| DFBP ID - DFBPANHY0006(Antihypertensive peptide) | 
		  	
		  	
		  		
		  			
		  				
		  					| DFBP ID | 
		  					DFBPANHY0006 | 
		  				 
		  				
		  					| Peptide sequence | 
		  					HLP | 
		  				 
		  				
		  					| Type | 
		  					Native peptide | 
		  				 
		  				
		  					| Peptide/Function name | 
		  					Antihypertensive peptide | 
		  				 
		  			 
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Function-activity relationship | 
		  	
		  	
		  		
		  			
		  				
		  					| Main bioactivity | 
		  					Antihypertensive activity | 
		  				 
		  				
		  					| Otheir bioactivity | 
		  					ACE-inhibitory activity [D1], Renin-inhibitory activity [D2], PEP-inhibitory activity [D3], Multifunctional activity [D4] | 
		  				 
		  			 
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Calculated physicochemical properties | 
		  	
		  	
		  		
		  			
		  				
		  					| Three-letter amino acid | 
		  					His-Leu-Pro | 
		  				 
		  				 
		  					| Single-letter amino acid | 
		  					HLP | 
		  				 
		  					| Peptide length | 
		  					3 | 
		  				 
		  				
		  					| Peptide mass | 
		  					
		  						
		  							
		  								| Experimental mass | 
		  								Theoretical mass | 
		  							 
		  							
		  								| N.D | 
		  								365.43 Da c | 
		  							 
		  						 
		  					 | 
		  				 
		  				
		  					| Net charge | 
		  					0.00 c | 
		  				 
		  				
		  					| Isoelectric point (pI) | 
		  					7.79 c | 
		  				 
		  				
		  					| IC50 | 
		  					N.D | 
		  				 
		  				
		  					| pIC50 | 
		  					N.D | 
		  				 
		  				
		  					| GRAVY | 
		  					-0.3333 c | 
		  				 
		  				
		  					| Hydrophilic residue ratio | 
		  					66.67% c | 
		  				 
		  				
		  					| Peptide calculator | 
		  					
		  						
		  					 | 
		  				 
		  			 
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Biological/Functional activity & target protein | 
		  	
		  	
		  		
		  			
		  				
		  					| Antihypertensive activity | 
		  					In vitro experiments
  | Dose (mg/kg)
  | SBP Decreases
  | Times |  SHR
  | 7
  | ≈ 6 mmHg
  | 2 h
  |  ≈ 11 mmHg
  | 4 h
  |  | 15.2 ± 1.4 mmHg (p < 0.001) | 6 h
  |  | ≈ 6 mmHg | 8 h
  |  | ≈ 0 mmHg | 24 h
  |  
  | 
		  				 
		  				
		  					| Specific target protein(s) | 
		  					N.D | 
		  				 
		  			 
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Taste properties & Structure | 
		  	
		  	
		  		
		  			
		  				
		  					| Bitterness | 
		  					
		  						
		  							
		  								| Literature report | 
		  								N.D | 
		  							 
		  							
		  								| Bitter prediction tools | 
		  								Bitter taste prediction | 
		  							 
		  						 
		  					 | 
		  				 
		  				
		  					| SMILES | 
		  					N[C@@]([H])(CC1=CN=C-N1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O | 
		  				 
		  			 
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Preparation method | 
		  	
		  	
		  		
		  			
		  				
		  					| Mode of preparation | 
		  					Enzymatic hydrolysis  | 
		  				 
		  				
		  					| Enzyme(s)/starter culture | 
		  					The peptide was obtained from the β-casein f(133-138) HLPLP hydrolyzed with plasma peptidases.  | 
		  				 
		  			 
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Stability & Cytotoxicity | 
		  	
		  	
		  		
		  			
		  				
		  					| Peptide stability | 
		  					
		  						
		  					 | 
		  				 
		  				
		  					| Peptide cytotoxicity | 
		  					
		  						
									
										| Literature report: | 
										Non-Toxin | 
									 
									
		  								| Prediction: | 
		  								ToxinPred | 
		  							 
								 
		  					 | 
		  				 
		  			 
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Additional information | 
		  	
		  	
		  		
		  			
		  				
		  					| Additional information | 
		  					N.D | 
		  				 
		  			 
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Database cross-references | 
		  	
		  	
			
				| 
					
				 | 
			
			
		  	
		  		| 
		  			
		  		 | 
		  	
		  	
		  		| 
		  			
		  		 | 
		  	
		  	
		  		| 
		  			
		  		 | 
		  	
		  	
		  		| 
		  			
		  		 | 
		  	
		  
		  
		  
		  	
		  		| Reference(s) | 
		  	
		  	
		  		
		  			
		  				
		  					| Primary literature | 
		  					
								Sánchez-Rivera, L., Santos, P.F., Miralles, B., Carrón, R., José Montero, M., Recio, I. Peptide fragments from β-casein f(134–138), HLPLP, generated by the action of rat blood plasma peptidases show potent antihypertensive activity. Food Research International. 2016, 88, 348-53.
								
								
								
								
							 | 
		  				 
		  				
		  					| Other literature(s) | 
		  					N.D | 
		  				 
		  				
		  					| PubDate | 
		  					2016 | 
		  				 
		  			 
		  		 |