E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1986(ACE-inhibitory peptide)
DFBP ID DFBPACEI1986
Peptide sequence VW
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antihypertensive activity [D1], Antioxidative activity [D2], α-Glucosidase inhibitory activity [D3], Other bioactive activity [D4], Multifunctional activity [D5]
Calculated physicochemical properties
Three-letter amino acid Val-Trp
Single-letter amino acid VW
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 303.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 3.5 ± 1.5 μM
pIC50 -0.544
GRAVY 1.6500 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Soy, Rice, Wheat, Pea
Precursor protein Soy/Rice/Wheat/Pea proteins
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.3: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.4: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5
Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.7: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.8: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.9: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.10: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.11: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.12: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.13: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.14: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.15: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.16: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.17: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.18: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.19: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.20: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.21: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.22: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.23: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.24: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.25: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.26: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.27: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.28: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.29: DFBPPR0886 ---- Plant proteins ---- Abscisic acid receptor PYL5
Source.30: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.31: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.32: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1
Source.33: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.34: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2
Source.35: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.36: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.37: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.38: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.39: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.40: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.41: DFBPPR0930 ---- Plant proteins ---- Abscisic acid receptor PYL3
Source.42: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.43: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8
Source.44: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.45: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.46: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.47: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.48: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.49: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.50: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.51: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.52: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.53: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.54: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.55: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.56: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.57: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.58: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.59: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.60: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.61: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7
Source.62: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.63: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.64: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50
Source.65: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.66: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.67: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.68: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.69: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.70: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.71: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.72: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.73: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.74: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.75: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.76: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.77: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.78: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4
Source.79: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.80: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.81: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.82: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.83: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.84: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.85: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.86: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10
Source.87: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.88: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.89: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.90: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.91: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.92: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.93: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE
Source.94: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.95: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.96: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.97: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.98: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.99: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.100: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.101: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.102: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.103: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.104: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.105: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.106: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.107: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.108: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.109: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.110: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.111: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.112: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog
Source.113: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.114: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.115: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.116: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.117: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.118: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.119: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.120: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A
Source.121: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.122: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.123: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.124: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.125: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.126: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.127: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.128: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.129: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.130: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.131: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.132: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.133: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.134: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.135: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.136: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.137: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.138: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.139: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.140: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.141: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.142: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.143: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.144: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.145: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8
Source.146: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.147: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.148: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.149: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.150: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.151: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.152: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.153: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.154: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.155: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.156: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.157: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.158: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.159: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.160: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.161: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.162: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.163: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.164: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.165: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.166: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.167: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.168: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.169: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.170: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.171: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.172: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.173: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.174: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.175: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.176: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.177: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.178: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.179: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.180: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.181: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.182: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.183: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.184: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.185: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.186: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.187: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.188: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.189: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.190: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.191: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.192: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.193: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.194: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.195: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.196: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.197: DFBPPR1444 ---- Plant proteins ---- Cysteine proteinase inhibitor 1
Source.198: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.199: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.200: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.201: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.202: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.203: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.204: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.205: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.206: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.207: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.208: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.209: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.210: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.211: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.212: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic
Source.213: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.214: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.215: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.216: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.217: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.218: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.219: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.220: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.221: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.222: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.223: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.224: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.225: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.226: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.227: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.228: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.229: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.230: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.231: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.232: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.233: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.234: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.235: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.236: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.237: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.238: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.239: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.240: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.241: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.242: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.243: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.244: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.245: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.246: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.247: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.248: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.249: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.250: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.251: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.252: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.253: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.254: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.255: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.256: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.257: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.258: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.259: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.260: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.261: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.262: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.263: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.264: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.265: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.266: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.267: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.268: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.269: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.270: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.271: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.272: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.273: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.274: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.275: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.276: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.277: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062
Source.278: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.279: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.280: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.281: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.282: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.283: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.284: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.285: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.286: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.287: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.288: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.289: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.290: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.291: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.292: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.293: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.294: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.295: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.296: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.297: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.298: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.299: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.300: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.301: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.302: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.303: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.304: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.305: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.306: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.307: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.308: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.309: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.310: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.311: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.312: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.313: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.314: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.315: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.316: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.317: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.318: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.319: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.320: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.321: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.322: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.323: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.324: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.325: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.326: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.327: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.328: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.329: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.330: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.331: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.332: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.333: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.334: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.335: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.336: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.337: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.338: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.339: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.340: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.341: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.342: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.343: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.344: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.345: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.346: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.347: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.348: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.349: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.350: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.351: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.352: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.353: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.354: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.355: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.356: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.357: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.358: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.359: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.360: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.361: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.362: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.363: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.364: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.365: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.366: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2
Source.367: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.368: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.369: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.370: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.371: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.372: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.373: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.374: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.375: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.376: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.377: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.378: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.379: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.380: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30
Source.381: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.382: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2
Source.383: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.384: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.385: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.386: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.387: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.388: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.389: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.390: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.391: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.392: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.393: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.394: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.395: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.396: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.397: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.398: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.399: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.400: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.401: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.402: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.403: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.404: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23
Source.405: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.406: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.407: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.408: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.409: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.410: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.411: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.412: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.413: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.414: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.415: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.416: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.417: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.418: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.419: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.420: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.421: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.422: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.423: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.424: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.425: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.426: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.427: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.428: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.429: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.430: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.431: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.432: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.433: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.434: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.435: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.436: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.437: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.438: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.439: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.440: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.441: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.442: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.443: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.444: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.445: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.446: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.447: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.448: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.449: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.450: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.451: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.452: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.453: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.454: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.455: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.456: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.457: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.458: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.459: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1
Source.460: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.461: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.462: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.463: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.464: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.465: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.466: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.467: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.468: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.469: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.470: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.471: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.472: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.473: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.474: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.475: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.476: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.477: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.478: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.479: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.480: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.481: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.482: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.483: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.484: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.485: DFBPPR2272 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 2
Source.486: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.487: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.488: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.489: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.490: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.491: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.492: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.493: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.494: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.495: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.496: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.497: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.498: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.499: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.500: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.501: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.502: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.503: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.504: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.505: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.506: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.507: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.508: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.509: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.510: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.511: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.512: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.513: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.514: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.515: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.516: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.517: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1
Source.518: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.519: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.520: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.521: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.522: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.523: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.524: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.525: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.526: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.527: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.528: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.529: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.530: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.531: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.532: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.533: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.534: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.535: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.536: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.537: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.538: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.539: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.540: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.541: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.542: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.543: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.544: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.545: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.546: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.547: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.548: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.549: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.550: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.551: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.552: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.553: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.554: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.555: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.556: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.557: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.558: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.559: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.560: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.561: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.562: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.563: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.564: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.565: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.566: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.567: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.568: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.569: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.570: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.571: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.572: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.573: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.574: DFBPPR2584 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.575: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.576: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.577: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.578: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.579: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.580: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.581: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.582: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.583: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19
Source.584: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.585: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.586: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.587: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.588: DFBPPR2624 ---- Plant proteins ---- Transcription initiation factor IIA subunit 2
Source.589: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1
Source.590: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal
Source.591: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.592: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.593: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.594: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.595: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.596: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.597: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.598: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.599: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.600: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.601: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.602: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.603: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.604: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.605: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.606: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.607: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.608: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.609: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.610: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.611: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.612: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.613: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.614: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72
Source.615: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2
Source.616: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.617: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.618: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.619: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.620: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.621: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.622: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.623: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.624: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.625: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.626: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.627: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.628: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.629: DFBPPR2758 ---- Plant proteins ---- Expansin-B17
Source.630: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.631: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.632: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.633: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.634: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.635: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.636: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.637: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.638: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.639: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.640: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.641: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.642: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.643: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.644: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.645: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.646: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.647: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.648: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.649: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.650: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.651: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.652: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.653: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.654: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.655: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.656: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.657: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.658: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.659: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1
Source.660: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.661: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.662: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.663: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.664: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.665: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.666: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.667: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A
Source.668: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21
Source.669: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.670: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.671: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.672: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.673: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.674: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.675: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.676: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.677: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.678: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.679: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.680: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.681: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.682: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.683: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.684: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.685: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.686: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.687: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.688: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.689: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.690: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.691: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.692: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.693: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.694: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.695: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.696: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20
Source.697: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.698: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.699: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.700: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.701: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.702: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.703: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.704: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.705: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.706: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.707: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.708: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.709: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.710: DFBPPR3063 ---- Plant proteins ---- Profilin-A
Source.711: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.712: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.713: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.714: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.715: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.716: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.717: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.718: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.719: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.720: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.721: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.722: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.723: DFBPPR3095 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 4
Source.724: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.725: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.726: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.727: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.728: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.729: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.730: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20
Source.731: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.732: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.733: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.734: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.735: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.736: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.737: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.738: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.739: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.740: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.741: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.742: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.743: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.744: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.745: DFBPPR3176 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.746: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.747: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.748: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15
Source.749: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.750: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.751: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.752: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17
Source.753: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.754: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.755: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.756: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.757: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.758: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.759: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.760: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.761: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.762: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.763: DFBPPR3238 ---- Plant proteins ---- Hydrophobic protein LTI6A
Source.764: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.765: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.766: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.767: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.768: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.769: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit
Source.770: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.771: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.772: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.773: DFBPPR3271 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP
Source.774: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase
Source.775: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.776: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.777: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.778: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.779: DFBPPR3296 ---- Plant proteins ---- MADS-box transcription factor 32
Source.780: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.781: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.782: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.783: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.784: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.785: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.786: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.787: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.788: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.789: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.790: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.791: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.792: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.793: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.794: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.795: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.796: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.797: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.798: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.799: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.800: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B
Source.801: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.802: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.803: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.804: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.805: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.806: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.807: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.808: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.809: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.810: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.811: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.812: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.813: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.814: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.815: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.816: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.817: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.818: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.819: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.820: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.821: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.822: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.823: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.824: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C
Source.825: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.826: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.827: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.828: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.829: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.830: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.831: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.832: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.833: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.834: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.835: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.836: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.837: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6
Source.838: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.839: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.840: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.841: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.842: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.843: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.844: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.845: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.846: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.847: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.848: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.849: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.850: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.851: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.852: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.853: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.854: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.855: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.856: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.857: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.858: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.859: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.860: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.861: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.862: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.863: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.864: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.865: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.866: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.867: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.868: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.869: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.870: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.871: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.872: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.873: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.874: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.875: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.876: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.877: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.878: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.879: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.880: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.881: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.882: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.883: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.884: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.885: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67
Source.886: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.887: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.888: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1
Source.889: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.890: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.891: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.892: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.893: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.894: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.895: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase
Source.896: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.897: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.898: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.899: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28
Source.900: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.901: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.902: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.903: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.904: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.905: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.906: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.907: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.908: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.909: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.910: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.911: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42
Source.912: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.913: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.914: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.915: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.916: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.917: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.918: DFBPPR3826 ---- Plant proteins ---- Profilin LP04
Source.919: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.920: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.921: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.922: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit
Source.923: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.924: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.925: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.926: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.927: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.928: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.929: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.930: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.931: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.932: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.933: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.934: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.935: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.936: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.937: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.938: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.939: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.940: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5
Source.941: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.942: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.943: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.944: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit
Source.945: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.946: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.947: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.948: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.949: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.950: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.951: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10
Source.952: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.953: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.954: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.955: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.956: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.957: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8
Source.958: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.959: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.960: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.961: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.962: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.963: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.964: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.965: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.966: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.967: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.968: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.969: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.970: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.971: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11
Source.972: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.973: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.974: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.975: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.976: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.977: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G
Source.978: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.979: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.980: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.981: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.982: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.983: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.984: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25
Source.985: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.986: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.987: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.988: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.989: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.990: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.991: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.992: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.993: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.994: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.995: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.996: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.997: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.998: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.999: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.1000: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1001: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.1002: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.1003: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.1004: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.1005: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.1006: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.1007: DFBPPR4128 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 2
Source.1008: DFBPPR4129 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 1
Source.1009: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.1010: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1011: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.1012: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1013: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.1014: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.1015: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1016: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1017: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1018: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.1019: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1020: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1021: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1022: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.1023: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.1024: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1025: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.1026: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1027: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.1028: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1029: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1030: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1031: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1032: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1033: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.1034: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.1035: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.1036: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1037: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1038: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.1039: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.1040: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.1041: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5
Source.1042: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.1043: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.1044: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1045: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.1046: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1047: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.1048: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.1049: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.1050: DFBPPR4304 ---- Plant proteins ---- Signal recognition particle 14 kDa protein
Source.1051: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.1052: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1053: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1054: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.1055: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.1056: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1057: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.1058: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.1059: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1060: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic
Source.1061: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.1062: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1063: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.1064: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.1065: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.1066: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.1067: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.1068: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog
Source.1069: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1070: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1071: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.1072: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1073: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.1074: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1075: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.1076: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.1077: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.1078: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.1079: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.1080: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.1081: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.1082: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.1083: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1084: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.1085: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.1086: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.1087: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1088: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.1089: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.1090: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.1091: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.1092: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.1093: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.1094: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.1095: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.1096: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.1097: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.1098: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1099: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1100: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.1101: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.1102: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.1103: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1
Source.1104: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.1105: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.1106: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.1107: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.1108: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.1109: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.1110: DFBPPR4636 ---- Plant proteins ---- Putative actin-depolymerizing factor 8
Source.1111: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.1112: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.1113: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.1114: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.1115: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1116: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.1117: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.1118: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.1119: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.1120: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18
Source.1121: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4
Source.1122: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.1123: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.1124: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.1125: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.1126: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1127: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1128: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.1129: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4
Source.1130: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.1131: DFBPPR4780 ---- Plant proteins ---- Ripening-related protein 3
Source.1132: DFBPPR4783 ---- Plant proteins ---- Putative ripening-related protein 7
Source.1133: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1
Source.1134: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.1135: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.1136: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.1137: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.1138: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.1139: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2
Source.1140: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.1141: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.1142: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.1143: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.1144: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.1145: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3
Source.1146: DFBPPR4841 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 5
Source.1147: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2
Source.1148: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.1149: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.1150: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1
Source.1151: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.1152: DFBPPR4854 ---- Plant proteins ---- Putative ripening-related protein 6
Source.1153: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.1154: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.1155: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1
Source.1156: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1157: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1158: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1159: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1
Source.1160: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1161: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.1162: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.1163: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1164: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.1165: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.1166: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.1167: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1168: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1169: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.1170: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1171: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.1172: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1173: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.1174: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1175: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.1176: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.1177: DFBPPR4980 ---- Plant proteins ---- Lactoylglutathione lyase
Source.1178: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1179: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.1180: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.1181: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1
Source.1182: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1183: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.1184: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.1185: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.1186: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.1187: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1188: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1189: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1190: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.1191: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.1192: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.1193: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.1194: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.1195: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1196: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.1197: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.1198: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.1199: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.1200: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.1201: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1202: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.1203: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1204: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.1205: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.1206: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2
Source.1207: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.1208: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1209: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1210: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1211: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic
Source.1212: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.1213: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1214: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.1215: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.1216: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.1217: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1218: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.1219: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1220: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3
Source.1221: DFBPPR5094 ---- Plant proteins ---- Protein PROPEP914
Source.1222: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.1223: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.1224: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.1225: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1226: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.1227: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.1228: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.1229: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein
Source.1230: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1231: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.1232: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1233: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein
Source.1234: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.1235: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.1236: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.1237: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.1238: DFBPPR5150 ---- Plant proteins ---- Profilin-2
Source.1239: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1240: DFBPPR5154 ---- Plant proteins ---- Profilin-1
Source.1241: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.1242: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.1243: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1244: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.1245: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1246: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.1247: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.1248: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.1249: DFBPPR5198 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1250: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.1251: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1252: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.1253: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.1254: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.1255: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.1256: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.1257: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.1258: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.1259: DFBPPR5219 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1260: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1261: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.1262: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1263: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.1264: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.1265: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1266: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.1267: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.1268: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.1269: DFBPPR5276 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1270: DFBPPR5281 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1271: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.1272: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.1273: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1274: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1275: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1276: DFBPPR5297 ---- Plant proteins ---- Protein PROPEP890
Source.1277: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.1278: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.1279: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.1280: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.1281: DFBPPR5338 ---- Plant proteins ---- 40S ribosomal protein S13
Source.1282: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.1283: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1284: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1285: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1286: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1287: DFBPPR5385 ---- Plant proteins ---- Profilin-5
Source.1288: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1289: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.1290: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4
Source.1291: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1292: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.1293: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.1294: DFBPPR5402 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.1295: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1296: DFBPPR5410 ---- Plant proteins ---- Profilin-4
Source.1297: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.1298: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.1299: DFBPPR5417 ---- Plant proteins ---- Profilin-3
Source.1300: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1301: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1302: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.1303: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.1304: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.1305: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.1306: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase
Source.1307: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.1308: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1
Source.1309: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.1310: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1311: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1312: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1313: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial
Source.1314: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1315: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.1316: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1317: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1318: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.1319: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1320: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.1321: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.1322: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.1323: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.1324: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.1325: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.1326: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.1327: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.1328: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1329: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.1330: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein
Source.1331: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.1332: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1333: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.1334: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase
Source.1335: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase
Source.1336: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1
Source.1337: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1338: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1339: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1340: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1341: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.1342: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1343: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1344: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1345: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1346: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1347: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1348: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.1349: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1350: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.1351: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1352: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.1353: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1354: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.1355: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1356: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.1357: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.1358: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1359: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.1360: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.1361: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1362: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1363: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.1364: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1365: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A
Source.1366: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.1367: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.1368: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial
Source.1369: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.1370: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.1371: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1372: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1373: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1374: DFBPPR5651 ---- Plant proteins ---- Cytochrome c
Source.1375: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1
Source.1376: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.1377: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.1378: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.1379: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.1380: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1381: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1382: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1383: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial
Source.1384: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.1385: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial
Source.1386: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.1387: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1388: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.1389: DFBPPR5689 ---- Plant proteins ---- Profilin-9
Source.1390: DFBPPR5690 ---- Plant proteins ---- Profilin-7
Source.1391: DFBPPR5691 ---- Plant proteins ---- Profilin-10
Source.1392: DFBPPR5692 ---- Plant proteins ---- Profilin-6
Source.1393: DFBPPR5693 ---- Plant proteins ---- Profilin-11
Source.1394: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1395: DFBPPR5697 ---- Plant proteins ---- Profilin-12
Source.1396: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1397: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1398: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1399: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.1400: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.1401: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.1402: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.1403: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1404: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1405: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.1406: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1407: DFBPPR5739 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR1
Source.1408: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.1409: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.1410: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.1411: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1412: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1413: DFBPPR5751 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein 2-B
Source.1414: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.1415: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.1416: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1417: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.1418: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1419: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1420: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1421: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.1422: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.1423: DFBPPR5794 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2
Source.1424: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1425: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.1426: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1427: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.1428: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1429: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1430: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1431: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1432: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.1433: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.1434: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1435: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.1436: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.1437: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1438: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1439: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1440: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.1441: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1442: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1443: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor
Source.1444: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1445: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.1446: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.1447: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1448: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1449: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.1450: DFBPPR5914 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase, variable chain
Source.1451: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.1452: DFBPPR5921 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1453: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1454: DFBPPR5933 ---- Plant proteins ---- Pathogenesis-related protein PRMS
Source.1455: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.1456: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.1457: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.1458: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2
Source.1459: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1460: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.1461: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.1462: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.1463: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.1464: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.1465: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.1466: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.1467: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.1468: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.1469: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.1470: DFBPPR6007 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1471: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.1472: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1473: DFBPPR6022 ---- Plant proteins ---- Stress-related protein 1
Source.1474: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.1475: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.1476: DFBPPR6052 ---- Plant proteins ---- Cystatin-1
Source.1477: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2
Source.1478: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1
Source.1479: DFBPPR6099 ---- Plant proteins ---- CASP-like protein 16
Source.1480: DFBPPR6147 ---- Plant proteins ---- 60S ribosomal protein L19
Source.1481: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1482: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.1483: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.1484: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.1485: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.1486: DFBPPR6202 ---- Plant proteins ---- Unknown protein from spot 308 of 2D-PAGE of etiolated coleoptile
Source.1487: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1488: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.1489: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.1490: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1491: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.1492: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1493: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1494: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1495: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1496: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.1497: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.1498: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.1499: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.1500: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1501: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.1502: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.1503: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.1504: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.1505: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1506: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1507: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.1508: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1509: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.1510: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1511: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1512: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1513: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.1514: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1515: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.1516: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.1517: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.1518: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.1519: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1520: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.1521: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.1522: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1523: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.1524: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.1525: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.1526: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.1527: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.1528: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.1529: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.1530: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.1531: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.1532: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.1533: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1534: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1535: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.1536: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1537: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.1538: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.1539: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1540: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1541: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.1542: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.1543: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.1544: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.1545: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.1546: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.1547: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.1548: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.1549: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.1550: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.1551: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic
Source.1552: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.1553: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1554: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5
Source.1555: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1556: DFBPPR6520 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1557: DFBPPR6522 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.1558: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.1559: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.1560: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.1561: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.1562: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1563: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1564: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.1565: DFBPPR6585 ---- Plant proteins ---- 40S ribosomal protein S13
Source.1566: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1567: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1568: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.1569: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.1570: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.1571: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.1572: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.1573: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.1574: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1575: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1576: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1577: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.1578: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.1579: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1580: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1581: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.1582: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1583: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.1584: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.1585: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.1586: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.1587: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1588: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.1589: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.1590: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1591: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1592: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1593: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1594: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1595: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1596: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1597: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.1598: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.1599: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1600: DFBPPR6808 ---- Plant proteins ---- Profilin-2
Source.1601: DFBPPR6810 ---- Plant proteins ---- Profilin-1
Source.1602: DFBPPR6813 ---- Plant proteins ---- Profilin-3
Source.1603: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1604: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.1605: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1606: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.1607: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1608: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A
Source.1609: DFBPPR6864 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1610: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1611: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.1612: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.1613: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1614: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1615: DFBPPR6931 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP
Source.1616: DFBPPR6970 ---- Plant proteins ---- 40S ribosomal protein S29
Source.1617: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.1618: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1619: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1620: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.1621: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1622: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.1623: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1624: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1625: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1626: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.1627: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.1628: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.1629: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1630: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1631: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1632: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1633: DFBPPR7056 ---- Plant proteins ---- Cysteine proteinase inhibitor
Source.1634: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1635: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1636: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1637: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.1638: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1639: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1640: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.1641: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.1642: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1643: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1644: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.1645: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.1646: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1647: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1648: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.1649: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1650: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1651: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1652: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1653: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.1654: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.1655: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.1656: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.1657: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.1658: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1659: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1660: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.1661: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1662: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.1663: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.1664: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1665: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.1666: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1667: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1668: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.1669: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3
Source.1670: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.1671: DFBPPR7207 ---- Plant proteins ---- Profilin-1
Source.1672: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1673: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1674: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.1675: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1676: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1677: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.1678: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1679: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.1680: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1
Source.1681: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2
Source.1682: DFBPPR7245 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1683: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.1684: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.1685: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.1686: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.1687: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1688: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R
Source.1689: DFBPPR7324 ---- Plant proteins ---- Antifungal protein S
Source.1690: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein
Source.1691: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1692: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.1693: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1694: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.1695: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.1696: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.1697: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1698: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.1699: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1700: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1701: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.1702: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.1703: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1704: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1705: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.1706: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1707: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.1708: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.1709: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.1710: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1711: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1712: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1713: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.1714: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1
Source.1715: DFBPPR7513 ---- Plant proteins ---- Thioredoxin H-type 2
Source.1716: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.1717: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.1718: DFBPPR7529 ---- Plant proteins ---- Profilin
Source.1719: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.1720: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1721: DFBPPR7550 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.1722: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.1723: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.1724: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.1725: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.1726: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.1727: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.1728: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1729: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1730: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1731: DFBPPR7630 ---- Milk proteins ---- Folate receptor alpha
Source.1732: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.1733: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.1734: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.1735: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.1736: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.1737: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.1738: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.1739: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.1740: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.1741: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1742: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.1743: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.1744: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.1745: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.1746: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.1747: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.1748: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.1749: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1750: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.1751: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1752: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.1753: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.1754: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4
Source.1755: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.1756: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.1757: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.1758: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.1759: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1760: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.1761: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.1762: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.1763: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.1764: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.1765: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.1766: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1767: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1768: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.1769: DFBPPR8377 ---- Plant proteins ---- Profilin
Source.1770: DFBPPR8408 ---- Plant proteins ---- Profilin
Source.1771: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.1772: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1773: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1774: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1775: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.1776: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.1777: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.1778: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.1779: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1780: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.1781: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1782: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.1783: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.1784: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.1785: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1786: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1787: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.1788: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.1789: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1790: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.1791: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1792: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.1793: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.1794: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.1795: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.1796: DFBPPR15944 ---- Animal proteins ---- Ras-related protein Rab-13
Source.1797: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.1798: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.1799: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1800: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1801: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1802: DFBPPR15956 ---- Animal proteins ---- Phospholipase A2
Source.1803: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1804: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.1805: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1806: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1807: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.1808: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1809: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.1810: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.1811: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.1812: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1813: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.1814: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.1815: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1816: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.1817: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1818: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.1819: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.1820: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.1821: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.1822: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.1823: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1824: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.1825: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1826: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1827: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.1828: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1829: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1830: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1831: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.1832: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1833: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1834: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1835: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1836: DFBPPR16042 ---- Animal proteins ---- Caveolin-2
Source.1837: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1838: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.1839: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1840: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1841: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.1842: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.1843: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1844: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.1845: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.1846: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.1847: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.1848: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.1849: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1850: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.1851: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.1852: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.1853: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.1854: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.1855: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.1856: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.1857: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.1858: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1859: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.1860: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.1861: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.1862: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.1863: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.1864: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.1865: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1866: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.1867: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1868: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.1869: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.1870: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.1871: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.1872: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1873: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.1874: DFBPPR16156 ---- Animal proteins ---- Ras-related protein Rab-22A
Source.1875: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1876: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1877: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1878: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.1879: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1880: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1881: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.1882: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.1883: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.1884: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.1885: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.1886: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.1887: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1888: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1889: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.1890: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1891: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1892: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.1893: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1894: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.1895: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1896: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.1897: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.1898: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.1899: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1900: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.1901: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.1902: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.1903: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1904: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.1905: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.1906: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.1907: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1908: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1909: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.1910: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.1911: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.1912: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.1913: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.1914: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1915: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.1916: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.1917: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.1918: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1919: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1920: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1921: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.1922: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.1923: DFBPPR16283 ---- Animal proteins ---- Nucleoside diphosphate kinase A
Source.1924: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1925: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1926: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.1927: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.1928: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.1929: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.1930: DFBPPR16325 ---- Animal proteins ---- Peripherin-2
Source.1931: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.1932: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.1933: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.1934: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1935: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1936: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.1937: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1938: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.1939: DFBPPR16378 ---- Animal proteins ---- Arginine esterase
Source.1940: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1941: DFBPPR16439 ---- Animal proteins ---- Lutropin subunit beta
Source.1942: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.1943: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.1944: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.1945: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.1946: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.1947: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.1948: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.1949: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1950: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.1951: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.1952: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.1953: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.1954: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.1955: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.1956: DFBPPR16517 ---- Animal proteins ---- Cholinesterase
Source.1957: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1958: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.1959: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.1960: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.1961: DFBPPR16550 ---- Animal proteins ---- Erythropoietin
Source.1962: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1963: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.1964: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.1965: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1966: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.1967: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1968: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1969: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.1970: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.1971: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S
Source.1972: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.1973: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.1974: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.1975: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.1976: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.1977: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.1978: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4
Source.1979: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1980: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.1981: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.1982: DFBPPR16645 ---- Animal proteins ---- Putative protein SCAMPER
Source.1983: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.1984: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1985: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.1986: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator
Source.1987: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor
Source.1988: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.1989: DFBPPR16704 ---- Animal proteins ---- Retbindin
Source.1990: DFBPPR16706 ---- Animal proteins ---- 60S ribosomal protein L19
Source.1991: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190
Source.1992: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1993: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1994: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.1995: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.1996: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region
Source.1997: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.1998: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.1999: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.2000: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.2001: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.2002: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2003: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.2004: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.2005: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.2006: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.2007: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2008: DFBPPR16818 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.2009: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.2010: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.2011: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.2012: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.2013: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.2014: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.2015: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.2016: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2017: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.2018: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.2019: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.2020: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.2021: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.2022: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.2023: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.2024: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.2025: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.2026: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.2027: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.2028: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.2029: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.2030: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.2031: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.2032: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.2033: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.2034: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.2035: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.2036: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.2037: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.2038: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.2039: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.2040: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.2041: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.2042: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1
Source.2043: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.2044: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.2045: DFBPPR16984 ---- Animal proteins ---- Caveolin-2
Source.2046: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.2047: DFBPPR16994 ---- Animal proteins ---- Somatoliberin
Source.2048: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.2049: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.2050: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.2051: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.2052: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.2053: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17
Source.2054: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.2055: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.2056: DFBPPR17017 ---- Animal proteins ---- Nucleoside diphosphate kinase A 2
Source.2057: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.2058: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2059: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.2060: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.2061: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.2062: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.2063: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.2064: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.2065: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2066: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.2067: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2068: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2069: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.2070: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.2071: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.2072: DFBPPR17052 ---- Animal proteins ---- Nucleoside diphosphate kinase A 1
Source.2073: DFBPPR17058 ---- Animal proteins ---- Ras-related protein Rab-13
Source.2074: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2075: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.2076: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.2077: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.2078: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.2079: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.2080: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.2081: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2082: DFBPPR17073 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.2083: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.2084: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2085: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.2086: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.2087: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.2088: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.2089: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2090: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.2091: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.2092: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.2093: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.2094: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.2095: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.2096: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.2097: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.2098: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.2099: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.2100: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.2101: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.2102: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.2103: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.2104: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.2105: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.2106: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.2107: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.2108: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2109: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2110: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.2111: DFBPPR17140 ---- Animal proteins ---- Adiponectin
Source.2112: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2113: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2114: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.2115: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.2116: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.2117: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.2118: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.2119: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.2120: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.2121: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.2122: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.2123: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.2124: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.2125: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.2126: DFBPPR17254 ---- Animal proteins ---- Zinc finger protein SNAI2
Source.2127: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.2128: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.2129: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.2130: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.2131: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.2132: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.2133: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.2134: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.2135: DFBPPR17311 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.2136: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.2137: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.2138: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.2139: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2140: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.2141: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.2142: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.2143: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.2144: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.2145: DFBPPR17343 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.2146: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.2147: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.2148: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.2149: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.2150: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.2151: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.2152: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.2153: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.2154: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.2155: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.2156: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.2157: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.2158: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.2159: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.2160: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.2161: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.2162: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.2163: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.2164: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.2165: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.2166: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.2167: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.2168: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.2169: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.2170: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.2171: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.2172: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.2173: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.2174: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.2175: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.2176: DFBPPR17423 ---- Animal proteins ---- Furin
Source.2177: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.2178: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.2179: DFBPPR17433 ---- Animal proteins ---- Caveolin-3
Source.2180: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.2181: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.2182: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.2183: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.2184: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.2185: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2186: DFBPPR17454 ---- Animal proteins ---- Peripherin-2
Source.2187: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.2188: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.2189: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.2190: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.2191: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.2192: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.2193: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1
Source.2194: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.2195: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.2196: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.2197: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.2198: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.2199: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.2200: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.2201: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.2202: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.2203: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1
Source.2204: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.2205: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.2206: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.2207: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.2208: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.2209: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2210: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.2211: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.2212: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2213: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.2214: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.2215: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.2216: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.2217: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.2218: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.2219: DFBPPR17584 ---- Animal proteins ---- Cytochrome c oxidase subunit 7B, mitochondrial
Source.2220: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.2221: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2222: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.2223: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.2224: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2225: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.2226: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.2227: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.2228: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.2229: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.2230: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.2231: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.2232: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.2233: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor
Source.2234: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.2235: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.2236: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2237: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.2238: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.2239: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2240: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.2241: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.2242: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.2243: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.2244: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.2245: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.2246: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.2247: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.2248: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.2249: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.2250: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.2251: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.2252: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2253: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.2254: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.2255: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.2256: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D
Source.2257: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.2258: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.2259: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1
Source.2260: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.2261: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.2262: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor
Source.2263: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.2264: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase
Source.2265: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.2266: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.2267: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.2268: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.2269: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.2270: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2271: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2272: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.2273: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.2274: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.2275: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.2276: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.2277: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.2278: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.2279: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.2280: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.2281: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.2282: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.2283: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.2284: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.2285: DFBPPR17947 ---- Animal proteins ---- Erythropoietin
Source.2286: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.2287: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.2288: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.2289: DFBPPR17970 ---- Animal proteins ---- Profilin-2
Source.2290: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.2291: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.2292: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.2293: DFBPPR17982 ---- Animal proteins ---- Sorting nexin-10
Source.2294: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.2295: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.2296: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.2297: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.2298: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.2299: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.2300: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.2301: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.2302: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.2303: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.2304: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.2305: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.2306: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.2307: DFBPPR18021 ---- Animal proteins ---- Lutropin subunit beta
Source.2308: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.2309: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.2310: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.2311: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.2312: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.2313: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.2314: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.2315: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.2316: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.2317: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.2318: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2319: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8
Source.2320: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.2321: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.2322: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.2323: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.2324: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.2325: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2326: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.2327: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.2328: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.2329: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.2330: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.2331: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.2332: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.2333: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4
Source.2334: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.2335: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.2336: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.2337: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.2338: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.2339: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.2340: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.2341: DFBPPR18166 ---- Animal proteins ---- Selenoprotein P
Source.2342: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.2343: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2344: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.2345: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.2346: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.2347: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2348: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.2349: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.2350: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.2351: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.2352: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.2353: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.2354: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.2355: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.2356: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.2357: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.2358: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.2359: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2360: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.2361: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.2362: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.2363: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.2364: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1
Source.2365: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.2366: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.2367: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.2368: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7
Source.2369: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.2370: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.2371: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.2372: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.2373: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.2374: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.2375: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2376: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.2377: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.2378: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.2379: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2380: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.2381: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2382: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2383: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1
Source.2384: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.2385: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.2386: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2387: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.2388: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.2389: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.2390: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.2391: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.2392: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.2393: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.2394: DFBPPR18416 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.2395: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2396: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.2397: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.2398: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.2399: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.2400: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.2401: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2402: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.2403: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.2404: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.2405: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.2406: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.2407: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.2408: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.2409: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2410: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.2411: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1
Source.2412: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.2413: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.2414: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.2415: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.2416: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.2417: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.2418: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.2419: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.2420: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.2421: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.2422: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.2423: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.2424: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.2425: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.2426: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.2427: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.2428: DFBPPR18568 ---- Animal proteins ---- Cdc42 effector protein 2
Source.2429: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.2430: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1
Source.2431: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.2432: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.2433: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.2434: DFBPPR18589 ---- Animal proteins ---- Interleukin-13
Source.2435: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.2436: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.2437: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.2438: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.2439: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2440: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.2441: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.2442: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.2443: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.2444: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.2445: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.2446: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.2447: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.2448: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5
Source.2449: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.2450: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.2451: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.2452: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.2453: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.2454: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.2455: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.2456: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.2457: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.2458: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.2459: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.2460: DFBPPR18752 ---- Animal proteins ---- Serine/arginine-rich splicing factor 3
Source.2461: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.2462: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.2463: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.2464: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50
Source.2465: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.2466: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.2467: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.2468: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.2469: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.2470: DFBPPR18812 ---- Animal proteins ---- Vesicle-associated membrane protein 3
Source.2471: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.2472: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.2473: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.2474: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.2475: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2476: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.2477: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.2478: DFBPPR18829 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 10
Source.2479: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2
Source.2480: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.2481: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.2482: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.2483: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.2484: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.2485: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.2486: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.2487: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.2488: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.2489: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.2490: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.2491: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.2492: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.2493: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.2494: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase
Source.2495: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.2496: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.2497: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2
Source.2498: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.2499: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.2500: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.2501: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.2502: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.2503: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.2504: DFBPPR18920 ---- Animal proteins ---- Profilin-1
Source.2505: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.2506: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.2507: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2508: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.2509: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.2510: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.2511: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.2512: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.2513: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.2514: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.2515: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.2516: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.2517: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.2518: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.2519: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.2520: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor
Source.2521: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.2522: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.2523: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.2524: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.2525: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.2526: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2527: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.2528: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.2529: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.2530: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.2531: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.2532: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.2533: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.2534: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.2535: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.2536: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.2537: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.2538: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.2539: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.2540: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.2541: DFBPPR19128 ---- Animal proteins ---- Spermadhesin-1
Source.2542: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.2543: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.2544: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.2545: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.2546: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.2547: DFBPPR19161 ---- Animal proteins ---- Anaphase-promoting complex subunit 11
Source.2548: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma
Source.2549: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.2550: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.2551: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.2552: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.2553: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.2554: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.2555: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.2556: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.2557: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2558: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.2559: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.2560: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.2561: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.2562: DFBPPR19225 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.2563: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.2564: DFBPPR19229 ---- Animal proteins ---- Interferon alpha-F
Source.2565: DFBPPR19230 ---- Animal proteins ---- Interferon alpha-G
Source.2566: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.2567: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.2568: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.2569: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.2570: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.2571: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.2572: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.2573: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2574: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.2575: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.2576: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6
Source.2577: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.2578: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.2579: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.2580: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.2581: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.2582: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.2583: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B
Source.2584: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.2585: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.2586: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.2587: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.2588: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.2589: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.2590: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.2591: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.2592: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.2593: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.2594: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.2595: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.2596: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.2597: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.2598: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.2599: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.2600: DFBPPR19389 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.2601: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A
Source.2602: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.2603: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20
Source.2604: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.2605: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.2606: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.2607: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.2608: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.2609: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.2610: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.2611: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.2612: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.2613: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial
Source.2614: DFBPPR19435 ---- Animal proteins ---- Interferon alpha-D
Source.2615: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.2616: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.2617: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2618: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.2619: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.2620: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.2621: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.2622: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.2623: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12
Source.2624: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.2625: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.2626: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.2627: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.2628: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.2629: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2
Source.2630: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.2631: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.2632: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.2633: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2634: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.2635: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.2636: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2
Source.2637: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E
Source.2638: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.2639: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.2640: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2641: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.2642: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.2643: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.2644: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.2645: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.2646: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.2647: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2648: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.2649: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.2650: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.2651: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.2652: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.2653: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.2654: DFBPPR19585 ---- Animal proteins ---- Interferon alpha-1
Source.2655: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.2656: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C
Source.2657: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.2658: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2659: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.2660: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2661: DFBPPR19617 ---- Animal proteins ---- Suppressor of cytokine signaling 2
Source.2662: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.2663: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.2664: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.2665: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.2666: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.2667: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.2668: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.2669: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.2670: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.2671: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.2672: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.2673: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.2674: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.2675: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.2676: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.2677: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.2678: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2679: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.2680: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.2681: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.2682: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.2683: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2684: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1
Source.2685: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.2686: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.2687: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.2688: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6
Source.2689: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.2690: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.2691: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.2692: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.2693: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.2694: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.2695: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.2696: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.2697: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.2698: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.2699: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.2700: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.2701: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.2702: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.2703: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8
Source.2704: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.2705: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.2706: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2
Source.2707: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.2708: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.2709: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.2710: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.2711: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.2712: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2713: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.2714: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.2715: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2716: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.2717: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.2718: DFBPPR19929 ---- Animal proteins ---- Ermin
Source.2719: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial
Source.2720: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.2721: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2722: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.2723: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.2724: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.2725: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.2726: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.2727: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.2728: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.2729: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2730: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.2731: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.2732: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.2733: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.2734: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.2735: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.2736: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.2737: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.2738: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.2739: DFBPPR20023 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.2740: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2741: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.2742: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.2743: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.2744: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.2745: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.2746: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.2747: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.2748: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2
Source.2749: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.2750: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.2751: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.2752: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.2753: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.2754: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.2755: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4
Source.2756: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.2757: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.2758: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.2759: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.2760: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.2761: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.2762: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.2763: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2764: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.2765: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.2766: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.2767: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.2768: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.2769: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.2770: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.2771: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.2772: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.2773: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein
Source.2774: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.2775: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.2776: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.2777: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase
Source.2778: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.2779: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2780: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.2781: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28
Source.2782: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.2783: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog
Source.2784: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial
Source.2785: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3
Source.2786: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.2787: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.2788: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.2789: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.2790: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.2791: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2
Source.2792: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.2793: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.2794: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.2795: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.2796: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.2797: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.2798: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9
Source.2799: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.2800: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.2801: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.2802: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.2803: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.2804: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2805: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2806: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.2807: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.2808: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.2809: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.2810: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2811: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.2812: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.2813: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.2814: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.2815: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.2816: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.2817: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.2818: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.2819: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2820: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.2821: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.2822: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.2823: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.2824: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.2825: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.2826: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.2827: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2
Source.2828: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.2829: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.2830: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5
Source.2831: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.2832: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.2833: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.2834: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.2835: DFBPPR20467 ---- Animal proteins ---- Tetranectin
Source.2836: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.2837: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.2838: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.2839: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.2840: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.2841: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.2842: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein
Source.2843: DFBPPR20510 ---- Animal proteins ---- Josephin-1
Source.2844: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.2845: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.2846: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6
Source.2847: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.2848: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.2849: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.2850: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.2851: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2
Source.2852: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.2853: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.2854: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.2855: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.2856: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.2857: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.2858: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D
Source.2859: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.2860: DFBPPR20566 ---- Animal proteins ---- RecQ-mediated genome instability protein 2
Source.2861: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.2862: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.2863: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.2864: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74
Source.2865: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.2866: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.2867: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.2868: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.2869: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.2870: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.2871: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.2872: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.2873: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.2874: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.2875: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.2876: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.2877: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2878: DFBPPR20643 ---- Animal proteins ---- Fibrinogen-like protein 1
Source.2879: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.2880: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.2881: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2882: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.2883: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.2884: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3
Source.2885: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.2886: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.2887: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.2888: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.2889: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.2890: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.2891: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.2892: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.2893: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.2894: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.2895: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10
Source.2896: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.2897: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.2898: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase
Source.2899: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.2900: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.2901: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.2902: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12
Source.2903: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.2904: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.2905: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.2906: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.2907: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.2908: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.2909: DFBPPR20767 ---- Animal proteins ---- GTP cyclohydrolase 1 feedback regulatory protein
Source.2910: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain
Source.2911: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.2912: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.2913: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.2914: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.2915: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.2916: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2917: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.2918: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.2919: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.2920: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.2921: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.2922: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.2923: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.2924: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.2925: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.2926: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase
Source.2927: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.2928: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.2929: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.2930: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.2931: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.2932: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.2933: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.2934: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.2935: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B
Source.2936: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.2937: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.2938: DFBPPR20927 ---- Animal proteins ---- ADP-ribosylation factor 4
Source.2939: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.2940: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.2941: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.2942: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.2943: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.2944: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17
Source.2945: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor
Source.2946: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.2947: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.2948: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.2949: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.2950: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.2951: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5
Source.2952: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.2953: DFBPPR21026 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog
Source.2954: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.2955: DFBPPR21033 ---- Animal proteins ---- 26S proteasome complex subunit SEM1
Source.2956: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2957: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.2958: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.2959: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.2960: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.2961: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.2962: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.2963: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.2964: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.2965: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.2966: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.2967: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7
Source.2968: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.2969: DFBPPR21122 ---- Animal proteins ---- Derlin-3
Source.2970: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.2971: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.2972: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.2973: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2974: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.2975: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.2976: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1
Source.2977: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.2978: DFBPPR21173 ---- Animal proteins ---- Sorting nexin-11
Source.2979: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.2980: DFBPPR21185 ---- Animal proteins ---- Lymphocyte antigen 6H
Source.2981: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.2982: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2983: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4
Source.2984: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.2985: DFBPPR21203 ---- Animal proteins ---- Nuclear protein 2
Source.2986: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.2987: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.2988: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.2989: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.2990: DFBPPR21230 ---- Animal proteins ---- Dynein light chain 4, axonemal
Source.2991: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2992: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2
Source.2993: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.2994: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta
Source.2995: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.2996: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2997: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.2998: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.2999: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.3000: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.3001: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.3002: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D
Source.3003: DFBPPR21304 ---- Animal proteins ---- NTF2-related export protein 2
Source.3004: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.3005: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.3006: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.3007: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.3008: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.3009: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.3010: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3
Source.3011: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3
Source.3012: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.3013: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.3014: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.3015: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.3016: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.3017: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.3018: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.3019: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.3020: DFBPPR21363 ---- Animal proteins ---- Pleckstrin homology-like domain family A member 2
Source.3021: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.3022: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.3023: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.3024: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.3025: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu
Source.3026: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.3027: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.3028: DFBPPR21396 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM6 homolog
Source.3029: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.3030: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.3031: DFBPPR21415 ---- Animal proteins ---- Leucine-rich repeat-containing protein 39
Source.3032: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.3033: DFBPPR21426 ---- Animal proteins ---- ORM1-like protein 3
Source.3034: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.3035: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5
Source.3036: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.3037: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.3038: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.3039: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.3040: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.3041: DFBPPR21448 ---- Animal proteins ---- Protein N-lysine methyltransferase METTL21A
Source.3042: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.3043: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.3044: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.3045: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.3046: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.3047: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.3048: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.3049: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.3050: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.3051: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.3052: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.3053: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18
Source.3054: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.3055: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.3056: DFBPPR21513 ---- Animal proteins ---- Profilin-3
Source.3057: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.3058: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.3059: DFBPPR21524 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 receptor
Source.3060: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.3061: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.3062: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.3063: DFBPPR21534 ---- Animal proteins ---- 39S ribosomal protein L46, mitochondrial
Source.3064: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.3065: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.3066: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.3067: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.3068: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.3069: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.3070: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.3071: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.3072: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19
Source.3073: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3074: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.3075: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.3076: DFBPPR21600 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit H
Source.3077: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138
Source.3078: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.3079: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.3080: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.3081: DFBPPR21617 ---- Animal proteins ---- Proteasome assembly chaperone 3
Source.3082: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.3083: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.3084: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial
Source.3085: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein
Source.3086: DFBPPR21644 ---- Animal proteins ---- Mpv17-like protein 2
Source.3087: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.3088: DFBPPR21649 ---- Animal proteins ---- NTF2-related export protein 1
Source.3089: DFBPPR21650 ---- Animal proteins ---- Synaptonemal complex central element protein 1
Source.3090: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.3091: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.3092: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.3093: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.3094: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.3095: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.3096: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.3097: DFBPPR21682 ---- Animal proteins ---- Protein SYS1 homolog
Source.3098: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.3099: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.3100: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator
Source.3101: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.3102: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.3103: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.3104: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.3105: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.3106: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.3107: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.3108: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.3109: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.3110: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.3111: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.3112: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.3113: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.3114: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190
Source.3115: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12
Source.3116: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.3117: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.3118: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.3119: DFBPPR21788 ---- Animal proteins ---- Keratin-associated protein 3-3
Source.3120: DFBPPR21789 ---- Animal proteins ---- Protein kish-B
Source.3121: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.3122: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.3123: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.3124: DFBPPR21805 ---- Animal proteins ---- 60S ribosomal protein L19
Source.3125: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3126: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1
Source.3127: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.3128: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2
Source.3129: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410
Source.3130: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.3131: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.3132: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.3133: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2
Source.3134: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.3135: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.3136: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.3137: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.3138: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.3139: DFBPPR21882 ---- Animal proteins ---- Insulin-like peptide INSL6
Source.3140: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.3141: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.3142: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.3143: DFBPPR21899 ---- Animal proteins ---- Gametocyte-specific factor 1
Source.3144: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.3145: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.3146: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.3147: DFBPPR21915 ---- Animal proteins ---- Tetraspanin-13
Source.3148: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.3149: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3150: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.3151: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.3152: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.3153: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.3154: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.3155: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.3156: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.3157: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.3158: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.3159: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.3160: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.3161: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.3162: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3163: DFBPPR21987 ---- Animal proteins ---- Ribonuclease H2 subunit C
Source.3164: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.3165: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.3166: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.3167: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.3168: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.3169: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.3170: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.3171: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.3172: DFBPPR22030 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 25 kDa protein
Source.3173: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.3174: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.3175: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.3176: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.3177: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.3178: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.3179: DFBPPR22070 ---- Animal proteins ---- Maturin
Source.3180: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.3181: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.3182: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.3183: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.3184: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11
Source.3185: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.3186: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.3187: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.3188: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.3189: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.3190: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.3191: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.3192: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.3193: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.3194: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1
Source.3195: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.3196: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.3197: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.3198: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.3199: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog
Source.3200: DFBPPR22179 ---- Animal proteins ---- CDKN2AIP N-terminal-like protein
Source.3201: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.3202: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.3203: DFBPPR22203 ---- Animal proteins ---- Serum amyloid A-4 protein
Source.3204: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.3205: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1
Source.3206: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.3207: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4
Source.3208: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein
Source.3209: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.3210: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.3211: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.3212: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A
Source.3213: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.3214: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.3215: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5
Source.3216: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.3217: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26
Source.3218: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.3219: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.3220: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.3221: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.3222: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.3223: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.3224: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.3225: DFBPPR22283 ---- Animal proteins ---- F-box only protein 8
Source.3226: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.3227: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2
Source.3228: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.3229: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.3230: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B
Source.3231: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.3232: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31
Source.3233: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.3234: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1
Source.3235: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.3236: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.3237: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1
Source.3238: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.3239: DFBPPR22338 ---- Animal proteins ---- Probable cystatin-16
Source.3240: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.3241: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.3242: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.3243: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.3244: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.3245: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.3246: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.3247: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.3248: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein
Source.3249: DFBPPR22376 ---- Animal proteins ---- 60S ribosomal protein L31
Source.3250: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86
Source.3251: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.3252: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.3253: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.3254: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.3255: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2
Source.3256: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.3257: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.3258: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.3259: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.3260: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18
Source.3261: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.3262: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11
Source.3263: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.3264: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.3265: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2
Source.3266: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.3267: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.3268: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.3269: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.3270: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.3271: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.3272: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C
Source.3273: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.3274: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3275: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.3276: DFBPPR22505 ---- Animal proteins ---- Protein HP-20 homolog
Source.3277: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.3278: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1
Source.3279: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.3280: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.3281: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.3282: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.3283: DFBPPR22584 ---- Animal proteins ---- Arginine vasopressin-induced protein 1
Source.3284: DFBPPR22591 ---- Animal proteins ---- Leucine-rich repeat-containing protein 51
Source.3285: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.3286: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.3287: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.3288: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.3289: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.3290: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153
Source.3291: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270
Source.3292: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.3293: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.3294: DFBPPR22665 ---- Animal proteins ---- UPF0686 protein C11orf1 homolog
Source.3295: DFBPPR22669 ---- Animal proteins ---- Uncharacterized protein C5orf46 homolog
Source.3296: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.3297: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.3298: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.3299: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.3300: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.3301: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.3302: DFBPPR22695 ---- Animal proteins ---- MORN repeat-containing protein 5
Source.3303: DFBPPR22708 ---- Animal proteins ---- Pregnancy-associated protein bPAP
Source.3304: DFBPPR22726 ---- Animal proteins ---- Uncharacterized protein C16orf90 homolog
Source.3305: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.3306: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.3307: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog
Source.3308: DFBPPR22744 ---- Animal proteins ---- Uncharacterized protein C10orf82 homolog
Source.3309: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog
Source.3310: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.3311: DFBPPR22751 ---- Animal proteins ---- Uncharacterized protein C8orf74 homolog
Source.3312: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3313: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.3314: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3315: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.3316: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.3317: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.3318: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.3319: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.3320: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3321: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.3322: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.3323: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3324: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3325: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.3326: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.3327: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.3328: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.3329: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.3330: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.3331: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.3332: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2
Source.3333: DFBPPR8607 ---- Animal proteins ---- Prolactin
Source.3334: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3335: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.3336: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3337: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3338: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.3339: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.3340: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.3341: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.3342: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.3343: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.3344: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.3345: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.3346: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.3347: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.3348: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.3349: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3350: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.3351: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.3352: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.3353: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.3354: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.3355: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.3356: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.3357: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.3358: DFBPPR8675 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.3359: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.3360: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.3361: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3362: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.3363: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.3364: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.3365: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.3366: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3367: DFBPPR8698 ---- Animal proteins ---- Prorelaxin
Source.3368: DFBPPR8699 ---- Animal proteins ---- ADP-ribosylation factor 6
Source.3369: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.3370: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.3371: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.3372: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.3373: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.3374: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.3375: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.3376: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.3377: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.3378: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.3379: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.3380: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3381: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.3382: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3383: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.3384: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3385: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3386: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.3387: DFBPPR8758 ---- Animal proteins ---- Caveolin-2
Source.3388: DFBPPR8759 ---- Animal proteins ---- Caveolin-3
Source.3389: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.3390: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3391: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.3392: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3393: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.3394: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.3395: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.3396: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3397: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.3398: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.3399: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.3400: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.3401: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.3402: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.3403: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.3404: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.3405: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3406: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.3407: DFBPPR8860 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.3408: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.3409: DFBPPR8879 ---- Animal proteins ---- Glandular kallikrein
Source.3410: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3411: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3412: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.3413: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.3414: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.3415: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.3416: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3417: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.3418: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.3419: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.3420: DFBPPR8932 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.3421: DFBPPR8933 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.3422: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3423: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.3424: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.3425: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.3426: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta
Source.3427: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.3428: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.3429: DFBPPR8983 ---- Animal proteins ---- Receptor activity-modifying protein 1
Source.3430: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3431: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.3432: DFBPPR8988 ---- Animal proteins ---- Erythropoietin
Source.3433: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.3434: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.3435: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3436: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3437: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.3438: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.3439: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.3440: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.3441: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.3442: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.3443: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.3444: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4
Source.3445: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.3446: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.3447: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.3448: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.3449: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3450: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.3451: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.3452: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.3453: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.3454: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3455: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.3456: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3457: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3458: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3459: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.3460: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.3461: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.3462: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.3463: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3464: DFBPPR9128 ---- Animal proteins ---- Interleukin-13
Source.3465: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.3466: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3467: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.3468: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.3469: DFBPPR9190 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.3470: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.3471: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.3472: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3473: DFBPPR9202 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2B
Source.3474: DFBPPR9212 ---- Animal proteins ---- Dihydrofolate reductase
Source.3475: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.3476: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.3477: DFBPPR9218 ---- Animal proteins ---- POU domain, class 3, transcription factor 3
Source.3478: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.3479: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.3480: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.3481: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.3482: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.3483: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.3484: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.3485: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.3486: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.3487: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.3488: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3489: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.3490: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.3491: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.3492: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.3493: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.3494: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.3495: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3496: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.3497: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3498: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.3499: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.3500: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.3501: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.3502: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.3503: DFBPPR9288 ---- Animal proteins ---- Beta-microseminoprotein
Source.3504: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.3505: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.3506: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.3507: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3508: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.3509: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.3510: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.3511: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.3512: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.3513: DFBPPR9324 ---- Animal proteins ---- Carbohydrate-binding protein AQN-3
Source.3514: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.3515: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3
Source.3516: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.3517: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.3518: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.3519: DFBPPR9345 ---- Animal proteins ---- Relaxin-3
Source.3520: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.3521: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.3522: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.3523: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.3524: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.3525: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3526: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.3527: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.3528: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.3529: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.3530: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.3531: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.3532: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.3533: DFBPPR9402 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.3534: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.3535: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.3536: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3537: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3538: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3539: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.3540: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.3541: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.3542: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3543: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3544: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3545: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3546: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.3547: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.3548: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3549: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.3550: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.3551: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.3552: DFBPPR9497 ---- Animal proteins ---- Myoglobin
Source.3553: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.3554: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.3555: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.3556: DFBPPR9511 ---- Animal proteins ---- Cholinesterase
Source.3557: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.3558: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.3559: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1
Source.3560: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.3561: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3562: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.3563: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.3564: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E
Source.3565: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.3566: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.3567: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.3568: DFBPPR9558 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.3569: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.3570: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.3571: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.3572: DFBPPR9568 ---- Animal proteins ---- Antibacterial peptide PMAP-23
Source.3573: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.3574: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.3575: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.3576: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.3577: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3578: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.3579: DFBPPR9631 ---- Animal proteins ---- Lithostathine
Source.3580: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3581: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.3582: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.3583: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.3584: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3585: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.3586: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3587: DFBPPR9685 ---- Animal proteins ---- Interleukin-27 subunit alpha
Source.3588: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.3589: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.3590: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.3591: DFBPPR9695 ---- Animal proteins ---- Seminal plasma sperm motility inhibitor
Source.3592: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.3593: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.3594: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.3595: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain
Source.3596: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3597: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.3598: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.3599: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain
Source.3600: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.3601: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.3602: DFBPPR9749 ---- Animal proteins ---- Guanylin
Source.3603: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.3604: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3605: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.3606: DFBPPR9767 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.3607: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.3608: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.3609: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.3610: DFBPPR9786 ---- Animal proteins ---- Adipogenin
Source.3611: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.3612: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.3613: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.3614: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.3615: DFBPPR9819 ---- Animal proteins ---- 40S ribosomal protein S9
Source.3616: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.3617: DFBPPR9828 ---- Animal proteins ---- Dynein light chain 4, axonemal
Source.3618: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3619: DFBPPR9843 ---- Animal proteins ---- P protein
Source.3620: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.3621: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3622: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.3623: DFBPPR9881 ---- Animal proteins ---- 60S ribosomal protein L31
Source.3624: DFBPPR9893 ---- Animal proteins ---- MICOS complex subunit MIC13
Source.3625: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.3626: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.3627: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1
Source.3628: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3629: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.3630: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.3631: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.3632: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.3633: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.3634: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.3635: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3636: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.3637: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3638: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.3639: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1
Source.3640: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3641: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.3642: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.3643: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.3644: DFBPPR9992 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.3645: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.3646: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.3647: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.3648: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.3649: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.3650: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.3651: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3652: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.3653: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.3654: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.3655: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3656: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.3657: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.3658: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.3659: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.3660: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.3661: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17
Source.3662: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.3663: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.3664: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3665: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3666: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3667: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.3668: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.3669: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.3670: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.3671: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3672: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.3673: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.3674: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.3675: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.3676: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.3677: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3678: DFBPPR10105 ---- Animal proteins ---- ADP-ribosylation factor 6
Source.3679: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.3680: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.3681: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.3682: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.3683: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.3684: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.3685: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.3686: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.3687: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3688: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.3689: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.3690: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.3691: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3692: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.3693: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.3694: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.3695: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II
Source.3696: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.3697: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.3698: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.3699: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.3700: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3701: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.3702: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1
Source.3703: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.3704: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.3705: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.3706: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.3707: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3708: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.3709: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.3710: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.3711: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.3712: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.3713: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.3714: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.3715: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.3716: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.3717: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.3718: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.3719: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.3720: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.3721: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.3722: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.3723: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.3724: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain
Source.3725: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.3726: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3727: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.3728: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.3729: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.3730: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.3731: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.3732: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.3733: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.3734: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.3735: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.3736: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3737: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3738: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.3739: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.3740: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.3741: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.3742: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.3743: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3744: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.3745: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.3746: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.3747: DFBPPR10298 ---- Animal proteins ---- Caldesmon
Source.3748: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.3749: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.3750: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3751: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.3752: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.3753: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.3754: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.3755: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3
Source.3756: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.3757: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.3758: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3759: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.3760: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.3761: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.3762: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.3763: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.3764: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.3765: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.3766: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.3767: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.3768: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.3769: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3770: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.3771: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.3772: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.3773: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.3774: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.3775: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.3776: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.3777: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.3778: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.3779: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3780: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.3781: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.3782: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.3783: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.3784: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.3785: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.3786: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3787: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3788: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3789: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.3790: DFBPPR10433 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.3791: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.3792: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.3793: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.3794: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3795: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.3796: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.3797: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.3798: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.3799: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.3800: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.3801: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3802: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.3803: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.3804: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.3805: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.3806: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.3807: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.3808: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.3809: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.3810: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.3811: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.3812: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.3813: DFBPPR10509 ---- Animal proteins ---- Calponin-1
Source.3814: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.3815: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.3816: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.3817: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.3818: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.3819: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.3820: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.3821: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.3822: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.3823: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3824: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.3825: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.3826: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3827: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.3828: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3829: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3830: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.3831: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.3832: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.3833: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.3834: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.3835: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.3836: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.3837: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.3838: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.3839: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.3840: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.3841: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.3842: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.3843: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.3844: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.3845: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.3846: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.3847: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.3848: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.3849: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3850: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3851: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.3852: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3
Source.3853: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.3854: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.3855: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3856: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3857: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase
Source.3858: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.3859: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.3860: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3861: DFBPPR10710 ---- Animal proteins ---- Linker for activation of T-cells family member 2
Source.3862: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.3863: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.3864: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.3865: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.3866: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.3867: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.3868: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.3869: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.3870: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.3871: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.3872: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.3873: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3874: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.3875: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.3876: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1
Source.3877: DFBPPR10757 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.3878: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3879: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3880: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3881: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.3882: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.3883: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.3884: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.3885: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.3886: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.3887: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.3888: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.3889: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.3890: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3891: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.3892: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.3893: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.3894: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.3895: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.3896: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.3897: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3898: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.3899: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.3900: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.3901: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.3902: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3903: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.3904: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.3905: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.3906: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.3907: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.3908: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.3909: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.3910: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.3911: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.3912: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.3913: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5
Source.3914: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.3915: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.3916: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.3917: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.3918: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.3919: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.3920: DFBPPR10915 ---- Animal proteins ---- Hepatic lectin
Source.3921: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.3922: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.3923: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.3924: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.3925: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.3926: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.3927: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.3928: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.3929: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.3930: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.3931: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.3932: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.3933: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.3934: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.3935: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.3936: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho
Source.3937: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.3938: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.3939: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.3940: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type
Source.3941: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.3942: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.3943: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.3944: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3945: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.3946: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.3947: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.3948: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.3949: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.3950: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.3951: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.3952: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.3953: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.3954: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.3955: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.3956: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.3957: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.3958: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.3959: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.3960: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.3961: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein
Source.3962: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.3963: DFBPPR11034 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.3964: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.3965: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.3966: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.3967: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.3968: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.3969: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.3970: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.3971: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.3972: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3973: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.3974: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.3975: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.3976: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.3977: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.3978: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.3979: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3980: DFBPPR11092 ---- Animal proteins ---- Ataxin-3
Source.3981: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.3982: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.3983: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.3984: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.3985: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3986: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.3987: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.3988: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3
Source.3989: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.3990: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.3991: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.3992: DFBPPR11146 ---- Animal proteins ---- Formin
Source.3993: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3994: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.3995: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.3996: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.3997: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.3998: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.3999: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.4000: DFBPPR11169 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.4001: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.4002: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4003: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.4004: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.4005: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.4006: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.4007: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.4008: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.4009: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.4010: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.4011: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.4012: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.4013: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.4014: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.4015: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.4016: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.4017: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.4018: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.4019: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.4020: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.4021: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.4022: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.4023: DFBPPR11253 ---- Animal proteins ---- Peripherin-2
Source.4024: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.4025: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.4026: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.4027: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.4028: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.4029: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.4030: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.4031: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.4032: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.4033: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.4034: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3
Source.4035: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.4036: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.4037: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.4038: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.4039: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.4040: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.4041: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.4042: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.4043: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.4044: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.4045: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.4046: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.4047: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.4048: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4049: DFBPPR11397 ---- Animal proteins ---- Frizzled-3
Source.4050: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.4051: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.4052: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.4053: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1
Source.4054: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.4055: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.4056: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.4057: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.4058: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4059: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.4060: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.4061: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.4062: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.4063: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2
Source.4064: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2
Source.4065: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2
Source.4066: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.4067: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.4068: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.4069: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.4070: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.4071: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.4072: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.4073: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1
Source.4074: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.4075: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.4076: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.4077: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.4078: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.4079: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12
Source.4080: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.4081: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.4082: DFBPPR11552 ---- Animal proteins ---- RecQ-mediated genome instability protein 2
Source.4083: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.4084: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.4085: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32
Source.4086: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.4087: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.4088: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.4089: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.4090: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.4091: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.4092: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.4093: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.4094: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.4095: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.4096: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4097: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein
Source.4098: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.4099: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.4100: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.4101: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.4102: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.4103: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.4104: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.4105: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.4106: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.4107: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.4108: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.4109: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4110: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.4111: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.4112: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1
Source.4113: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.4114: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.4115: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.4116: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4
Source.4117: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.4118: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.4119: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.4120: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.4121: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.4122: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.4123: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.4124: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.4125: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.4126: DFBPPR11751 ---- Animal proteins ---- NTF2-related export protein 2
Source.4127: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.4128: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.4129: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.4130: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.4131: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.4132: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.4133: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.4134: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.4135: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5
Source.4136: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.4137: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.4138: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62
Source.4139: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.4140: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.4141: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.4142: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.4143: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.4144: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.4145: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.4146: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.4147: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1
Source.4148: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.4149: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.4150: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.4151: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82
Source.4152: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.4153: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.4154: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.4155: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.4156: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.4157: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.4158: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.4159: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.4160: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.4161: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.4162: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.4163: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.4164: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.4165: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.4166: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.4167: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.4168: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.4169: DFBPPR11929 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD
Source.4170: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.4171: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.4172: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.4173: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.4174: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.4175: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.4176: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.4177: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.4178: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.4179: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.4180: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.4181: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.4182: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.4183: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.4184: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.4185: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.4186: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.4187: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.4188: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.4189: DFBPPR12001 ---- Animal proteins ---- Pleckstrin homology domain-containing family F member 2
Source.4190: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein
Source.4191: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.4192: DFBPPR12015 ---- Animal proteins ---- Homeobox protein Hox-D1
Source.4193: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.4194: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1
Source.4195: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.4196: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.4197: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208
Source.4198: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.4199: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.4200: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.4201: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.4202: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.4203: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.4204: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.4205: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.4206: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.4207: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.4208: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.4209: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.4210: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.4211: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.4212: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.4213: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.4214: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.4215: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.4216: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.4217: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.4218: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.4219: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.4220: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.4221: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.4222: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.4223: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.4224: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.4225: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.4226: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.4227: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.4228: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.4229: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.4230: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.4231: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.4232: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.4233: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.4234: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.4235: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.4236: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.4237: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.4238: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B
Source.4239: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.4240: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.4241: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.4242: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.4243: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.4244: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.4245: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.4246: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.4247: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.4248: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.4249: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.4250: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.4251: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.4252: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.4253: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.4254: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.4255: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.4256: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.4257: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.4258: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.4259: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.4260: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.4261: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.4262: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.4263: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4264: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.4265: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.4266: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.4267: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.4268: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.4269: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.4270: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.4271: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4272: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.4273: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.4274: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.4275: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.4276: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.4277: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4278: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.4279: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.4280: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.4281: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.4282: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.4283: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.4284: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.4285: DFBPPR12336 ---- Animal proteins ---- Apolipoprotein D
Source.4286: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.4287: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4288: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4289: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.4290: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.4291: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.4292: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.4293: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4294: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.4295: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4296: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.4297: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.4298: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4299: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.4300: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.4301: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.4302: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.4303: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.4304: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.4305: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.4306: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.4307: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.4308: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.4309: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.4310: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.4311: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.4312: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.4313: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.4314: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.4315: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.4316: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4317: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4318: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.4319: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.4320: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.4321: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.4322: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.4323: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4324: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.4325: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.4326: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.4327: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.4328: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.4329: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.4330: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.4331: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.4332: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4333: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.4334: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4335: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.4336: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.4337: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.4338: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.4339: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.4340: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.4341: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4
Source.4342: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.4343: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.4344: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.4345: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.4346: DFBPPR12534 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.4347: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.4348: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.4349: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.4350: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.4351: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4352: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.4353: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4354: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.4355: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.4356: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.4357: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.4358: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4359: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.4360: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.4361: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.4362: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4363: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.4364: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.4365: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.4366: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.4367: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.4368: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4369: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.4370: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.4371: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.4372: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.4373: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.4374: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.4375: DFBPPR12629 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.4376: DFBPPR12632 ---- Animal proteins ---- Caveolin-2
Source.4377: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.4378: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.4379: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.4380: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.4381: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.4382: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.4383: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.4384: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.4385: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.4386: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.4387: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4388: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4389: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.4390: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.4391: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.4392: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.4393: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.4394: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.4395: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.4396: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.4397: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.4398: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.4399: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.4400: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.4401: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.4402: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.4403: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.4404: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.4405: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.4406: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.4407: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.4408: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.4409: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.4410: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4
Source.4411: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.4412: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.4413: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4414: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.4415: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.4416: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.4417: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.4418: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.4419: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.4420: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.4421: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.4422: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.4423: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.4424: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.4425: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.4426: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4427: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4428: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.4429: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.4430: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.4431: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.4432: DFBPPR12888 ---- Animal proteins ---- Myoglobin
Source.4433: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.4434: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.4435: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.4436: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.4437: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.4438: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.4439: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.4440: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A
Source.4441: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.4442: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B
Source.4443: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.4444: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.4445: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.4446: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.4447: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.4448: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4449: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.4450: DFBPPR12948 ---- Animal proteins ---- Apolipoprotein C-IV
Source.4451: DFBPPR12952 ---- Animal proteins ---- Serum amyloid A-1 protein
Source.4452: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.4453: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.4454: DFBPPR12969 ---- Animal proteins ---- Prolactin
Source.4455: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.4456: DFBPPR12974 ---- Animal proteins ---- Serum amyloid A-3 protein
Source.4457: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.4458: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.4459: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A
Source.4460: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.4461: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.4462: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4463: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.4464: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.4465: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform
Source.4466: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.4467: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.4468: DFBPPR13024 ---- Animal proteins ---- Erythropoietin
Source.4469: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.4470: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.4471: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta
Source.4472: DFBPPR13052 ---- Animal proteins ---- Ubiquitin-like protein 4A
Source.4473: DFBPPR13055 ---- Animal proteins ---- Serum amyloid A-2 protein
Source.4474: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.4475: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.4476: DFBPPR13084 ---- Animal proteins ---- Ig heavy chain V-A2 region K-25
Source.4477: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4478: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1
Source.4479: DFBPPR13112 ---- Animal proteins ---- Ig heavy chain V-A1 region BS-5
Source.4480: DFBPPR13114 ---- Animal proteins ---- Ig heavy chain V-A2 region BS-1
Source.4481: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4482: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region
Source.4483: DFBPPR13142 ---- Animal proteins ---- Phospholipase A2
Source.4484: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.4485: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4486: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.4487: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain
Source.4488: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4489: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.4490: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.4491: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4492: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4493: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.4494: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.4495: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.4496: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4497: DFBPPR13197 ---- Animal proteins ---- Caveolin-2
Source.4498: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.4499: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4500: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.4501: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.4502: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta
Source.4503: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.4504: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4505: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.4506: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4507: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.4508: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.4509: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.4510: DFBPPR13257 ---- Animal proteins ---- Prolactin
Source.4511: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4512: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4513: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.4514: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.4515: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.4516: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.4517: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.4518: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.4519: DFBPPR13300 ---- Animal proteins ---- Sex-determining region Y protein
Source.4520: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4521: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.4522: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.4523: DFBPPR13323 ---- Animal proteins ---- Myoglobin
Source.4524: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.4525: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.4526: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4527: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.4528: DFBPPR13349 ---- Animal proteins ---- Cysteine-rich secretory protein 3
Source.4529: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.4530: DFBPPR13358 ---- Animal proteins ---- Erythropoietin
Source.4531: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.4532: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4
Source.4533: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.4534: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4535: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4536: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4537: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4538: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.4539: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.4540: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4541: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.4542: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.4543: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.4544: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.4545: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4546: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4547: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4548: DFBPPR13457 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4549: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4550: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.4551: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.4552: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.4553: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.4554: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4555: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.4556: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.4557: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.4558: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.4559: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4560: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4561: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.4562: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.4563: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.4564: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.4565: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.4566: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.4567: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4568: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.4569: DFBPPR13583 ---- Animal proteins ---- Caveolin-2
Source.4570: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4571: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1
Source.4572: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.4573: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4574: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4575: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.4576: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4577: DFBPPR13606 ---- Animal proteins ---- Estrogen receptor
Source.4578: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4579: DFBPPR13609 ---- Animal proteins ---- Lutropin subunit beta
Source.4580: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.4581: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.4582: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.4583: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4584: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.4585: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.4586: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.4587: DFBPPR13627 ---- Animal proteins ---- Erythropoietin
Source.4588: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.4589: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.4590: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4591: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.4592: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.4593: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.4594: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4595: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.4596: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.4597: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4598: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.4599: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.4600: DFBPPR13708 ---- Animal proteins ---- Renin
Source.4601: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.4602: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.4603: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.4604: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.4605: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.4606: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4607: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.4608: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4609: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4610: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.4611: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.4612: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.4613: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.4614: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.4615: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.4616: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4617: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4618: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.4619: DFBPPR13782 ---- Animal proteins ---- BMP and activin membrane-bound inhibitor homolog
Source.4620: DFBPPR13791 ---- Animal proteins ---- Cholinesterase
Source.4621: DFBPPR13805 ---- Animal proteins ---- Serum amyloid A protein
Source.4622: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.4623: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.4624: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.4625: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.4626: DFBPPR13869 ---- Animal proteins ---- Keratin, high sulfur matrix protein, IIIB4
Source.4627: DFBPPR13872 ---- Animal proteins ---- Keratin, high sulfur matrix protein, IIIB3
Source.4628: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4629: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4630: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4631: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.4632: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.4633: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.4634: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4635: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.4636: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4637: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.4638: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.4639: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4640: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2
Source.4641: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4642: DFBPPR13993 ---- Animal proteins ---- Insulin
Source.4643: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.4644: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.4645: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.4646: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.4647: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.4648: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.4649: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.4650: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4651: DFBPPR14007 ---- Animal proteins ---- Cystatin
Source.4652: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.4653: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.4654: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4655: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.4656: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4657: DFBPPR14025 ---- Animal proteins ---- Granulin-1
Source.4658: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.4659: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4660: DFBPPR14054 ---- Animal proteins ---- Pro-neuropeptide Y
Source.4661: DFBPPR14057 ---- Animal proteins ---- Granulin-2
Source.4662: DFBPPR14058 ---- Animal proteins ---- Granulin-3
Source.4663: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.4664: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4665: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.4666: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.4667: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.4668: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.4669: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.4670: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.4671: DFBPPR14102 ---- Marine protein ---- Anamorsin-B
Source.4672: DFBPPR14104 ---- Marine protein ---- Anamorsin-A
Source.4673: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.4674: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.4675: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.4676: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.4677: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.4678: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.4679: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.4680: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.4681: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.4682: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.4683: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.4684: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.4685: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.4686: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A
Source.4687: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.4688: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.4689: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B
Source.4690: DFBPPR14203 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-A
Source.4691: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.4692: DFBPPR14207 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.4693: DFBPPR14208 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.4694: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9
Source.4695: DFBPPR14218 ---- Marine protein ---- 60S ribosomal protein L18a
Source.4696: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.4697: DFBPPR14241 ---- Marine protein ---- Cystatin
Source.4698: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.4699: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.4700: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.4701: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.4702: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.4703: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.4704: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.4705: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.4706: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.4707: DFBPPR14311 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic
Source.4708: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4709: DFBPPR14316 ---- Marine protein ---- 50S ribosomal protein L28, chloroplastic
Source.4710: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4711: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.4712: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.4713: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4714: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.4715: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.4716: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.4717: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.4718: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.4719: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.4720: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.4721: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.4722: DFBPPR14384 ---- Marine protein ---- Cytochrome b6-f complex subunit 8
Source.4723: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.4724: DFBPPR14419 ---- Marine protein ---- Photosystem II reaction center protein K
Source.4725: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.4726: DFBPPR14440 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic
Source.4727: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4728: DFBPPR14465 ---- Marine protein ---- 50S ribosomal protein L16, chloroplastic
Source.4729: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.4730: DFBPPR14488 ---- Marine protein ---- Putative cytochrome c-type biogenesis protein DbsD-like
Source.4731: DFBPPR14501 ---- Marine protein ---- 50S ribosomal protein L28, chloroplastic
Source.4732: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.4733: DFBPPR14519 ---- Marine protein ---- Uncharacterized protein ycf21
Source.4734: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.4735: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.4736: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.4737: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.4738: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.4739: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.4740: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.4741: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.4742: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.4743: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.4744: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.4745: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.4746: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.4747: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4748: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.4749: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.4750: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.4751: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.4752: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.4753: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1
Source.4754: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.4755: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.4756: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.4757: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.4758: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.4759: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.4760: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.4761: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.4762: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.4763: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.4764: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.4765: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.4766: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.4767: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.4768: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.4769: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.4770: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.4771: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.4772: DFBPPR14698 ---- Marine protein ---- Cystatin
Source.4773: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.4774: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.4775: DFBPPR14720 ---- Marine protein ---- Transcription initiation factor IIA subunit 2
Source.4776: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.4777: DFBPPR14737 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.4778: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.4779: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B
Source.4780: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.4781: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.4782: DFBPPR14760 ---- Marine protein ---- Big defensin
Source.4783: DFBPPR14762 ---- Marine protein ---- Coagulogen
Source.4784: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.4785: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.4786: DFBPPR14770 ---- Marine protein ---- Lectin L6
Source.4787: DFBPPR14771 ---- Marine protein ---- L-cystatin
Source.4788: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.4789: DFBPPR14797 ---- Marine protein ---- Gonad-inhibiting hormone
Source.4790: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.4791: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.4792: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.4793: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.4794: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1
Source.4795: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta
Source.4796: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.4797: DFBPPR14880 ---- Microorganism protein ---- Spindle assembly checkpoint kinase
Source.4798: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.4799: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.4800: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.4801: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.4802: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.4803: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.4804: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.4805: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.4806: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.4807: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.4808: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.4809: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.4810: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.4811: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial
Source.4812: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.4813: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.4814: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.4815: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.4816: DFBPPR14976 ---- Microorganism protein ---- Adenylate kinase
Source.4817: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.4818: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.4819: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.4820: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1
Source.4821: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.4822: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.4823: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.4824: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.4825: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1
Source.4826: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.4827: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.4828: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.4829: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.4830: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.4831: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.4832: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.4833: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.4834: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.4835: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.4836: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13
Source.4837: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.4838: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.4839: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.4840: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.4841: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.4842: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.4843: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.4844: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.4845: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.4846: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.4847: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.4848: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.4849: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.4850: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase
Source.4851: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.4852: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.4853: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.4854: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.4855: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.4856: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.4857: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.4858: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.4859: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.4860: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.4861: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.4862: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.4863: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.4864: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.4865: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.4866: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.4867: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.4868: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.4869: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.4870: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1
Source.4871: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.4872: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.4873: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.4874: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.4875: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.4876: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.4877: DFBPPR15243 ---- Microorganism protein ---- Coupling of ubiquitin conjugation to ER degradation protein 1
Source.4878: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a
Source.4879: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.4880: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.4881: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1
Source.4882: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.4883: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.4884: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.4885: DFBPPR15276 ---- Microorganism protein ---- Guanine nucleotide-binding protein subunit gamma
Source.4886: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.4887: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone
Source.4888: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase
Source.4889: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12
Source.4890: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.4891: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.4892: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.4893: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.4894: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.4895: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase
Source.4896: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.4897: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.4898: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.4899: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.4900: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.4901: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.4902: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.4903: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.4904: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.4905: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.4906: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.4907: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.4908: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.4909: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.4910: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.4911: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.4912: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.4913: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.4914: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.4915: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial
Source.4916: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.4917: DFBPPR15393 ---- Microorganism protein ---- Inner membrane assembly complex subunit 17
Source.4918: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.4919: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.4920: DFBPPR15399 ---- Microorganism protein ---- 40S ribosomal protein S21
Source.4921: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.4922: DFBPPR15410 ---- Microorganism protein ---- Mitochondrial inner membrane protease ATP23
Source.4923: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4
Source.4924: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.4925: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.4926: DFBPPR15437 ---- Microorganism protein ---- Ubiquitin-like-conjugating enzyme ATG10
Source.4927: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.4928: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.4929: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.4930: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.4931: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.4932: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.4933: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1
Source.4934: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.4935: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.4936: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.4937: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.4938: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.4939: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.4940: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.4941: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.4942: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.4943: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.4944: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.4945: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.4946: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.4947: DFBPPR15543 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 7
Source.4948: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.4949: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.4950: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4
Source.4951: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.4952: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.4953: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.4954: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.4955: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.4956: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.4957: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.4958: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.4959: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.4960: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.4961: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.4962: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.4963: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.4964: DFBPPR15614 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX16, mitochondrial
Source.4965: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.4966: DFBPPR15621 ---- Microorganism protein ---- Spore membrane assembly protein 2
Source.4967: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.4968: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.4969: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5
Source.4970: DFBPPR15643 ---- Microorganism protein ---- Peroxisome assembly protein 22
Source.4971: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25
Source.4972: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.4973: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.4974: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1
Source.4975: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1
Source.4976: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.4977: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.4978: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.4979: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.4980: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.4981: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.4982: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.4983: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.4984: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.4985: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.4986: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.4987: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.4988: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.4989: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2
Source.4990: DFBPPR15734 ---- Microorganism protein ---- 40S ribosomal protein S29
Source.4991: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.4992: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.4993: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.4994: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.4995: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1
Source.4996: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.4997: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.4998: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.4999: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.5000: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.5001: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase
Source.5002: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.5003: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.5004: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase
Source.5005: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.5006: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.5007: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.5008: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.5009: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.5010: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.5011: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.5012: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.5013: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.5014: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.5015: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.5016: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.5017: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.5018: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.5019: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.5020: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.5021: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1
Source.5022: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.5023: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.5024: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5025: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.5026: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.5027: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.5028: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.5029: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.5030: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.5031: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5032: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.5033: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.5034: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.5035: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.5036: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5037: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.5038: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5039: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.5040: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.5041: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.5042: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5043: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.5044: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.5045: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.5046: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5047: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.5048: DFBPPR7813 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.5049: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.5050: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5051: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.5052: DFBPPR7833 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.5053: DFBPPR7834 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase homolog 2
Source.5054: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.5055: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.5056: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.5057: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.5058: DFBPPR7866 ---- Plant protein ---- Photosystem II reaction center protein K
Source.5059: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.5060: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.5061: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.5062: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.5063: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1
Source.5064: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.5065: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5066: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.5067: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.5068: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.5069: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.5070: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.5071: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5072: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5073: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.5074: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.5075: DFBPPR8033 ---- Plant protein ---- Uricase-2
Source.5076: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.5077: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5078: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.5079: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.5080: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5081: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.5082: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic
Source.5083: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5084: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.5085: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.5086: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.5087: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.5088: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5089: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase
Source.5090: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5091: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.5092: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.5093: DFBPPR8095 ---- Plant protein ---- Profilin-1
Source.5094: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.5095: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.5096: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.5097: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5098: DFBPPR8106 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.5099: DFBPPR8112 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.5100: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.5101: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.5102: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.5103: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.5104: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.5105: DFBPPR8153 ---- Plant protein ---- Thaumatin-like protein
Source.5106: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.5107: DFBPPR8156 ---- Plant protein ---- Nodulin-30
Source.5108: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.5109: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.5110: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5111: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.5112: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.5113: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.5114: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5115: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5116: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.5117: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.5118: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5119: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.5120: DFBPPR8247 ---- Plant protein ---- Nucleoside diphosphate kinase
Source.5121: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5122: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.5123: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.5124: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.5125: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5126: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.5127: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5128: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.5129: DFBPPR8277 ---- Plant protein ---- Profilin
Source.5130: DFBPPR8278 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.5131: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.5132: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.5133: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K
Source.5134: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.5135: DFBPPR8307 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.5136: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.5137: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.5138: DFBPPR8341 ---- Plant protein ---- Cysteine proteinase inhibitor A
Source.5139: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
Link 1: DFBPACEI0535----Grains----Sake lees
Link 2: DFBPACEI1176----Wakame (undaria pinnatifida)----Wakame hydrolysates
Link 3: DFBPACEI1193----Wakame (Undaria pinnatifida)----Extract of wakame powder
Link 4: DFBPACEI1198----Alfalfa (Medicago sativa)----Alfalfa white protein RuBisCO
Link 5: DFBPACEI1211----Shrimp----Izumi shrimp
Link 6: DFBPACEI1217----Antarctic krill (Euphausia superba)----Antarctic krill tail meat
Link 7: DFBPACEI1317----Bovine milk----Casein
Link 8: DFBPACEI1346----Land snail (Helix aspersa)----Hepatopancreas (by-product)
Link 9: DFBPACEI1351----Rapseed (Napin)----Rapseed meal protein
Link 10: DFBPACEI1553----Chum salmon----Defatted chum salmon muscle protein
Link 11: DFBPACEI1897----Amaranth seed proteins----Amaranth glutelins
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide showed potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 3.5 ± 1.5 μM (n = 3, mean ± SD).

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydroysis

Enzyme(s)/starter culture

Enzymatic hydrolysis of proteins from rice, soy, pea and wheat, with both chymotrypsin and thermolysin, resulted in hydrolysates, which are efficient inhibitors of the angiotensin-converting enzyme (ACE).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

Compared to hydrolysates from whey protein, where the inhibitory effect can almost exclusively be attributed to Ile-Trp, the ACE inhibition by plant protein hydrolysates is caused by a variety of peptides, in particular tyrosine-containing peptides. Hydrolysates of plant proteins are promising ingredients for the development of functional foods.

Table 1. Amounts of selected tryptophan- and tyrosine-containing dipeptides (mg per g) in the butanol extracts (n = 3, mean ± SD).
Peptides
IC50 (μmol/L)
soy [mg/g]
rice [mg/g]
wheat [mg/g]
pea [mg/g]
whey [mg/g]
IW
1.1 ± 0.7
0.74 ± 0.03
0.38 ± 0.090.52 ± 0.15
0.46 ± 0.05
10.7 ± 1.82
LW
10 ± 1.6
5.26 ± 0.041.51 ± 0.14
3.24 ± 0.74
0.87 ± 0.09
n.d.
KW
4.3 ± 1.5
n.d.0.41 ± 0.16
0.13 ± 0.02
0.09 ± 0.02
1.48 ± 0.47
FW
9.5 ± 1.2
0.52 ± 0.120.65 ± 0.14n.d.
1.60 ± 0.34
n.d.
VW
3.5 ± 1.5
0.36 ± 0.071.34 ± 0.070.42 ± 0.040.43 ± 0.08
n.d.
IY
5.2 ± 1.4
6.52 ± 1.025.44 ± 1.598.95 ± 0.482.59 ± 0.18
n.d.
LY
93 ± 3.2
7.90 ± 2.6210.62 ± 0.327.68 ± 2.4010.27 ± 1.39
n.d.
KY
> 100
1.29 ± 0.313.74 ± 0.890.91 ± 0.600.71 ± 0.28
n.d.
FY
58 ± 1.8
1.91 ± 0.112.43 ± 0.427.30 ± 0.512.07 ± 0.70
n.d.
VY
9.4 ± 1.3
1.47 ± 0.239.26 ± 0.971.68 ± 0.363.10 ± 0.18
4.03 ± 0.69
Abbreviation: n.d., not detected.
Database cross-references
DFBP
[D1] DFBPANHY0070, DFBPANHY0071, DFBPANHY0072, DFBPANHY0618, DFBPANHY0069, DFBPANHY0917, DFBPANHY0707
[D2] DFBPANOX0427
[D3] DFBPALGL0001
[D4] DFBPINPE0018
[D5] DFBPMUFU0130
BIOPEP-UWM [D6] 3486, 8461, 8928, 9387
APD [D7] -
BioPepDB [D8] -
MBPDB [D9] -
Reference(s)
Primary literature Rudolph S, Lunow D, Kaiser S, Henle T. Identification and quantification of ACE-inhibiting peptides in enzymatic hydrolysates of plant proteins. Food Chem. 2017 Jun 1;224:19-25.
PMID: 28159254
Other literature(s) N.D
PubDate 2017
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214