Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0496(Antioxidative peptide)

DFBP ID	DFBPANOX0496
Peptide sequence	GAA
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Gly-Ala-Ala

Single-letter amino acid

GAA

Peptide length

Peptide mass

Experimental mass	Theoretical mass
217.3 Da	217.22 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.0667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Spotless smoothhound (Mustelus griseus)
Precursor protein	Ethanol-soluble protein, muscle protein
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2 Source.3: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.4: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1 Source.5: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.6: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.7: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.8: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.9: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.10: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.11: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.12: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71 Source.13: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.14: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.15: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.16: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.17: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46 Source.18: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.19: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.20: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.21: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A Source.22: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.23: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.24: DFBPPR0876 ---- Plant proteins ---- Protein BZR1 homolog 1 Source.25: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.26: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.27: DFBPPR0886 ---- Plant proteins ---- Abscisic acid receptor PYL5 Source.28: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.29: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.30: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.31: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.32: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.33: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.34: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12 Source.35: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.36: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.37: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.38: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.39: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6 Source.40: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.41: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.42: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.43: DFBPPR0930 ---- Plant proteins ---- Abscisic acid receptor PYL3 Source.44: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.45: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.46: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.47: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.48: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.49: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.50: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.51: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5 Source.52: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.53: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.54: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5 Source.55: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.56: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.57: DFBPPR0971 ---- Plant proteins ---- Protein STAR1 Source.58: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.59: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.60: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.61: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.62: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.63: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.64: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185 Source.65: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase Source.66: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.67: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.68: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.69: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.70: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.71: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.72: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.73: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.74: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.75: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.76: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.77: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.78: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.79: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.80: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.81: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5 Source.82: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.83: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.84: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.85: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c Source.86: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.87: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.88: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.89: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.90: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.91: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24 Source.92: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46 Source.93: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.94: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1 Source.95: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13 Source.96: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.97: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.98: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.99: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.100: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.101: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.102: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.103: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic Source.104: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.105: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.106: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.107: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG Source.108: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.109: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic Source.110: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.111: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.112: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13 Source.113: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3 Source.114: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.115: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.116: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.117: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.118: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.119: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.120: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.121: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23 Source.122: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.123: DFBPPR1176 ---- Plant proteins ---- Chitinase 12 Source.124: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.125: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic Source.126: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.127: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3 Source.128: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA Source.129: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.130: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.131: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19 Source.132: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial Source.133: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.134: DFBPPR1224 ---- Plant proteins ---- MADS-box transcription factor 50 Source.135: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.136: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.137: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.138: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1 Source.139: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.140: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial Source.141: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.142: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24 Source.143: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.144: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.145: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.146: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.147: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic Source.148: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.149: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.150: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.151: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.152: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.153: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.154: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.155: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.156: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.157: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1 Source.158: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.159: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b Source.160: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.161: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.162: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.163: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.164: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1 Source.165: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B Source.166: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.167: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.168: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.169: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1 Source.170: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.171: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.172: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.173: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.174: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.175: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.176: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.177: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.178: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3 Source.179: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1 Source.180: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2 Source.181: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING Source.182: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.183: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.184: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.185: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.186: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase Source.187: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.188: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.189: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.190: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.191: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.192: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.193: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.194: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B Source.195: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.196: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.197: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.198: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.199: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7 Source.200: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.201: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.202: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.203: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.204: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.205: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.206: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.207: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.208: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.209: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.210: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.211: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.212: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.213: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.214: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.215: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.216: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.217: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.218: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.219: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.220: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.221: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.222: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.223: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.224: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16 Source.225: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.226: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.227: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.228: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.229: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.230: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.231: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.232: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5 Source.233: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.234: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.235: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.236: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.237: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.238: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.239: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.240: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.241: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.242: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.243: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.244: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.245: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.246: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.247: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.248: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5 Source.249: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.250: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.251: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.252: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF Source.253: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2 Source.254: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17 Source.255: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.256: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.257: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic Source.258: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.259: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.260: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.261: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.262: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.263: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.264: DFBPPR1600 ---- Plant proteins ---- Phytosulfokines 5 Source.265: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.266: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.267: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2 Source.268: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.269: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.270: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a Source.271: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic Source.272: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.273: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.274: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.275: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.276: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.277: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.278: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2 Source.279: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.280: DFBPPR1641 ---- Plant proteins ---- Enolase Source.281: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial Source.282: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3 Source.283: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.284: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein Source.285: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic Source.286: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.287: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19 Source.288: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.289: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1 Source.290: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal Source.291: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b Source.292: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.293: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.294: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.295: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.296: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.297: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.298: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.299: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.300: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.301: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.302: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.303: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic Source.304: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.305: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.306: DFBPPR1696 ---- Plant proteins ---- Phytosulfokines 2 Source.307: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.308: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.309: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a Source.310: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2 Source.311: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.312: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic Source.313: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.314: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.315: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.316: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.317: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.318: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.319: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.320: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1 Source.321: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.322: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2 Source.323: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.324: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.325: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.326: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.327: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.328: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.329: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.330: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.331: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22 Source.332: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.333: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.334: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1 Source.335: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.336: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.337: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.338: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9 Source.339: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.340: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2 Source.341: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.342: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a Source.343: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.344: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.345: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.346: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.347: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.348: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1 Source.349: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2 Source.350: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.351: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.352: DFBPPR1848 ---- Plant proteins ---- Chitinase 7 Source.353: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.354: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.355: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.356: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.357: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.358: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.359: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.360: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3 Source.361: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.362: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.363: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.364: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.365: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.366: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.367: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.368: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.369: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.370: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.371: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.372: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.373: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.374: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.375: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3 Source.376: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.377: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic Source.378: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.379: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.380: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA Source.381: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.382: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.383: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.384: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.385: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.386: DFBPPR1962 ---- Plant proteins ---- Expansin-A2 Source.387: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.388: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.389: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.390: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12 Source.391: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.392: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.393: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.394: DFBPPR1991 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic Source.395: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28 Source.396: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.397: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.398: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.399: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.400: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1 Source.401: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.402: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.403: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.404: DFBPPR2015 ---- Plant proteins ---- 50S ribosomal protein L12, chloroplastic Source.405: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a Source.406: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.407: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.408: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.409: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.410: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.411: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.412: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.413: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.414: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.415: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.416: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.417: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.418: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.419: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.420: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.421: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.422: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.423: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.424: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.425: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.426: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.427: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.428: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.429: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.430: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.431: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1 Source.432: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.433: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.434: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80 Source.435: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.436: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.437: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.438: DFBPPR2101 ---- Plant proteins ---- Cupincin Source.439: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.440: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4 Source.441: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1 Source.442: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.443: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2 Source.444: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.445: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD Source.446: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.447: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.448: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.449: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.450: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.451: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1 Source.452: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.453: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.454: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.455: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.456: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.457: DFBPPR2176 ---- Plant proteins ---- Expansin-B11 Source.458: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.459: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.460: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1 Source.461: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.462: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.463: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.464: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1 Source.465: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.466: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein Source.467: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.468: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.469: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.470: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21 Source.471: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.472: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.473: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26 Source.474: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.475: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.476: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.477: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.478: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.479: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.480: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6 Source.481: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.482: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.483: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.484: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.485: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.486: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13 Source.487: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.488: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.489: DFBPPR2260 ---- Plant proteins ---- Succinate dehydrogenase subunit 3-1, mitochondrial Source.490: DFBPPR2261 ---- Plant proteins ---- Succinate dehydrogenase subunit 3-2, mitochondrial Source.491: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.492: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8 Source.493: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.494: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.495: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.496: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.497: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.498: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.499: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.500: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial Source.501: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.502: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial Source.503: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.504: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b Source.505: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.506: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.507: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.508: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2 Source.509: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.510: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.511: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26 Source.512: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.513: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4 Source.514: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.515: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b Source.516: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1 Source.517: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400 Source.518: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial Source.519: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.520: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1 Source.521: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein Source.522: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase Source.523: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.524: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.525: DFBPPR2387 ---- Plant proteins ---- Chitinase 8 Source.526: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1 Source.527: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase Source.528: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.529: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3 Source.530: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2 Source.531: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.532: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.533: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2 Source.534: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.535: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.536: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1 Source.537: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.538: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.539: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.540: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56 Source.541: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.542: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.543: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d Source.544: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.545: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.546: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.547: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.548: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.549: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2 Source.550: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.551: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic Source.552: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.553: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.554: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.555: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.556: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.557: DFBPPR2518 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 2 Source.558: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.559: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.560: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.561: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.562: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.563: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.564: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.565: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.566: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic Source.567: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.568: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.569: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic Source.570: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.571: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.572: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.573: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.574: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.575: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9 Source.576: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.577: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.578: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.579: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.580: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.581: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.582: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.583: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19 Source.584: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.585: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2 Source.586: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.587: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2 Source.588: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57 Source.589: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.590: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.591: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.592: DFBPPR2625 ---- Plant proteins ---- 18.6 kDa class III heat shock protein Source.593: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34 Source.594: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.595: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.596: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.597: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal Source.598: DFBPPR2636 ---- Plant proteins ---- Expansin-B8 Source.599: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.600: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic Source.601: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25 Source.602: DFBPPR2648 ---- Plant proteins ---- SKP1-like protein 20 Source.603: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.604: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.605: DFBPPR2673 ---- Plant proteins ---- Expansin-B13 Source.606: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.607: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1 Source.608: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.609: DFBPPR2684 ---- Plant proteins ---- Arabinogalactan peptide 3 Source.610: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.611: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16 Source.612: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.613: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.614: DFBPPR2710 ---- Plant proteins ---- 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase, chloroplastic Source.615: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.616: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.617: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal Source.618: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.619: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2 Source.620: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.621: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.622: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9 Source.623: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.624: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.625: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2 Source.626: DFBPPR2758 ---- Plant proteins ---- Expansin-B17 Source.627: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.628: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.629: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.630: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.631: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.632: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a Source.633: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.634: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.635: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c Source.636: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS Source.637: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.638: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.639: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.640: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.641: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.642: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.643: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.644: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.645: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1 Source.646: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.647: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.648: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.649: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3 Source.650: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.651: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4 Source.652: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.653: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.654: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.655: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.656: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.657: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4 Source.658: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.659: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.660: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.661: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103 Source.662: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase Source.663: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.664: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.665: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.666: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.667: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.668: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.669: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.670: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.671: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.672: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.673: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.674: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.675: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7 Source.676: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.677: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.678: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.679: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.680: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.681: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1 Source.682: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1 Source.683: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.684: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.685: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.686: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.687: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.688: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.689: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.690: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.691: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.692: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.693: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.694: DFBPPR2948 ---- Plant proteins ---- Expansin-A25 Source.695: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic Source.696: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.697: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.698: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.699: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.700: DFBPPR2966 ---- Plant proteins ---- Probable histone H2A.5 Source.701: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.702: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.703: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.704: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.705: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic Source.706: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.707: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5 Source.708: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.709: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.710: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.711: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20 Source.712: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.713: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.714: DFBPPR3015 ---- Plant proteins ---- Expansin-A13 Source.715: DFBPPR3017 ---- Plant proteins ---- Expansin-A12 Source.716: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.717: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.718: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.719: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.720: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.721: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1 Source.722: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.723: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.724: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic Source.725: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.726: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36 Source.727: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.728: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.729: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.730: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.731: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.732: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.733: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.734: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3 Source.735: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.736: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.737: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.738: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.739: DFBPPR3102 ---- Plant proteins ---- Expansin-B18 Source.740: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3 Source.741: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.742: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6 Source.743: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.744: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.745: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.746: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.747: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.748: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.749: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6 Source.750: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.751: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.752: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.753: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.754: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13 Source.755: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.756: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1 Source.757: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.758: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.759: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.760: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4 Source.761: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5 Source.762: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.763: DFBPPR3170 ---- Plant proteins ---- Probable histone H2A.2 Source.764: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.765: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.766: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1 Source.767: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic Source.768: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.769: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.770: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.771: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300 Source.772: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.773: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.774: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.775: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.776: DFBPPR3200 ---- Plant proteins ---- Two-component response regulator ORR11 Source.777: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.778: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.779: DFBPPR3205 ---- Plant proteins ---- Monothiol glutaredoxin-S3 Source.780: DFBPPR3206 ---- Plant proteins ---- Expansin-B15 Source.781: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5 Source.782: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.783: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.784: DFBPPR3221 ---- Plant proteins ---- Probable acylpyruvase FAHD2, mitochondrial Source.785: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1 Source.786: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic Source.787: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain Source.788: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.789: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.790: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.791: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.792: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.793: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7 Source.794: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.795: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.796: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.797: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3 Source.798: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1 Source.799: DFBPPR3262 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.800: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic Source.801: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.802: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16 Source.803: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial Source.804: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.805: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.806: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1 Source.807: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4 Source.808: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.809: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.810: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.811: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1 Source.812: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a Source.813: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.814: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.815: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.816: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30 Source.817: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial Source.818: DFBPPR3337 ---- Plant proteins ---- Probable acylpyruvase FAHD1, mitochondrial Source.819: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.820: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4 Source.821: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic Source.822: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.823: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.824: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2 Source.825: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A Source.826: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.827: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.828: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.829: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.830: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.831: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.832: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.833: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.834: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.835: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.836: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1 Source.837: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.838: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2 Source.839: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.840: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.841: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.842: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.843: DFBPPR3397 ---- Plant proteins ---- Probable membrane-associated 30 kDa protein, chloroplastic Source.844: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12 Source.845: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.846: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.847: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.848: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.849: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.850: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.851: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.852: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.853: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.854: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.855: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.856: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.857: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.858: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.859: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3 Source.860: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.861: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.862: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.863: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44 Source.864: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.865: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.866: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16 Source.867: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.868: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.869: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3 Source.870: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.871: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5 Source.872: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31 Source.873: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19 Source.874: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.875: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.876: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.877: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.878: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.879: DFBPPR3510 ---- Plant proteins ---- Thioredoxin-like protein Clot Source.880: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.881: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.882: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic Source.883: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.884: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic Source.885: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.886: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4 Source.887: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10 Source.888: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.889: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.890: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.891: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic Source.892: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.893: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.894: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.895: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.896: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1 Source.897: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.898: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.899: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.900: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.901: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5 Source.902: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.903: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.904: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.905: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial Source.906: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.907: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1 Source.908: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e Source.909: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.910: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic Source.911: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.912: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.913: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.914: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.915: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.916: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.917: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.918: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.919: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5 Source.920: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.921: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2 Source.922: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4 Source.923: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a Source.924: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.925: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.926: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.927: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2 Source.928: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.929: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.930: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.931: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.932: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9 Source.933: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.934: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3 Source.935: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.936: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25 Source.937: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.938: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.939: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67 Source.940: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.941: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7 Source.942: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6 Source.943: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.944: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.945: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3 Source.946: DFBPPR3708 ---- Plant proteins ---- Late embryogenesis abundant protein 19 Source.947: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.948: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.949: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.950: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.951: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.952: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1 Source.953: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.954: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2 Source.955: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1 Source.956: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3 Source.957: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.958: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900 Source.959: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.960: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30 Source.961: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.962: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6 Source.963: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.964: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.965: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.966: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4 Source.967: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.968: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5 Source.969: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.970: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55 Source.971: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.972: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1 Source.973: DFBPPR3795 ---- Plant proteins ---- NRR repressor homolog 1 Source.974: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E Source.975: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6 Source.976: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.977: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic Source.978: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2 Source.979: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.980: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.981: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d Source.982: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.983: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.984: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2 Source.985: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39 Source.986: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13 Source.987: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46 Source.988: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.989: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.990: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.991: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.992: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.993: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.994: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.995: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.996: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2 Source.997: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31 Source.998: DFBPPR3884 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.999: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.1000: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.1001: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.1002: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.1003: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.1004: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7 Source.1005: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8 Source.1006: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.1007: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b Source.1008: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b Source.1009: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.1010: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1 Source.1011: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.1012: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.1013: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.1014: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10 Source.1015: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.1016: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial Source.1017: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.1018: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1 Source.1019: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.1020: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1 Source.1021: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.1022: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.1023: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.1024: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial Source.1025: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.1026: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.1027: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19 Source.1028: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.1029: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.1030: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.1031: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4 Source.1032: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.1033: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2 Source.1034: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.1035: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25 Source.1036: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2 Source.1037: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2 Source.1038: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2 Source.1039: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.1040: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.1041: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.1042: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9 Source.1043: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.1044: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7 Source.1045: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5 Source.1046: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5 Source.1047: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.1048: DFBPPR4017 ---- Plant proteins ---- Protein G1-like4 Source.1049: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.1050: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1 Source.1051: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2 Source.1052: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f Source.1053: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1 Source.1054: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1 Source.1055: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.1056: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.1057: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8 Source.1058: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase Source.1059: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.1060: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.1061: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.1062: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.1063: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB Source.1064: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.1065: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.1066: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like Source.1067: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.1068: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.1069: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b Source.1070: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.1071: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.1072: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.1073: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.1074: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.1075: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.1076: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10 Source.1077: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.1078: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29 Source.1079: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.1080: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.1081: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.1082: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.1083: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43 Source.1084: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.1085: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.1086: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3 Source.1087: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.1088: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74 Source.1089: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.1090: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.1091: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.1092: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.1093: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.1094: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.1095: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.1096: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7 Source.1097: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H Source.1098: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.1099: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.1100: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.1101: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.1102: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.1103: DFBPPR4166 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.1104: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.1105: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.1106: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.1107: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.1108: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.1109: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3 Source.1110: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.1111: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.1112: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.1113: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.1114: DFBPPR4198 ---- Plant proteins ---- Glutaredoxin-C15 Source.1115: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.1116: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1 Source.1117: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.1118: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.1119: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.1120: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.1121: DFBPPR4218 ---- Plant proteins ---- Glycine-rich cell wall structural protein 2 Source.1122: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.1123: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4 Source.1124: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.1125: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.1126: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.1127: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.1128: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4 Source.1129: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.1130: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.1131: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.1132: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.1133: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4 Source.1134: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.1135: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.1136: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1 Source.1137: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5 Source.1138: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4 Source.1139: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.1140: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.1141: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.1142: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.1143: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial Source.1144: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4 Source.1145: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21 Source.1146: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.1147: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3 Source.1148: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.1149: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.1150: DFBPPR4297 ---- Plant proteins ---- Protein translation factor SUI1 homolog Source.1151: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.1152: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17 Source.1153: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1 Source.1154: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1 Source.1155: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.1156: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1 Source.1157: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.1158: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.1159: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.1160: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.1161: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.1162: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2 Source.1163: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like Source.1164: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.1165: DFBPPR4328 ---- Plant proteins ---- Metallothionein-like protein 2A Source.1166: DFBPPR4329 ---- Plant proteins ---- Metallothionein-like protein 2B Source.1167: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.1168: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.1169: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5 Source.1170: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2 Source.1171: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1 Source.1172: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2 Source.1173: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.1174: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.1175: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25 Source.1176: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.1177: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.1178: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8 Source.1179: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.1180: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.1181: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2 Source.1182: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.1183: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.1184: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.1185: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.1186: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2 Source.1187: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.1188: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic Source.1189: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.1190: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14 Source.1191: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.1192: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2 Source.1193: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D Source.1194: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog Source.1195: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.1196: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.1197: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.1198: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.1199: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.1200: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.1201: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.1202: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.1203: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein Source.1204: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.1205: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.1206: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.1207: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.1208: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.1209: DFBPPR4455 ---- Plant proteins ---- CASP-like protein 5A2 Source.1210: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1 Source.1211: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.1212: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.1213: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4 Source.1214: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial Source.1215: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.1216: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.1217: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15 Source.1218: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.1219: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.1220: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.1221: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.1222: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.1223: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2 Source.1224: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.1225: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.1226: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.1227: DFBPPR4511 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 9 Source.1228: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.1229: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.1230: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.1231: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14 Source.1232: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.1233: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.1234: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.1235: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27 Source.1236: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7 Source.1237: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.1238: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.1239: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.1240: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1 Source.1241: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.1242: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.1243: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5 Source.1244: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1 Source.1245: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.1246: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.1247: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.1248: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4 Source.1249: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2 Source.1250: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.1251: DFBPPR4592 ---- Plant proteins ---- Ubiquitin-fold modifier 1 Source.1252: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.1253: DFBPPR4604 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 17 Source.1254: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.1255: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.1256: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.1257: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3 Source.1258: DFBPPR4629 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 7 Source.1259: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.1260: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.1261: DFBPPR4644 ---- Plant proteins ---- Nuclear transport factor 2 Source.1262: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.1263: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000 Source.1264: DFBPPR4649 ---- Plant proteins ---- Succinate dehydrogenase subunit 8B, mitochondrial Source.1265: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2 Source.1266: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1 Source.1267: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.1268: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.1269: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.1270: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.1271: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.1272: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.1273: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein Source.1274: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.1275: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.1276: DFBPPR4690 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 44 Source.1277: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.1278: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1 Source.1279: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2 Source.1280: DFBPPR4705 ---- Plant proteins ---- 40S ribosomal protein S26 Source.1281: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4 Source.1282: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.1283: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.1284: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.1285: DFBPPR4722 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 10 Source.1286: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18 Source.1287: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.1288: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5 Source.1289: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.1290: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.1291: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400 Source.1292: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400 Source.1293: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.1294: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.1295: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9 Source.1296: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.1297: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400 Source.1298: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7 Source.1299: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21 Source.1300: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35 Source.1301: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A Source.1302: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.1303: DFBPPR4776 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 3 Source.1304: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31 Source.1305: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.1306: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300 Source.1307: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.1308: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850 Source.1309: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.1310: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800 Source.1311: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2 Source.1312: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.1313: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1 Source.1314: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.1315: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000 Source.1316: DFBPPR4832 ---- Plant proteins ---- Protein GOS9 Source.1317: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.1318: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2 Source.1319: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400 Source.1320: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.1321: DFBPPR4861 ---- Plant proteins ---- B3 domain-containing protein Os06g0112300 Source.1322: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37 Source.1323: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.1324: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.1325: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.1326: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.1327: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.1328: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.1329: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.1330: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.1331: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID Source.1332: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8 Source.1333: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.1334: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.1335: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.1336: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.1337: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.1338: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.1339: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1 Source.1340: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.1341: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1 Source.1342: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.1343: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1344: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.1345: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.1346: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D Source.1347: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1348: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.1349: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1350: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.1351: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1352: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein Source.1353: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.1354: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.1355: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.1356: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.1357: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1358: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.1359: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2 Source.1360: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.1361: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1 Source.1362: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.1363: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22 Source.1364: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1365: DFBPPR5150 ---- Plant proteins ---- Profilin-2 Source.1366: DFBPPR5154 ---- Plant proteins ---- Profilin-1 Source.1367: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1368: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1369: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1370: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1371: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.1372: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.1373: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1374: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.1375: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.1376: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.1377: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.1378: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.1379: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1380: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.1381: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1382: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.1383: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.1384: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.1385: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.1386: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.1387: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1388: DFBPPR5260 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1389: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.1390: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.1391: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.1392: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2 Source.1393: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1 Source.1394: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.1395: DFBPPR5311 ---- Plant proteins ---- Nodulin-20 Source.1396: DFBPPR5319 ---- Plant proteins ---- Nodulin-22 Source.1397: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51 Source.1398: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1 Source.1399: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1 Source.1400: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a Source.1401: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.1402: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B Source.1403: DFBPPR5341 ---- Plant proteins ---- HMG1/2-like protein Source.1404: DFBPPR5342 ---- Plant proteins ---- Nodulin-44 Source.1405: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1 Source.1406: DFBPPR5352 ---- Plant proteins ---- Nodulin-27 Source.1407: DFBPPR5356 ---- Plant proteins ---- Nodulin-23 Source.1408: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.1409: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.1410: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.1411: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.1412: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2 Source.1413: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.1414: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1415: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1416: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.1417: DFBPPR5407 ---- Plant proteins ---- Profilin-2 Source.1418: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.1419: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.1420: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1 Source.1421: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.1422: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.1423: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.1424: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic Source.1425: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.1426: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit Source.1427: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A Source.1428: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.1429: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.1430: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.1431: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2 Source.1432: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1 Source.1433: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.1434: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.1435: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1 Source.1436: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.1437: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.1438: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2 Source.1439: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.1440: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial Source.1441: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial Source.1442: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.1443: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.1444: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.1445: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.1446: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.1447: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1 Source.1448: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.1449: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.1450: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.1451: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.1452: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.1453: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.1454: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.1455: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.1456: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.1457: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.1458: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.1459: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1460: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.1461: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.1462: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B Source.1463: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase Source.1464: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.1465: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.1466: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.1467: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1468: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.1469: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1 Source.1470: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1471: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1472: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10 Source.1473: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A Source.1474: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.1475: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1476: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.1477: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.1478: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.1479: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.1480: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.1481: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.1482: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.1483: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1484: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.1485: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.1486: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial Source.1487: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.1488: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.1489: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.1490: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.1491: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5 Source.1492: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.1493: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1 Source.1494: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.1495: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.1496: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1497: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.1498: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial Source.1499: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.1500: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4 Source.1501: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial Source.1502: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.1503: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.1504: DFBPPR5694 ---- Plant proteins ---- Profilin-8 Source.1505: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.1506: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.1507: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.1508: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4 Source.1509: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1510: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2 Source.1511: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.1512: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.1513: DFBPPR5752 ---- Plant proteins ---- 60S acidic ribosomal protein P1 Source.1514: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.1515: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B Source.1516: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1 Source.1517: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.1518: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.1519: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1520: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1521: DFBPPR5807 ---- Plant proteins ---- Histone H2A Source.1522: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1523: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.1524: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog Source.1525: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.1526: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1 Source.1527: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.1528: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.1529: DFBPPR5827 ---- Plant proteins ---- 60S acidic ribosomal protein P2B Source.1530: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.1531: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.1532: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.1533: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2 Source.1534: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.1535: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.1536: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.1537: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1538: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.1539: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.1540: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.1541: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1542: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B Source.1543: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.1544: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A Source.1545: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.1546: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.1547: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.1548: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3 Source.1549: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3 Source.1550: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.1551: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.1552: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1 Source.1553: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1554: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.1555: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.1556: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.1557: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3 Source.1558: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.1559: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B Source.1560: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.1561: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1562: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.1563: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.1564: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.1565: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.1566: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.1567: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.1568: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1 Source.1569: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7 Source.1570: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3 Source.1571: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2 Source.1572: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.1573: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.1574: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.1575: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2 Source.1576: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2 Source.1577: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1 Source.1578: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.1579: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.1580: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1 Source.1581: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1 Source.1582: DFBPPR6054 ---- Plant proteins ---- CASP-like protein 5A3 Source.1583: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.1584: DFBPPR6066 ---- Plant proteins ---- Protein translation factor SUI1 homolog Source.1585: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.1586: DFBPPR6073 ---- Plant proteins ---- Protein IAL1 Source.1587: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1 Source.1588: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10 Source.1589: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2 Source.1590: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1 Source.1591: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.1592: DFBPPR6167 ---- Plant proteins ---- Husk leaf blades expansion-promoting protein Source.1593: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A Source.1594: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.1595: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase Source.1596: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1597: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.1598: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic Source.1599: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.1600: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.1601: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic Source.1602: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein Source.1603: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1604: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.1605: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.1606: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1607: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.1608: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.1609: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic Source.1610: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic Source.1611: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1612: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic Source.1613: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.1614: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.1615: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.1616: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1617: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH Source.1618: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2 Source.1619: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F Source.1620: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.1621: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.1622: DFBPPR6332 ---- Plant proteins ---- Nucleoside diphosphate kinase 1 Source.1623: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS Source.1624: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.1625: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.1626: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.1627: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic Source.1628: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1629: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.1630: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial Source.1631: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1632: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1633: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1634: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D Source.1635: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.1636: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.1637: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.1638: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.1639: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1640: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B Source.1641: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A Source.1642: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.1643: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.1644: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.1645: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.1646: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.1647: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.1648: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.1649: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.1650: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.1651: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.1652: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.1653: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a Source.1654: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E Source.1655: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein Source.1656: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5 Source.1657: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic Source.1658: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1659: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.1660: DFBPPR6545 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1661: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.1662: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1663: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.1664: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase Source.1665: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic Source.1666: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1 Source.1667: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2 Source.1668: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1 Source.1669: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.1670: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.1671: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1672: DFBPPR6691 ---- Plant proteins ---- Histone H2A.2.1 Source.1673: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1674: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.1675: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1 Source.1676: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7 Source.1677: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein Source.1678: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1679: DFBPPR6721 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2 Source.1680: DFBPPR6729 ---- Plant proteins ---- Protein H2A.6 Source.1681: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1682: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1 Source.1683: DFBPPR6754 ---- Plant proteins ---- Histone H2A.4 Source.1684: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.1685: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase Source.1686: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.1687: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.1688: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.1689: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1690: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1691: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.1692: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.1693: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.1694: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.1695: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1696: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2 Source.1697: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.1698: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.1699: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1700: DFBPPR6848 ---- Plant proteins ---- Cold shock protein CS66 Source.1701: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1702: DFBPPR6871 ---- Plant proteins ---- EC protein I/II Source.1703: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial Source.1704: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1 Source.1705: DFBPPR6913 ---- Plant proteins ---- EC protein III Source.1706: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.1707: DFBPPR6957 ---- Plant proteins ---- Protein WIR1B Source.1708: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.1709: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.1710: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein Source.1711: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.1712: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.1713: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.1714: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1715: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.1716: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1 Source.1717: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.1718: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1719: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.1720: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1721: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.1722: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein Source.1723: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.1724: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1725: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1726: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1727: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1728: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI Source.1729: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4 Source.1730: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.1731: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1732: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1733: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.1734: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.1735: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1736: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1737: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.1738: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.1739: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.1740: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.1741: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.1742: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.1743: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.1744: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.1745: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9 Source.1746: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1747: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8 Source.1748: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.1749: DFBPPR7164 ---- Plant proteins ---- Probable non-specific lipid-transfer protein Source.1750: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2 Source.1751: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic Source.1752: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1753: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1754: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin Source.1755: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.1756: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.1757: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1 Source.1758: DFBPPR7200 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.1 Source.1759: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.1760: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain Source.1761: DFBPPR7217 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic Source.1762: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.1763: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1764: DFBPPR7227 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.2 Source.1765: DFBPPR7253 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.1766: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic Source.1767: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic Source.1768: DFBPPR7261 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.3 Source.1769: DFBPPR7278 ---- Plant proteins ---- Protein BLT4 Source.1770: DFBPPR7287 ---- Plant proteins ---- Dehydrin DHN3 Source.1771: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4 Source.1772: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.1773: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.1774: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3 Source.1775: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4 Source.1776: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.1777: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6 Source.1778: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7 Source.1779: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.1780: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.1781: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R Source.1782: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1 Source.1783: DFBPPR7331 ---- Plant proteins ---- Dehydrin DHN2 Source.1784: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2 Source.1785: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein Source.1786: DFBPPR7354 ---- Plant proteins ---- Cold-regulated protein 1 Source.1787: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.1788: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.1789: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1 Source.1790: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.1791: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1792: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6 Source.1793: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1794: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic Source.1795: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase Source.1796: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1797: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2 Source.1798: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1799: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1800: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1801: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic Source.1802: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.1803: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.1804: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.1805: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic Source.1806: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.1807: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1808: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1 Source.1809: DFBPPR7523 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1810: DFBPPR7524 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.1811: DFBPPR7525 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1812: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.1813: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.1814: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76 Source.1815: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.1816: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.1817: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.1818: DFBPPR7630 ---- Milk proteins ---- Folate receptor alpha Source.1819: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.1820: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.1821: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.1822: DFBPPR7659 ---- Milk proteins ---- Glycosylation-dependent cell adhesion molecule 1 Source.1823: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.1824: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.1825: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.1826: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1827: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.1828: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.1829: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.1830: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.1831: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1832: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1833: DFBPPR7737 ---- Plant proteins ---- Endochitinase Source.1834: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1835: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.1836: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.1837: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein Source.1838: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1839: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2 Source.1840: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.1841: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.1842: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.1843: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein Source.1844: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2 Source.1845: DFBPPR8443 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1846: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C Source.1847: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein Source.1848: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.1849: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.1850: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.1851: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.1852: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.1853: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.1854: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.1855: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1856: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1857: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1858: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1859: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1 Source.1860: DFBPPR15969 ---- Animal proteins ---- Natriuretic peptides A Source.1861: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.1862: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.1863: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.1864: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1865: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.1866: DFBPPR15995 ---- Animal proteins ---- Ras-related protein Rab-5A Source.1867: DFBPPR16001 ---- Animal proteins ---- Battenin Source.1868: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1869: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1870: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.1871: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.1872: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1873: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1874: DFBPPR16046 ---- Animal proteins ---- C-C motif chemokine 3 Source.1875: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1876: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1877: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.1878: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1879: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1880: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.1881: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.1882: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.1883: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.1884: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1885: DFBPPR16103 ---- Animal proteins ---- Laforin Source.1886: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1887: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.1888: DFBPPR16119 ---- Animal proteins ---- High mobility group protein HMG-I/HMG-Y Source.1889: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1890: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.1891: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1892: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1893: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.1894: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6 Source.1895: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.1896: DFBPPR16180 ---- Animal proteins ---- Orexin Source.1897: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.1898: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1899: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.1900: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.1901: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.1902: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.1903: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1904: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.1905: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein Source.1906: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.1907: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.1908: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1909: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1910: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.1911: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.1912: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1913: DFBPPR16267 ---- Animal proteins ---- Ras-related protein Rab-2A Source.1914: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.1915: DFBPPR16278 ---- Animal proteins ---- Major prion protein Source.1916: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1917: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.1918: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.1919: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1 Source.1920: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor Source.1921: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1922: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C Source.1923: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1924: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2 Source.1925: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1926: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4 Source.1927: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4 Source.1928: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1929: DFBPPR16368 ---- Animal proteins ---- Tyrosinase Source.1930: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.1931: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin Source.1932: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin Source.1933: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1934: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1 Source.1935: DFBPPR16497 ---- Animal proteins ---- Interleukin-5 Source.1936: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.1937: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.1938: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.1939: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.1940: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein Source.1941: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.1942: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2 Source.1943: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1944: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1945: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1946: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3 Source.1947: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.1948: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S Source.1949: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.1950: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B Source.1951: DFBPPR16605 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1952: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.1953: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.1954: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22 Source.1955: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3 Source.1956: DFBPPR16678 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A Source.1957: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein Source.1958: DFBPPR16693 ---- Animal proteins ---- Cingulin Source.1959: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein Source.1960: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor Source.1961: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.1962: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.1963: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.1964: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1965: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.1966: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.1967: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1968: DFBPPR16796 ---- Animal proteins ---- Major prion protein Source.1969: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin Source.1970: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.1971: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1 Source.1972: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.1973: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein Source.1974: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1975: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1976: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin Source.1977: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.1978: DFBPPR16877 ---- Animal proteins ---- Peptidoglycan recognition protein 1 Source.1979: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.1980: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.1981: DFBPPR16903 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.1982: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.1983: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1984: DFBPPR16918 ---- Animal proteins ---- Spastin Source.1985: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.1986: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1987: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1988: DFBPPR16947 ---- Animal proteins ---- Polyadenylate-binding protein 2 Source.1989: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.1990: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.1991: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.1992: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.1993: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor Source.1994: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1995: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1 Source.1996: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase Source.1997: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1998: DFBPPR16991 ---- Animal proteins ---- Osteocalcin Source.1999: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1 Source.2000: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.2001: DFBPPR17007 ---- Animal proteins ---- Microtubule-associated protein tau Source.2002: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.2003: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.2004: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2005: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.2006: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.2007: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.2008: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.2009: DFBPPR17055 ---- Animal proteins ---- Phospholipase A2, membrane associated Source.2010: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.2011: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.2012: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.2013: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2014: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1 Source.2015: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2016: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.2017: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1 Source.2018: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.2019: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2 Source.2020: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.2021: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.2022: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.2023: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7 Source.2024: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1 Source.2025: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.2026: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.2027: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.2028: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.2029: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.2030: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.2031: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.2032: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2033: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.2034: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.2035: DFBPPR17286 ---- Animal proteins ---- Septin-2 Source.2036: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1 Source.2037: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.2038: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.2039: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2 Source.2040: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.2041: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.2042: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.2043: DFBPPR17328 ---- Animal proteins ---- Ras-related protein Rab-5A Source.2044: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase Source.2045: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.2046: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.2047: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.2048: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.2049: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.2050: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H Source.2051: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.2052: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.2053: DFBPPR17376 ---- Animal proteins ---- Flotillin-1 Source.2054: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.2055: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.2056: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3 Source.2057: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.2058: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.2059: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.2060: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1 Source.2061: DFBPPR17420 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B Source.2062: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.2063: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.2064: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.2065: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2066: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.2067: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2068: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)] Source.2069: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.2070: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.2071: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2072: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.2073: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.2074: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.2075: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.2076: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.2077: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha Source.2078: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.2079: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.2080: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1 Source.2081: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.2082: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E Source.2083: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.2084: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.2085: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4 Source.2086: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1 Source.2087: DFBPPR17555 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial Source.2088: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.2089: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.2090: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.2091: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.2092: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.2093: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2 Source.2094: DFBPPR17592 ---- Animal proteins ---- Claudin-3 Source.2095: DFBPPR17593 ---- Animal proteins ---- Claudin-3 Source.2096: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2097: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.2098: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.2099: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2100: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.2101: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A Source.2102: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A Source.2103: DFBPPR17626 ---- Animal proteins ---- Elastin Source.2104: DFBPPR17629 ---- Animal proteins ---- Thiamine-triphosphatase Source.2105: DFBPPR17630 ---- Animal proteins ---- Thiamine-triphosphatase Source.2106: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.2107: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta Source.2108: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.2109: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.2110: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.2111: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.2112: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.2113: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.2114: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta Source.2115: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform Source.2116: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1 Source.2117: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5 Source.2118: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.2119: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.2120: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C Source.2121: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.2122: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.2123: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.2124: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2 Source.2125: DFBPPR17810 ---- Animal proteins ---- Histone H1.2 Source.2126: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.2127: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D Source.2128: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.2129: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.2130: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1 Source.2131: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.2132: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2133: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.2134: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.2135: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial Source.2136: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.2137: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.2138: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.2139: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.2140: DFBPPR17913 ---- Animal proteins ---- ATP synthase subunit gamma, mitochondrial Source.2141: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.2142: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.2143: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.2144: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.2145: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.2146: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.2147: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.2148: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.2149: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.2150: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.2151: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.2152: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.2153: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.2154: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.2155: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.2156: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.2157: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.2158: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.2159: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.2160: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.2161: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.2162: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.2163: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.2164: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.2165: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.2166: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.2167: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.2168: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.2169: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S Source.2170: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase Source.2171: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial Source.2172: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.2173: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.2174: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein Source.2175: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.2176: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3 Source.2177: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.2178: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.2179: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.2180: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha Source.2181: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1 Source.2182: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII Source.2183: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.2184: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin Source.2185: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.2186: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.2187: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.2188: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4 Source.2189: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.2190: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.2191: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.2192: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.2193: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4 Source.2194: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A Source.2195: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B Source.2196: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B' Source.2197: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.2198: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.2199: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3 Source.2200: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.2201: DFBPPR18257 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2202: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.2203: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2204: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein Source.2205: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.2206: DFBPPR18281 ---- Animal proteins ---- CD63 antigen Source.2207: DFBPPR18292 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 11 Source.2208: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2 Source.2209: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.2210: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.2211: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.2212: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a Source.2213: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase Source.2214: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.2215: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.2216: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2217: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2218: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.2219: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.2220: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.2221: DFBPPR18394 ---- Animal proteins ---- Histone H1.1 Source.2222: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase Source.2223: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.2224: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen Source.2225: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.2226: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain Source.2227: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.2228: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.2229: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.2230: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2231: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.2232: DFBPPR18433 ---- Animal proteins ---- Basigin Source.2233: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.2234: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.2235: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2236: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.2237: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2 Source.2238: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.2239: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1 Source.2240: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.2241: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.2242: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.2243: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.2244: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.2245: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.2246: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.2247: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.2248: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb Source.2249: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.2250: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit Source.2251: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1 Source.2252: DFBPPR18519 ---- Animal proteins ---- Ras-related protein Rab-21 Source.2253: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.2254: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.2255: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin Source.2256: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.2257: DFBPPR18538 ---- Animal proteins ---- Vesicle-associated membrane protein 1 Source.2258: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.2259: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial Source.2260: DFBPPR18568 ---- Animal proteins ---- Cdc42 effector protein 2 Source.2261: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.2262: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S Source.2263: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.2264: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.2265: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4 Source.2266: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2 Source.2267: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.2268: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561 Source.2269: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.2270: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.2271: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.2272: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.2273: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.2274: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.2275: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase Source.2276: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Source.2277: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2 Source.2278: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.2279: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3 Source.2280: DFBPPR18745 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein Source.2281: DFBPPR18748 ---- Animal proteins ---- Ras-related protein Rab-4A Source.2282: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.2283: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.2284: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.2285: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba Source.2286: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.2287: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.2288: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6 Source.2289: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.2290: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma Source.2291: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.2292: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.2293: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D Source.2294: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.2295: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.2296: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.2297: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.2298: DFBPPR18889 ---- Animal proteins ---- Achaete-scute homolog 2 Source.2299: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.2300: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.2301: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.2302: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.2303: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.2304: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.2305: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.2306: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.2307: DFBPPR18931 ---- Animal proteins ---- Ficolin-2 Source.2308: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.2309: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.2310: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6 Source.2311: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.2312: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.2313: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1 Source.2314: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.2315: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.2316: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.2317: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.2318: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5 Source.2319: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.2320: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.2321: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74 Source.2322: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.2323: DFBPPR19004 ---- Animal proteins ---- Histone H1.3 Source.2324: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.2325: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.2326: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.2327: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.2328: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.2329: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.2330: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.2331: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.2332: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.2333: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.2334: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.2335: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.2336: DFBPPR19055 ---- Animal proteins ---- Complement factor D Source.2337: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.2338: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.2339: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase Source.2340: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1 Source.2341: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.2342: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.2343: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.2344: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.2345: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H Source.2346: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1 Source.2347: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.2348: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.2349: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.2350: DFBPPR19170 ---- Animal proteins ---- Isoaspartyl peptidase/L-asparaginase Source.2351: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.2352: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein Source.2353: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.2354: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.2355: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169 Source.2356: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.2357: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.2358: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.2359: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Source.2360: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.2361: DFBPPR19253 ---- Animal proteins ---- Limbin Source.2362: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.2363: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2 Source.2364: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4 Source.2365: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.2366: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide Source.2367: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1 Source.2368: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.2369: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.2370: DFBPPR19291 ---- Animal proteins ---- Multicilin Source.2371: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.2372: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial Source.2373: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.2374: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.2375: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.2376: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.2377: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.2378: DFBPPR19351 ---- Animal proteins ---- Caveolae-associated protein 3 Source.2379: DFBPPR19356 ---- Animal proteins ---- Protamine-2 Source.2380: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2381: DFBPPR19359 ---- Animal proteins ---- Spartin Source.2382: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.2383: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.2384: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog Source.2385: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific Source.2386: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C Source.2387: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20 Source.2388: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.2389: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.2390: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.2391: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71 Source.2392: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3 Source.2393: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2 Source.2394: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.2395: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1 Source.2396: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.2397: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.2398: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial Source.2399: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.2400: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.2401: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.2402: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.2403: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.2404: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73 Source.2405: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N Source.2406: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.2407: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.2408: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A Source.2409: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.2410: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.2411: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial Source.2412: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1 Source.2413: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.2414: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.2415: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.2416: DFBPPR19574 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit 2 Source.2417: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.2418: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.2419: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.2420: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2 Source.2421: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.2422: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.2423: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.2424: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog Source.2425: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.2426: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.2427: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.2428: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Source.2429: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2 Source.2430: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.2431: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E Source.2432: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1 Source.2433: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.2434: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.2435: DFBPPR19703 ---- Animal proteins ---- Claudin-10 Source.2436: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.2437: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein Source.2438: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.2439: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.2440: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1 Source.2441: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.2442: DFBPPR19756 ---- Animal proteins ---- Ras-related protein Rab-1B Source.2443: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2 Source.2444: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.2445: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.2446: DFBPPR19781 ---- Animal proteins ---- Secretory carrier-associated membrane protein 5 Source.2447: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.2448: DFBPPR19783 ---- Animal proteins ---- Syndecan-1 Source.2449: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.2450: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.2451: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4 Source.2452: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3 Source.2453: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2 Source.2454: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.2455: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Source.2456: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.2457: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein Source.2458: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.2459: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.2460: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.2461: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.2462: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.2463: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.2464: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.2465: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.2466: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.2467: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.2468: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.2469: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2 Source.2470: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase Source.2471: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.2472: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3 Source.2473: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1 Source.2474: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.2475: DFBPPR19898 ---- Animal proteins ---- Essential MCU regulator, mitochondrial Source.2476: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6 Source.2477: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.2478: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.2479: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.2480: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase Source.2481: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1 Source.2482: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial Source.2483: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.2484: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.2485: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2 Source.2486: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.2487: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.2488: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.2489: DFBPPR19972 ---- Animal proteins ---- Prefoldin subunit 5 Source.2490: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.2491: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3 Source.2492: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1 Source.2493: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.2494: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12 Source.2495: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.2496: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4 Source.2497: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.2498: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.2499: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.2500: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.2501: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.2502: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.2503: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.2504: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2505: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D Source.2506: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.2507: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.2508: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein Source.2509: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4 Source.2510: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.2511: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein Source.2512: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7 Source.2513: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.2514: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4 Source.2515: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.2516: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.2517: DFBPPR20224 ---- Animal proteins ---- Sclerostin Source.2518: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase Source.2519: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.2520: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial Source.2521: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79 Source.2522: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1 Source.2523: DFBPPR20296 ---- Animal proteins ---- Claudin-18 Source.2524: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.2525: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.2526: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.2527: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2528: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.2529: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14 Source.2530: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.2531: DFBPPR20340 ---- Animal proteins ---- Peripherin Source.2532: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.2533: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7 Source.2534: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase Source.2535: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.2536: DFBPPR20374 ---- Animal proteins ---- 5'-deoxynucleotidase HDDC2 Source.2537: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.2538: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.2539: DFBPPR20383 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 7, mitochondrial Source.2540: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6 Source.2541: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1 Source.2542: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.2543: DFBPPR20396 ---- Animal proteins ---- Claudin-5 Source.2544: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.2545: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.2546: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4 Source.2547: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5 Source.2548: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5 Source.2549: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1 Source.2550: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.2551: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.2552: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79 Source.2553: DFBPPR20467 ---- Animal proteins ---- Tetranectin Source.2554: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.2555: DFBPPR20503 ---- Animal proteins ---- Cytochrome c oxidase subunit NDUFA4 Source.2556: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.2557: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial Source.2558: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2 Source.2559: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A Source.2560: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.2561: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.2562: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial Source.2563: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein Source.2564: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta Source.2565: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.2566: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Source.2567: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.2568: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.2569: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.2570: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.2571: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.2572: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.2573: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.2574: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.2575: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.2576: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47 Source.2577: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.2578: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91 Source.2579: DFBPPR20669 ---- Animal proteins ---- D site-binding protein Source.2580: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.2581: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14 Source.2582: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.2583: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.2584: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.2585: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.2586: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1 Source.2587: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.2588: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B Source.2589: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.2590: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf Source.2591: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.2592: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.2593: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1 Source.2594: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.2595: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.2596: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Source.2597: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.2598: DFBPPR20809 ---- Animal proteins ---- F-box and leucine-rich protein 22 Source.2599: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14 Source.2600: DFBPPR20841 ---- Animal proteins ---- Translationally-controlled tumor protein Source.2601: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.2602: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.2603: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.2604: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135 Source.2605: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta Source.2606: DFBPPR20880 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14 Source.2607: DFBPPR20894 ---- Animal proteins ---- THAP domain-containing protein 11 Source.2608: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.2609: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1 Source.2610: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.2611: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2612: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2613: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3 Source.2614: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2615: DFBPPR20924 ---- Animal proteins ---- Cyclin-dependent kinase 2-associated protein 2 Source.2616: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8 Source.2617: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.2618: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.2619: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10 Source.2620: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1 Source.2621: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.2622: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.2623: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit Source.2624: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.2625: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.2626: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial Source.2627: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial Source.2628: DFBPPR20996 ---- Animal proteins ---- Tripartite motif-containing protein 44 Source.2629: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1 Source.2630: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2 Source.2631: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.2632: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.2633: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26 Source.2634: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.2635: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.2636: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1 Source.2637: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.2638: DFBPPR21040 ---- Animal proteins ---- Neuritin Source.2639: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.2640: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.2641: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.2642: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.2643: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B Source.2644: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.2645: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A Source.2646: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.2647: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.2648: DFBPPR21100 ---- Animal proteins ---- Cochlin Source.2649: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.2650: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.2651: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16 Source.2652: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.2653: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7 Source.2654: DFBPPR21149 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 4 Source.2655: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor Source.2656: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22 Source.2657: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2 Source.2658: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22 Source.2659: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.2660: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.2661: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.2662: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2 Source.2663: DFBPPR21232 ---- Animal proteins ---- Cerebellin-3 Source.2664: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.2665: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2 Source.2666: DFBPPR21239 ---- Animal proteins ---- Coordinator of PRMT5 and differentiation stimulator Source.2667: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198 Source.2668: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5 Source.2669: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3 Source.2670: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2 Source.2671: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8 Source.2672: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2 Source.2673: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.2674: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11 Source.2675: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.2676: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2 Source.2677: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.2678: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.2679: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.2680: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.2681: DFBPPR21320 ---- Animal proteins ---- Sjoegren syndrome nuclear autoantigen 1 homolog Source.2682: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.2683: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.2684: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9 Source.2685: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein Source.2686: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397 Source.2687: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.2688: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3 Source.2689: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1 Source.2690: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.2691: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.2692: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.2693: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3 Source.2694: DFBPPR21383 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 2A Source.2695: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.2696: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.2697: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1 Source.2698: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.2699: DFBPPR21414 ---- Animal proteins ---- Neuromedin-B Source.2700: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.2701: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A Source.2702: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform Source.2703: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.2704: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2 Source.2705: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4 Source.2706: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.2707: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial Source.2708: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.2709: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2 Source.2710: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.2711: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.2712: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.2713: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.2714: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.2715: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1 Source.2716: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.2717: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20 Source.2718: DFBPPR21521 ---- Animal proteins ---- Active regulator of SIRT1 Source.2719: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2 Source.2720: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11 Source.2721: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.2722: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22 Source.2723: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.2724: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1 Source.2725: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19 Source.2726: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.2727: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like Source.2728: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.2729: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.2730: DFBPPR21624 ---- Animal proteins ---- Docking protein 1 Source.2731: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1 Source.2732: DFBPPR21640 ---- Animal proteins ---- 60S ribosomal protein L35 Source.2733: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein Source.2734: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26 Source.2735: DFBPPR21652 ---- Animal proteins ---- Protein Flattop Source.2736: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.2737: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.2738: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10 Source.2739: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.2740: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26 Source.2741: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like Source.2742: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1 Source.2743: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.2744: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator Source.2745: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23 Source.2746: DFBPPR21709 ---- Animal proteins ---- PEST proteolytic signal-containing nuclear protein Source.2747: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.2748: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2 Source.2749: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial Source.2750: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1 Source.2751: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7 Source.2752: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1 Source.2753: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.2754: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.2755: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.2756: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.2757: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.2758: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B Source.2759: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.2760: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2761: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.2762: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410 Source.2763: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11 Source.2764: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2 Source.2765: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1 Source.2766: DFBPPR21858 ---- Animal proteins ---- Chromatin complexes subunit BAP18 Source.2767: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B Source.2768: DFBPPR21864 ---- Animal proteins ---- Arpin Source.2769: DFBPPR21866 ---- Animal proteins ---- c-Myc-binding protein Source.2770: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.2771: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B Source.2772: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial Source.2773: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.2774: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor Source.2775: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2 Source.2776: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2 Source.2777: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12 Source.2778: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2 Source.2779: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11 Source.2780: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.2781: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.2782: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.2783: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.2784: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.2785: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.2786: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.2787: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.2788: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.2789: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B Source.2790: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A Source.2791: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial Source.2792: DFBPPR22081 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B Source.2793: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.2794: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2 Source.2795: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4 Source.2796: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.2797: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.2798: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1 Source.2799: DFBPPR22161 ---- Animal proteins ---- 39S ribosomal protein L53, mitochondrial Source.2800: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.2801: DFBPPR22169 ---- Animal proteins ---- Transmembrane protein 256 Source.2802: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.2803: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1 Source.2804: DFBPPR22218 ---- Animal proteins ---- Galectin-4 Source.2805: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.2806: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.2807: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.2808: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.2809: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1 Source.2810: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.2811: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.2812: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1 Source.2813: DFBPPR22280 ---- Animal proteins ---- 60S ribosomal protein L27a Source.2814: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.2815: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2 Source.2816: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.2817: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218 Source.2818: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein Source.2819: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.2820: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3 Source.2821: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.2822: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1 Source.2823: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A Source.2824: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.2825: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein Source.2826: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.2827: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like Source.2828: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4 Source.2829: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1 Source.2830: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.2831: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1 Source.2832: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.2833: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10 Source.2834: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog Source.2835: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160 Source.2836: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1 Source.2837: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11 Source.2838: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137 Source.2839: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.2840: DFBPPR22482 ---- Animal proteins ---- Adropin Source.2841: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog Source.2842: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1 Source.2843: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101 Source.2844: DFBPPR22536 ---- Animal proteins ---- Suprabasin Source.2845: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1 Source.2846: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog Source.2847: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.2848: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171 Source.2849: DFBPPR22593 ---- Animal proteins ---- UPF0688 protein C1orf174 homolog Source.2850: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19 Source.2851: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268 Source.2852: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.2853: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.2854: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71 Source.2855: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153 Source.2856: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65 Source.2857: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog Source.2858: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9 Source.2859: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog Source.2860: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.2861: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1 Source.2862: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.2863: DFBPPR22700 ---- Animal proteins ---- Protein FAM89A Source.2864: DFBPPR22716 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.2865: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11 Source.2866: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog Source.2867: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog Source.2868: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.2869: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog Source.2870: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2871: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.2872: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.2873: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.2874: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2875: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.2876: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.2877: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.2878: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.2879: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.2880: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.2881: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.2882: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.2883: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.2884: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.2885: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.2886: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.2887: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.2888: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2889: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.2890: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.2891: DFBPPR8642 ---- Animal proteins ---- Major prion protein Source.2892: DFBPPR8643 ---- Animal proteins ---- Phospholipase A2, major isoenzyme Source.2893: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.2894: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.2895: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.2896: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1 Source.2897: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.2898: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog Source.2899: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.2900: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.2901: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.2902: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.2903: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.2904: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1 Source.2905: DFBPPR8707 ---- Animal proteins ---- Flotillin-1 Source.2906: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.2907: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.2908: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C Source.2909: DFBPPR8722 ---- Animal proteins ---- Ras-related protein Rab-5A Source.2910: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.2911: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1 Source.2912: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.2913: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.2914: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.2915: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1 Source.2916: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.2917: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.2918: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin Source.2919: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1 Source.2920: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2921: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.2922: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.2923: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.2924: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.2925: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1 Source.2926: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.2927: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S Source.2928: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.2929: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.2930: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5 Source.2931: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.2932: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.2933: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.2934: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.2935: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2936: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.2937: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2938: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2939: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.2940: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.2941: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.2942: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.2943: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.2944: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.2945: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.2946: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain Source.2947: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain Source.2948: DFBPPR9005 ---- Animal proteins ---- Protein amnionless Source.2949: DFBPPR9012 ---- Animal proteins ---- Orexin Source.2950: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.2951: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2 Source.2952: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.2953: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.2954: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.2955: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.2956: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1 Source.2957: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.2958: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5 Source.2959: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32 Source.2960: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.2961: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2962: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.2963: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2964: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2965: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2966: DFBPPR9134 ---- Animal proteins ---- Ras-related protein Rab-14 Source.2967: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.2968: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II Source.2969: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2970: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.2971: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2 Source.2972: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.2973: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2974: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2975: DFBPPR9174 ---- Animal proteins ---- Ficolin-1 Source.2976: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2977: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.2978: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase Source.2979: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2980: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D Source.2981: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.2982: DFBPPR9216 ---- Animal proteins ---- Netrin-1 Source.2983: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII Source.2984: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2985: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10 Source.2986: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.2987: DFBPPR9254 ---- Animal proteins ---- Complement factor D Source.2988: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.2989: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.2990: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.2991: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase Source.2992: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.2993: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.2994: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.2995: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2996: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B Source.2997: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.2998: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2999: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.3000: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.3001: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.3002: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.3003: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase Source.3004: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.3005: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.3006: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.3007: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.3008: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.3009: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.3010: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.3011: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.3012: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.3013: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.3014: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14 Source.3015: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.3016: DFBPPR9518 ---- Animal proteins ---- Interleukin-5 Source.3017: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.3018: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE Source.3019: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.3020: DFBPPR9539 ---- Animal proteins ---- Neurofilament heavy polypeptide Source.3021: DFBPPR9547 ---- Animal proteins ---- Ras-related protein Rab-1B Source.3022: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.3023: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1 Source.3024: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein Source.3025: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26 Source.3026: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A Source.3027: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.3028: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.3029: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.3030: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.3031: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.3032: DFBPPR9633 ---- Animal proteins ---- Claudin-17 Source.3033: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561 Source.3034: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M Source.3035: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.3036: DFBPPR9662 ---- Animal proteins ---- 60S ribosomal protein L35 Source.3037: DFBPPR9671 ---- Animal proteins ---- S-arrestin Source.3038: DFBPPR9673 ---- Animal proteins ---- Neurokinin-B Source.3039: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.3040: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.3041: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2 Source.3042: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.3043: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B Source.3044: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.3045: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2 Source.3046: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.3047: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.3048: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.3049: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.3050: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.3051: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.3052: DFBPPR9829 ---- Animal proteins ---- Translationally-controlled tumor protein Source.3053: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.3054: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1 Source.3055: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.3056: DFBPPR9843 ---- Animal proteins ---- P protein Source.3057: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.3058: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.3059: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.3060: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1 Source.3061: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.3062: DFBPPR9905 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B Source.3063: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B Source.3064: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.3065: DFBPPR9953 ---- Animal proteins ---- Gallinacin-1 alpha Source.3066: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.3067: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase Source.3068: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.3069: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.3070: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.3071: DFBPPR9989 ---- Animal proteins ---- VIP peptides Source.3072: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.3073: DFBPPR10004 ---- Animal proteins ---- Spastin Source.3074: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.3075: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.3076: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7 Source.3077: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog Source.3078: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.3079: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.3080: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.3081: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase Source.3082: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.3083: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.3084: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.3085: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.3086: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.3087: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.3088: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.3089: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.3090: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1 Source.3091: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.3092: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.3093: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.3094: DFBPPR10121 ---- Animal proteins ---- Fibroblast growth factor 2 Source.3095: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.3096: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1 Source.3097: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.3098: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.3099: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.3100: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.3101: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.3102: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.3103: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog Source.3104: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.3105: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3 Source.3106: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.3107: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.3108: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.3109: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.3110: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.3111: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.3112: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1 Source.3113: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.3114: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.3115: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1 Source.3116: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.3117: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.3118: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.3119: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8 Source.3120: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.3121: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.3122: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1 Source.3123: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.3124: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.3125: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.3126: DFBPPR10270 ---- Animal proteins ---- Agrin Source.3127: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.3128: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C Source.3129: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.3130: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6 Source.3131: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.3132: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.3133: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP Source.3134: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.3135: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.3136: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.3137: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.3138: DFBPPR10306 ---- Animal proteins ---- D-erythrulose reductase Source.3139: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.3140: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.3141: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.3142: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2 Source.3143: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.3144: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.3145: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor Source.3146: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.3147: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2 Source.3148: DFBPPR10341 ---- Animal proteins ---- Brain acid soluble protein 1 homolog Source.3149: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.3150: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.3151: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24 Source.3152: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.3153: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.3154: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.3155: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf Source.3156: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3 Source.3157: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.3158: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3159: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.3160: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.3161: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.3162: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10 Source.3163: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.3164: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.3165: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.3166: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.3167: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.3168: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.3169: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.3170: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3171: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.3172: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.3173: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.3174: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.3175: DFBPPR10473 ---- Animal proteins ---- Gallinacin-1 Source.3176: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.3177: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.3178: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.3179: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.3180: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon Source.3181: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.3182: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.3183: DFBPPR10508 ---- Animal proteins ---- Septin-2 Source.3184: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.3185: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.3186: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2 Source.3187: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.3188: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.3189: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.3190: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.3191: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.3192: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain Source.3193: DFBPPR10537 ---- Animal proteins ---- Neuromodulin Source.3194: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.3195: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.3196: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.3197: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.3198: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.3199: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.3200: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.3201: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.3202: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.3203: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.3204: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B' Source.3205: DFBPPR10592 ---- Animal proteins ---- Ras-related protein Rab-14 Source.3206: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.3207: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.3208: DFBPPR10605 ---- Animal proteins ---- Elastin Source.3209: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.3210: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5 Source.3211: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.3212: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.3213: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.3214: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.3215: DFBPPR10646 ---- Animal proteins ---- Netrin-1 Source.3216: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.3217: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.3218: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.3219: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.3220: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.3221: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.3222: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.3223: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.3224: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.3225: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.3226: DFBPPR10703 ---- Animal proteins ---- Tensin Source.3227: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.3228: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.3229: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.3230: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog Source.3231: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.3232: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.3233: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor Source.3234: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3235: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.3236: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.3237: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.3238: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3239: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3240: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3241: DFBPPR10783 ---- Animal proteins ---- Fructose-bisphosphate aldolase C Source.3242: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.3243: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase Source.3244: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12 Source.3245: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.3246: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.3247: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide Source.3248: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.3249: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.3250: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.3251: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain Source.3252: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase Source.3253: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain Source.3254: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5 Source.3255: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.3256: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.3257: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3 Source.3258: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.3259: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.3260: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.3261: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.3262: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.3263: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.3264: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.3265: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.3266: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3267: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.3268: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.3269: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.3270: DFBPPR10923 ---- Animal proteins ---- Ras-related protein Rab-5B Source.3271: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.3272: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.3273: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.3274: DFBPPR10945 ---- Animal proteins ---- Prosaposin Source.3275: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.3276: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.3277: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type Source.3278: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2 Source.3279: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1 Source.3280: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.3281: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.3282: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein Source.3283: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.3284: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.3285: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.3286: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.3287: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.3288: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein Source.3289: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.3290: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.3291: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11 Source.3292: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.3293: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13 Source.3294: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.3295: DFBPPR11060 ---- Animal proteins ---- Netrin-3 Source.3296: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2 Source.3297: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1 Source.3298: DFBPPR11077 ---- Animal proteins ---- Tyrosinase Source.3299: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.3300: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.3301: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.3302: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.3303: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1 Source.3304: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.3305: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.3306: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.3307: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.3308: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.3309: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.3310: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.3311: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta Source.3312: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.3313: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2 Source.3314: DFBPPR11178 ---- Animal proteins ---- Gallinacin-3 Source.3315: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29 Source.3316: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1 Source.3317: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.3318: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1 Source.3319: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.3320: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.3321: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone Source.3322: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.3323: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1 Source.3324: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.3325: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H Source.3326: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.3327: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.3328: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.3329: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1 Source.3330: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.3331: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.3332: DFBPPR11269 ---- Animal proteins ---- Anosmin-1 Source.3333: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES Source.3334: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.3335: DFBPPR11282 ---- Animal proteins ---- Ras-related protein Rab-5C Source.3336: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.3337: DFBPPR11294 ---- Animal proteins ---- Frizzled-8 Source.3338: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.3339: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.3340: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1 Source.3341: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A Source.3342: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3 Source.3343: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42 Source.3344: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.3345: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.3346: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4 Source.3347: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1 Source.3348: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.3349: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.3350: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.3351: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13 Source.3352: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.3353: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.3354: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.3355: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX Source.3356: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.3357: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1 Source.3358: DFBPPR11376 ---- Animal proteins ---- Lamin-A Source.3359: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.3360: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.3361: DFBPPR11388 ---- Animal proteins ---- Matrilin-3 Source.3362: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.3363: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.3364: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1 Source.3365: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.3366: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1 Source.3367: DFBPPR11427 ---- Animal proteins ---- Protein Abitram Source.3368: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.3369: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1 Source.3370: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5 Source.3371: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.3372: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6 Source.3373: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.3374: DFBPPR11447 ---- Animal proteins ---- Translationally-controlled tumor protein homolog Source.3375: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46 Source.3376: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase Source.3377: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.3378: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2 Source.3379: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase Source.3380: DFBPPR11488 ---- Animal proteins ---- Ras-related protein Rab-2A Source.3381: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2 Source.3382: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b Source.3383: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2 Source.3384: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog Source.3385: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11 Source.3386: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.3387: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2 Source.3388: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.3389: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.3390: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.3391: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.3392: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.3393: DFBPPR11577 ---- Animal proteins ---- Vasotocin-neurophysin VT Source.3394: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.3395: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.3396: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.3397: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.3398: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.3399: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.3400: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.3401: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein Source.3402: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.3403: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.3404: DFBPPR11635 ---- Animal proteins ---- Cochlin Source.3405: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.3406: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.3407: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.3408: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein Source.3409: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.3410: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit Source.3411: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.3412: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.3413: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.3414: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.3415: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.3416: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.3417: DFBPPR11712 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.3418: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.3419: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.3420: DFBPPR11722 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.3421: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor Source.3422: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.3423: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15 Source.3424: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.3425: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.3426: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.3427: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1 Source.3428: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91 Source.3429: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.3430: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.3431: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.3432: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D Source.3433: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A Source.3434: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1 Source.3435: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1 Source.3436: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11 Source.3437: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17 Source.3438: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.3439: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase Source.3440: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2 Source.3441: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.3442: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.3443: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9 Source.3444: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13 Source.3445: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor Source.3446: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2 Source.3447: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.3448: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.3449: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.3450: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1 Source.3451: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.3452: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.3453: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.3454: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.3455: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.3456: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial Source.3457: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.3458: DFBPPR12001 ---- Animal proteins ---- Pleckstrin homology domain-containing family F member 2 Source.3459: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.3460: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.3461: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.3462: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1 Source.3463: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.3464: DFBPPR12023 ---- Animal proteins ---- 60S ribosomal protein L35 Source.3465: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.3466: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5 Source.3467: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2 Source.3468: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.3469: DFBPPR12041 ---- Animal proteins ---- Paladin Source.3470: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.3471: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.3472: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.3473: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.3474: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.3475: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.3476: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.3477: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.3478: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.3479: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.3480: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.3481: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93 Source.3482: DFBPPR12138 ---- Animal proteins ---- Protein LZIC Source.3483: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6 Source.3484: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.3485: DFBPPR12158 ---- Animal proteins ---- Protein CDV3 homolog Source.3486: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45 Source.3487: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1 Source.3488: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.3489: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40 Source.3490: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1 Source.3491: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.3492: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.3493: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.3494: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.3495: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A Source.3496: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.3497: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1 Source.3498: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.3499: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.3500: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.3501: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.3502: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.3503: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.3504: DFBPPR12278 ---- Animal proteins ---- Major prion protein Source.3505: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.3506: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.3507: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.3508: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.3509: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.3510: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.3511: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.3512: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.3513: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.3514: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.3515: DFBPPR12329 ---- Animal proteins ---- Natriuretic peptides A Source.3516: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.3517: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1 Source.3518: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.3519: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.3520: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.3521: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.3522: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.3523: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5 Source.3524: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.3525: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.3526: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.3527: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.3528: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.3529: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.3530: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3531: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.3532: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4 Source.3533: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.3534: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.3535: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.3536: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.3537: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.3538: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.3539: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.3540: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.3541: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.3542: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.3543: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X Source.3544: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.3545: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.3546: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.3547: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.3548: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.3549: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.3550: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.3551: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.3552: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.3553: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.3554: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.3555: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.3556: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.3557: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.3558: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.3559: DFBPPR12575 ---- Animal proteins ---- CD63 antigen Source.3560: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.3561: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase Source.3562: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.3563: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.3564: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.3565: DFBPPR12604 ---- Animal proteins ---- MARCKS-related protein Source.3566: DFBPPR12607 ---- Animal proteins ---- Basigin Source.3567: DFBPPR12611 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A Source.3568: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.3569: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.3570: DFBPPR12621 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B Source.3571: DFBPPR12622 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B Source.3572: DFBPPR12623 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B Source.3573: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.3574: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.3575: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1 Source.3576: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.3577: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.3578: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.3579: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.3580: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.3581: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.3582: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein Source.3583: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8 Source.3584: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.3585: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.3586: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.3587: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.3588: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.3589: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86 Source.3590: DFBPPR12738 ---- Animal proteins ---- Histone H1.4 Source.3591: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.3592: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.3593: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.3594: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.3595: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.3596: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.3597: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.3598: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin Source.3599: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.3600: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.3601: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.3602: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.3603: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor Source.3604: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.3605: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.3606: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2 Source.3607: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.3608: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.3609: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.3610: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.3611: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11 Source.3612: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.3613: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.3614: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.3615: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.3616: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.3617: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a Source.3618: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.3619: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial Source.3620: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2 Source.3621: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1 Source.3622: DFBPPR12935 ---- Animal proteins ---- Histone H1.3 Source.3623: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.3624: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.3625: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.3626: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.3627: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.3628: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.3629: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.3630: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.3631: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.3632: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain Source.3633: DFBPPR13003 ---- Animal proteins ---- Calcyphosin Source.3634: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.3635: DFBPPR13025 ---- Animal proteins ---- Translationally-controlled tumor protein Source.3636: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.3637: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.3638: DFBPPR13087 ---- Animal proteins ---- Lupus La protein homolog Source.3639: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3640: DFBPPR13094 ---- Animal proteins ---- Atherin Source.3641: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.3642: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.3643: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor Source.3644: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.3645: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.3646: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain Source.3647: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II Source.3648: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.3649: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain Source.3650: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha Source.3651: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.3652: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.3653: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.3654: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.3655: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2 Source.3656: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.3657: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.3658: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.3659: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3660: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta Source.3661: DFBPPR13376 ---- Animal proteins ---- Interleukin-5 Source.3662: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3663: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.3664: DFBPPR13412 ---- Animal proteins ---- Dander allergen Equ c 2.0101 Source.3665: DFBPPR13433 ---- Animal proteins ---- Major prion protein Source.3666: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2 Source.3667: DFBPPR13442 ---- Animal proteins ---- Microtubule-associated protein tau Source.3668: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.3669: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.3670: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.3671: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta Source.3672: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.3673: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3674: DFBPPR13530 ---- Animal proteins ---- Major prion protein Source.3675: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin Source.3676: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.3677: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.3678: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase Source.3679: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1 Source.3680: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3681: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.3682: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.3683: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1 Source.3684: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.3685: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.3686: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.3687: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.3688: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.3689: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.3690: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.3691: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.3692: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta Source.3693: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.3694: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2 Source.3695: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.3696: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2 Source.3697: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.3698: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.3699: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.3700: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.3701: DFBPPR13719 ---- Animal proteins ---- Nitric oxide synthase, brain Source.3702: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.3703: DFBPPR13727 ---- Animal proteins ---- Prolactin-releasing peptide Source.3704: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3705: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.3706: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.3707: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.3708: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.3709: DFBPPR13791 ---- Animal proteins ---- Cholinesterase Source.3710: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6 Source.3711: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5 Source.3712: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561 Source.3713: DFBPPR13847 ---- Animal proteins ---- Growth-regulated alpha protein Source.3714: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor Source.3715: DFBPPR13864 ---- Animal proteins ---- Interleukin-5 Source.3716: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.3717: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.3718: DFBPPR13895 ---- Animal proteins ---- Elastin Source.3719: DFBPPR13902 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.3720: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.3721: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein Source.3722: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein Source.3723: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3 Source.3724: DFBPPR13914 ---- Animal proteins ---- Homeobox protein Hox-C6 Source.3725: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.3726: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.3727: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.3728: DFBPPR13942 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A2, mitochondrial Source.3729: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26 Source.3730: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2 Source.3731: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B Source.3732: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A Source.3733: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.3734: DFBPPR14071 ---- Marine protein ---- Somatotropin Source.3735: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.3736: DFBPPR14081 ---- Marine protein ---- Beta-enolase Source.3737: DFBPPR14125 ---- Marine protein ---- Partner of Y14 and mago B Source.3738: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.3739: DFBPPR14141 ---- Marine protein ---- Ependymin-2 Source.3740: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E Source.3741: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2 Source.3742: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.3743: DFBPPR14231 ---- Marine protein ---- Somatotropin Source.3744: DFBPPR14254 ---- Marine protein ---- Isotocin-neurophysin IT 2 Source.3745: DFBPPR14287 ---- Marine protein ---- C-phycocyanin alpha chain Source.3746: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.3747: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit Source.3748: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B Source.3749: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase Source.3750: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.3751: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.3752: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.3753: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.3754: DFBPPR14383 ---- Marine protein ---- C-phycocyanin alpha chain Source.3755: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.3756: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.3757: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.3758: DFBPPR14392 ---- Marine protein ---- Prenyl transferase Source.3759: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha Source.3760: DFBPPR14409 ---- Marine protein ---- 30S ribosomal protein S5, chloroplastic Source.3761: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.3762: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.3763: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.3764: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.3765: DFBPPR14470 ---- Marine protein ---- Photosystem I reaction center subunit PsaK Source.3766: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.3767: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.3768: DFBPPR14541 ---- Marine protein ---- Somatotropin-1 Source.3769: DFBPPR14542 ---- Marine protein ---- Somatotropin-2 Source.3770: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.3771: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.3772: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.3773: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor Source.3774: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.3775: DFBPPR14618 ---- Marine protein ---- Ependymin-1 Source.3776: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.3777: DFBPPR14625 ---- Marine protein ---- Somatostatin-2 Source.3778: DFBPPR14645 ---- Marine protein ---- Ependymin-2 Source.3779: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A Source.3780: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B Source.3781: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.3782: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1 Source.3783: DFBPPR14760 ---- Marine protein ---- Big defensin Source.3784: DFBPPR14775 ---- Marine protein ---- Troponin C Source.3785: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.3786: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.3787: DFBPPR14783 ---- Marine protein ---- Enolase Source.3788: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.3789: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain Source.3790: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain Source.3791: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit Source.3792: DFBPPR14843 ---- Marine protein ---- Cuticle protein AMP5 Source.3793: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha Source.3794: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.3795: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.3796: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit Source.3797: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.3798: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.3799: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.3800: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.3801: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase Source.3802: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.3803: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.3804: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase Source.3805: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial Source.3806: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.3807: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.3808: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1 Source.3809: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.3810: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.3811: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27 Source.3812: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.3813: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.3814: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.3815: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.3816: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.3817: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.3818: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.3819: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase Source.3820: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.3821: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.3822: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.3823: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.3824: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.3825: DFBPPR15045 ---- Microorganism protein ---- Enolase Source.3826: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.3827: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4 Source.3828: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial Source.3829: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.3830: DFBPPR15107 ---- Microorganism protein ---- Calcineurin subunit B Source.3831: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.3832: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase Source.3833: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.3834: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G Source.3835: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2 Source.3836: DFBPPR15159 ---- Microorganism protein ---- Centromere-binding protein 1 Source.3837: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.3838: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2 Source.3839: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.3840: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.3841: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60 Source.3842: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1 Source.3843: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2 Source.3844: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase Source.3845: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.3846: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.3847: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9 Source.3848: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta Source.3849: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.3850: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.3851: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.3852: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.3853: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7 Source.3854: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1 Source.3855: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.3856: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4 Source.3857: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24 Source.3858: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1 Source.3859: DFBPPR15484 ---- Microorganism protein ---- Protein TOS6 Source.3860: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1 Source.3861: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.3862: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase Source.3863: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6 Source.3864: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7 Source.3865: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta Source.3866: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.3867: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5 Source.3868: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.3869: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18 Source.3870: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1 Source.3871: DFBPPR15689 ---- Microorganism protein ---- Ribosomal protein VAR1, mitochondrial Source.3872: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.3873: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1 Source.3874: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial Source.3875: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.3876: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.3877: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5 Source.3878: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.3879: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase Source.3880: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.3881: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.3882: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase Source.3883: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.3884: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.3885: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.3886: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.3887: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.3888: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.3889: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.3890: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase Source.3891: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2 Source.3892: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.3893: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.3894: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.3895: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.3896: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.3897: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.3898: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.3899: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.3900: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.3901: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.3902: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3903: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein Source.3904: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3905: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3 Source.3906: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.3907: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.3908: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.3909: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.3910: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.3911: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.3912: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.3913: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.3914: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic Source.3915: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.3916: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.3917: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.3918: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.3919: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.3920: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.3921: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.3922: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.3923: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1 Source.3924: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.3925: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1 Source.3926: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1 Source.3927: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1 Source.3928: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1 Source.3929: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2 Source.3930: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4 Source.3931: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2 Source.3932: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.3933: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1 Source.3934: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1 Source.3935: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase Source.3936: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.3937: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1 Source.3938: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.3939: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein Source.3940: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.3941: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3942: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.3943: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.3944: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.3945: DFBPPR8011 ---- Plant protein ---- Endochitinase 1 Source.3946: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.3947: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.3948: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.3949: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.3950: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1 Source.3951: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.3952: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3953: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.3954: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein Source.3955: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha Source.3956: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3957: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.3958: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.3959: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.3960: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.3961: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.3962: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.3963: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.3964: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2 Source.3965: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0 Source.3966: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.3967: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.3968: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3969: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein Source.3970: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.3971: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.3972: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.3973: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.3974: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.3975: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3976: DFBPPR8350 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic Source.3977: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity	(1) The purified peptide GAA exhibited high scavenging activity on hydroxyl radical (IC₅₀ 1.6337 mg/ml), ABTS radical (IC₅₀ 1.7541 mg/ml), and superoxide radical (IC₅₀ 0.6714 mg/ml). (2) The purified peptide also effectively inhibited the autooxidation in linoleic acid model system.
Specific target protein(s)	N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	The ethanol-soluble proteins antioxidant hydrolysates were prepared using papain.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The peptides isolated from the ethanol-soluble proteins hydrolysates of spotless smoothhound muscle were potent antioxidants and might be effectively used as food additives and pharmaceutical agents.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Wang, B., Gong, Y.-D., Li, Z.-R., Yu, D., Chi, C.-F., Ma, J.-Y. Isolation and characterisation of five novel antioxidant peptides from ethanol-soluble proteins hydrolysate of spotless smoothhound (Mustelus griseus) muscle. Journal of Functional Foods. 2014, 6, 176-85. DOI: 10.1016/j.jff.2013.10.004
Other literature(s)	[1] Zou, T.B., et al., The Structure-Activity Relationship of the Antioxidant Peptides from Natural Proteins. Molecules, 2016. 21(1): p. 72.
PubDate	2014