E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1929(ACE-inhibitory peptide)
DFBP ID DFBPACEI1929
Peptide sequence VAA
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Val-Ala-Ala
Single-letter amino acid VAA
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 259.30 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 2.6000 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Amaranth seed proteins
Precursor protein Amaranth glutelins
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit
Source.3: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.4: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.5: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.6: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.7: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.8: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.9: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.10: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.11: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.12: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.13: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.14: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.15: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.16: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.17: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.18: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.19: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.20: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.21: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.22: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.23: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.24: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.25: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.26: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.27: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.28: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.29: DFBPPR0876 ---- Plant proteins ---- Protein BZR1 homolog 1
Source.30: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.31: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.32: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.33: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.34: DFBPPR0886 ---- Plant proteins ---- Abscisic acid receptor PYL5
Source.35: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.36: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.37: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.38: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.39: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.40: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.41: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.42: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.43: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.44: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.45: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.46: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.47: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.48: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.49: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase
Source.50: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.51: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.52: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.53: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.54: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.55: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.56: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.57: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.58: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.59: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.60: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.61: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.62: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.63: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.64: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.65: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.66: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50
Source.67: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.68: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.69: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.70: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.71: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.72: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.73: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.74: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.75: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.76: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.77: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.78: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.79: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.80: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.81: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.82: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.83: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.84: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.85: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.86: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.87: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.88: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.89: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.90: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.91: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.92: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.93: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.94: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.95: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.96: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.97: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.98: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.99: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.100: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.101: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.102: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.103: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.104: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.105: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.106: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.107: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.108: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.109: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.110: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.111: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.112: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.113: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.114: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.115: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.116: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.117: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13
Source.118: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.119: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.120: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.121: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.122: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.123: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.124: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.125: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.126: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.127: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.128: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.129: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.130: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.131: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.132: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.133: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.134: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.135: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.136: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.137: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.138: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.139: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.140: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.141: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.142: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.143: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6
Source.144: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.145: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.146: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.147: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.148: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.149: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.150: DFBPPR1176 ---- Plant proteins ---- Chitinase 12
Source.151: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.152: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic
Source.153: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA
Source.154: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.155: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.156: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.157: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.158: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.159: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.160: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.161: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.162: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.163: DFBPPR1253 ---- Plant proteins ---- Phospholipase A2 homolog 3
Source.164: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.165: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.166: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.167: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.168: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.169: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.170: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.171: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.172: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.173: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.174: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.175: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.176: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.177: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.178: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.179: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.180: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.181: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.182: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.183: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic
Source.184: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.185: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.186: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.187: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.188: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.189: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.190: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.191: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.192: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.193: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.194: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.195: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.196: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.197: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.198: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.199: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.200: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.201: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.202: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.203: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.204: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.205: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.206: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.207: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.208: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.209: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.210: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.211: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.212: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.213: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.214: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.215: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.216: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.217: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.218: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.219: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.220: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.221: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.222: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.223: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.224: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.225: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156
Source.226: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.227: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.228: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.229: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic
Source.230: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.231: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.232: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.233: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.234: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.235: DFBPPR1444 ---- Plant proteins ---- Cysteine proteinase inhibitor 1
Source.236: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.237: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.238: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.239: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.240: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1
Source.241: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.242: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.243: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.244: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.245: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.246: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.247: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.248: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.249: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.250: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.251: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.252: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.253: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.254: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.255: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.256: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.257: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.258: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.259: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.260: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.261: DFBPPR1497 ---- Plant proteins ---- Chitinase 1
Source.262: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.263: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.264: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.265: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1
Source.266: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.267: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.268: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.269: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.270: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.271: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.272: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.273: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5
Source.274: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.275: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.276: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.277: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.278: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.279: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.280: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.281: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8
Source.282: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal
Source.283: DFBPPR1540 ---- Plant proteins ---- Protein DROOPING LEAF
Source.284: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.285: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.286: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.287: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.288: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.289: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.290: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.291: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.292: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.293: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.294: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.295: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.296: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.297: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.298: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.299: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.300: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.301: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.302: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic
Source.303: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.304: DFBPPR1600 ---- Plant proteins ---- Phytosulfokines 5
Source.305: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.306: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.307: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.308: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.309: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.310: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.311: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.312: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.313: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a
Source.314: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.315: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.316: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.317: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.318: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.319: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.320: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.321: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.322: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.323: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.324: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.325: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.326: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.327: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.328: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.329: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.330: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.331: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.332: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.333: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.334: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.335: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.336: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.337: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.338: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.339: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.340: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.341: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.342: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.343: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.344: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.345: DFBPPR1696 ---- Plant proteins ---- Phytosulfokines 2
Source.346: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.347: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.348: DFBPPR1706 ---- Plant proteins ---- Phytosulfokines 4
Source.349: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.350: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.351: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.352: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.353: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.354: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.355: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1
Source.356: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.357: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.358: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.359: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.360: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.361: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.362: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.363: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.364: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.365: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.366: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.367: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.368: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.369: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.370: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.371: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.372: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.373: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1
Source.374: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.375: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.376: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.377: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.378: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.379: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.380: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.381: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.382: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.383: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.384: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.385: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.386: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.387: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.388: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.389: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.390: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.391: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.392: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.393: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.394: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic
Source.395: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.396: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.397: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.398: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.399: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.400: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.401: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.402: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.403: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.404: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.405: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.406: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.407: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.408: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.409: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.410: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.411: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.412: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.413: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.414: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.415: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.416: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.417: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.418: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.419: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.420: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.421: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.422: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.423: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.424: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.425: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.426: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.427: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.428: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.429: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.430: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.431: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.432: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.433: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.434: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.435: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.436: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.437: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.438: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.439: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.440: DFBPPR1940 ---- Plant proteins ---- Histone H3.2
Source.441: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.442: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.443: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.444: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.445: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.446: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.447: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1
Source.448: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.449: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.450: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.451: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.452: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.453: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.454: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.455: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.456: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.457: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.458: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.459: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.460: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.461: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.462: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.463: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.464: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.465: DFBPPR2015 ---- Plant proteins ---- 50S ribosomal protein L12, chloroplastic
Source.466: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.467: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.468: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5
Source.469: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.470: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.471: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.472: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.473: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1
Source.474: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.475: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.476: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.477: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.478: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.479: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.480: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.481: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.482: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.483: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.484: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.485: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.486: DFBPPR2063 ---- Plant proteins ---- Non-specific lipid-transfer protein C6
Source.487: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.488: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa
Source.489: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.490: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.491: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.492: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.493: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.494: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.495: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.496: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.497: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.498: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1
Source.499: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.500: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.501: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.502: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.503: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.504: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.505: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.506: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.507: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.508: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1
Source.509: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.510: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.511: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.512: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.513: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.514: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.515: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.516: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.517: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.518: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.519: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2
Source.520: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.521: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.522: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.523: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.524: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.525: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.526: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.527: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.528: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.529: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.530: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.531: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.532: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.533: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.534: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.535: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.536: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.537: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.538: DFBPPR2206 ---- Plant proteins ---- Leucine-rich repeat protein 1
Source.539: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.540: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21
Source.541: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.542: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.543: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4
Source.544: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.545: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.546: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.547: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.548: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.549: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic
Source.550: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.551: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.552: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.553: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.554: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.555: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.556: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.557: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.558: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.559: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.560: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.561: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.562: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.563: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.564: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.565: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.566: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.567: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.568: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.569: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.570: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.571: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.572: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.573: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.574: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.575: DFBPPR2309 ---- Plant proteins ---- Two-component response regulator ORR6
Source.576: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.577: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.578: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.579: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic
Source.580: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.581: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.582: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.583: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.584: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.585: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.586: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.587: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.588: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.589: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.590: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.591: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.592: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.593: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.594: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6
Source.595: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.596: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.597: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.598: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.599: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.600: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic
Source.601: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.602: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.603: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.604: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.605: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.606: DFBPPR2381 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.607: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.608: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.609: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.610: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.611: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.612: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase
Source.613: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.614: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.615: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.616: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.617: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.618: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.619: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.620: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.621: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.622: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.623: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.624: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.625: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1
Source.626: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.627: DFBPPR2438 ---- Plant proteins ---- Arabinogalactan protein 1
Source.628: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B
Source.629: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.630: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.631: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.632: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.633: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.634: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.635: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.636: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.637: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.638: DFBPPR2462 ---- Plant proteins ---- Arabinogalactan peptide 1
Source.639: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.640: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.641: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.642: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.643: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.644: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.645: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.646: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.647: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.648: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.649: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.650: DFBPPR2500 ---- Plant proteins ---- Arabinogalactan peptide 2
Source.651: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.652: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic
Source.653: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.654: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.655: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9
Source.656: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.657: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.658: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.659: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.660: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.661: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.662: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.663: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.664: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300
Source.665: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.666: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.667: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.668: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.669: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.670: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.671: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.672: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.673: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.674: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.675: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.676: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9
Source.677: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.678: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.679: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.680: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.681: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20
Source.682: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.683: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.684: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.685: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.686: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.687: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.688: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1
Source.689: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.690: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.691: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.692: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.693: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.694: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.695: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19
Source.696: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.697: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2
Source.698: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.699: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.700: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.701: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.702: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.703: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.704: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.705: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial
Source.706: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.707: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.708: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.709: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.710: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.711: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.712: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.713: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.714: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.715: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2
Source.716: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.717: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.718: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.719: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.720: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.721: DFBPPR2684 ---- Plant proteins ---- Arabinogalactan peptide 3
Source.722: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.723: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic
Source.724: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.725: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.726: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.727: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.728: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.729: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.730: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.731: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.732: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.733: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.734: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.735: DFBPPR2754 ---- Plant proteins ---- Adenylate kinase 3
Source.736: DFBPPR2755 ---- Plant proteins ---- Adenylate kinase 4
Source.737: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.738: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.739: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.740: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.741: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.742: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.743: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.744: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.745: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.746: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.747: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.748: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS
Source.749: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.750: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.751: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.752: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.753: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.754: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.755: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.756: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.757: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.758: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.759: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.760: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.761: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.762: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.763: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.764: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.765: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.766: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.767: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.768: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B
Source.769: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.770: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.771: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.772: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.773: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.774: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.775: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.776: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.777: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B
Source.778: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.779: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.780: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32
Source.781: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.782: DFBPPR2889 ---- Plant proteins ---- Monothiol glutaredoxin-S1, mitochondrial
Source.783: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.784: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.785: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.786: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.787: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.788: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.789: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.790: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.791: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2
Source.792: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.793: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3
Source.794: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.795: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.796: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.797: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.798: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.799: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.800: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.801: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.802: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.803: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.804: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.805: DFBPPR2970 ---- Plant proteins ---- Germin-like protein 1-2
Source.806: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.807: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.808: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.809: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.810: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.811: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.812: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.813: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.814: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.815: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.816: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.817: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.818: DFBPPR3017 ---- Plant proteins ---- Expansin-A12
Source.819: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.820: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.821: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.822: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.823: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.824: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.825: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.826: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.827: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.828: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.829: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.830: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.831: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.832: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8
Source.833: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1
Source.834: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.835: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.836: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.837: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.838: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.839: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.840: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.841: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.842: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.843: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.844: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.845: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.846: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.847: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.848: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.849: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.850: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.851: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.852: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.853: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.854: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1
Source.855: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7
Source.856: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.857: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.858: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.859: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.860: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.861: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.862: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.863: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.864: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.865: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.866: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13
Source.867: DFBPPR3143 ---- Plant proteins ---- Protein OS-9 homolog
Source.868: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.869: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.870: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.871: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.872: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.873: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.874: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.875: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.876: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.877: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.878: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.879: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.880: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.881: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.882: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17
Source.883: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.884: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.885: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.886: DFBPPR3200 ---- Plant proteins ---- Two-component response regulator ORR11
Source.887: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.888: DFBPPR3203 ---- Plant proteins ---- Monothiol glutaredoxin-S10
Source.889: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.890: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.891: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.892: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.893: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.894: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.895: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.896: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.897: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.898: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.899: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.900: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.901: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.902: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.903: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic
Source.904: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.905: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.906: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.907: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.908: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.909: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.910: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.911: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.912: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.913: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.914: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.915: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.916: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.917: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.918: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.919: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.920: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.921: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.922: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.923: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.924: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.925: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.926: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b
Source.927: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.928: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.929: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4
Source.930: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.931: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.932: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.933: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.934: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.935: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.936: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.937: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.938: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.939: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.940: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.941: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.942: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.943: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.944: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.945: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.946: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.947: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.948: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.949: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.950: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.951: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.952: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.953: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.954: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.955: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.956: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.957: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.958: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.959: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.960: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.961: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.962: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.963: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.964: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.965: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.966: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.967: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.968: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.969: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.970: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3
Source.971: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.972: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.973: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.974: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.975: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.976: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.977: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.978: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.979: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3
Source.980: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.981: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.982: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.983: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.984: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.985: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.986: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.987: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.988: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.989: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.990: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.991: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.992: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.993: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5
Source.994: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.995: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19
Source.996: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.997: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.998: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32
Source.999: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1000: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.1001: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.1002: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.1003: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1004: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.1005: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.1006: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.1007: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.1008: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.1009: DFBPPR3523 ---- Plant proteins ---- Ubiquitin-like protein ATG12
Source.1010: DFBPPR3525 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.1011: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1012: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.1013: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10
Source.1014: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.1015: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1016: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1017: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7
Source.1018: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.1019: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.1020: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.1021: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.1022: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.1023: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.1024: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1025: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1026: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5
Source.1027: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.1028: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.1029: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1030: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17
Source.1031: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1032: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1033: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1034: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1035: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial
Source.1036: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.1037: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1038: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.1039: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.1040: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1041: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1042: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1043: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.1044: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.1045: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.1046: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1047: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.1048: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1049: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.1050: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.1051: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1052: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.1053: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1054: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.1055: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1056: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1057: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.1058: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1059: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.1060: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1061: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1062: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.1063: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.1064: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.1065: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.1066: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3
Source.1067: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.1068: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.1069: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.1070: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.1071: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4
Source.1072: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.1073: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1074: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.1075: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.1076: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.1077: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1
Source.1078: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1079: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.1080: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.1081: DFBPPR3753 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.1082: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.1083: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.1084: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.1085: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1086: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1087: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.1088: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.1089: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.1090: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.1091: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4
Source.1092: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.1093: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.1094: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial
Source.1095: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55
Source.1096: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.1097: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42
Source.1098: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.1099: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.1100: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.1101: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1102: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.1103: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.1104: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.1105: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.1106: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.1107: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.1108: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.1109: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.1110: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.1111: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.1112: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.1113: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.1114: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.1115: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.1116: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.1117: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.1118: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.1119: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.1120: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.1121: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1122: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.1123: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2
Source.1124: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.1125: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.1126: DFBPPR3884 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.1127: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.1128: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.1129: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.1130: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.1131: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.1132: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.1133: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.1134: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.1135: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.1136: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5
Source.1137: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.1138: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.1139: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.1140: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1141: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1142: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.1143: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.1144: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1145: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.1146: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.1147: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.1148: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10
Source.1149: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.1150: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.1151: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.1152: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.1153: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.1154: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.1155: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.1156: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.1157: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.1158: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.1159: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.1160: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.1161: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4
Source.1162: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.1163: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.1164: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.1165: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7
Source.1166: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1167: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.1168: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.1169: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.1170: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.1171: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.1172: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.1173: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.1174: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.1175: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.1176: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1177: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.1178: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.1179: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.1180: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1181: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f
Source.1182: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.1183: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.1184: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.1185: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1186: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.1187: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.1188: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.1189: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.1190: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.1191: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.1192: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.1193: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.1194: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.1195: DFBPPR4051 ---- Plant proteins ---- 40S ribosomal protein S3a
Source.1196: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.1197: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.1198: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.1199: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A
Source.1200: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.1201: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.1202: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.1203: DFBPPR4068 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 6
Source.1204: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.1205: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.1206: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.1207: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.1208: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.1209: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.1210: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1211: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.1212: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.1213: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.1214: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.1215: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.1216: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.1217: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.1218: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29
Source.1219: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.1220: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1221: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1222: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.1223: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.1224: DFBPPR4104 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.1225: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1226: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.1227: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.1228: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.1229: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.1230: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.1231: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.1232: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.1233: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.1234: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1235: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.1236: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.1237: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1238: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.1239: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.1240: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.1241: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1242: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1243: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.1244: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.1245: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1246: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.1247: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1248: DFBPPR4164 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 1
Source.1249: DFBPPR4166 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.1250: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3
Source.1251: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.1252: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1253: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1254: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.1255: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1256: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.1257: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2
Source.1258: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1259: DFBPPR4199 ---- Plant proteins ---- Protein transport protein Sec61 subunit gamma
Source.1260: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1
Source.1261: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1262: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.1263: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1264: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1265: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.1266: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1267: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.1268: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2
Source.1269: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.1270: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1271: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1272: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1273: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.1274: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.1275: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.1276: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.1277: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.1278: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.1279: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.1280: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1281: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.1282: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1283: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1284: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.1285: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.1286: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.1287: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1288: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.1289: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.1290: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.1291: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.1292: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.1293: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.1294: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20
Source.1295: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1296: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.1297: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.1298: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.1299: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.1300: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.1301: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1302: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.1303: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1304: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.1305: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.1306: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.1307: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.1308: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.1309: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.1310: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.1311: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.1312: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1313: DFBPPR4345 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 11
Source.1314: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.1315: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1316: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.1317: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.1318: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9
Source.1319: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.1320: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.1321: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.1322: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.1323: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.1324: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.1325: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.1326: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.1327: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.1328: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1329: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.1330: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.1331: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6
Source.1332: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1
Source.1333: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.1334: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1335: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.1336: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1337: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.1338: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.1339: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.1340: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.1341: DFBPPR4407 ---- Plant proteins ---- Mini zinc finger protein 4
Source.1342: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1343: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.1344: DFBPPR4413 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 4
Source.1345: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.1346: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.1347: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1348: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1349: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.1350: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.1351: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.1352: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.1353: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.1354: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.1355: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.1356: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1357: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.1358: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.1359: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.1360: DFBPPR4455 ---- Plant proteins ---- CASP-like protein 5A2
Source.1361: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.1362: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.1363: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.1364: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial
Source.1365: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.1366: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.1367: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.1368: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16
Source.1369: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.1370: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.1371: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.1372: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.1373: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.1374: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.1375: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.1376: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.1377: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.1378: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.1379: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.1380: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.1381: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.1382: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.1383: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1384: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.1385: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.1386: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3
Source.1387: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.1388: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.1389: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.1390: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.1391: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.1392: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.1393: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.1394: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15
Source.1395: DFBPPR4562 ---- Plant proteins ---- Mini zinc finger protein 2
Source.1396: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1
Source.1397: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.1398: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.1399: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.1400: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1
Source.1401: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.1402: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.1403: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.1404: DFBPPR4593 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 15
Source.1405: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.1406: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19
Source.1407: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.1408: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1409: DFBPPR4608 ---- Plant proteins ---- Metallothionein-like protein 3A
Source.1410: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.1411: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.1412: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1413: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.1414: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.1415: DFBPPR4623 ---- Plant proteins ---- Actin-depolymerizing factor 11
Source.1416: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.1417: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.1418: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.1419: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.1420: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.1421: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.1422: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.1423: DFBPPR4658 ---- Plant proteins ---- 60S ribosomal protein L9
Source.1424: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.1425: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.1426: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4
Source.1427: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.1428: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1429: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.1430: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1431: DFBPPR4682 ---- Plant proteins ---- Protein SPIRAL1-like 1
Source.1432: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.1433: DFBPPR4690 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 44
Source.1434: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.1435: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.1436: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5
Source.1437: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.1438: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.1439: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.1440: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.1441: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.1442: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.1443: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4
Source.1444: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.1445: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.1446: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.1447: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.1448: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.1449: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.1450: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1451: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1452: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.1453: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.1454: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.1455: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.1456: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.1457: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7
Source.1458: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.1459: DFBPPR4768 ---- Plant proteins ---- Protein SPIRAL1-like 2
Source.1460: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.1461: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.1462: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.1463: DFBPPR4780 ---- Plant proteins ---- Ripening-related protein 3
Source.1464: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.1465: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.1466: DFBPPR4790 ---- Plant proteins ---- 60S ribosomal protein L30
Source.1467: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.1468: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.1469: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.1470: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.1471: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1
Source.1472: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.1473: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.1474: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.1475: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.1476: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.1477: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1478: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.1479: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.1480: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.1481: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.1482: DFBPPR4854 ---- Plant proteins ---- Putative ripening-related protein 6
Source.1483: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.1484: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.1485: DFBPPR4863 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 1
Source.1486: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.1487: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.1488: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58
Source.1489: DFBPPR4881 ---- Plant proteins ---- Costars family protein
Source.1490: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.1491: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1492: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.1493: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1494: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.1495: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.1496: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5
Source.1497: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.1498: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.1499: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.1500: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.1501: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.1502: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1503: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1504: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.1505: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.1506: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.1507: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.1508: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1509: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.1510: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.1511: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.1512: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.1513: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.1514: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.1515: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.1516: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.1517: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1518: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.1519: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.1520: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.1521: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.1522: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.1523: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1524: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1525: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.1526: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.1527: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.1528: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1529: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.1530: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.1531: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.1532: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.1533: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.1534: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1535: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1536: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.1537: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.1538: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.1539: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.1540: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1541: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.1542: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.1543: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1544: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1545: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.1546: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A
Source.1547: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.1548: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.1549: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1550: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.1551: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.1552: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.1553: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.1554: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1555: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1556: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.1557: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6
Source.1558: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2
Source.1559: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1
Source.1560: DFBPPR5287 ---- Plant proteins ---- Nodulin-24
Source.1561: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.1562: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.1563: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.1564: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.1565: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2
Source.1566: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1567: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1568: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1569: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1570: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1571: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.1572: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1573: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1574: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1575: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.1576: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.1577: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1578: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1579: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.1580: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.1581: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.1582: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.1583: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.1584: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1
Source.1585: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1586: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1587: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1
Source.1588: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1589: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.1590: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.1591: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic
Source.1592: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.1593: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.1594: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.1595: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.1596: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1597: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.1598: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.1599: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1600: DFBPPR5489 ---- Plant proteins ---- Histone H3.2
Source.1601: DFBPPR5494 ---- Plant proteins ---- Peroxidase 70
Source.1602: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66
Source.1603: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.1604: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1605: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1606: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42
Source.1607: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.1608: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1609: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.1610: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1611: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1612: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1613: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.1614: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1615: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.1616: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1617: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1
Source.1618: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1619: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1620: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.1621: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.1622: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.1623: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1624: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A
Source.1625: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1626: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.1627: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1628: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.1629: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.1630: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1631: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.1632: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1633: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.1634: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1635: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.1636: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1637: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.1638: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1639: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.1640: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.1641: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.1642: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.1643: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A
Source.1644: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.1645: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1646: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1647: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.1648: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1649: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1650: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.1651: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.1652: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.1653: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.1654: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.1655: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1656: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.1657: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.1658: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1659: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1660: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1661: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1662: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.1663: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.1664: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.1665: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1666: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1667: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.1668: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.1669: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1670: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.1671: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1672: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.1673: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1674: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1675: DFBPPR5752 ---- Plant proteins ---- 60S acidic ribosomal protein P1
Source.1676: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.1677: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.1678: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1679: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.1680: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.1681: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1682: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.1683: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1684: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1685: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.1686: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2
Source.1687: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.1688: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.1689: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.1690: DFBPPR5839 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.1691: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1692: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1693: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4
Source.1694: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1695: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1696: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5
Source.1697: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16
Source.1698: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1699: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.1700: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.1701: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1
Source.1702: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.1703: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1704: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.1705: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.1706: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1707: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2
Source.1708: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.1709: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1710: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.1711: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3
Source.1712: DFBPPR5914 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase, variable chain
Source.1713: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.1714: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.1715: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.1716: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.1717: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.1718: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.1719: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.1720: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.1721: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.1722: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.1723: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.1724: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.1725: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.1726: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.1727: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.1728: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.1729: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.1730: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.1731: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.1732: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.1733: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.1734: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.1735: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.1736: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.1737: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.1738: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1
Source.1739: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.1740: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1741: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.1742: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.1743: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.1744: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.1745: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1746: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1
Source.1747: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.1748: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2
Source.1749: DFBPPR6052 ---- Plant proteins ---- Cystatin-1
Source.1750: DFBPPR6054 ---- Plant proteins ---- CASP-like protein 5A3
Source.1751: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.1752: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.1753: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1754: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2
Source.1755: DFBPPR6075 ---- Plant proteins ---- MFS18 protein
Source.1756: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1
Source.1757: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.1758: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.1759: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1
Source.1760: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3
Source.1761: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1
Source.1762: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1763: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1
Source.1764: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.1765: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.1766: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1767: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.1768: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49
Source.1769: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17
Source.1770: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.1771: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.1772: DFBPPR6183 ---- Plant proteins ---- Unknown protein from spot 206 of 2D-PAGE of etiolated coleoptile
Source.1773: DFBPPR6184 ---- Plant proteins ---- Unknown protein from spot 237 of 2D-PAGE of etiolated coleoptile
Source.1774: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.1775: DFBPPR6194 ---- Plant proteins ---- Unknown protein from spot 245 of 2D-PAGE of etiolated coleoptile
Source.1776: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.1777: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1778: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.1779: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1780: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.1781: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.1782: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.1783: DFBPPR6231 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1784: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.1785: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1786: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1787: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.1788: DFBPPR6254 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.1789: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.1790: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.1791: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic
Source.1792: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.1793: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.1794: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1795: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.1796: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2
Source.1797: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.1798: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.1799: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial
Source.1800: DFBPPR6303 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.1801: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1802: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.1803: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.1804: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.1805: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.1806: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.1807: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1808: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.1809: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1810: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.1811: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1812: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1813: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.1814: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.1815: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1816: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.1817: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.1818: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1819: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.1820: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1821: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.1822: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1823: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.1824: DFBPPR6421 ---- Plant proteins ---- 50S ribosomal protein L24, chloroplastic
Source.1825: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1826: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.1827: DFBPPR6433 ---- Plant proteins ---- Histone H1
Source.1828: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206
Source.1829: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.1830: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.1831: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.1832: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.1833: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.1834: DFBPPR6502 ---- Plant proteins ---- Early light-induced protein, chloroplastic
Source.1835: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A
Source.1836: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.1837: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1838: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.1839: DFBPPR6618 ---- Plant proteins ---- 50S ribosomal protein L36, chloroplastic
Source.1840: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1841: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.1842: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.1843: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.1844: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.1845: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.1846: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.1847: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1848: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1849: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1850: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.1851: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.1852: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.1853: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.1854: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.1855: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1856: DFBPPR6652 ---- Plant proteins ---- Histone H2A.1
Source.1857: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.1858: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.1859: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.1860: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.1861: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.1862: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1863: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.1864: DFBPPR6677 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 2
Source.1865: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.1866: DFBPPR6691 ---- Plant proteins ---- Histone H2A.2.1
Source.1867: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.1868: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1869: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.1870: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.1871: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2
Source.1872: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7
Source.1873: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.1874: DFBPPR6712 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM16
Source.1875: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1876: DFBPPR6721 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.1877: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1878: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.1879: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.1880: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.1881: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.1882: DFBPPR6752 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 3
Source.1883: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.1884: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.1885: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.1886: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.1887: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.1888: DFBPPR6788 ---- Plant proteins ---- Histone H1
Source.1889: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.1890: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.1891: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.1892: DFBPPR6801 ---- Plant proteins ---- Peroxidase
Source.1893: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1894: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1895: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1896: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.1897: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1898: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.1899: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1900: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1901: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1
Source.1902: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1903: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1904: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.1905: DFBPPR6911 ---- Plant proteins ---- Histone H1.3
Source.1906: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.1907: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1908: DFBPPR6955 ---- Plant proteins ---- Protein WIR1A
Source.1909: DFBPPR6963 ---- Plant proteins ---- Metallothionein-like protein 1
Source.1910: DFBPPR6978 ---- Plant proteins ---- Cyclic phosphodiesterase
Source.1911: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.1912: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1913: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1914: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.1915: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.1916: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1917: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1918: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.1919: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.1920: DFBPPR7031 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMb
Source.1921: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1922: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.1923: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.1924: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.1925: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1926: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.1927: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1928: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.1929: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1930: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2
Source.1931: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1932: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.1933: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1934: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.1935: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.1936: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.1937: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.1938: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.1939: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.1940: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.1941: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.1942: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.1943: DFBPPR7146 ---- Plant proteins ---- Non-specific lipid-transfer protein Cw18
Source.1944: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.1945: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.1946: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1947: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.1948: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.1949: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1950: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.1951: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.1952: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1953: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic
Source.1954: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1955: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1956: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1957: DFBPPR7200 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.1
Source.1958: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.1959: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.1960: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.1961: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic
Source.1962: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1963: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1964: DFBPPR7227 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.2
Source.1965: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.1966: DFBPPR7242 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.1967: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.1968: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.1969: DFBPPR7253 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.1970: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.1971: DFBPPR7261 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.3
Source.1972: DFBPPR7262 ---- Plant proteins ---- Photosystem I reaction center subunit IV, chloroplastic
Source.1973: DFBPPR7278 ---- Plant proteins ---- Protein BLT4
Source.1974: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.1975: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.1976: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.1977: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.1978: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.1979: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.1980: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.1981: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.1982: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.1983: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1984: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3
Source.1985: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4
Source.1986: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1987: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.1988: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1989: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.1990: DFBPPR7448 ---- Plant proteins ---- Histone H3.2
Source.1991: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1992: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.1993: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1994: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.1995: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.1996: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.1997: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.1998: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.1999: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1
Source.2000: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.2001: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial
Source.2002: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2003: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.2004: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.2005: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2
Source.2006: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2
Source.2007: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.2008: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.2009: DFBPPR7622 ---- Milk proteins ---- Mucin-1
Source.2010: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.2011: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein
Source.2012: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.2013: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.2014: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.2015: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.2016: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2017: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.2018: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.2019: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.2020: DFBPPR7690 ---- Milk proteins ---- Lactadherin
Source.2021: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.2022: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.2023: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.2024: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.2025: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.2026: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.2027: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.2028: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2029: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.2030: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.2031: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.2032: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.2033: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.2034: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.2035: DFBPPR8209 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.2036: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2037: DFBPPR8382 ---- Plant proteins ---- Cationic peroxidase 1
Source.2038: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101
Source.2039: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.2040: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101
Source.2041: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102
Source.2042: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3
Source.2043: DFBPPR8425 ---- Plant proteins ---- Oleosin L
Source.2044: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2045: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2046: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2047: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C
Source.2048: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A
Source.2049: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.2050: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.2051: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.2052: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2053: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2054: DFBPPR8485 ---- Milk proteins ---- Folate receptor alpha
Source.2055: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.2056: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.2057: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.2058: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.2059: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.2060: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.2061: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.2062: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2063: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.2064: DFBPPR15956 ---- Animal proteins ---- Phospholipase A2
Source.2065: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.2066: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.2067: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.2068: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.2069: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.2070: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.2071: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2072: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2073: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.2074: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.2075: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.2076: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.2077: DFBPPR16024 ---- Animal proteins ---- Podocalyxin
Source.2078: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2079: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2080: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.2081: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.2082: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.2083: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2084: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2085: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.2086: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.2087: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.2088: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2089: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.2090: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.2091: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.2092: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2093: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2094: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.2095: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.2096: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2097: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.2098: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.2099: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.2100: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2101: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.2102: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.2103: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.2104: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule
Source.2105: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.2106: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.2107: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.2108: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.2109: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta
Source.2110: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.2111: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.2112: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.2113: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.2114: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.2115: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.2116: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.2117: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.2118: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2119: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2120: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.2121: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2122: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.2123: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.2124: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.2125: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.2126: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.2127: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.2128: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2129: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.2130: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.2131: DFBPPR16287 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.2132: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.2133: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2134: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.2135: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.2136: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2
Source.2137: DFBPPR16324 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.2138: DFBPPR16338 ---- Animal proteins ---- Endothelin-2
Source.2139: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.2140: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.2141: DFBPPR16429 ---- Animal proteins ---- C-C motif chemokine 4
Source.2142: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.2143: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.2144: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.2145: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.2146: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.2147: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.2148: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.2149: DFBPPR16546 ---- Animal proteins ---- Apolipoprotein C-III
Source.2150: DFBPPR16549 ---- Animal proteins ---- Interleukin-1 alpha
Source.2151: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.2152: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.2153: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2154: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2155: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.2156: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.2157: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.2158: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.2159: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.2160: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.2161: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.2162: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.2163: DFBPPR16704 ---- Animal proteins ---- Retbindin
Source.2164: DFBPPR16707 ---- Animal proteins ---- Trefoil factor 2
Source.2165: DFBPPR16721 ---- Animal proteins ---- Testin
Source.2166: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.2167: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.2168: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2169: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.2170: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.2171: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.2172: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.2173: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.2174: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.2175: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.2176: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2177: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.2178: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.2179: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.2180: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.2181: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2182: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.2183: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.2184: DFBPPR16848 ---- Animal proteins ---- C-C motif chemokine 2
Source.2185: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2186: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.2187: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2188: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.2189: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2190: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.2191: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.2192: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.2193: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.2194: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.2195: DFBPPR16961 ---- Animal proteins ---- C-X-C motif chemokine 6
Source.2196: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.2197: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.2198: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.2199: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.2200: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2201: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.2202: DFBPPR17015 ---- Animal proteins ---- Microfibrillar-associated protein 2
Source.2203: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.2204: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2205: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2206: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.2207: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2208: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2209: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.2210: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta
Source.2211: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.2212: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.2213: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.2214: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.2215: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.2216: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.2217: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.2218: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.2219: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.2220: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.2221: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2
Source.2222: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short
Source.2223: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.2224: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.2225: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.2226: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.2227: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.2228: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.2229: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.2230: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.2231: DFBPPR17192 ---- Animal proteins ---- Kit ligand
Source.2232: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.2233: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.2234: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1
Source.2235: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.2236: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.2237: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.2238: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.2239: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.2240: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.2241: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.2242: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2243: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.2244: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.2245: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.2246: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.2247: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.2248: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.2249: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.2250: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2251: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.2252: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.2253: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.2254: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.2255: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.2256: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.2257: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.2258: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.2259: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.2260: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.2261: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.2262: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.2263: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.2264: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.2265: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4
Source.2266: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.2267: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.2268: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.2269: DFBPPR17423 ---- Animal proteins ---- Furin
Source.2270: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.2271: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.2272: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.2273: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.2274: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.2275: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.2276: DFBPPR17449 ---- Animal proteins ---- C-C motif chemokine 3
Source.2277: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2278: DFBPPR17452 ---- Animal proteins ---- CD81 antigen
Source.2279: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.2280: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.2281: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.2282: DFBPPR17468 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.2283: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.2284: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.2285: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.2286: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.2287: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.2288: DFBPPR17484 ---- Animal proteins ---- Histone H1.8
Source.2289: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.2290: DFBPPR17494 ---- Animal proteins ---- C-C motif chemokine 8
Source.2291: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.2292: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.2293: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.2294: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2295: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.2296: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.2297: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.2298: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.2299: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.2300: DFBPPR17577 ---- Animal proteins ---- Interleukin-1 alpha
Source.2301: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.2302: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.2303: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.2304: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.2305: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.2306: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.2307: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.2308: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.2309: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.2310: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7
Source.2311: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.2312: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2313: DFBPPR17629 ---- Animal proteins ---- Thiamine-triphosphatase
Source.2314: DFBPPR17630 ---- Animal proteins ---- Thiamine-triphosphatase
Source.2315: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.2316: DFBPPR17646 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial
Source.2317: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.2318: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.2319: DFBPPR17663 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 4, mitochondrial
Source.2320: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.2321: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.2322: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.2323: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.2324: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.2325: DFBPPR17749 ---- Animal proteins ---- CD9 antigen
Source.2326: DFBPPR17758 ---- Animal proteins ---- Matrix Gla protein
Source.2327: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.2328: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.2329: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.2330: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.2331: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.2332: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.2333: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.2334: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.2335: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.2336: DFBPPR17810 ---- Animal proteins ---- Histone H1.2
Source.2337: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.2338: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.2339: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.2340: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.2341: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2342: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.2343: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor
Source.2344: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.2345: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.2346: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.2347: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.2348: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.2349: DFBPPR17884 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.2350: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2351: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.2352: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.2353: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2354: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.2355: DFBPPR17913 ---- Animal proteins ---- ATP synthase subunit gamma, mitochondrial
Source.2356: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.2357: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.2358: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.2359: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.2360: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.2361: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase
Source.2362: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.2363: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.2364: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.2365: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.2366: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.2367: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2368: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.2369: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.2370: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.2371: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.2372: DFBPPR18011 ---- Animal proteins ---- Afamin
Source.2373: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.2374: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.2375: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.2376: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.2377: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.2378: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.2379: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1
Source.2380: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.2381: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.2382: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.2383: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.2384: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.2385: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.2386: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.2387: DFBPPR18104 ---- Animal proteins ---- Thioredoxin
Source.2388: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.2389: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.2390: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.2391: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.2392: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.2393: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2394: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.2395: DFBPPR18157 ---- Animal proteins ---- Hematopoietic cell signal transducer
Source.2396: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.2397: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.2398: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.2399: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.2400: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.2401: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.2402: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.2403: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.2404: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.2405: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.2406: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.2407: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.2408: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10
Source.2409: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.2410: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein
Source.2411: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.2412: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.2413: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.2414: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.2415: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.2416: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2417: DFBPPR18312 ---- Animal proteins ---- Interleukin-10
Source.2418: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.2419: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.2420: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.2421: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.2422: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.2423: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.2424: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2425: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.2426: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.2427: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.2428: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.2429: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.2430: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.2431: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2432: DFBPPR18373 ---- Animal proteins ---- Cellular retinoic acid-binding protein 1
Source.2433: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.2434: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.2435: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.2436: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.2437: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.2438: DFBPPR18396 ---- Animal proteins ---- Corticoliberin
Source.2439: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2440: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.2441: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.2442: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.2443: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2
Source.2444: DFBPPR18449 ---- Animal proteins ---- Prepronociceptin
Source.2445: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.2446: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.2447: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.2448: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.2449: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.2450: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.2451: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.2452: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.2453: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.2454: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.2455: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.2456: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2457: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.2458: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.2459: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5
Source.2460: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.2461: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.2462: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.2463: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.2464: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.2465: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.2466: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.2467: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.2468: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal
Source.2469: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.2470: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6
Source.2471: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.2472: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.2473: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.2474: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.2475: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.2476: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.2477: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D
Source.2478: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.2479: DFBPPR18718 ---- Animal proteins ---- Chondroadherin
Source.2480: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II
Source.2481: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.2482: DFBPPR18753 ---- Animal proteins ---- Endosome-associated-trafficking regulator 1
Source.2483: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.2484: DFBPPR18762 ---- Animal proteins ---- DDRGK domain-containing protein 1
Source.2485: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.2486: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50
Source.2487: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.2488: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.2489: DFBPPR18778 ---- Animal proteins ---- Erlin-2
Source.2490: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A
Source.2491: DFBPPR18785 ---- Animal proteins ---- Protein lin-7 homolog C
Source.2492: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.2493: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.2494: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A
Source.2495: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.2496: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.2497: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.2498: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.2499: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2500: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.2501: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor
Source.2502: DFBPPR18841 ---- Animal proteins ---- PHD finger protein 6
Source.2503: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.2504: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.2505: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.2506: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.2507: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.2508: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.2509: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.2510: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.2511: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.2512: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.2513: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.2514: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.2515: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.2516: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.2517: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.2518: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.2519: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2520: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.2521: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.2522: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.2523: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1
Source.2524: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.2525: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.2526: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.2527: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.2528: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.2529: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.2530: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.2531: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1
Source.2532: DFBPPR19003 ---- Animal proteins ---- Protein lin-7 homolog A
Source.2533: DFBPPR19004 ---- Animal proteins ---- Histone H1.3
Source.2534: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.2535: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.2536: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.2537: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.2538: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.2539: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.2540: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.2541: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.2542: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.2543: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.2544: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.2545: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.2546: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2547: DFBPPR19082 ---- Animal proteins ---- Protein SCO2 homolog, mitochondrial
Source.2548: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.2549: DFBPPR19099 ---- Animal proteins ---- Dr1-associated corepressor
Source.2550: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.2551: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.2552: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3
Source.2553: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.2554: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.2555: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.2556: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.2557: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.2558: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2559: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.2560: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A
Source.2561: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.2562: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169
Source.2563: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.2564: DFBPPR19211 ---- Animal proteins ---- Beta-synuclein
Source.2565: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2566: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.2567: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4
Source.2568: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.2569: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.2570: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.2571: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.2572: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.2573: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.2574: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.2575: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.2576: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2
Source.2577: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.2578: DFBPPR19275 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-5
Source.2579: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.2580: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.2581: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.2582: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.2583: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.2584: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.2585: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.2586: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.2587: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.2588: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2589: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.2590: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.2591: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.2592: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.2593: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.2594: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.2595: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.2596: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.2597: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6
Source.2598: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.2599: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.2600: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.2601: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.2602: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.2603: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2604: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.2605: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B
Source.2606: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4
Source.2607: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.2608: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.2609: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.2610: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2611: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.2612: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.2613: DFBPPR19484 ---- Animal proteins ---- Protein lin-7 homolog B
Source.2614: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.2615: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG
Source.2616: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5
Source.2617: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N
Source.2618: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.2619: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2620: DFBPPR19514 ---- Animal proteins ---- tRNA (cytosine(38)-C(5))-methyltransferase
Source.2621: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.2622: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.2623: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.2624: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.2625: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.2626: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.2627: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.2628: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.2629: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2630: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial
Source.2631: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1
Source.2632: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.2633: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.2634: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.2635: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.2636: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.2637: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.2638: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2639: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.2640: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2641: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.2642: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.2643: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.2644: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.2645: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.2646: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.2647: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.2648: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.2649: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.2650: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.2651: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2652: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.2653: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein
Source.2654: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1
Source.2655: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.2656: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.2657: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.2658: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog
Source.2659: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.2660: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.2661: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2
Source.2662: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.2663: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B
Source.2664: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.2665: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.2666: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.2667: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.2668: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.2669: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.2670: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.2671: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.2672: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.2673: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.2674: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.2675: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.2676: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.2677: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.2678: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.2679: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.2680: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase
Source.2681: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.2682: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.2683: DFBPPR19914 ---- Animal proteins ---- Cellular retinoic acid-binding protein 2
Source.2684: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.2685: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.2686: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2687: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.2688: DFBPPR19937 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.2689: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.2690: DFBPPR19944 ---- Animal proteins ---- Histone H1.0
Source.2691: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.2692: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2693: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.2694: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.2695: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.2696: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.2697: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.2698: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.2699: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.2700: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.2701: DFBPPR20019 ---- Animal proteins ---- 28S ribosomal protein S16, mitochondrial
Source.2702: DFBPPR20021 ---- Animal proteins ---- Neugrin
Source.2703: DFBPPR20022 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.2704: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.2705: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.2706: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.2707: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.2708: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.2709: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial
Source.2710: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.2711: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.2712: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2
Source.2713: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.2714: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2715: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.2716: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial
Source.2717: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.2718: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.2719: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.2720: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.2721: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.2722: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.2723: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.2724: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.2725: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2726: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.2727: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4
Source.2728: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.2729: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.2730: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.2731: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20
Source.2732: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.2733: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.2734: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.2735: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.2736: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.2737: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B
Source.2738: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2739: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28
Source.2740: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3
Source.2741: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6
Source.2742: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3
Source.2743: DFBPPR20318 ---- Animal proteins ---- Charged multivesicular body protein 1b
Source.2744: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.2745: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.2746: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.2747: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2748: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.2749: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.2750: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.2751: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.2752: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.2753: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.2754: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.2755: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.2756: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.2757: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2758: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.2759: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.2760: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF
Source.2761: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.2762: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.2763: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.2764: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.2765: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.2766: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2
Source.2767: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.2768: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.2769: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.2770: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6
Source.2771: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.2772: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.2773: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16
Source.2774: DFBPPR20540 ---- Animal proteins ---- Structure-specific endonuclease subunit SLX1
Source.2775: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1
Source.2776: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.2777: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.2778: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.2779: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.2780: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.2781: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.2782: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.2783: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.2784: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.2785: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.2786: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.2787: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.2788: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.2789: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2790: DFBPPR20640 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 8
Source.2791: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.2792: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.2793: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1
Source.2794: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.2795: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.2796: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45
Source.2797: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.2798: DFBPPR20677 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.2799: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.2800: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.2801: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.2802: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.2803: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.2804: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1
Source.2805: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta
Source.2806: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.2807: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.2808: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.2809: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.2810: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.2811: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.2812: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.2813: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.2814: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.2815: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.2816: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.2817: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2818: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.2819: DFBPPR20809 ---- Animal proteins ---- F-box and leucine-rich protein 22
Source.2820: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.2821: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.2822: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.2823: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.2824: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.2825: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.2826: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.2827: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.2828: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.2829: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2830: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.2831: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2832: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.2833: DFBPPR20919 ---- Animal proteins ---- Protein cornichon homolog 4
Source.2834: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.2835: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18
Source.2836: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B
Source.2837: DFBPPR20973 ---- Animal proteins ---- Growth-regulated protein homolog gamma
Source.2838: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial
Source.2839: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.2840: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.2841: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181
Source.2842: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.2843: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.2844: DFBPPR21005 ---- Animal proteins ---- Growth-regulated protein homolog beta
Source.2845: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.2846: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5
Source.2847: DFBPPR21026 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog
Source.2848: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.2849: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2850: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B
Source.2851: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.2852: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.2853: DFBPPR21049 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 9
Source.2854: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.2855: DFBPPR21077 ---- Animal proteins ---- Growth-regulated protein homolog alpha
Source.2856: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.2857: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.2858: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.2859: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32
Source.2860: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin
Source.2861: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.2862: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.2863: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2864: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.2865: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.2866: DFBPPR21160 ---- Animal proteins ---- Prefoldin subunit 3
Source.2867: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.2868: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2869: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.2870: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.2871: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.2872: DFBPPR21209 ---- Animal proteins ---- 40S ribosomal protein S6
Source.2873: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.2874: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.2875: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.2876: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.2877: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.2878: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.2879: DFBPPR21272 ---- Animal proteins ---- Testin
Source.2880: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.2881: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.2882: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.2883: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.2884: DFBPPR21312 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 B
Source.2885: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha
Source.2886: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.2887: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.2888: DFBPPR21335 ---- Animal proteins ---- Coiled-coil domain-containing protein 124
Source.2889: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.2890: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.2891: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.2892: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7
Source.2893: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.2894: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.2895: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.2896: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.2897: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.2898: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4
Source.2899: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.2900: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.2901: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.2902: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.2903: DFBPPR21383 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 2A
Source.2904: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1
Source.2905: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A
Source.2906: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.2907: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37
Source.2908: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.2909: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.2910: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.2911: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.2912: DFBPPR21448 ---- Animal proteins ---- Protein N-lysine methyltransferase METTL21A
Source.2913: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.2914: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.2915: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.2916: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1
Source.2917: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1
Source.2918: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.2919: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.2920: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.2921: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2
Source.2922: DFBPPR21546 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 29
Source.2923: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.2924: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.2925: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.2926: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.2927: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.2928: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.2929: DFBPPR21639 ---- Animal proteins ---- Elongator complex protein 4
Source.2930: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2
Source.2931: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.2932: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.2933: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.2934: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.2935: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23
Source.2936: DFBPPR21709 ---- Animal proteins ---- PEST proteolytic signal-containing nuclear protein
Source.2937: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.2938: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.2939: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.2940: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.2941: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.2942: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.2943: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.2944: DFBPPR21749 ---- Animal proteins ---- Protein CUSTOS
Source.2945: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.2946: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.2947: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6
Source.2948: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.2949: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.2950: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.2951: DFBPPR21793 ---- Animal proteins ---- Dynein light chain Tctex-type protein 2B
Source.2952: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2953: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.2954: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD
Source.2955: DFBPPR21854 ---- Animal proteins ---- Suppressor of IKBKE 1
Source.2956: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.2957: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.2958: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS
Source.2959: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3
Source.2960: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19
Source.2961: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.2962: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5
Source.2963: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.2964: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.2965: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14
Source.2966: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.2967: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.2968: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.2969: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.2970: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.2971: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.2972: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.2973: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.2974: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.2975: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1
Source.2976: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1
Source.2977: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.2978: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.2979: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2980: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6
Source.2981: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial
Source.2982: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.2983: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.2984: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.2985: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.2986: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.2987: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.2988: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.2989: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.2990: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.2991: DFBPPR22220 ---- Animal proteins ---- Secretoglobin family 1D member
Source.2992: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.2993: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8
Source.2994: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.2995: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.2996: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.2997: DFBPPR22243 ---- Animal proteins ---- COMM domain-containing protein 4
Source.2998: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1
Source.2999: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.3000: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2
Source.3001: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.3002: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.3003: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.3004: DFBPPR22268 ---- Animal proteins ---- Keratin-associated protein 10-8
Source.3005: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.3006: DFBPPR22274 ---- Animal proteins ---- 60S ribosomal protein L30
Source.3007: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.3008: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.3009: DFBPPR22283 ---- Animal proteins ---- F-box only protein 8
Source.3010: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.3011: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.3012: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31
Source.3013: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.3014: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.3015: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.3016: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.3017: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.3018: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.3019: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.3020: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.3021: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like
Source.3022: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.3023: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.3024: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.3025: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.3026: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.3027: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.3028: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.3029: DFBPPR22414 ---- Animal proteins ---- Protein C10
Source.3030: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.3031: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.3032: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18
Source.3033: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.3034: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.3035: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3
Source.3036: DFBPPR22508 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 2
Source.3037: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234
Source.3038: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.3039: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.3040: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.3041: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog
Source.3042: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.3043: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.3044: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.3045: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.3046: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.3047: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.3048: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.3049: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.3050: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.3051: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.3052: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.3053: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1
Source.3054: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.3055: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.3056: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.3057: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog
Source.3058: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog
Source.3059: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.3060: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog
Source.3061: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3062: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.3063: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.3064: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.3065: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.3066: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.3067: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.3068: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.3069: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.3070: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3071: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.3072: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.3073: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.3074: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3075: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.3076: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.3077: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.3078: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.3079: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.3080: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.3081: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein
Source.3082: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.3083: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.3084: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.3085: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3086: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.3087: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.3088: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.3089: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.3090: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.3091: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.3092: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3093: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.3094: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.3095: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.3096: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.3097: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3098: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.3099: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.3100: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.3101: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.3102: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.3103: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3104: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.3105: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.3106: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.3107: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.3108: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.3109: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.3110: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3111: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3112: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.3113: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3114: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.3115: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.3116: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.3117: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.3118: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.3119: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.3120: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.3121: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.3122: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.3123: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.3124: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3125: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.3126: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.3127: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.3128: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.3129: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.3130: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.3131: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.3132: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3133: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.3134: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.3135: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.3136: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.3137: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.3138: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.3139: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.3140: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.3141: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.3142: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.3143: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3144: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.3145: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.3146: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.3147: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.3148: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.3149: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3150: DFBPPR9009 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.3151: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3152: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3153: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.3154: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.3155: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.3156: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.3157: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.3158: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.3159: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.3160: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.3161: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5
Source.3162: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.3163: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.3164: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.3165: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.3166: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.3167: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.3168: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.3169: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.3170: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.3171: DFBPPR9159 ---- Animal proteins ---- Hematopoietic cell signal transducer
Source.3172: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3173: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.3174: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3
Source.3175: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.3176: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3177: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.3178: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.3179: DFBPPR9223 ---- Animal proteins ---- Protransforming growth factor alpha
Source.3180: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.3181: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.3182: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.3183: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.3184: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9
Source.3185: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.3186: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.3187: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.3188: DFBPPR9273 ---- Animal proteins ---- C-C motif chemokine 4
Source.3189: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.3190: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.3191: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.3192: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.3193: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.3194: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3195: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.3196: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.3197: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.3198: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.3199: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.3200: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.3201: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.3202: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34
Source.3203: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.3204: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.3205: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.3206: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.3207: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3208: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3209: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3210: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3211: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.3212: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.3213: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.3214: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.3215: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.3216: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.3217: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.3218: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.3219: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.3220: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.3221: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.3222: DFBPPR9585 ---- Animal proteins ---- Uterine plasmin/trypsin inhibitor
Source.3223: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.3224: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor
Source.3225: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.3226: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3227: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase
Source.3228: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta
Source.3229: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.3230: DFBPPR9698 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.3231: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.3232: DFBPPR9717 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.3233: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.3234: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.3235: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3236: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.3237: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.3238: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.3239: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1
Source.3240: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.3241: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.3242: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.3243: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32
Source.3244: DFBPPR9794 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.3245: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.3246: DFBPPR9814 ---- Animal proteins ---- Testin
Source.3247: DFBPPR9822 ---- Animal proteins ---- Selenoprotein W
Source.3248: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3249: DFBPPR9841 ---- Animal proteins ---- Interleukin-10
Source.3250: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3251: DFBPPR9890 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.3252: DFBPPR9904 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7
Source.3253: DFBPPR9909 ---- Animal proteins ---- Tetraspanin-31
Source.3254: DFBPPR9940 ---- Animal proteins ---- Neuronatin
Source.3255: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.3256: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.3257: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.3258: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.3259: DFBPPR9972 ---- Animal proteins ---- Taste receptor type 2 member 40
Source.3260: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.3261: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3262: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.3263: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.3264: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.3265: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.3266: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.3267: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.3268: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3269: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.3270: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3271: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.3272: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.3273: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.3274: DFBPPR10054 ---- Animal proteins ---- Kit ligand
Source.3275: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3276: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.3277: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.3278: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3279: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3280: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.3281: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3282: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.3283: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.3284: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.3285: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.3286: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.3287: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.3288: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3289: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.3290: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3291: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.3292: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.3293: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.3294: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.3295: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.3296: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.3297: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.3298: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.3299: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.3300: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.3301: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.3302: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.3303: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.3304: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.3305: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.3306: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3307: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.3308: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.3309: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.3310: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.3311: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.3312: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.3313: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.3314: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.3315: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.3316: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.3317: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3318: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.3319: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.3320: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.3321: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.3322: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.3323: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3324: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.3325: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3326: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.3327: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.3328: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.3329: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3330: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.3331: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.3332: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.3333: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.3334: DFBPPR10341 ---- Animal proteins ---- Brain acid soluble protein 1 homolog
Source.3335: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.3336: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.3337: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.3338: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.3339: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.3340: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.3341: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.3342: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.3343: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.3344: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.3345: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.3346: DFBPPR10385 ---- Animal proteins ---- Centromere protein S
Source.3347: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3348: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.3349: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.3350: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.3351: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.3352: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.3353: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.3354: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.3355: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.3356: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.3357: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.3358: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.3359: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.3360: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.3361: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.3362: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6
Source.3363: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.3364: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.3365: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.3366: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.3367: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.3368: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.3369: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.3370: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.3371: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.3372: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.3373: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.3374: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.3375: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3376: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.3377: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.3378: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.3379: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5
Source.3380: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.3381: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.3382: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B
Source.3383: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.3384: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.3385: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin
Source.3386: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.3387: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.3388: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.3389: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.3390: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.3391: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.3392: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.3393: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.3394: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3395: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.3396: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.3397: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.3398: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.3399: DFBPPR10680 ---- Animal proteins ---- Hemoglobin subunit pi
Source.3400: DFBPPR10685 ---- Animal proteins ---- Cellular retinoic acid-binding protein 1
Source.3401: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3402: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.3403: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.3404: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.3405: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.3406: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3407: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.3408: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.3409: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.3410: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.3411: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor
Source.3412: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.3413: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.3414: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A
Source.3415: DFBPPR10738 ---- Animal proteins ---- Histone H1.10
Source.3416: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.3417: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.3418: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.3419: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.3420: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.3421: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.3422: DFBPPR10790 ---- Animal proteins ---- Histone H1
Source.3423: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.3424: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.3425: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.3426: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3
Source.3427: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.3428: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.3429: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.3430: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3431: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.3432: DFBPPR10831 ---- Animal proteins ---- Early growth response protein 1
Source.3433: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.3434: DFBPPR10840 ---- Animal proteins ---- C-C motif chemokine 4 homolog
Source.3435: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.3436: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.3437: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2
Source.3438: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.3439: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.3440: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.3441: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.3442: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.3443: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.3444: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.3445: DFBPPR10917 ---- Animal proteins ---- Ribonuclease UK114
Source.3446: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.3447: DFBPPR10932 ---- Animal proteins ---- Histone H1.11L
Source.3448: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.3449: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.3450: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.3451: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.3452: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.3453: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate
Source.3454: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.3455: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.3456: DFBPPR10987 ---- Animal proteins ---- Charged multivesicular body protein 6
Source.3457: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.3458: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.3459: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.3460: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.3461: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.3462: DFBPPR11016 ---- Animal proteins ---- Protein lin-7 homolog C
Source.3463: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.3464: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.3465: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.3466: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.3467: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.3468: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.3469: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.3470: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.3471: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.3472: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.3473: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.3474: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3475: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.3476: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.3477: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.3478: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.3479: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.3480: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.3481: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.3482: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3483: DFBPPR11156 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase
Source.3484: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.3485: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.3486: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.3487: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.3488: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.3489: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.3490: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.3491: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.3492: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.3493: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.3494: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.3495: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.3496: DFBPPR11208 ---- Animal proteins ---- Transcription factor MafF
Source.3497: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.3498: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3499: DFBPPR11239 ---- Animal proteins ---- Charged multivesicular body protein 1b
Source.3500: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.3501: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.3502: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.3503: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.3504: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.3505: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.3506: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.3507: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.3508: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.3509: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3510: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.3511: DFBPPR11302 ---- Animal proteins ---- Histone H1.11R
Source.3512: DFBPPR11308 ---- Animal proteins ---- Histone H1.03
Source.3513: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.3514: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.3515: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.3516: DFBPPR11364 ---- Animal proteins ---- Interleukin-18
Source.3517: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.3518: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.3519: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.3520: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.3521: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.3522: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.3523: DFBPPR11388 ---- Animal proteins ---- Matrilin-3
Source.3524: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3525: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.3526: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.3527: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.3528: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.3529: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.3530: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.3531: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.3532: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.3533: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.3534: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.3535: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.3536: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.3537: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.3538: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.3539: DFBPPR11508 ---- Animal proteins ---- Cellular retinoic acid-binding protein 2
Source.3540: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.3541: DFBPPR11524 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF166
Source.3542: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.3543: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.3544: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.3545: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.3546: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.3547: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.3548: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.3549: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.3550: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.3551: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3552: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.3553: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3554: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.3555: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.3556: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein
Source.3557: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein
Source.3558: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.3559: DFBPPR11692 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14B
Source.3560: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.3561: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.3562: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.3563: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.3564: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.3565: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.3566: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.3567: DFBPPR11746 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.3568: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.3569: DFBPPR11768 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.3570: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.3571: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.3572: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.3573: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.3574: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.3575: DFBPPR11792 ---- Animal proteins ---- Selenoprotein W
Source.3576: DFBPPR11815 ---- Animal proteins ---- 60S ribosomal protein L30
Source.3577: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.3578: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.3579: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.3580: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.3581: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.3582: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.3583: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.3584: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.3585: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein
Source.3586: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.3587: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.3588: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta
Source.3589: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.3590: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.3591: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.3592: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.3593: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.3594: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.3595: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.3596: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.3597: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.3598: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.3599: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.3600: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.3601: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.3602: DFBPPR12024 ---- Animal proteins ---- 40S ribosomal protein S6
Source.3603: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.3604: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.3605: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.3606: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.3607: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.3608: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4
Source.3609: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.3610: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.3611: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.3612: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.3613: DFBPPR12121 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.3614: DFBPPR12122 ---- Animal proteins ---- Fibroblast growth factor-binding protein 2
Source.3615: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3616: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.3617: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.3618: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.3619: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.3620: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.3621: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.3622: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.3623: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.3624: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.3625: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.3626: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.3627: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.3628: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.3629: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.3630: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3631: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.3632: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.3633: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.3634: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3635: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.3636: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.3637: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.3638: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3639: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.3640: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.3641: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.3642: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3643: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.3644: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.3645: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.3646: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.3647: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3648: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3649: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.3650: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3651: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.3652: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.3653: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.3654: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.3655: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.3656: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.3657: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.3658: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.3659: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.3660: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.3661: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.3662: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.3663: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.3664: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.3665: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.3666: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3667: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.3668: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3669: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.3670: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.3671: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3672: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.3673: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.3674: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.3675: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.3676: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3677: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.3678: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.3679: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3680: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.3681: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.3682: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.3683: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.3684: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.3685: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.3686: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14
Source.3687: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3688: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.3689: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.3690: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.3691: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.3692: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.3693: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.3694: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.3695: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.3696: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.3697: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.3698: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.3699: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3700: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.3701: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.3702: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.3703: DFBPPR12569 ---- Animal proteins ---- Alveolar macrophage chemotactic factor
Source.3704: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.3705: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.3706: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3707: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.3708: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.3709: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.3710: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.3711: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14
Source.3712: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.3713: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.3714: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.3715: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.3716: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.3717: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.3718: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.3719: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.3720: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.3721: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.3722: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3723: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.3724: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.3725: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3726: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.3727: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.3728: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.3729: DFBPPR12738 ---- Animal proteins ---- Histone H1.4
Source.3730: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3731: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.3732: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.3733: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.3734: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.3735: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.3736: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.3737: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.3738: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.3739: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.3740: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.3741: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.3742: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.3743: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3744: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.3745: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.3746: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3747: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.3748: DFBPPR12876 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.3749: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.3750: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.3751: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.3752: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.3753: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.3754: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.3755: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.3756: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.3757: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3758: DFBPPR12935 ---- Animal proteins ---- Histone H1.3
Source.3759: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.3760: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.3761: DFBPPR12951 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.3762: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.3763: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.3764: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.3765: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.3766: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.3767: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.3768: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.3769: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.3770: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.3771: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.3772: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3773: DFBPPR13011 ---- Animal proteins ---- C-C motif chemokine 4
Source.3774: DFBPPR13014 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.3775: DFBPPR13024 ---- Animal proteins ---- Erythropoietin
Source.3776: DFBPPR13060 ---- Animal proteins ---- Growth-regulated protein homolog
Source.3777: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3778: DFBPPR13083 ---- Animal proteins ---- Promotilin
Source.3779: DFBPPR13092 ---- Animal proteins ---- Testin
Source.3780: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.3781: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.3782: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3783: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3784: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.3785: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.3786: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3787: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha
Source.3788: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.3789: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.3790: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.3791: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.3792: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.3793: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.3794: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.3795: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.3796: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.3797: DFBPPR13237 ---- Animal proteins ---- Thioredoxin
Source.3798: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3799: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3800: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3801: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2
Source.3802: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3803: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3804: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.3805: DFBPPR13286 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.3806: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.3807: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.3808: DFBPPR13299 ---- Animal proteins ---- Interleukin-1 alpha
Source.3809: DFBPPR13306 ---- Animal proteins ---- Tropomyosin alpha-4 chain
Source.3810: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.3811: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.3812: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.3813: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.3814: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3815: DFBPPR13390 ---- Animal proteins ---- C-X-C motif chemokine 6
Source.3816: DFBPPR13409 ---- Animal proteins ---- Testin
Source.3817: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.3818: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3819: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.3820: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.3821: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.3822: DFBPPR13443 ---- Animal proteins ---- Kit ligand
Source.3823: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3824: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3825: DFBPPR13468 ---- Animal proteins ---- Hemoglobin subunit alpha-1
Source.3826: DFBPPR13476 ---- Animal proteins ---- Hemoglobin subunit alpha-2
Source.3827: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.3828: DFBPPR13485 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.3829: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3830: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.3831: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.3832: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.3833: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.3834: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.3835: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.3836: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3837: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3838: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.3839: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3840: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.3841: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.3842: DFBPPR13654 ---- Animal proteins ---- Corticoliberin
Source.3843: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3844: DFBPPR13656 ---- Animal proteins ---- Thioredoxin
Source.3845: DFBPPR13661 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2
Source.3846: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.3847: DFBPPR13664 ---- Animal proteins ---- Interleukin-10
Source.3848: DFBPPR13665 ---- Animal proteins ---- Kit ligand
Source.3849: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.3850: DFBPPR13702 ---- Animal proteins ---- Protransforming growth factor alpha
Source.3851: DFBPPR13705 ---- Animal proteins ---- Galectin-1
Source.3852: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3853: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.3854: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.3855: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3856: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.3857: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3858: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.3859: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.3860: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.3861: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.3862: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.3863: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.3864: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.3865: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.3866: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.3867: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.3868: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.3869: DFBPPR13847 ---- Animal proteins ---- Growth-regulated alpha protein
Source.3870: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.3871: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.3872: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.3873: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.3874: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.3875: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein
Source.3876: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein
Source.3877: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.3878: DFBPPR13918 ---- Animal proteins ---- Testin
Source.3879: DFBPPR13919 ---- Animal proteins ---- Selenoprotein W
Source.3880: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.3881: DFBPPR13935 ---- Animal proteins ---- Major centromere autoantigen B
Source.3882: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.3883: DFBPPR13959 ---- Animal proteins ---- Calpastatin
Source.3884: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B
Source.3885: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.3886: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.3887: DFBPPR14007 ---- Animal proteins ---- Cystatin
Source.3888: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3889: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.3890: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta
Source.3891: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.3892: DFBPPR14147 ---- Marine protein ---- Parvalbumin beta 2
Source.3893: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.3894: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2
Source.3895: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.3896: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1
Source.3897: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.3898: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A
Source.3899: DFBPPR14206 ---- Marine protein ---- Intraflagellar transport protein 43 homolog B
Source.3900: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog
Source.3901: DFBPPR14268 ---- Marine protein ---- Cytochrome c oxidase subunit 6C-1
Source.3902: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.3903: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.3904: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.3905: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.3906: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.3907: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.3908: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.3909: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.3910: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.3911: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain
Source.3912: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.3913: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.3914: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.3915: DFBPPR14391 ---- Marine protein ---- Cytochrome b6-f complex subunit 5
Source.3916: DFBPPR14506 ---- Marine protein ---- Photosystem I reaction center subunit IV
Source.3917: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.3918: DFBPPR14522 ---- Marine protein ---- Uncharacterized protein ycf20
Source.3919: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.3920: DFBPPR14559 ---- Marine protein ---- Histone H1
Source.3921: DFBPPR14562 ---- Marine protein ---- Ladderlectin
Source.3922: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.3923: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4
Source.3924: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1
Source.3925: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.3926: DFBPPR14596 ---- Marine protein ---- Parvalbumin beta 2
Source.3927: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a
Source.3928: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.3929: DFBPPR14618 ---- Marine protein ---- Ependymin-1
Source.3930: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.3931: DFBPPR14634 ---- Marine protein ---- Neuroglobin-2
Source.3932: DFBPPR14656 ---- Marine protein ---- Neuroglobin-1
Source.3933: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.3934: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.3935: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.3936: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.3937: DFBPPR14725 ---- Marine protein ---- 40S ribosomal protein S6
Source.3938: DFBPPR14726 ---- Marine protein ---- Cytochrome c oxidase subunit 5B liver, mitochondrial
Source.3939: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.3940: DFBPPR14739 ---- Marine protein ---- Interleukin-1 receptor-associated kinase 1-binding protein 1 homolog
Source.3941: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.3942: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.3943: DFBPPR14783 ---- Marine protein ---- Enolase
Source.3944: DFBPPR14798 ---- Marine protein ---- Panusin
Source.3945: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.3946: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.3947: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.3948: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.3949: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.3950: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial
Source.3951: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.3952: DFBPPR14818 ---- Marine protein ---- Tropomyosin
Source.3953: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.3954: DFBPPR14828 ---- Marine protein ---- Tropomyosin
Source.3955: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta
Source.3956: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.3957: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.3958: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.3959: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.3960: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.3961: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.3962: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.3963: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.3964: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.3965: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.3966: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.3967: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.3968: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.3969: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.3970: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.3971: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.3972: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.3973: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.3974: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.3975: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.3976: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.3977: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit
Source.3978: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.3979: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.3980: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.3981: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.3982: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.3983: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.3984: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.3985: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.3986: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.3987: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.3988: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.3989: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.3990: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.3991: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.3992: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.3993: DFBPPR15093 ---- Microorganism protein ---- Inner kinetochore subunit AME1
Source.3994: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.3995: DFBPPR15106 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.3996: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.3997: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.3998: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.3999: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.4000: DFBPPR15133 ---- Microorganism protein ---- Iron sulfur cluster assembly protein 1, mitochondrial
Source.4001: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.4002: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.4003: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.4004: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.4005: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.4006: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.4007: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.4008: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.4009: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.4010: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.4011: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.4012: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase
Source.4013: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.4014: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.4015: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.4016: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.4017: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.4018: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.4019: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.4020: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.4021: DFBPPR15415 ---- Microorganism protein ---- Transcription initiation factor TFIID subunit 4
Source.4022: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.4023: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22
Source.4024: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.4025: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.4026: DFBPPR15484 ---- Microorganism protein ---- Protein TOS6
Source.4027: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.4028: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.4029: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.4030: DFBPPR15520 ---- Microorganism protein ---- Protein YAE1
Source.4031: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.4032: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6
Source.4033: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.4034: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.4035: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.4036: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.4037: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.4038: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.4039: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.4040: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.4041: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.4042: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.4043: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.4044: DFBPPR15651 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 34, mitochondrial
Source.4045: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.4046: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18
Source.4047: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14
Source.4048: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.4049: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.4050: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.4051: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.4052: DFBPPR15728 ---- Microorganism protein ---- DNA-binding protein TRF1
Source.4053: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.4054: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24
Source.4055: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.4056: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.4057: DFBPPR15777 ---- Microorganism protein ---- FAS1 domain-containing protein KLLA0E16841g
Source.4058: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.4059: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.4060: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase
Source.4061: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase
Source.4062: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.4063: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.4064: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.4065: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.4066: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase
Source.4067: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.4068: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.4069: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.4070: DFBPPR15832 ---- Microorganism protein ---- Uncharacterized protein in fgs 3'region
Source.4071: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.4072: DFBPPR15840 ---- Microorganism protein ---- Protein RecA
Source.4073: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.4074: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.4075: DFBPPR15856 ---- Microorganism protein ---- Laccase-2
Source.4076: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.4077: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.4078: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.4079: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.4080: DFBPPR15865 ---- Microorganism protein ---- Hydrophobin-1
Source.4081: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2
Source.4082: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.4083: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4084: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase
Source.4085: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.4086: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.4087: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.4088: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.4089: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.4090: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4091: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.4092: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.4093: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.4094: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.4095: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.4096: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.4097: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.4098: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.4099: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4100: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.4101: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4102: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4103: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.4104: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4105: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.4106: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2
Source.4107: DFBPPR7847 ---- Plant protein ---- Non-specific lipid-transfer protein 1
Source.4108: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.4109: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.4110: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4
Source.4111: DFBPPR7883 ---- Plant protein ---- Non-specific lipid-transfer protein 2
Source.4112: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1
Source.4113: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.4114: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.4115: DFBPPR7894 ---- Plant protein ---- CASP-like protein 2C2
Source.4116: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.4117: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.4118: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1
Source.4119: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.4120: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4
Source.4121: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.4122: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.4123: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1
Source.4124: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2
Source.4125: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1
Source.4126: DFBPPR7926 ---- Plant protein ---- Kafirin PSK8
Source.4127: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.4128: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.4129: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.4130: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.4131: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.4132: DFBPPR7933 ---- Plant protein ---- FK506-binding protein 2
Source.4133: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.4134: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4135: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein
Source.4136: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4137: DFBPPR8008 ---- Plant protein ---- CASP-like protein 5A2
Source.4138: DFBPPR8009 ---- Plant protein ---- CASP-like protein 5B1
Source.4139: DFBPPR8012 ---- Plant protein ---- CASP-like protein 5A1
Source.4140: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.4141: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.4142: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4143: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.4144: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.4145: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.4146: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.4147: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.4148: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.4149: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4150: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.4151: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4152: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.4153: DFBPPR8080 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.4154: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4155: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.4156: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin
Source.4157: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.4158: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.4159: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.4160: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.4161: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.4162: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4163: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.4164: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.4165: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.4166: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4167: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4168: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4169: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4170: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.4171: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.4172: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.4173: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.4174: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Source.4175: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.4176: DFBPPR8325 ---- Plant protein ---- 11 kDa late embryogenesis abundant protein
Source.4177: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3
Source.4178: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research
Link 1: DFBPACEI0563----Maize crops----α-Zein
Biological/Functional activity & target protein
ACE-inhibitory activity

Amaranth trypsin-digested glutelins induce endothelial NO production and consequent vasodilation through their ACE-inhibitory activity. The peptide VAA was isolated from the highest active fraction, so the peptide was a potential Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory peptide (No valid IC50 value was determined in this study).

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Native amaranth glutelins were digested with trypsin (Sigma-Aldrich, St. Louis, MO, USA) at an enzyme/substrate ratio of 1:10 (w/w) for 10 h at 37 ℃.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

Amaranth trypsin-digested glutelins have a high potential as a nutraceutical food in prevention of cardiovascular diseases.

Database cross-references
BIOPEP-UWM [D1] 3518
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature de la Rosa AP, Montoya AB, Martínez-Cuevas P, Hernández-Ledesma B, León-Galván MF, De León-Rodríguez A, González C. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides. Nitric Oxide. 2010 Sep 15;23(2):106-11.
PMID: 20435155
Other literature(s)

[1] Miyoshi S, Ishikawa H, Kaneko T, et al. Structures and activity of angiotensin-converting enzyme inhibitors in an alpha-zein hydrolysate.[J]. Journal of the Agricultural Chemical Society of Japan, 1991, 55(5):1313.

PubDate 2010
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214