Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANHY0850(Antihypertensive peptide)

DFBP ID	DFBPANHY0850
Peptide sequence	LVE
Type	Native peptide
Peptide/Function name	Antihypertensive peptide

Function-activity relationship

Main bioactivity	Antihypertensive activity
Otheir bioactivity	ACE-inhibitory activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Leu-Val-Glu

Single-letter amino acid

LVE

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	359.42 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.34 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.5000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Short-necked clam (Tapes philippinarum)
Precursor protein	Short-necked clam powder hydrolysates
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.2: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.3: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.4: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.5: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.6: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.7: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71 Source.8: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.9: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.10: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.11: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.12: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.13: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1 Source.14: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1 Source.15: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.16: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.17: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase Source.18: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.19: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.20: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.21: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.22: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.23: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.24: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.25: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1 Source.26: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.27: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.28: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.29: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A Source.30: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5 Source.31: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.32: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.33: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.34: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.35: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic Source.36: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.37: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.38: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185 Source.39: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.40: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.41: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.42: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.43: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.44: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.45: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.46: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1 Source.47: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.48: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.49: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic Source.50: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.51: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.52: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.53: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.54: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.55: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.56: DFBPPR1050 ---- Plant proteins ---- Mitogen-activated protein kinase kinase 1 Source.57: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14 Source.58: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62 Source.59: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.60: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.61: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c Source.62: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.63: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.64: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.65: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.66: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.67: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.68: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic Source.69: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.70: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.71: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.72: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.73: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG Source.74: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.75: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.76: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.77: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13 Source.78: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.79: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.80: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13 Source.81: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.82: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.83: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.84: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.85: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.86: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.87: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic Source.88: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.89: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.90: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.91: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19 Source.92: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.93: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.94: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28 Source.95: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2 Source.96: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic Source.97: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic Source.98: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.99: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15 Source.100: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.101: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.102: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.103: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b Source.104: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6 Source.105: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.106: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.107: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.108: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.109: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.110: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.111: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1 Source.112: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.113: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.114: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.115: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.116: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.117: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.118: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1 Source.119: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.120: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.121: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.122: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.123: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.124: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.125: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.126: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B Source.127: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.128: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.129: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.130: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.131: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.132: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.133: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.134: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3 Source.135: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.136: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.137: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1 Source.138: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.139: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.140: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.141: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.142: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.143: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.144: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.145: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.146: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.147: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.148: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.149: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.150: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.151: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.152: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.153: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.154: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.155: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.156: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.157: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.158: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2 Source.159: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.160: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.161: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.162: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2 Source.163: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.164: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.165: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.166: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.167: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.168: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.169: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.170: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.171: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.172: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.173: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.174: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic Source.175: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.176: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.177: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1 Source.178: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal Source.179: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b Source.180: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.181: DFBPPR1682 ---- Plant proteins ---- Phytosulfokines 3 Source.182: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.183: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.184: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1 Source.185: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B Source.186: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.187: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.188: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.189: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.190: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.191: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.192: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.193: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.194: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.195: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.196: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.197: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1 Source.198: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.199: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.200: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.201: DFBPPR1796 ---- Plant proteins ---- Fibrillin protein 5 homolog Source.202: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.203: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4 Source.204: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.205: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.206: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1 Source.207: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.208: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4 Source.209: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.210: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.211: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.212: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.213: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.214: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.215: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.216: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2 Source.217: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.218: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.219: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.220: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.221: DFBPPR1912 ---- Plant proteins ---- Expansin-B3 Source.222: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.223: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.224: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.225: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.226: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.227: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.228: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.229: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.230: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.231: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.232: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.233: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.234: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.235: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12 Source.236: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38 Source.237: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.238: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.239: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b Source.240: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.241: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.242: DFBPPR2026 ---- Plant proteins ---- Proteasome subunit alpha type-5 Source.243: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.244: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.245: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5 Source.246: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.247: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.248: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.249: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.250: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3 Source.251: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.252: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.253: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.254: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7 Source.255: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.256: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.257: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.258: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.259: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.260: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.261: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.262: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.263: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.264: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.265: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.266: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.267: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.268: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.269: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.270: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.271: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.272: DFBPPR2146 ---- Plant proteins ---- Expansin-B4 Source.273: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial Source.274: DFBPPR2157 ---- Plant proteins ---- Expansin-B6 Source.275: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.276: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.277: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.278: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.279: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.280: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2 Source.281: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.282: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.283: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.284: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.285: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.286: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4 Source.287: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.288: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.289: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76 Source.290: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.291: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.292: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.293: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.294: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.295: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog Source.296: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.297: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.298: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS Source.299: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.300: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.301: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.302: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.303: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.304: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.305: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.306: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.307: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.308: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.309: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.310: DFBPPR2353 ---- Plant proteins ---- Expansin-B12 Source.311: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.312: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.313: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic Source.314: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.315: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.316: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.317: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100 Source.318: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10 Source.319: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.320: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5 Source.321: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6 Source.322: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.323: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.324: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B Source.325: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8 Source.326: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.327: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.328: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1 Source.329: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.330: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.331: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73 Source.332: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.333: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.334: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.335: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d Source.336: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.337: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.338: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.339: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.340: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic Source.341: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.342: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.343: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.344: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.345: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1 Source.346: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.347: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.348: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.349: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.350: DFBPPR2595 ---- Plant proteins ---- Expansin-B7 Source.351: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.352: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24 Source.353: DFBPPR2636 ---- Plant proteins ---- Expansin-B8 Source.354: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.355: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.356: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.357: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.358: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1 Source.359: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.360: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.361: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9 Source.362: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.363: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.364: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.365: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.366: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.367: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8 Source.368: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.369: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.370: DFBPPR2758 ---- Plant proteins ---- Expansin-B17 Source.371: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.372: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.373: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.374: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.375: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.376: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33 Source.377: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.378: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic Source.379: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.380: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.381: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic Source.382: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.383: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.384: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.385: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.386: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.387: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.388: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.389: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.390: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.391: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.392: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.393: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.394: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.395: DFBPPR2884 ---- Plant proteins ---- Expansin-B2 Source.396: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.397: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.398: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.399: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.400: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.401: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.402: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14 Source.403: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.404: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.405: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.406: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.407: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.408: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.409: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2 Source.410: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog Source.411: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.412: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4 Source.413: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.414: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit Source.415: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.416: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.417: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.418: DFBPPR3063 ---- Plant proteins ---- Profilin-A Source.419: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial Source.420: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.421: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.422: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.423: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.424: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.425: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.426: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.427: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1 Source.428: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial Source.429: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.430: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.431: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.432: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.433: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.434: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.435: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6 Source.436: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.437: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.438: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.439: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.440: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.441: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.442: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.443: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.444: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.445: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48 Source.446: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.447: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.448: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300 Source.449: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.450: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.451: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.452: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.453: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.454: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.455: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.456: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1 Source.457: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.458: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.459: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.460: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial Source.461: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400 Source.462: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2 Source.463: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.464: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.465: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26 Source.466: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.467: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1 Source.468: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7 Source.469: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.470: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.471: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic Source.472: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.473: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.474: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22 Source.475: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.476: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.477: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.478: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.479: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.480: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.481: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.482: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.483: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.484: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.485: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.486: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.487: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.488: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.489: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.490: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.491: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44 Source.492: DFBPPR3456 ---- Plant proteins ---- Maturase K Source.493: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.494: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.495: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73 Source.496: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600 Source.497: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.498: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3 Source.499: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.500: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6 Source.501: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.502: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.503: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1 Source.504: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.505: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2 Source.506: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.507: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.508: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.509: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.510: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.511: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.512: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.513: DFBPPR3593 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 1 Source.514: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3 Source.515: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.516: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.517: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.518: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1 Source.519: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a Source.520: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.521: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.522: DFBPPR3652 ---- Plant proteins ---- Nucleosome assembly protein 1;3 Source.523: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.524: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J Source.525: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10 Source.526: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic Source.527: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.528: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.529: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.530: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.531: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.532: DFBPPR3680 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.533: DFBPPR3687 ---- Plant proteins ---- Two-component response regulator ORR41 Source.534: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.535: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6 Source.536: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.537: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.538: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.539: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.540: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.541: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1 Source.542: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.543: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8 Source.544: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.545: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.546: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900 Source.547: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.548: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.549: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.550: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.551: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.552: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.553: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.554: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B Source.555: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.556: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.557: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.558: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.559: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit Source.560: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.561: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14 Source.562: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73 Source.563: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein Source.564: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.565: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.566: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.567: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.568: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1 Source.569: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.570: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.571: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4 Source.572: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.573: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6 Source.574: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit Source.575: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.576: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit Source.577: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.578: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.579: DFBPPR3958 ---- Plant proteins ---- Probable U6 snRNA-associated Sm-like protein LSm4 Source.580: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.581: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.582: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.583: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.584: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4 Source.585: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A Source.586: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.587: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.588: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2 Source.589: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.590: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.591: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.592: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.593: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.594: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.595: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.596: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.597: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.598: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.599: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.600: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.601: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B Source.602: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1 Source.603: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3 Source.604: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2 Source.605: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2 Source.606: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2 Source.607: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1 Source.608: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49 Source.609: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.610: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.611: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.612: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.613: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.614: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.615: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.616: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.617: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.618: DFBPPR4213 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim9 Source.619: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.620: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.621: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.622: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.623: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.624: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.625: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63 Source.626: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.627: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3 Source.628: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.629: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial Source.630: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.631: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.632: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.633: DFBPPR4294 ---- Plant proteins ---- Nucleosome assembly protein 1-like 4 Source.634: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.635: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.636: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.637: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.638: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.639: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.640: DFBPPR4364 ---- Plant proteins ---- Two-component response regulator ORR42 Source.641: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.642: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.643: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.644: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.645: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2 Source.646: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.647: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.648: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.649: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8 Source.650: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.651: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.652: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.653: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4 Source.654: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.655: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3 Source.656: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2 Source.657: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.658: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.659: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14 Source.660: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.661: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16 Source.662: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.663: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.664: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10 Source.665: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.666: DFBPPR4584 ---- Plant proteins ---- Probable calcium-binding protein CML29 Source.667: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.668: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.669: DFBPPR4605 ---- Plant proteins ---- Protein LOL4 Source.670: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3 Source.671: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1 Source.672: DFBPPR4646 ---- Plant proteins ---- 40S ribosomal protein S13-1 Source.673: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.674: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1 Source.675: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.676: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51 Source.677: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.678: DFBPPR4730 ---- Plant proteins ---- 40S ribosomal protein S13-2 Source.679: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.680: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400 Source.681: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.682: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.683: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.684: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20 Source.685: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.686: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a Source.687: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36 Source.688: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2 Source.689: DFBPPR4864 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0625400 Source.690: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.691: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1 Source.692: DFBPPR4871 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0242900 Source.693: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.694: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.695: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.696: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.697: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.698: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.699: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.700: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1 Source.701: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.702: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.703: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.704: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1 Source.705: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.706: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.707: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.708: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.709: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.710: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.711: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.712: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.713: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.714: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.715: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.716: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.717: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.718: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.719: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.720: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.721: DFBPPR5081 ---- Plant proteins ---- Proteasome subunit alpha type-5 Source.722: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.723: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.724: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.725: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.726: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase Source.727: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog Source.728: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.729: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.730: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7 Source.731: DFBPPR5127 ---- Plant proteins ---- Pathogenesis-related protein 10 Source.732: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.733: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2 Source.734: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.735: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.736: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.737: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.738: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.739: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6 Source.740: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum Source.741: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.742: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.743: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.744: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.745: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.746: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.747: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.748: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.749: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.750: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.751: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.752: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.753: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.754: DFBPPR5319 ---- Plant proteins ---- Nodulin-22 Source.755: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B Source.756: DFBPPR5338 ---- Plant proteins ---- 40S ribosomal protein S13 Source.757: DFBPPR5352 ---- Plant proteins ---- Nodulin-27 Source.758: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.759: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.760: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.761: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.762: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.763: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.764: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.765: DFBPPR5417 ---- Plant proteins ---- Profilin-3 Source.766: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit Source.767: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.768: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.769: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.770: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.771: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.772: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.773: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.774: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.775: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase Source.776: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1 Source.777: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.778: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.779: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.780: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.781: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10 Source.782: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.783: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.784: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.785: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3 Source.786: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.787: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.788: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.789: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10 Source.790: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.791: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.792: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6 Source.793: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic Source.794: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.795: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1 Source.796: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.797: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.798: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.799: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.800: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.801: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.802: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.803: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.804: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.805: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.806: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.807: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.808: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.809: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic Source.810: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.811: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.812: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.813: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.814: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.815: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.816: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.817: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.818: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1 Source.819: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.820: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.821: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.822: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.823: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.824: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.825: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.826: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.827: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.828: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase Source.829: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.830: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.831: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a Source.832: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.833: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.834: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.835: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.836: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.837: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.838: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.839: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.840: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.841: DFBPPR5864 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.842: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1 Source.843: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1 Source.844: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.845: DFBPPR5898 ---- Plant proteins ---- ATP synthase protein MI25 Source.846: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.847: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.848: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.849: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein Source.850: DFBPPR5975 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.851: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.852: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.853: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase Source.854: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.855: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1 Source.856: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.857: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8 Source.858: DFBPPR6133 ---- Plant proteins ---- 40S ribosomal protein S13 Source.859: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.860: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA Source.861: DFBPPR6185 ---- Plant proteins ---- Unknown protein from spot 415 of 2D-PAGE of etiolated coleoptile Source.862: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic Source.863: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.864: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.865: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.866: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.867: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.868: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.869: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.870: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.871: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.872: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.873: DFBPPR6310 ---- Plant proteins ---- Catalase Source.874: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.875: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.876: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.877: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5 Source.878: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.879: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.880: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.881: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.882: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.883: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.884: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.885: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.886: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.887: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.888: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.889: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.890: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.891: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.892: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.893: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.894: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.895: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.896: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic Source.897: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.898: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.899: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.900: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.901: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.902: DFBPPR6453 ---- Plant proteins ---- Convicilin Source.903: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.904: DFBPPR6458 ---- Plant proteins ---- Convicilin Source.905: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.906: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.907: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.908: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.909: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.910: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.911: DFBPPR6585 ---- Plant proteins ---- 40S ribosomal protein S13 Source.912: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34 Source.913: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.914: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.915: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.916: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase Source.917: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.918: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.919: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.920: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.921: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1 Source.922: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase Source.923: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.924: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.925: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.926: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.927: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.928: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.929: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.930: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.931: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.932: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z Source.933: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6 Source.934: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.935: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.936: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.937: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.938: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.939: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.940: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.941: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic Source.942: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.943: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.944: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta Source.945: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic Source.946: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic Source.947: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.948: DFBPPR6902 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.949: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant Source.950: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.951: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.952: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.953: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.954: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.955: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase Source.956: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.957: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.958: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.959: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.960: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6 Source.961: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.962: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.963: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.964: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.965: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.966: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3 Source.967: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9 Source.968: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.969: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.970: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.971: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.972: DFBPPR7207 ---- Plant proteins ---- Profilin-1 Source.973: DFBPPR7266 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.974: DFBPPR7277 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2B Source.975: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3 Source.976: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.977: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.978: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.979: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.980: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.981: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.982: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.983: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.984: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a Source.985: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic Source.986: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.987: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.988: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.989: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.990: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase Source.991: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.992: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta Source.993: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.994: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.995: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.996: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1 Source.997: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.998: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.999: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.1000: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit Source.1001: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.1002: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.1003: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.1004: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.1005: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.1006: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.1007: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.1008: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.1009: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.1010: DFBPPR7659 ---- Milk proteins ---- Glycosylation-dependent cell adhesion molecule 1 Source.1011: DFBPPR7691 ---- Milk proteins ---- Albumin Source.1012: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.1013: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.1014: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.1015: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.1016: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1017: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.1018: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.1019: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.1020: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.1021: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.1022: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2 Source.1023: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1024: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1025: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1026: DFBPPR8448 ---- Plant proteins ---- Maturase K Source.1027: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.1028: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.1029: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2 Source.1030: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor Source.1031: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.1032: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1033: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E Source.1034: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.1035: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1036: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.1037: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.1038: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.1039: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.1040: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.1041: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.1042: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1043: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.1044: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1045: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1046: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1047: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1048: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1049: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV Source.1050: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.1051: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1052: DFBPPR16028 ---- Animal proteins ---- Presenilin-1 Source.1053: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1054: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.1055: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.1056: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1057: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.1058: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1059: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.1060: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type Source.1061: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1062: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2 Source.1063: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1064: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1065: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO Source.1066: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.1067: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.1068: DFBPPR16116 ---- Animal proteins ---- Kit ligand Source.1069: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66 Source.1070: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1071: DFBPPR16148 ---- Animal proteins ---- Haptoglobin Source.1072: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.1073: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.1074: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.1075: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone Source.1076: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1077: DFBPPR16189 ---- Animal proteins ---- Albumin Source.1078: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1079: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.1080: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1081: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11 Source.1082: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.1083: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1084: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.1085: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1086: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2 Source.1087: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1088: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta Source.1089: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1090: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.1091: DFBPPR16279 ---- Animal proteins ---- Galactokinase Source.1092: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.1093: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.1094: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1095: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21 Source.1096: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1097: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1098: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41 Source.1099: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1100: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1101: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.1102: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1103: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1104: DFBPPR16435 ---- Animal proteins ---- S-arrestin Source.1105: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1106: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.1107: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1108: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1109: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1110: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.1111: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.1112: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal Source.1113: DFBPPR16526 ---- Animal proteins ---- Insulin Source.1114: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.1115: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1116: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1117: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1118: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1119: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.1120: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1121: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1 Source.1122: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.1123: DFBPPR16633 ---- Animal proteins ---- DnaJ homolog subfamily C member 1 Source.1124: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1125: DFBPPR16654 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 1 Source.1126: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein Source.1127: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.1128: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.1129: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1130: DFBPPR16722 ---- Animal proteins ---- Ig heavy chain V region MOO Source.1131: DFBPPR16723 ---- Animal proteins ---- Ig heavy chain V region GOM Source.1132: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase Source.1133: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A Source.1134: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.1135: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.1136: DFBPPR16797 ---- Animal proteins ---- Albumin Source.1137: DFBPPR16814 ---- Animal proteins ---- Prothrombin Source.1138: DFBPPR16827 ---- Animal proteins ---- S-arrestin Source.1139: DFBPPR16835 ---- Animal proteins ---- Insulin Source.1140: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1141: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain Source.1142: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.1143: DFBPPR16852 ---- Animal proteins ---- Cytochrome b Source.1144: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.1145: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial Source.1146: DFBPPR16863 ---- Animal proteins ---- Biglycan Source.1147: DFBPPR16865 ---- Animal proteins ---- Apolipoprotein E Source.1148: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1149: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.1150: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1151: DFBPPR16905 ---- Animal proteins ---- Fatty acid-binding protein 5 Source.1152: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.1153: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.1154: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1155: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1156: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.1157: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1158: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.1159: DFBPPR16947 ---- Animal proteins ---- Polyadenylate-binding protein 2 Source.1160: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.1161: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta Source.1162: DFBPPR16972 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-2 Source.1163: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1164: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1165: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1166: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.1167: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.1168: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.1169: DFBPPR17013 ---- Animal proteins ---- Presenilin-1 Source.1170: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1171: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2 Source.1172: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.1173: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.1174: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1175: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.1176: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1177: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.1178: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.1179: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1 Source.1180: DFBPPR17090 ---- Animal proteins ---- Phakinin Source.1181: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2 Source.1182: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1183: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.1184: DFBPPR17107 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma Source.1185: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.1186: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.1187: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.1188: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1189: DFBPPR17132 ---- Animal proteins ---- Apolipoprotein A-II Source.1190: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein Source.1191: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1192: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1193: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1194: DFBPPR17192 ---- Animal proteins ---- Kit ligand Source.1195: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1196: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1197: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.1198: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1199: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.1200: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.1201: DFBPPR17276 ---- Animal proteins ---- Synaptosomal-associated protein 25 Source.1202: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.1203: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.1204: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1205: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1206: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha Source.1207: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.1208: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.1209: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.1210: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.1211: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.1212: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1213: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.1214: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.1215: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.1216: DFBPPR17361 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2 Source.1217: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1 Source.1218: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.1219: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.1220: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial Source.1221: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1222: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.1223: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1 Source.1224: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.1225: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.1226: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1 Source.1227: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.1228: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1229: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.1230: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.1231: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.1232: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.1233: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.1234: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.1235: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1236: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.1237: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.1238: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.1239: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.1240: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.1241: DFBPPR17503 ---- Animal proteins ---- Syntaxin-1A Source.1242: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD Source.1243: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1244: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1 Source.1245: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2 Source.1246: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1247: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.1248: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.1249: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1 Source.1250: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.1251: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4 Source.1252: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1253: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta Source.1254: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.1255: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.1256: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1257: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1 Source.1258: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.1259: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1260: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1 Source.1261: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.1262: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1263: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.1264: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.1265: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1266: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1267: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.1268: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.1269: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.1270: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.1271: DFBPPR17795 ---- Animal proteins ---- Acyl-coenzyme A thioesterase THEM4 Source.1272: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.1273: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.1274: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1275: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1276: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.1277: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.1278: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.1279: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9 Source.1280: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.1281: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.1282: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.1283: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.1284: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1285: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.1286: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1287: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.1288: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.1289: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1290: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.1291: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1292: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.1293: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.1294: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.1295: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.1296: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.1297: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1298: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT Source.1299: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.1300: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38 Source.1301: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.1302: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.1303: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.1304: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.1305: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1306: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.1307: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.1308: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor Source.1309: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1310: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Source.1311: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.1312: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B Source.1313: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B Source.1314: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.1315: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2 Source.1316: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1317: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.1318: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8 Source.1319: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.1320: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.1321: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.1322: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1323: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.1324: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3 Source.1325: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.1326: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4 Source.1327: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1328: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.1329: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1 Source.1330: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.1331: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25 Source.1332: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.1333: DFBPPR18203 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-7 Source.1334: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1335: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4 Source.1336: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.1337: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.1338: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1339: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10 Source.1340: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.1341: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.1342: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.1343: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.1344: DFBPPR18281 ---- Animal proteins ---- CD63 antigen Source.1345: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1346: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.1347: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.1348: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.1349: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.1350: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.1351: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.1352: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase Source.1353: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.1354: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a Source.1355: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.1356: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1 Source.1357: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog Source.1358: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B Source.1359: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1360: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1361: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1362: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1363: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.1364: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5 Source.1365: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.1366: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.1367: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial Source.1368: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.1369: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.1370: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.1371: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1372: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.1373: DFBPPR18434 ---- Animal proteins ---- Interferon beta-3 Source.1374: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.1375: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.1376: DFBPPR18470 ---- Animal proteins ---- Perilipin-5 Source.1377: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.1378: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.1379: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1 Source.1380: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.1381: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.1382: DFBPPR18516 ---- Animal proteins ---- Galactokinase Source.1383: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1 Source.1384: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.1385: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.1386: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.1387: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.1388: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1 Source.1389: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial Source.1390: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2 Source.1391: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1392: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1393: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.1394: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.1395: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.1396: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.1397: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.1398: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha Source.1399: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.1400: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.1401: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1402: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6 Source.1403: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor Source.1404: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1405: DFBPPR18728 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5 Source.1406: DFBPPR18732 ---- Animal proteins ---- RNA-binding protein 8A Source.1407: DFBPPR18734 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF114 Source.1408: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.1409: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.1410: DFBPPR18746 ---- Animal proteins ---- Anamorsin Source.1411: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1412: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.1413: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.1414: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.1415: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone Source.1416: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.1417: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.1418: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.1419: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8 Source.1420: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.1421: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.1422: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1423: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1424: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1 Source.1425: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma Source.1426: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.1427: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1428: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3 Source.1429: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D Source.1430: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor Source.1431: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.1432: DFBPPR18868 ---- Animal proteins ---- Haptoglobin Source.1433: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1434: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1435: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4 Source.1436: DFBPPR18898 ---- Animal proteins ---- Complexin-3 Source.1437: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.1438: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.1439: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11 Source.1440: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.1441: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.1442: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.1443: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.1444: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein Source.1445: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.1446: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.1447: DFBPPR18952 ---- Animal proteins ---- Serotransferrin Source.1448: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1449: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog Source.1450: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.1451: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb Source.1452: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.1453: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.1454: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.1455: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6 Source.1456: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.1457: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog Source.1458: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74 Source.1459: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19 Source.1460: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.1461: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial Source.1462: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog Source.1463: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1464: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.1465: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.1466: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11 Source.1467: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.1468: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.1469: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.1470: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5 Source.1471: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.1472: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.1473: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.1474: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.1475: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.1476: DFBPPR19124 ---- Animal proteins ---- Neuroguidin Source.1477: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1 Source.1478: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.1479: DFBPPR19165 ---- Animal proteins ---- Tropomyosin beta chain Source.1480: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.1481: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3 Source.1482: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.1483: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1484: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.1485: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.1486: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.1487: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1 Source.1488: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1489: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B Source.1490: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.1491: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.1492: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Source.1493: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase Source.1494: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.1495: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog Source.1496: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B Source.1497: DFBPPR19253 ---- Animal proteins ---- Limbin Source.1498: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1499: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like Source.1500: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.1501: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4 Source.1502: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic Source.1503: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D Source.1504: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.1505: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1 Source.1506: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.1507: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.1508: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1509: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.1510: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog Source.1511: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1512: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.1513: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A Source.1514: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.1515: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.1516: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19 Source.1517: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1 Source.1518: DFBPPR19429 ---- Animal proteins ---- Protein Spindly Source.1519: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.1520: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1521: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1 Source.1522: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial Source.1523: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase Source.1524: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.1525: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.1526: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.1527: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.1528: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.1529: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1530: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain Source.1531: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1532: DFBPPR19484 ---- Animal proteins ---- Protein lin-7 homolog B Source.1533: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.1534: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.1535: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1536: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.1537: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.1538: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1539: DFBPPR19520 ---- Animal proteins ---- Ferritin light chain Source.1540: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.1541: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A Source.1542: DFBPPR19530 ---- Animal proteins ---- Tuftelin Source.1543: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase Source.1544: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.1545: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.1546: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2 Source.1547: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.1548: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.1549: DFBPPR19592 ---- Animal proteins ---- Ras-related protein Rab-18 Source.1550: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.1551: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1552: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.1553: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.1554: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1555: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.1556: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.1557: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.1558: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial Source.1559: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2 Source.1560: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1561: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1562: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1 Source.1563: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.1564: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.1565: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.1566: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1 Source.1567: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase Source.1568: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1 Source.1569: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.1570: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain Source.1571: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit Source.1572: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.1573: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2 Source.1574: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Source.1575: DFBPPR19807 ---- Animal proteins ---- Spermine synthase Source.1576: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2 Source.1577: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2 Source.1578: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.1579: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30 Source.1580: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1581: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.1582: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase Source.1583: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.1584: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.1585: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8 Source.1586: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1 Source.1587: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27 Source.1588: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial Source.1589: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.1590: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.1591: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.1592: DFBPPR19935 ---- Animal proteins ---- Reticulon-3 Source.1593: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.1594: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.1595: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.1596: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2 Source.1597: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.1598: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.1599: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3 Source.1600: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.1601: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12 Source.1602: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2 Source.1603: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7 Source.1604: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2 Source.1605: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.1606: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26 Source.1607: DFBPPR20072 ---- Animal proteins ---- Adenine phosphoribosyltransferase Source.1608: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.1609: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B Source.1610: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial Source.1611: DFBPPR20139 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm4 Source.1612: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C Source.1613: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.1614: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1615: DFBPPR20188 ---- Animal proteins ---- Protein S100-A16 Source.1616: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1617: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial Source.1618: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B Source.1619: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1620: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.1621: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1 Source.1622: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1623: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial Source.1624: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor Source.1625: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2 Source.1626: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A Source.1627: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.1628: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.1629: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like Source.1630: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.1631: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.1632: DFBPPR20305 ---- Animal proteins ---- Nostrin Source.1633: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.1634: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1635: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.1636: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial Source.1637: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1 Source.1638: DFBPPR20350 ---- Animal proteins ---- Pinin Source.1639: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.1640: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.1641: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4 Source.1642: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1 Source.1643: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1644: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.1645: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial Source.1646: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.1647: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.1648: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2 Source.1649: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1 Source.1650: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.1651: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5 Source.1652: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.1653: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2 Source.1654: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54 Source.1655: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.1656: DFBPPR20497 ---- Animal proteins ---- Serine/Arginine-related protein 53 Source.1657: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29 Source.1658: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.1659: DFBPPR20529 ---- Animal proteins ---- Transgelin Source.1660: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog Source.1661: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.1662: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.1663: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.1664: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.1665: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.1666: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta Source.1667: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.1668: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.1669: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.1670: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.1671: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.1672: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.1673: DFBPPR20645 ---- Animal proteins ---- Eukaryotic translation initiation factor 1 Source.1674: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial Source.1675: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.1676: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.1677: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease Source.1678: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14 Source.1679: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.1680: DFBPPR20690 ---- Animal proteins ---- Neurotrimin Source.1681: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.1682: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.1683: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2 Source.1684: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10 Source.1685: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.1686: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta Source.1687: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.1688: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21 Source.1689: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12 Source.1690: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.1691: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5 Source.1692: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1693: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.1694: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial Source.1695: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.1696: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1697: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.1698: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.1699: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12 Source.1700: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.1701: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.1702: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.1703: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.1704: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135 Source.1705: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta Source.1706: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.1707: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A Source.1708: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.1709: DFBPPR20898 ---- Animal proteins ---- Transaldolase Source.1710: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1 Source.1711: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.1712: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.1713: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1 Source.1714: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.1715: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.1716: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.1717: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1 Source.1718: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11 Source.1719: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1720: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1721: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial Source.1722: DFBPPR20996 ---- Animal proteins ---- Tripartite motif-containing protein 44 Source.1723: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2 Source.1724: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B Source.1725: DFBPPR21013 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit D Source.1726: DFBPPR21019 ---- Animal proteins ---- Thioredoxin domain-containing protein 9 Source.1727: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.1728: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.1729: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D Source.1730: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.1731: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.1732: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog Source.1733: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.1734: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22 Source.1735: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7 Source.1736: DFBPPR21083 ---- Animal proteins ---- TRAF-interacting protein with FHA domain-containing protein A Source.1737: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.1738: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2 Source.1739: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1740: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.1741: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.1742: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel Source.1743: DFBPPR21165 ---- Animal proteins ---- Protein canopy homolog 3 Source.1744: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A Source.1745: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.1746: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1 Source.1747: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2 Source.1748: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome Source.1749: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1 Source.1750: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36 Source.1751: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5 Source.1752: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B Source.1753: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.1754: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.1755: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.1756: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial Source.1757: DFBPPR21293 ---- Animal proteins ---- IST1 homolog Source.1758: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.1759: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D Source.1760: DFBPPR21303 ---- Animal proteins ---- Palmdelphin Source.1761: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.1762: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.1763: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34 Source.1764: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4 Source.1765: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9 Source.1766: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204 Source.1767: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.1768: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18 Source.1769: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2 Source.1770: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.1771: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial Source.1772: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1 Source.1773: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2 Source.1774: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.1775: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog Source.1776: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.1777: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2 Source.1778: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.1779: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.1780: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2 Source.1781: DFBPPR21439 ---- Animal proteins ---- Mapk-regulated corepressor-interacting protein 1 Source.1782: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2 Source.1783: DFBPPR21450 ---- Animal proteins ---- Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1 Source.1784: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.1785: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.1786: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18 Source.1787: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2 Source.1788: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.1789: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3 Source.1790: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3 Source.1791: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1 Source.1792: DFBPPR21535 ---- Animal proteins ---- Gastrotropin Source.1793: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.1794: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.1795: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1 Source.1796: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.1797: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.1798: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10 Source.1799: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.1800: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.1801: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2 Source.1802: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.1803: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a Source.1804: DFBPPR21650 ---- Animal proteins ---- Synaptonemal complex central element protein 1 Source.1805: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial Source.1806: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8 Source.1807: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.1808: DFBPPR21667 ---- Animal proteins ---- Four and a half LIM domains protein 5 Source.1809: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2 Source.1810: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11 Source.1811: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18 Source.1812: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog Source.1813: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.1814: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7 Source.1815: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.1816: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog Source.1817: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1818: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.1819: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.1820: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410 Source.1821: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier Source.1822: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein Source.1823: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17 Source.1824: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.1825: DFBPPR21867 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5 Source.1826: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein Source.1827: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113 Source.1828: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2 Source.1829: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1 Source.1830: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.1831: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.1832: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.1833: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.1834: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.1835: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.1836: DFBPPR21977 ---- Animal proteins ---- Protein ARV1 Source.1837: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2 Source.1838: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.1839: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1 Source.1840: DFBPPR22011 ---- Animal proteins ---- 40S ribosomal protein S12 Source.1841: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein Source.1842: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.1843: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.1844: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1 Source.1845: DFBPPR22031 ---- Animal proteins ---- KxDL motif-containing protein 1 Source.1846: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2 Source.1847: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase Source.1848: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.1849: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein Source.1850: DFBPPR22068 ---- Animal proteins ---- Protein GPR108 Source.1851: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.1852: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6 Source.1853: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572 Source.1854: DFBPPR22130 ---- Animal proteins ---- 60S ribosomal protein L9 Source.1855: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48 Source.1856: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.1857: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1 Source.1858: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1 Source.1859: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.1860: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial Source.1861: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.1862: DFBPPR22218 ---- Animal proteins ---- Galectin-4 Source.1863: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.1864: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3 Source.1865: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.1866: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300 Source.1867: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.1868: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.1869: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.1870: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2 Source.1871: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.1872: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1 Source.1873: DFBPPR22307 ---- Animal proteins ---- MORF4 family-associated protein 1 Source.1874: DFBPPR22319 ---- Animal proteins ---- Regulator of G-protein signaling 5 Source.1875: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B Source.1876: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.1877: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1 Source.1878: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.1879: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.1880: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63 Source.1881: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11 Source.1882: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.1883: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2 Source.1884: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1 Source.1885: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86 Source.1886: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2 Source.1887: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10 Source.1888: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3 Source.1889: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9 Source.1890: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.1891: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein Source.1892: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein Source.1893: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11 Source.1894: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B Source.1895: DFBPPR22466 ---- Animal proteins ---- Transcription factor BTF3 homolog 4 Source.1896: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.1897: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1 Source.1898: DFBPPR22490 ---- Animal proteins ---- Costars family protein ABRACL Source.1899: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15 Source.1900: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169 Source.1901: DFBPPR22532 ---- Animal proteins ---- Cilia- and flagella-associated protein 299 Source.1902: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1 Source.1903: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.1904: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A Source.1905: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.1906: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B Source.1907: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1 Source.1908: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1 Source.1909: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175 Source.1910: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157 Source.1911: DFBPPR22646 ---- Animal proteins ---- Coiled-coil domain-containing protein 184 Source.1912: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein Source.1913: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D Source.1914: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog Source.1915: DFBPPR22682 ---- Animal proteins ---- Protein FAM216A Source.1916: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28 Source.1917: DFBPPR22715 ---- Animal proteins ---- Spermatogenesis-associated protein 45 Source.1918: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11 Source.1919: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1920: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1921: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.1922: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.1923: DFBPPR8546 ---- Animal proteins ---- Insulin Source.1924: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N Source.1925: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.1926: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial Source.1927: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1928: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.1929: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.1930: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.1931: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.1932: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.1933: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1 Source.1934: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1935: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1936: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.1937: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.1938: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1939: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1940: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.1941: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.1942: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.1943: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1944: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.1945: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1946: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.1947: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C Source.1948: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1949: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1950: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.1951: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1952: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.1953: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1954: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1955: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone Source.1956: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.1957: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.1958: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1959: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E Source.1960: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1961: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5 Source.1962: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.1963: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.1964: DFBPPR8860 ---- Animal proteins ---- Nucleoside diphosphate kinase B Source.1965: DFBPPR8866 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma Source.1966: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1967: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.1968: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.1969: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.1970: DFBPPR8897 ---- Animal proteins ---- Cytochrome b Source.1971: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.1972: DFBPPR8939 ---- Animal proteins ---- Kit ligand Source.1973: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1974: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.1975: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B Source.1976: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1977: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1978: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.1979: DFBPPR9015 ---- Animal proteins ---- Serotransferrin Source.1980: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1981: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.1982: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1983: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.1984: DFBPPR9033 ---- Animal proteins ---- Interleukin-2 Source.1985: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.1986: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.1987: DFBPPR9044 ---- Animal proteins ---- Albumin Source.1988: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3 Source.1989: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.1990: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.1991: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.1992: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase Source.1993: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.1994: DFBPPR9098 ---- Animal proteins ---- Gastrotropin Source.1995: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32 Source.1996: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase Source.1997: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.1998: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1999: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2000: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase Source.2001: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2002: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2003: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.2004: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.2005: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.2006: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.2007: DFBPPR9154 ---- Animal proteins ---- Interleukin-6 Source.2008: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2009: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2010: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2011: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase Source.2012: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase Source.2013: DFBPPR9173 ---- Animal proteins ---- Neurotrophin-3 Source.2014: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10 Source.2015: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase Source.2016: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.2017: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.2018: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.2019: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.2020: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.2021: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.2022: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.2023: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.2024: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1 Source.2025: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2026: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1 Source.2027: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.2028: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.2029: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2030: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.2031: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.2032: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.2033: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2034: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon Source.2035: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.2036: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.2037: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2038: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.2039: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.2040: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.2041: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.2042: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2043: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.2044: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE Source.2045: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2046: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.2047: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.2048: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.2049: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.2050: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2051: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.2052: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog Source.2053: DFBPPR9671 ---- Animal proteins ---- S-arrestin Source.2054: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1 Source.2055: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain Source.2056: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2057: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2058: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain Source.2059: DFBPPR9751 ---- Animal proteins ---- Perilipin-3 Source.2060: DFBPPR9768 ---- Animal proteins ---- Protein canopy homolog 3 Source.2061: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8 Source.2062: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2 Source.2063: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2064: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain Source.2065: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.2066: DFBPPR9858 ---- Animal proteins ---- Transaldolase Source.2067: DFBPPR9895 ---- Animal proteins ---- 40S ribosomal protein S12 Source.2068: DFBPPR9899 ---- Animal proteins ---- D-xylulose reductase Source.2069: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2 Source.2070: DFBPPR9926 ---- Animal proteins ---- 60S ribosomal protein L7a Source.2071: DFBPPR9932 ---- Animal proteins ---- Regulator of G-protein signaling 5 Source.2072: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.2073: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.2074: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2075: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin Source.2076: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput Source.2077: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.2078: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2079: DFBPPR10003 ---- Animal proteins ---- Progonadoliberin-1 Source.2080: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.2081: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.2082: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.2083: DFBPPR10045 ---- Animal proteins ---- Albumin Source.2084: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.2085: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.2086: DFBPPR10053 ---- Animal proteins ---- Synaptosomal-associated protein 25 Source.2087: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.2088: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.2089: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.2090: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2091: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.2092: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.2093: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.2094: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.2095: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.2096: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.2097: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1 Source.2098: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.2099: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein Source.2100: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.2101: DFBPPR10139 ---- Animal proteins ---- Cytochrome b Source.2102: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.2103: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.2104: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.2105: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor Source.2106: DFBPPR10163 ---- Animal proteins ---- Annexin A6 Source.2107: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.2108: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.2109: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.2110: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1 Source.2111: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2112: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.2113: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.2114: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A Source.2115: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.2116: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.2117: DFBPPR10219 ---- Animal proteins ---- Presenilin-1 Source.2118: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.2119: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.2120: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1 Source.2121: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.2122: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.2123: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.2124: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.2125: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2 Source.2126: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1 Source.2127: DFBPPR10270 ---- Animal proteins ---- Agrin Source.2128: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2129: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.2130: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2131: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.2132: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.2133: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.2134: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.2135: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.2136: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.2137: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1 Source.2138: DFBPPR10320 ---- Animal proteins ---- Insulin Source.2139: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2140: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1 Source.2141: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK Source.2142: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.2143: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.2144: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.2145: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.2146: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.2147: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.2148: DFBPPR10391 ---- Animal proteins ---- Annexin A5 Source.2149: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.2150: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.2151: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.2152: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.2153: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2154: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.2155: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.2156: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.2157: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.2158: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.2159: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.2160: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2161: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.2162: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.2163: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.2164: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.2165: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.2166: DFBPPR10459 ---- Animal proteins ---- Reelin Source.2167: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.2168: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.2169: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.2170: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.2171: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2 Source.2172: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.2173: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor Source.2174: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.2175: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.2176: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2177: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.2178: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.2179: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.2180: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.2181: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.2182: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.2183: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.2184: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.2185: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.2186: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.2187: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.2188: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.2189: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.2190: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.2191: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.2192: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.2193: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.2194: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.2195: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.2196: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein Source.2197: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.2198: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.2199: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.2200: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.2201: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.2202: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.2203: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.2204: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3 Source.2205: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.2206: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.2207: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.2208: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.2209: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.2210: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.2211: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.2212: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.2213: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.2214: DFBPPR10715 ---- Animal proteins ---- Lumican Source.2215: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.2216: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor Source.2217: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1 Source.2218: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2219: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.2220: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.2221: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2 Source.2222: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.2223: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1 Source.2224: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.2225: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.2226: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.2227: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.2228: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.2229: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2230: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Source.2231: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.2232: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.2233: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.2234: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1 Source.2235: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.2236: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.2237: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.2238: DFBPPR10865 ---- Animal proteins ---- Transgelin Source.2239: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.2240: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.2241: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha Source.2242: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.2243: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.2244: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1 Source.2245: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.2246: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2247: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.2248: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.2249: DFBPPR10964 ---- Animal proteins ---- Protein artemis Source.2250: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.2251: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.2252: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.2253: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.2254: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.2255: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.2256: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2257: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.2258: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.2259: DFBPPR11000 ---- Animal proteins ---- Tropomyosin beta chain Source.2260: DFBPPR11007 ---- Animal proteins ---- Anamorsin Source.2261: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1 Source.2262: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.2263: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.2264: DFBPPR11027 ---- Animal proteins ---- Ras-related protein Rab-18 Source.2265: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.2266: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.2267: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.2268: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.2269: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.2270: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2 Source.2271: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.2272: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.2273: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.2274: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.2275: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin Source.2276: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5 Source.2277: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.2278: DFBPPR11118 ---- Animal proteins ---- Filensin Source.2279: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.2280: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.2281: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.2282: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.2283: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.2284: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.2285: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.2286: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.2287: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha Source.2288: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1 Source.2289: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.2290: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2 Source.2291: DFBPPR11256 ---- Animal proteins ---- Neuroblastoma suppressor of tumorigenicity 1 Source.2292: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.2293: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B Source.2294: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.2295: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin Source.2296: DFBPPR11283 ---- Animal proteins ---- Centromere protein U Source.2297: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.2298: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.2299: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.2300: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.2301: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.2302: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.2303: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.2304: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.2305: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog Source.2306: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2 Source.2307: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.2308: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.2309: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.2310: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1 Source.2311: DFBPPR11376 ---- Animal proteins ---- Lamin-A Source.2312: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.2313: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.2314: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.2315: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.2316: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial Source.2317: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.2318: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.2319: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1 Source.2320: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.2321: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.2322: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase Source.2323: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.2324: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.2325: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.2326: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.2327: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2 Source.2328: DFBPPR11557 ---- Animal proteins ---- Regulator of G-protein signaling 17 Source.2329: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.2330: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.2331: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.2332: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.2333: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.2334: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.2335: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2336: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.2337: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.2338: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.2339: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.2340: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.2341: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2342: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.2343: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2 Source.2344: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2345: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.2346: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.2347: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2348: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.2349: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.2350: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor Source.2351: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.2352: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.2353: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.2354: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.2355: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1 Source.2356: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B Source.2357: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3 Source.2358: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.2359: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3 Source.2360: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5 Source.2361: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.2362: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.2363: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2364: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2365: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.2366: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.2367: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.2368: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2 Source.2369: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.2370: DFBPPR11865 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.2371: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5 Source.2372: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.2373: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.2374: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.2375: DFBPPR11895 ---- Animal proteins ---- 40S ribosomal protein S12 Source.2376: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3 Source.2377: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.2378: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.2379: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.2380: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2 Source.2381: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.2382: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.2383: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.2384: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.2385: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.2386: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog Source.2387: DFBPPR11999 ---- Animal proteins ---- Dymeclin Source.2388: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal Source.2389: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.2390: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.2391: DFBPPR12042 ---- Animal proteins ---- Mapk-regulated corepressor-interacting protein 1 Source.2392: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.2393: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.2394: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.2395: DFBPPR12077 ---- Animal proteins ---- Eukaryotic translation initiation factor 1 Source.2396: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129 Source.2397: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121 Source.2398: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.2399: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.2400: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.2401: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.2402: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.2403: DFBPPR12129 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial Source.2404: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.2405: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.2406: DFBPPR12142 ---- Animal proteins ---- FGFR1 oncogene partner 2 homolog Source.2407: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like Source.2408: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.2409: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a Source.2410: DFBPPR12162 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2 Source.2411: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3 Source.2412: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.2413: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10 Source.2414: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180 Source.2415: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.2416: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2 Source.2417: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.2418: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2419: DFBPPR12251 ---- Animal proteins ---- Serotransferrin Source.2420: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1 Source.2421: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2422: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1 Source.2423: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin Source.2424: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.2425: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2426: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2427: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2428: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.2429: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1 Source.2430: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2431: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.2432: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2433: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.2434: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.2435: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.2436: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.2437: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.2438: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.2439: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E Source.2440: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2441: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2442: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.2443: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.2444: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.2445: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.2446: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.2447: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.2448: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.2449: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2450: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2451: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase Source.2452: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.2453: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.2454: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.2455: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.2456: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.2457: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4 Source.2458: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.2459: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2460: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.2461: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.2462: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.2463: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2464: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.2465: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.2466: DFBPPR12471 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.2467: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.2468: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.2469: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.2470: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4 Source.2471: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.2472: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.2473: DFBPPR12536 ---- Animal proteins ---- Albumin Source.2474: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.2475: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2476: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.2477: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.2478: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.2479: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.2480: DFBPPR12575 ---- Animal proteins ---- CD63 antigen Source.2481: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.2482: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.2483: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1 Source.2484: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2485: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.2486: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.2487: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.2488: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.2489: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.2490: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2 Source.2491: DFBPPR12642 ---- Animal proteins ---- Haptoglobin Source.2492: DFBPPR12643 ---- Animal proteins ---- Haptoglobin Source.2493: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5 Source.2494: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2495: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.2496: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.2497: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5 Source.2498: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase Source.2499: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.2500: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2501: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.2502: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.2503: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.2504: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I Source.2505: DFBPPR12728 ---- Animal proteins ---- Cytochrome b Source.2506: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2507: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.2508: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.2509: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1 Source.2510: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.2511: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3 Source.2512: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.2513: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial Source.2514: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin Source.2515: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.2516: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.2517: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.2518: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.2519: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.2520: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15 Source.2521: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.2522: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc Source.2523: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase Source.2524: DFBPPR12832 ---- Animal proteins ---- Secretin receptor Source.2525: DFBPPR12833 ---- Animal proteins ---- Cullin-5 Source.2526: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.2527: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.2528: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain Source.2529: DFBPPR12853 ---- Animal proteins ---- Insulin Source.2530: DFBPPR12868 ---- Animal proteins ---- Synaptosomal-associated protein 25 Source.2531: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.2532: DFBPPR12871 ---- Animal proteins ---- Tropomyosin beta chain Source.2533: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2 Source.2534: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial Source.2535: DFBPPR12935 ---- Animal proteins ---- Histone H1.3 Source.2536: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.2537: DFBPPR12939 ---- Animal proteins ---- Gastrotropin Source.2538: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.2539: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein Source.2540: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.2541: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.2542: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.2543: DFBPPR13001 ---- Animal proteins ---- Annexin A6 Source.2544: DFBPPR13017 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.2545: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.2546: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1 Source.2547: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2548: DFBPPR13030 ---- Animal proteins ---- T-cell surface glycoprotein CD1b Source.2549: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D Source.2550: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2551: DFBPPR13097 ---- Animal proteins ---- Lumican Source.2552: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2 Source.2553: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.2554: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2555: DFBPPR13149 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.2556: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2557: DFBPPR13153 ---- Animal proteins ---- Interleukin-18 Source.2558: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2559: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.2560: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.2561: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.2562: DFBPPR13195 ---- Animal proteins ---- Albumin Source.2563: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2564: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.2565: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6 Source.2566: DFBPPR13219 ---- Animal proteins ---- Kit ligand Source.2567: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.2568: DFBPPR13267 ---- Animal proteins ---- Interferon beta Source.2569: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.2570: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.2571: DFBPPR13305 ---- Animal proteins ---- Cytochrome b Source.2572: DFBPPR13306 ---- Animal proteins ---- Tropomyosin alpha-4 chain Source.2573: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2574: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter Source.2575: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2576: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2577: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2578: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.2579: DFBPPR13362 ---- Animal proteins ---- Biglycan Source.2580: DFBPPR13383 ---- Animal proteins ---- Insulin Source.2581: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2582: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.2583: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2584: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.2585: DFBPPR13443 ---- Animal proteins ---- Kit ligand Source.2586: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.2587: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.2588: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2589: DFBPPR13514 ---- Animal proteins ---- Insulin Source.2590: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2591: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.2592: DFBPPR13538 ---- Animal proteins ---- Apolipoprotein E Source.2593: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2594: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36 Source.2595: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.2596: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.2597: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2598: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.2599: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2600: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2601: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.2602: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.2603: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6 Source.2604: DFBPPR13665 ---- Animal proteins ---- Kit ligand Source.2605: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2606: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.2607: DFBPPR13722 ---- Animal proteins ---- Insulin Source.2608: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2609: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.2610: DFBPPR13734 ---- Animal proteins ---- Perilipin-5 Source.2611: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2612: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2613: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2614: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.2615: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B Source.2616: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.2617: DFBPPR13788 ---- Animal proteins ---- Albumin Source.2618: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1 Source.2619: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2620: DFBPPR13834 ---- Animal proteins ---- Biglycan Source.2621: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.2622: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5 Source.2623: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2624: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.2625: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor Source.2626: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.2627: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2628: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.2629: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.2630: DFBPPR13926 ---- Animal proteins ---- Ferritin light chain Source.2631: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2632: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.2633: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.2634: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2 Source.2635: DFBPPR13958 ---- Animal proteins ---- Homeobox protein Hox-D3 Source.2636: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.2637: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.2638: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.2639: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1 Source.2640: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2 Source.2641: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.2642: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha Source.2643: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.2644: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.2645: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1 Source.2646: DFBPPR14123 ---- Marine protein ---- Albumin 1 Source.2647: DFBPPR14124 ---- Marine protein ---- Albumin 2 Source.2648: DFBPPR14127 ---- Marine protein ---- RNA-binding protein 8A Source.2649: DFBPPR14133 ---- Marine protein ---- Calumenin-B Source.2650: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6 Source.2651: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1 Source.2652: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4 Source.2653: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog Source.2654: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein Source.2655: DFBPPR14217 ---- Marine protein ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.2656: DFBPPR14298 ---- Marine protein ---- Acetolactate synthase small subunit Source.2657: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.2658: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.2659: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.2660: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta' Source.2661: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.2662: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.2663: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.2664: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.2665: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.2666: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.2667: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein Source.2668: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic Source.2669: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic Source.2670: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.2671: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.2672: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.2673: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29 Source.2674: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic Source.2675: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.2676: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.2677: DFBPPR14530 ---- Marine protein ---- Uncharacterized protein ycf34 Source.2678: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.2679: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor Source.2680: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.2681: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.2682: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1 Source.2683: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.2684: DFBPPR14592 ---- Marine protein ---- Intelectin Source.2685: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2 Source.2686: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha Source.2687: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.2688: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.2689: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase Source.2690: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein Source.2691: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.2692: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme Source.2693: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3 Source.2694: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4 Source.2695: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.2696: DFBPPR14775 ---- Marine protein ---- Troponin C Source.2697: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.2698: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.2699: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2700: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.2701: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.2702: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1 Source.2703: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.2704: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.2705: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.2706: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.2707: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.2708: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2709: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.2710: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase Source.2711: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial Source.2712: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.2713: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.2714: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1 Source.2715: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.2716: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.2717: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.2718: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1 Source.2719: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.2720: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.2721: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32 Source.2722: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.2723: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.2724: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.2725: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase Source.2726: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.2727: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.2728: DFBPPR14998 ---- Microorganism protein ---- Galactokinase Source.2729: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.2730: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.2731: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.2732: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.2733: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase Source.2734: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.2735: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.2736: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.2737: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.2738: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase Source.2739: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit Source.2740: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21 Source.2741: DFBPPR15060 ---- Microorganism protein ---- Transaldolase Source.2742: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.2743: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.2744: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12 Source.2745: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase Source.2746: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13 Source.2747: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial Source.2748: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.2749: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.2750: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.2751: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.2752: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.2753: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.2754: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.2755: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.2756: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.2757: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.2758: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4 Source.2759: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.2760: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.2761: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81 Source.2762: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2 Source.2763: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain Source.2764: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.2765: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2 Source.2766: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35 Source.2767: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2768: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.2769: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1 Source.2770: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9 Source.2771: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3 Source.2772: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.2773: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase Source.2774: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase Source.2775: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.2776: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.2777: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.2778: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.2779: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.2780: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.2781: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60 Source.2782: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.2783: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.2784: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.2785: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.2786: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor Source.2787: DFBPPR15262 ---- Microorganism protein ---- Inner kinetochore subunit NKP1 Source.2788: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3 Source.2789: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.2790: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase Source.2791: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.2792: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1 Source.2793: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18 Source.2794: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.2795: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.2796: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.2797: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.2798: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.2799: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.2800: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1 Source.2801: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.2802: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.2803: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1 Source.2804: DFBPPR15399 ---- Microorganism protein ---- 40S ribosomal protein S21 Source.2805: DFBPPR15405 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM9 Source.2806: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2 Source.2807: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34 Source.2808: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.2809: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase Source.2810: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.2811: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10 Source.2812: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.2813: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.2814: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1 Source.2815: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24 Source.2816: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.2817: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.2818: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.2819: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.2820: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1 Source.2821: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.2822: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.2823: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.2824: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3 Source.2825: DFBPPR15511 ---- Microorganism protein ---- 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase Source.2826: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.2827: DFBPPR15513 ---- Microorganism protein ---- Killer toxin subunit gamma Source.2828: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1 Source.2829: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10 Source.2830: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta Source.2831: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.2832: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6 Source.2833: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.2834: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4 Source.2835: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.2836: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2 Source.2837: DFBPPR15565 ---- Microorganism protein ---- 37S ribosomal protein S10, mitochondrial Source.2838: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta Source.2839: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.2840: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2 Source.2841: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial Source.2842: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.2843: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7 Source.2844: DFBPPR15651 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 34, mitochondrial Source.2845: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25 Source.2846: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11 Source.2847: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial Source.2848: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.2849: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.2850: DFBPPR15711 ---- Microorganism protein ---- SWR1-complex protein 7 Source.2851: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.2852: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial Source.2853: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.2854: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2 Source.2855: DFBPPR15739 ---- Microorganism protein ---- Long chronological lifespan protein 2 Source.2856: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial Source.2857: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1 Source.2858: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86 Source.2859: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial Source.2860: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1 Source.2861: DFBPPR15785 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 7 Source.2862: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g Source.2863: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component Source.2864: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.2865: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase Source.2866: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.2867: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.2868: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.2869: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2 Source.2870: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.2871: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.2872: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog Source.2873: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.2874: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.2875: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.2876: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.2877: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.2878: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.2879: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic Source.2880: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.2881: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.2882: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3 Source.2883: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.2884: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.2885: DFBPPR7794 ---- Plant protein ---- Cytochrome b6 Source.2886: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.2887: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.2888: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.2889: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2890: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.2891: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1 Source.2892: DFBPPR7864 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic Source.2893: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.2894: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.2895: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a Source.2896: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.2897: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.2898: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.2899: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.2900: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.2901: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.2902: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.2903: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.2904: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.2905: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2906: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2907: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.2908: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.2909: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5 Source.2910: DFBPPR8144 ---- Plant protein ---- Maturase K Source.2911: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.2912: DFBPPR8157 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic Source.2913: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.2914: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.2915: DFBPPR8235 ---- Plant protein ---- Catalase Source.2916: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase Source.2917: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.2918: DFBPPR8247 ---- Plant protein ---- Nucleoside diphosphate kinase Source.2919: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.2920: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2921: DFBPPR8271 ---- Plant protein ---- Cytochrome b6 Source.2922: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2923: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2924: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.2925: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3 Source.2926: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit Source.2927: DFBPPR8323 ---- Plant protein ---- Cytochrome P450 Source.2928: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21 Source.2929: DFBPPR8356 ---- Plant protein ---- Unknown protein 1
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antihypertensive activity

The antihypertensive activity of each peptidic fraction obtained from the pearl oysters was evaluated by measuring the change in SBP at 1h, 2h, 3h, 4h, and 6h after oral administration. Systolic blood pressure did not change in the control rats during the experimental period (6 h). Captopril (10 mg/kg) lowered SBP significantly from 1 h to 4 h after administration of the drug. A single dose of the peptidic fraction from the short-necked clam reduced SBP significantly by 42.2 mmHg at 2 h, and this antihypertensive effect continued for 4 h after administration. The ACE-inhibitory peptide LVE was isolated from the highest active fraction, so the peptide was a potential antihypertensive peptide.

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Hydrolysis with pepsin (Porcine tomach mucosa; Wako Pure Chemicals, Osaka, Japan).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	No measured
Prediction:	ToxinPred

Additional information

The purified peptide LVE is a possible candidate for application as a dietary supplement or as a component of a functional food product.

Database cross-references

DFBP

[D1]	DFBPACEI1185
[D2]	DFBPMUFU0241

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	Suetsuna, K. Identification of antihypertensive peptides from peptic digest of the short-necked clam Tapes philippinarum and the pearl oyster Pinctada fucata martensii. Fisheries Science. 2002, 68, 233-5. DOI: 10.1046/j.1444-2906.2002.00415.x
Other literature(s)	N.D
PubDate	2002