E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0602(Antioxidative peptide)
DFBP ID DFBPANOX0602
Peptide sequence EVR
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Glu-Val-Arg
Single-letter amino acid EVR
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
402.23 Da 402.45 Da c
Net charge 0.00 c
Isoelectric point (pI) 6.95 c
IC50 N.D
pIC50 N.D
GRAVY -1.2667 c
Hydrophilic residue ratio 33.33% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Black-bone silky fowl (Gallus gallus domesticus Brisson)
Precursor protein Black-bone silky fowl muscle
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.2: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.3: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.4: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.5: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.6: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.7: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.8: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.9: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.10: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.11: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.12: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase
Source.13: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.14: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.15: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.16: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.17: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50
Source.18: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.19: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.20: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.21: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.22: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.23: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.24: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.25: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.26: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.27: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.28: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.29: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.30: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.31: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.32: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.33: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.34: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.35: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.36: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.37: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.38: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.39: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.40: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.41: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.42: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.43: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.44: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.45: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.46: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.47: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.48: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.49: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.50: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.51: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.52: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.53: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.54: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.55: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.56: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.57: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.58: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.59: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.60: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.61: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.62: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.63: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.64: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.65: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.66: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.67: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.68: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.69: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.70: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.71: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.72: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.73: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.74: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.75: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.76: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.77: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.78: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.79: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.80: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.81: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.82: DFBPPR1768 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase RZFP34
Source.83: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.84: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.85: DFBPPR1782 ---- Plant proteins ---- Transcription factor BHLH133
Source.86: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.87: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.88: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.89: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.90: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.91: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.92: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.93: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.94: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.95: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.96: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.97: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.98: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.99: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.100: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.101: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.102: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.103: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.104: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.105: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.106: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.107: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.108: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.109: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.110: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.111: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38
Source.112: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.113: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.114: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.115: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.116: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5
Source.117: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.118: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.119: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.120: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.121: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.122: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.123: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.124: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.125: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.126: DFBPPR2115 ---- Plant proteins ---- E3 ubiquitin-protein ligase SIRP1
Source.127: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.128: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.129: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.130: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.131: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.132: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.133: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.134: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.135: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.136: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.137: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.138: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.139: DFBPPR2223 ---- Plant proteins ---- Urease
Source.140: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.141: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.142: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.143: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.144: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.145: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.146: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.147: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.148: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.149: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.150: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.151: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.152: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.153: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.154: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.155: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.156: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.157: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.158: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.159: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.160: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.161: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.162: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.163: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.164: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.165: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.166: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.167: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.168: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.169: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.170: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.171: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.172: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.173: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.174: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.175: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.176: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34
Source.177: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal
Source.178: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.179: DFBPPR2648 ---- Plant proteins ---- SKP1-like protein 20
Source.180: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3
Source.181: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.182: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.183: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.184: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.185: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.186: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.187: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72
Source.188: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.189: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.190: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.191: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.192: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.193: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.194: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.195: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.196: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.197: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.198: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.199: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.200: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.201: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.202: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c
Source.203: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.204: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.205: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.206: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.207: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.208: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.209: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.210: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.211: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.212: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.213: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.214: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.215: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.216: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.217: DFBPPR2860 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 3
Source.218: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.219: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.220: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.221: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.222: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.223: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.224: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.225: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1
Source.226: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.227: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.228: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.229: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.230: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10
Source.231: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.232: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.233: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.234: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.235: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3
Source.236: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.237: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.238: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.239: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.240: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.241: DFBPPR3143 ---- Plant proteins ---- Protein OS-9 homolog
Source.242: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.243: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.244: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.245: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.246: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.247: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic
Source.248: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.249: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.250: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.251: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59
Source.252: DFBPPR3205 ---- Plant proteins ---- Monothiol glutaredoxin-S3
Source.253: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.254: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.255: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.256: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.257: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.258: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.259: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit
Source.260: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.261: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.262: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.263: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.264: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.265: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.266: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.267: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.268: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.269: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.270: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.271: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.272: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.273: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.274: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.275: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.276: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5
Source.277: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.278: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.279: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.280: DFBPPR3526 ---- Plant proteins ---- Protein XAP5 CIRCADIAN TIMEKEEPER
Source.281: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.282: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic
Source.283: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.284: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.285: DFBPPR3557 ---- Plant proteins ---- NRR repressor homolog 3
Source.286: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.287: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.288: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.289: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.290: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.291: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.292: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.293: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.294: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic
Source.295: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.296: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.297: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.298: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.299: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.300: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3
Source.301: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.302: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.303: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28
Source.304: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.305: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.306: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4
Source.307: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial
Source.308: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.309: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.310: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.311: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit
Source.312: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.313: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.314: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.315: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.316: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.317: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.318: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.319: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.320: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.321: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.322: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8
Source.323: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.324: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.325: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.326: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.327: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.328: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.329: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.330: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.331: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.332: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.333: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5
Source.334: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11
Source.335: DFBPPR4017 ---- Plant proteins ---- Protein G1-like4
Source.336: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.337: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.338: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.339: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25
Source.340: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.341: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.342: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.343: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.344: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.345: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.346: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.347: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.348: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.349: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.350: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.351: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.352: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.353: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.354: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.355: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.356: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.357: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.358: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2
Source.359: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.360: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.361: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.362: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.363: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.364: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.365: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.366: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.367: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.368: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.369: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.370: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.371: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.372: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.373: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.374: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.375: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.376: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.377: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.378: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18
Source.379: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.380: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.381: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.382: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.383: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.384: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.385: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.386: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.387: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.388: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.389: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.390: DFBPPR4584 ---- Plant proteins ---- Probable calcium-binding protein CML29
Source.391: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.392: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.393: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.394: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.395: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.396: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.397: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.398: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.399: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.400: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.401: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.402: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.403: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.404: DFBPPR4759 ---- Plant proteins ---- 60S ribosomal protein L18a
Source.405: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.406: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.407: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4
Source.408: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.409: DFBPPR4783 ---- Plant proteins ---- Putative ripening-related protein 7
Source.410: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19
Source.411: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1
Source.412: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.413: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2
Source.414: DFBPPR4838 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 4
Source.415: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3
Source.416: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400
Source.417: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820
Source.418: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.419: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.420: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.421: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.422: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.423: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.424: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.425: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.426: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.427: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.428: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.429: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.430: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.431: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.432: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.433: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.434: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.435: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.436: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.437: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.438: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.439: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.440: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.441: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.442: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.443: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.444: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.445: DFBPPR5235 ---- Plant proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.446: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic
Source.447: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic
Source.448: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.449: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.450: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.451: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.452: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.453: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.454: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.455: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.456: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.457: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.458: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.459: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.460: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1
Source.461: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.462: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.463: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.464: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.465: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.466: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.467: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.468: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.469: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.470: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.471: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.472: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.473: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.474: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.475: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.476: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.477: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.478: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.479: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.480: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.481: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.482: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.483: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.484: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.485: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.486: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.487: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.488: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.489: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.490: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.491: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.492: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.493: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.494: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.495: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.496: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.497: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.498: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.499: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.500: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.501: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.502: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.503: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.504: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.505: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.506: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.507: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.508: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.509: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.510: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1
Source.511: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.512: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.513: DFBPPR6108 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 5
Source.514: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.515: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.516: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.517: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5
Source.518: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2
Source.519: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4
Source.520: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3
Source.521: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.522: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.523: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.524: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.525: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.526: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.527: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.528: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.529: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.530: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.531: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.532: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.533: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.534: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.535: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.536: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.537: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.538: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.539: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.540: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic
Source.541: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.542: DFBPPR6549 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.543: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.544: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.545: DFBPPR6640 ---- Plant proteins ---- Puroindoline-B
Source.546: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.547: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.548: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.549: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.550: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.551: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.552: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.553: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.554: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.555: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.556: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.557: DFBPPR6953 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.558: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.559: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.560: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.561: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.562: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.563: DFBPPR7032 ---- Plant proteins ---- Hordoindoline-B2
Source.564: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.565: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.566: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.567: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.568: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.569: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.570: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.571: DFBPPR7069 ---- Plant proteins ---- Hordoindoline-B1
Source.572: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.573: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.574: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.575: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.576: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.577: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.578: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.579: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.580: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.581: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.582: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.583: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.584: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.585: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.586: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.587: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.588: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.589: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.590: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.591: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.592: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.593: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.594: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.595: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.596: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein
Source.597: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24
Source.598: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.599: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.600: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2
Source.601: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.602: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.603: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.604: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.605: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76
Source.606: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.607: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.608: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.609: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.610: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.611: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.612: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.613: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.614: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.615: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.616: DFBPPR7710 ---- Milk proteins ---- Beta-lactoglobulin, Beta-LG
Source.617: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.618: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.619: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.620: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.621: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.622: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.623: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.624: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.625: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.626: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.627: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.628: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.629: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.630: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.631: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.632: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.633: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.634: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.635: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.636: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.637: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.638: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.639: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.640: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.641: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.642: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.643: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.644: DFBPPR16065 ---- Animal proteins ---- Caspase-3
Source.645: DFBPPR16075 ---- Animal proteins ---- Hematopoietic progenitor cell antigen CD34
Source.646: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.647: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.648: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3
Source.649: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.650: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.651: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.652: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.653: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.654: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.655: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.656: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.657: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.658: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.659: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.660: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.661: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.662: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.663: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.664: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.665: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.666: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain
Source.667: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.668: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.669: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.670: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.671: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.672: DFBPPR16474 ---- Animal proteins ---- Pinin
Source.673: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.674: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.675: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.676: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.677: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.678: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain
Source.679: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.680: DFBPPR16660 ---- Animal proteins ---- Gamma-crystallin C
Source.681: DFBPPR16674 ---- Animal proteins ---- Double-headed protease inhibitor, submandibular gland
Source.682: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.683: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.684: DFBPPR16745 ---- Animal proteins ---- Ig kappa chain V region GOM
Source.685: DFBPPR16746 ---- Animal proteins ---- Tektin-1
Source.686: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.687: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.688: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.689: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.690: DFBPPR16788 ---- Animal proteins ---- Alpha-crystallin A chain
Source.691: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.692: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.693: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.694: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.695: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.696: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.697: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.698: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.699: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.700: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.701: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain
Source.702: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.703: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.704: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.705: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.706: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.707: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.708: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.709: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.710: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.711: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.712: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.713: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.714: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.715: DFBPPR17073 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.716: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.717: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.718: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.719: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.720: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.721: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.722: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.723: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.724: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.725: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.726: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.727: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.728: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.729: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.730: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.731: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.732: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.733: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.734: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.735: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4
Source.736: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.737: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.738: DFBPPR17423 ---- Animal proteins ---- Furin
Source.739: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.740: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.741: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.742: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.743: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.744: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.745: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.746: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.747: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.748: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.749: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.750: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.751: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.752: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.753: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.754: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1
Source.755: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.756: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.757: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.758: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.759: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.760: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.761: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.762: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.763: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.764: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.765: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.766: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.767: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.768: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.769: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3
Source.770: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.771: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.772: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.773: DFBPPR17823 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 1
Source.774: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.775: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.776: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.777: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.778: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.779: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.780: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.781: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.782: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.783: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.784: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.785: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.786: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.787: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.788: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.789: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.790: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.791: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A
Source.792: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.793: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.794: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.795: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.796: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.797: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.798: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.799: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.800: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.801: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.802: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B
Source.803: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.804: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.805: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.806: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.807: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.808: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.809: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.810: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.811: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1
Source.812: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.813: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.814: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2
Source.815: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.816: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.817: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.818: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.819: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.820: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.821: DFBPPR18462 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.822: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.823: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.824: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.825: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.826: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.827: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.828: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.829: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.830: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.831: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.832: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.833: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.834: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.835: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1
Source.836: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.837: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.838: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.839: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.840: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.841: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.842: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.843: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D
Source.844: DFBPPR18719 ---- Animal proteins ---- A-kinase anchor protein 5
Source.845: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.846: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.847: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.848: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.849: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1
Source.850: DFBPPR18785 ---- Animal proteins ---- Protein lin-7 homolog C
Source.851: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.852: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.853: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.854: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.855: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.856: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.857: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.858: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.859: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.860: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.861: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.862: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.863: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.864: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.865: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.866: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.867: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.868: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.869: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.870: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.871: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.872: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.873: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.874: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.875: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.876: DFBPPR19096 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.877: DFBPPR19118 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-1
Source.878: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.879: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1
Source.880: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.881: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.882: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4
Source.883: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.884: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.885: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.886: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.887: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.888: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.889: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.890: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.891: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.892: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.893: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.894: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.895: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.896: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.897: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.898: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.899: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.900: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.901: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.902: DFBPPR19512 ---- Animal proteins ---- Centrin-1
Source.903: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.904: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.905: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.906: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.907: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.908: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.909: DFBPPR19607 ---- Animal proteins ---- Obg-like ATPase 1
Source.910: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.911: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.912: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.913: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.914: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.915: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.916: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.917: DFBPPR19686 ---- Animal proteins ---- Spindle and kinetochore-associated protein 1
Source.918: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.919: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3
Source.920: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.921: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH
Source.922: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog
Source.923: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.924: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.925: DFBPPR19802 ---- Animal proteins ---- 28S ribosomal protein S26, mitochondrial
Source.926: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.927: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.928: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.929: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.930: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.931: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.932: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.933: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.934: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.935: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.936: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.937: DFBPPR19929 ---- Animal proteins ---- Ermin
Source.938: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.939: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.940: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.941: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.942: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1
Source.943: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.944: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.945: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.946: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.947: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.948: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.949: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.950: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.951: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.952: DFBPPR20130 ---- Animal proteins ---- Stathmin
Source.953: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.954: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.955: DFBPPR20189 ---- Animal proteins ---- Protein disulfide isomerase CRELD2
Source.956: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.957: DFBPPR20210 ---- Animal proteins ---- Exonuclease V
Source.958: DFBPPR20215 ---- Animal proteins ---- Caspase-3
Source.959: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.960: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.961: DFBPPR20269 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor
Source.962: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.963: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.964: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2
Source.965: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.966: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.967: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.968: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.969: DFBPPR20350 ---- Animal proteins ---- Pinin
Source.970: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.971: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.972: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.973: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.974: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.975: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.976: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein
Source.977: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog
Source.978: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.979: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.980: DFBPPR20528 ---- Animal proteins ---- Thiamin pyrophosphokinase 1
Source.981: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.982: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.983: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.984: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.985: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.986: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.987: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.988: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.989: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.990: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47
Source.991: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.992: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2
Source.993: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.994: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.995: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.996: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.997: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.998: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.999: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.1000: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.1001: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.1002: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1003: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.1004: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta
Source.1005: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1006: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.1007: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.1008: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.1009: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.1010: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.1011: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma
Source.1012: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog
Source.1013: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.1014: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.1015: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.1016: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.1017: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.1018: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.1019: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2
Source.1020: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24
Source.1021: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.1022: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.1023: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.1024: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.1025: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.1026: DFBPPR21239 ---- Animal proteins ---- Coordinator of PRMT5 and differentiation stimulator
Source.1027: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.1028: DFBPPR21288 ---- Animal proteins ---- Polycomb group RING finger protein 1
Source.1029: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.1030: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.1031: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.1032: DFBPPR21320 ---- Animal proteins ---- Sjoegren syndrome nuclear autoantigen 1 homolog
Source.1033: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1034: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.1035: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.1036: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1037: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.1038: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.1039: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.1040: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.1041: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207
Source.1042: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.1043: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1
Source.1044: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1045: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.1046: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19
Source.1047: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.1048: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.1049: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.1050: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.1051: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.1052: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.1053: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.1054: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2
Source.1055: DFBPPR21794 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 8
Source.1056: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.1057: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.1058: DFBPPR21843 ---- Animal proteins ---- Tektin-1
Source.1059: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor
Source.1060: DFBPPR21904 ---- Animal proteins ---- Protein TBATA
Source.1061: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.1062: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1063: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.1064: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.1065: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.1066: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.1067: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.1068: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.1069: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.1070: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.1071: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.1072: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8
Source.1073: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1074: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.1075: DFBPPR22206 ---- Animal proteins ---- Promotilin
Source.1076: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.1077: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1
Source.1078: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.1079: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog
Source.1080: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222
Source.1081: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.1082: DFBPPR22329 ---- Animal proteins ---- Coiled-coil domain-containing protein 172
Source.1083: DFBPPR22338 ---- Animal proteins ---- Probable cystatin-16
Source.1084: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.1085: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2
Source.1086: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.1087: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.1088: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474
Source.1089: DFBPPR22425 ---- Animal proteins ---- Protein THEM6
Source.1090: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.1091: DFBPPR22443 ---- Animal proteins ---- Stromal cell-derived factor 2
Source.1092: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.1093: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.1094: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97
Source.1095: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.1096: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.1097: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.1098: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.1099: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.1100: DFBPPR22584 ---- Animal proteins ---- Arginine vasopressin-induced protein 1
Source.1101: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105
Source.1102: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71
Source.1103: DFBPPR22632 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 1
Source.1104: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.1105: DFBPPR22659 ---- Animal proteins ---- Testis-expressed protein 35
Source.1106: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9
Source.1107: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.1108: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.1109: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1110: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.1111: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1112: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.1113: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1114: DFBPPR8564 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.1115: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1116: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.1117: DFBPPR8607 ---- Animal proteins ---- Prolactin
Source.1118: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.1119: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.1120: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1121: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1122: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.1123: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.1124: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1125: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1126: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1127: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1128: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1129: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.1130: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1131: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.1132: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.1133: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3
Source.1134: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.1135: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.1136: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.1137: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1138: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.1139: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.1140: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.1141: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.1142: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.1143: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.1144: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.1145: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.1146: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.1147: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1
Source.1148: DFBPPR8973 ---- Animal proteins ---- Caspase-3
Source.1149: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1150: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.1151: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1152: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1153: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1154: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.1155: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1156: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1157: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1158: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.1159: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.1160: DFBPPR9190 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.1161: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.1162: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.1163: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.1164: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.1165: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.1166: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.1167: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.1168: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.1169: DFBPPR9324 ---- Animal proteins ---- Carbohydrate-binding protein AQN-3
Source.1170: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.1171: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.1172: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.1173: DFBPPR9449 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.1174: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1175: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.1176: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.1177: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1178: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.1179: DFBPPR9577 ---- Animal proteins ---- Stathmin
Source.1180: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.1181: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.1182: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.1183: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1184: DFBPPR9685 ---- Animal proteins ---- Interleukin-27 subunit alpha
Source.1185: DFBPPR9695 ---- Animal proteins ---- Seminal plasma sperm motility inhibitor
Source.1186: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.1187: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1188: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.1189: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1190: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1
Source.1191: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.1192: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.1193: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8
Source.1194: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.1195: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19
Source.1196: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.1197: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.1198: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.1199: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.1200: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.1201: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.1202: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.1203: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.1204: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.1205: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I
Source.1206: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.1207: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1208: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.1209: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.1210: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1211: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.1212: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.1213: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.1214: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.1215: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1216: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1217: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.1218: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.1219: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1220: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1221: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.1222: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.1223: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.1224: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.1225: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.1226: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.1227: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.1228: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.1229: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.1230: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.1231: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.1232: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.1233: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1234: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.1235: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1236: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.1237: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.1238: DFBPPR10326 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1239: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.1240: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.1241: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1242: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.1243: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.1244: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.1245: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.1246: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.1247: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.1248: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.1249: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1250: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.1251: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.1252: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.1253: DFBPPR10400 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.1254: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1255: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1256: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.1257: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1258: DFBPPR10433 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.1259: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.1260: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.1261: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1262: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.1263: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.1264: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.1265: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.1266: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.1267: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.1268: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1269: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.1270: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1271: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.1272: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.1273: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1274: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1275: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.1276: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.1277: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.1278: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.1279: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.1280: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.1281: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.1282: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1283: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.1284: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.1285: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.1286: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.1287: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1288: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1289: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.1290: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1291: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.1292: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.1293: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.1294: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.1295: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.1296: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.1297: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1298: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.1299: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.1300: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.1301: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1302: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.1303: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.1304: DFBPPR10816 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-1
Source.1305: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.1306: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1307: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.1308: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.1309: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.1310: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1311: DFBPPR10873 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-2
Source.1312: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.1313: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.1314: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.1315: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.1316: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.1317: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.1318: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.1319: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1320: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.1321: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.1322: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.1323: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.1324: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.1325: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.1326: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.1327: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.1328: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.1329: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1330: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.1331: DFBPPR11016 ---- Animal proteins ---- Protein lin-7 homolog C
Source.1332: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.1333: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.1334: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.1335: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1336: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.1337: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.1338: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.1339: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.1340: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.1341: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1342: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.1343: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.1344: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.1345: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.1346: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.1347: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.1348: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.1349: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.1350: DFBPPR11155 ---- Animal proteins ---- Stathmin
Source.1351: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.1352: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.1353: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1354: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.1355: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.1356: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.1357: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1
Source.1358: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.1359: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1360: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.1361: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3
Source.1362: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42
Source.1363: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.1364: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.1365: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.1366: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.1367: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.1368: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.1369: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.1370: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.1371: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.1372: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1373: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.1374: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.1375: DFBPPR11652 ---- Animal proteins ---- Stathmin-3
Source.1376: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.1377: DFBPPR11683 ---- Animal proteins ---- Somatostatin
Source.1378: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.1379: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1380: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.1381: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.1382: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.1383: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.1384: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.1385: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.1386: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.1387: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.1388: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13
Source.1389: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.1390: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.1391: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.1392: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.1393: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.1394: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.1395: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1396: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.1397: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.1398: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.1399: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.1400: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1401: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1402: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.1403: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1
Source.1404: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.1405: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.1406: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.1407: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.1408: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.1409: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.1410: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.1411: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.1412: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1
Source.1413: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.1414: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.1415: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.1416: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.1417: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.1418: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.1419: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1
Source.1420: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.1421: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1422: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.1423: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.1424: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1425: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1426: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1427: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1428: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.1429: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1430: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1431: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1432: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1433: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.1434: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.1435: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.1436: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.1437: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1438: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1439: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.1440: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.1441: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.1442: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.1443: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.1444: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.1445: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1446: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1447: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.1448: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.1449: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.1450: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I
Source.1451: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1452: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.1453: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.1454: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.1455: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1456: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.1457: DFBPPR12519 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-1
Source.1458: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1459: DFBPPR12534 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.1460: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1461: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1
Source.1462: DFBPPR12629 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.1463: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.1464: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1465: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.1466: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.1467: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1468: DFBPPR12761 ---- Animal proteins ---- Trichohyalin
Source.1469: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.1470: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.1471: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.1472: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1473: DFBPPR12796 ---- Animal proteins ---- Caspase-3
Source.1474: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.1475: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1476: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.1477: DFBPPR12875 ---- Animal proteins ---- Fatty acid synthase
Source.1478: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1479: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2
Source.1480: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1
Source.1481: DFBPPR12969 ---- Animal proteins ---- Prolactin
Source.1482: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.1483: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.1484: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.1485: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.1486: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207
Source.1487: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1488: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1489: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1490: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.1491: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.1492: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.1493: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.1494: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.1495: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.1496: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1497: DFBPPR13257 ---- Animal proteins ---- Prolactin
Source.1498: DFBPPR13261 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.1499: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1500: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1501: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.1502: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.1503: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1504: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1505: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.1506: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.1507: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.1508: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1509: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1510: DFBPPR13538 ---- Animal proteins ---- Apolipoprotein E
Source.1511: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.1512: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.1513: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1514: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1515: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.1516: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1517: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1518: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.1519: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.1520: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.1521: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain
Source.1522: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.1523: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.1524: DFBPPR13702 ---- Animal proteins ---- Protransforming growth factor alpha
Source.1525: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.1526: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.1527: DFBPPR13778 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.1528: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1529: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1530: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.1531: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.1532: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.1533: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.1534: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.1535: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.1536: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.1537: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.1538: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.1539: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.1540: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.1541: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.1542: DFBPPR14151 ---- Marine protein ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.1543: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.1544: DFBPPR14178 ---- Marine protein ---- Hepcidin-1
Source.1545: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A
Source.1546: DFBPPR14206 ---- Marine protein ---- Intraflagellar transport protein 43 homolog B
Source.1547: DFBPPR14213 ---- Marine protein ---- Electron transfer flavoprotein regulatory factor 1
Source.1548: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.1549: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.1550: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1551: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.1552: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1553: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha
Source.1554: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.1555: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.1556: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic
Source.1557: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic
Source.1558: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.1559: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.1560: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.1561: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.1562: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.1563: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.1564: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18
Source.1565: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.1566: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.1567: DFBPPR14763 ---- Marine protein ---- Tachyplesin-1
Source.1568: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.1569: DFBPPR14766 ---- Marine protein ---- Tachyplesin-2
Source.1570: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.1571: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.1572: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.1573: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.1574: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.1575: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.1576: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.1577: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.1578: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.1579: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.1580: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.1581: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32
Source.1582: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.1583: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.1584: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.1585: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.1586: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.1587: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.1588: DFBPPR15053 ---- Microorganism protein ---- 60S ribosomal subunit assembly/export protein LOC1
Source.1589: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1
Source.1590: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.1591: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.1592: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.1593: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.1594: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.1595: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.1596: DFBPPR15103 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein END3
Source.1597: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.1598: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.1599: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.1600: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.1601: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.1602: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.1603: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.1604: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.1605: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.1606: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.1607: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.1608: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4
Source.1609: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.1610: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.1611: DFBPPR15252 ---- Microorganism protein ---- Protein DSE2
Source.1612: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.1613: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25
Source.1614: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.1615: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.1616: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.1617: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.1618: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.1619: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.1620: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1621: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.1622: DFBPPR15432 ---- Microorganism protein ---- Pre-rRNA-processing protein ESF2
Source.1623: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2
Source.1624: DFBPPR15477 ---- Microorganism protein ---- MICOS complex subunit MIC12
Source.1625: DFBPPR15495 ---- Microorganism protein ---- DNA replication complex GINS protein PSF2
Source.1626: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.1627: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.1628: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein
Source.1629: DFBPPR15571 ---- Microorganism protein ---- Mating-type protein ALPHA2
Source.1630: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.1631: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.1632: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.1633: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.1634: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.1635: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.1636: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6
Source.1637: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24
Source.1638: DFBPPR15758 ---- Microorganism protein ---- Required for respiratory growth protein 8, mitochondrial
Source.1639: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.1640: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.1641: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.1642: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.1643: DFBPPR15841 ---- Microorganism protein ---- Agaricus bisporus lectin
Source.1644: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.1645: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.1646: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.1647: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.1648: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.1649: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.1650: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.1651: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.1652: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.1653: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.1654: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.1655: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1656: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.1657: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.1658: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.1659: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.1660: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.1661: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.1662: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.1663: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.1664: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.1665: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1
Source.1666: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.1667: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.1668: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.1669: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1670: DFBPPR8107 ---- Plant protein ---- Stress-related protein
Source.1671: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.1672: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.1673: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1674: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.1675: DFBPPR8130 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.1676: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.1677: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.1678: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.1679: DFBPPR8235 ---- Plant protein ---- Catalase
Source.1680: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1681: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.1682: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.1683: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The peptide EVR showed a lower DPPH radical-scavenging activity of below 20%. Although the peptide did not exhibit strong scavenging activity, it may have a synergistic effect with other peptides and thereby enhance the overall antioxidant activity of black-bone silky fowl muscle hydrolysates. However, further study is needed to determine the precise synergistic effects of these peptides.

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

The protein was hydrolyzed with Alcalase 2.4 L and Papain.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The antioxidative peptide EVR can be a source of natural antioxidant and used as a food additive.

Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Liu W, Gu R, Lin F, Lu J, Yi W, Ma Y, Dong Z, Cai M. Isolation and identification of antioxidative peptides from pilot-scale black-bone silky fowl (Gallus gallus domesticus Brisson) muscle oligopeptides. J Sci Food Agric. 2013 Aug 30;93(11):2782-8.
PMID: 23408437
Other literature(s) N.D
PubDate 2013
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214