E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANHY0388(Antihypertensive peptide)
DFBP ID DFBPANHY0388
Peptide sequence VAE
Type Native peptide
Peptide/Function name Antihypertensive peptide
Function-activity relationship
Main bioactivity Antihypertensive activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Val-Ala-Glu
Single-letter amino acid VAE
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
318.0 Da 317.34 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.34 c
IC50 N.D
pIC50 N.D
GRAVY 0.8333 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Buckwheat (Fagopyrum esculentum)
Precursor protein Buckwheat sprouts
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.2: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.3: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.4: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.5: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.6: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.7: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.8: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.9: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.10: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.11: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.12: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.13: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.14: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.15: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.16: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.17: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.18: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.19: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.20: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.21: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.22: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.23: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.24: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.25: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.26: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.27: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.28: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.29: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1
Source.30: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.31: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.32: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.33: DFBPPR1028 ---- Plant proteins ---- Defensin-like protein CAL1
Source.34: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.35: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.36: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.37: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.38: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.39: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.40: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.41: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.42: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.43: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.44: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.45: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.46: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.47: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.48: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.49: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.50: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.51: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.52: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.53: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.54: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.55: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.56: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.57: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.58: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.59: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.60: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3
Source.61: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.62: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial
Source.63: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.64: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.65: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.66: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.67: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.68: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.69: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.70: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.71: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.72: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.73: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.74: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.75: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.76: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.77: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.78: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.79: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.80: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.81: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.82: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.83: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.84: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.85: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.86: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.87: DFBPPR1361 ---- Plant proteins ---- Anthranilate synthase beta subunit 2, chloroplastic
Source.88: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.89: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.90: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.91: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.92: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.93: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.94: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.95: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.96: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.97: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.98: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.99: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.100: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.101: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.102: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.103: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.104: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.105: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.106: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.107: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.108: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.109: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.110: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.111: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.112: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.113: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.114: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.115: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.116: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.117: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.118: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.119: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.120: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.121: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.122: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.123: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.124: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.125: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.126: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.127: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.128: DFBPPR1545 ---- Plant proteins ---- Protein NEGATIVE REGULATOR OF RESISTANCE
Source.129: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.130: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.131: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.132: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.133: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.134: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.135: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.136: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.137: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.138: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.139: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.140: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.141: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.142: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.143: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.144: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.145: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.146: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.147: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3
Source.148: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.149: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.150: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.151: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.152: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.153: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.154: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.155: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.156: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.157: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.158: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.159: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.160: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.161: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.162: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.163: DFBPPR1751 ---- Plant proteins ---- Heat stress transcription factor A-4b
Source.164: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.165: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.166: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.167: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.168: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.169: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.170: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.171: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.172: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.173: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.174: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.175: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.176: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.177: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.178: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.179: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.180: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.181: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.182: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.183: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.184: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.185: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.186: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B
Source.187: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d
Source.188: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.189: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.190: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2
Source.191: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.192: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.193: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.194: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.195: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.196: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.197: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A
Source.198: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.199: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.200: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.201: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.202: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B
Source.203: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.204: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.205: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.206: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.207: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.208: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.209: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.210: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.211: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.212: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.213: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.214: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.215: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.216: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.217: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.218: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.219: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.220: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.221: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.222: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.223: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.224: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.225: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.226: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.227: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.228: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.229: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.230: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.231: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.232: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.233: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.234: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.235: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.236: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.237: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.238: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.239: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.240: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.241: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.242: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.243: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.244: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4
Source.245: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.246: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.247: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.248: DFBPPR2223 ---- Plant proteins ---- Urease
Source.249: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.250: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.251: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.252: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.253: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.254: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.255: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.256: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.257: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.258: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.259: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.260: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.261: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.262: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.263: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.264: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.265: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.266: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.267: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic
Source.268: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.269: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.270: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.271: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.272: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.273: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.274: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.275: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.276: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.277: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.278: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.279: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.280: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.281: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.282: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.283: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.284: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.285: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.286: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.287: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.288: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic
Source.289: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.290: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9
Source.291: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.292: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.293: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.294: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.295: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.296: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.297: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.298: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.299: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.300: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.301: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.302: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.303: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.304: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.305: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.306: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.307: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.308: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.309: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.310: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34
Source.311: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.312: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal
Source.313: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.314: DFBPPR2648 ---- Plant proteins ---- SKP1-like protein 20
Source.315: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.316: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.317: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.318: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.319: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.320: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.321: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.322: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.323: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.324: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.325: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.326: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.327: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.328: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.329: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.330: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.331: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.332: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33
Source.333: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic
Source.334: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c
Source.335: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.336: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.337: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.338: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.339: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.340: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.341: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.342: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.343: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.344: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.345: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.346: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.347: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.348: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.349: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32
Source.350: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6
Source.351: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.352: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.353: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5
Source.354: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4
Source.355: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.356: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.357: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.358: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.359: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.360: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.361: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.362: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase
Source.363: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.364: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.365: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1
Source.366: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.367: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase
Source.368: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.369: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.370: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.371: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.372: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.373: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.374: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.375: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5
Source.376: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.377: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1
Source.378: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.379: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.380: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.381: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.382: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic
Source.383: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.384: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.385: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.386: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.387: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.388: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.389: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.390: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.391: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.392: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.393: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.394: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.395: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.396: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.397: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.398: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.399: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.400: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.401: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.402: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.403: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.404: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.405: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.406: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.407: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.408: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.409: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.410: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.411: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.412: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.413: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.414: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.415: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.416: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.417: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.418: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19
Source.419: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.420: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.421: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.422: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.423: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.424: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.425: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.426: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.427: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.428: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.429: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44
Source.430: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.431: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.432: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.433: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.434: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.435: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.436: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5
Source.437: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.438: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.439: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.440: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.441: DFBPPR3510 ---- Plant proteins ---- Thioredoxin-like protein Clot
Source.442: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.443: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.444: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.445: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.446: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.447: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7
Source.448: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.449: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.450: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.451: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.452: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.453: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.454: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial
Source.455: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.456: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.457: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1
Source.458: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial
Source.459: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.460: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.461: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.462: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.463: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.464: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.465: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.466: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.467: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.468: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.469: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.470: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.471: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.472: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.473: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.474: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.475: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.476: DFBPPR3753 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.477: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.478: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.479: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.480: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.481: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.482: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.483: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial
Source.484: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.485: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.486: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.487: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic
Source.488: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.489: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.490: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.491: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.492: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.493: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.494: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62
Source.495: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.496: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.497: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.498: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.499: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.500: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.501: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.502: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.503: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.504: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.505: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.506: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.507: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.508: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.509: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.510: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.511: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1
Source.512: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.513: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7
Source.514: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.515: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.516: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.517: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.518: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3
Source.519: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.520: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.521: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27
Source.522: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.523: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.524: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.525: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.526: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.527: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.528: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.529: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.530: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.531: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.532: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.533: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.534: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.535: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.536: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.537: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.538: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.539: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.540: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.541: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.542: DFBPPR4169 ---- Plant proteins ---- Succinate dehydrogenase subunit 6, mitochondrial
Source.543: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog
Source.544: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.545: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.546: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.547: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.548: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1
Source.549: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.550: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.551: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.552: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.553: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.554: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.555: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.556: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63
Source.557: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.558: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.559: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.560: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.561: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.562: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.563: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.564: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.565: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.566: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.567: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.568: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.569: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.570: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.571: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2
Source.572: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.573: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.574: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.575: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.576: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.577: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.578: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.579: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.580: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.581: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.582: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.583: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.584: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.585: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.586: DFBPPR4511 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 9
Source.587: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.588: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.589: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.590: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.591: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.592: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5
Source.593: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.594: DFBPPR4593 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 15
Source.595: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23
Source.596: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.597: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.598: DFBPPR4629 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 7
Source.599: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.600: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.601: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.602: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.603: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.604: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.605: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.606: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.607: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1
Source.608: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.609: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.610: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.611: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.612: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.613: DFBPPR4740 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 2
Source.614: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.615: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.616: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G
Source.617: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.618: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.619: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.620: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.621: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.622: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.623: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.624: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090
Source.625: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820
Source.626: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58
Source.627: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.628: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.629: DFBPPR4896 ---- Plant proteins ---- Thioredoxin H1
Source.630: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.631: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.632: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.633: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.634: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.635: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.636: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.637: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.638: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.639: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.640: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.641: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.642: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.643: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.644: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.645: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.646: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.647: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.648: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.649: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.650: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.651: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.652: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.653: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.654: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.655: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.656: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.657: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.658: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.659: DFBPPR5144 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-A
Source.660: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.661: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.662: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic
Source.663: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.664: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.665: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.666: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial
Source.667: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.668: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.669: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.670: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein
Source.671: DFBPPR5254 ---- Plant proteins ---- Chalcone--flavonone isomerase 3
Source.672: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase
Source.673: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.674: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.675: DFBPPR5311 ---- Plant proteins ---- Nodulin-20
Source.676: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.677: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.678: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.679: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.680: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B
Source.681: DFBPPR5347 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.682: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.683: DFBPPR5368 ---- Plant proteins ---- Desiccation protectant protein Lea14 homolog
Source.684: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.685: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.686: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.687: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.688: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.689: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.690: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.691: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.692: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.693: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.694: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.695: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.696: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.697: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.698: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.699: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.700: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.701: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.702: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.703: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.704: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.705: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.706: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.707: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.708: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.709: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.710: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.711: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.712: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.713: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.714: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.715: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.716: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.717: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.718: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.719: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.720: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.721: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.722: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.723: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.724: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.725: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.726: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.727: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.728: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.729: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.730: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.731: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.732: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.733: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.734: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.735: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.736: DFBPPR5638 ---- Plant proteins ---- Histone H2B.5
Source.737: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.738: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.739: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.740: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.741: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.742: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.743: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.744: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.745: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.746: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.747: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.748: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.749: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.750: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.751: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.752: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.753: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.754: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.755: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.756: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.757: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.758: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase
Source.759: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.760: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.761: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog
Source.762: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.763: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.764: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.765: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.766: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.767: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.768: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.769: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.770: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.771: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.772: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.773: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.774: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.775: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.776: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.777: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2
Source.778: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.779: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.780: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.781: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.782: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.783: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.784: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.785: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1
Source.786: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.787: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.788: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.789: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.790: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.791: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.792: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.793: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.794: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.795: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.796: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.797: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.798: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.799: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.800: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.801: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.802: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.803: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.804: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.805: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.806: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.807: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.808: DFBPPR6303 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.809: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.810: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.811: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.812: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.813: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.814: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.815: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.816: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.817: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.818: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.819: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.820: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.821: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.822: DFBPPR6430 ---- Plant proteins ---- Legumin J
Source.823: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.824: DFBPPR6455 ---- Plant proteins ---- Legumin K
Source.825: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.826: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.827: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.828: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.829: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8
Source.830: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.831: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.832: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8
Source.833: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5
Source.834: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.835: DFBPPR6714 ---- Plant proteins ---- Histone H2B.3
Source.836: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.837: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.838: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.839: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.840: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.841: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.842: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.843: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.844: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.845: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.846: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.847: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.848: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.849: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212
Source.850: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.851: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.852: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.853: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.854: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.855: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.856: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.857: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.858: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.859: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.860: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3
Source.861: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.862: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.863: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.864: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.865: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1
Source.866: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2
Source.867: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.868: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.869: DFBPPR7056 ---- Plant proteins ---- Cysteine proteinase inhibitor
Source.870: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.871: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.872: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.873: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.874: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.875: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.876: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.877: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.878: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.879: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.880: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.881: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.882: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.883: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.884: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.885: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.886: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.887: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.888: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.889: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.890: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.891: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.892: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.893: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.894: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.895: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.896: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.897: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin
Source.898: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.899: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.900: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.901: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.902: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.903: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7
Source.904: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.905: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.906: DFBPPR7415 ---- Plant proteins ---- Co-chaperone protein p23-1
Source.907: DFBPPR7426 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.908: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.909: DFBPPR7429 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.910: DFBPPR7435 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.911: DFBPPR7436 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.912: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.913: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.914: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.915: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.916: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.917: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.918: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.919: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.920: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.921: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.922: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.923: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.924: DFBPPR7522 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.925: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.926: DFBPPR7544 ---- Plant proteins ---- Metallothionein-like protein type 2 LSC210
Source.927: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.928: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.929: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.930: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.931: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.932: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.933: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.934: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.935: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.936: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.937: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein
Source.938: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.939: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.940: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.941: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.942: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.943: DFBPPR8369 ---- Plant proteins ---- Thioredoxin H-type
Source.944: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.945: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1
Source.946: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A
Source.947: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.948: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7
Source.949: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.950: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.951: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.952: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.953: DFBPPR8521 ---- Milk proteins ---- Probetacellulin
Source.954: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein
Source.955: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.956: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.957: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.958: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.959: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.960: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.961: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.962: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.963: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.964: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.965: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.966: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.967: DFBPPR16072 ---- Animal proteins ---- Clusterin
Source.968: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.969: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.970: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.971: DFBPPR16093 ---- Animal proteins ---- Menin
Source.972: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.973: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.974: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.975: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.976: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.977: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.978: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.979: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.980: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.981: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.982: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.983: DFBPPR16148 ---- Animal proteins ---- Haptoglobin
Source.984: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.985: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.986: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.987: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.988: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.989: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.990: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.991: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.992: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.993: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.994: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.995: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.996: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.997: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.998: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.999: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.1000: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.1001: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.1002: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1003: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1004: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.1005: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.1006: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.1007: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1008: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.1009: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.1010: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1011: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1012: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1013: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1014: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.1015: DFBPPR16492 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.1016: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.1017: DFBPPR16497 ---- Animal proteins ---- Interleukin-5
Source.1018: DFBPPR16501 ---- Animal proteins ---- F-box/LRR-repeat protein 15
Source.1019: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.1020: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.1021: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1022: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.1023: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1024: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.1025: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1026: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain
Source.1027: DFBPPR16627 ---- Animal proteins ---- 60S ribosomal protein L15
Source.1028: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1029: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1030: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.1031: DFBPPR16719 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A1, mitochondrial
Source.1032: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1033: DFBPPR16730 ---- Animal proteins ---- RING finger protein 141
Source.1034: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.1035: DFBPPR16746 ---- Animal proteins ---- Tektin-1
Source.1036: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.1037: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1038: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.1039: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.1040: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1041: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1042: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.1043: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.1044: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1045: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.1046: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1047: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15
Source.1048: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.1049: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.1050: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.1051: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.1052: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1053: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.1054: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.1055: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1056: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1057: DFBPPR16962 ---- Animal proteins ---- Interleukin-18
Source.1058: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.1059: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.1060: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.1061: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1
Source.1062: DFBPPR16981 ---- Animal proteins ---- Clusterin
Source.1063: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.1064: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.1065: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1066: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.1067: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.1068: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.1069: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1070: DFBPPR17047 ---- Animal proteins ---- Neuromodulin
Source.1071: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1072: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.1073: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.1074: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.1075: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.1076: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1077: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.1078: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.1079: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1080: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1081: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.1082: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.1083: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.1084: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.1085: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.1086: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.1087: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1088: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.1089: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.1090: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.1091: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1092: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.1093: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.1094: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.1095: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.1096: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.1097: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.1098: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1099: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.1100: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.1101: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.1102: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.1103: DFBPPR17324 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1104: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1105: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.1106: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.1107: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.1108: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.1109: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.1110: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.1111: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.1112: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.1113: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1114: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1115: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.1116: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.1117: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.1118: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.1119: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.1120: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.1121: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.1122: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.1123: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1124: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1
Source.1125: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.1126: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.1127: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.1128: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1129: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1130: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.1131: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.1132: DFBPPR17441 ---- Animal proteins ---- DnaJ homolog subfamily C member 5
Source.1133: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1134: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.1135: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1136: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1137: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.1138: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.1139: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1140: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.1141: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.1142: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1143: DFBPPR17545 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A1, mitochondrial
Source.1144: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.1145: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1146: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.1147: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.1148: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.1149: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1150: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.1151: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.1152: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.1153: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor
Source.1154: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.1155: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.1156: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10
Source.1157: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.1158: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1159: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.1160: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1161: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.1162: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.1163: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1164: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.1165: DFBPPR17799 ---- Animal proteins ---- Gamma-synuclein
Source.1166: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.1167: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.1168: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.1169: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.1170: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.1171: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1172: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.1173: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.1174: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.1175: DFBPPR17877 ---- Animal proteins ---- Syntaxin-7
Source.1176: DFBPPR17879 ---- Animal proteins ---- Menin
Source.1177: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.1178: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1179: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.1180: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8
Source.1181: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.1182: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.1183: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.1184: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.1185: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1186: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.1187: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.1188: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.1189: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.1190: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.1191: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.1192: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1193: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.1194: DFBPPR17981 ---- Animal proteins ---- Retinol-binding protein 4
Source.1195: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.1196: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.1197: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.1198: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1199: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1200: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.1201: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.1202: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.1203: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1204: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1205: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.1206: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1207: DFBPPR18064 ---- Animal proteins ---- Sperm flagellar protein 1
Source.1208: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.1209: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.1210: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.1211: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.1212: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.1213: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.1214: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1215: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1216: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.1217: DFBPPR18136 ---- Animal proteins ---- Septin-8
Source.1218: DFBPPR18137 ---- Animal proteins ---- Septin-8
Source.1219: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.1220: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.1221: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.1222: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.1223: DFBPPR18199 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 N
Source.1224: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.1225: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.1226: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.1227: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.1228: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.1229: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.1230: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1231: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.1232: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1233: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.1234: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.1235: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.1236: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial
Source.1237: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.1238: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.1239: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.1240: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.1241: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.1242: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.1243: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.1244: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1245: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.1246: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1247: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.1248: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.1249: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1250: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.1251: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1252: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.1253: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.1254: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.1255: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.1256: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.1257: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.1258: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.1259: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.1260: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.1261: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.1262: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.1263: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.1264: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.1265: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.1266: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.1267: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.1268: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.1269: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.1270: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.1271: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.1272: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.1273: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.1274: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1275: DFBPPR18564 ---- Animal proteins ---- BRISC and BRCA1-A complex member 1
Source.1276: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1
Source.1277: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.1278: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1279: DFBPPR18597 ---- Animal proteins ---- Telethonin
Source.1280: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1281: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1282: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.1283: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1284: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.1285: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.1286: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.1287: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.1288: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.1289: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1290: DFBPPR18703 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.1291: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.1292: DFBPPR18713 ---- Animal proteins ---- Arginase-1
Source.1293: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.1294: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.1295: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2
Source.1296: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.1297: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1298: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.1299: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II
Source.1300: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.1301: DFBPPR18753 ---- Animal proteins ---- Endosome-associated-trafficking regulator 1
Source.1302: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.1303: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1304: DFBPPR18778 ---- Animal proteins ---- Erlin-2
Source.1305: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.1306: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.1307: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1308: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.1309: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1310: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.1311: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.1312: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.1313: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.1314: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.1315: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.1316: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1317: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.1318: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.1319: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.1320: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.1321: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.1322: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.1323: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1324: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.1325: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.1326: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.1327: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.1328: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.1329: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.1330: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.1331: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.1332: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1333: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.1334: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1335: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.1336: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.1337: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.1338: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.1339: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.1340: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.1341: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1342: DFBPPR18982 ---- Animal proteins ---- Gastrin-releasing peptide
Source.1343: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor
Source.1344: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.1345: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.1346: DFBPPR19003 ---- Animal proteins ---- Protein lin-7 homolog A
Source.1347: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.1348: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1349: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.1350: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.1351: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1352: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.1353: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1354: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3
Source.1355: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1356: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.1357: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.1358: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein
Source.1359: DFBPPR19165 ---- Animal proteins ---- Tropomyosin beta chain
Source.1360: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain
Source.1361: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.1362: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.1363: DFBPPR19211 ---- Animal proteins ---- Beta-synuclein
Source.1364: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.1365: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1366: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4
Source.1367: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.1368: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.1369: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1370: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like
Source.1371: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.1372: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1373: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.1374: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.1375: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1
Source.1376: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.1377: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1378: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.1379: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.1380: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1381: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.1382: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.1383: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.1384: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.1385: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.1386: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1387: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.1388: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.1389: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19
Source.1390: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.1391: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.1392: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1393: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1394: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.1395: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1396: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase
Source.1397: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.1398: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1399: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.1400: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.1401: DFBPPR19539 ---- Animal proteins ---- MICOS complex subunit MIC19
Source.1402: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.1403: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1404: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.1405: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.1406: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.1407: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.1408: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.1409: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.1410: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.1411: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1412: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.1413: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.1414: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.1415: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.1416: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.1417: DFBPPR19645 ---- Animal proteins ---- Barrier-to-autointegration factor
Source.1418: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.1419: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.1420: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.1421: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.1422: DFBPPR19709 ---- Animal proteins ---- Centromere protein X
Source.1423: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.1424: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1
Source.1425: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.1426: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.1427: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase
Source.1428: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.1429: DFBPPR19767 ---- Animal proteins ---- F-box/LRR-repeat protein 15
Source.1430: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1431: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.1432: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2
Source.1433: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.1434: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.1435: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.1436: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.1437: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.1438: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.1439: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.1440: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.1441: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.1442: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B
Source.1443: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.1444: DFBPPR19900 ---- Animal proteins ---- C-type natriuretic peptide
Source.1445: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.1446: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1447: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.1448: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.1449: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.1450: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.1451: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.1452: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.1453: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1454: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.1455: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.1456: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.1457: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.1458: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.1459: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1460: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.1461: DFBPPR19958 ---- Animal proteins ---- 60S ribosomal protein L10
Source.1462: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.1463: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.1464: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.1465: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.1466: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.1467: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.1468: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.1469: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.1470: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.1471: DFBPPR20084 ---- Animal proteins ---- Transcription and mRNA export factor ENY2
Source.1472: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.1473: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.1474: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.1475: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.1476: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.1477: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C
Source.1478: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.1479: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.1480: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.1481: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.1482: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.1483: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1484: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53
Source.1485: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.1486: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1
Source.1487: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1488: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.1489: DFBPPR20283 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 1
Source.1490: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1
Source.1491: DFBPPR20295 ---- Animal proteins ---- Protein dpy-30 homolog
Source.1492: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.1493: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.1494: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.1495: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.1496: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase
Source.1497: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.1498: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.1499: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1500: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1501: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.1502: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4
Source.1503: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1504: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.1505: DFBPPR20458 ---- Animal proteins ---- Putative transcription factor Ovo-like 1
Source.1506: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.1507: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.1508: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54
Source.1509: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.1510: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.1511: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.1512: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.1513: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.1514: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.1515: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.1516: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.1517: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.1518: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.1519: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.1520: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1521: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.1522: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.1523: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.1524: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.1525: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1526: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.1527: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.1528: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.1529: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.1530: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1531: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6
Source.1532: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.1533: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.1534: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1535: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.1536: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.1537: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.1538: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.1539: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.1540: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.1541: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.1542: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1543: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.1544: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4
Source.1545: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.1546: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1547: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.1548: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator
Source.1549: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1550: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.1551: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.1552: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.1553: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1554: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.1555: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.1556: DFBPPR21013 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit D
Source.1557: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.1558: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.1559: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.1560: DFBPPR21046 ---- Animal proteins ---- Opalin
Source.1561: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.1562: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.1563: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.1564: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.1565: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.1566: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.1567: DFBPPR21129 ---- Animal proteins ---- 60S ribosomal protein L15
Source.1568: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.1569: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22
Source.1570: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.1571: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2
Source.1572: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.1573: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.1574: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.1575: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.1576: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.1577: DFBPPR21204 ---- Animal proteins ---- ADP-ribosylation factor-like protein 5A
Source.1578: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.1579: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.1580: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.1581: DFBPPR21260 ---- Animal proteins ---- 40S ribosomal protein S21
Source.1582: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.1583: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.1584: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.1585: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.1586: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha
Source.1587: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.1588: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.1589: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.1590: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.1591: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.1592: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.1593: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.1594: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.1595: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1
Source.1596: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A
Source.1597: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1
Source.1598: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.1599: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.1600: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.1601: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.1602: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.1603: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.1604: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.1605: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.1606: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.1607: DFBPPR21547 ---- Animal proteins ---- Osteoclast-stimulating factor 1
Source.1608: DFBPPR21559 ---- Animal proteins ---- C-type lectin domain family 3 member A
Source.1609: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.1610: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1611: DFBPPR21572 ---- Animal proteins ---- 39S ribosomal protein L43, mitochondrial
Source.1612: DFBPPR21574 ---- Animal proteins ---- Parvalbumin alpha
Source.1613: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like
Source.1614: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.1615: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.1616: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.1617: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1618: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.1619: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1620: DFBPPR21674 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3B
Source.1621: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.1622: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.1623: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11
Source.1624: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.1625: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.1626: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.1627: DFBPPR21738 ---- Animal proteins ---- Bcl-2-related protein A1
Source.1628: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.1629: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2
Source.1630: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.1631: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.1632: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.1633: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.1634: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1
Source.1635: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.1636: DFBPPR21826 ---- Animal proteins ---- RING finger protein 141
Source.1637: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.1638: DFBPPR21843 ---- Animal proteins ---- Tektin-1
Source.1639: DFBPPR21856 ---- Animal proteins ---- Protein FAM32A
Source.1640: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.1641: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.1642: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.1643: DFBPPR21920 ---- Animal proteins ---- Protein DPCD
Source.1644: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.1645: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2
Source.1646: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.1647: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.1648: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.1649: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.1650: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.1651: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.1652: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2
Source.1653: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.1654: DFBPPR22025 ---- Animal proteins ---- Putative deoxyribonuclease TATDN3
Source.1655: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.1656: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.1657: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.1658: DFBPPR22070 ---- Animal proteins ---- Maturin
Source.1659: DFBPPR22081 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.1660: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.1661: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.1662: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.1663: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.1664: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.1665: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.1666: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.1667: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1668: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.1669: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.1670: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.1671: DFBPPR22199 ---- Animal proteins ---- SCAN domain-containing protein 1
Source.1672: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.1673: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.1674: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.1675: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.1676: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5
Source.1677: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.1678: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.1679: DFBPPR22251 ---- Animal proteins ---- SUZ domain-containing protein 1
Source.1680: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.1681: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.1682: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.1683: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.1684: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11
Source.1685: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.1686: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.1687: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.1688: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.1689: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.1690: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.1691: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.1692: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.1693: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1
Source.1694: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.1695: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149
Source.1696: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.1697: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137
Source.1698: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.1699: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.1700: DFBPPR22479 ---- Animal proteins ---- Transcription elongation factor A protein-like 1
Source.1701: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.1702: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.1703: DFBPPR22551 ---- Animal proteins ---- Pancreatic progenitor cell differentiation and proliferation factor-like protein
Source.1704: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.1705: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.1706: DFBPPR22584 ---- Animal proteins ---- Arginine vasopressin-induced protein 1
Source.1707: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.1708: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26
Source.1709: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.1710: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.1711: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.1712: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.1713: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.1714: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.1715: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.1716: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog
Source.1717: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.1718: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.1719: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.1720: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.1721: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.1722: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1723: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.1724: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.1725: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1726: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.1727: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.1728: DFBPPR8592 ---- Animal proteins ---- Interleukin-18
Source.1729: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.1730: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.1731: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.1732: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein
Source.1733: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.1734: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.1735: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1736: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.1737: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.1738: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.1739: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.1740: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1741: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.1742: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1743: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1744: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.1745: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.1746: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.1747: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.1748: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.1749: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1750: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.1751: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1752: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.1753: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.1754: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1755: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1756: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.1757: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.1758: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1759: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1760: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1761: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.1762: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.1763: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1764: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.1765: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1766: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.1767: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.1768: DFBPPR8813 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1769: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.1770: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.1771: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.1772: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1773: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.1774: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.1775: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.1776: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1777: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1778: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1779: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1780: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.1781: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1782: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.1783: DFBPPR9038 ---- Animal proteins ---- C-type natriuretic peptide
Source.1784: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.1785: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.1786: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4
Source.1787: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.1788: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.1789: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.1790: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.1791: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1792: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1793: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.1794: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.1795: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1796: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.1797: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.1798: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1799: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.1800: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.1801: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.1802: DFBPPR9194 ---- Animal proteins ---- Arginase-1
Source.1803: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.1804: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1805: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.1806: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.1807: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.1808: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.1809: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.1810: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1811: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.1812: DFBPPR9294 ---- Animal proteins ---- 60S ribosomal protein L10
Source.1813: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.1814: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.1815: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.1816: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.1817: DFBPPR9312 ---- Animal proteins ---- 40S ribosomal protein S21
Source.1818: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1
Source.1819: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.1820: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.1821: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.1822: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1823: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.1824: DFBPPR9359 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.1825: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.1826: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.1827: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1828: DFBPPR9426 ---- Animal proteins ---- Opalin
Source.1829: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.1830: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1831: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1832: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1833: DFBPPR9495 ---- Animal proteins ---- Complement factor B
Source.1834: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.1835: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1836: DFBPPR9518 ---- Animal proteins ---- Interleukin-5
Source.1837: DFBPPR9532 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.1838: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1839: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.1840: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1841: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.1842: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1843: DFBPPR9618 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A1, mitochondrial
Source.1844: DFBPPR9638 ---- Animal proteins ---- Troponin T, slow skeletal muscle
Source.1845: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.1846: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.1847: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.1848: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.1849: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.1850: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.1851: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.1852: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.1853: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8
Source.1854: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.1855: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.1856: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.1857: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C
Source.1858: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.1859: DFBPPR9862 ---- Animal proteins ---- Osteoclast-stimulating factor 1
Source.1860: DFBPPR9879 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1861: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.1862: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.1863: DFBPPR9901 ---- Animal proteins ---- 40S ribosomal protein S14
Source.1864: DFBPPR9904 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7
Source.1865: DFBPPR9905 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.1866: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.1867: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.1868: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1869: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.1870: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.1871: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.1872: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.1873: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1874: DFBPPR10005 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.1875: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.1876: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I
Source.1877: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a
Source.1878: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1879: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.1880: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7
Source.1881: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.1882: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.1883: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.1884: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.1885: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.1886: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.1887: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.1888: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.1889: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.1890: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.1891: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.1892: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.1893: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.1894: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.1895: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.1896: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.1897: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.1898: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.1899: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.1900: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.1901: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.1902: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.1903: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.1904: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1905: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1
Source.1906: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.1907: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.1908: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.1909: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.1910: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.1911: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.1912: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.1913: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.1914: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1915: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.1916: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1917: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.1918: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1919: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.1920: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.1921: DFBPPR10298 ---- Animal proteins ---- Caldesmon
Source.1922: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.1923: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.1924: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.1925: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1926: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1927: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.1928: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.1929: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.1930: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.1931: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta
Source.1932: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.1933: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.1934: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.1935: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.1936: DFBPPR10385 ---- Animal proteins ---- Centromere protein S
Source.1937: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.1938: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.1939: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.1940: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.1941: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.1942: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.1943: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.1944: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1945: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.1946: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.1947: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.1948: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.1949: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.1950: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.1951: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.1952: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.1953: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.1954: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1
Source.1955: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.1956: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.1957: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.1958: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.1959: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.1960: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.1961: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.1962: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.1963: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1964: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1965: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.1966: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.1967: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1968: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1969: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.1970: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.1971: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.1972: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.1973: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1974: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.1975: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.1976: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.1977: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.1978: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.1979: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.1980: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.1981: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1982: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.1983: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1984: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.1985: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.1986: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.1987: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1988: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1989: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.1990: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.1991: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.1992: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.1993: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.1994: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.1995: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.1996: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.1997: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1998: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1999: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.2000: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.2001: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6
Source.2002: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.2003: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.2004: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.2005: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.2006: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.2007: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.2008: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.2009: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.2010: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2011: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.2012: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.2013: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1
Source.2014: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.2015: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2
Source.2016: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.2017: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.2018: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.2019: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.2020: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.2021: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.2022: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.2023: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.2024: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.2025: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.2026: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.2027: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.2028: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.2029: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.2030: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2031: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.2032: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.2033: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.2034: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.2035: DFBPPR11000 ---- Animal proteins ---- Tropomyosin beta chain
Source.2036: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.2037: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.2038: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.2039: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.2040: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.2041: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.2042: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.2043: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.2044: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2045: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.2046: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.2047: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.2048: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.2049: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2050: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.2051: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.2052: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.2053: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.2054: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.2055: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.2056: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.2057: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.2058: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.2059: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.2060: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.2061: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.2062: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.2063: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2064: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.2065: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.2066: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2067: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.2068: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.2069: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.2070: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.2071: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.2072: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.2073: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.2074: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.2075: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.2076: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.2077: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.2078: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.2079: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.2080: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2081: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.2082: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B
Source.2083: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.2084: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.2085: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4
Source.2086: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.2087: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.2088: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.2089: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.2090: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.2091: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.2092: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.2093: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.2094: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.2095: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.2096: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.2097: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.2098: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.2099: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.2100: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC
Source.2101: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.2102: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.2103: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.2104: DFBPPR11583 ---- Animal proteins ---- Translin
Source.2105: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.2106: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.2107: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.2108: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.2109: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.2110: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.2111: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.2112: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.2113: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.2114: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.2115: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.2116: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.2117: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.2118: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.2119: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.2120: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.2121: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.2122: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.2123: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.2124: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.2125: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.2126: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.2127: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.2128: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.2129: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.2130: DFBPPR11838 ---- Animal proteins ---- Enhancer of mRNA-decapping protein 3
Source.2131: DFBPPR11848 ---- Animal proteins ---- Parvalbumin, muscle
Source.2132: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.2133: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.2134: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.2135: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.2136: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.2137: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.2138: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.2139: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.2140: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.2141: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.2142: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.2143: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.2144: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.2145: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein
Source.2146: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.2147: DFBPPR12018 ---- Animal proteins ---- Density-regulated protein
Source.2148: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.2149: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.2150: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.2151: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.2152: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.2153: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.2154: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.2155: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.2156: DFBPPR12129 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.2157: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.2158: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.2159: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2
Source.2160: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.2161: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.2162: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.2163: DFBPPR12168 ---- Animal proteins ---- Osteoclast-stimulating factor 1
Source.2164: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.2165: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.2166: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.2167: DFBPPR12196 ---- Animal proteins ---- 60S ribosomal protein L15
Source.2168: DFBPPR12198 ---- Animal proteins ---- RING finger protein 141
Source.2169: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1
Source.2170: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog
Source.2171: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.2172: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.2173: DFBPPR12232 ---- Animal proteins ---- SUZ domain-containing protein 1
Source.2174: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.2175: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2176: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.2177: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.2178: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.2179: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.2180: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.2181: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2182: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.2183: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2184: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.2185: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2186: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.2187: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.2188: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.2189: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.2190: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.2191: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2192: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.2193: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.2194: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.2195: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2196: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.2197: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.2198: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.2199: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.2200: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2201: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2202: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.2203: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.2204: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.2205: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.2206: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.2207: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.2208: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.2209: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.2210: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.2211: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2212: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.2213: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2214: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.2215: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.2216: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2217: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2218: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.2219: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.2220: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.2221: DFBPPR12642 ---- Animal proteins ---- Haptoglobin
Source.2222: DFBPPR12643 ---- Animal proteins ---- Haptoglobin
Source.2223: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2224: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2225: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2226: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.2227: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.2228: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2229: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.2230: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.2231: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.2232: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.2233: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.2234: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.2235: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.2236: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.2237: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.2238: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.2239: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.2240: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4
Source.2241: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.2242: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2243: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor
Source.2244: DFBPPR12857 ---- Animal proteins ---- Arginase-1
Source.2245: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.2246: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.2247: DFBPPR12871 ---- Animal proteins ---- Tropomyosin beta chain
Source.2248: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.2249: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.2250: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.2251: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.2252: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.2253: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.2254: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.2255: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.2256: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.2257: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.2258: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.2259: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.2260: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2261: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.2262: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.2263: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.2264: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.2265: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.2266: DFBPPR13153 ---- Animal proteins ---- Interleukin-18
Source.2267: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2268: DFBPPR13174 ---- Animal proteins ---- Clusterin
Source.2269: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2270: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.2271: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.2272: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.2273: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.2274: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.2275: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.2276: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2277: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.2278: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.2279: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.2280: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.2281: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2282: DFBPPR13357 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.2283: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4
Source.2284: DFBPPR13376 ---- Animal proteins ---- Interleukin-5
Source.2285: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.2286: DFBPPR13389 ---- Animal proteins ---- Phosducin
Source.2287: DFBPPR13483 ---- Animal proteins ---- Interleukin-18
Source.2288: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.2289: DFBPPR13505 ---- Animal proteins ---- Spectrin beta chain, non-erythrocytic 1
Source.2290: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.2291: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.2292: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.2293: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2294: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.2295: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.2296: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2297: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1
Source.2298: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.2299: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2300: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2301: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.2302: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2303: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.2304: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.2305: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2306: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.2307: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2308: DFBPPR13705 ---- Animal proteins ---- Galectin-1
Source.2309: DFBPPR13717 ---- Animal proteins ---- C-type natriuretic peptide
Source.2310: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.2311: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.2312: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2313: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.2314: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.2315: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.2316: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2317: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.2318: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5
Source.2319: DFBPPR13843 ---- Animal proteins ---- 60S ribosomal protein L10
Source.2320: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.2321: DFBPPR13864 ---- Animal proteins ---- Interleukin-5
Source.2322: DFBPPR13915 ---- Animal proteins ---- Gastrin-releasing peptide
Source.2323: DFBPPR13925 ---- Animal proteins ---- Homeobox protein BarH-like 2
Source.2324: DFBPPR13943 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A1, mitochondrial
Source.2325: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.2326: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.2327: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.2328: DFBPPR14070 ---- Animal proteins ---- 60S ribosomal protein L15
Source.2329: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.2330: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.2331: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.2332: DFBPPR14108 ---- Marine protein ---- 6-pyruvoyl tetrahydrobiopterin synthase
Source.2333: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.2334: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.2335: DFBPPR14128 ---- Marine protein ---- F-box/LRR-repeat protein 15
Source.2336: DFBPPR14141 ---- Marine protein ---- Ependymin-2
Source.2337: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.2338: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.2339: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.2340: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.2341: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain
Source.2342: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.2343: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain
Source.2344: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.2345: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.2346: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.2347: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.2348: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.2349: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.2350: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.2351: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.2352: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.2353: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.2354: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic
Source.2355: DFBPPR14418 ---- Marine protein ---- Acyl carrier protein
Source.2356: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.2357: DFBPPR14498 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic
Source.2358: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.2359: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.2360: DFBPPR14547 ---- Marine protein ---- Interleukin-6
Source.2361: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.2362: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.2363: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.2364: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.2365: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.2366: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.2367: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.2368: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.2369: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.2370: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.2371: DFBPPR14628 ---- Marine protein ---- C-type natriuretic peptide 1
Source.2372: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.2373: DFBPPR14645 ---- Marine protein ---- Ependymin-2
Source.2374: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.2375: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.2376: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.2377: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.2378: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64
Source.2379: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.2380: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.2381: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.2382: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.2383: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.2384: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta
Source.2385: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.2386: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.2387: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.2388: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.2389: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.2390: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.2391: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.2392: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.2393: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.2394: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.2395: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.2396: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.2397: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.2398: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.2399: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.2400: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.2401: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.2402: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.2403: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.2404: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.2405: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.2406: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.2407: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.2408: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.2409: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.2410: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.2411: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial
Source.2412: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.2413: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.2414: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.2415: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.2416: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.2417: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.2418: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.2419: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2420: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.2421: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.2422: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.2423: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.2424: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.2425: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.2426: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.2427: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.2428: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.2429: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.2430: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.2431: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.2432: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.2433: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.2434: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.2435: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.2436: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.2437: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.2438: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.2439: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.2440: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24
Source.2441: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.2442: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.2443: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1
Source.2444: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.2445: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.2446: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.2447: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.2448: DFBPPR15576 ---- Microorganism protein ---- Cytochrome c oxidase-assembly factor COX23, mitochondrial
Source.2449: DFBPPR15617 ---- Microorganism protein ---- Cap-associated protein CAF20
Source.2450: DFBPPR15638 ---- Microorganism protein ---- ATP-dependent kinase YFH7
Source.2451: DFBPPR15642 ---- Microorganism protein ---- Spindle pole component 29
Source.2452: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.2453: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.2454: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.2455: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.2456: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.2457: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.2458: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.2459: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.2460: DFBPPR15737 ---- Microorganism protein ---- Required for respiratory growth protein 9, mitochondrial
Source.2461: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.2462: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.2463: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.2464: DFBPPR15766 ---- Microorganism protein ---- Protein ATC1/LIC4
Source.2465: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2
Source.2466: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.2467: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.2468: DFBPPR15793 ---- Microorganism protein ---- Uncharacterized protein KLLA0D02464g
Source.2469: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.2470: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.2471: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.2472: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.2473: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.2474: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase
Source.2475: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase
Source.2476: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.2477: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.2478: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.2479: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.2480: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.2481: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2482: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.2483: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.2484: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.2485: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.2486: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.2487: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.2488: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic
Source.2489: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.2490: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.2491: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2492: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.2493: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.2494: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2495: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.2496: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2497: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.2498: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.2499: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.2500: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.2501: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.2502: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.2503: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.2504: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.2505: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.2506: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.2507: DFBPPR7947 ---- Plant protein ---- Legumin type B
Source.2508: DFBPPR7956 ---- Plant protein ---- Legumin type B
Source.2509: DFBPPR7957 ---- Plant protein ---- Legumin type B
Source.2510: DFBPPR7958 ---- Plant protein ---- Legumin type B
Source.2511: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.2512: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.2513: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.2514: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2515: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.2516: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.2517: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2518: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.2519: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.2520: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.2521: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.2522: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.2523: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5
Source.2524: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.2525: DFBPPR8156 ---- Plant protein ---- Nodulin-30
Source.2526: DFBPPR8163 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.2527: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.2528: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2529: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2530: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.2531: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2532: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antihypertensive activity
In vitro experiments
Dose (mg/kg)
SBP Decreases (Maximal)
DBP Decreases (Maximal)
SHR
0.10
No decrease
17.7 ± 2.0 mm Hg
Time
3 h
Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O
Preparation method
Mode of preparation Fermentation
Enzyme(s)/starter culture

Buckwheat sprouts was fermented with lactobacillus plantarum KT(Biotech Japan, Agano, Japan).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: Non-Toxin
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Koyama M, Naramoto K, Nakajima T, Aoyama T, Watanabe M, Nakamura K. Purification and identification of antihypertensive peptides from fermented buckwheat sprouts. J Agric Food Chem. 2013 Mar 27;61(12):3013-21.
PMID: 23432021
Other literature(s) N.D
PubDate 2013
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214