Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0329(Antioxidative peptide)

DFBP ID	DFBPANOX0329
Peptide sequence	KAI
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Lys-Ala-Ile

Single-letter amino acid

KAI

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	330.42 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

10.04 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

0.8000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Fish, Marine
Organism/Source	Bonito
Precursor protein	Dried bonito muscle
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.2: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.3: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.4: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.5: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.6: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1 Source.7: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.8: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.9: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.10: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.11: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.12: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.13: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A Source.14: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.15: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.16: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.17: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.18: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.19: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.20: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.21: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.22: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185 Source.23: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.24: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.25: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.26: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4 Source.27: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.28: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.29: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.30: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.31: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.32: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.33: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.34: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.35: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.36: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.37: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.38: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial Source.39: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.40: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.41: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.42: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.43: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.44: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.45: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.46: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase Source.47: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.48: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.49: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.50: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.51: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.52: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.53: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.54: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.55: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.56: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.57: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.58: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.59: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.60: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.61: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.62: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.63: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2 Source.64: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2 Source.65: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.66: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.67: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.68: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.69: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.70: DFBPPR1431 ---- Plant proteins ---- Glutaredoxin-C6 Source.71: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.72: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.73: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.74: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.75: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.76: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.77: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.78: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.79: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.80: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.81: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.82: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.83: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.84: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.85: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.86: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.87: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.88: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33 Source.89: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.90: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.91: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.92: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.93: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.94: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.95: DFBPPR1641 ---- Plant proteins ---- Enolase Source.96: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.97: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.98: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19 Source.99: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.100: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.101: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3 Source.102: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.103: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.104: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2 Source.105: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.106: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1 Source.107: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.108: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.109: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.110: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1 Source.111: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.112: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.113: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic Source.114: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.115: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.116: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.117: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.118: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.119: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.120: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.121: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.122: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.123: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.124: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4 Source.125: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.126: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.127: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.128: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.129: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.130: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.131: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1 Source.132: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.133: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.134: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.135: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.136: DFBPPR2026 ---- Plant proteins ---- Proteasome subunit alpha type-5 Source.137: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2 Source.138: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.139: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.140: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.141: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.142: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.143: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.144: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.145: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2 Source.146: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.147: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.148: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.149: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.150: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.151: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.152: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.153: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.154: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.155: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.156: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.157: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.158: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.159: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.160: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3 Source.161: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.162: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.163: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.164: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.165: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.166: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.167: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.168: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.169: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.170: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2 Source.171: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.172: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.173: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2 Source.174: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.175: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.176: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.177: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.178: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.179: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.180: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.181: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.182: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.183: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.184: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.185: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2 Source.186: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57 Source.187: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.188: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12 Source.189: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.190: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3 Source.191: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.192: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.193: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.194: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.195: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.196: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.197: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.198: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.199: DFBPPR2728 ---- Plant proteins ---- Autophagy-related protein 8B Source.200: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.201: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C Source.202: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A Source.203: DFBPPR2745 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor EL2 Source.204: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.205: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.206: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.207: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.208: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.209: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.210: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.211: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.212: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.213: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.214: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.215: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2 Source.216: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.217: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.218: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.219: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.220: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.221: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.222: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103 Source.223: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.224: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.225: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.226: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.227: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.228: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.229: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.230: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7 Source.231: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.232: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.233: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.234: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.235: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.236: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.237: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.238: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.239: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3 Source.240: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.241: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.242: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1 Source.243: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.244: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.245: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.246: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.247: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.248: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6 Source.249: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.250: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O Source.251: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.252: DFBPPR3170 ---- Plant proteins ---- Probable histone H2A.2 Source.253: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.254: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.255: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.256: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.257: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.258: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.259: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.260: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1 Source.261: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.262: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7 Source.263: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.264: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit Source.265: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1 Source.266: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.267: DFBPPR3294 ---- Plant proteins ---- Probable histone H2A.3 Source.268: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5 Source.269: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.270: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.271: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.272: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.273: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.274: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.275: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.276: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.277: DFBPPR3456 ---- Plant proteins ---- Maturase K Source.278: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.279: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1 Source.280: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600 Source.281: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.282: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.283: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.284: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.285: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.286: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7 Source.287: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.288: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.289: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3 Source.290: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.291: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.292: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3 Source.293: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.294: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6 Source.295: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.296: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.297: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.298: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.299: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.300: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.301: DFBPPR3652 ---- Plant proteins ---- Nucleosome assembly protein 1;3 Source.302: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.303: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.304: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.305: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67 Source.306: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.307: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.308: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.309: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.310: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.311: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.312: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.313: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.314: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.315: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.316: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit Source.317: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.318: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.319: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1 Source.320: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.321: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3 Source.322: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.323: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein Source.324: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.325: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2 Source.326: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4 Source.327: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2 Source.328: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.329: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.330: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.331: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.332: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.333: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1 Source.334: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600 Source.335: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.336: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3 Source.337: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.338: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3 Source.339: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.340: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.341: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP Source.342: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.343: DFBPPR4294 ---- Plant proteins ---- Nucleosome assembly protein 1-like 4 Source.344: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.345: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.346: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.347: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1 Source.348: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.349: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.350: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.351: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.352: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2 Source.353: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.354: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2 Source.355: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.356: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.357: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.358: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.359: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.360: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1 Source.361: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.362: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.363: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.364: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.365: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6 Source.366: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.367: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.368: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic Source.369: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein Source.370: DFBPPR4705 ---- Plant proteins ---- 40S ribosomal protein S26 Source.371: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800 Source.372: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36 Source.373: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500 Source.374: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.375: DFBPPR4898 ---- Plant proteins ---- Serine racemase Source.376: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.377: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.378: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.379: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.380: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.381: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.382: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.383: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.384: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.385: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.386: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.387: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.388: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1 Source.389: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.390: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.391: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.392: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase Source.393: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.394: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.395: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase Source.396: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.397: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.398: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1 Source.399: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.400: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2 Source.401: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.402: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3 Source.403: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.404: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.405: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.406: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.407: DFBPPR5081 ---- Plant proteins ---- Proteasome subunit alpha type-5 Source.408: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.409: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.410: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase Source.411: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial Source.412: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22 Source.413: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein Source.414: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.415: DFBPPR5131 ---- Plant proteins ---- 17.5 kDa class I heat shock protein Source.416: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein Source.417: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2 Source.418: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein Source.419: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2 Source.420: DFBPPR5158 ---- Plant proteins ---- Class I heat shock protein Source.421: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.422: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.423: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.424: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.425: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.426: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.427: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.428: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.429: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.430: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.431: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.432: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1 Source.433: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.434: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B Source.435: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.436: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.437: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.438: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.439: DFBPPR5316 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.440: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.441: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.442: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.443: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.444: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.445: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.446: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.447: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.448: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.449: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.450: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.451: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.452: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.453: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.454: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.455: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.456: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.457: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.458: DFBPPR5492 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit Source.459: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.460: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.461: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.462: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.463: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1 Source.464: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.465: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3 Source.466: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.467: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1 Source.468: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.469: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1 Source.470: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.471: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.472: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.473: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2 Source.474: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.475: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.476: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.477: DFBPPR5681 ---- Plant proteins ---- Single myb histone 4 Source.478: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.479: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.480: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.481: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.482: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.483: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.484: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1 Source.485: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2 Source.486: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.487: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.488: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic Source.489: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B Source.490: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.491: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A Source.492: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.493: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.494: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF Source.495: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.496: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.497: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.498: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.499: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin Source.500: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.501: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.502: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.503: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1 Source.504: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B Source.505: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.506: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.507: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1 Source.508: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.509: DFBPPR5946 ---- Plant proteins ---- Maturase K Source.510: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2 Source.511: DFBPPR5959 ---- Plant proteins ---- Ribosomal protein S13, mitochondrial Source.512: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.513: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.514: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.515: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.516: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.517: DFBPPR6056 ---- Plant proteins ---- Bowman-Birk type wound-induced proteinase inhibitor WIP1 Source.518: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1 Source.519: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4 Source.520: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.521: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.522: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.523: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34 Source.524: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.525: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic Source.526: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.527: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.528: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.529: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.530: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.531: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.532: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.533: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic Source.534: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.535: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.536: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing] Source.537: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.538: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.539: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.540: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A Source.541: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase Source.542: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.543: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme Source.544: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B Source.545: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin Source.546: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.547: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.548: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.549: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.550: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.551: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.552: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.553: DFBPPR6453 ---- Plant proteins ---- Convicilin Source.554: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.555: DFBPPR6458 ---- Plant proteins ---- Convicilin Source.556: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.557: DFBPPR6470 ---- Plant proteins ---- Vicilin Source.558: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic Source.559: DFBPPR6510 ---- Plant proteins ---- 50S ribosomal protein 6, chloroplastic Source.560: DFBPPR6528 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.561: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.562: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.563: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.564: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.565: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.566: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.567: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.568: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.569: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase Source.570: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A Source.571: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.572: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.573: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.574: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2 Source.575: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7 Source.576: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B Source.577: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D Source.578: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.579: DFBPPR6754 ---- Plant proteins ---- Histone H2A.4 Source.580: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.581: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.582: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.583: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.584: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.585: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.586: DFBPPR6882 ---- Plant proteins ---- Maturase K Source.587: DFBPPR6883 ---- Plant proteins ---- Ribosomal protein S13, mitochondrial Source.588: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.589: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.590: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.591: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin Source.592: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.593: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein Source.594: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.595: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.596: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.597: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.598: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.599: DFBPPR7077 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor Source.600: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.601: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.602: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.603: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.604: DFBPPR7098 ---- Plant proteins ---- Acyl carrier protein 2, chloroplastic Source.605: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2 Source.606: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.607: DFBPPR7114 ---- Plant proteins ---- Acyl carrier protein 3, chloroplastic Source.608: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.609: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.610: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B Source.611: DFBPPR7170 ---- Plant proteins ---- Maturase K Source.612: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.613: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.614: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.615: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.616: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.617: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.618: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.619: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.620: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2 Source.621: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.622: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.623: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase Source.624: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.625: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.626: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.627: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.628: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.629: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.630: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.631: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.632: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.633: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.634: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.635: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.636: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.637: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.638: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS Source.639: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.640: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A Source.641: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C Source.642: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.643: DFBPPR7606 ---- Milk proteins ---- Osteopontin Source.644: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.645: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.646: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain Source.647: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.648: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.649: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor Source.650: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A Source.651: DFBPPR7657 ---- Milk proteins ---- Chymosin Source.652: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein Source.653: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein Source.654: DFBPPR7699 ---- Milk proteins ---- Chymosin Source.655: DFBPPR7708 ---- Milk proteins ---- Late lactation protein B, LLP-B Source.656: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.657: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.658: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.659: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.660: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.661: DFBPPR7737 ---- Plant proteins ---- Endochitinase Source.662: DFBPPR7744 ---- Plant proteins ---- Maturase K Source.663: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.664: DFBPPR8198 ---- Plant proteins ---- Inhibitor of trypsin and hageman factor Source.665: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.666: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.667: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.668: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.669: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.670: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.671: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic Source.672: DFBPPR8436 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor Source.673: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.674: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.675: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.676: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1 Source.677: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.678: DFBPPR8505 ---- Milk proteins ---- Chymosin Source.679: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.680: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.681: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.682: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A Source.683: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.684: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.685: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.686: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.687: DFBPPR16011 ---- Animal proteins ---- Interferon gamma Source.688: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.689: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.690: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.691: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.692: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.693: DFBPPR16083 ---- Animal proteins ---- Annexin A13 Source.694: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.695: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.696: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.697: DFBPPR16120 ---- Animal proteins ---- C-X-C motif chemokine 10 Source.698: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66 Source.699: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.700: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.701: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.702: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.703: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.704: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.705: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.706: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor Source.707: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.708: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.709: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.710: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.711: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.712: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15 Source.713: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.714: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.715: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.716: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.717: DFBPPR16312 ---- Animal proteins ---- C-C motif chemokine 13 Source.718: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.719: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.720: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.721: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.722: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.723: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.724: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.725: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.726: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.727: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.728: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.729: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.730: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3 Source.731: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.732: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin Source.733: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.734: DFBPPR16627 ---- Animal proteins ---- 60S ribosomal protein L15 Source.735: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial Source.736: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.737: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2 Source.738: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3 Source.739: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator Source.740: DFBPPR16743 ---- Animal proteins ---- 60S ribosomal protein L32 Source.741: DFBPPR16746 ---- Animal proteins ---- Tektin-1 Source.742: DFBPPR16747 ---- Animal proteins ---- Pleckstrin Source.743: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.744: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.745: DFBPPR16808 ---- Animal proteins ---- Fibroblast growth factor 2 Source.746: DFBPPR16829 ---- Animal proteins ---- Fibroblast growth factor 1 Source.747: DFBPPR16837 ---- Animal proteins ---- Interferon gamma Source.748: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.749: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.750: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.751: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.752: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.753: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.754: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.755: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.756: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.757: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.758: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.759: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.760: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2 Source.761: DFBPPR17037 ---- Animal proteins ---- Annexin A1 Source.762: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.763: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Source.764: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2 Source.765: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.766: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.767: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.768: DFBPPR17128 ---- Animal proteins ---- Intraflagellar transport protein 20 homolog Source.769: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.770: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.771: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.772: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.773: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.774: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.775: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B Source.776: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.777: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3 Source.778: DFBPPR17286 ---- Animal proteins ---- Septin-2 Source.779: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.780: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2 Source.781: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.782: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.783: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.784: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.785: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.786: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.787: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1 Source.788: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal Source.789: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.790: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H Source.791: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.792: DFBPPR17379 ---- Animal proteins ---- Dematin Source.793: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.794: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.795: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.796: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.797: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.798: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1 Source.799: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.800: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.801: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1 Source.802: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.803: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.804: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1 Source.805: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.806: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.807: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha Source.808: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1 Source.809: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.810: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.811: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.812: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1 Source.813: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.814: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.815: DFBPPR17559 ---- Animal proteins ---- C-X-C motif chemokine 10 Source.816: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor Source.817: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.818: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.819: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2 Source.820: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.821: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.822: DFBPPR17749 ---- Animal proteins ---- CD9 antigen Source.823: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase Source.824: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.825: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60 Source.826: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.827: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.828: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.829: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.830: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.831: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.832: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial Source.833: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.834: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.835: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.836: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.837: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome Source.838: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.839: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.840: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.841: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.842: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.843: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.844: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.845: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.846: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.847: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A Source.848: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3 Source.849: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B Source.850: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.851: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.852: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.853: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.854: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.855: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.856: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.857: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta Source.858: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.859: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.860: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.861: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1 Source.862: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.863: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.864: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.865: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.866: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.867: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein Source.868: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.869: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.870: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.871: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.872: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1 Source.873: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1 Source.874: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q Source.875: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.876: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.877: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.878: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1 Source.879: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.880: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.881: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.882: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.883: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1 Source.884: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial Source.885: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial Source.886: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.887: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.888: DFBPPR18632 ---- Animal proteins ---- Syntaxin-4 Source.889: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.890: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.891: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.892: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.893: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.894: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3 Source.895: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein Source.896: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.897: DFBPPR18778 ---- Animal proteins ---- Erlin-2 Source.898: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.899: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.900: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.901: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.902: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.903: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase Source.904: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7 Source.905: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1 Source.906: DFBPPR18869 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit beta Source.907: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.908: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4 Source.909: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.910: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.911: DFBPPR18908 ---- Animal proteins ---- Proteasome subunit alpha type-6 Source.912: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.913: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.914: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.915: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.916: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.917: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.918: DFBPPR18952 ---- Animal proteins ---- Serotransferrin Source.919: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 Source.920: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.921: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.922: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.923: DFBPPR18986 ---- Animal proteins ---- Granzyme A Source.924: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.925: DFBPPR18995 ---- Animal proteins ---- Tektin-3 Source.926: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11 Source.927: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.928: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.929: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.930: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha Source.931: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.932: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1 Source.933: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.934: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.935: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.936: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11 Source.937: DFBPPR19165 ---- Animal proteins ---- Tropomyosin beta chain Source.938: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein Source.939: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.940: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.941: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.942: DFBPPR19224 ---- Animal proteins ---- Fetuin-B Source.943: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128 Source.944: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.945: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2 Source.946: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1 Source.947: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.948: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1 Source.949: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3 Source.950: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.951: DFBPPR19317 ---- Animal proteins ---- AP-1 complex subunit sigma-1A Source.952: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9 Source.953: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A Source.954: DFBPPR19359 ---- Animal proteins ---- Spartin Source.955: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.956: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.957: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein Source.958: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.959: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.960: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase Source.961: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.962: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.963: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1 Source.964: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.965: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.966: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.967: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.968: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.969: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2 Source.970: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.971: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.972: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.973: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.974: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.975: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.976: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2 Source.977: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.978: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.979: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1 Source.980: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1 Source.981: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1 Source.982: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.983: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain Source.984: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.985: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2 Source.986: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.987: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1 Source.988: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.989: DFBPPR19844 ---- Animal proteins ---- Prosalusin Source.990: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein Source.991: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.992: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1 Source.993: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.994: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta Source.995: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.996: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6 Source.997: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27 Source.998: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.999: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.1000: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2 Source.1001: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.1002: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2 Source.1003: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.1004: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.1005: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.1006: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1 Source.1007: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase Source.1008: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2 Source.1009: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2 Source.1010: DFBPPR20021 ---- Animal proteins ---- Neugrin Source.1011: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12 Source.1012: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.1013: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2 Source.1014: DFBPPR20057 ---- Animal proteins ---- AP-3 complex subunit sigma-1 Source.1015: DFBPPR20063 ---- Animal proteins ---- Histone H2B subacrosomal variant Source.1016: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4 Source.1017: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.1018: DFBPPR20130 ---- Animal proteins ---- Stathmin Source.1019: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.1020: DFBPPR20164 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 2 Source.1021: DFBPPR20184 ---- Animal proteins ---- Centromere protein H Source.1022: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.1023: DFBPPR20212 ---- Animal proteins ---- Outer dense fiber protein 1 Source.1024: DFBPPR20223 ---- Animal proteins ---- Protein cereblon Source.1025: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.1026: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein Source.1027: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.1028: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3 Source.1029: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial Source.1030: DFBPPR20305 ---- Animal proteins ---- Nostrin Source.1031: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.1032: DFBPPR20318 ---- Animal proteins ---- Charged multivesicular body protein 1b Source.1033: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.1034: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.1035: DFBPPR20371 ---- Animal proteins ---- Vesicle-associated membrane protein 4 Source.1036: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56 Source.1037: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial Source.1038: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog Source.1039: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1 Source.1040: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7 Source.1041: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4 Source.1042: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.1043: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3 Source.1044: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.1045: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4 Source.1046: DFBPPR20504 ---- Animal proteins ---- 28S ribosomal protein S18c, mitochondrial Source.1047: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.1048: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial Source.1049: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1050: DFBPPR20536 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1 Source.1051: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230 Source.1052: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.1053: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial Source.1054: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.1055: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.1056: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.1057: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.1058: DFBPPR20656 ---- Animal proteins ---- Protein archease Source.1059: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1060: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4 Source.1061: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.1062: DFBPPR20721 ---- Animal proteins ---- Myomesin-1 Source.1063: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.1064: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.1065: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.1066: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2 Source.1067: DFBPPR20766 ---- Animal proteins ---- Torsin-2A Source.1068: DFBPPR20769 ---- Animal proteins ---- Coiled-coil domain-containing protein 69 Source.1069: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain Source.1070: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Source.1071: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.1072: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.1073: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1074: DFBPPR20867 ---- Animal proteins ---- Protein BUD31 homolog Source.1075: DFBPPR20868 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial Source.1076: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1 Source.1077: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.1078: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1079: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4 Source.1080: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.1081: DFBPPR20954 ---- Animal proteins ---- Secretagogin Source.1082: DFBPPR20960 ---- Animal proteins ---- Complexin-1 Source.1083: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit Source.1084: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1085: DFBPPR21013 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit D Source.1086: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.1087: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.1088: DFBPPR21092 ---- Animal proteins ---- Calponin-1 Source.1089: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148 Source.1090: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1091: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7 Source.1092: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog Source.1093: DFBPPR21129 ---- Animal proteins ---- 60S ribosomal protein L15 Source.1094: DFBPPR21153 ---- Animal proteins ---- Resistin Source.1095: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1 Source.1096: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22 Source.1097: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.1098: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.1099: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.1100: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6 Source.1101: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.1102: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.1103: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3 Source.1104: DFBPPR21376 ---- Animal proteins ---- Calponin-3 Source.1105: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.1106: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.1107: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.1108: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.1109: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.1110: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.1111: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like Source.1112: DFBPPR21525 ---- Animal proteins ---- AN1-type zinc finger protein 6 Source.1113: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55 Source.1114: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.1115: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1116: DFBPPR21629 ---- Animal proteins ---- Annexin A3 Source.1117: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14 Source.1118: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1 Source.1119: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26 Source.1120: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like Source.1121: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.1122: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator Source.1123: DFBPPR21702 ---- Animal proteins ---- Rhombotin-2 Source.1124: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2 Source.1125: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.1126: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.1127: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.1128: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1129: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.1130: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.1131: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B Source.1132: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1133: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.1134: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2 Source.1135: DFBPPR21843 ---- Animal proteins ---- Tektin-1 Source.1136: DFBPPR21846 ---- Animal proteins ---- Izumo sperm-egg fusion protein 3 Source.1137: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2 Source.1138: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin Source.1139: DFBPPR21869 ---- Animal proteins ---- Centromere protein O Source.1140: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1 Source.1141: DFBPPR21902 ---- Animal proteins ---- Centromere protein N Source.1142: DFBPPR21935 ---- Animal proteins ---- Sentan Source.1143: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.1144: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.1145: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein Source.1146: DFBPPR22004 ---- Animal proteins ---- 60S ribosomal protein L35a Source.1147: DFBPPR22029 ---- Animal proteins ---- COMM domain-containing protein 7 Source.1148: DFBPPR22030 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 25 kDa protein Source.1149: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.1150: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.1151: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.1152: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.1153: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.1154: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2 Source.1155: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.1156: DFBPPR22184 ---- Animal proteins ---- 60S ribosomal protein L32 Source.1157: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial Source.1158: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.1159: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5 Source.1160: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog Source.1161: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.1162: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.1163: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.1164: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B Source.1165: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.1166: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.1167: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.1168: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4 Source.1169: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2 Source.1170: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog Source.1171: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog Source.1172: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.1173: DFBPPR22445 ---- Animal proteins ---- Tetratricopeptide repeat protein 1 Source.1174: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2 Source.1175: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein Source.1176: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.1177: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3 Source.1178: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2 Source.1179: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1 Source.1180: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18 Source.1181: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.1182: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.1183: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153 Source.1184: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5 Source.1185: DFBPPR22650 ---- Animal proteins ---- Protein FAM183A Source.1186: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1 Source.1187: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A Source.1188: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28 Source.1189: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.1190: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog Source.1191: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1 Source.1192: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1193: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.1194: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1195: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.1196: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1197: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.1198: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1199: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.1200: DFBPPR8582 ---- Animal proteins ---- Interferon gamma Source.1201: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1202: DFBPPR8607 ---- Animal proteins ---- Prolactin Source.1203: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.1204: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.1205: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1206: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.1207: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.1208: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.1209: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1210: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.1211: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A Source.1212: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.1213: DFBPPR8659 ---- Animal proteins ---- Fibroblast growth factor 1 Source.1214: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.1215: DFBPPR8668 ---- Animal proteins ---- Annexin A1 Source.1216: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.1217: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.1218: DFBPPR8694 ---- Animal proteins ---- Spastin Source.1219: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.1220: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1221: DFBPPR8734 ---- Animal proteins ---- Clusterin Source.1222: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H Source.1223: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.1224: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.1225: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1226: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1227: DFBPPR8787 ---- Animal proteins ---- Cathepsin D Source.1228: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.1229: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.1230: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1 Source.1231: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2 Source.1232: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1233: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1234: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.1235: DFBPPR8904 ---- Animal proteins ---- Osteopontin Source.1236: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.1237: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.1238: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.1239: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.1240: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.1241: DFBPPR9015 ---- Animal proteins ---- Serotransferrin Source.1242: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.1243: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.1244: DFBPPR9040 ---- Animal proteins ---- Angiogenin Source.1245: DFBPPR9045 ---- Animal proteins ---- Ferritin heavy chain Source.1246: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.1247: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.1248: DFBPPR9072 ---- Animal proteins ---- CD9 antigen Source.1249: DFBPPR9077 ---- Animal proteins ---- Lysozyme C-2 Source.1250: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase Source.1251: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.1252: DFBPPR9092 ---- Animal proteins ---- Galanin peptides Source.1253: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1254: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.1255: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.1256: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.1257: DFBPPR9189 ---- Animal proteins ---- Follitropin subunit beta Source.1258: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.1259: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein Source.1260: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.1261: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.1262: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1263: DFBPPR9291 ---- Animal proteins ---- Lysozyme C-1 Source.1264: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4 Source.1265: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.1266: DFBPPR9320 ---- Animal proteins ---- Aromatase 1 Source.1267: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.1268: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.1269: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1 Source.1270: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.1271: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.1272: DFBPPR9382 ---- Animal proteins ---- Proteasome subunit beta type-4 Source.1273: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.1274: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.1275: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.1276: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1277: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.1278: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26 Source.1279: DFBPPR9577 ---- Animal proteins ---- Stathmin Source.1280: DFBPPR9630 ---- Animal proteins ---- Calponin-1 Source.1281: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.1282: DFBPPR9688 ---- Animal proteins ---- Outer dense fiber protein 1 Source.1283: DFBPPR9713 ---- Animal proteins ---- Hepcidin Source.1284: DFBPPR9729 ---- Animal proteins ---- Secretagogin Source.1285: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide Source.1286: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.1287: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1288: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain Source.1289: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.1290: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.1291: DFBPPR9824 ---- Animal proteins ---- 60S ribosomal protein L32 Source.1292: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1 Source.1293: DFBPPR9845 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.1294: DFBPPR9900 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.1295: DFBPPR9914 ---- Animal proteins ---- 60S ribosomal protein L15 Source.1296: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2 Source.1297: DFBPPR9920 ---- Animal proteins ---- 60S ribosomal protein L4 Source.1298: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127 Source.1299: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.1300: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.1301: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase Source.1302: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.1303: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1304: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin Source.1305: DFBPPR9975 ---- Animal proteins ---- Interleukin-10 Source.1306: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2 Source.1307: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1308: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.1309: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.1310: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.1311: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.1312: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.1313: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.1314: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.1315: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.1316: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4 Source.1317: DFBPPR10115 ---- Animal proteins ---- Annexin A1 Source.1318: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.1319: DFBPPR10121 ---- Animal proteins ---- Fibroblast growth factor 2 Source.1320: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase Source.1321: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.1322: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3 Source.1323: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1324: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.1325: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.1326: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.1327: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1 Source.1328: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.1329: DFBPPR10205 ---- Animal proteins ---- Noelin Source.1330: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.1331: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11 Source.1332: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.1333: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.1334: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2 Source.1335: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.1336: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.1337: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1 Source.1338: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1 Source.1339: DFBPPR10264 ---- Animal proteins ---- Fibroblast growth factor 1 Source.1340: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.1341: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.1342: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.1343: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1344: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.1345: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4 Source.1346: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.1347: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1348: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.1349: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1350: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.1351: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.1352: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.1353: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1354: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.1355: DFBPPR10434 ---- Animal proteins ---- Parathyroid hormone Source.1356: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.1357: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.1358: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.1359: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.1360: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.1361: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1362: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1363: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1 Source.1364: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.1365: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.1366: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.1367: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1 Source.1368: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.1369: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.1370: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.1371: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.1372: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.1373: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.1374: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.1375: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.1376: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.1377: DFBPPR10686 ---- Animal proteins ---- Collectin-11 Source.1378: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1379: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.1380: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.1381: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.1382: DFBPPR10731 ---- Animal proteins ---- Protein cereblon Source.1383: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10 Source.1384: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.1385: DFBPPR10756 ---- Animal proteins ---- Ferritin heavy chain Source.1386: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1387: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3 Source.1388: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1389: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide Source.1390: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1391: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Source.1392: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.1393: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.1394: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.1395: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.1396: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.1397: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.1398: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2 Source.1399: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.1400: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.1401: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.1402: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.1403: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D Source.1404: DFBPPR11000 ---- Animal proteins ---- Tropomyosin beta chain Source.1405: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.1406: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.1407: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.1408: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.1409: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.1410: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.1411: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.1412: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1413: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform Source.1414: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1415: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.1416: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B Source.1417: DFBPPR11155 ---- Animal proteins ---- Stathmin Source.1418: DFBPPR11160 ---- Animal proteins ---- 16 kDa beta-galactoside-binding lectin Source.1419: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.1420: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta Source.1421: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein Source.1422: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.1423: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1424: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha Source.1425: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.1426: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.1427: DFBPPR11239 ---- Animal proteins ---- Charged multivesicular body protein 1b Source.1428: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.1429: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1430: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.1431: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3 Source.1432: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.1433: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8 Source.1434: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1435: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4 Source.1436: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.1437: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1438: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1439: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.1440: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.1441: DFBPPR11447 ---- Animal proteins ---- Translationally-controlled tumor protein homolog Source.1442: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin Source.1443: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.1444: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.1445: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1 Source.1446: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog Source.1447: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.1448: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.1449: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.1450: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230 Source.1451: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.1452: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.1453: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59 Source.1454: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4 Source.1455: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2 Source.1456: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.1457: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.1458: DFBPPR11674 ---- Animal proteins ---- Protein MRP-126 Source.1459: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H Source.1460: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.1461: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.1462: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.1463: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.1464: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.1465: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.1466: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.1467: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.1468: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.1469: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.1470: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11 Source.1471: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.1472: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.1473: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.1474: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.1475: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.1476: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein Source.1477: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.1478: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.1479: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.1480: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1481: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.1482: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.1483: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.1484: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.1485: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.1486: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.1487: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.1488: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93 Source.1489: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.1490: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6 Source.1491: DFBPPR12142 ---- Animal proteins ---- FGFR1 oncogene partner 2 homolog Source.1492: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23 Source.1493: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX Source.1494: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.1495: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1496: DFBPPR12251 ---- Animal proteins ---- Serotransferrin Source.1497: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1 Source.1498: DFBPPR12276 ---- Animal proteins ---- Protein S100-A9 Source.1499: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.1500: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.1501: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.1502: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.1503: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.1504: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.1505: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.1506: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1507: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.1508: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2 Source.1509: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.1510: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.1511: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.1512: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.1513: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.1514: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.1515: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.1516: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.1517: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.1518: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.1519: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1520: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.1521: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.1522: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1523: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.1524: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.1525: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.1526: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.1527: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.1528: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.1529: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.1530: DFBPPR12502 ---- Animal proteins ---- Fibroblast growth factor 2 Source.1531: DFBPPR12511 ---- Animal proteins ---- Serine/threonine-protein kinase 17A Source.1532: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.1533: DFBPPR12536 ---- Animal proteins ---- Albumin Source.1534: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.1535: DFBPPR12569 ---- Animal proteins ---- Alveolar macrophage chemotactic factor Source.1536: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.1537: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.1538: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.1539: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.1540: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.1541: DFBPPR12767 ---- Animal proteins ---- Follitropin subunit beta Source.1542: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase Source.1543: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.1544: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.1545: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.1546: DFBPPR12871 ---- Animal proteins ---- Tropomyosin beta chain Source.1547: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.1548: DFBPPR12894 ---- Animal proteins ---- Parvalbumin alpha Source.1549: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.1550: DFBPPR12969 ---- Animal proteins ---- Prolactin Source.1551: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.1552: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1553: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.1554: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein Source.1555: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.1556: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.1557: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1558: DFBPPR13146 ---- Animal proteins ---- Interferon gamma Source.1559: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.1560: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.1561: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.1562: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1563: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.1564: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.1565: DFBPPR13210 ---- Animal proteins ---- Angiogenin Source.1566: DFBPPR13257 ---- Animal proteins ---- Prolactin Source.1567: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.1568: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.1569: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.1570: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.1571: DFBPPR13319 ---- Animal proteins ---- Ferritin heavy chain Source.1572: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.1573: DFBPPR13422 ---- Animal proteins ---- Interferon gamma Source.1574: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.1575: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.1576: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.1577: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.1578: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1579: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.1580: DFBPPR13557 ---- Animal proteins ---- Interferon gamma Source.1581: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.1582: DFBPPR13569 ---- Animal proteins ---- Fibroblast growth factor 2 Source.1583: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1584: DFBPPR13584 ---- Animal proteins ---- Calpain-3 Source.1585: DFBPPR13586 ---- Animal proteins ---- Fibroblast growth factor 1 Source.1586: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.1587: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.1588: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1589: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1590: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.1591: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.1592: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.1593: DFBPPR13696 ---- Animal proteins ---- Cathepsin D Source.1594: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.1595: DFBPPR13774 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1 Source.1596: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor Source.1597: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B Source.1598: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.1599: DFBPPR13893 ---- Animal proteins ---- Calponin-1 Source.1600: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1601: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1602: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26 Source.1603: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.1604: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.1605: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.1606: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1607: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.1608: DFBPPR14070 ---- Animal proteins ---- 60S ribosomal protein L15 Source.1609: DFBPPR14082 ---- Marine protein ---- Estrogen receptor Source.1610: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1 Source.1611: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.1612: DFBPPR14125 ---- Marine protein ---- Partner of Y14 and mago B Source.1613: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial Source.1614: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.1615: DFBPPR14183 ---- Marine protein ---- Pleckstrin homology-like domain family A member 2 Source.1616: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1 Source.1617: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.1618: DFBPPR14301 ---- Marine protein ---- ATP synthase subunit b', chloroplastic Source.1619: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.1620: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH Source.1621: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B Source.1622: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.1623: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.1624: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.1625: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.1626: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.1627: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase Source.1628: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.1629: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.1630: DFBPPR14392 ---- Marine protein ---- Prenyl transferase Source.1631: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic Source.1632: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic Source.1633: DFBPPR14405 ---- Marine protein ---- Uncharacterized monothiol glutaredoxin ycf64 Source.1634: DFBPPR14408 ---- Marine protein ---- Cytochrome b6-f complex subunit 6 Source.1635: DFBPPR14413 ---- Marine protein ---- 30S ribosomal protein S18, chloroplastic Source.1636: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.1637: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.1638: DFBPPR14444 ---- Marine protein ---- 50S ribosomal protein L23, chloroplastic Source.1639: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29 Source.1640: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46 Source.1641: DFBPPR14494 ---- Marine protein ---- 50S ribosomal protein L35, chloroplastic Source.1642: DFBPPR14498 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic Source.1643: DFBPPR14501 ---- Marine protein ---- 50S ribosomal protein L28, chloroplastic Source.1644: DFBPPR14509 ---- Marine protein ---- Uncharacterized protein ycf37 Source.1645: DFBPPR14517 ---- Marine protein ---- Uncharacterized protein ycf54 Source.1646: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.1647: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.1648: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.1649: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.1650: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4 Source.1651: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase Source.1652: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.1653: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.1654: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor Source.1655: DFBPPR14720 ---- Marine protein ---- Transcription initiation factor IIA subunit 2 Source.1656: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.1657: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain Source.1658: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.1659: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1660: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.1661: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.1662: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.1663: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.1664: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1 Source.1665: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.1666: DFBPPR14906 ---- Microorganism protein ---- Autophagy-related protein 8 Source.1667: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase Source.1668: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18 Source.1669: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.1670: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2 Source.1671: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1 Source.1672: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.1673: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.1674: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.1675: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.1676: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1 Source.1677: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1 Source.1678: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4 Source.1679: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.1680: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.1681: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.1682: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52 Source.1683: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.1684: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.1685: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.1686: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.1687: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2 Source.1688: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial Source.1689: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1 Source.1690: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.1691: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.1692: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase Source.1693: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.1694: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase Source.1695: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.1696: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.1697: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.1698: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C Source.1699: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase Source.1700: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.1701: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.1702: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.1703: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5 Source.1704: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.1705: DFBPPR15247 ---- Microorganism protein ---- Vacuolar-sorting protein SNF7 Source.1706: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.1707: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3 Source.1708: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.1709: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5 Source.1710: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1 Source.1711: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.1712: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1 Source.1713: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.1714: DFBPPR15363 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit F, mitochondrial Source.1715: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase Source.1716: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.1717: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.1718: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.1719: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1 Source.1720: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.1721: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.1722: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41 Source.1723: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71 Source.1724: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1 Source.1725: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial Source.1726: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.1727: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121 Source.1728: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.1729: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.1730: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6 Source.1731: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5 Source.1732: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.1733: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.1734: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.1735: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2 Source.1736: DFBPPR15609 ---- Microorganism protein ---- Shugoshin Source.1737: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.1738: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2 Source.1739: DFBPPR15627 ---- Microorganism protein ---- Multiprotein-bridging factor 1 Source.1740: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1 Source.1741: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16 Source.1742: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3 Source.1743: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21 Source.1744: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.1745: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.1746: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial Source.1747: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial Source.1748: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.1749: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2 Source.1750: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial Source.1751: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1 Source.1752: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1 Source.1753: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial Source.1754: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.1755: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase Source.1756: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.1757: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.1758: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component Source.1759: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.1760: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.1761: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.1762: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.1763: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.1764: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial Source.1765: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.1766: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase Source.1767: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.1768: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.1769: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog Source.1770: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4 Source.1771: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.1772: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.1773: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.1774: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A Source.1775: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase Source.1776: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.1777: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.1778: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.1779: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.1780: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.1781: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.1782: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.1783: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.1784: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.1785: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.1786: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.1787: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.1788: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.1789: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.1790: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.1791: DFBPPR7856 ---- Plant protein ---- Maturase K Source.1792: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.1793: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.1794: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1 Source.1795: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic Source.1796: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.1797: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP Source.1798: DFBPPR7960 ---- Plant protein ---- Vicilin Source.1799: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1 Source.1800: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92 Source.1801: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87 Source.1802: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1 Source.1803: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.1804: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.1805: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.1806: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.1807: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.1808: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.1809: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.1810: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.1811: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic Source.1812: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.1813: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.1814: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1 Source.1815: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2 Source.1816: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.1817: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.1818: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1 Source.1819: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.1820: DFBPPR8149 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic Source.1821: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.1822: DFBPPR8156 ---- Plant protein ---- Nodulin-30 Source.1823: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase Source.1824: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase Source.1825: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase Source.1826: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase Source.1827: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.1828: DFBPPR8308 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.1829: DFBPPR8314 ---- Plant protein ---- Maturase K Source.1830: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein Source.1831: DFBPPR8328 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity	The peptide KAI was a potential antioxidant peptide (data not shown).
Specific target protein(s)	N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	A peptidic fraction having antioxidant activity was separated from the proteolytic digest of dried bonito protein by ion-exchange chromatography and gel filtration.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Suetsuna, K. Separation and Identification of Antioxidant Peptides from Proteolytic Digest of Dried Bonito. NIPPON SUISAN GAKKAISHI. 1999, 65, 92-6. DOI: 10.2331/suisan.65.92
Other literature(s)	N.D
PubDate	1999