E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANHY0869(Antihypertensive peptide)
DFBP ID DFBPANHY0869
Peptide sequence YP
Type Native peptide
Peptide/Function name Antihypertensive peptide
Function-activity relationship
Main bioactivity Antihypertensive activity
Otheir bioactivity ACE-inhibitory activity [D1], Antioxidative activity [D2], DPP IV-inhibitory activity [D3], α-Glucosidase inhibitory activity [D4], Opioid activity [D5], Multifunctional activity [D6]
Calculated physicochemical properties
Three-letter amino acid Tyr-Pro
Single-letter amino acid YP
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 278.30 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
IC50 N.D
pIC50 N.D
GRAVY -1.4500 c
Hydrophilic residue ratio 50% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Grains, Rice
Precursor protein Sake lees
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin
Source.3: DFBPPR0380 ---- Plant protein ---- Alpha-gliadin
Source.4: DFBPPR0381 ---- Plant protein ---- Alpha-gliadin
Source.5: DFBPPR0382 ---- Plant protein ---- Alpha-gliadin
Source.6: DFBPPR0383 ---- Plant protein ---- Alpha-gliadin
Source.7: DFBPPR0384 ---- Plant protein ---- Alpha-gliadin
Source.8: DFBPPR0385 ---- Plant protein ---- Alpha-gliadin
Source.9: DFBPPR0389 ---- Plant protein ---- Alpha-gliadin
Source.10: DFBPPR0390 ---- Plant protein ---- B3144=ALPHA-gliadin derived CELIAC active peptide
Source.11: DFBPPR0391 ---- Plant protein ---- B3143=ALPHA-gliadin derived CELIAC active peptide
Source.12: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.13: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.14: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.15: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.16: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1
Source.17: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.18: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A
Source.19: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.20: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.21: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.22: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.23: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.24: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.25: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.26: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.27: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.28: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.29: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.30: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.31: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.32: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.33: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.34: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.35: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.36: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.37: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.38: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.39: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.40: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.41: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.42: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.43: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.44: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.45: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.46: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.47: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.48: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.49: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.50: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.51: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.52: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.53: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.54: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic
Source.55: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.56: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.57: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.58: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2
Source.59: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.60: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.61: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.62: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.63: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.64: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.65: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.66: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.67: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.68: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.69: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.70: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8
Source.71: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.72: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.73: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.74: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3
Source.75: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.76: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.77: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.78: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.79: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.80: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.81: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.82: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.83: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.84: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.85: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.86: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.87: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.88: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.89: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.90: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7
Source.91: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.92: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.93: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.94: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.95: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.96: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.97: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.98: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.99: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.100: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.101: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.102: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.103: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.104: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.105: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.106: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.107: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.108: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.109: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.110: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.111: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.112: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.113: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4
Source.114: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.115: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.116: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.117: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.118: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.119: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.120: DFBPPR1041 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 1
Source.121: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.122: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.123: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.124: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.125: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.126: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.127: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.128: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.129: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.130: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.131: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.132: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.133: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.134: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.135: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.136: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.137: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.138: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.139: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.140: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.141: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.142: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.143: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.144: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.145: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.146: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.147: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.148: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.149: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.150: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.151: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.152: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.153: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.154: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.155: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.156: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.157: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.158: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.159: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.160: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.161: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.162: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.163: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.164: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.165: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.166: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.167: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.168: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.169: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.170: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.171: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.172: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.173: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.174: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.175: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.176: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.177: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.178: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.179: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.180: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.181: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.182: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.183: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.184: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.185: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.186: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.187: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.188: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.189: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.190: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.191: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.192: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.193: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.194: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.195: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.196: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.197: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.198: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.199: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.200: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.201: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.202: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1
Source.203: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.204: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.205: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.206: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.207: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.208: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.209: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.210: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.211: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.212: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.213: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.214: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.215: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.216: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.217: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.218: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.219: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic
Source.220: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.221: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.222: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.223: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.224: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.225: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.226: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.227: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.228: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.229: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.230: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.231: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.232: DFBPPR1357 ---- Plant proteins ---- MADS-box transcription factor 47
Source.233: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.234: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.235: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.236: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.237: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.238: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.239: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.240: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.241: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.242: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3
Source.243: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.244: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.245: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.246: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.247: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.248: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.249: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.250: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.251: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.252: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.253: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.254: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.255: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.256: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.257: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.258: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.259: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.260: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.261: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.262: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.263: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.264: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.265: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.266: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.267: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.268: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.269: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.270: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.271: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.272: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.273: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.274: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.275: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.276: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.277: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.278: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.279: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.280: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.281: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.282: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.283: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.284: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.285: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.286: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.287: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.288: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.289: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.290: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.291: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.292: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.293: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.294: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.295: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.296: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.297: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.298: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.299: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.300: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.301: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.302: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.303: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.304: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.305: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.306: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.307: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.308: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.309: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.310: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.311: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.312: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.313: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.314: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.315: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.316: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.317: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.318: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.319: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.320: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.321: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.322: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.323: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.324: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.325: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.326: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.327: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.328: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.329: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.330: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.331: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.332: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.333: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.334: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.335: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.336: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.337: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.338: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.339: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.340: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.341: DFBPPR1581 ---- Plant proteins ---- Peroxiredoxin-2C
Source.342: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.343: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.344: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.345: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.346: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.347: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.348: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.349: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.350: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.351: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.352: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.353: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.354: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.355: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.356: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.357: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.358: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.359: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.360: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.361: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.362: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.363: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.364: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.365: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.366: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.367: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.368: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.369: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.370: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.371: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.372: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.373: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.374: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.375: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.376: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19
Source.377: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.378: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.379: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.380: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.381: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.382: DFBPPR1675 ---- Plant proteins ---- Protein LSD1
Source.383: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.384: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.385: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.386: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.387: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.388: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062
Source.389: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.390: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.391: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.392: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.393: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.394: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.395: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.396: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.397: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.398: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.399: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.400: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.401: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.402: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.403: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.404: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.405: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.406: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.407: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.408: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.409: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.410: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.411: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.412: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.413: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.414: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.415: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.416: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.417: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.418: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.419: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.420: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.421: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.422: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.423: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.424: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2
Source.425: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.426: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.427: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.428: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.429: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.430: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.431: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.432: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.433: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.434: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.435: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.436: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.437: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.438: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.439: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.440: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.441: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.442: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.443: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1
Source.444: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.445: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.446: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.447: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.448: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.449: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.450: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.451: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.452: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.453: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.454: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.455: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.456: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.457: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.458: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.459: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.460: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.461: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.462: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.463: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.464: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.465: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.466: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.467: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.468: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.469: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.470: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.471: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.472: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.473: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.474: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.475: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.476: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.477: DFBPPR1887 ---- Plant proteins ---- Probable glutathione S-transferase DHAR2, chloroplastic
Source.478: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.479: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.480: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.481: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.482: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.483: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.484: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.485: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.486: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.487: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.488: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.489: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.490: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.491: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.492: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.493: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.494: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.495: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.496: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.497: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.498: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.499: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.500: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.501: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.502: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.503: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.504: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.505: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.506: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B
Source.507: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.508: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.509: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.510: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.511: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.512: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.513: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.514: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.515: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.516: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.517: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.518: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.519: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.520: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.521: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.522: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.523: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.524: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.525: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.526: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.527: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.528: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.529: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.530: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.531: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.532: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.533: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.534: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.535: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.536: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1
Source.537: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.538: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.539: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.540: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.541: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.542: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.543: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.544: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.545: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.546: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.547: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.548: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.549: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.550: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.551: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.552: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.553: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.554: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.555: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.556: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.557: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.558: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.559: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.560: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.561: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.562: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.563: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.564: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.565: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.566: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.567: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.568: DFBPPR2085 ---- Plant proteins ---- Protein LOL5
Source.569: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.570: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.571: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.572: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.573: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.574: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.575: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.576: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.577: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.578: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.579: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.580: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.581: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.582: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.583: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.584: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1
Source.585: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.586: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.587: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.588: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.589: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.590: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.591: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.592: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.593: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.594: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.595: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.596: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.597: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.598: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A
Source.599: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.600: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.601: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.602: DFBPPR2159 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.603: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.604: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.605: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.606: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.607: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.608: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.609: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.610: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.611: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.612: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.613: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.614: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.615: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.616: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.617: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.618: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.619: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.620: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.621: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.622: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.623: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.624: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.625: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.626: DFBPPR2223 ---- Plant proteins ---- Urease
Source.627: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.628: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.629: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.630: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.631: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.632: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.633: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.634: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.635: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.636: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.637: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.638: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.639: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.640: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.641: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.642: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.643: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.644: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.645: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.646: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.647: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.648: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.649: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.650: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.651: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.652: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.653: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.654: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.655: DFBPPR2302 ---- Plant proteins ---- Bowman-Birk type bran trypsin inhibitor
Source.656: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.657: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.658: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.659: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.660: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.661: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.662: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.663: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.664: DFBPPR2329 ---- Plant proteins ---- Protein HEADING DATE REPRESSOR 1
Source.665: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.666: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.667: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.668: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.669: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.670: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.671: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.672: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.673: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.674: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.675: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.676: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.677: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.678: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.679: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6
Source.680: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.681: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.682: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.683: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.684: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.685: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.686: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1
Source.687: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.688: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.689: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.690: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.691: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.692: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.693: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.694: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.695: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.696: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase
Source.697: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.698: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.699: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.700: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.701: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.702: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.703: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.704: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.705: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.706: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.707: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.708: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.709: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.710: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.711: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.712: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.713: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.714: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3
Source.715: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.716: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.717: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.718: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.719: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.720: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.721: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34
Source.722: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2
Source.723: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.724: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.725: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.726: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.727: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.728: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.729: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.730: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.731: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.732: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.733: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.734: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.735: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.736: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.737: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.738: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.739: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.740: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.741: DFBPPR2520 ---- Plant proteins ---- Metallothionein-like protein 4C
Source.742: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.743: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.744: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.745: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.746: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.747: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.748: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.749: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.750: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.751: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.752: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.753: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.754: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.755: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.756: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.757: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.758: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.759: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.760: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.761: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.762: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.763: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.764: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.765: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.766: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.767: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.768: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.769: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.770: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.771: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.772: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.773: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.774: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.775: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.776: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.777: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.778: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.779: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.780: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.781: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.782: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.783: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.784: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial
Source.785: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.786: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.787: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.788: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2
Source.789: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein
Source.790: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.791: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.792: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.793: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.794: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.795: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.796: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.797: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.798: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.799: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.800: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.801: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.802: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.803: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.804: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.805: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.806: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.807: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.808: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.809: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.810: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.811: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.812: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.813: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.814: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.815: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.816: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.817: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.818: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.819: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.820: DFBPPR2733 ---- Plant proteins ---- Metallothionein-like protein 1B
Source.821: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.822: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C
Source.823: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.824: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.825: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.826: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.827: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.828: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.829: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.830: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.831: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.832: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.833: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.834: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.835: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.836: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.837: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.838: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.839: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.840: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.841: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.842: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.843: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.844: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.845: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.846: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.847: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic
Source.848: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.849: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.850: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.851: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.852: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.853: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.854: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.855: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.856: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.857: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.858: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.859: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.860: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.861: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.862: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.863: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.864: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.865: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.866: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.867: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.868: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.869: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.870: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.871: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.872: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.873: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.874: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.875: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.876: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.877: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.878: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.879: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.880: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.881: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.882: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.883: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.884: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.885: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.886: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.887: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.888: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.889: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.890: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.891: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.892: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.893: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.894: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.895: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.896: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.897: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.898: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.899: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.900: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.901: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2
Source.902: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1
Source.903: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.904: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.905: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.906: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.907: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.908: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.909: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.910: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.911: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.912: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.913: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.914: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.915: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.916: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.917: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.918: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.919: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.920: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.921: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.922: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.923: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.924: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.925: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.926: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.927: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.928: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.929: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.930: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.931: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.932: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.933: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.934: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.935: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.936: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.937: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.938: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.939: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.940: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.941: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.942: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.943: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.944: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.945: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.946: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.947: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.948: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.949: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.950: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.951: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.952: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.953: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.954: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.955: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.956: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.957: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.958: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.959: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic
Source.960: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.961: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.962: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.963: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.964: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.965: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.966: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.967: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.968: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.969: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.970: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.971: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.972: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.973: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.974: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.975: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.976: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.977: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.978: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.979: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.980: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.981: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.982: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.983: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.984: DFBPPR3108 ---- Plant proteins ---- Thioredoxin H4-2
Source.985: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.986: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5
Source.987: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1
Source.988: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1
Source.989: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.990: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.991: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.992: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.993: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.994: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.995: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.996: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.997: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.998: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.999: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1000: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1001: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.1002: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.1003: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.1004: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.1005: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1006: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.1007: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.1008: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.1009: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.1010: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1011: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1012: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.1013: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1014: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.1015: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1016: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.1017: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1018: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1019: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1020: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1021: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1022: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.1023: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1024: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1025: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1026: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1027: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.1028: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1029: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1030: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1031: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.1032: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1033: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.1034: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.1035: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.1036: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.1037: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.1038: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.1039: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1040: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.1041: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1042: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.1043: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1044: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.1045: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1046: DFBPPR3261 ---- Plant proteins ---- Autophagy-related protein 8D
Source.1047: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.1048: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1049: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.1050: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1051: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.1052: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.1053: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16
Source.1054: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1055: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1056: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.1057: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1058: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.1059: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1060: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.1061: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.1062: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.1063: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.1064: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.1065: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.1066: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.1067: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.1068: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10
Source.1069: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.1070: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1071: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1072: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.1073: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.1074: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1075: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1076: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1077: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.1078: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1079: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1080: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.1081: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.1082: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1083: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.1084: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1085: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.1086: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.1087: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.1088: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.1089: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1090: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1091: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1092: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1093: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1094: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1095: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.1096: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.1097: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1098: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1099: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.1100: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5
Source.1101: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.1102: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1103: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1104: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1105: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1106: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.1107: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.1108: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.1109: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.1110: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.1111: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1112: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.1113: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1114: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1115: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1116: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C
Source.1117: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.1118: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.1119: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.1120: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.1121: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.1122: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.1123: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.1124: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.1125: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1126: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.1127: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1128: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.1129: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1130: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.1131: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1132: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1133: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1134: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.1135: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.1136: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1137: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1138: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.1139: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.1140: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.1141: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.1142: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.1143: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1144: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2
Source.1145: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1146: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1147: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.1148: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1149: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1150: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.1151: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1152: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.1153: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.1154: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.1155: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1156: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.1157: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1158: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.1159: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.1160: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1
Source.1161: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1162: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1163: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.1164: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1165: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.1166: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1167: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1168: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1169: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.1170: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1171: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1
Source.1172: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1173: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1174: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1175: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1176: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1177: DFBPPR3614 ---- Plant proteins ---- Prolamin PPROL 17D
Source.1178: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1179: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1180: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.1181: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1182: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1183: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1184: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2
Source.1185: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1186: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1187: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.1188: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1189: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1190: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.1191: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1192: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.1193: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1194: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1195: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.1196: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.1197: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.1198: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1199: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1200: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.1201: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.1202: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1
Source.1203: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.1204: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.1205: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.1206: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.1207: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase
Source.1208: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4
Source.1209: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.1210: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.1211: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.1212: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1213: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.1214: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.1215: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.1216: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1217: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.1218: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1219: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.1220: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.1221: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.1222: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.1223: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.1224: DFBPPR3760 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.1225: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.1226: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.1227: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.1228: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.1229: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.1230: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.1231: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1232: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1233: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.1234: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1235: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.1236: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.1237: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.1238: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.1239: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.1240: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.1241: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.1242: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.1243: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1244: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.1245: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.1246: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.1247: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.1248: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.1249: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.1250: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.1251: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.1252: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.1253: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1254: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.1255: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.1256: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.1257: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.1258: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.1259: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.1260: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.1261: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.1262: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.1263: DFBPPR3908 ---- Plant proteins ---- Metallothionein-like protein 1A
Source.1264: DFBPPR3909 ---- Plant proteins ---- LIM domain-containing protein PLIM2b
Source.1265: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1266: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1267: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.1268: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.1269: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.1270: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.1271: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit
Source.1272: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1273: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.1274: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1275: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.1276: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.1277: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.1278: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.1279: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.1280: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.1281: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.1282: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.1283: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.1284: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.1285: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.1286: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.1287: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.1288: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.1289: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1290: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1291: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.1292: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1293: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.1294: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.1295: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1296: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.1297: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.1298: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1299: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.1300: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.1301: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.1302: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1303: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3
Source.1304: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1305: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.1306: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.1307: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1308: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.1309: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1310: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.1311: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.1312: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.1313: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1314: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.1315: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.1316: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.1317: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.1318: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.1319: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.1320: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.1321: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1322: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.1323: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.1324: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.1325: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.1326: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1327: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.1328: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.1329: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1330: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.1331: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4
Source.1332: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.1333: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.1334: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1335: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.1336: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1337: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.1338: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1339: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.1340: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.1341: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1342: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1343: DFBPPR4151 ---- Plant proteins ---- Metallothionein-like protein 4A
Source.1344: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.1345: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.1346: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.1347: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1348: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6
Source.1349: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.1350: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1351: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.1352: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1353: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.1354: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.1355: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3
Source.1356: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.1357: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.1358: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.1359: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1360: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.1361: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.1362: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.1363: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1364: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1365: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1366: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1367: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.1368: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1369: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1370: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.1371: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1372: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.1373: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P
Source.1374: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1375: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1376: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1377: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.1378: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.1379: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1380: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.1381: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1382: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1383: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic
Source.1384: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.1385: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.1386: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.1387: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1388: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.1389: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1390: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.1391: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1392: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1393: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.1394: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1395: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.1396: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.1397: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.1398: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.1399: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.1400: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.1401: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1
Source.1402: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1403: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1404: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.1405: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.1406: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.1407: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.1408: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.1409: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.1410: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.1411: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1412: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.1413: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1414: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.1415: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.1416: DFBPPR4328 ---- Plant proteins ---- Metallothionein-like protein 2A
Source.1417: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.1418: DFBPPR4331 ---- Plant proteins ---- 60S ribosomal protein L10-2
Source.1419: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.1420: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.1421: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.1422: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1423: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.1424: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1425: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.1426: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.1427: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.1428: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1429: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.1430: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1431: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.1432: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.1433: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.1434: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1435: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1436: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.1437: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.1438: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2
Source.1439: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.1440: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1441: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.1442: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.1443: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.1444: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1445: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog
Source.1446: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1447: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1448: DFBPPR4420 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 1
Source.1449: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.1450: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.1451: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1452: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.1453: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1454: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1455: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.1456: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.1457: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.1458: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.1459: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.1460: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.1461: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.1462: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.1463: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.1464: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1465: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.1466: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.1467: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.1468: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.1469: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.1470: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1471: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.1472: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.1473: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.1474: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.1475: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.1476: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.1477: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1478: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.1479: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.1480: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.1481: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.1482: DFBPPR4501 ---- Plant proteins ---- Metallothionein-like protein 4B
Source.1483: DFBPPR4504 ---- Plant proteins ---- 60S ribosomal protein L10-1
Source.1484: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B
Source.1485: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.1486: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.1487: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.1488: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.1489: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.1490: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.1491: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.1492: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1493: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.1494: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1495: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.1496: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1497: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.1498: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.1499: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.1500: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.1501: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.1502: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.1503: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.1504: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.1505: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.1506: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.1507: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.1508: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1
Source.1509: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.1510: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.1511: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.1512: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.1513: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.1514: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.1515: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.1516: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1517: DFBPPR4607 ---- Plant proteins ---- Protein LOL2
Source.1518: DFBPPR4610 ---- Plant proteins ---- Protein LOL3
Source.1519: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.1520: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.1521: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1522: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.1523: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.1524: DFBPPR4620 ---- Plant proteins ---- Protein LOL1
Source.1525: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.1526: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.1527: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.1528: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.1529: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.1530: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.1531: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.1532: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.1533: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.1534: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.1535: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1536: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.1537: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.1538: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1539: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.1540: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.1541: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4
Source.1542: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.1543: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2
Source.1544: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.1545: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.1546: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.1547: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.1548: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5
Source.1549: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.1550: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1551: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.1552: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.1553: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.1554: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.1555: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.1556: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.1557: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4
Source.1558: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.1559: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.1560: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.1561: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.1562: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.1563: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1564: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1565: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.1566: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.1567: DFBPPR4776 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 3
Source.1568: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.1569: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1
Source.1570: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2
Source.1571: DFBPPR4800 ---- Plant proteins ---- Protein BUD31 homolog 2
Source.1572: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.1573: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.1574: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.1575: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.1576: DFBPPR4820 ---- Plant proteins ---- B3 domain-containing protein Os10g0323000
Source.1577: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.1578: DFBPPR4829 ---- Plant proteins ---- Protein BUD31 homolog 3
Source.1579: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1580: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400
Source.1581: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2
Source.1582: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.1583: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1
Source.1584: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.1585: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.1586: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.1587: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100
Source.1588: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.1589: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.1590: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.1591: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.1592: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1593: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1594: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.1595: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1
Source.1596: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.1597: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1598: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.1599: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic
Source.1600: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.1601: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.1602: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.1603: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.1604: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.1605: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1606: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1607: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.1608: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.1609: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1610: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.1611: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.1612: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1613: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.1614: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.1615: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.1616: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.1617: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.1618: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.1619: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1620: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.1621: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.1622: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.1623: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.1624: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.1625: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.1626: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.1627: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.1628: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.1629: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.1630: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.1631: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.1632: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1633: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.1634: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.1635: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.1636: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.1637: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1
Source.1638: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease
Source.1639: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1640: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1641: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1642: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.1643: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1644: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1645: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.1646: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.1647: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.1648: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1649: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.1650: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.1651: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1652: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.1653: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1654: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.1655: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.1656: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.1657: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.1658: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase
Source.1659: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1660: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.1661: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.1662: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1663: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.1664: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.1665: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.1666: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.1667: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1668: DFBPPR5051 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor
Source.1669: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein
Source.1670: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1671: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1672: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.1673: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.1674: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.1675: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.1676: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.1677: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.1678: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.1679: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.1680: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.1681: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.1682: DFBPPR5079 ---- Plant proteins ---- Albumin-1
Source.1683: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1684: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.1685: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.1686: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.1687: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1688: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1689: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1690: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.1691: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.1692: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.1693: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.1694: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.1695: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.1696: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.1697: DFBPPR5111 ---- Plant proteins ---- Lectin
Source.1698: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.1699: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.1700: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.1701: DFBPPR5122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1702: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1703: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1704: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.1705: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1706: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.1707: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.1708: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.1709: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.1710: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.1711: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1712: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1713: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.1714: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1715: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1716: DFBPPR5164 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 2
Source.1717: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1718: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.1719: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.1720: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1721: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1722: DFBPPR5179 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1723: DFBPPR5182 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 1
Source.1724: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.1725: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.1726: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A
Source.1727: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1728: DFBPPR5192 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1729: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.1730: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.1731: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.1732: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1733: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.1734: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.1735: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.1736: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.1737: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.1738: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.1739: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.1740: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1741: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein
Source.1742: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1743: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.1744: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2
Source.1745: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.1746: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1747: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1748: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.1749: DFBPPR5274 ---- Plant proteins ---- Early nodulin-75
Source.1750: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.1751: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.1752: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.1753: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1754: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.1755: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1756: DFBPPR5311 ---- Plant proteins ---- Nodulin-20
Source.1757: DFBPPR5314 ---- Plant proteins ---- Hydrophobic seed protein
Source.1758: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.1759: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.1760: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.1761: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.1762: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.1763: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.1764: DFBPPR5333 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 3
Source.1765: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B
Source.1766: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.1767: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.1768: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.1769: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.1770: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1771: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.1772: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1773: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.1774: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1775: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1776: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1777: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1778: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1779: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1780: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1781: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.1782: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.1783: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.1784: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1785: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.1786: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1787: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1788: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.1789: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.1790: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1791: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1792: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.1793: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.1794: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A
Source.1795: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.1796: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.1797: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.1798: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.1799: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.1800: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.1801: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.1802: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1803: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1804: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic
Source.1805: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha
Source.1806: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.1807: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1808: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.1809: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1810: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1811: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.1812: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1813: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.1814: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.1815: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1816: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1817: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.1818: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1819: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.1820: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.1821: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.1822: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.1823: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.1824: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.1825: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1826: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1827: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1828: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.1829: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic
Source.1830: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.1831: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.1832: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1833: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.1834: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1835: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.1836: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic
Source.1837: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1838: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase
Source.1839: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1840: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.1841: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1842: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.1843: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.1844: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1845: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.1846: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1847: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1848: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.1849: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1850: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1851: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1852: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1853: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1854: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.1855: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.1856: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1857: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.1858: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.1859: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.1860: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.1861: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1862: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.1863: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.1864: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.1865: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.1866: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.1867: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.1868: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.1869: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.1870: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1871: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1872: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1873: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1874: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1875: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.1876: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1877: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1878: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.1879: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1880: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.1881: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1882: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1883: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.1884: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.1885: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.1886: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1887: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1888: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1889: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.1890: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1891: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.1892: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.1893: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.1894: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.1895: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1896: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1897: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1898: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.1899: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.1900: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.1901: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.1902: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.1903: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.1904: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1905: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.1906: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1907: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1908: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1909: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1910: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.1911: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.1912: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.1913: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.1914: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1915: DFBPPR5706 ---- Plant proteins ---- Glutelin-2
Source.1916: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.1917: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1918: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.1919: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1920: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1921: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.1922: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.1923: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.1924: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1925: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.1926: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1927: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1928: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.1929: DFBPPR5729 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.1930: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.1931: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1932: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.1933: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.1934: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1935: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.1936: DFBPPR5741 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1937: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.1938: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.1939: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.1940: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1941: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.1942: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.1943: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1944: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic
Source.1945: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.1946: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1947: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.1948: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.1949: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1950: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic
Source.1951: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.1952: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.1953: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.1954: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1955: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2
Source.1956: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.1957: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1958: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1959: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.1960: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.1961: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1962: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1963: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.1964: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1965: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1966: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.1967: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1968: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.1969: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.1970: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.1971: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.1972: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.1973: DFBPPR5836 ---- Plant proteins ---- Eukaryotic translation initiation factor 5A
Source.1974: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.1975: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.1976: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.1977: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic
Source.1978: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1979: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1980: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1981: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1982: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.1983: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1984: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1985: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1
Source.1986: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.1987: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1988: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.1989: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1990: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1991: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1992: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.1993: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1994: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2
Source.1995: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1996: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.1997: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.1998: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.1999: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.2000: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.2001: DFBPPR5924 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.2002: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.2003: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein
Source.2004: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.2005: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.2006: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.2007: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.2008: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.2009: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.2010: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.2011: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.2012: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5
Source.2013: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.2014: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2015: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.2016: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.2017: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.2018: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.2019: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.2020: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3
Source.2021: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.2022: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.2023: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.2024: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2025: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.2026: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2027: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.2028: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.2029: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.2030: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.2031: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4
Source.2032: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.2033: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.2034: DFBPPR6059 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.2035: DFBPPR6060 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.2036: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.2037: DFBPPR6064 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.2038: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2039: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.2040: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.2041: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.2042: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1
Source.2043: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.2044: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.2045: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99
Source.2046: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.2047: DFBPPR6094 ---- Plant proteins ---- Zein-alpha PZ19.1
Source.2048: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.2049: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.2050: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2
Source.2051: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.2052: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4
Source.2053: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.2054: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.2055: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13
Source.2056: DFBPPR6142 ---- Plant proteins ---- Metallothionein-like protein 1
Source.2057: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.2058: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.2059: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.2060: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.2061: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.2062: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.2063: DFBPPR6177 ---- Plant proteins ---- Unknown protein from spot 159 of 2D-PAGE of etiolated coleoptile
Source.2064: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile
Source.2065: DFBPPR6185 ---- Plant proteins ---- Unknown protein from spot 415 of 2D-PAGE of etiolated coleoptile
Source.2066: DFBPPR6200 ---- Plant proteins ---- Unknown protein from spot 443 of 2D-PAGE of etiolated coleoptile
Source.2067: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.2068: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2069: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.2070: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.2071: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.2072: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2073: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.2074: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.2075: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.2076: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.2077: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.2078: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2079: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.2080: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.2081: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.2082: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.2083: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.2084: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.2085: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein
Source.2086: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2087: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.2088: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.2089: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2090: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.2091: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.2092: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.2093: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.2094: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.2095: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2096: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2097: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.2098: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.2099: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.2100: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.2101: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.2102: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.2103: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic
Source.2104: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2105: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.2106: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.2107: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.2108: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic
Source.2109: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2110: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.2111: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2112: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein
Source.2113: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2114: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.2115: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2116: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.2117: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2118: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2119: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.2120: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.2121: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.2122: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.2123: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.2124: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.2125: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.2126: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2127: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2128: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.2129: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.2130: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.2131: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F
Source.2132: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2133: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2134: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.2135: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2136: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.2137: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2138: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.2139: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.2140: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.2141: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.2142: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.2143: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.2144: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2145: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2146: DFBPPR6358 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.2147: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2148: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2149: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.2150: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2151: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2152: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2153: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.2154: DFBPPR6377 ---- Plant proteins ---- Lectin
Source.2155: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D
Source.2156: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C
Source.2157: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2158: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.2159: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.2160: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.2161: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.2162: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.2163: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase
Source.2164: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2165: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2166: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.2167: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.2168: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2169: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2170: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic
Source.2171: DFBPPR6430 ---- Plant proteins ---- Legumin J
Source.2172: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2173: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B
Source.2174: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A
Source.2175: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72
Source.2176: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.2177: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.2178: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.2179: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.2180: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.2181: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.2182: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.2183: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.2184: DFBPPR6455 ---- Plant proteins ---- Legumin K
Source.2185: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.2186: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.2187: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.2188: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.2189: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.2190: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.2191: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.2192: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.2193: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic
Source.2194: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.2195: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.2196: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.2197: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E
Source.2198: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.2199: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.2200: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.2201: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2202: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.2203: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.2204: DFBPPR6534 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.2205: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2206: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2207: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.2208: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.2209: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.2210: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.2211: DFBPPR6594 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.2212: DFBPPR6595 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.2213: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28
Source.2214: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2215: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.2216: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.2217: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.2218: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.2219: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.2220: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.2221: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.2222: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2223: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.2224: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2225: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.2226: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.2227: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.2228: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.2229: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.2230: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.2231: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.2232: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2233: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.2234: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.2235: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2236: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.2237: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.2238: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.2239: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.2240: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.2241: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2242: DFBPPR6677 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 2
Source.2243: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.2244: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.2245: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5
Source.2246: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.2247: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.2248: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.2249: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.2250: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2251: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.2252: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.2253: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.2254: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.2255: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.2256: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.2257: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.2258: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.2259: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2260: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.2261: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.2262: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.2263: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.2264: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.2265: DFBPPR6733 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2266: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2267: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.2268: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.2269: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.2270: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.2271: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2272: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.2273: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2274: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.2275: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2276: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.2277: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.2278: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic
Source.2279: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2280: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.2281: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.2282: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.2283: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z
Source.2284: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.2285: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.2286: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.2287: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.2288: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2289: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2290: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3
Source.2291: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2292: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.2293: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.2294: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7
Source.2295: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2296: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.2297: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.2298: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.2299: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.2300: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2301: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.2302: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.2303: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2304: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.2305: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2306: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.2307: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.2308: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.2309: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.2310: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.2311: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2312: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2313: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512
Source.2314: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2
Source.2315: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.2316: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2317: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.2318: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2319: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.2320: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2321: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10
Source.2322: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1
Source.2323: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.2324: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.2325: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12
Source.2326: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.2327: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.2328: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2329: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.2330: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.2331: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212
Source.2332: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2333: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2334: DFBPPR6924 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC256
Source.2335: DFBPPR6930 ---- Plant proteins ---- Alpha/beta-gliadin
Source.2336: DFBPPR6934 ---- Plant proteins ---- Alpha/beta-gliadin clone PW1215
Source.2337: DFBPPR6936 ---- Plant proteins ---- Alpha/beta-gliadin A-II
Source.2338: DFBPPR6937 ---- Plant proteins ---- Alpha/beta-gliadin A-IV
Source.2339: DFBPPR6938 ---- Plant proteins ---- Alpha/beta-gliadin clone PW8142
Source.2340: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V
Source.2341: DFBPPR6940 ---- Plant proteins ---- Alpha/beta-gliadin A-III
Source.2342: DFBPPR6941 ---- Plant proteins ---- Alpha/beta-gliadin A-I
Source.2343: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2344: DFBPPR6954 ---- Plant proteins ---- Alpha/beta-gliadin clone PTO-A10
Source.2345: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.2346: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin
Source.2347: DFBPPR6963 ---- Plant proteins ---- Metallothionein-like protein 1
Source.2348: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B
Source.2349: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin
Source.2350: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.2351: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.2352: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.2353: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.2354: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.2355: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.2356: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.2357: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2358: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.2359: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.2360: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.2361: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1
Source.2362: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.2363: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.2364: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.2365: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.2366: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.2367: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.2368: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2369: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.2370: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.2371: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.2372: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.2373: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.2374: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.2375: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2376: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2377: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.2378: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.2379: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.2380: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.2381: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2382: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2383: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2384: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.2385: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2386: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.2387: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.2388: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.2389: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.2390: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2391: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.2392: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.2393: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.2394: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2395: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.2396: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.2397: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.2398: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2399: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2400: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.2401: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.2402: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2403: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.2404: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.2405: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.2406: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.2407: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.2408: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2409: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.2410: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.2411: DFBPPR7132 ---- Plant proteins ---- Beta-galactosidase
Source.2412: DFBPPR7133 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2413: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.2414: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.2415: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.2416: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.2417: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.2418: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.2419: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.2420: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.2421: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2422: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.2423: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.2424: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.2425: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.2426: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2427: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.2428: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.2429: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.2430: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.2431: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2432: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2433: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.2434: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.2435: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2436: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2437: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2438: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2439: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.2440: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.2441: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.2442: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.2443: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2444: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.2445: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.2446: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.2447: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2448: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2449: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.2450: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.2451: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.2452: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2453: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.2454: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2455: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.2456: DFBPPR7223 ---- Plant proteins ---- Ferredoxin
Source.2457: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.2458: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.2459: DFBPPR7246 ---- Plant proteins ---- Leaf-specific thionin
Source.2460: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.2461: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.2462: DFBPPR7251 ---- Plant proteins ---- Leaf-specific thionin DB4
Source.2463: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.2464: DFBPPR7262 ---- Plant proteins ---- Photosystem I reaction center subunit IV, chloroplastic
Source.2465: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6
Source.2466: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3
Source.2467: DFBPPR7267 ---- Plant proteins ---- Thionin BTH7
Source.2468: DFBPPR7268 ---- Plant proteins ---- Probable leaf thionin
Source.2469: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.2470: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.2471: DFBPPR7274 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1B
Source.2472: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C
Source.2473: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.2474: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2475: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.2476: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein
Source.2477: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.2478: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.2479: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.2480: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.2481: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.2482: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.2483: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1
Source.2484: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2485: DFBPPR7318 ---- Plant proteins ---- B3-hordein
Source.2486: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.2487: DFBPPR7322 ---- Plant proteins ---- Metallothionein-like protein 1
Source.2488: DFBPPR7335 ---- Plant proteins ---- C-hordein
Source.2489: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24
Source.2490: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2491: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein
Source.2492: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.2493: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.2494: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.2495: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.2496: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.2497: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.2498: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.2499: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.2500: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.2501: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.2502: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.2503: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.2504: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.2505: DFBPPR7419 ---- Plant proteins ---- Cytochrome b
Source.2506: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.2507: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.2508: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.2509: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.2510: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2511: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2512: DFBPPR7441 ---- Plant proteins ---- Defensin-like protein 4
Source.2513: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2514: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.2515: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.2516: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2517: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2518: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2
Source.2519: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1
Source.2520: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.2521: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2522: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.2523: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.2524: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.2525: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II
Source.2526: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.2527: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.2528: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.2529: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.2530: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2531: DFBPPR7499 ---- Plant proteins ---- Ferredoxin
Source.2532: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.2533: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.2534: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.2535: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2536: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.2537: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2538: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.2539: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.2540: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.2541: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76
Source.2542: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.2543: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.2544: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.2545: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.2546: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.2547: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.2548: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.2549: DFBPPR7606 ---- Milk proteins ---- Osteopontin
Source.2550: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.2551: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.2552: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.2553: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.2554: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.2555: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.2556: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.2557: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.2558: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.2559: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.2560: DFBPPR7622 ---- Milk proteins ---- Mucin-1
Source.2561: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.2562: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.2563: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain
Source.2564: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2565: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.2566: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.2567: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.2568: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.2569: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.2570: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.2571: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.2572: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.2573: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator
Source.2574: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.2575: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.2576: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.2577: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6
Source.2578: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.2579: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.2580: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.2581: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2582: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12
Source.2583: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.2584: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.2585: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2586: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.2587: DFBPPR7663 ---- Milk proteins ---- Kappa-casein
Source.2588: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein
Source.2589: DFBPPR7665 ---- Milk proteins ---- Beta-casein
Source.2590: DFBPPR7668 ---- Milk proteins ---- Beta-casein
Source.2591: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.2592: DFBPPR7673 ---- Milk proteins ---- Kappa-casein
Source.2593: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.2594: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A
Source.2595: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein
Source.2596: DFBPPR7681 ---- Milk proteins ---- Beta-casein
Source.2597: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.2598: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.2599: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.2600: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein
Source.2601: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein
Source.2602: DFBPPR7692 ---- Milk proteins ---- Beta-casein
Source.2603: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2604: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein
Source.2605: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.2606: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.2607: DFBPPR7700 ---- Milk proteins ---- Beta-casein
Source.2608: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.2609: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.2610: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.2611: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.2612: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.2613: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.2614: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.2615: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.2616: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.2617: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.2618: DFBPPR7725 ---- Plant proteins ---- Avenin-3
Source.2619: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.2620: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.2621: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2622: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2623: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.2624: DFBPPR7739 ---- Plant proteins ---- Avenin-E
Source.2625: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.2626: DFBPPR7741 ---- Plant proteins ---- Avenin-F
Source.2627: DFBPPR7742 ---- Plant proteins ---- Avenin-A
Source.2628: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.2629: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.2630: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.2631: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.2632: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.2633: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.2634: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.2635: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.2636: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1
Source.2637: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.2638: DFBPPR8357 ---- Plant proteins ---- 2S albumin
Source.2639: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.2640: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.2641: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.2642: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.2643: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2644: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2645: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.2646: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2647: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.2648: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.2649: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin
Source.2650: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.2651: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.2652: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101
Source.2653: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.2654: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.2655: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.2656: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.2657: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.2658: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1
Source.2659: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2660: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2661: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2
Source.2662: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2663: DFBPPR8434 ---- Plant proteins ---- Lectin
Source.2664: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.2665: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.2666: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.2667: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase
Source.2668: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.2669: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.2670: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.2671: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.2672: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.2673: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2674: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.2675: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2676: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.2677: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.2678: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2679: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2680: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein
Source.2681: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.2682: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.2683: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.2684: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.2685: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.2686: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.2687: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.2688: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.2689: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.2690: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.2691: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.2692: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2693: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.2694: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.2695: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.2696: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.2697: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.2698: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.2699: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.2700: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.2701: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.2702: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.2703: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2704: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.2705: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2706: DFBPPR15951 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.2707: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.2708: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.2709: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2710: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2711: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.2712: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.2713: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.2714: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.2715: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.2716: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.2717: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.2718: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.2719: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.2720: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.2721: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.2722: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.2723: DFBPPR15988 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.2724: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.2725: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2726: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.2727: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2728: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.2729: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.2730: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.2731: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.2732: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2733: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.2734: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.2735: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2736: DFBPPR16013 ---- Animal proteins ---- Osteocalcin
Source.2737: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.2738: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.2739: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2740: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.2741: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.2742: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA
Source.2743: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2744: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2745: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.2746: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.2747: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2748: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.2749: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2750: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2751: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.2752: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.2753: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.2754: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.2755: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.2756: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.2757: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2758: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.2759: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.2760: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.2761: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.2762: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.2763: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.2764: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.2765: DFBPPR16065 ---- Animal proteins ---- Caspase-3
Source.2766: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.2767: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.2768: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2769: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.2770: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.2771: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.2772: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.2773: DFBPPR16093 ---- Animal proteins ---- Menin
Source.2774: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.2775: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.2776: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.2777: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.2778: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2779: DFBPPR16103 ---- Animal proteins ---- Laforin
Source.2780: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2781: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.2782: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.2783: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.2784: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.2785: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2786: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.2787: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.2788: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.2789: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.2790: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2791: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.2792: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.2793: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.2794: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.2795: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2796: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.2797: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.2798: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.2799: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.2800: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.2801: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.2802: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.2803: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.2804: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.2805: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.2806: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.2807: DFBPPR16154 ---- Animal proteins ---- Apolipoprotein C-II
Source.2808: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.2809: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.2810: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.2811: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.2812: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.2813: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.2814: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.2815: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.2816: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.2817: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.2818: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2819: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.2820: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.2821: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.2822: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2823: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.2824: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.2825: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.2826: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.2827: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.2828: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.2829: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2830: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.2831: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.2832: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2833: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2834: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.2835: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2836: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.2837: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.2838: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.2839: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.2840: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.2841: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2842: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.2843: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2844: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.2845: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.2846: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24
Source.2847: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.2848: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.2849: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.2850: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.2851: DFBPPR16240 ---- Animal proteins ---- Fibronectin
Source.2852: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2853: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.2854: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.2855: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2856: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain
Source.2857: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.2858: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2859: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.2860: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.2861: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2862: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.2863: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.2864: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.2865: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone
Source.2866: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.2867: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.2868: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.2869: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.2870: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.2871: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta
Source.2872: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.2873: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.2874: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.2875: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.2876: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1
Source.2877: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2878: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.2879: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2880: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.2881: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.2882: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.2883: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.2884: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.2885: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2886: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.2887: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.2888: DFBPPR16305 ---- Animal proteins ---- Phosducin
Source.2889: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2890: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.2891: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.2892: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.2893: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.2894: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.2895: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.2896: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.2897: DFBPPR16324 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.2898: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.2899: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.2900: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.2901: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.2902: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.2903: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.2904: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.2905: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.2906: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5
Source.2907: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2908: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.2909: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.2910: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.2911: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.2912: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta
Source.2913: DFBPPR16435 ---- Animal proteins ---- S-arrestin
Source.2914: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2915: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.2916: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.2917: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.2918: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.2919: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin
Source.2920: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin
Source.2921: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.2922: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.2923: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.2924: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.2925: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.2926: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.2927: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.2928: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.2929: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.2930: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.2931: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.2932: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.2933: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.2934: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.2935: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.2936: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.2937: DFBPPR16499 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.2938: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.2939: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2940: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.2941: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.2942: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.2943: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.2944: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.2945: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.2946: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2947: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.2948: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.2949: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.2950: DFBPPR16538 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 1B
Source.2951: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.2952: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2953: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.2954: DFBPPR16543 ---- Animal proteins ---- ATP synthase protein 8
Source.2955: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.2956: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.2957: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2958: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.2959: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.2960: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.2961: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2962: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.2963: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2964: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.2965: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin
Source.2966: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.2967: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.2968: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20
Source.2969: DFBPPR16588 ---- Animal proteins ---- Peptide YY
Source.2970: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.2971: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S
Source.2972: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.2973: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.2974: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.2975: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.2976: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.2977: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.2978: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain
Source.2979: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.2980: DFBPPR16611 ---- Animal proteins ---- Nuclear transition protein 2
Source.2981: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.2982: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4
Source.2983: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2984: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.2985: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.2986: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2987: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.2988: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.2989: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.2990: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.2991: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.2992: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2993: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2994: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27
Source.2995: DFBPPR16660 ---- Animal proteins ---- Gamma-crystallin C
Source.2996: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.2997: DFBPPR16663 ---- Animal proteins ---- Involucrin
Source.2998: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.2999: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.3000: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.3001: DFBPPR16680 ---- Animal proteins ---- Gastrin-releasing peptide
Source.3002: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.3003: DFBPPR16689 ---- Animal proteins ---- Gamma-crystallin B
Source.3004: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3
Source.3005: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor
Source.3006: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.3007: DFBPPR16707 ---- Animal proteins ---- Trefoil factor 2
Source.3008: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190
Source.3009: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3010: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.3011: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.3012: DFBPPR16737 ---- Animal proteins ---- Trefoil factor 1
Source.3013: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.3014: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.3015: DFBPPR16745 ---- Animal proteins ---- Ig kappa chain V region GOM
Source.3016: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3017: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.3018: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.3019: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.3020: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.3021: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.3022: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.3023: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.3024: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.3025: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.3026: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.3027: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.3028: DFBPPR16779 ---- Animal proteins ---- Hemoglobin subunit beta
Source.3029: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.3030: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.3031: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.3032: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.3033: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.3034: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3035: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3036: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.3037: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.3038: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3039: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.3040: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.3041: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3042: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3043: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta
Source.3044: DFBPPR16822 ---- Animal proteins ---- Kininogen-2
Source.3045: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II
Source.3046: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.3047: DFBPPR16830 ---- Animal proteins ---- Kininogen-1
Source.3048: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3049: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.3050: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6
Source.3051: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.3052: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.3053: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.3054: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.3055: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.3056: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.3057: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial
Source.3058: DFBPPR16860 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.3059: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.3060: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.3061: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.3062: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.3063: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.3064: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.3065: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.3066: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3067: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.3068: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.3069: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3070: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.3071: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.3072: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.3073: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain
Source.3074: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.3075: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.3076: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.3077: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3078: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3079: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.3080: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.3081: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3082: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.3083: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.3084: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3085: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.3086: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3087: DFBPPR16933 ---- Animal proteins ---- Proenkephalin-A
Source.3088: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.3089: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.3090: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.3091: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.3092: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA
Source.3093: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3094: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.3095: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.3096: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.3097: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.3098: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3099: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3100: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.3101: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.3102: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.3103: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.3104: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.3105: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.3106: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3107: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.3108: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.3109: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3110: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.3111: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1
Source.3112: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.3113: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.3114: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.3115: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.3116: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2
Source.3117: DFBPPR16991 ---- Animal proteins ---- Osteocalcin
Source.3118: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.3119: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1
Source.3120: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3121: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.3122: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3123: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.3124: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.3125: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.3126: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.3127: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.3128: DFBPPR17015 ---- Animal proteins ---- Microfibrillar-associated protein 2
Source.3129: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3130: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3131: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.3132: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.3133: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.3134: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.3135: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.3136: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.3137: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2
Source.3138: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.3139: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3140: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.3141: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3142: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.3143: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.3144: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.3145: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.3146: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.3147: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3148: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.3149: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.3150: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.3151: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.3152: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.3153: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.3154: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.3155: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.3156: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.3157: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.3158: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168
Source.3159: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.3160: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3161: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.3162: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3163: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.3164: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.3165: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1
Source.3166: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.3167: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.3168: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.3169: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.3170: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.3171: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.3172: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.3173: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3174: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.3175: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.3176: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.3177: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.3178: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.3179: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.3180: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.3181: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.3182: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.3183: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short
Source.3184: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3185: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.3186: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.3187: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3188: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3189: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.3190: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.3191: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.3192: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3193: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3194: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3195: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.3196: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.3197: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.3198: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.3199: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1
Source.3200: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.3201: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.3202: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6
Source.3203: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.3204: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.3205: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.3206: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.3207: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.3208: DFBPPR17254 ---- Animal proteins ---- Zinc finger protein SNAI2
Source.3209: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.3210: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.3211: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.3212: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.3213: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.3214: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.3215: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.3216: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.3217: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.3218: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.3219: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.3220: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.3221: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.3222: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.3223: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.3224: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.3225: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.3226: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.3227: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.3228: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.3229: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.3230: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.3231: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.3232: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.3233: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.3234: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.3235: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.3236: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.3237: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.3238: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.3239: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.3240: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.3241: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.3242: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.3243: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3244: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.3245: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3246: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.3247: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.3248: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.3249: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1
Source.3250: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.3251: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3252: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.3253: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.3254: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.3255: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.3256: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.3257: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3258: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.3259: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.3260: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3261: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.3262: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.3263: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.3264: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.3265: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.3266: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.3267: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.3268: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.3269: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.3270: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.3271: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.3272: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.3273: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.3274: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.3275: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.3276: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.3277: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.3278: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.3279: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.3280: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.3281: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.3282: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.3283: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.3284: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.3285: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.3286: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.3287: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.3288: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.3289: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.3290: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.3291: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.3292: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.3293: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.3294: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.3295: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.3296: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.3297: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.3298: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.3299: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.3300: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.3301: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.3302: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.3303: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.3304: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.3305: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.3306: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.3307: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.3308: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.3309: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.3310: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.3311: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.3312: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.3313: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.3314: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.3315: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.3316: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.3317: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.3318: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.3319: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.3320: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3321: DFBPPR17484 ---- Animal proteins ---- Histone H1.8
Source.3322: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.3323: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.3324: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.3325: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.3326: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.3327: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.3328: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.3329: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.3330: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b
Source.3331: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.3332: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.3333: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3334: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.3335: DFBPPR17517 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.3336: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.3337: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3338: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein
Source.3339: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.3340: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.3341: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.3342: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.3343: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.3344: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.3345: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.3346: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.3347: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3348: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.3349: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.3350: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.3351: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.3352: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.3353: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.3354: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.3355: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.3356: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.3357: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.3358: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.3359: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.3360: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.3361: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.3362: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.3363: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.3364: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.3365: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.3366: DFBPPR17586 ---- Animal proteins ---- Dermatopontin
Source.3367: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.3368: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3369: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.3370: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.3371: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.3372: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.3373: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.3374: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.3375: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.3376: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.3377: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3378: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1
Source.3379: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.3380: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.3381: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.3382: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.3383: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.3384: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.3385: DFBPPR17646 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial
Source.3386: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.3387: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.3388: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.3389: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta
Source.3390: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.3391: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.3392: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.3393: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.3394: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.3395: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.3396: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.3397: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6
Source.3398: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3399: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.3400: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.3401: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.3402: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.3403: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.3404: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3405: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.3406: DFBPPR17752 ---- Animal proteins ---- Follistatin
Source.3407: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.3408: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.3409: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.3410: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.3411: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.3412: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.3413: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.3414: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3415: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.3416: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.3417: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.3418: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.3419: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.3420: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.3421: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.3422: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3423: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.3424: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.3425: DFBPPR17793 ---- Animal proteins ---- Interleukin-17A
Source.3426: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.3427: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.3428: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.3429: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.3430: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.3431: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.3432: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.3433: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.3434: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.3435: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.3436: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.3437: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.3438: DFBPPR17816 ---- Animal proteins ---- Lumican
Source.3439: DFBPPR17817 ---- Animal proteins ---- Peroxiredoxin-2
Source.3440: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3441: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.3442: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3443: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.3444: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.3445: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.3446: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.3447: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3
Source.3448: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.3449: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.3450: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B
Source.3451: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.3452: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.3453: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3454: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.3455: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3456: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.3457: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.3458: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.3459: DFBPPR17858 ---- Animal proteins ---- Calsenilin
Source.3460: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.3461: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.3462: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.3463: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.3464: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.3465: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.3466: DFBPPR17879 ---- Animal proteins ---- Menin
Source.3467: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.3468: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.3469: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.3470: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.3471: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.3472: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.3473: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3474: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.3475: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.3476: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.3477: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.3478: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.3479: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein
Source.3480: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.3481: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.3482: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.3483: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.3484: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.3485: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.3486: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.3487: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.3488: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.3489: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.3490: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.3491: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.3492: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.3493: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.3494: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.3495: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.3496: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.3497: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.3498: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.3499: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.3500: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.3501: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.3502: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.3503: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.3504: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.3505: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase
Source.3506: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.3507: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG
Source.3508: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.3509: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.3510: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.3511: DFBPPR17968 ---- Animal proteins ---- Cathelicidin-2
Source.3512: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.3513: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.3514: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.3515: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.3516: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.3517: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.3518: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.3519: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.3520: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.3521: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.3522: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3523: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.3524: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.3525: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.3526: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase
Source.3527: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.3528: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3529: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.3530: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.3531: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.3532: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.3533: DFBPPR18017 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19
Source.3534: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.3535: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.3536: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3537: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.3538: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.3539: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.3540: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.3541: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.3542: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1
Source.3543: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1
Source.3544: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3545: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3546: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T
Source.3547: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.3548: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.3549: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.3550: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.3551: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.3552: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.3553: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.3554: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.3555: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta
Source.3556: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.3557: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.3558: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.3559: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3560: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.3561: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.3562: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.3563: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.3564: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.3565: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.3566: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.3567: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29
Source.3568: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.3569: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.3570: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.3571: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.3572: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.3573: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.3574: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.3575: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.3576: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3577: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3578: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.3579: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.3580: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.3581: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.3582: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.3583: DFBPPR18136 ---- Animal proteins ---- Septin-8
Source.3584: DFBPPR18137 ---- Animal proteins ---- Septin-8
Source.3585: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.3586: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1
Source.3587: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.3588: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.3589: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.3590: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.3591: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.3592: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.3593: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.3594: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.3595: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.3596: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.3597: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.3598: DFBPPR18168 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 W
Source.3599: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin
Source.3600: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.3601: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.3602: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.3603: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3604: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.3605: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.3606: DFBPPR18199 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 N
Source.3607: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.3608: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.3609: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.3610: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3611: DFBPPR18211 ---- Animal proteins ---- Phosducin
Source.3612: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.3613: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor
Source.3614: DFBPPR18221 ---- Animal proteins ---- Gamma-crystallin B
Source.3615: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.3616: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40
Source.3617: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B
Source.3618: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.3619: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.3620: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3621: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.3622: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.3623: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.3624: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.3625: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.3626: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.3627: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.3628: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.3629: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.3630: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.3631: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.3632: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.3633: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6
Source.3634: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.3635: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.3636: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.3637: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.3638: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.3639: DFBPPR18280 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.3640: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.3641: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3642: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.3643: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.3644: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.3645: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3646: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.3647: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.3648: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.3649: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.3650: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.3651: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3652: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.3653: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.3654: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.3655: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.3656: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3657: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.3658: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.3659: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.3660: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1
Source.3661: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.3662: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.3663: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.3664: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.3665: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.3666: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.3667: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2
Source.3668: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.3669: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.3670: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.3671: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3672: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.3673: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.3674: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.3675: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.3676: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.3677: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.3678: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.3679: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.3680: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.3681: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.3682: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.3683: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.3684: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3685: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.3686: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.3687: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3688: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3689: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.3690: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.3691: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.3692: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.3693: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.3694: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.3695: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.3696: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.3697: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.3698: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.3699: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.3700: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.3701: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.3702: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14
Source.3703: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3704: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.3705: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.3706: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.3707: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.3708: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.3709: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.3710: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.3711: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.3712: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.3713: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.3714: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.3715: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.3716: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.3717: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.3718: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.3719: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.3720: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.3721: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.3722: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.3723: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.3724: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.3725: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.3726: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.3727: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.3728: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.3729: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.3730: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.3731: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.3732: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.3733: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.3734: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.3735: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.3736: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6
Source.3737: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.3738: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3739: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.3740: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.3741: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.3742: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.3743: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.3744: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.3745: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.3746: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.3747: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.3748: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.3749: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3750: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.3751: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.3752: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.3753: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.3754: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1
Source.3755: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.3756: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.3757: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.3758: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.3759: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.3760: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.3761: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.3762: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.3763: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor
Source.3764: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.3765: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.3766: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.3767: DFBPPR18563 ---- Animal proteins ---- Collectin-43
Source.3768: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.3769: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.3770: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.3771: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.3772: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S
Source.3773: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.3774: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1
Source.3775: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.3776: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.3777: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.3778: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.3779: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.3780: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.3781: DFBPPR18600 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.3782: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.3783: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.3784: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.3785: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26
Source.3786: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3787: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.3788: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.3789: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.3790: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha
Source.3791: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.3792: DFBPPR18619 ---- Animal proteins ---- Ras-related protein Rab-7b
Source.3793: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3794: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.3795: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.3796: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.3797: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.3798: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB
Source.3799: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.3800: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.3801: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3
Source.3802: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.3803: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.3804: DFBPPR18643 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.3805: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.3806: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.3807: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.3808: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.3809: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.3810: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor
Source.3811: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase
Source.3812: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.3813: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.3814: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.3815: DFBPPR18718 ---- Animal proteins ---- Chondroadherin
Source.3816: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.3817: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3818: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.3819: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.3820: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.3821: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.3822: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.3823: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.3824: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.3825: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.3826: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.3827: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.3828: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3
Source.3829: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.3830: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.3831: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.3832: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.3833: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.3834: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.3835: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.3836: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.3837: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.3838: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.3839: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU
Source.3840: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.3841: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.3842: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.3843: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.3844: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.3845: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.3846: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.3847: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.3848: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.3849: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.3850: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.3851: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.3852: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.3853: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1
Source.3854: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.3855: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.3856: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.3857: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3858: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.3859: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.3860: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.3861: DFBPPR18828 ---- Animal proteins ---- Follitropin subunit beta
Source.3862: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1
Source.3863: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.3864: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.3865: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.3866: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.3867: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.3868: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.3869: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.3870: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.3871: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.3872: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.3873: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.3874: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.3875: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.3876: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.3877: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.3878: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.3879: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.3880: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.3881: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.3882: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.3883: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.3884: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.3885: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.3886: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.3887: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.3888: DFBPPR18894 ---- Animal proteins ---- NEDD8-conjugating enzyme Ubc12
Source.3889: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.3890: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.3891: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.3892: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.3893: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.3894: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.3895: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.3896: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.3897: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.3898: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.3899: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.3900: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.3901: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.3902: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.3903: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.3904: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.3905: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.3906: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.3907: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.3908: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.3909: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.3910: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.3911: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.3912: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.3913: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.3914: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.3915: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.3916: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.3917: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.3918: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.3919: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.3920: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.3921: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.3922: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.3923: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.3924: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.3925: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.3926: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.3927: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19
Source.3928: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1
Source.3929: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.3930: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.3931: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.3932: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.3933: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3934: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.3935: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.3936: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.3937: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.3938: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.3939: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.3940: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.3941: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.3942: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.3943: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase
Source.3944: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.3945: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.3946: DFBPPR19051 ---- Animal proteins ---- Pro-neuropeptide Y
Source.3947: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.3948: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.3949: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.3950: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.3951: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.3952: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.3953: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.3954: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.3955: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.3956: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.3957: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.3958: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.3959: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.3960: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A
Source.3961: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.3962: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.3963: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.3964: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.3965: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.3966: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.3967: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.3968: DFBPPR19108 ---- Animal proteins ---- Hepatocyte cell adhesion molecule
Source.3969: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.3970: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.3971: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.3972: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.3973: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.3974: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.3975: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.3976: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.3977: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.3978: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.3979: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.3980: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.3981: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.3982: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11
Source.3983: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.3984: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.3985: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.3986: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.3987: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.3988: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.3989: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.3990: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial
Source.3991: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.3992: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.3993: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.3994: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33
Source.3995: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.3996: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.3997: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3998: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.3999: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.4000: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.4001: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.4002: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.4003: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639
Source.4004: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.4005: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.4006: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.4007: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.4008: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.4009: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.4010: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.4011: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.4012: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4
Source.4013: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.4014: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.4015: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.4016: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.4017: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.4018: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.4019: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.4020: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.4021: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.4022: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.4023: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.4024: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.4025: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4026: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.4027: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.4028: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.4029: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6
Source.4030: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.4031: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.4032: DFBPPR19278 ---- Animal proteins ---- R-spondin-3
Source.4033: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.4034: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.4035: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.4036: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3
Source.4037: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.4038: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.4039: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.4040: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.4041: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.4042: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.4043: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.4044: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.4045: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.4046: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.4047: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.4048: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.4049: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.4050: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.4051: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.4052: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.4053: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD
Source.4054: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.4055: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.4056: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.4057: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3
Source.4058: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.4059: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.4060: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.4061: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.4062: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.4063: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.4064: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.4065: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.4066: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.4067: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.4068: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A
Source.4069: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.4070: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.4071: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.4072: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.4073: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.4074: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.4075: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20
Source.4076: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4
Source.4077: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog
Source.4078: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.4079: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.4080: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.4081: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.4082: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.4083: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.4084: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.4085: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.4086: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.4087: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.4088: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.4089: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.4090: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.4091: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.4092: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.4093: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.4094: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.4095: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.4096: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.4097: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.4098: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.4099: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.4100: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.4101: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.4102: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.4103: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.4104: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.4105: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.4106: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.4107: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.4108: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5
Source.4109: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3
Source.4110: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.4111: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.4112: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.4113: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.4114: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.4115: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.4116: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N
Source.4117: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.4118: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.4119: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.4120: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.4121: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.4122: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.4123: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.4124: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta
Source.4125: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.4126: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.4127: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.4128: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.4129: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase
Source.4130: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.4131: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.4132: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.4133: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.4134: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1
Source.4135: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.4136: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.4137: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.4138: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.4139: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.4140: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.4141: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.4142: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.4143: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.4144: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4145: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.4146: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.4147: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.4148: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.4149: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.4150: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.4151: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1
Source.4152: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.4153: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.4154: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.4155: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.4156: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.4157: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.4158: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.4159: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.4160: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.4161: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.4162: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.4163: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.4164: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog
Source.4165: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.4166: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.4167: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.4168: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.4169: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.4170: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.4171: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.4172: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.4173: DFBPPR19654 ---- Animal proteins ---- Alpha-endosulfine
Source.4174: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.4175: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.4176: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.4177: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E
Source.4178: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.4179: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.4180: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.4181: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1
Source.4182: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.4183: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.4184: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.4185: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.4186: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.4187: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.4188: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.4189: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.4190: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.4191: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.4192: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.4193: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.4194: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.4195: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.4196: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3
Source.4197: DFBPPR19745 ---- Animal proteins ---- Collectin-46
Source.4198: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.4199: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.4200: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.4201: DFBPPR19769 ---- Animal proteins ---- Septin-14
Source.4202: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.4203: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.4204: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.4205: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.4206: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.4207: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1
Source.4208: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.4209: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.4210: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1
Source.4211: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3
Source.4212: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.4213: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.4214: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.4215: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.4216: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.4217: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.4218: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6
Source.4219: DFBPPR19820 ---- Animal proteins ---- Septin-10
Source.4220: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.4221: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.4222: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.4223: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.4224: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.4225: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.4226: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.4227: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.4228: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.4229: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.4230: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.4231: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.4232: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.4233: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial
Source.4234: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.4235: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.4236: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.4237: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.4238: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.4239: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.4240: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.4241: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.4242: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1
Source.4243: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.4244: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.4245: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.4246: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A
Source.4247: DFBPPR19880 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.4248: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.4249: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2
Source.4250: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.4251: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase
Source.4252: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.4253: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.4254: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30
Source.4255: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.4256: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.4257: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.4258: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.4259: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.4260: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.4261: DFBPPR19921 ---- Animal proteins ---- Histone deacetylase complex subunit SAP18
Source.4262: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.4263: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.4264: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.4265: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6
Source.4266: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial
Source.4267: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.4268: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial
Source.4269: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.4270: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.4271: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.4272: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.4273: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.4274: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.4275: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.4276: DFBPPR19958 ---- Animal proteins ---- 60S ribosomal protein L10
Source.4277: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.4278: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.4279: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.4280: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial
Source.4281: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4
Source.4282: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.4283: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.4284: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.4285: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1
Source.4286: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.4287: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.4288: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.4289: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.4290: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.4291: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.4292: DFBPPR19995 ---- Animal proteins ---- 39S ribosomal protein L55, mitochondrial
Source.4293: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16
Source.4294: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.4295: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1
Source.4296: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.4297: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.4298: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.4299: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.4300: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4301: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1
Source.4302: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.4303: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.4304: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.4305: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.4306: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9
Source.4307: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.4308: DFBPPR20036 ---- Animal proteins ---- Urocortin-3
Source.4309: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.4310: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.4311: DFBPPR20045 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 2, mitochondrial
Source.4312: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2
Source.4313: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.4314: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.4315: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.4316: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.4317: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.4318: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial
Source.4319: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.4320: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.4321: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.4322: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.4323: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.4324: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.4325: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.4326: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.4327: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.4328: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.4329: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4330: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.4331: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.4332: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.4333: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.4334: DFBPPR20123 ---- Animal proteins ---- Securin
Source.4335: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.4336: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.4337: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.4338: DFBPPR20145 ---- Animal proteins ---- Adipogenin
Source.4339: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.4340: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.4341: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.4342: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.4343: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2
Source.4344: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.4345: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.4346: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.4347: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.4348: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98
Source.4349: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.4350: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4
Source.4351: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.4352: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.4353: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.4354: DFBPPR20212 ---- Animal proteins ---- Outer dense fiber protein 1
Source.4355: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.4356: DFBPPR20215 ---- Animal proteins ---- Caspase-3
Source.4357: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.4358: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.4359: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.4360: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.4361: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.4362: DFBPPR20235 ---- Animal proteins ---- Gamma-crystallin A
Source.4363: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B
Source.4364: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.4365: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.4366: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.4367: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.4368: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.4369: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4370: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.4371: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.4372: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.4373: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.4374: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.4375: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.4376: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.4377: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.4378: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.4379: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.4380: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator
Source.4381: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3
Source.4382: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.4383: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3
Source.4384: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV
Source.4385: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.4386: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.4387: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.4388: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4389: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial
Source.4390: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.4391: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.4392: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.4393: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.4394: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.4395: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.4396: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.4397: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7
Source.4398: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.4399: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.4400: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.4401: DFBPPR20369 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1
Source.4402: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.4403: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2
Source.4404: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.4405: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.4406: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.4407: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.4408: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.4409: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.4410: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.4411: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial
Source.4412: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.4413: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2
Source.4414: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.4415: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.4416: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.4417: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.4418: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.4419: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.4420: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.4421: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.4422: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.4423: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5
Source.4424: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.4425: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.4426: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.4427: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.4428: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.4429: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.4430: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP
Source.4431: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.4432: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.4433: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.4434: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.4435: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1
Source.4436: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.4437: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.4438: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.4439: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.4440: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.4441: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.4442: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.4443: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.4444: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.4445: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.4446: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2
Source.4447: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.4448: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.4449: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.4450: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.4451: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.4452: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.4453: DFBPPR20531 ---- Animal proteins ---- Myozenin-2
Source.4454: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.4455: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.4456: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.4457: DFBPPR20537 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 3
Source.4458: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16
Source.4459: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.4460: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial
Source.4461: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.4462: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.4463: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.4464: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.4465: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.4466: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.4467: DFBPPR20569 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 10
Source.4468: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.4469: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.4470: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a
Source.4471: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.4472: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.4473: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.4474: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.4475: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.4476: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74
Source.4477: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.4478: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.4479: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.4480: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.4481: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.4482: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.4483: DFBPPR20613 ---- Animal proteins ---- Gamma-crystallin D
Source.4484: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.4485: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.4486: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.4487: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.4488: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.4489: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.4490: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47
Source.4491: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.4492: DFBPPR20638 ---- Animal proteins ---- DPH3 homolog
Source.4493: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.4494: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.4495: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.4496: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.4497: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.4498: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.4499: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.4500: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.4501: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.4502: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.4503: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.4504: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.4505: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.4506: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.4507: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.4508: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.4509: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.4510: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.4511: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.4512: DFBPPR20699 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 31
Source.4513: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.4514: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.4515: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.4516: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.4517: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.4518: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.4519: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.4520: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.4521: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.4522: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.4523: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.4524: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6
Source.4525: DFBPPR20730 ---- Animal proteins ---- Gamma-crystallin F
Source.4526: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.4527: DFBPPR20736 ---- Animal proteins ---- Osteopontin-K
Source.4528: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.4529: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.4530: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.4531: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.4532: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf
Source.4533: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.4534: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.4535: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.4536: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.4537: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.4538: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.4539: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.4540: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.4541: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.4542: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.4543: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.4544: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.4545: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4
Source.4546: DFBPPR20805 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.4547: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.4548: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.4549: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.4550: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.4551: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2
Source.4552: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.4553: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.4554: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.4555: DFBPPR20828 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1
Source.4556: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.4557: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.4558: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.4559: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.4560: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.4561: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.4562: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.4563: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.4564: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.4565: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.4566: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.4567: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.4568: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4
Source.4569: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5
Source.4570: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.4571: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.4572: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.4573: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.4574: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.4575: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.4576: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3
Source.4577: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.4578: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3
Source.4579: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.4580: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.4581: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.4582: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.4583: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.4584: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.4585: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.4586: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.4587: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.4588: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.4589: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.4590: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.4591: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.4592: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.4593: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A
Source.4594: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4
Source.4595: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.4596: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.4597: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B
Source.4598: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9
Source.4599: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.4600: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.4601: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.4602: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog
Source.4603: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.4604: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein
Source.4605: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.4606: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.4607: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.4608: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.4609: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.4610: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.4611: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27
Source.4612: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial
Source.4613: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.4614: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.4615: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.4616: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.4617: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.4618: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.4619: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.4620: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2
Source.4621: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.4622: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.4623: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.4624: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.4625: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.4626: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.4627: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.4628: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.4629: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1
Source.4630: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.4631: DFBPPR21040 ---- Animal proteins ---- Neuritin
Source.4632: DFBPPR21041 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.4633: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.4634: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.4635: DFBPPR21051 ---- Animal proteins ---- SH2 domain-containing protein 1A
Source.4636: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.4637: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.4638: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B
Source.4639: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.4640: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.4641: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.4642: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.4643: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial
Source.4644: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.4645: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.4646: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.4647: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.4648: DFBPPR21090 ---- Animal proteins ---- Developmental pluripotency-associated protein 3
Source.4649: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.4650: DFBPPR21092 ---- Animal proteins ---- Calponin-1
Source.4651: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.4652: DFBPPR21095 ---- Animal proteins ---- 28S ribosomal protein S33, mitochondrial
Source.4653: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.4654: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.4655: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32
Source.4656: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin
Source.4657: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.4658: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.4659: DFBPPR21132 ---- Animal proteins ---- Regulator of G-protein signaling 7-binding protein
Source.4660: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.4661: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.4662: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.4663: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1
Source.4664: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.4665: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1
Source.4666: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4
Source.4667: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.4668: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.4669: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.4670: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.4671: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.4672: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.4673: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.4674: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.4675: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.4676: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4
Source.4677: DFBPPR21197 ---- Animal proteins ---- Spindle and kinetochore-associated protein 2
Source.4678: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.4679: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.4680: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.4681: DFBPPR21210 ---- Animal proteins ---- T-cell receptor-associated transmembrane adapter 1
Source.4682: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.4683: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.4684: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.4685: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.4686: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.4687: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.4688: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.4689: DFBPPR21242 ---- Animal proteins ---- Tachykinin-3
Source.4690: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.4691: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.4692: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.4693: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.4694: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.4695: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.4696: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.4697: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.4698: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.4699: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.4700: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.4701: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.4702: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.4703: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.4704: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.4705: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.4706: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.4707: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.4708: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.4709: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.4710: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.4711: DFBPPR21323 ---- Animal proteins ---- Trefoil factor 3
Source.4712: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.4713: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.4714: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.4715: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.4716: DFBPPR21343 ---- Animal proteins ---- DNA polymerase delta subunit 4
Source.4717: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.4718: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.4719: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.4720: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.4721: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.4722: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4
Source.4723: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.4724: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.4725: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.4726: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.4727: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.4728: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.4729: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.4730: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.4731: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu
Source.4732: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.4733: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.4734: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.4735: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.4736: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.4737: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.4738: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4739: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1
Source.4740: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.4741: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.4742: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37
Source.4743: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.4744: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.4745: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.4746: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1
Source.4747: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.4748: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.4749: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.4750: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.4751: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.4752: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.4753: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5
Source.4754: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.4755: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.4756: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.4757: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.4758: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.4759: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.4760: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.4761: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.4762: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.4763: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.4764: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.4765: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.4766: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.4767: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.4768: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.4769: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.4770: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.4771: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.4772: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.4773: DFBPPR21486 ---- Animal proteins ---- Caspase recruitment domain-containing protein 19
Source.4774: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.4775: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.4776: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.4777: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.4778: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.4779: DFBPPR21509 ---- Animal proteins ---- Myoneurin
Source.4780: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2
Source.4781: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.4782: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.4783: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.4784: DFBPPR21535 ---- Animal proteins ---- Gastrotropin
Source.4785: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.4786: DFBPPR21546 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 29
Source.4787: DFBPPR21548 ---- Animal proteins ---- Cornifelin
Source.4788: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.4789: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma
Source.4790: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c
Source.4791: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3
Source.4792: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1
Source.4793: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3
Source.4794: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.4795: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.4796: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.4797: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.4798: DFBPPR21580 ---- Animal proteins ---- Density-regulated protein
Source.4799: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.4800: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.4801: DFBPPR21586 ---- Animal proteins ---- Cyclin-C
Source.4802: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.4803: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.4804: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.4805: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.4806: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.4807: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.4808: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.4809: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.4810: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.4811: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.4812: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.4813: DFBPPR21631 ---- Animal proteins ---- 39S ribosomal protein L49, mitochondrial
Source.4814: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19
Source.4815: DFBPPR21640 ---- Animal proteins ---- 60S ribosomal protein L35
Source.4816: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein
Source.4817: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.4818: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.4819: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.4820: DFBPPR21654 ---- Animal proteins ---- DET1- and DDB1-associated protein 1
Source.4821: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.4822: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.4823: DFBPPR21667 ---- Animal proteins ---- Four and a half LIM domains protein 5
Source.4824: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.4825: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.4826: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.4827: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.4828: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.4829: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.4830: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.4831: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.4832: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.4833: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.4834: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.4835: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.4836: DFBPPR21740 ---- Animal proteins ---- 60S ribosomal protein L36
Source.4837: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.4838: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.4839: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190
Source.4840: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.4841: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.4842: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.4843: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.4844: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.4845: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.4846: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.4847: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.4848: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.4849: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.4850: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.4851: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.4852: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.4853: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.4854: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.4855: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.4856: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24
Source.4857: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.4858: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.4859: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.4860: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.4861: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD
Source.4862: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.4863: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.4864: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.4865: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.4866: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2
Source.4867: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.4868: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS
Source.4869: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.4870: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.4871: DFBPPR21878 ---- Animal proteins ---- Statherin
Source.4872: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.4873: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.4874: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.4875: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial
Source.4876: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.4877: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.4878: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.4879: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.4880: DFBPPR21920 ---- Animal proteins ---- Protein DPCD
Source.4881: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.4882: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4883: DFBPPR21930 ---- Animal proteins ---- Protein Churchill
Source.4884: DFBPPR21934 ---- Animal proteins ---- Transcription elongation factor A protein-like 8
Source.4885: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.4886: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.4887: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.4888: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.4889: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.4890: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.4891: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.4892: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.4893: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.4894: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.4895: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.4896: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.4897: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.4898: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.4899: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6
Source.4900: DFBPPR21978 ---- Animal proteins ---- Cx9C motif-containing protein 4
Source.4901: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.4902: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4903: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.4904: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8
Source.4905: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.4906: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1
Source.4907: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.4908: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.4909: DFBPPR22004 ---- Animal proteins ---- 60S ribosomal protein L35a
Source.4910: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.4911: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.4912: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.4913: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.4914: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.4915: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2
Source.4916: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.4917: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.4918: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.4919: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.4920: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.4921: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.4922: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.4923: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.4924: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.4925: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.4926: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog
Source.4927: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ
Source.4928: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.4929: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A
Source.4930: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.4931: DFBPPR22065 ---- Animal proteins ---- 60S ribosomal protein L10-like
Source.4932: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.4933: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.4934: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4
Source.4935: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.4936: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.4937: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein
Source.4938: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.4939: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.4940: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.4941: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.4942: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.4943: DFBPPR22099 ---- Animal proteins ---- Beta-centractin
Source.4944: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1
Source.4945: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1
Source.4946: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.4947: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.4948: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.4949: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.4950: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.4951: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.4952: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.4953: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.4954: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.4955: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1
Source.4956: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.4957: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.4958: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.4959: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.4960: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.4961: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.4962: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.4963: DFBPPR22173 ---- Animal proteins ---- Electron transfer flavoprotein regulatory factor 1
Source.4964: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog
Source.4965: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.4966: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.4967: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.4968: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.4969: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5
Source.4970: DFBPPR22197 ---- Animal proteins ---- Nuclear receptor 2C2-associated protein
Source.4971: DFBPPR22200 ---- Animal proteins ---- Profilin-4
Source.4972: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.4973: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.4974: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.4975: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.4976: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog
Source.4977: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.4978: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.4979: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.4980: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.4981: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.4982: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.4983: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.4984: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26
Source.4985: DFBPPR22246 ---- Animal proteins ---- Pancreatic progenitor cell differentiation and proliferation factor
Source.4986: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.4987: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.4988: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1
Source.4989: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.4990: DFBPPR22269 ---- Animal proteins ---- Protein preY, mitochondrial
Source.4991: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.4992: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.4993: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.4994: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.4995: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.4996: DFBPPR22297 ---- Animal proteins ---- Histatherin
Source.4997: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.4998: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.4999: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2
Source.5000: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.5001: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.5002: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.5003: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.5004: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.5005: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.5006: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.5007: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.5008: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.5009: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.5010: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.5011: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7
Source.5012: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.5013: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.5014: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.5015: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5
Source.5016: DFBPPR22392 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1A
Source.5017: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.5018: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.5019: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.5020: DFBPPR22399 ---- Animal proteins ---- Transgelin-3
Source.5021: DFBPPR22402 ---- Animal proteins ---- Alternative prion protein
Source.5022: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog
Source.5023: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.5024: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.5025: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.5026: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.5027: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1
Source.5028: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B
Source.5029: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2
Source.5030: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.5031: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.5032: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein
Source.5033: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13
Source.5034: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.5035: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog
Source.5036: DFBPPR22479 ---- Animal proteins ---- Transcription elongation factor A protein-like 1
Source.5037: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.5038: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.5039: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183
Source.5040: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1
Source.5041: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.5042: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.5043: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.5044: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141
Source.5045: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.5046: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.5047: DFBPPR22535 ---- Animal proteins ---- Protein FAM205C
Source.5048: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.5049: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.5050: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.5051: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.5052: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.5053: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1
Source.5054: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.5055: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein
Source.5056: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.5057: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.5058: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog
Source.5059: DFBPPR22577 ---- Animal proteins ---- Uncharacterized protein C12orf31 homolog
Source.5060: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1
Source.5061: DFBPPR22582 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein
Source.5062: DFBPPR22596 ---- Animal proteins ---- Ubiquitin domain-containing protein 2
Source.5063: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.5064: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.5065: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.5066: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71
Source.5067: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.5068: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.5069: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.5070: DFBPPR22623 ---- Animal proteins ---- Lysine-rich coiled-coil protein 1
Source.5071: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30
Source.5072: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.5073: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4
Source.5074: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.5075: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.5076: DFBPPR22650 ---- Animal proteins ---- Protein FAM183A
Source.5077: DFBPPR22653 ---- Animal proteins ---- Coiled-coil domain-containing protein 152
Source.5078: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.5079: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog
Source.5080: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89
Source.5081: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9
Source.5082: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.5083: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.5084: DFBPPR22682 ---- Animal proteins ---- Protein FAM216A
Source.5085: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.5086: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.5087: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.5088: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.5089: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein
Source.5090: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.5091: DFBPPR22710 ---- Animal proteins ---- RIIa domain-containing protein 1
Source.5092: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.5093: DFBPPR22731 ---- Animal proteins ---- Uncharacterized protein C12orf54 homolog
Source.5094: DFBPPR22744 ---- Animal proteins ---- Uncharacterized protein C10orf82 homolog
Source.5095: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog
Source.5096: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.5097: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog
Source.5098: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog
Source.5099: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog
Source.5100: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog
Source.5101: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.5102: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.5103: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.5104: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.5105: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.5106: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.5107: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.5108: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.5109: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.5110: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.5111: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.5112: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.5113: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.5114: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.5115: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.5116: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.5117: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.5118: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.5119: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.5120: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.5121: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.5122: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.5123: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5124: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.5125: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.5126: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.5127: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.5128: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.5129: DFBPPR8568 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.5130: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.5131: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5132: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.5133: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.5134: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.5135: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.5136: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.5137: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.5138: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.5139: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.5140: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.5141: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.5142: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.5143: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.5144: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.5145: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.5146: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.5147: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.5148: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.5149: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.5150: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.5151: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6
Source.5152: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.5153: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.5154: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.5155: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.5156: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5157: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.5158: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.5159: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.5160: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.5161: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.5162: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.5163: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.5164: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.5165: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.5166: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.5167: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.5168: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.5169: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.5170: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.5171: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.5172: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.5173: DFBPPR8651 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.5174: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.5175: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.5176: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.5177: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.5178: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.5179: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.5180: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.5181: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.5182: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.5183: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.5184: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.5185: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.5186: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.5187: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.5188: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.5189: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.5190: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.5191: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.5192: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.5193: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.5194: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.5195: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.5196: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.5197: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.5198: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.5199: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.5200: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.5201: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.5202: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.5203: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.5204: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.5205: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.5206: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.5207: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.5208: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.5209: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.5210: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.5211: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.5212: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.5213: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.5214: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.5215: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.5216: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.5217: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.5218: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.5219: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.5220: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.5221: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5222: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.5223: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.5224: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.5225: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.5226: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.5227: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.5228: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.5229: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.5230: DFBPPR8788 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.5231: DFBPPR8789 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.5232: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.5233: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.5234: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.5235: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.5236: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.5237: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II
Source.5238: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.5239: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.5240: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.5241: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.5242: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.5243: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.5244: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.5245: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.5246: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2
Source.5247: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.5248: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.5249: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.5250: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.5251: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.5252: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.5253: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.5254: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.5255: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.5256: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.5257: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.5258: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.5259: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.5260: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.5261: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.5262: DFBPPR8870 ---- Animal proteins ---- Ribonuclease K3
Source.5263: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.5264: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.5265: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.5266: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.5267: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.5268: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.5269: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.5270: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.5271: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.5272: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.5273: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.5274: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.5275: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.5276: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.5277: DFBPPR8926 ---- Animal proteins ---- Osteocalcin
Source.5278: DFBPPR8927 ---- Animal proteins ---- Pro-neuropeptide Y
Source.5279: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.5280: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta
Source.5281: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.5282: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.5283: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.5284: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.5285: DFBPPR8973 ---- Animal proteins ---- Caspase-3
Source.5286: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.5287: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.5288: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.5289: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.5290: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.5291: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.5292: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.5293: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.5294: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta
Source.5295: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.5296: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.5297: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic
Source.5298: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.5299: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.5300: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.5301: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.5302: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.5303: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.5304: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.5305: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.5306: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.5307: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.5308: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.5309: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.5310: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.5311: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.5312: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain
Source.5313: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.5314: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.5315: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.5316: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.5317: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.5318: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.5319: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.5320: DFBPPR9074 ---- Animal proteins ---- Trefoil factor 2
Source.5321: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5322: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.5323: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.5324: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.5325: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.5326: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.5327: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.5328: DFBPPR9098 ---- Animal proteins ---- Gastrotropin
Source.5329: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.5330: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.5331: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.5332: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.5333: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.5334: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.5335: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.5336: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.5337: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.5338: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.5339: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.5340: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.5341: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.5342: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.5343: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5344: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.5345: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.5346: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.5347: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.5348: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.5349: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.5350: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.5351: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.5352: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.5353: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.5354: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.5355: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase
Source.5356: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.5357: DFBPPR9176 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.5358: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.5359: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.5360: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.5361: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.5362: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.5363: DFBPPR9189 ---- Animal proteins ---- Follitropin subunit beta
Source.5364: DFBPPR9190 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.5365: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2
Source.5366: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.5367: DFBPPR9198 ---- Animal proteins ---- Fibroblast growth factor 7
Source.5368: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.5369: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.5370: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D
Source.5371: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.5372: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.5373: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.5374: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.5375: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.5376: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.5377: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.5378: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.5379: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.5380: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.5381: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.5382: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.5383: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.5384: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.5385: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.5386: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.5387: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.5388: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.5389: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.5390: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.5391: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.5392: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.5393: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.5394: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.5395: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.5396: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.5397: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.5398: DFBPPR9266 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.5399: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.5400: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.5401: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.5402: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.5403: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.5404: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.5405: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.5406: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.5407: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.5408: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.5409: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.5410: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27
Source.5411: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.5412: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.5413: DFBPPR9294 ---- Animal proteins ---- 60S ribosomal protein L10
Source.5414: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2
Source.5415: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.5416: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.5417: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.5418: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.5419: DFBPPR9304 ---- Animal proteins ---- Peroxiredoxin-2
Source.5420: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.5421: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.5422: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.5423: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.5424: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.5425: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.5426: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.5427: DFBPPR9318 ---- Animal proteins ---- Alpha-endosulfine
Source.5428: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.5429: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.5430: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.5431: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.5432: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.5433: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.5434: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.5435: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.5436: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.5437: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.5438: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.5439: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.5440: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.5441: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.5442: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.5443: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.5444: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.5445: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.5446: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.5447: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.5448: DFBPPR9367 ---- Animal proteins ---- Peptide YY
Source.5449: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.5450: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.5451: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.5452: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.5453: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.5454: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.5455: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.5456: DFBPPR9404 ---- Animal proteins ---- Tryptase
Source.5457: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.5458: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.5459: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.5460: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.5461: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.5462: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.5463: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.5464: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.5465: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.5466: DFBPPR9428 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.5467: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.5468: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.5469: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.5470: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.5471: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.5472: DFBPPR9445 ---- Animal proteins ---- Securin
Source.5473: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.5474: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.5475: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.5476: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.5477: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.5478: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.5479: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.5480: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.5481: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.5482: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.5483: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.5484: DFBPPR9496 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.5485: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.5486: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.5487: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.5488: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.5489: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.5490: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.5491: DFBPPR9523 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.5492: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.5493: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.5494: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.5495: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE
Source.5496: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.5497: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.5498: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.5499: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.5500: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.5501: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.5502: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.5503: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.5504: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.5505: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.5506: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.5507: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.5508: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.5509: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.5510: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.5511: DFBPPR9588 ---- Animal proteins ---- ATP synthase protein 8
Source.5512: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.5513: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.5514: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor
Source.5515: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.5516: DFBPPR9602 ---- Animal proteins ---- Gastrin-releasing peptide
Source.5517: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.5518: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.5519: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor
Source.5520: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.5521: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.5522: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.5523: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.5524: DFBPPR9630 ---- Animal proteins ---- Calponin-1
Source.5525: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.5526: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.5527: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.5528: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase
Source.5529: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.5530: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.5531: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.5532: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.5533: DFBPPR9662 ---- Animal proteins ---- 60S ribosomal protein L35
Source.5534: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.5535: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.5536: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.5537: DFBPPR9669 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.5538: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.5539: DFBPPR9673 ---- Animal proteins ---- Neurokinin-B
Source.5540: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.5541: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5542: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.5543: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.5544: DFBPPR9688 ---- Animal proteins ---- Outer dense fiber protein 1
Source.5545: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.5546: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.5547: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.5548: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta
Source.5549: DFBPPR9711 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.5550: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.5551: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.5552: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.5553: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.5554: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.5555: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.5556: DFBPPR9730 ---- Animal proteins ---- Urotensin-2
Source.5557: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.5558: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.5559: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.5560: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis
Source.5561: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.5562: DFBPPR9745 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.5563: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.5564: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region
Source.5565: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.5566: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide
Source.5567: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.5568: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.5569: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.5570: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.5571: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.5572: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.5573: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32
Source.5574: DFBPPR9786 ---- Animal proteins ---- Adipogenin
Source.5575: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.5576: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.5577: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.5578: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.5579: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.5580: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.5581: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.5582: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.5583: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.5584: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.5585: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1
Source.5586: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.5587: DFBPPR9843 ---- Animal proteins ---- P protein
Source.5588: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.5589: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.5590: DFBPPR9866 ---- Animal proteins ---- SH2 domain-containing protein 1A
Source.5591: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.5592: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.5593: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3
Source.5594: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.5595: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.5596: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.5597: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.5598: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3
Source.5599: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.5600: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin
Source.5601: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.5602: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.5603: DFBPPR9947 ---- Animal proteins ---- Hypothalamic tetradecapeptide
Source.5604: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.5605: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.5606: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.5607: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.5608: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.5609: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor
Source.5610: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.5611: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.5612: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.5613: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.5614: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.5615: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.5616: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.5617: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.5618: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.5619: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.5620: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.5621: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.5622: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.5623: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.5624: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.5625: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.5626: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.5627: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.5628: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.5629: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.5630: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.5631: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.5632: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.5633: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides
Source.5634: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.5635: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.5636: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.5637: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.5638: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.5639: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.5640: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.5641: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.5642: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.5643: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.5644: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.5645: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.5646: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.5647: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.5648: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a
Source.5649: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.5650: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.5651: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.5652: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.5653: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6
Source.5654: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.5655: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.5656: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.5657: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.5658: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.5659: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.5660: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.5661: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.5662: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.5663: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.5664: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5665: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor
Source.5666: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.5667: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.5668: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.5669: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.5670: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.5671: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.5672: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.5673: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.5674: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.5675: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.5676: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.5677: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.5678: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.5679: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.5680: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.5681: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.5682: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.5683: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.5684: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.5685: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5686: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.5687: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.5688: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.5689: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.5690: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.5691: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.5692: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.5693: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.5694: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.5695: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.5696: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.5697: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.5698: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.5699: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.5700: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.5701: DFBPPR10172 ---- Animal proteins ---- Basic helix-loop-helix transcription factor scleraxis
Source.5702: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.5703: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.5704: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.5705: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3
Source.5706: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.5707: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.5708: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.5709: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.5710: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.5711: DFBPPR10195 ---- Animal proteins ---- SUMO-conjugating enzyme UBC9
Source.5712: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.5713: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.5714: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.5715: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.5716: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.5717: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.5718: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.5719: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.5720: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.5721: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.5722: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.5723: DFBPPR10217 ---- Animal proteins ---- Follistatin
Source.5724: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.5725: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.5726: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.5727: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.5728: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.5729: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.5730: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.5731: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.5732: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.5733: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.5734: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.5735: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8
Source.5736: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.5737: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.5738: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.5739: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.5740: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.5741: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.5742: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.5743: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.5744: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.5745: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.5746: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.5747: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.5748: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.5749: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.5750: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.5751: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.5752: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.5753: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.5754: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.5755: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.5756: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.5757: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.5758: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.5759: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.5760: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.5761: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.5762: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.5763: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.5764: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5765: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.5766: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.5767: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.5768: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.5769: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.5770: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.5771: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.5772: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.5773: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.5774: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.5775: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.5776: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.5777: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.5778: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.5779: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.5780: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.5781: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1
Source.5782: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.5783: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.5784: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.5785: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.5786: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.5787: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5788: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.5789: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC
Source.5790: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.5791: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.5792: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.5793: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.5794: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta
Source.5795: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.5796: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.5797: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.5798: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.5799: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.5800: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.5801: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.5802: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.5803: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.5804: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.5805: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.5806: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.5807: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.5808: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.5809: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.5810: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.5811: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.5812: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.5813: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.5814: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.5815: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.5816: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.5817: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.5818: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.5819: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.5820: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.5821: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.5822: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.5823: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.5824: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.5825: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.5826: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.5827: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.5828: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.5829: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.5830: DFBPPR10433 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.5831: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.5832: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.5833: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.5834: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.5835: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.5836: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.5837: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.5838: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.5839: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.5840: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.5841: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.5842: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.5843: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.5844: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.5845: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.5846: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.5847: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.5848: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.5849: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.5850: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.5851: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.5852: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.5853: DFBPPR10477 ---- Animal proteins ---- Aprataxin
Source.5854: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.5855: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.5856: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.5857: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.5858: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.5859: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6
Source.5860: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.5861: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.5862: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1
Source.5863: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.5864: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.5865: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.5866: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.5867: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.5868: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.5869: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.5870: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.5871: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.5872: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.5873: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.5874: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2
Source.5875: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.5876: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.5877: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.5878: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.5879: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.5880: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.5881: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.5882: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.5883: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.5884: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.5885: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.5886: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.5887: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor
Source.5888: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.5889: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.5890: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.5891: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5892: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.5893: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.5894: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.5895: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.5896: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.5897: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.5898: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.5899: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.5900: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.5901: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.5902: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.5903: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.5904: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.5905: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.5906: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.5907: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.5908: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.5909: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.5910: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.5911: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.5912: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.5913: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.5914: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.5915: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.5916: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.5917: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.5918: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.5919: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.5920: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.5921: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.5922: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.5923: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.5924: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.5925: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.5926: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.5927: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.5928: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.5929: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.5930: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.5931: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.5932: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.5933: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.5934: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.5935: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.5936: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.5937: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.5938: DFBPPR10634 ---- Animal proteins ---- Procathepsin L
Source.5939: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.5940: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.5941: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.5942: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.5943: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.5944: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.5945: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.5946: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.5947: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.5948: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.5949: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.5950: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.5951: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.5952: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.5953: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.5954: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.5955: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.5956: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.5957: DFBPPR10680 ---- Animal proteins ---- Hemoglobin subunit pi
Source.5958: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.5959: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.5960: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.5961: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.5962: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.5963: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.5964: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.5965: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase
Source.5966: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.5967: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.5968: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.5969: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.5970: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.5971: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.5972: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.5973: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.5974: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.5975: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.5976: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.5977: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.5978: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.5979: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.5980: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.5981: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.5982: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.5983: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.5984: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.5985: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.5986: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.5987: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.5988: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.5989: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.5990: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10
Source.5991: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.5992: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.5993: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.5994: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.5995: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.5996: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.5997: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.5998: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.5999: DFBPPR10757 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.6000: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.6001: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.6002: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.6003: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6004: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.6005: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.6006: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.6007: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.6008: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.6009: DFBPPR10794 ---- Animal proteins ---- Zyxin
Source.6010: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.6011: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.6012: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.6013: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.6014: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.6015: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.6016: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.6017: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.6018: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.6019: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.6020: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.6021: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.6022: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.6023: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.6024: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.6025: DFBPPR10831 ---- Animal proteins ---- Early growth response protein 1
Source.6026: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.6027: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.6028: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.6029: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.6030: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.6031: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.6032: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.6033: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.6034: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.6035: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.6036: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.6037: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.6038: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.6039: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase
Source.6040: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.6041: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.6042: DFBPPR10873 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-2
Source.6043: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.6044: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.6045: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3
Source.6046: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.6047: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.6048: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.6049: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.6050: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.6051: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.6052: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.6053: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.6054: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.6055: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.6056: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.6057: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.6058: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.6059: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2
Source.6060: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.6061: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.6062: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.6063: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.6064: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.6065: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6066: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.6067: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.6068: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.6069: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.6070: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.6071: DFBPPR10934 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.6072: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.6073: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.6074: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.6075: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.6076: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.6077: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.6078: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.6079: DFBPPR10952 ---- Animal proteins ---- Protein XRP2
Source.6080: DFBPPR10954 ---- Animal proteins ---- Protein max
Source.6081: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2
Source.6082: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho
Source.6083: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.6084: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.6085: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.6086: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.6087: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.6088: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.6089: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.6090: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.6091: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.6092: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.6093: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.6094: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.6095: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.6096: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.6097: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.6098: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.6099: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.6100: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.6101: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.6102: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.6103: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.6104: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.6105: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.6106: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.6107: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.6108: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.6109: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.6110: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.6111: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.6112: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.6113: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.6114: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.6115: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.6116: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.6117: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.6118: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.6119: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.6120: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.6121: DFBPPR11048 ---- Animal proteins ---- Calcitonin
Source.6122: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.6123: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.6124: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.6125: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.6126: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.6127: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.6128: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.6129: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.6130: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.6131: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2
Source.6132: DFBPPR11070 ---- Animal proteins ---- Protein sprouty homolog 1
Source.6133: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.6134: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.6135: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.6136: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.6137: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.6138: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6139: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.6140: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.6141: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.6142: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.6143: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.6144: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.6145: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.6146: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.6147: DFBPPR11091 ---- Animal proteins ---- Pro-neuropeptide Y
Source.6148: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.6149: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.6150: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.6151: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.6152: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.6153: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.6154: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.6155: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.6156: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.6157: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.6158: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.6159: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.6160: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.6161: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.6162: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.6163: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.6164: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.6165: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.6166: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.6167: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.6168: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.6169: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.6170: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.6171: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.6172: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.6173: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.6174: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.6175: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.6176: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.6177: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.6178: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.6179: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.6180: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.6181: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.6182: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b
Source.6183: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.6184: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.6185: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.6186: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.6187: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.6188: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.6189: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.6190: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.6191: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.6192: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.6193: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.6194: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.6195: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.6196: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.6197: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.6198: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.6199: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.6200: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.6201: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.6202: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone
Source.6203: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.6204: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.6205: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.6206: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.6207: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.6208: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.6209: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.6210: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.6211: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.6212: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.6213: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.6214: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.6215: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.6216: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.6217: DFBPPR11244 ---- Animal proteins ---- Frizzled-6
Source.6218: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.6219: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3
Source.6220: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.6221: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.6222: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3
Source.6223: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.6224: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.6225: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.6226: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.6227: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.6228: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.6229: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.6230: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.6231: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.6232: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein
Source.6233: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.6234: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.6235: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.6236: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.6237: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.6238: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.6239: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.6240: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.6241: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.6242: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.6243: DFBPPR11301 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19
Source.6244: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.6245: DFBPPR11306 ---- Animal proteins ---- Transcription factor 15
Source.6246: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.6247: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.6248: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.6249: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.6250: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.6251: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.6252: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.6253: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.6254: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.6255: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.6256: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.6257: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.6258: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.6259: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.6260: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.6261: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.6262: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.6263: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.6264: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.6265: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.6266: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.6267: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.6268: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.6269: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR
Source.6270: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.6271: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.6272: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.6273: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.6274: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.6275: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.6276: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.6277: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.6278: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.6279: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.6280: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.6281: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.6282: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.6283: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6284: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.6285: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.6286: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.6287: DFBPPR11397 ---- Animal proteins ---- Frizzled-3
Source.6288: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.6289: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.6290: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.6291: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.6292: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.6293: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.6294: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.6295: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.6296: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.6297: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.6298: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.6299: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.6300: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.6301: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.6302: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.6303: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6
Source.6304: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.6305: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6306: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2
Source.6307: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1
Source.6308: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2
Source.6309: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.6310: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.6311: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.6312: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.6313: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.6314: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.6315: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.6316: DFBPPR11478 ---- Animal proteins ---- Gastrin-releasing peptide
Source.6317: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.6318: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.6319: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.6320: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.6321: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.6322: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.6323: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein
Source.6324: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.6325: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.6326: DFBPPR11504 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.6327: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.6328: DFBPPR11510 ---- Animal proteins ---- Gonadoliberin-2
Source.6329: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.6330: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.6331: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.6332: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide
Source.6333: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.6334: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.6335: DFBPPR11528 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.6336: DFBPPR11529 ---- Animal proteins ---- Alpha-endosulfine
Source.6337: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.6338: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.6339: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.6340: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.6341: DFBPPR11537 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.6342: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.6343: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.6344: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.6345: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.6346: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.6347: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.6348: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.6349: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.6350: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.6351: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.6352: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.6353: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.6354: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.6355: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.6356: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.6357: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.6358: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.6359: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.6360: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.6361: DFBPPR11597 ---- Animal proteins ---- Trypsin inhibitor ClTI-1
Source.6362: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.6363: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.6364: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.6365: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.6366: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.6367: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.6368: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.6369: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.6370: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6371: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3
Source.6372: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.6373: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.6374: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6375: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.6376: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.6377: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.6378: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.6379: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.6380: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.6381: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.6382: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.6383: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.6384: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.6385: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.6386: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.6387: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.6388: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.6389: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.6390: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6391: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10
Source.6392: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.6393: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.6394: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.6395: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein
Source.6396: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.6397: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.6398: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.6399: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.6400: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.6401: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.6402: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain
Source.6403: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4
Source.6404: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.6405: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.6406: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.6407: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.6408: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.6409: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.6410: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.6411: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1
Source.6412: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.6413: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.6414: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8
Source.6415: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.6416: DFBPPR11725 ---- Animal proteins ---- D-dopachrome decarboxylase
Source.6417: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.6418: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.6419: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.6420: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.6421: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.6422: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.6423: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.6424: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.6425: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.6426: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.6427: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.6428: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.6429: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.6430: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.6431: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.6432: DFBPPR11765 ---- Animal proteins ---- Peptide YY-like
Source.6433: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.6434: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.6435: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.6436: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.6437: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.6438: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.6439: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.6440: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.6441: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.6442: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.6443: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.6444: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.6445: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.6446: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.6447: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.6448: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17
Source.6449: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.6450: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.6451: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.6452: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27
Source.6453: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.6454: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.6455: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.6456: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.6457: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.6458: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.6459: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.6460: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.6461: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.6462: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.6463: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.6464: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1
Source.6465: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.6466: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.6467: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.6468: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.6469: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.6470: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.6471: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.6472: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.6473: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.6474: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.6475: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.6476: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.6477: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.6478: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.6479: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.6480: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.6481: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant
Source.6482: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.6483: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.6484: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.6485: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.6486: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.6487: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.6488: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.6489: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.6490: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.6491: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.6492: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.6493: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.6494: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.6495: DFBPPR11928 ---- Animal proteins ---- Cyclin-C
Source.6496: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.6497: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.6498: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.6499: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.6500: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.6501: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.6502: DFBPPR11942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.6503: DFBPPR11945 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1
Source.6504: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.6505: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.6506: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.6507: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.6508: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.6509: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.6510: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.6511: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.6512: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.6513: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.6514: DFBPPR11964 ---- Animal proteins ---- Protein LLP homolog
Source.6515: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.6516: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.6517: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.6518: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4
Source.6519: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.6520: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.6521: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.6522: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.6523: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.6524: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.6525: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.6526: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.6527: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.6528: DFBPPR11996 ---- Animal proteins ---- Homeobox protein Hox-A6
Source.6529: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.6530: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.6531: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.6532: DFBPPR12011 ---- Animal proteins ---- Protein Churchill
Source.6533: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.6534: DFBPPR12018 ---- Animal proteins ---- Density-regulated protein
Source.6535: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.6536: DFBPPR12023 ---- Animal proteins ---- 60S ribosomal protein L35
Source.6537: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.6538: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.6539: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.6540: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208
Source.6541: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.6542: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.6543: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.6544: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.6545: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.6546: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.6547: DFBPPR12049 ---- Animal proteins ---- 60S ribosomal protein L36
Source.6548: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.6549: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.6550: DFBPPR12057 ---- Animal proteins ---- Fatty acid-binding protein, smooth muscle
Source.6551: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.6552: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.6553: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.6554: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.6555: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.6556: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4
Source.6557: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.6558: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.6559: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.6560: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.6561: DFBPPR12086 ---- Animal proteins ---- DET1- and DDB1-associated protein 1
Source.6562: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.6563: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.6564: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.6565: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.6566: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.6567: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.6568: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.6569: DFBPPR12106 ---- Animal proteins ---- Ig lambda chain C region
Source.6570: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.6571: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.6572: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.6573: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.6574: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.6575: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.6576: DFBPPR12127 ---- Animal proteins ---- SRY-related protein CH3
Source.6577: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.6578: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.6579: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.6580: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.6581: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.6582: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.6583: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.6584: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.6585: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.6586: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.6587: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.6588: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.6589: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.6590: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.6591: DFBPPR12178 ---- Animal proteins ---- SRY-related protein CH32
Source.6592: DFBPPR12179 ---- Animal proteins ---- SRY-related protein CH31
Source.6593: DFBPPR12182 ---- Animal proteins ---- SRY-related protein CH1
Source.6594: DFBPPR12183 ---- Animal proteins ---- SRY-related protein CH4
Source.6595: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.6596: DFBPPR12185 ---- Animal proteins ---- SRY-related protein CH2
Source.6597: DFBPPR12186 ---- Animal proteins ---- SRY-related protein CH7
Source.6598: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.6599: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.6600: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.6601: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.6602: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.6603: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.6604: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.6605: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7
Source.6606: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.6607: DFBPPR12225 ---- Animal proteins ---- Coiled-coil domain-containing protein 50
Source.6608: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.6609: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.6610: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.6611: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.6612: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog
Source.6613: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.6614: DFBPPR12247 ---- Animal proteins ---- Uncharacterized protein KIAA1671 homolog
Source.6615: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.6616: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.6617: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.6618: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.6619: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.6620: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.6621: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor
Source.6622: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.6623: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.6624: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.6625: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.6626: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.6627: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.6628: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.6629: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.6630: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.6631: DFBPPR12278 ---- Animal proteins ---- Major prion protein
Source.6632: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.6633: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.6634: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.6635: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.6636: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.6637: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.6638: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.6639: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.6640: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.6641: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.6642: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.6643: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.6644: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.6645: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.6646: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.6647: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.6648: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.6649: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.6650: DFBPPR12308 ---- Animal proteins ---- Phospholipase A2, membrane associated
Source.6651: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.6652: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.6653: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.6654: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.6655: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.6656: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.6657: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.6658: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.6659: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.6660: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.6661: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.6662: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.6663: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.6664: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.6665: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.6666: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.6667: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.6668: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.6669: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.6670: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.6671: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.6672: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.6673: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.6674: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.6675: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.6676: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.6677: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1
Source.6678: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.6679: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.6680: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.6681: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.6682: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.6683: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.6684: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.6685: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.6686: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.6687: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.6688: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.6689: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.6690: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6691: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.6692: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.6693: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.6694: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.6695: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.6696: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.6697: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.6698: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.6699: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.6700: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.6701: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.6702: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.6703: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.6704: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.6705: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3
Source.6706: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.6707: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6708: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.6709: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.6710: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.6711: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2
Source.6712: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.6713: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.6714: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.6715: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.6716: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.6717: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.6718: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.6719: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.6720: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.6721: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.6722: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.6723: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.6724: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.6725: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.6726: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.6727: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.6728: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.6729: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6730: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.6731: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.6732: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.6733: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.6734: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.6735: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.6736: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.6737: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.6738: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.6739: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.6740: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.6741: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.6742: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6743: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.6744: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.6745: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.6746: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.6747: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.6748: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.6749: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.6750: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.6751: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.6752: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.6753: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.6754: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.6755: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.6756: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.6757: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.6758: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.6759: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.6760: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.6761: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII
Source.6762: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.6763: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.6764: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.6765: DFBPPR12534 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.6766: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.6767: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.6768: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.6769: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.6770: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.6771: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.6772: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.6773: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.6774: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.6775: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.6776: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.6777: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.6778: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6779: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.6780: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.6781: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.6782: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.6783: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.6784: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.6785: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.6786: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.6787: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.6788: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.6789: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.6790: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.6791: DFBPPR12593 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.6792: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.6793: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.6794: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.6795: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.6796: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.6797: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.6798: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.6799: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.6800: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.6801: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.6802: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.6803: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.6804: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.6805: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.6806: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.6807: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.6808: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.6809: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.6810: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.6811: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.6812: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.6813: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.6814: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.6815: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.6816: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.6817: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.6818: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.6819: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.6820: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.6821: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.6822: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.6823: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin
Source.6824: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.6825: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.6826: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.6827: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.6828: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.6829: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.6830: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.6831: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.6832: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86
Source.6833: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.6834: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.6835: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.6836: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.6837: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.6838: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.6839: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.6840: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.6841: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.6842: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.6843: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.6844: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.6845: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.6846: DFBPPR12767 ---- Animal proteins ---- Follitropin subunit beta
Source.6847: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.6848: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.6849: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.6850: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.6851: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.6852: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.6853: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.6854: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.6855: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.6856: DFBPPR12790 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 4
Source.6857: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.6858: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.6859: DFBPPR12796 ---- Animal proteins ---- Caspase-3
Source.6860: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.6861: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.6862: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.6863: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.6864: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2
Source.6865: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.6866: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.6867: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.6868: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma
Source.6869: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.6870: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.6871: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.6872: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.6873: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.6874: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain
Source.6875: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.6876: DFBPPR12836 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.6877: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.6878: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.6879: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.6880: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.6881: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.6882: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.6883: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.6884: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.6885: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.6886: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.6887: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.6888: DFBPPR12878 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.6889: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.6890: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.6891: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.6892: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.6893: DFBPPR12890 ---- Animal proteins ---- ATP synthase protein 8
Source.6894: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.6895: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.6896: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.6897: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.6898: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.6899: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.6900: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.6901: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.6902: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.6903: DFBPPR12915 ---- Animal proteins ---- Small proline-rich protein 3
Source.6904: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.6905: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.6906: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.6907: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.6908: DFBPPR12933 ---- Animal proteins ---- Peptide YY
Source.6909: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.6910: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6911: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6912: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.6913: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.6914: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.6915: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.6916: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.6917: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.6918: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.6919: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.6920: DFBPPR12971 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase
Source.6921: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.6922: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.6923: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.6924: DFBPPR12984 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.6925: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.6926: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.6927: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.6928: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.6929: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.6930: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.6931: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.6932: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6933: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.6934: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6935: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.6936: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.6937: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.6938: DFBPPR13018 ---- Animal proteins ---- Neuropeptide Y
Source.6939: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.6940: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1
Source.6941: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.6942: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A
Source.6943: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S
Source.6944: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.6945: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.6946: DFBPPR13040 ---- Animal proteins ---- Pancreatic hormone
Source.6947: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.6948: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein
Source.6949: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.6950: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.6951: DFBPPR13067 ---- Animal proteins ---- Beta-casein
Source.6952: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.6953: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6954: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.6955: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.6956: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.6957: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.6958: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.6959: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region
Source.6960: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain
Source.6961: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.6962: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region
Source.6963: DFBPPR13120 ---- Animal proteins ---- Ig lambda chain C region
Source.6964: DFBPPR13135 ---- Animal proteins ---- Ig kappa-b4 chain C region
Source.6965: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.6966: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.6967: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6968: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.6969: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.6970: DFBPPR13149 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.6971: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.6972: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.6973: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.6974: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.6975: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.6976: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.6977: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.6978: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1
Source.6979: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6980: DFBPPR13174 ---- Animal proteins ---- Clusterin
Source.6981: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.6982: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.6983: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.6984: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.6985: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.6986: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6987: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.6988: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.6989: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.6990: DFBPPR13207 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.6991: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.6992: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.6993: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.6994: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.6995: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.6996: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.6997: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.6998: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.6999: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7000: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.7001: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.7002: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.7003: DFBPPR13232 ---- Animal proteins ---- Osteocalcin
Source.7004: DFBPPR13233 ---- Animal proteins ---- Fibronectin
Source.7005: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain
Source.7006: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.7007: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.7008: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7009: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta
Source.7010: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.7011: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7012: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.7013: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.7014: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.7015: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.7016: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7017: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.7018: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.7019: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.7020: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7021: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.7022: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.7023: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.7024: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.7025: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.7026: DFBPPR13300 ---- Animal proteins ---- Sex-determining region Y protein
Source.7027: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.7028: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.7029: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.7030: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.7031: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.7032: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.7033: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.7034: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.7035: DFBPPR13329 ---- Animal proteins ---- Follitropin subunit beta
Source.7036: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.7037: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.7038: DFBPPR13339 ---- Animal proteins ---- Runt-related transcription factor 2
Source.7039: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.7040: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.7041: DFBPPR13352 ---- Animal proteins ---- ATP synthase protein 8
Source.7042: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7043: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.7044: DFBPPR13364 ---- Animal proteins ---- Glycophorin-A
Source.7045: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7046: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.7047: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.7048: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.7049: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.7050: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7051: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7052: DFBPPR13389 ---- Animal proteins ---- Phosducin
Source.7053: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.7054: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.7055: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.7056: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.7057: DFBPPR13407 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 1
Source.7058: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.7059: DFBPPR13418 ---- Animal proteins ---- 40S ribosomal protein S4
Source.7060: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7061: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.7062: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.7063: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7064: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7065: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7066: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.7067: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.7068: DFBPPR13433 ---- Animal proteins ---- Major prion protein
Source.7069: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.7070: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.7071: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7072: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A
Source.7073: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.7074: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7075: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.7076: DFBPPR13448 ---- Animal proteins ---- Osteocalcin
Source.7077: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7078: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.7079: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3
Source.7080: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.7081: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.7082: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.7083: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.7084: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.7085: DFBPPR13474 ---- Animal proteins ---- Hemoglobin subunit epsilon-1
Source.7086: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.7087: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta
Source.7088: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.7089: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.7090: DFBPPR13485 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.7091: DFBPPR13487 ---- Animal proteins ---- Cathelicidin-3.4
Source.7092: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.7093: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.7094: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.7095: DFBPPR13497 ---- Animal proteins ---- Plasminogen
Source.7096: DFBPPR13501 ---- Animal proteins ---- Follitropin subunit beta
Source.7097: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor
Source.7098: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.7099: DFBPPR13523 ---- Animal proteins ---- Keratin-associated protein 15-1
Source.7100: DFBPPR13530 ---- Animal proteins ---- Major prion protein
Source.7101: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.7102: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.7103: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.7104: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7105: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.7106: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.7107: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.7108: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.7109: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.7110: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.7111: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.7112: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7113: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.7114: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.7115: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.7116: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.7117: DFBPPR13562 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.7118: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.7119: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.7120: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.7121: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.7122: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.7123: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.7124: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.7125: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.7126: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1
Source.7127: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.7128: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.7129: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7130: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.7131: DFBPPR13602 ---- Animal proteins ---- Acrosin
Source.7132: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.7133: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.7134: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7135: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.7136: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.7137: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.7138: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.7139: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II
Source.7140: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.7141: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta
Source.7142: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.7143: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.7144: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.7145: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.7146: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.7147: DFBPPR13631 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.7148: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.7149: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.7150: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.7151: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7152: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.7153: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.7154: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.7155: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.7156: DFBPPR13646 ---- Animal proteins ---- Procathepsin L
Source.7157: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7158: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain
Source.7159: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.7160: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.7161: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.7162: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.7163: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.7164: DFBPPR13688 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.7165: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7166: DFBPPR13692 ---- Animal proteins ---- Pro-neuropeptide Y
Source.7167: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.7168: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.7169: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1
Source.7170: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.7171: DFBPPR13704 ---- Animal proteins ---- Osteopontin
Source.7172: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta
Source.7173: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.7174: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.7175: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.7176: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1
Source.7177: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.7178: DFBPPR13738 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.7179: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.7180: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.7181: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.7182: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.7183: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.7184: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.7185: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.7186: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.7187: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.7188: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.7189: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.7190: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.7191: DFBPPR13789 ---- Animal proteins ---- Tryptase-2
Source.7192: DFBPPR13790 ---- Animal proteins ---- Follitropin subunit beta
Source.7193: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.7194: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.7195: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone
Source.7196: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.7197: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.7198: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.7199: DFBPPR13818 ---- Animal proteins ---- Keratin-associated protein 7-1
Source.7200: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.7201: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.7202: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.7203: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.7204: DFBPPR13843 ---- Animal proteins ---- 60S ribosomal protein L10
Source.7205: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.7206: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.7207: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.7208: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.7209: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.7210: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor
Source.7211: DFBPPR13876 ---- Animal proteins ---- Follistatin
Source.7212: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.7213: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7214: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7215: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7216: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.7217: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.7218: DFBPPR13893 ---- Animal proteins ---- Calponin-1
Source.7219: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.7220: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7221: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.7222: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3
Source.7223: DFBPPR13914 ---- Animal proteins ---- Homeobox protein Hox-C6
Source.7224: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.7225: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon
Source.7226: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.7227: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.7228: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.7229: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7230: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.7231: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.7232: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.7233: DFBPPR13985 ---- Animal proteins ---- Gonadotropin subunit beta-2
Source.7234: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.7235: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7236: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B
Source.7237: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.7238: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.7239: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog
Source.7240: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.7241: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.7242: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1
Source.7243: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.7244: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2
Source.7245: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1
Source.7246: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.7247: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.7248: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.7249: DFBPPR14024 ---- Animal proteins ---- Gamma-crystallin S
Source.7250: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7251: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7252: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.7253: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.7254: DFBPPR14054 ---- Animal proteins ---- Pro-neuropeptide Y
Source.7255: DFBPPR14071 ---- Marine protein ---- Somatotropin
Source.7256: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.7257: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.7258: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.7259: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.7260: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha
Source.7261: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.7262: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.7263: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.7264: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.7265: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.7266: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.7267: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.7268: DFBPPR14120 ---- Marine protein ---- Thyrotropin subunit beta
Source.7269: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.7270: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.7271: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.7272: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.7273: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.7274: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.7275: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.7276: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.7277: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.7278: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.7279: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.7280: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.7281: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.7282: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.7283: DFBPPR14175 ---- Marine protein ---- Draxin-B
Source.7284: DFBPPR14179 ---- Marine protein ---- Alpha-endosulfine
Source.7285: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.7286: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.7287: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.7288: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.7289: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.7290: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.7291: DFBPPR14213 ---- Marine protein ---- Electron transfer flavoprotein regulatory factor 1
Source.7292: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.7293: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.7294: DFBPPR14225 ---- Marine protein ---- LYR motif-containing protein 1
Source.7295: DFBPPR14227 ---- Marine protein ---- LYR motif-containing protein 4B
Source.7296: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog
Source.7297: DFBPPR14231 ---- Marine protein ---- Somatotropin
Source.7298: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.7299: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.7300: DFBPPR14236 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.7301: DFBPPR14238 ---- Marine protein ---- Insulin
Source.7302: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.7303: DFBPPR14243 ---- Marine protein ---- Glycoprotein hormones alpha chain 2
Source.7304: DFBPPR14246 ---- Marine protein ---- Glycoprotein hormones alpha chain 1
Source.7305: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.7306: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.7307: DFBPPR14265 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.7308: DFBPPR14266 ---- Marine protein ---- Gonadotropin subunit beta-1
Source.7309: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.7310: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.7311: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.7312: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.7313: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.7314: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.7315: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.7316: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.7317: DFBPPR14309 ---- Marine protein ---- 50S ribosomal protein L21, chloroplastic
Source.7318: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.7319: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region
Source.7320: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.7321: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.7322: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.7323: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7324: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.7325: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7326: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.7327: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.7328: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.7329: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.7330: DFBPPR14357 ---- Marine protein ---- Ferredoxin
Source.7331: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.7332: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.7333: DFBPPR14363 ---- Marine protein ---- Putative peroxiredoxin ycf42
Source.7334: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.7335: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.7336: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.7337: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.7338: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta
Source.7339: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.7340: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha
Source.7341: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.7342: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.7343: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.7344: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.7345: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.7346: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic
Source.7347: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.7348: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain
Source.7349: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26
Source.7350: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.7351: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator
Source.7352: DFBPPR14431 ---- Marine protein ---- 50S ribosomal protein L31, chloroplastic
Source.7353: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.7354: DFBPPR14444 ---- Marine protein ---- 50S ribosomal protein L23, chloroplastic
Source.7355: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.7356: DFBPPR14485 ---- Marine protein ---- Uncharacterized N-acetyltransferase ycf52
Source.7357: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.7358: DFBPPR14506 ---- Marine protein ---- Photosystem I reaction center subunit IV
Source.7359: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.7360: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.7361: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.7362: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53
Source.7363: DFBPPR14519 ---- Marine protein ---- Uncharacterized protein ycf21
Source.7364: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56
Source.7365: DFBPPR14530 ---- Marine protein ---- Uncharacterized protein ycf34
Source.7366: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.7367: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.7368: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.7369: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.7370: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.7371: DFBPPR14541 ---- Marine protein ---- Somatotropin-1
Source.7372: DFBPPR14542 ---- Marine protein ---- Somatotropin-2
Source.7373: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.7374: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.7375: DFBPPR14547 ---- Marine protein ---- Interleukin-6
Source.7376: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.7377: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.7378: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.7379: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.7380: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.7381: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.7382: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.7383: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.7384: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.7385: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.7386: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1
Source.7387: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.7388: DFBPPR14581 ---- Marine protein ---- Interferon alpha/beta receptor 2
Source.7389: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4
Source.7390: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.7391: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.7392: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.7393: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1
Source.7394: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.7395: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.7396: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7397: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1
Source.7398: DFBPPR14608 ---- Marine protein ---- Polysialoglycoprotein
Source.7399: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.7400: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.7401: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.7402: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.7403: DFBPPR14625 ---- Marine protein ---- Somatostatin-2
Source.7404: DFBPPR14628 ---- Marine protein ---- C-type natriuretic peptide 1
Source.7405: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.7406: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.7407: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin
Source.7408: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.7409: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.7410: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.7411: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.7412: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.7413: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.7414: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2
Source.7415: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc
Source.7416: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.7417: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.7418: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.7419: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.7420: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.7421: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2
Source.7422: DFBPPR14695 ---- Marine protein ---- C-type natriuretic peptide 2
Source.7423: DFBPPR14700 ---- Marine protein ---- Neuropeptide Y
Source.7424: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.7425: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.7426: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.7427: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.7428: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.7429: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.7430: DFBPPR14730 ---- Marine protein ---- Peptide YY-like
Source.7431: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.7432: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.7433: DFBPPR14768 ---- Marine protein ---- Tachylectin-2
Source.7434: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.7435: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.7436: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.7437: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.7438: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.7439: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.7440: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.7441: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.7442: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.7443: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.7444: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.7445: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.7446: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.7447: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.7448: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.7449: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.7450: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.7451: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.7452: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.7453: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.7454: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.7455: DFBPPR14839 ---- Marine protein ---- Hemocyanin subunit 2
Source.7456: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.7457: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.7458: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7459: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta
Source.7460: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.7461: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.7462: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta
Source.7463: DFBPPR14867 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.7464: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.7465: DFBPPR14869 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.7466: DFBPPR14873 ---- Marine protein ---- Somatolactin
Source.7467: DFBPPR14875 ---- Marine protein ---- Probable pancreatic secretory proteinase inhibitor
Source.7468: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.7469: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2
Source.7470: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.7471: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.7472: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.7473: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.7474: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.7475: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.7476: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.7477: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.7478: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.7479: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.7480: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.7481: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.7482: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.7483: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.7484: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.7485: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.7486: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4
Source.7487: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.7488: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.7489: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.7490: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.7491: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.7492: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.7493: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.7494: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.7495: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.7496: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.7497: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.7498: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.7499: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.7500: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.7501: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.7502: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.7503: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.7504: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.7505: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.7506: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.7507: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial
Source.7508: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.7509: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.7510: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.7511: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.7512: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.7513: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.7514: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.7515: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.7516: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.7517: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.7518: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.7519: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.7520: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.7521: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.7522: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1
Source.7523: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.7524: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.7525: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.7526: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.7527: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.7528: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.7529: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.7530: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1
Source.7531: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.7532: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.7533: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.7534: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.7535: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6
Source.7536: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.7537: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.7538: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.7539: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.7540: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.7541: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.7542: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.7543: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.7544: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1
Source.7545: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.7546: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.7547: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.7548: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.7549: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.7550: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.7551: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.7552: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.7553: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.7554: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.7555: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.7556: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.7557: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.7558: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10
Source.7559: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.7560: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.7561: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.7562: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.7563: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.7564: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.7565: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.7566: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.7567: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.7568: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12
Source.7569: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.7570: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.7571: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase
Source.7572: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.7573: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.7574: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.7575: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.7576: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.7577: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.7578: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.7579: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6
Source.7580: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.7581: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.7582: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.7583: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.7584: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.7585: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.7586: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.7587: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.7588: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase
Source.7589: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.7590: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.7591: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.7592: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1
Source.7593: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.7594: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.7595: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.7596: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.7597: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.7598: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.7599: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D
Source.7600: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.7601: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.7602: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.7603: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.7604: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.7605: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.7606: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.7607: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.7608: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.7609: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.7610: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.7611: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.7612: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.7613: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.7614: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.7615: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.7616: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.7617: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1
Source.7618: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.7619: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.7620: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.7621: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.7622: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.7623: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.7624: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.7625: DFBPPR15222 ---- Microorganism protein ---- DASH complex subunit ASK1
Source.7626: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.7627: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.7628: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.7629: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.7630: DFBPPR15237 ---- Microorganism protein ---- U6 snRNA-associated Sm-like protein LSm6
Source.7631: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.7632: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.7633: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.7634: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.7635: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.7636: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.7637: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.7638: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.7639: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.7640: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3
Source.7641: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.7642: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.7643: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.7644: DFBPPR15276 ---- Microorganism protein ---- Guanine nucleotide-binding protein subunit gamma
Source.7645: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.7646: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5
Source.7647: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.7648: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12
Source.7649: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.7650: DFBPPR15297 ---- Microorganism protein ---- Transcriptional activator HAP2
Source.7651: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase
Source.7652: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.7653: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14
Source.7654: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.7655: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.7656: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.7657: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.7658: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.7659: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.7660: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.7661: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.7662: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.7663: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.7664: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.7665: DFBPPR15328 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 31
Source.7666: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.7667: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.7668: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.7669: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.7670: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.7671: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.7672: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.7673: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.7674: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.7675: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.7676: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog
Source.7677: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.7678: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.7679: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.7680: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.7681: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.7682: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.7683: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.7684: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.7685: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.7686: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.7687: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.7688: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.7689: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.7690: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.7691: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.7692: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.7693: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.7694: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4
Source.7695: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.7696: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82
Source.7697: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.7698: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3
Source.7699: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.7700: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1
Source.7701: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.7702: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.7703: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1
Source.7704: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.7705: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.7706: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1
Source.7707: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24
Source.7708: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.7709: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.7710: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1
Source.7711: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.7712: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.7713: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.7714: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.7715: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.7716: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.7717: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.7718: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.7719: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.7720: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.7721: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.7722: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.7723: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.7724: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.7725: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.7726: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101
Source.7727: DFBPPR15521 ---- Microorganism protein ---- rRNA-processing protein EFG1
Source.7728: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.7729: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5
Source.7730: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.7731: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.7732: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.7733: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.7734: DFBPPR15543 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 7
Source.7735: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6
Source.7736: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.7737: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.7738: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14
Source.7739: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.7740: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.7741: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.7742: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.7743: DFBPPR15576 ---- Microorganism protein ---- Cytochrome c oxidase-assembly factor COX23, mitochondrial
Source.7744: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.7745: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.7746: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.7747: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28
Source.7748: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.7749: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.7750: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.7751: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.7752: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.7753: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.7754: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.7755: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.7756: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.7757: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.7758: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.7759: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.7760: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11
Source.7761: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.7762: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.7763: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.7764: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25
Source.7765: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.7766: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.7767: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.7768: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.7769: DFBPPR15670 ---- Microorganism protein ---- Imidazoleglycerol-phosphate dehydratase
Source.7770: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.7771: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6
Source.7772: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.7773: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.7774: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.7775: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.7776: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.7777: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial
Source.7778: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.7779: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.7780: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1
Source.7781: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.7782: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.7783: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.7784: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.7785: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.7786: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.7787: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.7788: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.7789: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1
Source.7790: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.7791: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.7792: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.7793: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.7794: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.7795: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24
Source.7796: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1
Source.7797: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.7798: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.7799: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.7800: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial
Source.7801: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.7802: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.7803: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.7804: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4
Source.7805: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.7806: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.7807: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.7808: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1
Source.7809: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.7810: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.7811: DFBPPR15794 ---- Microorganism protein ---- Uncharacterized protein KLLA0E17732g
Source.7812: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase
Source.7813: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.7814: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase
Source.7815: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.7816: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.7817: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.7818: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.7819: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.7820: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.7821: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.7822: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.7823: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.7824: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.7825: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.7826: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.7827: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.7828: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.7829: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.7830: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.7831: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.7832: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.7833: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.7834: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.7835: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.7836: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.7837: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.7838: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.7839: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.7840: DFBPPR15856 ---- Microorganism protein ---- Laccase-2
Source.7841: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.7842: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.7843: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.7844: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.7845: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2
Source.7846: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.7847: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.7848: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.7849: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.7850: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.7851: DFBPPR15889 ---- Marine protein ---- Ferredoxin
Source.7852: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.7853: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.7854: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.7855: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7856: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.7857: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.7858: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.7859: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.7860: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog
Source.7861: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.7862: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.7863: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.7864: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.7865: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.7866: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.7867: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7868: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.7869: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.7870: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.7871: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.7872: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.7873: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7874: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.7875: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.7876: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7877: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.7878: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.7879: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.7880: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.7881: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.7882: DFBPPR7795 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.7883: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7884: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.7885: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.7886: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.7887: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.7888: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.7889: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.7890: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.7891: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.7892: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.7893: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.7894: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.7895: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.7896: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.7897: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.7898: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2
Source.7899: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1
Source.7900: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.7901: DFBPPR7832 ---- Plant protein ---- Extensin
Source.7902: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.7903: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.7904: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.7905: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.7906: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.7907: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.7908: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.7909: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.7910: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.7911: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.7912: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.7913: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.7914: DFBPPR7865 ---- Plant protein ---- 50S ribosomal protein L23-A, chloroplastic
Source.7915: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.7916: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.7917: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.7918: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.7919: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1
Source.7920: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.7921: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.7922: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.7923: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.7924: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.7925: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.7926: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.7927: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.7928: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7929: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.7930: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.7931: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha
Source.7932: DFBPPR7954 ---- Plant protein ---- Favin
Source.7933: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.7934: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.7935: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.7936: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.7937: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.7938: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.7939: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7940: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1
Source.7941: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7942: DFBPPR7997 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.7943: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.7944: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.7945: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.7946: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.7947: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.7948: DFBPPR8029 ---- Plant protein ---- Vignain
Source.7949: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.7950: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.7951: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.7952: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.7953: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.7954: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7955: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.7956: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.7957: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.7958: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7959: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1
Source.7960: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.7961: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.7962: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.7963: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.7964: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.7965: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.7966: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.7967: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.7968: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.7969: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.7970: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.7971: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4
Source.7972: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.7973: DFBPPR8066 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.7974: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.7975: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.7976: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.7977: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.7978: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.7979: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.7980: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.7981: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7982: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.7983: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.7984: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.7985: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.7986: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin
Source.7987: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.7988: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.7989: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.7990: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.7991: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.7992: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.7993: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.7994: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.7995: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.7996: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.7997: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.7998: DFBPPR8156 ---- Plant protein ---- Nodulin-30
Source.7999: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0
Source.8000: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.8001: DFBPPR8183 ---- Plant protein ---- 26 kDa cell wall protein
Source.8002: DFBPPR8185 ---- Plant protein ---- Uncharacterized basic polypeptide
Source.8003: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.8004: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.8005: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.8006: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.8007: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.8008: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.8009: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.8010: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.8011: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.8012: DFBPPR8235 ---- Plant protein ---- Catalase
Source.8013: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.8014: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.8015: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.8016: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.8017: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.8018: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.8019: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.8020: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.8021: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.8022: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.8023: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.8024: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.8025: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.8026: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.8027: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.8028: DFBPPR8270 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.8029: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.8030: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.8031: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase
Source.8032: DFBPPR8296 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.8033: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.8034: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K
Source.8035: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.8036: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.8037: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.8038: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Source.8039: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1
Source.8040: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3
Source.8041: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a
Source.8042: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
Link 1: DFBPANHY0886----Milk Proteins----αs1-Casein, β-Casein
Biological/Functional activity & target protein
Antihypertensive activity
Table 1. Effects of ACE Inhibitory Peptides on SBP of SHR
Sample
Dose (mg/kg)
Time after administration (hr)
0
4
6
24
48
72
Control

226 ± 10.1
223 ± 13.1
223 ± 6.4
222 ± 8.0
YP
100
221 ± 11.5
218 ± 14.8
208 ± 15.1 *
213 ± 18.4

SBP (mmHg) are shown as mean ± SD, n=10.
Significant difference from SBP on 0 hr * p < 0.05, ** p < 0.01.
Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Preparation method
Mode of preparation Synthesis
Enzyme(s)/starter culture

Solid-phase peptide synthesis was done with a peptide synthesizer (PEPTICOUPLER 2200; Vega Co., Ltd.).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: No measured
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPACEI0348, DFBPACEI1315, DFBPACEI1540, DFBPACEI1901
[D2] DFBPANOX0681
[D3] DFBPDPIV0023, DFBPDPIV0140
[D4] DFBPALGL0021
[D5] DFBPOPIO0147
[D6] DFBPMUFU0106
BIOPEP-UWM [D7] 3666, 8521, 9548
APD [D8] -
BioPepDB [D9] -
MBPDB [D10] -
Reference(s)
Primary literature Saito Y, Wanezaki K, Kawato A, Imayasu S. Structure and activity of angiotensin I converting enzyme inhibitory peptides from sake and sake lees. Biosci Biotechnol Biochem. 1994 Oct;58(10):1767-71.
PMID: 7765503
Other literature(s) N.D
PubDate 1994
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214