E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0329(Antioxidative peptide)
DFBP ID DFBPANOX0329
Peptide sequence KAI
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Lys-Ala-Ile
Single-letter amino acid KAI
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 330.42 Da c
Net charge 0.00 c
Isoelectric point (pI) 10.04 c
IC50 N.D
pIC50 N.D
GRAVY 0.8000 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal, Fish, Marine
Organism/Source Bonito
Precursor protein Dried bonito muscle
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.2: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.3: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.4: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.5: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.6: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.7: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.8: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.9: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.10: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.11: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.12: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.13: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.14: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.15: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.16: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.17: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.18: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.19: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.20: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.21: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.22: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.23: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.24: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.25: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.26: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.27: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.28: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.29: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.30: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.31: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.32: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.33: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.34: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.35: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.36: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.37: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.38: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.39: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.40: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.41: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.42: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.43: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.44: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.45: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.46: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.47: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.48: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.49: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.50: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3
Source.51: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.52: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.53: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.54: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.55: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.56: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.57: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.58: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.59: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.60: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.61: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.62: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.63: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.64: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.65: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.66: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.67: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.68: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.69: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.70: DFBPPR1431 ---- Plant proteins ---- Glutaredoxin-C6
Source.71: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.72: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.73: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.74: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.75: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.76: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.77: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.78: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.79: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.80: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.81: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.82: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.83: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.84: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.85: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.86: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.87: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.88: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.89: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.90: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.91: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.92: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.93: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.94: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.95: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.96: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.97: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.98: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19
Source.99: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.100: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.101: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3
Source.102: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.103: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.104: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.105: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.106: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.107: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.108: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.109: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.110: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1
Source.111: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.112: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.113: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic
Source.114: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.115: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.116: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.117: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.118: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.119: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.120: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.121: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.122: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.123: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.124: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4
Source.125: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.126: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.127: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.128: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.129: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.130: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.131: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1
Source.132: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.133: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.134: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.135: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.136: DFBPPR2026 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.137: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.138: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.139: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.140: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.141: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.142: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.143: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.144: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.145: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2
Source.146: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.147: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.148: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.149: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.150: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.151: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.152: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.153: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.154: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.155: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.156: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.157: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.158: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.159: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.160: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3
Source.161: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.162: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.163: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.164: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.165: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.166: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.167: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.168: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.169: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.170: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.171: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.172: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.173: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2
Source.174: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.175: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.176: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.177: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.178: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.179: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.180: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.181: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.182: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.183: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.184: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.185: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2
Source.186: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.187: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.188: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.189: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.190: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3
Source.191: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.192: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.193: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.194: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.195: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.196: DFBPPR2712 ---- Plant proteins ---- Expansin-A20
Source.197: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.198: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.199: DFBPPR2728 ---- Plant proteins ---- Autophagy-related protein 8B
Source.200: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.201: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C
Source.202: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A
Source.203: DFBPPR2745 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor EL2
Source.204: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.205: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.206: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.207: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.208: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.209: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.210: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.211: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.212: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.213: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.214: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.215: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2
Source.216: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.217: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.218: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.219: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.220: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.221: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.222: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.223: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.224: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.225: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.226: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.227: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.228: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.229: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.230: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.231: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.232: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.233: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.234: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.235: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.236: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.237: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.238: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.239: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.240: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.241: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.242: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1
Source.243: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2
Source.244: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.245: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.246: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.247: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.248: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.249: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.250: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.251: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.252: DFBPPR3170 ---- Plant proteins ---- Probable histone H2A.2
Source.253: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.254: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.255: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.256: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.257: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.258: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.259: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.260: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.261: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.262: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7
Source.263: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.264: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit
Source.265: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1
Source.266: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.267: DFBPPR3294 ---- Plant proteins ---- Probable histone H2A.3
Source.268: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.269: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.270: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.271: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.272: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.273: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.274: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.275: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.276: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.277: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.278: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.279: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.280: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.281: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.282: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.283: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.284: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.285: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.286: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7
Source.287: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.288: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.289: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.290: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.291: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.292: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.293: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.294: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.295: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.296: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.297: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.298: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.299: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.300: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.301: DFBPPR3652 ---- Plant proteins ---- Nucleosome assembly protein 1;3
Source.302: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.303: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.304: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.305: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67
Source.306: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.307: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.308: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.309: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.310: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.311: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.312: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.313: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.314: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.315: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.316: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit
Source.317: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.318: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.319: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.320: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.321: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3
Source.322: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.323: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.324: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.325: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.326: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.327: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.328: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.329: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.330: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.331: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.332: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.333: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1
Source.334: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.335: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.336: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3
Source.337: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.338: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3
Source.339: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.340: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.341: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.342: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.343: DFBPPR4294 ---- Plant proteins ---- Nucleosome assembly protein 1-like 4
Source.344: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.345: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.346: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.347: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.348: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.349: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.350: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.351: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.352: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.353: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.354: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.355: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.356: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.357: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.358: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.359: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.360: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.361: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.362: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.363: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.364: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.365: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.366: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.367: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.368: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.369: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.370: DFBPPR4705 ---- Plant proteins ---- 40S ribosomal protein S26
Source.371: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.372: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.373: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500
Source.374: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.375: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.376: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.377: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.378: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.379: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.380: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.381: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.382: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.383: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.384: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.385: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.386: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.387: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.388: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.389: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.390: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.391: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.392: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.393: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.394: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.395: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.396: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.397: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.398: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1
Source.399: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.400: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2
Source.401: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.402: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3
Source.403: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.404: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.405: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.406: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.407: DFBPPR5081 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.408: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.409: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.410: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.411: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.412: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22
Source.413: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein
Source.414: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.415: DFBPPR5131 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.416: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein
Source.417: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2
Source.418: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.419: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.420: DFBPPR5158 ---- Plant proteins ---- Class I heat shock protein
Source.421: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.422: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.423: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.424: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.425: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.426: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.427: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.428: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.429: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.430: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.431: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.432: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1
Source.433: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.434: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B
Source.435: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.436: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.437: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.438: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.439: DFBPPR5316 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic
Source.440: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.441: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.442: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.443: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.444: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.445: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.446: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.447: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.448: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.449: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.450: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.451: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.452: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.453: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.454: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.455: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.456: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.457: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.458: DFBPPR5492 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit
Source.459: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.460: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.461: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.462: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.463: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.464: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.465: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.466: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.467: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.468: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.469: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.470: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.471: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.472: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.473: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.474: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.475: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.476: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.477: DFBPPR5681 ---- Plant proteins ---- Single myb histone 4
Source.478: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.479: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.480: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.481: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.482: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.483: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.484: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.485: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.486: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.487: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.488: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.489: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.490: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.491: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.492: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.493: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.494: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF
Source.495: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.496: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.497: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.498: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.499: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.500: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.501: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.502: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.503: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.504: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B
Source.505: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.506: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.507: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.508: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.509: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.510: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.511: DFBPPR5959 ---- Plant proteins ---- Ribosomal protein S13, mitochondrial
Source.512: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.513: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.514: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.515: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.516: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.517: DFBPPR6056 ---- Plant proteins ---- Bowman-Birk type wound-induced proteinase inhibitor WIP1
Source.518: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.519: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4
Source.520: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.521: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.522: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.523: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34
Source.524: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.525: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.526: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.527: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.528: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.529: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.530: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.531: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.532: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.533: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.534: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.535: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.536: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.537: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.538: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.539: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.540: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.541: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.542: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.543: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.544: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.545: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.546: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.547: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.548: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.549: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.550: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.551: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.552: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.553: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.554: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.555: DFBPPR6458 ---- Plant proteins ---- Convicilin
Source.556: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.557: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.558: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.559: DFBPPR6510 ---- Plant proteins ---- 50S ribosomal protein 6, chloroplastic
Source.560: DFBPPR6528 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic
Source.561: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.562: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.563: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.564: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.565: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.566: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.567: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.568: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.569: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.570: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.571: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.572: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.573: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.574: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.575: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7
Source.576: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.577: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.578: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.579: DFBPPR6754 ---- Plant proteins ---- Histone H2A.4
Source.580: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.581: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.582: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.583: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.584: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.585: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.586: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.587: DFBPPR6883 ---- Plant proteins ---- Ribosomal protein S13, mitochondrial
Source.588: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.589: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.590: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.591: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.592: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.593: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.594: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.595: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.596: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.597: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.598: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.599: DFBPPR7077 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor
Source.600: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.601: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.602: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.603: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.604: DFBPPR7098 ---- Plant proteins ---- Acyl carrier protein 2, chloroplastic
Source.605: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.606: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.607: DFBPPR7114 ---- Plant proteins ---- Acyl carrier protein 3, chloroplastic
Source.608: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.609: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.610: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.611: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.612: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.613: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.614: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.615: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.616: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.617: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.618: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.619: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.620: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2
Source.621: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.622: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.623: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.624: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.625: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.626: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.627: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.628: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.629: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.630: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.631: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.632: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.633: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.634: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.635: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.636: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.637: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.638: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.639: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial
Source.640: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.641: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.642: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.643: DFBPPR7606 ---- Milk proteins ---- Osteopontin
Source.644: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.645: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.646: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.647: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.648: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.649: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.650: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.651: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.652: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein
Source.653: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein
Source.654: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.655: DFBPPR7708 ---- Milk proteins ---- Late lactation protein B, LLP-B
Source.656: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.657: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.658: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.659: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.660: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.661: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.662: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.663: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.664: DFBPPR8198 ---- Plant proteins ---- Inhibitor of trypsin and hageman factor
Source.665: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.666: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.667: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.668: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.669: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.670: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.671: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.672: DFBPPR8436 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor
Source.673: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.674: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.675: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.676: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1
Source.677: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.678: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.679: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.680: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.681: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.682: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.683: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.684: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.685: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.686: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.687: DFBPPR16011 ---- Animal proteins ---- Interferon gamma
Source.688: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.689: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.690: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.691: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.692: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.693: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.694: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.695: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.696: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.697: DFBPPR16120 ---- Animal proteins ---- C-X-C motif chemokine 10
Source.698: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.699: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.700: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.701: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.702: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.703: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.704: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.705: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.706: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.707: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.708: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.709: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.710: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.711: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.712: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.713: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.714: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.715: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.716: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.717: DFBPPR16312 ---- Animal proteins ---- C-C motif chemokine 13
Source.718: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.719: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.720: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.721: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.722: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.723: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.724: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.725: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.726: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.727: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.728: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.729: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.730: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.731: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.732: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin
Source.733: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.734: DFBPPR16627 ---- Animal proteins ---- 60S ribosomal protein L15
Source.735: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.736: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.737: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2
Source.738: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3
Source.739: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator
Source.740: DFBPPR16743 ---- Animal proteins ---- 60S ribosomal protein L32
Source.741: DFBPPR16746 ---- Animal proteins ---- Tektin-1
Source.742: DFBPPR16747 ---- Animal proteins ---- Pleckstrin
Source.743: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.744: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.745: DFBPPR16808 ---- Animal proteins ---- Fibroblast growth factor 2
Source.746: DFBPPR16829 ---- Animal proteins ---- Fibroblast growth factor 1
Source.747: DFBPPR16837 ---- Animal proteins ---- Interferon gamma
Source.748: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.749: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.750: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.751: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.752: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.753: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.754: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.755: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.756: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.757: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.758: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.759: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.760: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2
Source.761: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.762: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.763: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.764: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.765: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.766: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.767: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.768: DFBPPR17128 ---- Animal proteins ---- Intraflagellar transport protein 20 homolog
Source.769: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.770: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.771: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.772: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.773: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.774: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.775: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B
Source.776: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.777: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.778: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.779: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.780: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.781: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.782: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.783: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.784: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.785: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.786: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.787: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1
Source.788: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.789: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.790: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.791: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.792: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.793: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.794: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.795: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.796: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.797: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.798: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.799: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.800: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.801: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1
Source.802: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.803: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.804: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.805: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.806: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.807: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.808: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.809: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.810: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.811: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.812: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.813: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.814: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein
Source.815: DFBPPR17559 ---- Animal proteins ---- C-X-C motif chemokine 10
Source.816: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.817: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.818: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.819: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.820: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.821: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.822: DFBPPR17749 ---- Animal proteins ---- CD9 antigen
Source.823: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase
Source.824: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.825: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.826: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.827: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.828: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.829: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.830: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.831: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.832: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.833: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.834: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.835: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.836: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.837: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.838: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.839: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.840: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.841: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.842: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.843: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.844: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.845: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.846: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.847: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A
Source.848: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3
Source.849: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B
Source.850: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.851: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.852: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.853: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.854: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.855: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.856: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.857: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.858: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.859: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.860: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.861: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1
Source.862: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.863: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.864: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.865: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.866: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.867: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.868: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.869: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.870: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.871: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.872: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.873: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.874: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.875: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.876: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.877: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.878: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.879: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.880: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.881: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.882: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.883: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1
Source.884: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.885: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.886: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.887: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.888: DFBPPR18632 ---- Animal proteins ---- Syntaxin-4
Source.889: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.890: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.891: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.892: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.893: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.894: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3
Source.895: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.896: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.897: DFBPPR18778 ---- Animal proteins ---- Erlin-2
Source.898: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.899: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.900: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.901: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.902: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.903: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.904: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.905: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.906: DFBPPR18869 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit beta
Source.907: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.908: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.909: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.910: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.911: DFBPPR18908 ---- Animal proteins ---- Proteasome subunit alpha type-6
Source.912: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.913: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.914: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.915: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.916: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.917: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.918: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.919: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.920: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.921: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.922: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.923: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.924: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.925: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.926: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.927: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.928: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.929: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.930: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.931: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.932: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.933: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.934: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.935: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.936: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11
Source.937: DFBPPR19165 ---- Animal proteins ---- Tropomyosin beta chain
Source.938: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein
Source.939: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.940: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.941: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.942: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.943: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.944: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.945: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2
Source.946: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.947: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.948: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.949: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.950: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.951: DFBPPR19317 ---- Animal proteins ---- AP-1 complex subunit sigma-1A
Source.952: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.953: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.954: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.955: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.956: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.957: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.958: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.959: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.960: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.961: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.962: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.963: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1
Source.964: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.965: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.966: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.967: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.968: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.969: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.970: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.971: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.972: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.973: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.974: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.975: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.976: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.977: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.978: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.979: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.980: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1
Source.981: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.982: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.983: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.984: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.985: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2
Source.986: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.987: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.988: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.989: DFBPPR19844 ---- Animal proteins ---- Prosalusin
Source.990: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.991: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.992: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1
Source.993: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.994: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.995: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.996: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.997: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.998: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.999: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.1000: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2
Source.1001: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.1002: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.1003: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.1004: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.1005: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.1006: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.1007: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.1008: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.1009: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.1010: DFBPPR20021 ---- Animal proteins ---- Neugrin
Source.1011: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.1012: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.1013: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.1014: DFBPPR20057 ---- Animal proteins ---- AP-3 complex subunit sigma-1
Source.1015: DFBPPR20063 ---- Animal proteins ---- Histone H2B subacrosomal variant
Source.1016: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.1017: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.1018: DFBPPR20130 ---- Animal proteins ---- Stathmin
Source.1019: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.1020: DFBPPR20164 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 2
Source.1021: DFBPPR20184 ---- Animal proteins ---- Centromere protein H
Source.1022: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.1023: DFBPPR20212 ---- Animal proteins ---- Outer dense fiber protein 1
Source.1024: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.1025: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.1026: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.1027: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.1028: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3
Source.1029: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.1030: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.1031: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.1032: DFBPPR20318 ---- Animal proteins ---- Charged multivesicular body protein 1b
Source.1033: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1034: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.1035: DFBPPR20371 ---- Animal proteins ---- Vesicle-associated membrane protein 4
Source.1036: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.1037: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.1038: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.1039: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.1040: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7
Source.1041: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.1042: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.1043: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.1044: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.1045: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4
Source.1046: DFBPPR20504 ---- Animal proteins ---- 28S ribosomal protein S18c, mitochondrial
Source.1047: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.1048: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.1049: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.1050: DFBPPR20536 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1
Source.1051: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.1052: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.1053: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.1054: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.1055: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.1056: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.1057: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.1058: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.1059: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.1060: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.1061: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45
Source.1062: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.1063: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.1064: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.1065: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.1066: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.1067: DFBPPR20766 ---- Animal proteins ---- Torsin-2A
Source.1068: DFBPPR20769 ---- Animal proteins ---- Coiled-coil domain-containing protein 69
Source.1069: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain
Source.1070: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4
Source.1071: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1072: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.1073: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1074: DFBPPR20867 ---- Animal proteins ---- Protein BUD31 homolog
Source.1075: DFBPPR20868 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.1076: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.1077: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1078: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.1079: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4
Source.1080: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.1081: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.1082: DFBPPR20960 ---- Animal proteins ---- Complexin-1
Source.1083: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit
Source.1084: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1085: DFBPPR21013 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit D
Source.1086: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.1087: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial
Source.1088: DFBPPR21092 ---- Animal proteins ---- Calponin-1
Source.1089: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.1090: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.1091: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7
Source.1092: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog
Source.1093: DFBPPR21129 ---- Animal proteins ---- 60S ribosomal protein L15
Source.1094: DFBPPR21153 ---- Animal proteins ---- Resistin
Source.1095: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1
Source.1096: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22
Source.1097: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.1098: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.1099: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.1100: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6
Source.1101: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.1102: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.1103: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.1104: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.1105: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.1106: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.1107: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.1108: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.1109: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.1110: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.1111: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.1112: DFBPPR21525 ---- Animal proteins ---- AN1-type zinc finger protein 6
Source.1113: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55
Source.1114: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3
Source.1115: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1116: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.1117: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.1118: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.1119: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26
Source.1120: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.1121: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.1122: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator
Source.1123: DFBPPR21702 ---- Animal proteins ---- Rhombotin-2
Source.1124: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.1125: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.1126: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.1127: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.1128: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1129: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.1130: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.1131: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.1132: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1133: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1
Source.1134: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.1135: DFBPPR21843 ---- Animal proteins ---- Tektin-1
Source.1136: DFBPPR21846 ---- Animal proteins ---- Izumo sperm-egg fusion protein 3
Source.1137: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.1138: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.1139: DFBPPR21869 ---- Animal proteins ---- Centromere protein O
Source.1140: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.1141: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.1142: DFBPPR21935 ---- Animal proteins ---- Sentan
Source.1143: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.1144: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.1145: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein
Source.1146: DFBPPR22004 ---- Animal proteins ---- 60S ribosomal protein L35a
Source.1147: DFBPPR22029 ---- Animal proteins ---- COMM domain-containing protein 7
Source.1148: DFBPPR22030 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 25 kDa protein
Source.1149: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.1150: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.1151: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.1152: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.1153: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.1154: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.1155: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.1156: DFBPPR22184 ---- Animal proteins ---- 60S ribosomal protein L32
Source.1157: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.1158: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.1159: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5
Source.1160: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog
Source.1161: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.1162: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.1163: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.1164: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.1165: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.1166: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.1167: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.1168: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.1169: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2
Source.1170: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog
Source.1171: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.1172: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.1173: DFBPPR22445 ---- Animal proteins ---- Tetratricopeptide repeat protein 1
Source.1174: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2
Source.1175: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.1176: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.1177: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.1178: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2
Source.1179: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1
Source.1180: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.1181: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.1182: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.1183: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153
Source.1184: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5
Source.1185: DFBPPR22650 ---- Animal proteins ---- Protein FAM183A
Source.1186: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1
Source.1187: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A
Source.1188: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.1189: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.1190: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.1191: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1
Source.1192: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1193: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.1194: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1195: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.1196: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1197: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1198: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1199: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.1200: DFBPPR8582 ---- Animal proteins ---- Interferon gamma
Source.1201: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.1202: DFBPPR8607 ---- Animal proteins ---- Prolactin
Source.1203: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.1204: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.1205: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1206: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.1207: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1208: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.1209: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.1210: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.1211: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A
Source.1212: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.1213: DFBPPR8659 ---- Animal proteins ---- Fibroblast growth factor 1
Source.1214: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1215: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.1216: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.1217: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1218: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.1219: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.1220: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1221: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.1222: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.1223: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.1224: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1225: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1226: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1227: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.1228: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1229: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.1230: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.1231: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.1232: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.1233: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.1234: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.1235: DFBPPR8904 ---- Animal proteins ---- Osteopontin
Source.1236: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1237: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1238: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1239: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1240: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.1241: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.1242: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.1243: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.1244: DFBPPR9040 ---- Animal proteins ---- Angiogenin
Source.1245: DFBPPR9045 ---- Animal proteins ---- Ferritin heavy chain
Source.1246: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.1247: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1248: DFBPPR9072 ---- Animal proteins ---- CD9 antigen
Source.1249: DFBPPR9077 ---- Animal proteins ---- Lysozyme C-2
Source.1250: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1251: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.1252: DFBPPR9092 ---- Animal proteins ---- Galanin peptides
Source.1253: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1254: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.1255: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1256: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.1257: DFBPPR9189 ---- Animal proteins ---- Follitropin subunit beta
Source.1258: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.1259: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein
Source.1260: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.1261: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.1262: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1263: DFBPPR9291 ---- Animal proteins ---- Lysozyme C-1
Source.1264: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.1265: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.1266: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.1267: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1268: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.1269: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.1270: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.1271: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.1272: DFBPPR9382 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.1273: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.1274: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.1275: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.1276: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.1277: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.1278: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26
Source.1279: DFBPPR9577 ---- Animal proteins ---- Stathmin
Source.1280: DFBPPR9630 ---- Animal proteins ---- Calponin-1
Source.1281: DFBPPR9683 ---- Animal proteins ---- Calpastatin
Source.1282: DFBPPR9688 ---- Animal proteins ---- Outer dense fiber protein 1
Source.1283: DFBPPR9713 ---- Animal proteins ---- Hepcidin
Source.1284: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.1285: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide
Source.1286: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1287: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.1288: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.1289: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.1290: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.1291: DFBPPR9824 ---- Animal proteins ---- 60S ribosomal protein L32
Source.1292: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.1293: DFBPPR9845 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.1294: DFBPPR9900 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.1295: DFBPPR9914 ---- Animal proteins ---- 60S ribosomal protein L15
Source.1296: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.1297: DFBPPR9920 ---- Animal proteins ---- 60S ribosomal protein L4
Source.1298: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.1299: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.1300: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.1301: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.1302: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1303: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1304: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.1305: DFBPPR9975 ---- Animal proteins ---- Interleukin-10
Source.1306: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.1307: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.1308: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.1309: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.1310: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.1311: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.1312: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.1313: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1314: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.1315: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.1316: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.1317: DFBPPR10115 ---- Animal proteins ---- Annexin A1
Source.1318: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.1319: DFBPPR10121 ---- Animal proteins ---- Fibroblast growth factor 2
Source.1320: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.1321: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.1322: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.1323: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1324: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1325: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.1326: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.1327: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.1328: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.1329: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.1330: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.1331: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.1332: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.1333: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.1334: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.1335: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.1336: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.1337: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1
Source.1338: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.1339: DFBPPR10264 ---- Animal proteins ---- Fibroblast growth factor 1
Source.1340: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.1341: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1342: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.1343: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1344: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.1345: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.1346: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.1347: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1348: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.1349: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.1350: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.1351: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.1352: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.1353: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1354: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1355: DFBPPR10434 ---- Animal proteins ---- Parathyroid hormone
Source.1356: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.1357: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.1358: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.1359: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.1360: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.1361: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.1362: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1363: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.1364: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.1365: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1366: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.1367: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1
Source.1368: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.1369: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.1370: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.1371: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.1372: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.1373: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.1374: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1375: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.1376: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1377: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.1378: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1379: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1380: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.1381: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.1382: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.1383: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10
Source.1384: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1385: DFBPPR10756 ---- Animal proteins ---- Ferritin heavy chain
Source.1386: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1387: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3
Source.1388: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.1389: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.1390: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1391: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.1392: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.1393: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.1394: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.1395: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.1396: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.1397: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1398: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2
Source.1399: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.1400: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.1401: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.1402: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.1403: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.1404: DFBPPR11000 ---- Animal proteins ---- Tropomyosin beta chain
Source.1405: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.1406: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.1407: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.1408: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.1409: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.1410: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.1411: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.1412: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1413: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.1414: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1415: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.1416: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.1417: DFBPPR11155 ---- Animal proteins ---- Stathmin
Source.1418: DFBPPR11160 ---- Animal proteins ---- 16 kDa beta-galactoside-binding lectin
Source.1419: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.1420: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.1421: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.1422: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.1423: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1424: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.1425: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.1426: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.1427: DFBPPR11239 ---- Animal proteins ---- Charged multivesicular body protein 1b
Source.1428: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.1429: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1430: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.1431: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.1432: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.1433: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.1434: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1435: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4
Source.1436: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.1437: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1438: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.1439: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1440: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.1441: DFBPPR11447 ---- Animal proteins ---- Translationally-controlled tumor protein homolog
Source.1442: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.1443: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.1444: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.1445: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.1446: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.1447: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.1448: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.1449: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.1450: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230
Source.1451: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1452: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.1453: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.1454: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.1455: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.1456: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.1457: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.1458: DFBPPR11674 ---- Animal proteins ---- Protein MRP-126
Source.1459: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.1460: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.1461: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.1462: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.1463: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1
Source.1464: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.1465: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.1466: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.1467: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.1468: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.1469: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.1470: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.1471: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.1472: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.1473: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.1474: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.1475: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.1476: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein
Source.1477: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.1478: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.1479: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.1480: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1481: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.1482: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.1483: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.1484: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.1485: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.1486: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.1487: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.1488: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.1489: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.1490: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.1491: DFBPPR12142 ---- Animal proteins ---- FGFR1 oncogene partner 2 homolog
Source.1492: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.1493: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.1494: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1495: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1496: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.1497: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.1498: DFBPPR12276 ---- Animal proteins ---- Protein S100-A9
Source.1499: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.1500: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1501: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1502: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1503: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1504: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.1505: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.1506: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1507: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.1508: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.1509: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.1510: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.1511: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.1512: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.1513: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.1514: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.1515: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1516: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.1517: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.1518: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.1519: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.1520: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.1521: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.1522: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1523: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.1524: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.1525: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.1526: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.1527: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.1528: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.1529: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1530: DFBPPR12502 ---- Animal proteins ---- Fibroblast growth factor 2
Source.1531: DFBPPR12511 ---- Animal proteins ---- Serine/threonine-protein kinase 17A
Source.1532: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1533: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.1534: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.1535: DFBPPR12569 ---- Animal proteins ---- Alveolar macrophage chemotactic factor
Source.1536: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1537: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.1538: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.1539: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1540: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1541: DFBPPR12767 ---- Animal proteins ---- Follitropin subunit beta
Source.1542: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.1543: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.1544: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1545: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.1546: DFBPPR12871 ---- Animal proteins ---- Tropomyosin beta chain
Source.1547: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.1548: DFBPPR12894 ---- Animal proteins ---- Parvalbumin alpha
Source.1549: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.1550: DFBPPR12969 ---- Animal proteins ---- Prolactin
Source.1551: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.1552: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1553: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.1554: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein
Source.1555: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.1556: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1557: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1558: DFBPPR13146 ---- Animal proteins ---- Interferon gamma
Source.1559: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.1560: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.1561: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.1562: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1563: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.1564: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.1565: DFBPPR13210 ---- Animal proteins ---- Angiogenin
Source.1566: DFBPPR13257 ---- Animal proteins ---- Prolactin
Source.1567: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.1568: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.1569: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.1570: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.1571: DFBPPR13319 ---- Animal proteins ---- Ferritin heavy chain
Source.1572: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.1573: DFBPPR13422 ---- Animal proteins ---- Interferon gamma
Source.1574: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.1575: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1576: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.1577: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.1578: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1579: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1580: DFBPPR13557 ---- Animal proteins ---- Interferon gamma
Source.1581: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.1582: DFBPPR13569 ---- Animal proteins ---- Fibroblast growth factor 2
Source.1583: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1584: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.1585: DFBPPR13586 ---- Animal proteins ---- Fibroblast growth factor 1
Source.1586: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1587: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.1588: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1589: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1590: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.1591: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1592: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.1593: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.1594: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.1595: DFBPPR13774 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1
Source.1596: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.1597: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B
Source.1598: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.1599: DFBPPR13893 ---- Animal proteins ---- Calponin-1
Source.1600: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.1601: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1602: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26
Source.1603: DFBPPR13959 ---- Animal proteins ---- Calpastatin
Source.1604: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.1605: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.1606: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1607: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.1608: DFBPPR14070 ---- Animal proteins ---- 60S ribosomal protein L15
Source.1609: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.1610: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.1611: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.1612: DFBPPR14125 ---- Marine protein ---- Partner of Y14 and mago B
Source.1613: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.1614: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.1615: DFBPPR14183 ---- Marine protein ---- Pleckstrin homology-like domain family A member 2
Source.1616: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1
Source.1617: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.1618: DFBPPR14301 ---- Marine protein ---- ATP synthase subunit b', chloroplastic
Source.1619: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1620: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.1621: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.1622: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.1623: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.1624: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.1625: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1626: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.1627: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.1628: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1629: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.1630: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.1631: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.1632: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.1633: DFBPPR14405 ---- Marine protein ---- Uncharacterized monothiol glutaredoxin ycf64
Source.1634: DFBPPR14408 ---- Marine protein ---- Cytochrome b6-f complex subunit 6
Source.1635: DFBPPR14413 ---- Marine protein ---- 30S ribosomal protein S18, chloroplastic
Source.1636: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.1637: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator
Source.1638: DFBPPR14444 ---- Marine protein ---- 50S ribosomal protein L23, chloroplastic
Source.1639: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29
Source.1640: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.1641: DFBPPR14494 ---- Marine protein ---- 50S ribosomal protein L35, chloroplastic
Source.1642: DFBPPR14498 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic
Source.1643: DFBPPR14501 ---- Marine protein ---- 50S ribosomal protein L28, chloroplastic
Source.1644: DFBPPR14509 ---- Marine protein ---- Uncharacterized protein ycf37
Source.1645: DFBPPR14517 ---- Marine protein ---- Uncharacterized protein ycf54
Source.1646: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.1647: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.1648: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.1649: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.1650: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4
Source.1651: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.1652: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.1653: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.1654: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.1655: DFBPPR14720 ---- Marine protein ---- Transcription initiation factor IIA subunit 2
Source.1656: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.1657: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.1658: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.1659: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1660: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.1661: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.1662: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.1663: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.1664: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.1665: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.1666: DFBPPR14906 ---- Microorganism protein ---- Autophagy-related protein 8
Source.1667: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.1668: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.1669: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.1670: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.1671: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.1672: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.1673: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.1674: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.1675: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.1676: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.1677: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1
Source.1678: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.1679: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.1680: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.1681: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.1682: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.1683: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.1684: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.1685: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.1686: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.1687: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.1688: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.1689: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.1690: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.1691: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.1692: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.1693: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.1694: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.1695: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.1696: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.1697: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.1698: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.1699: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.1700: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.1701: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.1702: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.1703: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.1704: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.1705: DFBPPR15247 ---- Microorganism protein ---- Vacuolar-sorting protein SNF7
Source.1706: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.1707: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.1708: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.1709: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.1710: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.1711: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.1712: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1
Source.1713: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.1714: DFBPPR15363 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit F, mitochondrial
Source.1715: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.1716: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.1717: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.1718: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.1719: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.1720: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.1721: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.1722: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.1723: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71
Source.1724: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.1725: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.1726: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.1727: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121
Source.1728: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.1729: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.1730: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.1731: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.1732: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.1733: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.1734: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.1735: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.1736: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.1737: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.1738: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2
Source.1739: DFBPPR15627 ---- Microorganism protein ---- Multiprotein-bridging factor 1
Source.1740: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.1741: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16
Source.1742: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.1743: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.1744: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.1745: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.1746: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.1747: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.1748: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.1749: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2
Source.1750: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial
Source.1751: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1
Source.1752: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.1753: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial
Source.1754: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.1755: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.1756: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.1757: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.1758: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.1759: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.1760: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase
Source.1761: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.1762: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.1763: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.1764: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.1765: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.1766: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.1767: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.1768: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.1769: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog
Source.1770: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.1771: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.1772: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.1773: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.1774: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A
Source.1775: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.1776: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.1777: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.1778: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.1779: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.1780: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.1781: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.1782: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.1783: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.1784: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.1785: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.1786: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.1787: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.1788: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.1789: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.1790: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.1791: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.1792: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Source.1793: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.1794: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.1795: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.1796: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.1797: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.1798: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.1799: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.1800: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.1801: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.1802: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.1803: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1
Source.1804: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.1805: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.1806: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.1807: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.1808: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.1809: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.1810: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.1811: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.1812: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.1813: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.1814: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.1815: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.1816: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.1817: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.1818: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.1819: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.1820: DFBPPR8149 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic
Source.1821: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.1822: DFBPPR8156 ---- Plant protein ---- Nodulin-30
Source.1823: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.1824: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.1825: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.1826: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.1827: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.1828: DFBPPR8308 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.1829: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.1830: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein
Source.1831: DFBPPR8328 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The peptide KAI was a potential antioxidant peptide (data not shown).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O
Preparation method
Mode of preparation Enzymatic hydrolysis
Enzyme(s)/starter culture

A peptidic fraction having antioxidant activity was separated from the proteolytic digest of dried bonito protein by ion-exchange chromatography and gel filtration.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
BIOPEP-UWM [D1] 8132
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Suetsuna, K. Separation and Identification of Antioxidant Peptides from Proteolytic Digest of Dried Bonito. NIPPON SUISAN GAKKAISHI. 1999, 65, 92-6.
Other literature(s) N.D
PubDate 1999
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214