin Source.6880: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase Source.6881: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.6882: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta Source.6883: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2 Source.6884: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.6885: DFBPPR20871 ---- Animal proteins ---- Iron-sulfur cluster assembly 2 homolog, mitochondrial Source.6886: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C Source.6887: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.6888: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2 Source.6889: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.6890: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B Source.6891: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237 Source.6892: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3 Source.6893: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta Source.6894: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3 Source.6895: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.6896: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1 Source.6897: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.6898: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.6899: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B Source.6900: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna Source.6901: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a Source.6902: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3 Source.6903: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.6904: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor Source.6905: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27 Source.6906: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator Source.6907: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2 Source.6908: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.6909: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.6910: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.6911: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.6912: DFBPPR20919 ---- Animal proteins ---- Protein cornichon homolog 4 Source.6913: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.6914: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1 Source.6915: DFBPPR20922 ---- Animal proteins ---- Calcipressin-2 Source.6916: DFBPPR20923 ---- Animal proteins ---- Cystatin-A Source.6917: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta Source.6918: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8 Source.6919: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1 Source.6920: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial Source.6921: DFBPPR20930 ---- Animal proteins ---- Centromere protein U Source.6922: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14 Source.6923: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A Source.6924: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18 Source.6925: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25 Source.6926: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4 Source.6927: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.6928: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1 Source.6929: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.6930: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.6931: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1 Source.6932: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2 Source.6933: DFBPPR20950 ---- Animal proteins ---- WAP four-disulfide core domain protein 18 Source.6934: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1 Source.6935: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial Source.6936: DFBPPR20953 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.6937: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.6938: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.6939: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17 Source.6940: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog Source.6941: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.6942: DFBPPR20964 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP2 Source.6943: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein Source.6944: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.6945: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1 Source.6946: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3 Source.6947: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.6948: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit Source.6949: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.6950: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.6951: DFBPPR20982 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.6952: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.6953: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.6954: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1 Source.6955: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7 Source.6956: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27 Source.6957: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.6958: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181 Source.6959: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821 Source.6960: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2 Source.6961: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha Source.6962: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.6963: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.6964: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase Source.6965: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2 Source.6966: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.6967: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.6968: DFBPPR21014 ---- Animal proteins ---- Transmembrane protein 258 Source.6969: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A Source.6970: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.6971: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.6972: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21 Source.6973: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5 Source.6974: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein Source.6975: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.6976: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein Source.6977: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B Source.6978: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C Source.6979: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.6980: DFBPPR21034 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 25 Source.6981: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial Source.6982: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.6983: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.6984: DFBPPR21040 ---- Animal proteins ---- Neuritin Source.6985: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.6986: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.6987: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10 Source.6988: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.6989: DFBPPR21051 ---- Animal proteins ---- SH2 domain-containing protein 1A Source.6990: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D Source.6991: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.6992: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.6993: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B Source.6994: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2 Source.6995: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.6996: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.6997: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.6998: DFBPPR21066 ---- Animal proteins ---- 40S ribosomal protein S27-like Source.6999: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.7000: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog Source.7001: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.7002: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial Source.7003: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.7004: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A Source.7005: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22 Source.7006: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7 Source.7007: DFBPPR21083 ---- Animal proteins ---- TRAF-interacting protein with FHA domain-containing protein A Source.7008: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.7009: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.7010: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43 Source.7011: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.7012: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.7013: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148 Source.7014: DFBPPR21100 ---- Animal proteins ---- Cochlin Source.7015: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.7016: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase Source.7017: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2 Source.7018: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3 Source.7019: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.7020: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7 Source.7021: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16 Source.7022: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein Source.7023: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5 Source.7024: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3 Source.7025: DFBPPR21122 ---- Animal proteins ---- Derlin-3 Source.7026: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor Source.7027: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial Source.7028: DFBPPR21128 ---- Animal proteins ---- Stefin-C Source.7029: DFBPPR21130 ---- Animal proteins ---- Transmembrane protein 17 Source.7030: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.7031: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B Source.7032: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.7033: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.7034: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.7035: DFBPPR21144 ---- Animal proteins ---- Repressor of RNA polymerase III transcription MAF1 homolog Source.7036: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.7037: DFBPPR21149 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 4 Source.7038: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.7039: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350 Source.7040: DFBPPR21152 ---- Animal proteins ---- Protein S100-A2 Source.7041: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel Source.7042: DFBPPR21155 ---- Animal proteins ---- Cyclin-H Source.7043: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1 Source.7044: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.7045: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4 Source.7046: DFBPPR21160 ---- Animal proteins ---- Prefoldin subunit 3 Source.7047: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6 Source.7048: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22 Source.7049: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1 Source.7050: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.7051: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A Source.7052: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial Source.7053: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52 Source.7054: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase Source.7055: DFBPPR21177 ---- Animal proteins ---- Ran guanine nucleotide release factor Source.7056: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5 Source.7057: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7 Source.7058: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173 Source.7059: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2 Source.7060: DFBPPR21187 ---- Animal proteins ---- Plasmolipin Source.7061: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.7062: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.7063: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.7064: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin Source.7065: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.7066: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.7067: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2 Source.7068: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.7069: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog Source.7070: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.7071: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1 Source.7072: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.7073: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2 Source.7074: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.7075: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1 Source.7076: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.7077: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4 Source.7078: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.7079: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.7080: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein Source.7081: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2 Source.7082: DFBPPR21239 ---- Animal proteins ---- Coordinator of PRMT5 and differentiation stimulator Source.7083: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase Source.7084: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1 Source.7085: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36 Source.7086: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal Source.7087: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial Source.7088: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3 Source.7089: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3 Source.7090: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8 Source.7091: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7 Source.7092: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.7093: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6 Source.7094: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B Source.7095: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.7096: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.7097: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4 Source.7098: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21 Source.7099: DFBPPR21272 ---- Animal proteins ---- Testin Source.7100: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4 Source.7101: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.7102: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11 Source.7103: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.7104: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen Source.7105: DFBPPR21290 ---- Animal proteins ---- Metaxin-1 Source.7106: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b Source.7107: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial Source.7108: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.7109: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3 Source.7110: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.7111: DFBPPR21302 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC9 Source.7112: DFBPPR21303 ---- Animal proteins ---- Palmdelphin Source.7113: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial Source.7114: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.7115: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18 Source.7116: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.7117: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein Source.7118: DFBPPR21322 ---- Animal proteins ---- Zinc finger protein 227 Source.7119: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34 Source.7120: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3 Source.7121: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.7122: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3 Source.7123: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.7124: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9 Source.7125: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.7126: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein Source.7127: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.7128: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein Source.7129: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.7130: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.7131: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3 Source.7132: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform Source.7133: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1 Source.7134: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.7135: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4 Source.7136: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.7137: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24 Source.7138: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18 Source.7139: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1 Source.7140: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog Source.7141: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.7142: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420 Source.7143: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2 Source.7144: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2 Source.7145: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4 Source.7146: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.7147: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.7148: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.7149: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4 Source.7150: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.7151: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3 Source.7152: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.7153: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1 Source.7154: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.7155: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.7156: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A Source.7157: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2 Source.7158: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1 Source.7159: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.7160: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog Source.7161: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.7162: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.7163: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like Source.7164: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.7165: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2 Source.7166: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.7167: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.7168: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.7169: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.7170: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84 Source.7171: DFBPPR21425 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 A Source.7172: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1 Source.7173: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.7174: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A Source.7175: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B Source.7176: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.7177: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207 Source.7178: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8 Source.7179: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A Source.7180: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2 Source.7181: DFBPPR21451 ---- Animal proteins ---- Nurim Source.7182: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330 Source.7183: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.7184: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2 Source.7185: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein Source.7186: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.7187: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.7188: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.7189: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.7190: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.7191: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.7192: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9 Source.7193: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial Source.7194: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8 Source.7195: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.7196: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2 Source.7197: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1 Source.7198: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14 Source.7199: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial Source.7200: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.7201: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2 Source.7202: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.7203: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like Source.7204: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.7205: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1 Source.7206: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3 Source.7207: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40 Source.7208: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3 Source.7209: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.7210: DFBPPR21509 ---- Animal proteins ---- Myoneurin Source.7211: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.7212: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B Source.7213: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2 Source.7214: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1 Source.7215: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20 Source.7216: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2 Source.7217: DFBPPR21521 ---- Animal proteins ---- Active regulator of SIRT1 Source.7218: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1 Source.7219: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2 Source.7220: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11 Source.7221: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.7222: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225 Source.7223: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19 Source.7224: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.7225: DFBPPR21538 ---- Animal proteins ---- Small cell adhesion glycoprotein Source.7226: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.7227: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A Source.7228: DFBPPR21542 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6c Source.7229: DFBPPR21545 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1 Source.7230: DFBPPR21547 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.7231: DFBPPR21549 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit Y Source.7232: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22 Source.7233: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4 Source.7234: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.7235: DFBPPR21555 ---- Animal proteins ---- Zinc finger and SCAN domain-containing protein 26 Source.7236: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55 Source.7237: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6 Source.7238: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.7239: DFBPPR21564 ---- Animal proteins ---- HORMA domain-containing protein 2 Source.7240: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.7241: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.7242: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B Source.7243: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2 Source.7244: DFBPPR21574 ---- Animal proteins ---- Parvalbumin alpha Source.7245: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein Source.7246: DFBPPR21582 ---- Animal proteins ---- MORN repeat-containing protein 4 Source.7247: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2 Source.7248: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19 Source.7249: DFBPPR21586 ---- Animal proteins ---- Cyclin-C Source.7250: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.7251: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.7252: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.7253: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.7254: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like Source.7255: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.7256: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.7257: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3 Source.7258: DFBPPR21599 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.7259: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.7260: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138 Source.7261: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1 Source.7262: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.7263: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.7264: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.7265: DFBPPR21617 ---- Animal proteins ---- Proteasome assembly chaperone 3 Source.7266: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2 Source.7267: DFBPPR21620 ---- Animal proteins ---- Claudin-12 Source.7268: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a Source.7269: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1 Source.7270: DFBPPR21625 ---- Animal proteins ---- 40S ribosomal protein S24 Source.7271: DFBPPR21629 ---- Animal proteins ---- Annexin A3 Source.7272: DFBPPR21630 ---- Animal proteins ---- Maspardin Source.7273: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14 Source.7274: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta Source.7275: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19 Source.7276: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial Source.7277: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44 Source.7278: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6 Source.7279: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1 Source.7280: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.7281: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein Source.7282: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6 Source.7283: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.7284: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial Source.7285: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8 Source.7286: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2 Source.7287: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1 Source.7288: DFBPPR21663 ---- Animal proteins ---- Trafficking protein particle complex subunit 6B Source.7289: DFBPPR21664 ---- Animal proteins ---- Signal recognition particle 14 kDa protein Source.7290: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.7291: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.7292: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10 Source.7293: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4 Source.7294: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A Source.7295: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.7296: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26 Source.7297: DFBPPR21682 ---- Animal proteins ---- Protein SYS1 homolog Source.7298: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like Source.7299: DFBPPR21686 ---- Animal proteins ---- FXYD domain-containing ion transport regulator 6 Source.7300: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2 Source.7301: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18 Source.7302: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1 Source.7303: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.7304: DFBPPR21698 ---- Animal proteins ---- Alpha-hemoglobin-stabilizing protein Source.7305: DFBPPR21699 ---- Animal proteins ---- Transmembrane protein 208 Source.7306: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B Source.7307: DFBPPR21706 ---- Animal proteins ---- Small membrane A-kinase anchor protein Source.7308: DFBPPR21708 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial Source.7309: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog Source.7310: DFBPPR21712 ---- Animal proteins ---- Serpin E3 Source.7311: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.7312: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic Source.7313: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.7314: DFBPPR21719 ---- Animal proteins ---- Protein reprimo Source.7315: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.7316: DFBPPR21723 ---- Animal proteins ---- OCIA domain-containing protein 1 Source.7317: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.7318: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.7319: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial Source.7320: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2 Source.7321: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1 Source.7322: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.7323: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1 Source.7324: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A Source.7325: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15 Source.7326: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog Source.7327: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.7328: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.7329: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.7330: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta Source.7331: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog Source.7332: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10 Source.7333: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.7334: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.7335: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.7336: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.7337: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6 Source.7338: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.7339: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.7340: DFBPPR21771 ---- Animal proteins ---- RAD9, HUS1, RAD1-interacting nuclear orphan protein 1 Source.7341: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.7342: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog Source.7343: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B Source.7344: DFBPPR21777 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 10 Source.7345: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.7346: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.7347: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog Source.7348: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2 Source.7349: DFBPPR21789 ---- Animal proteins ---- Protein kish-B Source.7350: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.7351: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.7352: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial Source.7353: DFBPPR21793 ---- Animal proteins ---- Dynein light chain Tctex-type protein 2B Source.7354: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like Source.7355: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.7356: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.7357: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B Source.7358: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.7359: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein Source.7360: DFBPPR21805 ---- Animal proteins ---- 60S ribosomal protein L19 Source.7361: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1 Source.7362: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.7363: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.7364: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.7365: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog Source.7366: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.7367: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2 Source.7368: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24 Source.7369: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410 Source.7370: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11 Source.7371: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.7372: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526 Source.7373: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1 Source.7374: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1 Source.7375: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier Source.7376: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2 Source.7377: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein Source.7378: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein Source.7379: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.7380: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B Source.7381: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.7382: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1 Source.7383: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2 Source.7384: DFBPPR21846 ---- Animal proteins ---- Izumo sperm-egg fusion protein 3 Source.7385: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.7386: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.7387: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B Source.7388: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS Source.7389: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3 Source.7390: DFBPPR21869 ---- Animal proteins ---- Centromere protein O Source.7391: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.7392: DFBPPR21871 ---- Animal proteins ---- Serpin B10 Source.7393: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein Source.7394: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113 Source.7395: DFBPPR21876 ---- Animal proteins ---- IgA-inducing protein Source.7396: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B Source.7397: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.7398: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1 Source.7399: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial Source.7400: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39 Source.7401: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.7402: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1 Source.7403: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor Source.7404: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6 Source.7405: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial Source.7406: DFBPPR21892 ---- Animal proteins ---- COMM domain-containing protein 9 Source.7407: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5 Source.7408: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3 Source.7409: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.7410: DFBPPR21902 ---- Animal proteins ---- Centromere protein N Source.7411: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35 Source.7412: DFBPPR21905 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 2 Source.7413: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.7414: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2 Source.7415: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11 Source.7416: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog Source.7417: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1 Source.7418: DFBPPR21912 ---- Animal proteins ---- Death-associated protein 1 Source.7419: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2 Source.7420: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13 Source.7421: DFBPPR21915 ---- Animal proteins ---- Tetraspanin-13 Source.7422: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6 Source.7423: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2 Source.7424: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12 Source.7425: DFBPPR21920 ---- Animal proteins ---- Protein DPCD Source.7426: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4 Source.7427: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog Source.7428: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14 Source.7429: DFBPPR21927 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase-interacting protein Source.7430: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.7431: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11 Source.7432: DFBPPR21935 ---- Animal proteins ---- Sentan Source.7433: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.7434: DFBPPR21938 ---- Animal proteins ---- Protein RER1 Source.7435: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.7436: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.7437: DFBPPR21941 ---- Animal proteins ---- MOB kinase activator 3A Source.7438: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.7439: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.7440: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.7441: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414 Source.7442: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.7443: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.7444: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1 Source.7445: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3 Source.7446: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.7447: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15 Source.7448: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.7449: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.7450: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial Source.7451: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1 Source.7452: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1 Source.7453: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.7454: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101 Source.7455: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog Source.7456: DFBPPR21977 ---- Animal proteins ---- Protein ARV1 Source.7457: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.7458: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.7459: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.7460: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like Source.7461: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.7462: DFBPPR21994 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial Source.7463: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2 Source.7464: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1 Source.7465: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1 Source.7466: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3 Source.7467: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.7468: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.7469: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81 Source.7470: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.7471: DFBPPR22012 ---- Animal proteins ---- GRB2-related adapter protein Source.7472: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3 Source.7473: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.7474: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2 Source.7475: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial Source.7476: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1 Source.7477: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2 Source.7478: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4 Source.7479: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1 Source.7480: DFBPPR22031 ---- Animal proteins ---- KxDL motif-containing protein 1 Source.7481: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.7482: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.7483: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3 Source.7484: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12 Source.7485: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C Source.7486: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37 Source.7487: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B Source.7488: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.7489: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.7490: DFBPPR22048 ---- Animal proteins ---- Regulated endocrine-specific protein 18 Source.7491: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ Source.7492: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B Source.7493: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3 Source.7494: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.7495: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A Source.7496: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.7497: DFBPPR22068 ---- Animal proteins ---- Protein GPR108 Source.7498: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.7499: DFBPPR22070 ---- Animal proteins ---- Maturin Source.7500: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B Source.7501: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8 Source.7502: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6 Source.7503: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4 Source.7504: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.7505: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.7506: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1 Source.7507: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7 Source.7508: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor Source.7509: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3 Source.7510: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.7511: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41 Source.7512: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B Source.7513: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog Source.7514: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2 Source.7515: DFBPPR22099 ---- Animal proteins ---- Beta-centractin Source.7516: DFBPPR22100 ---- Animal proteins ---- Centromere protein M Source.7517: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.7518: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2 Source.7519: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1 Source.7520: DFBPPR22105 ---- Animal proteins ---- Centromere protein L Source.7521: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2 Source.7522: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1 Source.7523: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1 Source.7524: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.7525: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain Source.7526: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4 Source.7527: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.7528: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog Source.7529: DFBPPR22125 ---- Animal proteins ---- 40S ribosomal protein S16 Source.7530: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11 Source.7531: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.7532: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.7533: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2 Source.7534: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a Source.7535: DFBPPR22133 ---- Animal proteins ---- MOB kinase activator 3C Source.7536: DFBPPR22134 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8 Source.7537: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.7538: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1 Source.7539: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2 Source.7540: DFBPPR22141 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1 Source.7541: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1 Source.7542: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.7543: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.7544: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.7545: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.7546: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog Source.7547: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1 Source.7548: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24 Source.7549: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.7550: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2 Source.7551: DFBPPR22164 ---- Animal proteins ---- Complex III assembly factor LYRM7 Source.7552: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143 Source.7553: DFBPPR22170 ---- Animal proteins ---- Transmembrane protein 106C Source.7554: DFBPPR22173 ---- Animal proteins ---- Electron transfer flavoprotein regulatory factor 1 Source.7555: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.7556: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.7557: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.7558: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.7559: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8 Source.7560: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2 Source.7561: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.7562: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5 Source.7563: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5 Source.7564: DFBPPR22193 ---- Animal proteins ---- CapZ-interacting protein Source.7565: DFBPPR22194 ---- Animal proteins ---- Cystatin-9 Source.7566: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2 Source.7567: DFBPPR22196 ---- Animal proteins ---- Bladder cancer-associated protein Source.7568: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.7569: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.7570: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4 Source.7571: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein Source.7572: DFBPPR22213 ---- Animal proteins ---- Protein TEX261 Source.7573: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.7574: DFBPPR22218 ---- Animal proteins ---- Galectin-4 Source.7575: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.7576: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.7577: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9 Source.7578: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8 Source.7579: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36 Source.7580: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22 Source.7581: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.7582: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.7583: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300 Source.7584: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.7585: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.7586: DFBPPR22239 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.7587: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.7588: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.7589: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3 Source.7590: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26 Source.7591: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.7592: DFBPPR22249 ---- Animal proteins ---- CXXC motif containing zinc binding protein Source.7593: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1 Source.7594: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.7595: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34 Source.7596: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.7597: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18 Source.7598: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog Source.7599: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog Source.7600: DFBPPR22266 ---- Animal proteins ---- Vexin Source.7601: DFBPPR22267 ---- Animal proteins ---- Keratin-associated protein 12-2 Source.7602: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1 Source.7603: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial Source.7604: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.7605: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.7606: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2 Source.7607: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1 Source.7608: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial Source.7609: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2 Source.7610: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31 Source.7611: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein Source.7612: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.7613: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.7614: DFBPPR22309 ---- Animal proteins ---- Spermatogenesis-associated protein 9 Source.7615: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1 Source.7616: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218 Source.7617: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35 Source.7618: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.7619: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70 Source.7620: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7 Source.7621: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39 Source.7622: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.7623: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3 Source.7624: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.7625: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1 Source.7626: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.7627: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1 Source.7628: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.7629: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A Source.7630: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2 Source.7631: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog Source.7632: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11 Source.7633: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80 Source.7634: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.7635: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6 Source.7636: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein Source.7637: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.7638: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.7639: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.7640: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.7641: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein Source.7642: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23 Source.7643: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2 Source.7644: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1 Source.7645: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4 Source.7646: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.7647: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92 Source.7648: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like Source.7649: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein Source.7650: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1 Source.7651: DFBPPR22379 ---- Animal proteins ---- Ribosomal biogenesis factor Source.7652: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39 Source.7653: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B Source.7654: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1 Source.7655: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.7656: DFBPPR22391 ---- Animal proteins ---- Transmembrane protein 88B Source.7657: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2 Source.7658: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein Source.7659: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog Source.7660: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.7661: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1 Source.7662: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9 Source.7663: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.7664: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5 Source.7665: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.7666: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.7667: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1 Source.7668: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.7669: DFBPPR22424 ---- Animal proteins ---- Transmembrane protein 243 Source.7670: DFBPPR22426 ---- Animal proteins ---- Single-pass membrane and coiled-coil domain-containing protein 4 Source.7671: DFBPPR22427 ---- Animal proteins ---- Coiled-coil domain-containing protein 58 Source.7672: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.7673: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog Source.7674: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein Source.7675: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3 Source.7676: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1 Source.7677: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein Source.7678: DFBPPR22446 ---- Animal proteins ---- Tektin-5 Source.7679: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.7680: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9 Source.7681: DFBPPR22452 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 37 Source.7682: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2 Source.7683: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97 Source.7684: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein Source.7685: DFBPPR22459 ---- Animal proteins ---- SCP2 sterol-binding domain-containing protein 1 Source.7686: DFBPPR22461 ---- Animal proteins ---- Ashwin Source.7687: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13 Source.7688: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein Source.7689: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.7690: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog Source.7691: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.7692: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3 Source.7693: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1 Source.7694: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144 Source.7695: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223 Source.7696: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3 Source.7697: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.7698: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog Source.7699: DFBPPR22491 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1B Source.7700: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1 Source.7701: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.7702: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1 Source.7703: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1 Source.7704: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.7705: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog Source.7706: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46 Source.7707: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.7708: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2 Source.7709: DFBPPR22505 ---- Animal proteins ---- Protein HP-20 homolog Source.7710: DFBPPR22507 ---- Animal proteins ---- Secernin-3 Source.7711: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101 Source.7712: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2 Source.7713: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15 Source.7714: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248 Source.7715: DFBPPR22522 ---- Animal proteins ---- Coiled-coil domain-containing protein 126 Source.7716: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54 Source.7717: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8 Source.7718: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29 Source.7719: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169 Source.7720: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251 Source.7721: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9 Source.7722: DFBPPR22536 ---- Animal proteins ---- Suprabasin Source.7723: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.7724: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.7725: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25 Source.7726: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.7727: DFBPPR22544 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 2 Source.7728: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1 Source.7729: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.7730: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2 Source.7731: DFBPPR22556 ---- Animal proteins ---- Protein maestro Source.7732: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1 Source.7733: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187 Source.7734: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein Source.7735: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein Source.7736: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5 Source.7737: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein Source.7738: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1 Source.7739: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.7740: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.7741: DFBPPR22576 ---- Animal proteins ---- UPF0547 protein C16orf87 homolog Source.7742: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1 Source.7743: DFBPPR22585 ---- Animal proteins ---- UPF0449 protein C19orf25 homolog Source.7744: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.7745: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19 Source.7746: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268 Source.7747: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.7748: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.7749: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.7750: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.7751: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53 Source.7752: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36 Source.7753: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.7754: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215 Source.7755: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105 Source.7756: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71 Source.7757: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54 Source.7758: DFBPPR22618 ---- Animal proteins ---- BSD domain-containing protein 1 Source.7759: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42 Source.7760: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72 Source.7761: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1 Source.7762: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61 Source.7763: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30 Source.7764: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175 Source.7765: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157 Source.7766: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog Source.7767: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1 Source.7768: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32 Source.7769: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.7770: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog Source.7771: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog Source.7772: DFBPPR22671 ---- Animal proteins ---- Uncharacterized protein C1orf185 homolog Source.7773: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89 Source.7774: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog Source.7775: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.7776: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3 Source.7777: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.7778: DFBPPR22693 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1 Source.7779: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein Source.7780: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A Source.7781: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28 Source.7782: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.7783: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16 Source.7784: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D Source.7785: DFBPPR22713 ---- Animal proteins ---- UPF0728 protein C10orf53 homolog Source.7786: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein Source.7787: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog Source.7788: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog Source.7789: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog Source.7790: DFBPPR22729 ---- Animal proteins ---- UPF0538 protein C2orf76 homolog Source.7791: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1 Source.7792: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1 Source.7793: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog Source.7794: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein Source.7795: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog Source.7796: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog Source.7797: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog Source.7798: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog Source.7799: DFBPPR22751 ---- Animal proteins ---- Uncharacterized protein C8orf74 homolog Source.7800: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog Source.7801: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog Source.7802: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog Source.7803: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog Source.7804: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6 Source.7805: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.7806: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.7807: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.7808: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.7809: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.7810: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.7811: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.7812: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.7813: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.7814: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.7815: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.7816: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.7817: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.7818: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase Source.7819: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.7820: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.7821: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.7822: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.7823: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.7824: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.7825: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.7826: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.7827: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.7828: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.7829: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.7830: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.7831: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.7832: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.7833: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.7834: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.7835: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1 Source.7836: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.7837: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.7838: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.7839: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1 Source.7840: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.7841: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.7842: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.7843: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.7844: DFBPPR8592 ---- Animal proteins ---- Interleukin-18 Source.7845: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.7846: DFBPPR8595 ---- Animal proteins ---- Annexin A4 Source.7847: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.7848: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.7849: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.7850: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.7851: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein Source.7852: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.7853: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.7854: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.7855: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6 Source.7856: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.7857: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase Source.7858: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.7859: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.7860: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.7861: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.7862: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.7863: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1 Source.7864: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.7865: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.7866: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1 Source.7867: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.7868: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.7869: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C Source.7870: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.7871: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.7872: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.7873: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase Source.7874: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2 Source.7875: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.7876: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.7877: DFBPPR8647 ---- Animal proteins ---- Beclin-1 Source.7878: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.7879: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.7880: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.7881: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.7882: DFBPPR8655 ---- Animal proteins ---- Azurocidin Source.7883: DFBPPR8657 ---- Animal proteins ---- Annexin A2 Source.7884: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog Source.7885: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.7886: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.7887: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.7888: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.7889: DFBPPR8668 ---- Animal proteins ---- Annexin A1 Source.7890: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.7891: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.7892: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.7893: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.7894: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.7895: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.7896: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog Source.7897: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.7898: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.7899: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.7900: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.7901: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.7902: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor Source.7903: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.7904: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.7905: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.7906: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1 Source.7907: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.7908: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.7909: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.7910: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.7911: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein Source.7912: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.7913: DFBPPR8707 ---- Animal proteins ---- Flotillin-1 Source.7914: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.7915: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.7916: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.7917: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.7918: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.7919: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.7920: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6 Source.7921: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.7922: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.7923: DFBPPR8720 ---- Animal proteins ---- Interleukin-4 Source.7924: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.7925: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.7926: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.7927: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1 Source.7928: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.7929: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase Source.7930: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A Source.7931: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.7932: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H Source.7933: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.7934: DFBPPR8738 ---- Animal proteins ---- Interleukin-8 Source.7935: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.7936: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.7937: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.7938: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9 Source.7939: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1 Source.7940: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.7941: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.7942: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.7943: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.7944: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.7945: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.7946: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.7947: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.7948: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin Source.7949: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein Source.7950: DFBPPR8758 ---- Animal proteins ---- Caveolin-2 Source.7951: DFBPPR8759 ---- Animal proteins ---- Caveolin-3 Source.7952: DFBPPR8760 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.7953: DFBPPR8761 ---- Animal proteins ---- VIP peptides Source.7954: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.7955: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.7956: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.7957: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.7958: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.7959: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.7960: DFBPPR8771 ---- Animal proteins ---- Cofilin-1 Source.7961: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.7962: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.7963: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.7964: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.7965: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.7966: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.7967: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.7968: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.7969: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.7970: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain Source.7971: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.7972: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.7973: DFBPPR8787 ---- Animal proteins ---- Cathepsin D Source.7974: DFBPPR8788 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.7975: DFBPPR8789 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.7976: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain Source.7977: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.7978: DFBPPR8793 ---- Animal proteins ---- Histone H4 Source.7979: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.7980: DFBPPR8796 ---- Animal proteins ---- UMP-CMP kinase Source.7981: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.7982: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.7983: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase Source.7984: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II Source.7985: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase Source.7986: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.7987: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.7988: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S Source.7989: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.7990: DFBPPR8810 ---- Animal proteins ---- Follistatin Source.7991: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.7992: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.7993: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.7994: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.7995: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.7996: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.7997: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.7998: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.7999: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2 Source.8000: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.8001: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.8002: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.8003: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1 Source.8004: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance Source.8005: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.8006: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4 Source.8007: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase Source.8008: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1 Source.8009: DFBPPR8843 ---- Animal proteins ---- Pepsin A Source.8010: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.8011: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.8012: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.8013: DFBPPR8848 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase Source.8014: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.8015: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog Source.8016: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide Source.8017: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.8018: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2 Source.8019: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.8020: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.8021: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8022: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8023: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8024: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.8025: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.8026: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B Source.8027: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.8028: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.8029: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.8030: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.8031: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.8032: DFBPPR8906 ---- Animal proteins ---- Sialidase-1 Source.8033: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.8034: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.8035: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.8036: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.8037: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.8038: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.8039: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.8040: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.8041: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.8042: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.8043: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha Source.8044: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha Source.8045: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.8046: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha Source.8047: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.8048: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.8049: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.8050: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.8051: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.8052: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.8053: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.8054: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.8055: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.8056: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta Source.8057: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.8058: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3 Source.8059: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain Source.8060: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain Source.8061: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component Source.8062: DFBPPR9005 ---- Animal proteins ---- Protein amnionless Source.8063: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.8064: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.8065: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.8066: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.8067: DFBPPR9015 ---- Animal proteins ---- Serotransferrin Source.8068: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.8069: DFBPPR9018 ---- Animal proteins ---- Transthyretin Source.8070: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.8071: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.8072: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.8073: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.8074: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.8075: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.8076: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.8077: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.8078: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.8079: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.8080: DFBPPR9039 ---- Animal proteins ---- Desmin Source.8081: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.8082: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.8083: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.8084: DFBPPR9044 ---- Animal proteins ---- Albumin Source.8085: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3 Source.8086: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.8087: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.8088: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4 Source.8089: DFBPPR9052 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B Source.8090: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf Source.8091: DFBPPR9061 ---- Animal proteins ---- Caspase-1 Source.8092: DFBPPR9065 ---- Animal proteins ---- GTPase NRas Source.8093: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1 Source.8094: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.8095: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.8096: DFBPPR9069 ---- Animal proteins ---- E-selectin Source.8097: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.8098: DFBPPR9072 ---- Animal proteins ---- CD9 antigen Source.8099: DFBPPR9073 ---- Animal proteins ---- Vitronectin Source.8100: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.8101: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.8102: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.8103: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.8104: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.8105: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.8106: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.8107: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.8108: DFBPPR9093 ---- Animal proteins ---- Hemopexin Source.8109: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5 Source.8110: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.8111: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1 Source.8112: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32 Source.8113: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.8114: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.8115: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.8116: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.8117: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.8118: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.8119: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.8120: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.8121: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1 Source.8122: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.8123: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6 Source.8124: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.8125: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.8126: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6 Source.8127: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.8128: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.8129: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42 Source.8130: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.8131: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.8132: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.8133: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.8134: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1 Source.8135: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.8136: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.8137: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.8138: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1 Source.8139: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II Source.8140: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.8141: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.8142: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.8143: DFBPPR9149 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1 Source.8144: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.8145: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.8146: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.8147: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.8148: DFBPPR9159 ---- Animal proteins ---- Hematopoietic cell signal transducer Source.8149: DFBPPR9160 ---- Animal proteins ---- Acylphosphatase-1 Source.8150: DFBPPR9162 ---- Animal proteins ---- Thioredoxin Source.8151: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.8152: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.8153: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.8154: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.8155: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase Source.8156: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.8157: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.8158: DFBPPR9174 ---- Animal proteins ---- Ficolin-1 Source.8159: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3 Source.8160: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6 Source.8161: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.8162: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.8163: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.8164: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.8165: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.8166: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10 Source.8167: DFBPPR9188 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain Source.8168: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2 Source.8169: DFBPPR9192 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase Source.8170: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein Source.8171: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.8172: DFBPPR9199 ---- Animal proteins ---- 60S ribosomal protein L23 Source.8173: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.8174: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.8175: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.8176: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.8177: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein Source.8178: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1 Source.8179: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.8180: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase Source.8181: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.8182: DFBPPR9218 ---- Animal proteins ---- POU domain, class 3, transcription factor 3 Source.8183: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.8184: DFBPPR9221 ---- Animal proteins ---- Catalase Source.8185: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.8186: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.8187: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.8188: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1 Source.8189: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.8190: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C Source.8191: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.8192: DFBPPR9236 ---- Animal proteins ---- Radixin Source.8193: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.8194: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B Source.8195: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29 Source.8196: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.8197: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.8198: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1 Source.8199: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor Source.8200: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.8201: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.8202: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.8203: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase Source.8204: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.8205: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.8206: DFBPPR9265 ---- Animal proteins ---- Pantetheinase Source.8207: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.8208: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase Source.8209: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent Source.8210: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.8211: DFBPPR9272 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.8212: DFBPPR9273 ---- Animal proteins ---- C-C motif chemokine 4 Source.8213: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase Source.8214: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type Source.8215: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.8216: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.8217: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.8218: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.8219: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.8220: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.8221: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27 Source.8222: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.8223: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.8224: DFBPPR9293 ---- Animal proteins ---- Calcium load-activated calcium channel Source.8225: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2 Source.8226: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1 Source.8227: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4 Source.8228: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.8229: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2 Source.8230: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.8231: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.8232: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.8233: DFBPPR9308 ---- Animal proteins ---- Aromatase 3 Source.8234: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.8235: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.8236: DFBPPR9311 ---- Animal proteins ---- Beta-defensin 1 Source.8237: DFBPPR9320 ---- Animal proteins ---- Aromatase 1 Source.8238: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.8239: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.8240: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha Source.8241: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1 Source.8242: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.8243: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.8244: DFBPPR9328 ---- Animal proteins ---- Cofilin-2 Source.8245: DFBPPR9329 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2 Source.8246: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor Source.8247: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.8248: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.8249: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.8250: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.8251: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.8252: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.8253: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin Source.8254: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.8255: DFBPPR9345 ---- Animal proteins ---- Relaxin-3 Source.8256: DFBPPR9346 ---- Animal proteins ---- Myozenin-1 Source.8257: DFBPPR9347 ---- Animal proteins ---- C-reactive protein Source.8258: DFBPPR9348 ---- Animal proteins ---- 60S ribosomal protein L18 Source.8259: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor Source.8260: DFBPPR9356 ---- Animal proteins ---- Odorant-binding protein Source.8261: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.8262: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.8263: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.8264: DFBPPR9363 ---- Animal proteins ---- Moesin Source.8265: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.8266: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.8267: DFBPPR9366 ---- Animal proteins ---- Decorin Source.8268: DFBPPR9368 ---- Animal proteins ---- Myosin-11 Source.8269: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.8270: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.8271: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.8272: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.8273: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor Source.8274: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.8275: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.8276: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.8277: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon Source.8278: DFBPPR9385 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.8279: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.8280: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11 Source.8281: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.8282: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.8283: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.8284: DFBPPR9395 ---- Animal proteins ---- Calponin-2 Source.8285: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b Source.8286: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.8287: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1 Source.8288: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.8289: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34 Source.8290: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.8291: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type Source.8292: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type Source.8293: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase Source.8294: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase Source.8295: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase Source.8296: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.8297: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.8298: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.8299: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin Source.8300: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.8301: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.8302: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor Source.8303: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.8304: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.8305: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.8306: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.8307: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.8308: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.8309: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.8310: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.8311: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.8312: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4 Source.8313: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.8314: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.8315: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.8316: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.8317: DFBPPR9455 ---- Animal proteins ---- Cystatin-B Source.8318: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.8319: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase Source.8320: DFBPPR9459 ---- Animal proteins ---- Glutaredoxin-1 Source.8321: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.8322: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.8323: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.8324: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1 Source.8325: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type Source.8326: DFBPPR9484 ---- Animal proteins ---- Macoilin Source.8327: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.8328: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14 Source.8329: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.8330: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor Source.8331: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.8332: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.8333: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.8334: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.8335: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.8336: DFBPPR9512 ---- Animal proteins ---- Acylphosphatase-2 Source.8337: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3 Source.8338: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a Source.8339: DFBPPR9518 ---- Animal proteins ---- Interleukin-5 Source.8340: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.8341: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a Source.8342: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1 Source.8343: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.8344: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.8345: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE Source.8346: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein Source.8347: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.8348: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.8349: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.8350: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha Source.8351: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.8352: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2 Source.8353: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.8354: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3 Source.8355: DFBPPR9555 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.8356: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.8357: DFBPPR9559 ---- Animal proteins ---- CD302 antigen Source.8358: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C Source.8359: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.8360: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.8361: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3 Source.8362: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein Source.8363: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1 Source.8364: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.8365: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26 Source.8366: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.8367: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase Source.8368: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial Source.8369: DFBPPR9582 ---- Animal proteins ---- C-C motif chemokine 5 Source.8370: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.8371: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2 Source.8372: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.8373: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.8374: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor Source.8375: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.8376: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2 Source.8377: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.8378: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.8379: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.8380: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform Source.8381: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.8382: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.8383: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.8384: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.8385: DFBPPR9624 ---- Animal proteins ---- Cadherin-3 Source.8386: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.8387: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.8388: DFBPPR9628 ---- Animal proteins ---- Mineralocorticoid receptor Source.8389: DFBPPR9633 ---- Animal proteins ---- Claudin-17 Source.8390: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.8391: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561 Source.8392: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.8393: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M Source.8394: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1 Source.8395: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.8396: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1 Source.8397: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1 Source.8398: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial Source.8399: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5 Source.8400: DFBPPR9659 ---- Animal proteins ---- Placenta-expressed transcript 1 protein Source.8401: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.8402: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial Source.8403: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.8404: DFBPPR9664 ---- Animal proteins ---- Perilipin-2 Source.8405: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1 Source.8406: DFBPPR9671 ---- Animal proteins ---- S-arrestin Source.8407: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta Source.8408: DFBPPR9675 ---- Animal proteins ---- Cystatin-A5 Source.8409: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.8410: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.8411: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.8412: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1 Source.8413: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4 Source.8414: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.8415: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.8416: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.8417: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1 Source.8418: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39 Source.8419: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein Source.8420: DFBPPR9705 ---- Animal proteins ---- Elafin Source.8421: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.8422: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1 Source.8423: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27 Source.8424: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1 Source.8425: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain Source.8426: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2 Source.8427: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain Source.8428: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.8429: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.8430: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.8431: DFBPPR9728 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.8432: DFBPPR9732 ---- Animal proteins ---- Leukocyte cysteine proteinase inhibitor 1 Source.8433: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2 Source.8434: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain Source.8435: DFBPPR9736 ---- Animal proteins ---- Metaxin-1 Source.8436: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7 Source.8437: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.8438: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.8439: DFBPPR9741 ---- Animal proteins ---- Syndecan-4 Source.8440: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis Source.8441: DFBPPR9745 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.8442: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog Source.8443: DFBPPR9753 ---- Animal proteins ---- Syntaxin-binding protein 2 Source.8444: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.8445: DFBPPR9759 ---- Animal proteins ---- Palmdelphin Source.8446: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.8447: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.8448: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.8449: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.8450: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A Source.8451: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a Source.8452: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.8453: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.8454: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1 Source.8455: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15 Source.8456: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.8457: DFBPPR9793 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1 Source.8458: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.8459: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2 Source.8460: DFBPPR9803 ---- Animal proteins ---- 60S ribosomal protein L3 Source.8461: DFBPPR9805 ---- Animal proteins ---- Fatty acid-binding protein, intestinal Source.8462: DFBPPR9807 ---- Animal proteins ---- Galectin-4 Source.8463: DFBPPR9810 ---- Animal proteins ---- 40S ribosomal protein S16 Source.8464: DFBPPR9811 ---- Animal proteins ---- Protein WAP-3 Source.8465: DFBPPR9814 ---- Animal proteins ---- Testin Source.8466: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.8467: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.8468: DFBPPR9819 ---- Animal proteins ---- 40S ribosomal protein S9 Source.8469: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.8470: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6 Source.8471: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1 Source.8472: DFBPPR9827 ---- Animal proteins ---- Guanylate cyclase activator 2B Source.8473: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.8474: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.8475: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1 Source.8476: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.8477: DFBPPR9839 ---- Animal proteins ---- Nurim Source.8478: DFBPPR9843 ---- Animal proteins ---- P protein Source.8479: DFBPPR9850 ---- Animal proteins ---- Retinol-binding protein 2 Source.8480: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.8481: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.8482: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1 Source.8483: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.8484: DFBPPR9862 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.8485: DFBPPR9866 ---- Animal proteins ---- SH2 domain-containing protein 1A Source.8486: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2 Source.8487: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1 Source.8488: DFBPPR9875 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.8489: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.8490: DFBPPR9887 ---- Animal proteins ---- Cystatin-A8 Source.8491: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1 Source.8492: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.8493: DFBPPR9899 ---- Animal proteins ---- D-xylulose reductase Source.8494: DFBPPR9901 ---- Animal proteins ---- 40S ribosomal protein S14 Source.8495: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3 Source.8496: DFBPPR9909 ---- Animal proteins ---- Tetraspanin-31 Source.8497: DFBPPR9912 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial Source.8498: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B Source.8499: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2 Source.8500: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1 Source.8501: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.8502: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin Source.8503: DFBPPR9926 ---- Animal proteins ---- 60S ribosomal protein L7a Source.8504: DFBPPR9927 ---- Animal proteins ---- Protein BTG3 Source.8505: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1 Source.8506: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1 Source.8507: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.8508: DFBPPR9940 ---- Animal proteins ---- Neuronatin Source.8509: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1 Source.8510: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251 Source.8511: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.8512: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.8513: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.8514: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.8515: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase Source.8516: DFBPPR9961 ---- Animal proteins ---- Somatotropin Source.8517: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.8518: DFBPPR9965 ---- Animal proteins ---- Lysozyme C Source.8519: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.8520: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.8521: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor Source.8522: DFBPPR9972 ---- Animal proteins ---- Taste receptor type 2 member 40 Source.8523: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.8524: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin Source.8525: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.8526: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.8527: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.8528: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput Source.8529: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.8530: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.8531: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.8532: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.8533: DFBPPR9989 ---- Animal proteins ---- VIP peptides Source.8534: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.8535: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.8536: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.8537: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.8538: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.8539: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.8540: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type Source.8541: DFBPPR10004 ---- Animal proteins ---- Spastin Source.8542: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.8543: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1 Source.8544: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.8545: DFBPPR10009 ---- Animal proteins ---- Transthyretin Source.8546: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.8547: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.8548: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13 Source.8549: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.8550: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.8551: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.8552: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.8553: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6 Source.8554: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog Source.8555: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.8556: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.8557: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.8558: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B Source.8559: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.8560: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.8561: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase Source.8562: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.8563: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2 Source.8564: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.8565: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.8566: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase Source.8567: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta Source.8568: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.8569: DFBPPR10044 ---- Animal proteins ---- Histone H4 Source.8570: DFBPPR10045 ---- Animal proteins ---- Albumin Source.8571: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.8572: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.8573: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.8574: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.8575: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.8576: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4 Source.8577: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.8578: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.8579: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.8580: DFBPPR10064 ---- Animal proteins ---- Pleiotrophin Source.8581: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6 Source.8582: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.8583: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.8584: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.8585: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog Source.8586: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.8587: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1 Source.8588: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.8589: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.8590: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.8591: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.8592: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.8593: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor Source.8594: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.8595: DFBPPR10082 ---- Animal proteins ---- Pinopsin Source.8596: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.8597: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.8598: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.8599: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.8600: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.8601: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog Source.8602: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.8603: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4 Source.8604: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor Source.8605: DFBPPR10094 ---- Animal proteins ---- Proliferating cell nuclear antigen Source.8606: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.8607: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor Source.8608: DFBPPR10098 ---- Animal proteins ---- Mucin-6 Source.8609: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.8610: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.8611: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.8612: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.8613: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.8614: DFBPPR10107 ---- Animal proteins ---- Ovomucoid Source.8615: DFBPPR10110 ---- Animal proteins ---- ER lumen protein-retaining receptor 2 Source.8616: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.8617: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.8618: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.8619: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.8620: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.8621: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.8622: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.8623: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.8624: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.8625: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.8626: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase Source.8627: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1 Source.8628: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.8629: DFBPPR10129 ---- Animal proteins ---- Gremlin-1 Source.8630: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.8631: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase Source.8632: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.8633: DFBPPR10136 ---- Animal proteins ---- Annexin A2 Source.8634: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8 Source.8635: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.8636: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.8637: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.8638: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.8639: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2 Source.8640: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.8641: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3 Source.8642: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.8643: DFBPPR10148 ---- Animal proteins ---- Ubiquitin-40S ribosomal protein S27a Source.8644: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.8645: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.8646: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor Source.8647: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.8648: DFBPPR10157 ---- Animal proteins ---- CD40 ligand Source.8649: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.8650: DFBPPR10163 ---- Animal proteins ---- Annexin A6 Source.8651: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.8652: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.8653: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1 Source.8654: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.8655: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.8656: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.8657: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.8658: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2 Source.8659: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.8660: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5 Source.8661: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.8662: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3 Source.8663: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20 Source.8664: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.8665: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.8666: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.8667: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.8668: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1 Source.8669: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85 Source.8670: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.8671: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.8672: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1 Source.8673: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.8674: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.8675: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.8676: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.8677: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.8678: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A Source.8679: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.8680: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.8681: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.8682: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4 Source.8683: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.8684: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1 Source.8685: DFBPPR10219 ---- Animal proteins ---- Presenilin-1 Source.8686: DFBPPR10220 ---- Animal proteins ---- Paxillin Source.8687: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance Source.8688: DFBPPR10222 ---- Animal proteins ---- Podocalyxin Source.8689: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha Source.8690: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.8691: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.8692: DFBPPR10226 ---- Animal proteins ---- GTPase HRas Source.8693: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11 Source.8694: DFBPPR10228 ---- Animal proteins ---- Presenilin-2 Source.8695: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.8696: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.8697: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4 Source.8698: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3 Source.8699: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.8700: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8 Source.8701: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1 Source.8702: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1 Source.8703: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.8704: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.8705: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.8706: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.8707: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1 Source.8708: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.8709: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1 Source.8710: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.8711: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.8712: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6 Source.8713: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.8714: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.8715: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.8716: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1 Source.8717: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.8718: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.8719: DFBPPR10268 ---- Animal proteins ---- CD166 antigen Source.8720: DFBPPR10270 ---- Animal proteins ---- Agrin Source.8721: DFBPPR10271 ---- Animal proteins ---- Cadherin-7 Source.8722: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.8723: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.8724: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.8725: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B Source.8726: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.8727: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.8728: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.8729: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.8730: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6 Source.8731: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.8732: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6 Source.8733: DFBPPR10286 ---- Animal proteins ---- Avidin Source.8734: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.8735: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.8736: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.8737: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.8738: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.8739: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.8740: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP Source.8741: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.8742: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.8743: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.8744: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.8745: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.8746: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.8747: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.8748: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.8749: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.8750: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.8751: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.8752: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.8753: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.8754: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.8755: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.8756: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.8757: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4 Source.8758: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.8759: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.8760: DFBPPR10320 ---- Animal proteins ---- Insulin Source.8761: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.8762: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1 Source.8763: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.8764: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein Source.8765: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.8766: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.8767: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.8768: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC Source.8769: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.8770: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.8771: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.8772: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.8773: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1 Source.8774: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.8775: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.8776: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.8777: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.8778: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.8779: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.8780: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase Source.8781: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.8782: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.8783: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.8784: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.8785: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.8786: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR Source.8787: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24 Source.8788: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.8789: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.8790: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.8791: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.8792: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.8793: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.8794: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.8795: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.8796: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.8797: DFBPPR10391 ---- Animal proteins ---- Annexin A5 Source.8798: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.8799: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.8800: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.8801: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.8802: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.8803: DFBPPR10400 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.8804: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.8805: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.8806: DFBPPR10403 ---- Animal proteins ---- UMP-CMP kinase Source.8807: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.8808: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.8809: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.8810: DFBPPR10408 ---- Animal proteins ---- Beta-galactoside-binding lectin Source.8811: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.8812: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.8813: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.8814: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.8815: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.8816: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.8817: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A Source.8818: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.8819: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin Source.8820: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.8821: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.8822: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.8823: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.8824: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor Source.8825: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.8826: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform Source.8827: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.8828: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.8829: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.8830: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.8831: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.8832: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.8833: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.8834: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.8835: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c Source.8836: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.8837: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.8838: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1 Source.8839: DFBPPR10452 ---- Animal proteins ---- Desmin Source.8840: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.8841: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.8842: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.8843: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.8844: DFBPPR10459 ---- Animal proteins ---- Reelin Source.8845: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.8846: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.8847: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.8848: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.8849: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.8850: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.8851: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.8852: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.8853: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.8854: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.8855: DFBPPR10480 ---- Animal proteins ---- Cathepsin D Source.8856: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.8857: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.8858: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2 Source.8859: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2 Source.8860: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.8861: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.8862: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.8863: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.8864: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1 Source.8865: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1 Source.8866: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.8867: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.8868: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon Source.8869: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.8870: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.8871: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.8872: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3 Source.8873: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.8874: DFBPPR10513 ---- Animal proteins ---- Parafibromin Source.8875: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.8876: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.8877: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.8878: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.8879: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9 Source.8880: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.8881: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta Source.8882: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1 Source.8883: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.8884: DFBPPR10531 ---- Animal proteins ---- Serpin H1 Source.8885: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.8886: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.8887: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog Source.8888: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.8889: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.8890: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3 Source.8891: DFBPPR10544 ---- Animal proteins ---- Thioredoxin Source.8892: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.8893: DFBPPR10546 ---- Animal proteins ---- Calmodulin Source.8894: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type Source.8895: DFBPPR10548 ---- Animal proteins ---- Syndecan-4 Source.8896: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1 Source.8897: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.8898: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.8899: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.8900: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.8901: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.8902: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1 Source.8903: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2 Source.8904: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.8905: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.8906: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.8907: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.8908: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.8909: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.8910: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.8911: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.8912: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.8913: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.8914: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b Source.8915: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.8916: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase Source.8917: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.8918: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.8919: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.8920: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5 Source.8921: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B' Source.8922: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.8923: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.8924: DFBPPR10590 ---- Animal proteins ---- Centromere protein X Source.8925: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase Source.8926: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.8927: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.8928: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.8929: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.8930: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B Source.8931: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1 Source.8932: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.8933: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain Source.8934: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.8935: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.8936: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.8937: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.8938: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.8939: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.8940: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.8941: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5 Source.8942: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.8943: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX Source.8944: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.8945: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.8946: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.8947: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.8948: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin Source.8949: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.8950: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.8951: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.8952: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.8953: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.8954: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.8955: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.8956: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.8957: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein Source.8958: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53 Source.8959: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3 Source.8960: DFBPPR10640 ---- Animal proteins ---- Caveolin-1 Source.8961: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.8962: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.8963: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5 Source.8964: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.8965: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.8966: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.8967: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.8968: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.8969: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.8970: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.8971: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.8972: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.8973: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.8974: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.8975: DFBPPR10660 ---- Animal proteins ---- Tsukushin Source.8976: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.8977: DFBPPR10662 ---- Animal proteins ---- CCN family member 3 Source.8978: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.8979: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.8980: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.8981: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.8982: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.8983: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.8984: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.8985: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.8986: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.8987: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin Source.8988: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.8989: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.8990: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.8991: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3 Source.8992: DFBPPR10683 ---- Animal proteins ---- Histone H4 type VIII Source.8993: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.8994: DFBPPR10686 ---- Animal proteins ---- Collectin-11 Source.8995: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.8996: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.8997: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.8998: DFBPPR10691 ---- Animal proteins ---- Beclin-1 Source.8999: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.9000: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.9001: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2 Source.9002: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.9003: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.9004: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.9005: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.9006: DFBPPR10703 ---- Animal proteins ---- Tensin Source.9007: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2 Source.9008: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.9009: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2 Source.9010: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.9011: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.9012: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.9013: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.9014: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9 Source.9015: DFBPPR10715 ---- Animal proteins ---- Lumican Source.9016: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.9017: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1 Source.9018: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform Source.9019: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.9020: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.9021: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8 Source.9022: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.9023: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.9024: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.9025: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.9026: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.9027: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.9028: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A Source.9029: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.9030: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10 Source.9031: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14 Source.9032: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.9033: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1 Source.9034: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.9035: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6 Source.9036: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.9037: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.9038: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.9039: DFBPPR10755 ---- Animal proteins ---- Draxin Source.9040: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase Source.9041: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A Source.9042: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.9043: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.9044: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6 Source.9045: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.9046: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.9047: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.9048: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1 Source.9049: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.9050: DFBPPR10778 ---- Animal proteins ---- Avidin-related protein 2 Source.9051: DFBPPR10780 ---- Animal proteins ---- Caspase-2 Source.9052: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain Source.9053: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b Source.9054: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.9055: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.9056: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.9057: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.9058: DFBPPR10796 ---- Animal proteins ---- Protrudin Source.9059: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.9060: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1 Source.9061: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.9062: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.9063: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.9064: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.9065: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.9066: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.9067: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.9068: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.9069: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.9070: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.9071: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.9072: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha Source.9073: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.9074: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain Source.9075: DFBPPR10826 ---- Animal proteins ---- Cofilin-2 Source.9076: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Source.9077: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.9078: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.9079: DFBPPR10837 ---- Animal proteins ---- GTPase NRas Source.9080: DFBPPR10838 ---- Animal proteins ---- Protein lin-28 homolog A Source.9081: DFBPPR10840 ---- Animal proteins ---- C-C motif chemokine 4 homolog Source.9082: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5 Source.9083: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.9084: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5 Source.9085: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.9086: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A Source.9087: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.9088: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.9089: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.9090: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.9091: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.9092: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein Source.9093: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.9094: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.9095: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.9096: DFBPPR10865 ---- Animal proteins ---- Transgelin Source.9097: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase Source.9098: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2 Source.9099: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.9100: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.9101: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.9102: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3 Source.9103: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.9104: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.9105: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.9106: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.9107: DFBPPR10885 ---- Animal proteins ---- Pepsin A Source.9108: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1 Source.9109: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.9110: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.9111: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.9112: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.9113: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.9114: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.9115: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform Source.9116: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.9117: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152 Source.9118: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.9119: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.9120: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.9121: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.9122: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1 Source.9123: DFBPPR10917 ---- Animal proteins ---- Ribonuclease UK114 Source.9124: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.9125: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.9126: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3 Source.9127: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.9128: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.9129: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.9130: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase Source.9131: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.9132: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.9133: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.9134: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2 Source.9135: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.9136: DFBPPR10939 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.9137: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.9138: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.9139: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.9140: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.9141: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.9142: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.9143: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.9144: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.9145: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y Source.9146: DFBPPR10952 ---- Animal proteins ---- Protein XRP2 Source.9147: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.9148: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type Source.9149: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type Source.9150: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C Source.9151: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type Source.9152: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.9153: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1 Source.9154: DFBPPR10970 ---- Animal proteins ---- Prohibitin Source.9155: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo Source.9156: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.9157: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog Source.9158: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.9159: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.9160: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.9161: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain Source.9162: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.9163: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein Source.9164: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.9165: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C Source.9166: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.9167: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20 Source.9168: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.9169: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase Source.9170: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2 Source.9171: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.9172: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.9173: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.9174: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.9175: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.9176: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D Source.9177: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.9178: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.9179: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1 Source.9180: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.9181: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein Source.9182: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.9183: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.9184: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.9185: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase Source.9186: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.9187: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1 Source.9188: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.9189: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.9190: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2 Source.9191: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.9192: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein Source.9193: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.9194: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu Source.9195: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.9196: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.9197: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.9198: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.9199: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.9200: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.9201: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.9202: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.9203: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11 Source.9204: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.9205: DFBPPR11047 ---- Animal proteins ---- Nucleolin Source.9206: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.9207: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.9208: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase Source.9209: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.9210: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13 Source.9211: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A Source.9212: DFBPPR11060 ---- Animal proteins ---- Netrin-3 Source.9213: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.9214: DFBPPR11064 ---- Animal proteins ---- General transcription factor IIH subunit 5 Source.9215: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.9216: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.9217: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a Source.9218: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.9219: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.9220: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1 Source.9221: DFBPPR11077 ---- Animal proteins ---- Tyrosinase Source.9222: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.9223: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.9224: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.9225: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.9226: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.9227: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.9228: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1 Source.9229: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.9230: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.9231: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.9232: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.9233: DFBPPR11095 ---- Animal proteins ---- Ras-related protein Rab-33B Source.9234: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.9235: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.9236: DFBPPR11098 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.9237: DFBPPR11099 ---- Animal proteins ---- Acylphosphatase-1 Source.9238: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin Source.9239: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.9240: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS Source.9241: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.9242: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.9243: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.9244: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase Source.9245: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.9246: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1 Source.9247: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.9248: DFBPPR11118 ---- Animal proteins ---- Filensin Source.9249: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.9250: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14 Source.9251: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.9252: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.9253: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.9254: DFBPPR11126 ---- Animal proteins ---- Parvalbumin, thymic Source.9255: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.9256: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.9257: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit Source.9258: DFBPPR11134 ---- Animal proteins ---- Keratocan Source.9259: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3 Source.9260: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.9261: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.9262: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.9263: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.9264: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B Source.9265: DFBPPR11146 ---- Animal proteins ---- Formin Source.9266: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.9267: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.9268: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog Source.9269: DFBPPR11151 ---- Animal proteins ---- SPARC Source.9270: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain Source.9271: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3 Source.9272: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.9273: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.9274: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta Source.9275: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.9276: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.9277: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.9278: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta Source.9279: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2 Source.9280: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b Source.9281: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1 Source.9282: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase Source.9283: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.9284: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.9285: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1 Source.9286: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22 Source.9287: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1 Source.9288: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.9289: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.9290: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.9291: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.9292: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.9293: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.9294: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1 Source.9295: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.9296: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.9297: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1 Source.9298: DFBPPR11209 ---- Animal proteins ---- Protein S100-A11 Source.9299: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1 Source.9300: DFBPPR11211 ---- Animal proteins ---- Acylphosphatase-2 Source.9301: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein Source.9302: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.9303: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.9304: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.9305: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.9306: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1 Source.9307: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.9308: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.9309: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.9310: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.9311: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.9312: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase Source.9313: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.9314: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A Source.9315: DFBPPR11237 ---- Animal proteins ---- Fibroblast growth factor 3 Source.9316: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.9317: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2 Source.9318: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.9319: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3 Source.9320: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.9321: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.9322: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.9323: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.9324: DFBPPR11253 ---- Animal proteins ---- Peripherin-2 Source.9325: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.9326: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.9327: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.9328: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7 Source.9329: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.9330: DFBPPR11269 ---- Animal proteins ---- Anosmin-1 Source.9331: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.9332: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.9333: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.9334: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3 Source.9335: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.9336: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5 Source.9337: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.9338: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin Source.9339: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2 Source.9340: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.9341: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog Source.9342: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.9343: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.9344: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.9345: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.9346: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.9347: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.9348: DFBPPR11294 ---- Animal proteins ---- Frizzled-8 Source.9349: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.9350: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.9351: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.9352: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.9353: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.9354: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A Source.9355: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.9356: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42 Source.9357: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.9358: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15 Source.9359: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8 Source.9360: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.9361: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.9362: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog Source.9363: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1 Source.9364: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1 Source.9365: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.9366: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.9367: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2 Source.9368: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.9369: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.9370: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.9371: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.9372: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase Source.9373: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13 Source.9374: DFBPPR11351 ---- Animal proteins ---- Small ubiquitin-related modifier 3 Source.9375: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase Source.9376: DFBPPR11354 ---- Animal proteins ---- Centromere protein O Source.9377: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.9378: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.9379: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2 Source.9380: DFBPPR11373 ---- Animal proteins ---- Decorin Source.9381: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.9382: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1 Source.9383: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6 Source.9384: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.9385: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.9386: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.9387: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3 Source.9388: DFBPPR11387 ---- Animal proteins ---- Amphiphysin Source.9389: DFBPPR11388 ---- Animal proteins ---- Matrilin-3 Source.9390: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.9391: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.9392: DFBPPR11393 ---- Animal proteins ---- Avidin-related protein 4/5 Source.9393: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4 Source.9394: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.9395: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.9396: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.9397: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.9398: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.9399: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1 Source.9400: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.9401: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF Source.9402: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.9403: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.9404: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.9405: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231 Source.9406: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.9407: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.9408: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.9409: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1 Source.9410: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.9411: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20 Source.9412: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5 Source.9413: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3 Source.9414: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.9415: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.9416: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.9417: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.9418: DFBPPR11441 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.9419: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform Source.9420: DFBPPR11445 ---- Animal proteins ---- Gallinacin-12 Source.9421: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.9422: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7 Source.9423: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2 Source.9424: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1 Source.9425: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2 Source.9426: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin Source.9427: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.9428: DFBPPR11463 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.9429: DFBPPR11467 ---- Animal proteins ---- Synembryn-A Source.9430: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.9431: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase Source.9432: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.9433: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3 Source.9434: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2 Source.9435: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3 Source.9436: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein Source.9437: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.9438: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1 Source.9439: DFBPPR11488 ---- Animal proteins ---- Ras-related protein Rab-2A Source.9440: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2 Source.9441: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.9442: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L Source.9443: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7 Source.9444: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.9445: DFBPPR11499 ---- Animal proteins ---- Myosin regulatory light chain 2B, cardiac muscle isoform Source.9446: DFBPPR11504 ---- Animal proteins ---- TATA box-binding protein-like 1 Source.9447: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.9448: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b Source.9449: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2 Source.9450: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.9451: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A Source.9452: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide Source.9453: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.9454: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.9455: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.9456: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.9457: DFBPPR11524 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF166 Source.9458: DFBPPR11525 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.9459: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.9460: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform Source.9461: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.9462: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform Source.9463: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80 Source.9464: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.9465: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.9466: DFBPPR11543 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.9467: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.9468: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2 Source.9469: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.9470: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1 Source.9471: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.9472: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein Source.9473: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.9474: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog Source.9475: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.9476: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.9477: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein Source.9478: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.9479: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.9480: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle Source.9481: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.9482: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.9483: DFBPPR11583 ---- Animal proteins ---- Translin Source.9484: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.9485: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.9486: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein Source.9487: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.9488: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.9489: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230 Source.9490: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.9491: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.9492: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.9493: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.9494: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.9495: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.9496: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.9497: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13 Source.9498: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.9499: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.9500: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.9501: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.9502: DFBPPR11613 ---- Animal proteins ---- Transmembrane protein 258 Source.9503: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3 Source.9504: DFBPPR11616 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.9505: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B Source.9506: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.9507: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.9508: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.9509: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59 Source.9510: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2 Source.9511: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.9512: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.9513: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.9514: DFBPPR11635 ---- Animal proteins ---- Cochlin Source.9515: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2 Source.9516: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4 Source.9517: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon Source.9518: DFBPPR11640 ---- Animal proteins ---- Transmembrane protein 170A Source.9519: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.9520: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2 Source.9521: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.9522: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.9523: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase Source.9524: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.9525: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37 Source.9526: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.9527: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.9528: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.9529: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.9530: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.9531: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.9532: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.9533: DFBPPR11672 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 3 Source.9534: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Source.9535: DFBPPR11674 ---- Animal proteins ---- Protein MRP-126 Source.9536: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.9537: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.9538: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial Source.9539: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1 Source.9540: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1 Source.9541: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta Source.9542: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H Source.9543: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1 Source.9544: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7 Source.9545: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.9546: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit Source.9547: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.9548: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.9549: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2 Source.9550: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.9551: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.9552: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.9553: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.9554: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.9555: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.9556: DFBPPR11719 ---- Animal proteins ---- Protein RER1 Source.9557: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.9558: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.9559: DFBPPR11723 ---- Animal proteins ---- Visinin Source.9560: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.9561: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta Source.9562: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7 Source.9563: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.9564: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi Source.9565: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3 Source.9566: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.9567: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.9568: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.9569: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.9570: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.9571: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.9572: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.9573: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta Source.9574: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3 Source.9575: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1 Source.9576: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38 Source.9577: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.9578: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6 Source.9579: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.9580: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1 Source.9581: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B Source.9582: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.9583: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like Source.9584: DFBPPR11774 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1 Source.9585: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.9586: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4 Source.9587: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.9588: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.9589: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2 Source.9590: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5 Source.9591: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B Source.9592: DFBPPR11790 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.9593: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5 Source.9594: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.9595: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4 Source.9596: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3 Source.9597: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5 Source.9598: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1 Source.9599: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17 Source.9600: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62 Source.9601: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.9602: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.9603: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.9604: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1 Source.9605: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.9606: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27 Source.9607: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.9608: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.9609: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.9610: DFBPPR11822 ---- Animal proteins ---- Inversin Source.9611: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13 Source.9612: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.9613: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog Source.9614: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.9615: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B Source.9616: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.9617: DFBPPR11831 ---- Animal proteins ---- Protein lin-28 homolog B Source.9618: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.9619: DFBPPR11838 ---- Animal proteins ---- Enhancer of mRNA-decapping protein 3 Source.9620: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1 Source.9621: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.9622: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1 Source.9623: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11 Source.9624: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7 Source.9625: DFBPPR11847 ---- Animal proteins ---- Borealin-2 Source.9626: DFBPPR11848 ---- Animal proteins ---- Parvalbumin, muscle Source.9627: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.9628: DFBPPR11851 ---- Animal proteins ---- Borealin Source.9629: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase Source.9630: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2 Source.9631: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.9632: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82 Source.9633: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.9634: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.9635: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.9636: DFBPPR11863 ---- Animal proteins ---- Purpurin Source.9637: DFBPPR11864 ---- Animal proteins ---- Radixin Source.9638: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2 Source.9639: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog Source.9640: DFBPPR11869 ---- Animal proteins ---- BH3-interacting domain death agonist Source.9641: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.9642: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.9643: DFBPPR11874 ---- Animal proteins ---- Serum response factor Source.9644: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region Source.9645: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.9646: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.9647: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like Source.9648: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.9649: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.9650: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.9651: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2 Source.9652: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.9653: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.9654: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8 Source.9655: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.9656: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like Source.9657: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant Source.9658: DFBPPR11894 ---- Animal proteins ---- Centromere protein K Source.9659: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3 Source.9660: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3 Source.9661: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.9662: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein Source.9663: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.9664: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B Source.9665: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9 Source.9666: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.9667: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.9668: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein Source.9669: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.9670: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.9671: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3 Source.9672: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.9673: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.9674: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.9675: DFBPPR11925 ---- Animal proteins ---- GSK3-beta interaction protein Source.9676: DFBPPR11928 ---- Animal proteins ---- Cyclin-C Source.9677: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20 Source.9678: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta Source.9679: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.9680: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.9681: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle Source.9682: DFBPPR11942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.9683: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.9684: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.9685: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.9686: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.9687: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.9688: DFBPPR11952 ---- Animal proteins ---- Avidin-related protein 1 Source.9689: DFBPPR11953 ---- Animal proteins ---- Protein NEL Source.9690: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor Source.9691: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.9692: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.9693: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.9694: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein Source.9695: DFBPPR11962 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.9696: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.9697: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.9698: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.9699: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.9700: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.9701: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.9702: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4 Source.9703: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1 Source.9704: DFBPPR11973 ---- Animal proteins ---- Avidin-related protein 3 Source.9705: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.9706: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.9707: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.9708: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial Source.9709: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.9710: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.9711: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.9712: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1 Source.9713: DFBPPR11995 ---- Animal proteins ---- Protein orai-2 Source.9714: DFBPPR11997 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.9715: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.9716: DFBPPR11999 ---- Animal proteins ---- Dymeclin Source.9717: DFBPPR12002 ---- Animal proteins ---- Avidin-related protein 6 Source.9718: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.9719: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2 Source.9720: DFBPPR12006 ---- Animal proteins ---- Avidin-related protein 7 Source.9721: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein Source.9722: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein Source.9723: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.9724: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.9725: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2 Source.9726: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.9727: DFBPPR12025 ---- Animal proteins ---- Transmembrane protein 18 Source.9728: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.9729: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.9730: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5 Source.9731: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208 Source.9732: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.9733: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2 Source.9734: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.9735: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.9736: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.9737: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.9738: DFBPPR12041 ---- Animal proteins ---- Paladin Source.9739: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.9740: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24 Source.9741: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.9742: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.9743: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.9744: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.9745: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.9746: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.9747: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.9748: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.9749: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.9750: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.9751: DFBPPR12065 ---- Animal proteins ---- Testin Source.9752: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1 Source.9753: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.9754: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237 Source.9755: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.9756: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4 Source.9757: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.9758: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.9759: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.9760: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129 Source.9761: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.9762: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.9763: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma Source.9764: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2 Source.9765: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.9766: DFBPPR12091 ---- Animal proteins ---- Neurofibromin Source.9767: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.9768: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.9769: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.9770: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.9771: DFBPPR12100 ---- Animal proteins ---- Centromere protein Q Source.9772: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.9773: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2 Source.9774: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2 Source.9775: DFBPPR12105 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1 Source.9776: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.9777: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.9778: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.9779: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic Source.9780: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1 Source.9781: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.9782: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21 Source.9783: DFBPPR12115 ---- Animal proteins ---- Active regulator of SIRT1 Source.9784: DFBPPR12118 ---- Animal proteins ---- Protein EURL Source.9785: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.9786: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.9787: DFBPPR12125 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8 Source.9788: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.9789: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.9790: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19 Source.9791: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.9792: DFBPPR12133 ---- Animal proteins ---- Protein Asterix Source.9793: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.9794: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2 Source.9795: DFBPPR12138 ---- Animal proteins ---- Protein LZIC Source.9796: DFBPPR12140 ---- Animal proteins ---- Centromere protein N Source.9797: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2 Source.9798: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23 Source.9799: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog Source.9800: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3 Source.9801: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.9802: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.9803: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a Source.9804: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.9805: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104 Source.9806: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin Source.9807: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.9808: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog Source.9809: DFBPPR12168 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.9810: DFBPPR12172 ---- Animal proteins ---- Neuronal regeneration-related protein Source.9811: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.9812: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1 Source.9813: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.9814: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.9815: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein Source.9816: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.9817: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1 Source.9818: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251 Source.9819: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B Source.9820: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A Source.9821: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10 Source.9822: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.9823: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1 Source.9824: DFBPPR12202 ---- Animal proteins ---- Protein chibby homolog 2 Source.9825: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40 Source.9826: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.9827: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180 Source.9828: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3 Source.9829: DFBPPR12213 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1 Source.9830: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.9831: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog Source.9832: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.9833: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.9834: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.9835: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.9836: DFBPPR12225 ---- Animal proteins ---- Coiled-coil domain-containing protein 50 Source.9837: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6 Source.9838: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2 Source.9839: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68 Source.9840: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.9841: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.9842: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.9843: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.9844: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.9845: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.9846: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1 Source.9847: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.9848: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.9849: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1 Source.9850: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.9851: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.9852: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.9853: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1 Source.9854: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.9855: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2 Source.9856: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase Source.9857: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor Source.9858: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.9859: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.9860: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1 Source.9861: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.9862: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.9863: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.9864: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.9865: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1 Source.9866: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.9867: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.9868: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.9869: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.9870: DFBPPR12276 ---- Animal proteins ---- Protein S100-A9 Source.9871: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.9872: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.9873: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1 Source.9874: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.9875: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.9876: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.9877: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.9878: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.9879: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.9880: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.9881: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.9882: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.9883: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.9884: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3 Source.9885: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.9886: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.9887: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.9888: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.9889: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.9890: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.9891: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein Source.9892: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.9893: DFBPPR12309 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.9894: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.9895: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.9896: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.9897: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.9898: DFBPPR12314 ---- Animal proteins ---- Annexin A1 Source.9899: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.9900: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.9901: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.9902: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.9903: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.9904: DFBPPR12322 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A Source.9905: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5 Source.9906: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.9907: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.9908: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.9909: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type Source.9910: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type Source.9911: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.9912: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.9913: DFBPPR12333 ---- Animal proteins ---- Angiogenin Source.9914: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1 Source.9915: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.9916: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.9917: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.9918: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.9919: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.9920: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.9921: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.9922: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.9923: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.9924: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.9925: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1 Source.9926: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.9927: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.9928: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.9929: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.9930: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.9931: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.9932: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a Source.9933: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.9934: DFBPPR12366 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10 Source.9935: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2 Source.9936: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.9937: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.9938: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.9939: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1 Source.9940: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.9941: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.9942: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.9943: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.9944: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.9945: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.9946: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.9947: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.9948: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.9949: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.9950: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.9951: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.9952: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.9953: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.9954: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.9955: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.9956: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.9957: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.9958: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.9959: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Source.9960: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.9961: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.9962: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein Source.9963: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1 Source.9964: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.9965: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.9966: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4 Source.9967: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.9968: DFBPPR12408 ---- Animal proteins ---- Vitronectin Source.9969: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.9970: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.9971: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.9972: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2 Source.9973: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.9974: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.9975: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.9976: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.9977: DFBPPR12417 ---- Animal proteins ---- Rhodopsin Source.9978: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.9979: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.9980: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.9981: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.9982: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.9983: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.9984: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.9985: DFBPPR12439 ---- Animal proteins ---- Tissue factor Source.9986: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.9987: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1 Source.9988: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.9989: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.9990: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.9991: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.9992: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.9993: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.9994: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.9995: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.9996: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.9997: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.9998: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.9999: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.10000: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.10001: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.10002: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.10003: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X Source.10004: DFBPPR12463 ---- Animal proteins ---- Interleukin-15 Source.10005: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase Source.10006: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.10007: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.10008: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.10009: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.10010: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.10011: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.10012: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.10013: DFBPPR12476 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1 Source.10014: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.10015: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.10016: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.10017: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.10018: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.10019: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.10020: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.10021: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.10022: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.10023: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14 Source.10024: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.10025: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.10026: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.10027: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.10028: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.10029: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.10030: DFBPPR12501 ---- Animal proteins ---- Ezrin Source.10031: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.10032: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.10033: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3 Source.10034: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1 Source.10035: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.10036: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4 Source.10037: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.10038: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.10039: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.10040: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.10041: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase Source.10042: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin Source.10043: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.10044: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.10045: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10046: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.10047: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.10048: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase Source.10049: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.10050: DFBPPR12532 ---- Animal proteins ---- Amyloid-beta A4 protein Source.10051: DFBPPR12536 ---- Animal proteins ---- Albumin Source.10052: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.10053: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.10054: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.10055: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.10056: DFBPPR12542 ---- Animal proteins ---- Decorin Source.10057: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.10058: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.10059: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.10060: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.10061: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.10062: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10063: DFBPPR12551 ---- Animal proteins ---- C-reactive protein Source.10064: DFBPPR12552 ---- Animal proteins ---- Acylphosphatase-2 Source.10065: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.10066: DFBPPR12554 ---- Animal proteins ---- Ras-related protein Rab-7a Source.10067: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.10068: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.10069: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.10070: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type Source.10071: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.10072: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1 Source.10073: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.10074: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.10075: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.10076: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.10077: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11 Source.10078: DFBPPR12575 ---- Animal proteins ---- CD63 antigen Source.10079: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.10080: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.10081: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.10082: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.10083: DFBPPR12583 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.10084: DFBPPR12585 ---- Animal proteins ---- Calmodulin Source.10085: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.10086: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1 Source.10087: DFBPPR12591 ---- Animal proteins ---- Annexin A11 Source.10088: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.10089: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20 Source.10090: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.10091: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.10092: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.10093: DFBPPR12602 ---- Animal proteins ---- Osteopontin Source.10094: DFBPPR12603 ---- Animal proteins ---- Osteopontin Source.10095: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.10096: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.10097: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.10098: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14 Source.10099: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.10100: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.10101: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.10102: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4 Source.10103: DFBPPR12626 ---- Animal proteins ---- E-selectin Source.10104: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase Source.10105: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.10106: DFBPPR12629 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform Source.10107: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.10108: DFBPPR12632 ---- Animal proteins ---- Caveolin-2 Source.10109: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.10110: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.10111: DFBPPR12636 ---- Animal proteins ---- Complement component C9 Source.10112: DFBPPR12637 ---- Animal proteins ---- Thioredoxin Source.10113: DFBPPR12638 ---- Animal proteins ---- Thioredoxin Source.10114: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.10115: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5 Source.10116: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10117: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.10118: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.10119: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5 Source.10120: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.10121: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.10122: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.10123: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.10124: DFBPPR12681 ---- Animal proteins ---- Myosin-7 Source.10125: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.10126: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.10127: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.10128: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.10129: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10130: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10131: DFBPPR12709 ---- Animal proteins ---- Somatotropin Source.10132: DFBPPR12710 ---- Animal proteins ---- Endoplasmin Source.10133: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.10134: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1 Source.10135: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.10136: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.10137: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein Source.10138: DFBPPR12725 ---- Animal proteins ---- Uricase Source.10139: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.10140: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.10141: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.10142: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2 Source.10143: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.10144: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.10145: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.10146: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86 Source.10147: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3 Source.10148: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.10149: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1 Source.10150: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25 Source.10151: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.10152: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1 Source.10153: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.10154: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.10155: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.10156: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta Source.10157: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3 Source.10158: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.10159: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4 Source.10160: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.10161: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta Source.10162: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.10163: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.10164: DFBPPR12768 ---- Animal proteins ---- Pepsin-3 Source.10165: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.10166: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.10167: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10168: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.10169: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.10170: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.10171: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.10172: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.10173: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.10174: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase Source.10175: DFBPPR12789 ---- Animal proteins ---- CD59 glycoprotein Source.10176: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.10177: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15 Source.10178: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10 Source.10179: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor Source.10180: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6 Source.10181: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.10182: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.10183: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.10184: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.10185: DFBPPR12809 ---- Animal proteins ---- Glutaredoxin-1 Source.10186: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.10187: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.10188: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter Source.10189: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.10190: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.10191: DFBPPR12817 ---- Animal proteins ---- Cathepsin E Source.10192: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.10193: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.10194: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B Source.10195: DFBPPR12821 ---- Animal proteins ---- Gastricsin Source.10196: DFBPPR12823 ---- Animal proteins ---- Pepsin F Source.10197: DFBPPR12825 ---- Animal proteins ---- Bleomycin hydrolase Source.10198: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.10199: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4 Source.10200: DFBPPR12832 ---- Animal proteins ---- Secretin receptor Source.10201: DFBPPR12833 ---- Animal proteins ---- Cullin-5 Source.10202: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor Source.10203: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.10204: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10205: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.10206: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.10207: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.10208: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1 Source.10209: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.10210: DFBPPR12850 ---- Animal proteins ---- VIP peptides Source.10211: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.10212: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.10213: DFBPPR12856 ---- Animal proteins ---- Leupaxin Source.10214: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.10215: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.10216: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11 Source.10217: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein Source.10218: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.10219: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin Source.10220: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.10221: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.10222: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein Source.10223: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn] Source.10224: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.10225: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase Source.10226: DFBPPR12889 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform Source.10227: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.10228: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D Source.10229: DFBPPR12894 ---- Animal proteins ---- Parvalbumin alpha Source.10230: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.10231: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.10232: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.10233: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.10234: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.10235: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a Source.10236: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.10237: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2 Source.10238: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6 Source.10239: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.10240: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.10241: DFBPPR12914 ---- Animal proteins ---- Lipase member H Source.10242: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2 Source.10243: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30 Source.10244: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.10245: DFBPPR12924 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.10246: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2 Source.10247: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1 Source.10248: DFBPPR12930 ---- Animal proteins ---- Kappa-casein Source.10249: DFBPPR12931 ---- Animal proteins ---- Transthyretin Source.10250: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C Source.10251: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.10252: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.10253: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.10254: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.10255: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1 Source.10256: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.10257: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.10258: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.10259: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein Source.10260: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.10261: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.10262: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.10263: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.10264: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2 Source.10265: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3 Source.10266: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.10267: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3 Source.10268: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5 Source.10269: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain Source.10270: DFBPPR12967 ---- Animal proteins ---- Beta-sarcoglycan Source.10271: DFBPPR12970 ---- Animal proteins ---- Protein S100-B Source.10272: DFBPPR12971 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase Source.10273: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.10274: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.10275: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.10276: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.10277: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.10278: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.10279: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.10280: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A Source.10281: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form Source.10282: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.10283: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.10284: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.10285: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.10286: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.10287: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10288: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.10289: DFBPPR13011 ---- Animal proteins ---- C-C motif chemokine 4 Source.10290: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2 Source.10291: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2 Source.10292: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.10293: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1 Source.10294: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A Source.10295: DFBPPR13034 ---- Animal proteins ---- Sarcospan Source.10296: DFBPPR13035 ---- Animal proteins ---- Chymase Source.10297: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.10298: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.10299: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein Source.10300: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1 Source.10301: DFBPPR13050 ---- Animal proteins ---- Odorant-binding protein 3 Source.10302: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D Source.10303: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2 Source.10304: DFBPPR13061 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial Source.10305: DFBPPR13064 ---- Animal proteins ---- Metalloproteinase inhibitor 4 Source.10306: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5 Source.10307: DFBPPR13067 ---- Animal proteins ---- Beta-casein Source.10308: DFBPPR13069 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP alpha-1 chain Source.10309: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.10310: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.10311: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1 Source.10312: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog Source.10313: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207 Source.10314: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta Source.10315: DFBPPR13090 ---- Animal proteins ---- Annexin A8 Source.10316: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10317: DFBPPR13092 ---- Animal proteins ---- Testin Source.10318: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.10319: DFBPPR13094 ---- Animal proteins ---- Atherin Source.10320: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2 Source.10321: DFBPPR13097 ---- Animal proteins ---- Lumican Source.10322: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1 Source.10323: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form Source.10324: DFBPPR13100 ---- Animal proteins ---- Lengsin Source.10325: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region Source.10326: DFBPPR13105 ---- Animal proteins ---- Ig kappa chain V region BS-5 Source.10327: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2 Source.10328: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.10329: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain Source.10330: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10331: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region Source.10332: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region Source.10333: DFBPPR13131 ---- Animal proteins ---- Ig kappa chain V region K29-213 Source.10334: DFBPPR13133 ---- Animal proteins ---- Ig kappa chain V region K16-167 Source.10335: DFBPPR13140 ---- Animal proteins ---- Blastocyst protein 4 Source.10336: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.10337: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.10338: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.10339: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.10340: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.10341: DFBPPR13153 ---- Animal proteins ---- Interleukin-18 Source.10342: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.10343: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5 Source.10344: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor Source.10345: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.10346: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.10347: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.10348: DFBPPR13166 ---- Animal proteins ---- CD44 antigen Source.10349: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.10350: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.10351: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase Source.10352: DFBPPR13176 ---- Animal proteins ---- Aromatase Source.10353: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase Source.10354: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10355: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.10356: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.10357: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain Source.10358: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.10359: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.10360: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.10361: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.10362: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.10363: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain Source.10364: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11 Source.10365: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.10366: DFBPPR13195 ---- Animal proteins ---- Albumin Source.10367: DFBPPR13196 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.10368: DFBPPR13197 ---- Animal proteins ---- Caveolin-2 Source.10369: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha Source.10370: DFBPPR13201 ---- Animal proteins ---- Major allergen Equ c 1 Source.10371: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.10372: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.10373: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.10374: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.10375: DFBPPR13210 ---- Animal proteins ---- Angiogenin Source.10376: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2 Source.10377: DFBPPR13213 ---- Animal proteins ---- Seminal plasma protein HSP-1 Source.10378: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.10379: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase Source.10380: DFBPPR13223 ---- Animal proteins ---- Caspase-1 Source.10381: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta Source.10382: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.10383: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10384: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.10385: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1 Source.10386: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10387: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein Source.10388: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.10389: DFBPPR13237 ---- Animal proteins ---- Thioredoxin Source.10390: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2 Source.10391: DFBPPR13240 ---- Animal proteins ---- Decorin Source.10392: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10393: DFBPPR13242 ---- Animal proteins ---- E-selectin Source.10394: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B Source.10395: DFBPPR13245 ---- Animal proteins ---- Somatotropin Source.10396: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.10397: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2 Source.10398: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.10399: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.10400: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta Source.10401: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.10402: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.10403: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.10404: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E Source.10405: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.10406: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.10407: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.10408: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8 Source.10409: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2 Source.10410: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.10411: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10412: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.10413: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.10414: DFBPPR13284 ---- Animal proteins ---- Interleukin-8 Source.10415: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.10416: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.10417: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.10418: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.10419: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2 Source.10420: DFBPPR13296 ---- Animal proteins ---- Complement component C9 Source.10421: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10422: DFBPPR13305 ---- Animal proteins ---- Cytochrome b Source.10423: DFBPPR13308 ---- Animal proteins ---- Interleukin-10 Source.10424: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta Source.10425: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.10426: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.10427: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0 Source.10428: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.10429: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10430: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.10431: DFBPPR13324 ---- Animal proteins ---- Acylphosphatase-2 Source.10432: DFBPPR13326 ---- Animal proteins ---- Interferon alpha-1 Source.10433: DFBPPR13328 ---- Animal proteins ---- Interferon alpha-2 Source.10434: DFBPPR13332 ---- Animal proteins ---- Interferon alpha-3 Source.10435: DFBPPR13333 ---- Animal proteins ---- Interferon alpha-4 Source.10436: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.10437: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.10438: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a Source.10439: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10440: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.10441: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.10442: DFBPPR13352 ---- Animal proteins ---- ATP synthase protein 8 Source.10443: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.10444: DFBPPR13359 ---- Animal proteins ---- Protein S100-A7 Source.10445: DFBPPR13362 ---- Animal proteins ---- Biglycan Source.10446: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.10447: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.10448: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.10449: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.10450: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.10451: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4 Source.10452: DFBPPR13375 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.10453: DFBPPR13376 ---- Animal proteins ---- Interleukin-5 Source.10454: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein Source.10455: DFBPPR13378 ---- Animal proteins ---- Neutrophil elastase 2A Source.10456: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein Source.10457: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10458: DFBPPR13390 ---- Animal proteins ---- C-X-C motif chemokine 6 Source.10459: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.10460: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.10461: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1 Source.10462: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.10463: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10464: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog Source.10465: DFBPPR13409 ---- Animal proteins ---- Testin Source.10466: DFBPPR13410 ---- Animal proteins ---- Lysozyme C, spleen isozyme Source.10467: DFBPPR13418 ---- Animal proteins ---- 40S ribosomal protein S4 Source.10468: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10469: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor Source.10470: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.10471: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.10472: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10473: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.10474: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.10475: DFBPPR13434 ---- Animal proteins ---- Aromatase Source.10476: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.10477: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8 Source.10478: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.10479: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10480: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.10481: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10482: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.10483: DFBPPR13457 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.10484: DFBPPR13458 ---- Animal proteins ---- Interleukin-4 Source.10485: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase Source.10486: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10487: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta Source.10488: DFBPPR13481 ---- Animal proteins ---- Somatotropin Source.10489: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.10490: DFBPPR13483 ---- Animal proteins ---- Interleukin-18 Source.10491: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.10492: DFBPPR13488 ---- Animal proteins ---- Lysozyme C-2 Source.10493: DFBPPR13489 ---- Animal proteins ---- Lysozyme C-1 Source.10494: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a Source.10495: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1 Source.10496: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.10497: DFBPPR13499 ---- Animal proteins ---- Vasoactive intestinal peptide Source.10498: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.10499: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.10500: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10501: DFBPPR13521 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.10502: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin Source.10503: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.10504: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.10505: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.10506: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.10507: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.10508: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase Source.10509: DFBPPR13540 ---- Animal proteins ---- Somatotropin Source.10510: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase Source.10511: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.10512: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1 Source.10513: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein Source.10514: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1 Source.10515: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10516: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.10517: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.10518: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.10519: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1 Source.10520: DFBPPR13564 ---- Animal proteins ---- Calmodulin Source.10521: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.10522: DFBPPR13566 ---- Animal proteins ---- Calcium and integrin-binding protein 1 Source.10523: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.10524: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase Source.10525: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36 Source.10526: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor Source.10527: DFBPPR13574 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.10528: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.10529: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.10530: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.10531: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein Source.10532: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.10533: DFBPPR13583 ---- Animal proteins ---- Caveolin-2 Source.10534: DFBPPR13584 ---- Animal proteins ---- Calpain-3 Source.10535: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.10536: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.10537: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.10538: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.10539: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.10540: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.10541: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.10542: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10543: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.10544: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor Source.10545: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.10546: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2 Source.10547: DFBPPR13605 ---- Animal proteins ---- Rhodopsin Source.10548: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.10549: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.10550: DFBPPR13615 ---- Animal proteins ---- Cofilin-1 Source.10551: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.10552: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.10553: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.10554: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.10555: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.10556: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.10557: DFBPPR13625 ---- Animal proteins ---- Lysozyme C-1 Source.10558: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10559: DFBPPR13628 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.10560: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.10561: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.10562: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.10563: DFBPPR13635 ---- Animal proteins ---- Amyloid-beta A4 protein Source.10564: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.10565: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.10566: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8 Source.10567: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.10568: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6 Source.10569: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.10570: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6 Source.10571: DFBPPR13651 ---- Animal proteins ---- Clusterin Source.10572: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10573: DFBPPR13656 ---- Animal proteins ---- Thioredoxin Source.10574: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2 Source.10575: DFBPPR13664 ---- Animal proteins ---- Interleukin-10 Source.10576: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor Source.10577: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.10578: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2 Source.10579: DFBPPR13672 ---- Animal proteins ---- Annexin A2 Source.10580: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.10581: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic Source.10582: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.10583: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.10584: DFBPPR13683 ---- Animal proteins ---- 14-3-3 protein sigma Source.10585: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.10586: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.10587: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen Source.10588: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.10589: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.10590: DFBPPR13696 ---- Animal proteins ---- Cathepsin D Source.10591: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.10592: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.10593: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.10594: DFBPPR13704 ---- Animal proteins ---- Osteopontin Source.10595: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase Source.10596: DFBPPR13707 ---- Animal proteins ---- Lysozyme C-3 Source.10597: DFBPPR13708 ---- Animal proteins ---- Renin Source.10598: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta Source.10599: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX Source.10600: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.10601: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.10602: DFBPPR13716 ---- Animal proteins ---- Trichohyalin Source.10603: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d Source.10604: DFBPPR13719 ---- Animal proteins ---- Nitric oxide synthase, brain Source.10605: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10606: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.10607: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.10608: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase Source.10609: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.10610: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1 Source.10611: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.10612: DFBPPR13740 ---- Animal proteins ---- Lysozyme C, kidney isozyme Source.10613: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.10614: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.10615: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase Source.10616: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic Source.10617: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.10618: DFBPPR13752 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.10619: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.10620: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.10621: DFBPPR13755 ---- Animal proteins ---- Aromatase Source.10622: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.10623: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21 Source.10624: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.10625: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.10626: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein Source.10627: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.10628: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor Source.10629: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10630: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10631: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.10632: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.10633: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor Source.10634: DFBPPR13777 ---- Animal proteins ---- Centromere protein C Source.10635: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.10636: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.10637: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.10638: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.10639: DFBPPR13788 ---- Animal proteins ---- Albumin Source.10640: DFBPPR13793 ---- Animal proteins ---- Decorin Source.10641: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain Source.10642: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel Source.10643: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor Source.10644: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6 Source.10645: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24 Source.10646: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.10647: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4 Source.10648: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.10649: DFBPPR13810 ---- Animal proteins ---- Transthyretin Source.10650: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma Source.10651: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2 Source.10652: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1 Source.10653: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5 Source.10654: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.10655: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.10656: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.10657: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a Source.10658: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.10659: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.10660: DFBPPR13832 ---- Animal proteins ---- Cystatin-B Source.10661: DFBPPR13834 ---- Animal proteins ---- Biglycan Source.10662: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3 Source.10663: DFBPPR13839 ---- Animal proteins ---- Interleukin-4 Source.10664: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561 Source.10665: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.10666: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.10667: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor Source.10668: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.10669: DFBPPR13850 ---- Animal proteins ---- Interleukin-15 Source.10670: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1 Source.10671: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.10672: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin Source.10673: DFBPPR13864 ---- Animal proteins ---- Interleukin-5 Source.10674: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9 Source.10675: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor Source.10676: DFBPPR13867 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.10677: DFBPPR13871 ---- Animal proteins ---- Parathyroid hormone-related protein Source.10678: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor Source.10679: DFBPPR13876 ---- Animal proteins ---- Follistatin Source.10680: DFBPPR13877 ---- Animal proteins ---- Sialin Source.10681: DFBPPR13879 ---- Animal proteins ---- Vasoactive intestinal peptide Source.10682: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.10683: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10684: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.10685: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.10686: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5 Source.10687: DFBPPR13897 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.10688: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.10689: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.10690: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3 Source.10691: DFBPPR13918 ---- Animal proteins ---- Testin Source.10692: DFBPPR13919 ---- Animal proteins ---- Selenoprotein W Source.10693: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.10694: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.10695: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.10696: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.10697: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.10698: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.10699: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10700: DFBPPR13948 ---- Animal proteins ---- Calcium and integrin-binding family member 4 Source.10701: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.10702: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26 Source.10703: DFBPPR13957 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.10704: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.10705: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10706: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.10707: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B Source.10708: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A Source.10709: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2 Source.10710: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10711: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.10712: DFBPPR13992 ---- Animal proteins ---- Rhodopsin Source.10713: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.10714: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog Source.10715: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.10716: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.10717: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B Source.10718: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A Source.10719: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.10720: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.10721: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.10722: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin Source.10723: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase Source.10724: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a Source.10725: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10726: DFBPPR14010 ---- Animal proteins ---- GTPase KRas Source.10727: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10728: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1 Source.10729: DFBPPR14017 ---- Animal proteins ---- Ependymin Source.10730: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10731: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1 Source.10732: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2 Source.10733: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.10734: DFBPPR14039 ---- Animal proteins ---- ATP synthase protein 8 Source.10735: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10736: DFBPPR14043 ---- Animal proteins ---- Prolactin Source.10737: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B Source.10738: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.10739: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos Source.10740: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form Source.10741: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form Source.10742: DFBPPR14058 ---- Animal proteins ---- Granulin-3 Source.10743: DFBPPR14071 ---- Marine protein ---- Somatotropin Source.10744: DFBPPR14073 ---- Marine protein ---- Elastase-1 Source.10745: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1 Source.10746: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.10747: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36 Source.10748: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.10749: DFBPPR14082 ---- Marine protein ---- Estrogen receptor Source.10750: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III Source.10751: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta Source.10752: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A Source.10753: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B Source.10754: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1 Source.10755: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.10756: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.10757: DFBPPR14096 ---- Marine protein ---- Serum amyloid P-component Source.10758: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.10759: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.10760: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran Source.10761: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha Source.10762: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146 Source.10763: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1 Source.10764: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.10765: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.10766: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial Source.10767: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.10768: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin Source.10769: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.10770: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.10771: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.10772: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.10773: DFBPPR14141 ---- Marine protein ---- Ependymin-2 Source.10774: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1 Source.10775: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a Source.10776: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein Source.10777: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.10778: DFBPPR14155 ---- Marine protein ---- ATP synthase protein 8 Source.10779: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E Source.10780: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12 Source.10781: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.10782: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.10783: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial Source.10784: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.10785: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog Source.10786: DFBPPR14166 ---- Marine protein ---- Draxin-A Source.10787: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator Source.10788: DFBPPR14174 ---- Marine protein ---- Ubiquitin-fold modifier 1 Source.10789: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A Source.10790: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6 Source.10791: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.10792: DFBPPR14188 ---- Marine protein ---- DNA repair protein SWI5 homolog Source.10793: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein Source.10794: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor Source.10795: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog Source.10796: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.10797: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein Source.10798: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B Source.10799: DFBPPR14203 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-A Source.10800: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2 Source.10801: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a Source.10802: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.10803: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.10804: DFBPPR14217 ---- Marine protein ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.10805: DFBPPR14220 ---- Marine protein ---- Coiled-coil domain-containing protein 58 Source.10806: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.10807: DFBPPR14225 ---- Marine protein ---- LYR motif-containing protein 1 Source.10808: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog Source.10809: DFBPPR14231 ---- Marine protein ---- Somatotropin Source.10810: DFBPPR14236 ---- Marine protein ---- Gonadotropin subunit beta-2 Source.10811: DFBPPR14237 ---- Marine protein ---- Stanniocalcin Source.10812: DFBPPR14240 ---- Marine protein ---- Otolin-1 Source.10813: DFBPPR14246 ---- Marine protein ---- Glycoprotein hormones alpha chain 1 Source.10814: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3 Source.10815: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1 Source.10816: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2 Source.10817: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin Source.10818: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain Source.10819: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial Source.10820: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.10821: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain Source.10822: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein Source.10823: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase Source.10824: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.10825: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.10826: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.10827: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.10828: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.10829: DFBPPR14308 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic Source.10830: DFBPPR14317 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic Source.10831: DFBPPR14319 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic Source.10832: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region Source.10833: DFBPPR14324 ---- Marine protein ---- Uncharacterized protein ycf19 Source.10834: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase Source.10835: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.10836: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.10837: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain Source.10838: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.10839: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain Source.10840: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.10841: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein Source.10842: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH Source.10843: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B Source.10844: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase Source.10845: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.10846: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.10847: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.10848: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase Source.10849: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3 Source.10850: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.10851: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.10852: DFBPPR14353 ---- Marine protein ---- Cytochrome c6 Source.10853: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha Source.10854: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta' Source.10855: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.10856: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.10857: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.10858: DFBPPR14367 ---- Marine protein ---- Cytochrome f Source.10859: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.10860: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.10861: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha Source.10862: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.10863: DFBPPR14373 ---- Marine protein ---- Cytochrome b6 Source.10864: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha Source.10865: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta Source.10866: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.10867: DFBPPR14378 ---- Marine protein ---- Probable replicative DNA helicase Source.10868: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.10869: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.10870: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase Source.10871: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.10872: DFBPPR14392 ---- Marine protein ---- Prenyl transferase Source.10873: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein Source.10874: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain Source.10875: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic Source.10876: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.10877: DFBPPR14408 ---- Marine protein ---- Cytochrome b6-f complex subunit 6 Source.10878: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.10879: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.10880: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4 Source.10881: DFBPPR14419 ---- Marine protein ---- Photosystem II reaction center protein K Source.10882: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.10883: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.10884: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.10885: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III Source.10886: DFBPPR14428 ---- Marine protein ---- Photosystem II reaction center protein I Source.10887: DFBPPR14433 ---- Marine protein ---- 50S ribosomal protein L14, chloroplastic Source.10888: DFBPPR14442 ---- Marine protein ---- 50S ribosomal protein L18, chloroplastic Source.10889: DFBPPR14443 ---- Marine protein ---- 30S ribosomal protein S14, chloroplastic Source.10890: DFBPPR14445 ---- Marine protein ---- 50S ribosomal protein L21, chloroplastic Source.10891: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY Source.10892: DFBPPR14464 ---- Marine protein ---- 30S ribosomal protein S19, chloroplastic Source.10893: DFBPPR14465 ---- Marine protein ---- 50S ribosomal protein L16, chloroplastic Source.10894: DFBPPR14478 ---- Marine protein ---- Photosystem II reaction center protein T Source.10895: DFBPPR14479 ---- Marine protein ---- Photosystem I assembly protein Ycf4 Source.10896: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38 Source.10897: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein Source.10898: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28 Source.10899: DFBPPR14491 ---- Marine protein ---- Photosystem I reaction center subunit II Source.10900: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46 Source.10901: DFBPPR14493 ---- Marine protein ---- 50S ribosomal protein L19, chloroplastic Source.10902: DFBPPR14497 ---- Marine protein ---- 50S ribosomal protein L33, chloroplastic Source.10903: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.10904: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39 Source.10905: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43 Source.10906: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60 Source.10907: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92 Source.10908: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.10909: DFBPPR14514 ---- Marine protein ---- Putative single-stranded DNA-binding protein ycf41 Source.10910: DFBPPR14517 ---- Marine protein ---- Uncharacterized protein ycf54 Source.10911: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56 Source.10912: DFBPPR14524 ---- Marine protein ---- Uncharacterized protein ycf36 Source.10913: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55 Source.10914: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35 Source.10915: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.10916: DFBPPR14533 ---- Marine protein ---- Uncharacterized protein ORF148 Source.10917: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2 Source.10918: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.10919: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.10920: DFBPPR14541 ---- Marine protein ---- Somatotropin-1 Source.10921: DFBPPR14542 ---- Marine protein ---- Somatotropin-2 Source.10922: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A Source.10923: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.10924: DFBPPR14546 ---- Marine protein ---- Stanniocalcin Source.10925: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor Source.10926: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.10927: DFBPPR14551 ---- Marine protein ---- Histone H4 Source.10928: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.10929: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2 Source.10930: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.10931: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10932: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.10933: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor Source.10934: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.10935: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1 Source.10936: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.10937: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific Source.10938: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.10939: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27 Source.10940: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4 Source.10941: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1 Source.10942: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1 Source.10943: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.10944: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I Source.10945: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase Source.10946: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.10947: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2 Source.10948: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2 Source.10949: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10950: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a Source.10951: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.10952: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.10953: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha Source.10954: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.10955: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.10956: DFBPPR14618 ---- Marine protein ---- Ependymin-1 Source.10957: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.10958: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase Source.10959: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.10960: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.10961: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18 Source.10962: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein Source.10963: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.10964: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin Source.10965: DFBPPR14645 ---- Marine protein ---- Ependymin-2 Source.10966: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2 Source.10967: DFBPPR14650 ---- Marine protein ---- Thyroid hormone receptor alpha Source.10968: DFBPPR14651 ---- Marine protein ---- ATP synthase protein 8 Source.10969: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.10970: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.10971: DFBPPR14654 ---- Marine protein ---- Gastrin-releasing peptide Source.10972: DFBPPR14660 ---- Marine protein ---- Otolin-1 Source.10973: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme Source.10974: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc Source.10975: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.10976: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.10977: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.10978: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor Source.10979: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.10980: DFBPPR14680 ---- Marine protein ---- Steroidogenic acute regulatory protein, mitochondrial Source.10981: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II Source.10982: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.10983: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.10984: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2 Source.10985: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3 Source.10986: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.10987: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1 Source.10988: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2 Source.10989: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.10990: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2 Source.10991: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1 Source.10992: DFBPPR14739 ---- Marine protein ---- Interleukin-1 receptor-associated kinase 1-binding protein 1 homolog Source.10993: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein Source.10994: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3 Source.10995: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2 Source.10996: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1 Source.10997: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B Source.10998: DFBPPR14745 ---- Marine protein ---- Parvalbumin beta 2 Source.10999: DFBPPR14746 ---- Marine protein ---- Parvalbumin beta 1 Source.11000: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.11001: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1 Source.11002: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.11003: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.11004: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.11005: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit Source.11006: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.11007: DFBPPR14758 ---- Marine protein ---- Techylectin-5B Source.11008: DFBPPR14760 ---- Marine protein ---- Big defensin Source.11009: DFBPPR14762 ---- Marine protein ---- Coagulogen Source.11010: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.11011: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3 Source.11012: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase Source.11013: DFBPPR14770 ---- Marine protein ---- Lectin L6 Source.11014: DFBPPR14771 ---- Marine protein ---- L-cystatin Source.11015: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.11016: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11017: DFBPPR14783 ---- Marine protein ---- Enolase Source.11018: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11019: DFBPPR14787 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform A Source.11020: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain Source.11021: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain Source.11022: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain Source.11023: DFBPPR14791 ---- Marine protein ---- Guanine nucleotide-binding protein G(i) subunit alpha Source.11024: DFBPPR14792 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform B Source.11025: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.11026: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.11027: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.11028: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit Source.11029: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.11030: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.11031: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1 Source.11032: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.11033: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit Source.11034: DFBPPR14811 ---- Marine protein ---- Crustacean hyperglycemic hormone Source.11035: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1 Source.11036: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1 Source.11037: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3 Source.11038: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2 Source.11039: DFBPPR14831 ---- Marine protein ---- 40S ribosomal protein S27 Source.11040: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1 Source.11041: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form Source.11042: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form Source.11043: DFBPPR14857 ---- Marine protein ---- Hemoglobin anodic subunit alpha Source.11044: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha Source.11045: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.11046: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233 Source.11047: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.11048: DFBPPR14867 ---- Marine protein ---- Gonadotropin subunit beta-2 Source.11049: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle Source.11050: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.11051: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.11052: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.11053: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.11054: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit Source.11055: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system Source.11056: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit Source.11057: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.11058: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1 Source.11059: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.11060: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.11061: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.11062: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific Source.11063: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.11064: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.11065: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase Source.11066: DFBPPR14897 ---- Microorganism protein ---- Calmodulin Source.11067: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.11068: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.11069: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.11070: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.11071: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.11072: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5 Source.11073: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1 Source.11074: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.11075: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8 Source.11076: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.11077: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.11078: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase Source.11079: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.11080: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.11081: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.11082: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.11083: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.11084: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial Source.11085: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18 Source.11086: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.11087: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.11088: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1 Source.11089: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.11090: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.11091: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.11092: DFBPPR14935 ---- Microorganism protein ---- Actin Source.11093: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.11094: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase Source.11095: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.11096: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.11097: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5 Source.11098: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.11099: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.11100: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.11101: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.11102: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32 Source.11103: DFBPPR14950 ---- Microorganism protein ---- 5'-AMP-activated protein kinase subunit gamma Source.11104: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.11105: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.11106: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1 Source.11107: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2 Source.11108: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1 Source.11109: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.11110: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.11111: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.11112: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27 Source.11113: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial Source.11114: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.11115: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.11116: DFBPPR14968 ---- Microorganism protein ---- Small COPII coat GTPase SAR1 Source.11117: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.11118: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.11119: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.11120: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.11121: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.11122: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.11123: DFBPPR14976 ---- Microorganism protein ---- Adenylate kinase Source.11124: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1 Source.11125: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.11126: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3 Source.11127: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.11128: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.11129: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.11130: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.11131: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial Source.11132: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.11133: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.11134: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.11135: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.11136: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.11137: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.11138: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.11139: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1 Source.11140: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase Source.11141: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b Source.11142: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.11143: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase Source.11144: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.11145: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.11146: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4 Source.11147: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1 Source.11148: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.11149: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.11150: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1 Source.11151: DFBPPR15026 ---- Microorganism protein ---- ATP synthase subunit 9, mitochondrial Source.11152: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5 Source.11153: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.11154: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.11155: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2 Source.11156: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.11157: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.11158: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.11159: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate) Source.11160: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial Source.11161: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.11162: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase Source.11163: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2 Source.11164: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.11165: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.11166: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.11167: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit Source.11168: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1 Source.11169: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10 Source.11170: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.11171: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.11172: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21 Source.11173: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.11174: DFBPPR15053 ---- Microorganism protein ---- 60S ribosomal subunit assembly/export protein LOC1 Source.11175: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9 Source.11176: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1 Source.11177: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.11178: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.11179: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1 Source.11180: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9 Source.11181: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.11182: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.11183: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.11184: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.11185: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.11186: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.11187: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor Source.11188: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)] Source.11189: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4 Source.11190: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.11191: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.11192: DFBPPR15079 ---- Microorganism protein ---- Autophagy-related protein 3 Source.11193: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase Source.11194: DFBPPR15082 ---- Microorganism protein ---- Cytochrome c Source.11195: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.11196: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1 Source.11197: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.11198: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial Source.11199: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial Source.11200: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.11201: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.11202: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase Source.11203: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.11204: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.11205: DFBPPR15107 ---- Microorganism protein ---- Calcineurin subunit B Source.11206: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.11207: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.11208: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.11209: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1 Source.11210: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase Source.11211: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.11212: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase Source.11213: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.11214: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.11215: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.11216: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.11217: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G Source.11218: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase Source.11219: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.11220: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.11221: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.11222: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.11223: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.11224: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22 Source.11225: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1 Source.11226: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.11227: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.11228: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A Source.11229: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6 Source.11230: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.11231: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.11232: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.11233: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40 Source.11234: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D Source.11235: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.11236: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic Source.11237: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.11238: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2 Source.11239: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.11240: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase Source.11241: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.11242: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3 Source.11243: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.11244: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.11245: DFBPPR15163 ---- Microorganism protein ---- Ubiquitin-related modifier 1 Source.11246: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain Source.11247: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.11248: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1 Source.11249: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.11250: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1 Source.11251: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.11252: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.11253: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.11254: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.11255: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.11256: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1 Source.11257: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.11258: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1 Source.11259: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.11260: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C Source.11261: DFBPPR15185 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 8 Source.11262: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2 Source.11263: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase Source.11264: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.11265: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.11266: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I Source.11267: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase Source.11268: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9 Source.11269: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3 Source.11270: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.11271: DFBPPR15204 ---- Microorganism protein ---- FK506-binding protein 1 Source.11272: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase Source.11273: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase Source.11274: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.11275: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.11276: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.11277: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.11278: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1 Source.11279: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60 Source.11280: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1 Source.11281: DFBPPR15223 ---- Microorganism protein ---- FK506-binding protein 2 Source.11282: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.11283: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4 Source.11284: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.11285: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4 Source.11286: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.11287: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1 Source.11288: DFBPPR15237 ---- Microorganism protein ---- U6 snRNA-associated Sm-like protein LSm6 Source.11289: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.11290: DFBPPR15239 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 9 Source.11291: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B Source.11292: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3 Source.11293: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2 Source.11294: DFBPPR15244 ---- Microorganism protein ---- DASH complex subunit SPC19 Source.11295: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial Source.11296: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a Source.11297: DFBPPR15248 ---- Microorganism protein ---- DASH complex subunit SPC34 Source.11298: DFBPPR15251 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP38 Source.11299: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.11300: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.11301: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1 Source.11302: DFBPPR15258 ---- Microorganism protein ---- Invertase Source.11303: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase Source.11304: DFBPPR15261 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit alpha Source.11305: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4 Source.11306: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.11307: DFBPPR15267 ---- Microorganism protein ---- Cofilin Source.11308: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3 Source.11309: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25 Source.11310: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.11311: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.11312: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase Source.11313: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.11314: DFBPPR15277 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 20 Source.11315: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.11316: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.11317: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase Source.11318: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1 Source.11319: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase Source.11320: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12 Source.11321: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2 Source.11322: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9 Source.11323: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D Source.11324: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta Source.11325: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.11326: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.11327: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.11328: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.11329: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.11330: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase Source.11331: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106 Source.11332: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1 Source.11333: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7 Source.11334: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.11335: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4 Source.11336: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21 Source.11337: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.11338: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.11339: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.11340: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5 Source.11341: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.11342: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2 Source.11343: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1 Source.11344: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2 Source.11345: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3 Source.11346: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3 Source.11347: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.11348: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1 Source.11349: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial Source.11350: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.11351: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.11352: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.11353: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.11354: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.11355: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase Source.11356: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase Source.11357: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.11358: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.11359: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog Source.11360: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase Source.11361: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5 Source.11362: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.11363: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80 Source.11364: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1 Source.11365: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17 Source.11366: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.11367: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1 Source.11368: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.11369: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.11370: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.11371: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41 Source.11372: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1 Source.11373: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1 Source.11374: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.11375: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3 Source.11376: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2 Source.11377: DFBPPR15410 ---- Microorganism protein ---- Mitochondrial inner membrane protease ATP23 Source.11378: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1 Source.11379: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59 Source.11380: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2 Source.11381: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16 Source.11382: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1 Source.11383: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.11384: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase Source.11385: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.11386: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82 Source.11387: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.11388: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3 Source.11389: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3 Source.11390: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101 Source.11391: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1 Source.11392: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.11393: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase Source.11394: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1 Source.11395: DFBPPR15440 ---- Microorganism protein ---- Mitochondrial homologous recombination protein 1 Source.11396: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2 Source.11397: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22 Source.11398: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.11399: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22 Source.11400: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1 Source.11401: DFBPPR15451 ---- Microorganism protein ---- GrpE protein homolog, mitochondrial Source.11402: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase Source.11403: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial Source.11404: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.11405: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.11406: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1 Source.11407: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.11408: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.11409: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1 Source.11410: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.11411: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.11412: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1 Source.11413: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.11414: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.11415: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.11416: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44 Source.11417: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.11418: DFBPPR15484 ---- Microorganism protein ---- Protein TOS6 Source.11419: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.11420: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1 Source.11421: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.11422: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1 Source.11423: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6 Source.11424: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.11425: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123 Source.11426: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62 Source.11427: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.11428: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.11429: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5 Source.11430: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.11431: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32 Source.11432: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11 Source.11433: DFBPPR15505 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC15 Source.11434: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.11435: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3 Source.11436: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1 Source.11437: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.11438: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1 Source.11439: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101 Source.11440: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10 Source.11441: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3 Source.11442: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.11443: DFBPPR15530 ---- Microorganism protein ---- Translationally-controlled tumor protein homolog Source.11444: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5 Source.11445: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta Source.11446: DFBPPR15537 ---- Microorganism protein ---- mRNA 3'-end-processing protein YTH1 Source.11447: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.11448: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase Source.11449: DFBPPR15541 ---- Microorganism protein ---- F-actin-capping protein subunit alpha Source.11450: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.11451: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial Source.11452: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase Source.11453: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25 Source.11454: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.11455: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14 Source.11456: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4 Source.11457: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110 Source.11458: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial Source.11459: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.11460: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.11461: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.11462: DFBPPR15562 ---- Microorganism protein ---- Mitotic spindle-associated protein SHE1 Source.11463: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1 Source.11464: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2 Source.11465: DFBPPR15567 ---- Microorganism protein ---- Mating-type protein A2 Source.11466: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1 Source.11467: DFBPPR15572 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 2, mitochondrial Source.11468: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1 Source.11469: DFBPPR15574 ---- Microorganism protein ---- Protein PXR1 Source.11470: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381 Source.11471: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7 Source.11472: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6 Source.11473: DFBPPR15583 ---- Microorganism protein ---- DNA replication complex GINS protein PSF3 Source.11474: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.11475: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28 Source.11476: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1 Source.11477: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.11478: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27 Source.11479: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.11480: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial Source.11481: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.11482: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2 Source.11483: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase Source.11484: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1 Source.11485: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2 Source.11486: DFBPPR15606 ---- Microorganism protein ---- Assembly factor CBP4 Source.11487: DFBPPR15608 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP2 Source.11488: DFBPPR15609 ---- Microorganism protein ---- Shugoshin Source.11489: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2 Source.11490: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.11491: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.11492: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5 Source.11493: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial Source.11494: DFBPPR15621 ---- Microorganism protein ---- Spore membrane assembly protein 2 Source.11495: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.11496: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.11497: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12 Source.11498: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1 Source.11499: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7 Source.11500: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.11501: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.11502: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7 Source.11503: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3 Source.11504: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5 Source.11505: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2 Source.11506: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3 Source.11507: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22 Source.11508: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.11509: DFBPPR15654 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.11510: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18 Source.11511: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11 Source.11512: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1 Source.11513: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1 Source.11514: DFBPPR15664 ---- Microorganism protein ---- Spindle pole body component SPC42 Source.11515: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25 Source.11516: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial Source.11517: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1 Source.11518: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial Source.11519: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.11520: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6 Source.11521: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21 Source.11522: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1 Source.11523: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.11524: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2 Source.11525: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14 Source.11526: DFBPPR15688 ---- Microorganism protein ---- Nuclear transport factor 2 Source.11527: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.11528: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3 Source.11529: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1 Source.11530: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.11531: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1 Source.11532: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2 Source.11533: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.11534: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.11535: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.11536: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.11537: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.11538: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23 Source.11539: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.11540: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial Source.11541: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial Source.11542: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial Source.11543: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.11544: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2 Source.11545: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial Source.11546: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial Source.11547: DFBPPR15725 ---- Microorganism protein ---- Protein DML1 Source.11548: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.11549: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.11550: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1 Source.11551: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5 Source.11552: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g Source.11553: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5 Source.11554: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial Source.11555: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1 Source.11556: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog Source.11557: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1 Source.11558: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86 Source.11559: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.11560: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6 Source.11561: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3 Source.11562: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.11563: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.11564: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111 Source.11565: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial Source.11566: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial Source.11567: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6 Source.11568: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4 Source.11569: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.11570: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial Source.11571: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.11572: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g Source.11573: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32 Source.11574: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase Source.11575: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.11576: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.11577: DFBPPR15802 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurQ Source.11578: DFBPPR15803 ---- Microorganism protein ---- Galactokinase Source.11579: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase Source.11580: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.11581: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component Source.11582: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.11583: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase Source.11584: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.11585: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.11586: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase Source.11587: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase Source.11588: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD Source.11589: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.11590: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component Source.11591: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase Source.11592: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain Source.11593: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase Source.11594: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase Source.11595: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.11596: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR Source.11597: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT Source.11598: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.11599: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.11600: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.11601: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.11602: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase Source.11603: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.11604: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase Source.11605: DFBPPR15845 ---- Microorganism protein ---- Calmodulin Source.11606: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.11607: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.11608: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.11609: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.11610: DFBPPR15856 ---- Microorganism protein ---- Laccase-2 Source.11611: DFBPPR15857 ---- Microorganism protein ---- Laccase-1 Source.11612: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase Source.11613: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.11614: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.11615: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.11616: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.11617: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase Source.11618: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase Source.11619: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.11620: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase Source.11621: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11622: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11623: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.11624: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase Source.11625: DFBPPR15886 ---- Microorganism protein ---- Capsid protein Source.11626: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.11627: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1 Source.11628: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase Source.11629: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.11630: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1 Source.11631: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11632: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2 Source.11633: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.11634: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.11635: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.11636: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4 Source.11637: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase Source.11638: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.11639: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.11640: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.11641: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.11642: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.11643: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.11644: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase Source.11645: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.11646: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11647: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.11648: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.11649: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.11650: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A Source.11651: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.11652: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.11653: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B Source.11654: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.11655: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11656: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase Source.11657: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein Source.11658: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.11659: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.11660: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.11661: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial Source.11662: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.11663: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.11664: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.11665: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase Source.11666: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.11667: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.11668: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.11669: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.11670: DFBPPR7794 ---- Plant protein ---- Cytochrome b6 Source.11671: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.11672: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.11673: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.11674: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.11675: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.11676: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.11677: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.11678: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.11679: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.11680: DFBPPR7810 ---- Plant protein ---- Cytochrome f Source.11681: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.11682: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.11683: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.11684: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.11685: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.11686: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.11687: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta Source.11688: DFBPPR7824 ---- Plant protein ---- Cytochrome b559 subunit alpha Source.11689: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.11690: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.11691: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.11692: DFBPPR7833 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.11693: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a Source.11694: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic Source.11695: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.11696: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.11697: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.11698: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.11699: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.11700: DFBPPR7844 ---- Plant protein ---- Actin-1 Source.11701: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.11702: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.11703: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.11704: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.11705: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.11706: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a Source.11707: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic Source.11708: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1 Source.11709: DFBPPR7856 ---- Plant protein ---- Maturase K Source.11710: DFBPPR7859 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.11711: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1 Source.11712: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.11713: DFBPPR7863 ---- Plant protein ---- 50S ribosomal protein L23-B, chloroplastic Source.11714: DFBPPR7865 ---- Plant protein ---- 50S ribosomal protein L23-A, chloroplastic Source.11715: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.11716: DFBPPR7872 ---- Plant protein ---- Photosystem II reaction center protein J Source.11717: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4 Source.11718: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1 Source.11719: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.11720: DFBPPR7881 ---- Plant protein ---- 50S ribosomal protein L20, chloroplastic Source.11721: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.11722: DFBPPR7888 ---- Plant protein ---- Photosystem II reaction center protein Z Source.11723: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1 Source.11724: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1 Source.11725: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1 Source.11726: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1 Source.11727: DFBPPR7897 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic Source.11728: DFBPPR7904 ---- Plant protein ---- Photosystem I reaction center subunit VIII Source.11729: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.11730: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2 Source.11731: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1 Source.11732: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1 Source.11733: DFBPPR7912 ---- Plant protein ---- Chloroplast envelope membrane protein Source.11734: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2 Source.11735: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.11736: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.11737: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1 Source.11738: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.11739: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.11740: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic Source.11741: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.11742: DFBPPR7933 ---- Plant protein ---- FK506-binding protein 2 Source.11743: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.11744: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic Source.11745: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.11746: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic Source.11747: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1 Source.11748: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.11749: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.11750: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.11751: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1 Source.11752: DFBPPR7947 ---- Plant protein ---- Legumin type B Source.11753: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.11754: DFBPPR7949 ---- Plant protein ---- Cytochrome f Source.11755: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP Source.11756: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.11757: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.11758: DFBPPR7954 ---- Plant protein ---- Favin Source.11759: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1 Source.11760: DFBPPR7956 ---- Plant protein ---- Legumin type B Source.11761: DFBPPR7957 ---- Plant protein ---- Legumin type B Source.11762: DFBPPR7958 ---- Plant protein ---- Legumin type B Source.11763: DFBPPR7959 ---- Plant protein ---- Leghemoglobin 49 Source.11764: DFBPPR7960 ---- Plant protein ---- Vicilin Source.11765: DFBPPR7963 ---- Plant protein ---- Leghemoglobin 29 Source.11766: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.11767: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1 Source.11768: DFBPPR7967 ---- Plant protein ---- Plastocyanin Source.11769: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92 Source.11770: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87 Source.11771: DFBPPR7973 ---- Plant protein ---- Maturase K Source.11772: DFBPPR7975 ---- Plant protein ---- Protein Ycf2 Source.11773: DFBPPR7977 ---- Plant protein ---- Ribosomal protein S14, mitochondrial Source.11774: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein Source.11775: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1 Source.11776: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B Source.11777: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A Source.11778: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.11779: DFBPPR7989 ---- Plant protein ---- Cytochrome c Source.11780: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11781: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.11782: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11783: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.11784: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B Source.11785: DFBPPR7996 ---- Plant protein ---- Cytochrome b559 subunit alpha Source.11786: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.11787: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.11788: DFBPPR8002 ---- Plant protein ---- Plastocyanin Source.11789: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein Source.11790: DFBPPR8025 ---- Plant protein ---- Unknown protein 12 Source.11791: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase Source.11792: DFBPPR8029 ---- Plant protein ---- Vignain Source.11793: DFBPPR8030 ---- Plant protein ---- Arcelin-5A Source.11794: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.11795: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1 Source.11796: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.11797: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.11798: DFBPPR8037 ---- Plant protein ---- Arcelin-1 Source.11799: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11800: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.11801: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.11802: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1 Source.11803: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.11804: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11805: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.11806: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.11807: DFBPPR8049 ---- Plant protein ---- Bowman-Birk type proteinase inhibitor 2 Source.11808: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein Source.11809: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.11810: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.11811: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic Source.11812: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha Source.11813: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.11814: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.11815: DFBPPR8063 ---- Plant protein ---- Leghemoglobin A Source.11816: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.11817: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3 Source.11818: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.11819: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.11820: DFBPPR8073 ---- Plant protein ---- Arcelin-5B Source.11821: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.11822: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.11823: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1 Source.11824: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme Source.11825: DFBPPR8082 ---- Plant protein ---- Plastocyanin Source.11826: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase Source.11827: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.11828: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.11829: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.11830: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.11831: DFBPPR8091 ---- Plant protein ---- Cytochrome f Source.11832: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.11833: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.11834: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.11835: DFBPPR8099 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.11836: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.11837: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.11838: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.11839: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.11840: DFBPPR8107 ---- Plant protein ---- Stress-related protein Source.11841: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1 Source.11842: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A Source.11843: DFBPPR8110 ---- Plant protein ---- Leghemoglobin Source.11844: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.11845: DFBPPR8112 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.11846: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.11847: DFBPPR8114 ---- Plant protein ---- Arcelin-2 Source.11848: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.11849: DFBPPR8119 ---- Plant protein ---- Chalcone--flavonone isomerase Source.11850: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.11851: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.11852: DFBPPR8122 ---- Plant protein ---- Arcelin-4 Source.11853: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.11854: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.11855: DFBPPR8144 ---- Plant protein ---- Maturase K Source.11856: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.11857: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2 Source.11858: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.11859: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0 Source.11860: DFBPPR8159 ---- Plant protein ---- Chloroplast envelope membrane protein Source.11861: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.11862: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.11863: DFBPPR8183 ---- Plant protein ---- 26 kDa cell wall protein Source.11864: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.11865: DFBPPR8214 ---- Plant protein ---- Cytochrome c Source.11866: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase Source.11867: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.11868: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase Source.11869: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.11870: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.11871: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1 Source.11872: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.11873: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11874: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein Source.11875: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.11876: DFBPPR8228 ---- Plant protein ---- Albumin-8 Source.11877: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.11878: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase Source.11879: DFBPPR8234 ---- Plant protein ---- Anther-specific protein SF18 Source.11880: DFBPPR8235 ---- Plant protein ---- Catalase Source.11881: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.11882: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.11883: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.11884: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.11885: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.11886: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.11887: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.11888: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.11889: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.11890: DFBPPR8259 ---- Plant protein ---- Cytochrome f Source.11891: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.11892: DFBPPR8261 ---- Plant protein ---- Photosystem II reaction center protein H Source.11893: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.11894: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.11895: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.11896: DFBPPR8267 ---- Plant protein ---- Cytochrome b559 subunit alpha Source.11897: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.11898: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.11899: DFBPPR8271 ---- Plant protein ---- Cytochrome b6 Source.11900: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.11901: DFBPPR8273 ---- Plant protein ---- Anther-specific protein SF2 Source.11902: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.11903: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.11904: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.11905: DFBPPR8278 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.11906: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.11907: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.11908: DFBPPR8284 ---- Plant protein ---- Calmodulin Source.11909: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog Source.11910: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.11911: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.11912: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein Source.11913: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase Source.11914: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.11915: DFBPPR8299 ---- Plant protein ---- 50S ribosomal protein L23, chloroplastic Source.11916: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.11917: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5 Source.11918: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.11919: DFBPPR8306 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic Source.11920: DFBPPR8314 ---- Plant protein ---- Maturase K Source.11921: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.11922: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1 Source.11923: DFBPPR8322 ---- Plant protein ---- Photosystem II reaction center protein J Source.11924: DFBPPR8324 ---- Plant protein ---- Photosystem II reaction center protein Z Source.11925: DFBPPR8334 ---- Plant protein ---- Photosystem I reaction center subunit VIII Source.11926: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.11927: DFBPPR8339 ---- Plant protein ---- Cysteine proteinase inhibitor B Source.11928: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a Source.11929: DFBPPR8343 ---- Plant protein ---- Chloroplast envelope membrane protein Source.11930: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.11931: DFBPPR8348 ---- Plant protein ---- 30S ribosomal protein S16, chloroplastic Source.11932: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein Source.11933: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein Source.11934: DFBPPR8356 ---- Plant protein ---- Unknown protein 1
Link-research Inductive analysis	Link 1: DFBPACEI0108----Cotton leafworm, Spodoptera littoralis (Lepidoptera)----Cotton leafworm hydrolysates Link 2: DFBPACEI1194----Wakame (Undaria pinnatifida)----Extract of wakame powder Link 3: DFBPACEI1362----Wheat----Wheat germ hydrolysates Link 4: DFBPACEI0484----Sardine muscle----Muscle protein

Biological/Functional activity & target protein

ACE-inhibitory activity

(1) Amaranth trypsin-digested glutelins induce endothelial NO production and consequent vasodilation through their ACE-inhibitory activity. The peptide VF was isolated from the highest active fraction, so the peptide was a potential Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory peptide (No valid IC₅₀ value was determined in this study).
(2) The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 53 uM ^[1].

Specific target protein(s)

Specific Target Protein(s):
Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Native amaranth glutelins were digested with trypsin (Sigma-Aldrich, St. Louis, MO, USA) at an enzyme/substrate ratio of 1:10 (w/w) for 10 h at 37 ℃.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

Amaranth trypsin-digested glutelins have a high potential as a nutraceutical food in prevention of cardiovascular diseases.

Database cross-references

DFBP

[D1]	DFBPANHY0593
[D2]	DFBPMUFU0045

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	de la Rosa AP, Montoya AB, Martínez-Cuevas P, Hernández-Ledesma B, León-Galván MF, De León-Rodríguez A, González C. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides. Nitric Oxide. 2010 Sep 15;23(2):106-11. PMID: 20435155 DOI: 10.1016/j.niox.2010.04.006
Other literature(s)	[1] Cushman D. W., 1981. Angiotensin converting enzyme inhibitors: Evolution of a new class of antihypertensive drugs (page 19). in: Horovitz Z. P. (Ed.)(1981), Mechanisms of action and clinical implications, Urban & Schwarzenberg. [2] Matsufuji H, Matsui T, Seki E, et al. Angiotensin I-converting Enzyme Inhibitory Peptides in an Alkaline Protease Hydrolyzate Derived from Sardine Muscle[J]. Bioscience Biotechnology & Biochemistry, 1994, 58(12):2244-2245.
PubDate	2010