E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANHY0031(Antihypertensive peptide)
DFBP ID DFBPANHY0031
Peptide sequence LDV
Type Native peptide
Peptide/Function name Antihypertensive peptide
Function-activity relationship
Main bioactivity Antihypertensive activity
Otheir bioactivity ACE-inhibitory activity [D1], Renin-inhibitory activity [D2], Multifunctional activity [D3]
Calculated physicochemical properties
Three-letter amino acid Leu-Asp-Val
Single-letter amino acid LDV
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
345 Da 345.39 Da c
Net charge -1
Isoelectric point (pI) 3.10
IC50 N.D
pIC50 N.D
GRAVY 1.5000 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Rapeseed
Precursor protein Cruciferin
Residue position f(42-44)
Precursor protein(s) search
Source.1: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.2: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.3: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.4: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3
Source.5: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.6: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.7: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.8: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.9: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.10: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.11: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.12: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.13: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.14: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.15: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.16: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a
Source.17: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.18: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.19: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.20: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.21: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.22: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.23: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.24: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.25: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.26: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.27: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.28: DFBPPR0971 ---- Plant proteins ---- Protein STAR1
Source.29: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.30: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.31: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.32: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.33: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.34: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.35: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.36: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.37: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.38: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.39: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.40: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.41: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.42: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.43: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.44: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.45: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.46: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.47: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.48: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.49: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.50: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.51: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.52: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.53: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.54: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.55: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial
Source.56: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic
Source.57: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.58: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.59: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.60: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.61: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.62: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4
Source.63: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.64: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.65: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.66: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.67: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.68: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.69: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.70: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.71: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.72: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.73: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.74: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5
Source.75: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.76: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.77: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.78: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.79: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.80: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.81: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.82: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.83: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.84: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.85: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.86: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.87: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.88: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.89: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.90: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.91: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.92: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.93: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.94: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.95: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.96: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.97: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic
Source.98: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.99: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.100: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.101: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.102: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.103: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.104: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.105: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.106: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.107: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.108: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.109: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.110: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.111: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.112: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.113: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.114: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.115: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.116: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.117: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.118: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic
Source.119: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.120: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.121: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.122: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.123: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.124: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.125: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.126: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.127: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.128: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.129: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.130: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.131: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.132: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.133: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.134: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.135: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.136: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.137: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.138: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.139: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.140: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.141: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.142: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.143: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.144: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.145: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.146: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.147: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.148: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.149: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.150: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2
Source.151: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.152: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.153: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.154: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.155: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.156: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.157: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.158: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.159: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.160: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.161: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.162: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.163: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.164: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.165: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.166: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.167: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.168: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.169: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.170: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.171: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.172: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.173: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3
Source.174: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.175: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.176: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.177: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.178: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.179: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.180: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.181: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.182: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.183: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.184: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.185: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.186: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.187: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.188: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.189: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.190: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.191: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.192: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.193: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.194: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.195: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.196: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.197: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.198: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.199: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.200: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.201: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.202: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.203: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.204: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.205: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.206: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.207: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.208: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.209: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.210: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.211: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.212: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1
Source.213: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.214: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.215: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.216: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.217: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.218: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.219: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.220: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.221: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.222: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.223: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.224: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.225: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.226: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.227: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.228: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.229: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic
Source.230: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.231: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.232: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.233: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.234: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.235: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.236: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.237: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.238: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.239: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1
Source.240: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.241: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.242: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.243: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.244: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.245: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.246: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.247: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.248: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.249: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.250: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.251: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.252: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.253: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.254: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.255: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.256: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.257: DFBPPR2625 ---- Plant proteins ---- 18.6 kDa class III heat shock protein
Source.258: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.259: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.260: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.261: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.262: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.263: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.264: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.265: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.266: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.267: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic
Source.268: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.269: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.270: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.271: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.272: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.273: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.274: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.275: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.276: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.277: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.278: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.279: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.280: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.281: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic
Source.282: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.283: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.284: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.285: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.286: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.287: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.288: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.289: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.290: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.291: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic
Source.292: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.293: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.294: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.295: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.296: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.297: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.298: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.299: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.300: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.301: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6
Source.302: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.303: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.304: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28
Source.305: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5
Source.306: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.307: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.308: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.309: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4
Source.310: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.311: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.312: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23
Source.313: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.314: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.315: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.316: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.317: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.318: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.319: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.320: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.321: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.322: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.323: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.324: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.325: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.326: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.327: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.328: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.329: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.330: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.331: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.332: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.333: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.334: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.335: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.336: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.337: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.338: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.339: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.340: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.341: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.342: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.343: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.344: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.345: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta
Source.346: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4
Source.347: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.348: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.349: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.350: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.351: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.352: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.353: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.354: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.355: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.356: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.357: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.358: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.359: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.360: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.361: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.362: DFBPPR3452 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.363: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.364: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.365: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.366: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.367: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6
Source.368: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.369: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.370: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.371: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.372: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.373: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.374: DFBPPR3547 ---- Plant proteins ---- Probable BRI1 kinase inhibitor 1
Source.375: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.376: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.377: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.378: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1
Source.379: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.380: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.381: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.382: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.383: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.384: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.385: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.386: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.387: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2
Source.388: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.389: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.390: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.391: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.392: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.393: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.394: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.395: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.396: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.397: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.398: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.399: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.400: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.401: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.402: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.403: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.404: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.405: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.406: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.407: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.408: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.409: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.410: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.411: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.412: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.413: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.414: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.415: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.416: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.417: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.418: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.419: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.420: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.421: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.422: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.423: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.424: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.425: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.426: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.427: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.428: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.429: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.430: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.431: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.432: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.433: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.434: DFBPPR4112 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.435: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.436: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.437: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.438: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.439: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.440: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1
Source.441: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.442: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.443: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1
Source.444: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.445: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.446: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.447: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.448: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.449: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.450: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.451: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.452: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.453: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.454: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.455: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.456: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.457: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.458: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.459: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.460: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9
Source.461: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.462: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.463: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.464: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.465: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.466: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.467: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.468: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2
Source.469: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.470: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.471: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.472: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.473: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.474: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.475: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.476: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.477: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.478: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial
Source.479: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.480: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.481: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.482: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.483: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.484: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.485: DFBPPR4502 ---- Plant proteins ---- Actin-depolymerizing factor 7
Source.486: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic
Source.487: DFBPPR4512 ---- Plant proteins ---- Actin-depolymerizing factor 3
Source.488: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.489: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.490: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.491: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.492: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.493: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.494: DFBPPR4584 ---- Plant proteins ---- Probable calcium-binding protein CML29
Source.495: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.496: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23
Source.497: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.498: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.499: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.500: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3
Source.501: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.502: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.503: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.504: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.505: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.506: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.507: DFBPPR4755 ---- Plant proteins ---- 40S ribosomal protein S8
Source.508: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.509: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1
Source.510: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4
Source.511: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.512: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.513: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.514: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.515: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.516: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.517: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.518: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.519: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.520: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.521: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.522: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.523: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.524: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.525: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.526: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.527: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.528: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.529: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.530: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.531: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.532: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.533: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.534: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.535: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.536: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.537: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein
Source.538: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein
Source.539: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.540: DFBPPR5145 ---- Plant proteins ---- 22.0 kDa class IV heat shock protein
Source.541: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.542: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.543: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.544: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.545: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.546: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.547: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.548: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.549: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2
Source.550: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.551: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.552: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein
Source.553: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D
Source.554: DFBPPR5368 ---- Plant proteins ---- Desiccation protectant protein Lea14 homolog
Source.555: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.556: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.557: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.558: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.559: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.560: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.561: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.562: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.563: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.564: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.565: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic
Source.566: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.567: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.568: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.569: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.570: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic
Source.571: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.572: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.573: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.574: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.575: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.576: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.577: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.578: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.579: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.580: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.581: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.582: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.583: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.584: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.585: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.586: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.587: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.588: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.589: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.590: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.591: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.592: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.593: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.594: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.595: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.596: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.597: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.598: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.599: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.600: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.601: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.602: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.603: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.604: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.605: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.606: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.607: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.608: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.609: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.610: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.611: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.612: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.613: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.614: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.615: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.616: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.617: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.618: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.619: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.620: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.621: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.622: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.623: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.624: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.625: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.626: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.627: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.628: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.629: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.630: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.631: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.632: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.633: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.634: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.635: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.636: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.637: DFBPPR6070 ---- Plant proteins ---- 40S ribosomal protein S8
Source.638: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.639: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.640: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49
Source.641: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17
Source.642: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase
Source.643: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.644: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.645: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.646: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.647: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein
Source.648: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.649: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.650: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.651: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor
Source.652: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein
Source.653: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.654: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.655: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.656: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.657: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.658: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.659: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.660: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.661: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.662: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic
Source.663: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.664: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.665: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.666: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.667: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.668: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.669: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.670: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.671: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.672: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.673: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.674: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.675: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.676: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.677: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.678: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.679: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.680: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.681: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.682: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.683: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.684: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.685: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.686: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27
Source.687: DFBPPR6606 ---- Plant proteins ---- Unknown protein from spot 251 of 2D-PAGE of thylakoid
Source.688: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.689: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.690: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.691: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.692: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8
Source.693: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.694: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.695: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.696: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.697: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.698: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.699: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.700: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.701: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.702: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.703: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.704: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.705: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.706: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.707: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.708: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.709: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.710: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.711: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.712: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.713: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.714: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.715: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.716: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.717: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.718: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.719: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2
Source.720: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.721: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.722: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.723: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.724: DFBPPR7068 ---- Plant proteins ---- Peroxidase 2
Source.725: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.726: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.727: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.728: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.729: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.730: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.731: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.732: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.733: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.734: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.735: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.736: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1
Source.737: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2
Source.738: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein
Source.739: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.740: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.741: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.742: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.743: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.744: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.745: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.746: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.747: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.748: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase
Source.749: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.750: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.751: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.752: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.753: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.754: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.755: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1
Source.756: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.757: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.758: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.759: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.760: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.761: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.762: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.763: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.764: DFBPPR7656 ---- Milk proteins ---- Putative glycosylation-dependent cell adhesion molecule 1
Source.765: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.766: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.767: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.768: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.769: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.770: DFBPPR8398 ---- Plant proteins ---- Conglutin
Source.771: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.772: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.773: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.774: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.775: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.776: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.777: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein
Source.778: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.779: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.780: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.781: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.782: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.783: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.784: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.785: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.786: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.787: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.788: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.789: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.790: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.791: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.792: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.793: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.794: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.795: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.796: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.797: DFBPPR16072 ---- Animal proteins ---- Clusterin
Source.798: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.799: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.800: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.801: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.802: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.803: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.804: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.805: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.806: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.807: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.808: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.809: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.810: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.811: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.812: DFBPPR16240 ---- Animal proteins ---- Fibronectin
Source.813: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.814: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.815: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain
Source.816: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.817: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.818: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.819: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.820: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.821: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.822: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.823: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.824: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.825: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.826: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.827: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.828: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.829: DFBPPR16490 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.830: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.831: DFBPPR16502 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.832: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.833: DFBPPR16521 ---- Animal proteins ---- Interleukin-3
Source.834: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.835: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.836: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.837: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.838: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.839: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.840: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.841: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.842: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.843: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.844: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.845: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.846: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.847: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4
Source.848: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.849: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.850: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.851: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.852: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.853: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.854: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.855: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.856: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.857: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.858: DFBPPR16788 ---- Animal proteins ---- Alpha-crystallin A chain
Source.859: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.860: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.861: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.862: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.863: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.864: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.865: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.866: DFBPPR16872 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.867: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.868: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial
Source.869: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain
Source.870: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.871: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.872: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.873: DFBPPR16913 ---- Animal proteins ---- Alpha-crystallin B chain
Source.874: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.875: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.876: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.877: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5
Source.878: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.879: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.880: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.881: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.882: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.883: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.884: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.885: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.886: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.887: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.888: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.889: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.890: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.891: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.892: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.893: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.894: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.895: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.896: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.897: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.898: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.899: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.900: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.901: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.902: DFBPPR17278 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.903: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.904: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.905: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.906: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.907: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.908: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.909: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.910: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.911: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1
Source.912: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.913: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.914: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.915: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.916: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.917: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.918: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.919: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.920: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2
Source.921: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.922: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.923: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.924: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.925: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.926: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.927: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.928: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.929: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.930: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.931: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.932: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.933: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.934: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.935: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.936: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.937: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.938: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.939: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.940: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.941: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.942: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.943: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.944: DFBPPR17594 ---- Animal proteins ---- E-selectin
Source.945: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.946: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.947: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial
Source.948: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.949: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.950: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.951: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.952: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.953: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.954: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.955: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.956: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.957: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.958: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.959: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.960: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase
Source.961: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.962: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA
Source.963: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.964: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.965: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.966: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.967: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase
Source.968: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.969: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.970: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9
Source.971: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.972: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.973: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.974: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.975: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.976: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.977: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.978: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.979: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.980: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.981: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.982: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.983: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.984: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.985: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.986: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.987: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.988: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.989: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.990: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.991: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.992: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.993: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.994: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.995: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.996: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.997: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.998: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T
Source.999: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.1000: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.1001: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.1002: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.1003: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.1004: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4
Source.1005: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase
Source.1006: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29
Source.1007: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1008: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.1009: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.1010: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.1011: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.1012: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.1013: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.1014: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.1015: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.1016: DFBPPR18229 ---- Animal proteins ---- Protein S100-A13
Source.1017: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.1018: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.1019: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1020: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.1021: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.1022: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.1023: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.1024: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1025: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.1026: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.1027: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.1028: DFBPPR18340 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.1029: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.1030: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.1031: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1032: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.1033: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3
Source.1034: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.1035: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1036: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.1037: DFBPPR18407 ---- Animal proteins ---- DNA damage-inducible transcript 4 protein
Source.1038: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.1039: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.1040: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.1041: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1042: DFBPPR18427 ---- Animal proteins ---- Cystatin-C
Source.1043: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.1044: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.1045: DFBPPR18448 ---- Animal proteins ---- Septin-1
Source.1046: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.1047: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.1048: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.1049: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.1050: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.1051: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.1052: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.1053: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.1054: DFBPPR18490 ---- Animal proteins ---- N-terminal Xaa-Pro-Lys N-methyltransferase 1
Source.1055: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.1056: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.1057: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.1058: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.1059: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.1060: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1061: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.1062: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.1063: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1064: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.1065: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.1066: DFBPPR18590 ---- Animal proteins ---- Retinol-binding protein 1
Source.1067: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2
Source.1068: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.1069: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.1070: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1071: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.1072: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.1073: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.1074: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.1075: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1076: DFBPPR18728 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5
Source.1077: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.1078: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1079: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II
Source.1080: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1081: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1
Source.1082: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.1083: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.1084: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.1085: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.1086: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.1087: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1088: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.1089: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.1090: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.1091: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.1092: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.1093: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1094: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.1095: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1096: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.1097: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.1098: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.1099: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1100: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.1101: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.1102: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.1103: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.1104: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.1105: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.1106: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1
Source.1107: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.1108: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.1109: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.1110: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.1111: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1112: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.1113: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A
Source.1114: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.1115: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.1116: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.1117: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.1118: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.1119: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.1120: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.1121: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.1122: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.1123: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1124: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.1125: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1126: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.1127: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.1128: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.1129: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.1130: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.1131: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1132: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.1133: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.1134: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220
Source.1135: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.1136: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.1137: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.1138: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.1139: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.1140: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.1141: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.1142: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.1143: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.1144: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.1145: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A
Source.1146: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.1147: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1148: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.1149: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.1150: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.1151: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.1152: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2
Source.1153: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.1154: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.1155: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1156: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1157: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.1158: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.1159: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.1160: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.1161: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.1162: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.1163: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.1164: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1165: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.1166: DFBPPR19520 ---- Animal proteins ---- Ferritin light chain
Source.1167: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E
Source.1168: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.1169: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.1170: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase
Source.1171: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.1172: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.1173: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.1174: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.1175: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.1176: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1177: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.1178: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.1179: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.1180: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.1181: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.1182: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1183: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.1184: DFBPPR19696 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.1185: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.1186: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.1187: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.1188: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1189: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.1190: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.1191: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.1192: DFBPPR19777 ---- Animal proteins ---- Translin
Source.1193: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.1194: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.1195: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.1196: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.1197: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.1198: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.1199: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.1200: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.1201: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30
Source.1202: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1203: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1204: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.1205: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B
Source.1206: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.1207: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.1208: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.1209: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.1210: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1211: DFBPPR19929 ---- Animal proteins ---- Ermin
Source.1212: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.1213: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.1214: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.1215: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.1216: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.1217: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR
Source.1218: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.1219: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.1220: DFBPPR20036 ---- Animal proteins ---- Urocortin-3
Source.1221: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.1222: DFBPPR20044 ---- Animal proteins ---- Secernin-1
Source.1223: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.1224: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.1225: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.1226: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4
Source.1227: DFBPPR20123 ---- Animal proteins ---- Securin
Source.1228: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.1229: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.1230: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.1231: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.1232: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.1233: DFBPPR20184 ---- Animal proteins ---- Centromere protein H
Source.1234: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1235: DFBPPR20210 ---- Animal proteins ---- Exonuclease V
Source.1236: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.1237: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.1238: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.1239: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1240: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.1241: DFBPPR20311 ---- Animal proteins ---- Peroxisomal membrane protein 11B
Source.1242: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.1243: DFBPPR20318 ---- Animal proteins ---- Charged multivesicular body protein 1b
Source.1244: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.1245: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1246: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.1247: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.1248: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog
Source.1249: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.1250: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.1251: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.1252: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.1253: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4
Source.1254: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.1255: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.1256: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2
Source.1257: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.1258: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.1259: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1260: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.1261: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.1262: DFBPPR20476 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.1263: DFBPPR20479 ---- Animal proteins ---- Ribonuclease P protein subunit p29
Source.1264: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.1265: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.1266: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.1267: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.1268: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1269: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.1270: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.1271: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a
Source.1272: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.1273: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.1274: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.1275: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.1276: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1277: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.1278: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.1279: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.1280: DFBPPR20644 ---- Animal proteins ---- Dynein regulatory complex protein 9
Source.1281: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.1282: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.1283: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.1284: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.1285: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.1286: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.1287: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.1288: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.1289: DFBPPR20750 ---- Animal proteins ---- 40S ribosomal protein S8
Source.1290: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.1291: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1292: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.1293: DFBPPR20766 ---- Animal proteins ---- Torsin-2A
Source.1294: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.1295: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.1296: DFBPPR20799 ---- Animal proteins ---- F-box/LRR-repeat protein 20
Source.1297: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.1298: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1299: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.1300: DFBPPR20831 ---- Animal proteins ---- Keratin, type II cytoskeletal 59 kDa, component IV
Source.1301: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.1302: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.1303: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5
Source.1304: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.1305: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.1306: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator
Source.1307: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.1308: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.1309: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.1310: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.1311: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.1312: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25
Source.1313: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.1314: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.1315: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.1316: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.1317: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.1318: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1319: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.1320: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.1321: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.1322: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.1323: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.1324: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.1325: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.1326: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.1327: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.1328: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin
Source.1329: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.1330: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III
Source.1331: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.1332: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.1333: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.1334: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.1335: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.1336: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.1337: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.1338: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.1339: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.1340: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.1341: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta
Source.1342: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.1343: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.1344: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.1345: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.1346: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.1347: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.1348: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.1349: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.1350: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.1351: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.1352: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.1353: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.1354: DFBPPR21420 ---- Animal proteins ---- Gem-associated protein 7
Source.1355: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.1356: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.1357: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.1358: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.1359: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.1360: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.1361: DFBPPR21509 ---- Animal proteins ---- Myoneurin
Source.1362: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.1363: DFBPPR21536 ---- Animal proteins ---- Alpha-1-acid glycoprotein
Source.1364: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.1365: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.1366: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23
Source.1367: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55
Source.1368: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.1369: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.1370: DFBPPR21572 ---- Animal proteins ---- 39S ribosomal protein L43, mitochondrial
Source.1371: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1372: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10
Source.1373: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.1374: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26
Source.1375: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.1376: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.1377: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.1378: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.1379: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.1380: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.1381: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.1382: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190
Source.1383: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.1384: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.1385: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.1386: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1387: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.1388: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier
Source.1389: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.1390: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.1391: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.1392: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.1393: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS
Source.1394: DFBPPR21864 ---- Animal proteins ---- Arpin
Source.1395: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC
Source.1396: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.1397: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.1398: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1
Source.1399: DFBPPR21892 ---- Animal proteins ---- COMM domain-containing protein 9
Source.1400: DFBPPR21901 ---- Animal proteins ---- Calcyphosin
Source.1401: DFBPPR21932 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IB
Source.1402: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.1403: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.1404: DFBPPR22025 ---- Animal proteins ---- Putative deoxyribonuclease TATDN3
Source.1405: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.1406: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.1407: DFBPPR22084 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 49
Source.1408: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.1409: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3
Source.1410: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.1411: DFBPPR22171 ---- Animal proteins ---- Leucine-rich repeat flightless-interacting protein 2
Source.1412: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1413: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.1414: DFBPPR22191 ---- Animal proteins ---- Heat shock protein beta-3
Source.1415: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.1416: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1
Source.1417: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.1418: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2
Source.1419: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.1420: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.1421: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.1422: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17
Source.1423: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.1424: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.1425: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.1426: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.1427: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.1428: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.1429: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.1430: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.1431: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.1432: DFBPPR22421 ---- Animal proteins ---- Placenta-specific protein 9
Source.1433: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.1434: DFBPPR22508 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 2
Source.1435: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.1436: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.1437: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B
Source.1438: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.1439: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26
Source.1440: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.1441: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.1442: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.1443: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.1444: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19
Source.1445: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8
Source.1446: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1447: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.1448: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1449: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.1450: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.1451: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.1452: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.1453: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1454: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.1455: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.1456: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.1457: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.1458: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.1459: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.1460: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.1461: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.1462: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.1463: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1464: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.1465: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.1466: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.1467: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.1468: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1469: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.1470: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.1471: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.1472: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1473: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1474: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.1475: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1476: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.1477: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.1478: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.1479: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1480: DFBPPR8763 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.1481: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.1482: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1483: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.1484: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.1485: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.1486: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA
Source.1487: DFBPPR8827 ---- Animal proteins ---- Guanylate kinase
Source.1488: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.1489: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1490: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.1491: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.1492: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.1493: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.1494: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.1495: DFBPPR8973 ---- Animal proteins ---- Caspase-3
Source.1496: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.1497: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.1498: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.1499: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1500: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.1501: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.1502: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.1503: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1504: DFBPPR9063 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.1505: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.1506: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1507: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.1508: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.1509: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.1510: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.1511: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.1512: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.1513: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.1514: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.1515: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.1516: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1517: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.1518: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.1519: DFBPPR9202 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2B
Source.1520: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.1521: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein
Source.1522: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.1523: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.1524: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.1525: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.1526: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.1527: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1
Source.1528: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.1529: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.1530: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.1531: DFBPPR9329 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.1532: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.1533: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.1534: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.1535: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.1536: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.1537: DFBPPR9381 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1538: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.1539: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.1540: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.1541: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.1542: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.1543: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1544: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.1545: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.1546: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1547: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.1548: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.1549: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.1550: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.1551: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.1552: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1553: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.1554: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1555: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.1556: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.1557: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.1558: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.1559: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1560: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.1561: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1562: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.1563: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1564: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.1565: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.1566: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.1567: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.1568: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1
Source.1569: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.1570: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.1571: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.1572: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2
Source.1573: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1574: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1575: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.1576: DFBPPR10094 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.1577: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.1578: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.1579: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1580: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.1581: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.1582: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.1583: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.1584: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.1585: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.1586: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.1587: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.1588: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.1589: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.1590: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.1591: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.1592: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.1593: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain
Source.1594: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.1595: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1
Source.1596: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1597: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.1598: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1599: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.1600: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.1601: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1602: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1603: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.1604: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1605: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1606: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.1607: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.1608: DFBPPR10325 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1609: DFBPPR10326 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1610: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.1611: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.1612: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.1613: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.1614: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1615: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.1616: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.1617: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1618: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.1619: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.1620: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1621: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.1622: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.1623: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.1624: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.1625: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.1626: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.1627: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.1628: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1
Source.1629: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1630: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.1631: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.1632: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain
Source.1633: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1
Source.1634: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.1635: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.1636: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5
Source.1637: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.1638: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.1639: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1640: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.1641: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA
Source.1642: DFBPPR10627 ---- Animal proteins ---- Apovitellenin-1
Source.1643: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.1644: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.1645: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.1646: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1647: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.1648: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1649: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.1650: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.1651: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.1652: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.1653: DFBPPR10660 ---- Animal proteins ---- Tsukushin
Source.1654: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.1655: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1656: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.1657: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1658: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.1659: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1660: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.1661: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1662: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.1663: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.1664: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1665: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.1666: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1667: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.1668: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.1669: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.1670: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.1671: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3
Source.1672: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.1673: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.1674: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.1675: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.1676: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.1677: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.1678: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.1679: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1680: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.1681: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1682: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase
Source.1683: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1684: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.1685: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.1686: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.1687: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.1688: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1689: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1690: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.1691: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.1692: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.1693: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1694: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.1695: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.1696: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.1697: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.1698: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1
Source.1699: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.1700: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.1701: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.1702: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.1703: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.1704: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.1705: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.1706: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.1707: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.1708: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.1709: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.1710: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.1711: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3
Source.1712: DFBPPR11146 ---- Animal proteins ---- Formin
Source.1713: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.1714: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.1715: DFBPPR11160 ---- Animal proteins ---- 16 kDa beta-galactoside-binding lectin
Source.1716: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1717: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.1718: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.1719: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1720: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.1721: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.1722: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.1723: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1724: DFBPPR11239 ---- Animal proteins ---- Charged multivesicular body protein 1b
Source.1725: DFBPPR11244 ---- Animal proteins ---- Frizzled-6
Source.1726: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.1727: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.1728: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.1729: DFBPPR11283 ---- Animal proteins ---- Centromere protein U
Source.1730: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.1731: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.1732: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.1733: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1734: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1735: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.1736: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.1737: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.1738: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.1739: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.1740: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.1741: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.1742: DFBPPR11388 ---- Animal proteins ---- Matrilin-3
Source.1743: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.1744: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.1745: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.1746: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.1747: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.1748: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.1749: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.1750: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.1751: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.1752: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.1753: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.1754: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.1755: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.1756: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.1757: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.1758: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.1759: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.1760: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.1761: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.1762: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1763: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.1764: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.1765: DFBPPR11584 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.1766: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.1767: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.1768: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.1769: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.1770: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.1771: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.1772: DFBPPR11618 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.1773: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.1774: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.1775: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.1776: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.1777: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1778: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1779: DFBPPR11670 ---- Animal proteins ---- Snurportin-1
Source.1780: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1
Source.1781: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.1782: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1783: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.1784: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.1785: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.1786: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.1787: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.1788: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.1789: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.1790: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.1791: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.1792: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.1793: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13
Source.1794: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.1795: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.1796: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.1797: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.1798: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.1799: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein
Source.1800: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.1801: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.1802: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1803: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.1804: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.1805: DFBPPR11936 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.1806: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.1807: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1808: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.1809: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.1810: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein
Source.1811: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.1812: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.1813: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.1814: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.1815: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.1816: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.1817: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.1818: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.1819: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.1820: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.1821: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.1822: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.1823: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.1824: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.1825: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.1826: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.1827: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.1828: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.1829: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.1830: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.1831: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.1832: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1833: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.1834: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.1835: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.1836: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.1837: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.1838: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1839: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1840: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1841: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.1842: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.1843: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1844: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.1845: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.1846: DFBPPR12330 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1847: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.1848: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.1849: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.1850: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.1851: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.1852: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.1853: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.1854: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.1855: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.1856: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1857: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.1858: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.1859: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.1860: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.1861: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.1862: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.1863: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.1864: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1865: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.1866: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.1867: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.1868: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.1869: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.1870: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.1871: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1872: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.1873: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.1874: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1875: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.1876: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.1877: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.1878: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.1879: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.1880: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.1881: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1882: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.1883: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.1884: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.1885: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.1886: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.1887: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.1888: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.1889: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.1890: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.1891: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.1892: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.1893: DFBPPR12772 ---- Animal proteins ---- Colipase
Source.1894: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.1895: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.1896: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.1897: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1898: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.1899: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.1900: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.1901: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.1902: DFBPPR12897 ---- Animal proteins ---- Fibronectin
Source.1903: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.1904: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.1905: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.1906: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.1907: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5
Source.1908: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.1909: DFBPPR12981 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-4
Source.1910: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.1911: DFBPPR13000 ---- Animal proteins ---- Cystatin-C
Source.1912: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta
Source.1913: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.1914: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1915: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.1916: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.1917: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1918: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1919: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1920: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.1921: DFBPPR13174 ---- Animal proteins ---- Clusterin
Source.1922: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.1923: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.1924: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.1925: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.1926: DFBPPR13233 ---- Animal proteins ---- Fibronectin
Source.1927: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1928: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1929: DFBPPR13280 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.1930: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.1931: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.1932: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.1933: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.1934: DFBPPR13303 ---- Animal proteins ---- Apolipoprotein C-III
Source.1935: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.1936: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.1937: DFBPPR13327 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.1938: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.1939: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.1940: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.1941: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1942: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1943: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.1944: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1945: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.1946: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.1947: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1948: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.1949: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.1950: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1951: DFBPPR13659 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.1952: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA
Source.1953: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.1954: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1955: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.1956: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.1957: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.1958: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1959: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1960: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.1961: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.1962: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.1963: DFBPPR13824 ---- Animal proteins ---- Adrenodoxin
Source.1964: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.1965: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.1966: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1967: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.1968: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1969: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.1970: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.1971: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.1972: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.1973: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA
Source.1974: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.1975: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.1976: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.1977: DFBPPR14102 ---- Marine protein ---- Anamorsin-B
Source.1978: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9
Source.1979: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1
Source.1980: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.1981: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.1982: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.1983: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.1984: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.1985: DFBPPR14237 ---- Marine protein ---- Stanniocalcin
Source.1986: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3
Source.1987: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1
Source.1988: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2
Source.1989: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain
Source.1990: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.1991: DFBPPR14343 ---- Marine protein ---- Anthranilate synthase component 2
Source.1992: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.1993: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.1994: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.1995: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.1996: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.1997: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.1998: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.1999: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK
Source.2000: DFBPPR14423 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic
Source.2001: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.2002: DFBPPR14438 ---- Marine protein ---- 50S ribosomal protein L1, chloroplastic
Source.2003: DFBPPR14479 ---- Marine protein ---- Photosystem I assembly protein Ycf4
Source.2004: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.2005: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.2006: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.2007: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.2008: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.2009: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.2010: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9
Source.2011: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a
Source.2012: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.2013: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.2014: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.2015: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.2016: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.2017: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.2018: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein
Source.2019: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.2020: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.2021: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.2022: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.2023: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.2024: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.2025: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.2026: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.2027: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial
Source.2028: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.2029: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.2030: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.2031: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.2032: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.2033: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.2034: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4
Source.2035: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.2036: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.2037: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.2038: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.2039: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.2040: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.2041: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.2042: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.2043: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.2044: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.2045: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.2046: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1
Source.2047: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.2048: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.2049: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.2050: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.2051: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.2052: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.2053: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.2054: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.2055: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.2056: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.2057: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.2058: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.2059: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.2060: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.2061: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.2062: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.2063: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.2064: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.2065: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.2066: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.2067: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial
Source.2068: DFBPPR15093 ---- Microorganism protein ---- Inner kinetochore subunit AME1
Source.2069: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.2070: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.2071: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.2072: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.2073: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.2074: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.2075: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.2076: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.2077: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic
Source.2078: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.2079: DFBPPR15159 ---- Microorganism protein ---- Centromere-binding protein 1
Source.2080: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.2081: DFBPPR15163 ---- Microorganism protein ---- Ubiquitin-related modifier 1
Source.2082: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.2083: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35
Source.2084: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2085: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.2086: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.2087: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.2088: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.2089: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.2090: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1
Source.2091: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.2092: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.2093: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.2094: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.2095: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.2096: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.2097: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1
Source.2098: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.2099: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.2100: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80
Source.2101: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1
Source.2102: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.2103: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.2104: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.2105: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.2106: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.2107: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.2108: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.2109: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.2110: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3
Source.2111: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34
Source.2112: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.2113: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82
Source.2114: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.2115: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.2116: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10
Source.2117: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.2118: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.2119: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123
Source.2120: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.2121: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.2122: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.2123: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.2124: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.2125: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.2126: DFBPPR15549 ---- Microorganism protein ---- Probable kinetochore protein SPC25
Source.2127: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14
Source.2128: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.2129: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.2130: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1
Source.2131: DFBPPR15568 ---- Microorganism protein ---- Probable kinetochore protein SPC24
Source.2132: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein
Source.2133: DFBPPR15574 ---- Microorganism protein ---- Protein PXR1
Source.2134: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.2135: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13
Source.2136: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.2137: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5
Source.2138: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.2139: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.2140: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.2141: DFBPPR15654 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase
Source.2142: DFBPPR15661 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 2
Source.2143: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.2144: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.2145: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.2146: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.2147: DFBPPR15739 ---- Microorganism protein ---- Long chronological lifespan protein 2
Source.2148: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1
Source.2149: DFBPPR15777 ---- Microorganism protein ---- FAS1 domain-containing protein KLLA0E16841g
Source.2150: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.2151: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.2152: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD
Source.2153: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.2154: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.2155: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.2156: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.2157: DFBPPR15859 ---- Microorganism protein ---- Histone H4
Source.2158: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2159: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.2160: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.2161: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.2162: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.2163: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.2164: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.2165: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.2166: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase
Source.2167: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.2168: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.2169: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A
Source.2170: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.2171: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.2172: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.2173: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic
Source.2174: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2175: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.2176: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.2177: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.2178: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1
Source.2179: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.2180: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.2181: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.2182: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.2183: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.2184: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.2185: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.2186: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.2187: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.2188: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.2189: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.2190: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.2191: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.2192: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.2193: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.2194: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.2195: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2196: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2197: DFBPPR8235 ---- Plant protein ---- Catalase
Source.2198: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.2199: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.2200: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antihypertensive activity

The final rapeseed protein hydrolysate (FRPH) produced the maximum systolic blood pressure reduction of -51 mmHg after six hours oral administration (100 mg/kg body weight) to spontaneously hypertensive rats. The peptide LDV was isolated from the FRPH using electrodialysis with ultrafiltration membrane (EDUF) technology, so it was a potential antihypertensive peptide (data not shown).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)O
Preparation method
Mode of preparation Enzymatic hydrolysis
Enzyme(s)/starter culture

Rapeseed protein isolate was subjected to alcalase digestion to obtain a protein hydrolysate.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: Non-Toxin
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPACEI1409
[D2] DFBPRENI0005
[D3] DFBPMUFU0362
BIOPEP-UWM [D4] -
APD [D5] -
BioPepDB [D6] -
MBPDB [D7] -
Reference(s)
Primary literature He R, Girgih AT, Rozoy E, Bazinet L, Ju XR, Aluko RE. Selective separation and concentration of antihypertensive peptides from rapeseed protein hydrolysate by electrodialysis with ultrafiltration membranes. Food Chem. 2016 Apr 15;197(Pt A):1008-14.
PMID: 26617047
Other literature(s)

[1] He R ,  Alashi A ,  Malomo S A , et al. Antihypertensive and free radical scavenging properties of enzymatic rapeseed protein hydrolysates[J]. Food Chemistry, 2013, 141(1):153-159.

PubDate 2016
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214