DFBP ID - DFBPANHY0899(Antihypertensive peptide) |
DFBP ID |
DFBPANHY0899 |
Peptide sequence |
LTFPG |
Type |
Native peptide |
Peptide/Function name |
Antihypertensive peptide |
|
Function-activity relationship |
Main bioactivity |
Antihypertensive activity
|
Otheir bioactivity |
ACE-inhibitory activity [D1], Multifunctional activity [D2] |
|
Calculated physicochemical properties |
Three-letter amino acid |
Leu-Thr-Phe-Pro-Gly |
Single-letter amino acid |
LTFPG |
Peptide length |
5 |
Peptide mass |
Experimental mass |
Theoretical mass |
534.26 Da |
533.62 Da c |
|
Net charge |
0.00 c |
Isoelectric point (pI) |
5.97 c |
IC50 |
N.D |
pIC50 |
N.D |
GRAVY |
0.7800 c |
Hydrophilic residue ratio |
80% c |
Peptide calculator |
|
|
Biological/Functional activity & target protein |
Antihypertensive activity |
In vitro experiments
| Dose (mg/kg)
| SBP Decreases
| Times | SHR
| 30
| 37 mmHg
| 2 h
| ≈ 30 mmHg | 4 h
| ≈ 18 mmHg | 6 h
| ≈ 10 mmHg
| 8 h
| ≈ 6 mmHg | 24 h
|
|
Specific target protein(s) |
N.D |
|
Taste properties & Structure |
Bitterness |
Literature report |
N.D |
Bitter prediction tools |
Bitter taste prediction |
|
SMILES |
N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)O |
|
Preparation method |
Mode of preparation |
Enzymatic hydrolysis |
Enzyme(s)/starter culture |
Yellow field pea seed was hydrolyzed with Thermolysin. |
|
Stability & Cytotoxicity |
Peptide stability |
|
Peptide cytotoxicity |
Literature report: |
No measured |
Prediction: |
ToxinPred |
|
|
Additional information |
Additional information |
The peptide showed 41.41 ± 0.36 % Renin (EC 3.4.23.15) inhibition (1.0 mg/mL assay concentration).
|
|
Database cross-references |
|
|
|
|
|
Reference(s) |
Primary literature |
Aluko, R.E., Girgih, A.T., He, R., Malomo, S., Li, H., Offengenden, M., et al. Structural and functional characterization of yellow field pea seed (Pisum sativum L.) protein-derived antihypertensive peptides. Food Research International. 2015, 77, 10-6.
|
Other literature(s) |
N.D |
PubDate |
2015 |
|