| DFBP ID - DFBPANHY0297(Antihypertensive peptide) |
| DFBP ID |
DFBPANHY0297 |
| Peptide sequence |
WYT |
| Type |
Native peptide |
| Peptide/Function name |
Antihypertensive peptide |
|
| Function-activity relationship |
| Main bioactivity |
Antihypertensive activity |
| Otheir bioactivity |
ACE-inhibitory activity [D1], Antioxidative activity [D2], Multifunctional activity [D3] |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Trp-Tyr-Thr |
| Single-letter amino acid |
WYT |
| Peptide length |
3 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| 469.2 Da |
468.51 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
5.92 c |
| IC50 |
N.D |
| pIC50 |
N.D |
| GRAVY |
-0.9667 c |
| Hydrophilic residue ratio |
33.33% c |
| Peptide calculator |
|
|
| Biological/Functional activity & target protein |
| Antihypertensive activity |
In vitro experiments
| Dose (mg/kg)
| SBP Decreases
| Times | SHR
| 30
| 13 mmHg
| 2 h
|
|
| Specific target protein(s) |
N.D |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
Bitter taste prediction |
|
| SMILES |
N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O |
|
| Preparation method |
| Mode of preparation |
Enzymatic hydrolysis |
| Enzyme(s)/starter culture |
Hemp seed proteins was hydrolyzed by simulating gastrointestinal tract digestion (Pepsin and Pancreatin). |
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
| Literature report: |
Non-Toxin |
| Prediction: |
ToxinPred |
|
|
| Additional information |
| Additional information |
The peptide had inhibition for renin (77%).
|
|
| Database cross-references |
|
|
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Girgih, A.T., He, R., Malomo, S., Offengenden, M., Wu, J., Aluko, R.E. Structural and functional characterization of hemp seed (Cannabis sativa L.) protein-derived antioxidant and antihypertensive peptides. Journal of Functional Foods. 2014, 6, 384-94.
|
| Other literature(s) |
N.D |
| PubDate |
2014 |
|