DFBP ID - DFBPANHY0007(Antihypertensive peptide) |
DFBP ID |
DFBPANHY0007 |
Peptide sequence |
LPL |
Type |
Native peptide |
Peptide/Function name |
Antihypertensive peptide |
|
Function-activity relationship |
Main bioactivity |
Antihypertensive activity |
Otheir bioactivity |
ACE-inhibitory activity [D1], Antioxidative activity [D2], DPP IV-inhibitory activity [D3], Multifunctional activity [D4] |
|
Calculated physicochemical properties |
Three-letter amino acid |
Leu-Pro-Leu |
Single-letter amino acid |
LPL |
Peptide length |
3 |
Peptide mass |
Experimental mass |
Theoretical mass |
N.D |
341.44 Da c |
|
Net charge |
0.00 c |
Isoelectric point (pI) |
5.97 c |
IC50 |
N.D |
pIC50 |
N.D |
GRAVY |
2.0000 c |
Hydrophilic residue ratio |
100% c |
Peptide calculator |
|
|
Biological/Functional activity & target protein |
Antihypertensive activity |
In vitro experiments
| Dose (mg/kg)
| SBP Decreases
| Times | SHR
| 7
| ≈ 12 mmHg
| 2 h
| ≈ 16 mmHg | 4 h
| 22.0 ± 2.5 mmHg (p < 0.001) | 6 h
| ≈ 10 mmHg | 8 h
| ≈ 6 mmHg | 24 h
|
|
Specific target protein(s) |
N.D |
|
Taste properties & Structure |
Bitterness |
Literature report |
N.D |
Bitter prediction tools |
Bitter taste prediction |
|
SMILES |
N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O |
|
Preparation method |
Mode of preparation |
Enzymatic hydrolysis |
Enzyme(s)/starter culture |
The peptide was obtained from the β-casein f(133-138) HLPLP hydrolyzed with plasma peptidases. |
|
Stability & Cytotoxicity |
Peptide stability |
|
Peptide cytotoxicity |
Literature report: |
Non-Toxin |
Prediction: |
ToxinPred |
|
|
Additional information |
Additional information |
N.D |
|
Database cross-references |
|
|
|
|
|
Reference(s) |
Primary literature |
Sánchez-Rivera, L., Santos, P.F., Miralles, B., Carrón, R., José Montero, M., Recio, I. Peptide fragments from β-casein f(134–138), HLPLP, generated by the action of rat blood plasma peptidases show potent antihypertensive activity. Food Research International. 2016, 88, 348-53.
|
Other literature(s) |
N.D |
PubDate |
2016 |
|