E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANHY0636(Antihypertensive peptide)
DFBP ID DFBPANHY0636
Peptide sequence GLY
Type Native peptide
Peptide/Function name Antihypertensive peptide
Function-activity relationship
Main bioactivity Antihypertensive activity
Otheir bioactivity ACE-inhibitory activity [D1], Regulating activity [D2], Multifunctional activity [D3]
Calculated physicochemical properties
Three-letter amino acid Gly-Leu-Tyr
Single-letter amino acid GLY
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 351.40 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
IC50 N.D
pIC50 N.D
GRAVY 0.7000 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source royal jelly
Precursor protein royal jelly glycoprotein
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.2: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.3: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.4: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.5: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.6: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.7: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.8: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.9: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.10: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.11: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.12: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.13: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.14: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.15: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.16: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.17: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.18: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1
Source.19: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.20: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.21: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.22: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.23: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.24: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.25: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.26: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.27: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.28: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.29: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.30: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.31: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.32: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.33: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.34: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.35: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2
Source.36: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.37: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.38: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.39: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.40: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.41: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.42: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.43: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.44: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.45: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.46: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.47: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.48: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.49: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.50: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.51: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.52: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.53: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.54: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.55: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.56: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.57: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.58: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.59: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.60: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.61: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.62: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.63: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.64: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.65: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.66: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.67: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.68: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.69: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.70: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.71: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.72: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.73: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.74: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.75: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.76: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1
Source.77: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.78: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.79: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.80: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.81: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.82: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.83: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.84: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.85: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.86: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.87: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.88: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.89: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.90: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.91: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.92: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.93: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.94: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.95: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5
Source.96: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.97: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.98: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.99: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.100: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.101: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.102: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.103: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.104: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.105: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.106: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.107: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.108: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.109: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.110: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.111: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.112: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.113: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.114: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.115: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic
Source.116: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.117: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.118: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.119: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.120: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.121: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.122: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.123: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.124: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.125: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.126: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.127: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.128: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.129: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.130: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.131: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.132: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.133: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.134: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.135: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1
Source.136: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.137: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.138: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.139: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2
Source.140: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.141: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.142: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2
Source.143: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.144: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.145: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.146: DFBPPR2849 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 3
Source.147: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.148: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.149: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.150: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.151: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.152: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.153: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.154: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.155: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.156: DFBPPR3021 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 1
Source.157: DFBPPR3022 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 2
Source.158: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.159: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.160: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.161: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.162: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.163: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.164: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.165: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.166: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.167: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.168: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.169: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.170: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.171: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.172: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.173: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.174: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.175: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.176: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.177: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.178: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.179: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.180: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.181: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.182: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.183: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.184: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.185: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.186: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.187: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.188: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.189: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.190: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.191: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.192: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.193: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.194: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.195: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.196: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.197: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.198: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.199: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.200: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.201: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.202: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.203: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.204: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.205: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.206: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.207: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.208: DFBPPR3654 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7a
Source.209: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.210: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.211: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.212: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.213: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.214: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.215: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.216: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.217: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.218: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.219: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.220: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.221: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.222: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.223: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.224: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.225: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.226: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.227: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.228: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.229: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.230: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.231: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.232: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.233: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.234: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.235: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.236: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.237: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.238: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.239: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.240: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.241: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.242: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.243: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.244: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.245: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.246: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.247: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.248: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.249: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.250: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.251: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.252: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.253: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.254: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.255: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.256: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.257: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.258: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.259: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.260: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.261: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.262: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.263: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.264: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.265: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.266: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.267: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.268: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.269: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.270: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.271: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.272: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.273: DFBPPR4664 ---- Plant proteins ---- 40S ribosomal protein S21
Source.274: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.275: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.276: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.277: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.278: DFBPPR4752 ---- Plant proteins ---- Uncharacterized protein ycf70
Source.279: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.280: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.281: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.282: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.283: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.284: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.285: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.286: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.287: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.288: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.289: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.290: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.291: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.292: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.293: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.294: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.295: DFBPPR5150 ---- Plant proteins ---- Profilin-2
Source.296: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.297: DFBPPR5154 ---- Plant proteins ---- Profilin-1
Source.298: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.299: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.300: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.301: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.302: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.303: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.304: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.305: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.306: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.307: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.308: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.309: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.310: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.311: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1
Source.312: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2
Source.313: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.314: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.315: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.316: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.317: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.318: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.319: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.320: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.321: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.322: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.323: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.324: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.325: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.326: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4
Source.327: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.328: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.329: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.330: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.331: DFBPPR5772 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1
Source.332: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.333: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.334: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.335: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.336: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.337: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.338: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor
Source.339: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.340: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.341: DFBPPR5896 ---- Plant proteins ---- 50 kDa gamma-zein
Source.342: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.343: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.344: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.345: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.346: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.347: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.348: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.349: DFBPPR6056 ---- Plant proteins ---- Bowman-Birk type wound-induced proteinase inhibitor WIP1
Source.350: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.351: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.352: DFBPPR6132 ---- Plant proteins ---- 40S ribosomal protein S21
Source.353: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.354: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.355: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.356: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.357: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.358: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.359: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.360: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.361: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.362: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.363: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.364: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.365: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.366: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.367: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.368: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.369: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic
Source.370: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.371: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.372: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.373: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.374: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.375: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.376: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.377: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.378: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.379: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z
Source.380: DFBPPR6774 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1
Source.381: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.382: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.383: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.384: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.385: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.386: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.387: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.388: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.389: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.390: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.391: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.392: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.393: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.394: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.395: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.396: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.397: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.398: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.399: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.400: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.401: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.402: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.403: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.404: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.405: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.406: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.407: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.408: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.409: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.410: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.411: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.412: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.413: DFBPPR7534 ---- Plant proteins ---- Acyl-CoA-binding protein
Source.414: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.415: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.416: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.417: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.418: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.419: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.420: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.421: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.422: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.423: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.424: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.425: DFBPPR8377 ---- Plant proteins ---- Profilin
Source.426: DFBPPR8408 ---- Plant proteins ---- Profilin
Source.427: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.428: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.429: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.430: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.431: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.432: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.433: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.434: DFBPPR15967 ---- Animal proteins ---- Interleukin-4
Source.435: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.436: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.437: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor
Source.438: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.439: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.440: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.441: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.442: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.443: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.444: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.445: DFBPPR16067 ---- Animal proteins ---- CD40 ligand
Source.446: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.447: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.448: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.449: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.450: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.451: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.452: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.453: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.454: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.455: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.456: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.457: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.458: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.459: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.460: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.461: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.462: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.463: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.464: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.465: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.466: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.467: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.468: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.469: DFBPPR16328 ---- Animal proteins ---- Fibroblast growth factor 8
Source.470: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.471: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.472: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.473: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.474: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.475: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.476: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.477: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.478: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.479: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.480: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.481: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.482: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.483: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.484: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.485: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.486: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.487: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.488: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.489: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.490: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.491: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.492: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.493: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.494: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region
Source.495: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.496: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.497: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.498: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.499: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.500: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.501: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor
Source.502: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.503: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.504: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.505: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.506: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.507: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.508: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.509: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.510: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.511: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.512: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.513: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.514: DFBPPR17140 ---- Animal proteins ---- Adiponectin
Source.515: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.516: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.517: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.518: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial
Source.519: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.520: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.521: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.522: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.523: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.524: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.525: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.526: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.527: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.528: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.529: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.530: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.531: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.532: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.533: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.534: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.535: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.536: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.537: DFBPPR17441 ---- Animal proteins ---- DnaJ homolog subfamily C member 5
Source.538: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.539: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.540: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.541: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.542: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.543: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1
Source.544: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.545: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.546: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.547: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.548: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.549: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.550: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.551: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.552: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.553: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.554: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.555: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.556: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.557: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.558: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.559: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.560: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.561: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.562: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.563: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.564: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.565: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.566: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.567: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P
Source.568: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.569: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.570: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.571: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.572: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.573: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.574: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.575: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.576: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.577: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.578: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.579: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.580: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.581: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.582: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.583: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.584: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.585: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.586: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.587: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.588: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.589: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.590: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.591: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.592: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.593: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.594: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.595: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.596: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.597: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.598: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.599: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.600: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.601: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.602: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.603: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.604: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.605: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.606: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.607: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.608: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.609: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.610: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.611: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.612: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.613: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.614: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.615: DFBPPR18643 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.616: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.617: DFBPPR18703 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.618: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.619: DFBPPR18713 ---- Animal proteins ---- Arginase-1
Source.620: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.621: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.622: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.623: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.624: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.625: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.626: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.627: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.628: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.629: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.630: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.631: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.632: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.633: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.634: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.635: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.636: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.637: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.638: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.639: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.640: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.641: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1
Source.642: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.643: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.644: DFBPPR19037 ---- Animal proteins ---- Transthyretin
Source.645: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.646: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.647: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.648: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.649: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.650: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.651: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.652: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.653: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.654: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.655: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639
Source.656: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.657: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.658: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.659: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.660: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.661: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.662: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.663: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.664: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.665: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.666: DFBPPR19377 ---- Animal proteins ---- ER lumen protein-retaining receptor 2
Source.667: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.668: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.669: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.670: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.671: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.672: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.673: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.674: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.675: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.676: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.677: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.678: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.679: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.680: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.681: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.682: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.683: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.684: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.685: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.686: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.687: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.688: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.689: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.690: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.691: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.692: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.693: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.694: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.695: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.696: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.697: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.698: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.699: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.700: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B
Source.701: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.702: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.703: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.704: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer
Source.705: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.706: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.707: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.708: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1
Source.709: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1
Source.710: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.711: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.712: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.713: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.714: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma
Source.715: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.716: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.717: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.718: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.719: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.720: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3
Source.721: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan
Source.722: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.723: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.724: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.725: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.726: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.727: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.728: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.729: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.730: DFBPPR20461 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm8
Source.731: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.732: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.733: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.734: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.735: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2
Source.736: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.737: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1
Source.738: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.739: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.740: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.741: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.742: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.743: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3
Source.744: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.745: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.746: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.747: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.748: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.749: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.750: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.751: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.752: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.753: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14
Source.754: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.755: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.756: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.757: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.758: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.759: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.760: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.761: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.762: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.763: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.764: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.765: DFBPPR20927 ---- Animal proteins ---- ADP-ribosylation factor 4
Source.766: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.767: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.768: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.769: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.770: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.771: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.772: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.773: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.774: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.775: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.776: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.777: DFBPPR21087 ---- Animal proteins ---- Claudin-11
Source.778: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.779: DFBPPR21095 ---- Animal proteins ---- 28S ribosomal protein S33, mitochondrial
Source.780: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.781: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.782: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.783: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.784: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.785: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.786: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.787: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.788: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.789: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.790: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.791: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.792: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2
Source.793: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.794: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.795: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma
Source.796: DFBPPR21581 ---- Animal proteins ---- T-cell leukemia translocation-altered gene protein homolog
Source.797: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.798: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.799: DFBPPR21625 ---- Animal proteins ---- 40S ribosomal protein S24
Source.800: DFBPPR21668 ---- Animal proteins ---- Putative deoxyribonuclease TATDN1
Source.801: DFBPPR21676 ---- Animal proteins ---- ER membrane protein complex subunit 6
Source.802: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.803: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23
Source.804: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.805: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.806: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1
Source.807: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.808: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.809: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1
Source.810: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.811: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.812: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.813: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.814: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.815: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.816: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.817: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.818: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.819: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.820: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.821: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8
Source.822: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3
Source.823: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.824: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.825: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37
Source.826: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.827: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.828: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.829: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.830: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A
Source.831: DFBPPR22081 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.832: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.833: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.834: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.835: DFBPPR22138 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 7
Source.836: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.837: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1
Source.838: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.839: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.840: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.841: DFBPPR22200 ---- Animal proteins ---- Profilin-4
Source.842: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein
Source.843: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.844: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.845: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.846: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.847: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.848: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B
Source.849: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.850: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.851: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.852: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.853: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5
Source.854: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.855: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.856: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.857: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.858: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.859: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.860: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.861: DFBPPR22508 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 2
Source.862: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.863: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251
Source.864: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.865: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1
Source.866: DFBPPR22556 ---- Animal proteins ---- Protein maestro
Source.867: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89
Source.868: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.869: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.870: DFBPPR22710 ---- Animal proteins ---- RIIa domain-containing protein 1
Source.871: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog
Source.872: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.873: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.874: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.875: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.876: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.877: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.878: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.879: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.880: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.881: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.882: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.883: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.884: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.885: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.886: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.887: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.888: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.889: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor
Source.890: DFBPPR8699 ---- Animal proteins ---- ADP-ribosylation factor 6
Source.891: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.892: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.893: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.894: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.895: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9
Source.896: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.897: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.898: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.899: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.900: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.901: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.902: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.903: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.904: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.905: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.906: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.907: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.908: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.909: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.910: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.911: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.912: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.913: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.914: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.915: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.916: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.917: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.918: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.919: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.920: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.921: DFBPPR9116 ---- Animal proteins ---- Cathepsin B
Source.922: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.923: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.924: DFBPPR9171 ---- Animal proteins ---- Sorbin and SH3 domain-containing protein 2
Source.925: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.926: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.927: DFBPPR9188 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.928: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.929: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.930: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.931: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.932: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.933: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.934: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.935: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.936: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.937: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.938: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.939: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.940: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.941: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.942: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.943: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.944: DFBPPR9359 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.945: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.946: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.947: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.948: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.949: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.950: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.951: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain
Source.952: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.953: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.954: DFBPPR9561 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.955: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.956: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.957: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.958: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.959: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.960: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.961: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.962: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.963: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.964: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.965: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.966: DFBPPR9905 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.967: DFBPPR9939 ---- Animal proteins ---- Tctex1 domain-containing protein 4
Source.968: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251
Source.969: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.970: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.971: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.972: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.973: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.974: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.975: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.976: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.977: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.978: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.979: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.980: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.981: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.982: DFBPPR10105 ---- Animal proteins ---- ADP-ribosylation factor 6
Source.983: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.984: DFBPPR10110 ---- Animal proteins ---- ER lumen protein-retaining receptor 2
Source.985: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.986: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.987: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.988: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.989: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.990: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.991: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.992: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.993: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.994: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.995: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.996: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.997: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.998: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.999: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.1000: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.1001: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.1002: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.1003: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.1004: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.1005: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.1006: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.1007: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.1008: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1009: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.1010: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1011: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1012: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2
Source.1013: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.1014: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.1015: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.1016: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.1017: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.1018: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.1019: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1020: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.1021: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.1022: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.1023: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.1024: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1025: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.1026: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.1027: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.1028: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.1029: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.1030: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.1031: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor
Source.1032: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.1033: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.1034: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.1035: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.1036: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.1037: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.1038: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.1039: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.1040: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.1041: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.1042: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1043: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.1044: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.1045: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.1046: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.1047: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1048: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.1049: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.1050: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.1051: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.1052: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.1053: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.1054: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.1055: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.1056: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.1057: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.1058: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.1059: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.1060: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.1061: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.1062: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.1063: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.1064: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.1065: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.1066: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.1067: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.1068: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.1069: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1070: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.1071: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.1072: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1073: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.1074: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.1075: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.1076: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.1077: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1078: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.1079: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.1080: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1081: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.1082: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.1083: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.1084: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.1085: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.1086: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.1087: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.1088: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4
Source.1089: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.1090: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.1091: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.1092: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.1093: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.1094: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.1095: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.1096: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.1097: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1098: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.1099: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.1100: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.1101: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.1102: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.1103: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.1104: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.1105: DFBPPR11734 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.1106: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.1107: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.1108: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.1109: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5
Source.1110: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.1111: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein
Source.1112: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.1113: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.1114: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.1115: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.1116: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.1117: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.1118: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.1119: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.1120: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.1121: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1122: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.1123: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.1124: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.1125: DFBPPR12038 ---- Animal proteins ---- Scale keratin
Source.1126: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.1127: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.1128: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.1129: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.1130: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251
Source.1131: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.1132: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1133: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.1134: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1135: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor
Source.1136: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1137: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1138: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1139: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.1140: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.1141: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.1142: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.1143: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1144: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1145: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.1146: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1147: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.1148: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.1149: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.1150: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.1151: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.1152: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.1153: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.1154: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.1155: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1156: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1157: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.1158: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1159: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.1160: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.1161: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.1162: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.1163: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86
Source.1164: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.1165: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.1166: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.1167: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.1168: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.1169: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.1170: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.1171: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.1172: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1173: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.1174: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.1175: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.1176: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region
Source.1177: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.1178: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.1179: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1180: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1181: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.1182: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1183: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.1184: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.1185: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.1186: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.1187: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.1188: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.1189: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1190: DFBPPR13326 ---- Animal proteins ---- Interferon alpha-1
Source.1191: DFBPPR13328 ---- Animal proteins ---- Interferon alpha-2
Source.1192: DFBPPR13332 ---- Animal proteins ---- Interferon alpha-3
Source.1193: DFBPPR13333 ---- Animal proteins ---- Interferon alpha-4
Source.1194: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.1195: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1196: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.1197: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor
Source.1198: DFBPPR13455 ---- Animal proteins ---- Glutathione S-transferase P
Source.1199: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.1200: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.1201: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.1202: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor
Source.1203: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.1204: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.1205: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.1206: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.1207: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.1208: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.1209: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.1210: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.1211: DFBPPR13810 ---- Animal proteins ---- Transthyretin
Source.1212: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1213: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.1214: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1215: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.1216: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1217: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.1218: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.1219: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1220: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.1221: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.1222: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.1223: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.1224: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.1225: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.1226: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.1227: DFBPPR14325 ---- Marine protein ---- Uncharacterized protein ycf20
Source.1228: DFBPPR14327 ---- Marine protein ---- Allophycocyanin beta chain
Source.1229: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1230: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1231: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.1232: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.1233: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.1234: DFBPPR14524 ---- Marine protein ---- Uncharacterized protein ycf36
Source.1235: DFBPPR14529 ---- Marine protein ---- Uncharacterized protein ycf22
Source.1236: DFBPPR14533 ---- Marine protein ---- Uncharacterized protein ORF148
Source.1237: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.1238: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.1239: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.1240: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.1241: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.1242: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.1243: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.1244: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1245: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.1246: DFBPPR14755 ---- Marine protein ---- Techylectin-5A
Source.1247: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.1248: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.1249: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.1250: DFBPPR14875 ---- Marine protein ---- Probable pancreatic secretory proteinase inhibitor
Source.1251: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.1252: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.1253: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.1254: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.1255: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.1256: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.1257: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.1258: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.1259: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5
Source.1260: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.1261: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.1262: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.1263: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.1264: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.1265: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.1266: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.1267: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.1268: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.1269: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor
Source.1270: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.1271: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.1272: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.1273: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.1274: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.1275: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.1276: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.1277: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.1278: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.1279: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.1280: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.1281: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.1282: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2
Source.1283: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.1284: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.1285: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone
Source.1286: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.1287: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.1288: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.1289: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.1290: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.1291: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.1292: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.1293: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.1294: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.1295: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.1296: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial
Source.1297: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.1298: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter
Source.1299: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.1300: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.1301: DFBPPR15513 ---- Microorganism protein ---- Killer toxin subunit gamma
Source.1302: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.1303: DFBPPR15622 ---- Microorganism protein ---- Mitochondrial zinc maintenance protein 1, mitochondrial
Source.1304: DFBPPR15638 ---- Microorganism protein ---- ATP-dependent kinase YFH7
Source.1305: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2
Source.1306: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.1307: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.1308: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.1309: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase
Source.1310: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.1311: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.1312: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.1313: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.1314: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1
Source.1315: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.1316: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1317: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1318: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.1319: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1320: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1321: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.1322: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.1323: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1324: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.1325: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.1326: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.1327: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.1328: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.1329: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.1330: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.1331: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.1332: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1333: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.1334: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1335: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.1336: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1337: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1338: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1339: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.1340: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.1341: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.1342: DFBPPR8095 ---- Plant protein ---- Profilin-1
Source.1343: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.1344: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.1345: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.1346: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.1347: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.1348: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1349: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1350: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.1351: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1352: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1353: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1354: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.1355: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1356: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.1357: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.1358: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.1359: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antihypertensive activity

The peptide was a potential antihypertensive peptide (data not shown).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O
Preparation method
Mode of preparation Enzymatic hydrolysis
Enzyme(s)/starter culture

gastrointestinal enzyme (porcine gastric mucosa pepsin, bovine pancreas chymotrypsin, and bovine pancreas trypsin from Boehringer Mannheim)

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: No measured
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPACEI1136
[D2] DFBPREPE0004
[D3] DFBPMUFU0222
BIOPEP-UWM [D4] 2739, 9033
APD [D5] -
BioPepDB [D6] -
MBPDB [D7] -
Reference(s)
Primary literature Matsui T, Yukiyoshi A, Doi S, Sugimoto H, Yamada H, Matsumoto K. Gastrointestinal enzyme production of bioactive peptides from royal jelly protein and their antihypertensive ability in SHR. J Nutr Biochem. 2002 Feb;13(2):80-86.
PMID: 11834223
Other literature(s) N.D
PubDate 2002
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214