| DFBP ID - DFBPAGPE0009(Alpha-gliadin peptide) |
| DFBP ID |
DFBPAGPE0009 |
| Peptide sequence |
LGQQQPFPPQQPY |
| Type |
Native peptide |
| Peptide/Function name |
α-Gliadin peptide, Coeliac toxic peptide |
|
| Function-activity relationship |
| Main bioactivity |
Alpha-gliadin peptide activity |
| Otheir bioactivity |
N.D |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Leu-Gly-Gln-Gln-Gln-Pro-Phe-Pro-Pro-Gln-Gln-Pro-Tyr |
| Single-letter amino acid |
LGQQQPFPPQQPY |
| Peptide length |
13 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| 1527.6820 Da |
1527.71 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
5.92 c |
| IC50 |
N.D |
| pIC50 |
N.D |
| GRAVY |
-1.4615 c |
| Hydrophilic residue ratio |
53.85% c |
| Peptide calculator |
|
|
| Peptide source & Food-borne protein(s) search |
| Classification |
Plant |
| Organism/Source |
Wheat |
| Precursor protein |
α-Gliadin |
| Residue position |
f(56-68)
|
|
Precursor protein(s) search
|
|
|
Link-research
|
There are no literature reports on the discovery of this sequence in other food-source proteins. |
|
| Biological/Functional activity & target protein |
| Coeliac toxic activity |
Celiac toxic |
| Specific target protein(s) |
N.D |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
No prediction can be made about the peptide bitterness. prediction |
|
| SMILES |
N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O |
|
| Preparation method |
| Mode of preparation |
null |
| Enzyme(s)/starter culture |
null |
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
|
|
| Additional information |
| Additional information |
N.D |
|
| Database cross-references |
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Marsh, M.N., Morgan, S., Ensari, A., Wardle, T., Lobley, R., Mills, C., et al. In vivo activity of peptides 31-43, 44-55, 56-68 of α-gliadin in gluten sensitive enteropathy (GSE). Gastroenterology. 1995, 108, A871.
|
| Other literature(s) |
N.D |
| PubDate |
1995 |
|