Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0636(Antioxidative peptide)

DFBP ID	DFBPANOX0636
Peptide sequence	WP
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	DPP IV-inhibitory activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Trp-Pro

Single-letter amino acid

Peptide length

Peptide mass

Experimental mass	Theoretical mass
302.141 Da	301.34 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

-1.2500^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Marine
Organism/Source	Thai traditional fermented shrimp pastes
Precursor protein	Kapi Ta Dam (Kp-B6)
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0393 ---- Plant protein ---- Gamma 2 gliadin Source.2: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5 Source.3: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3 Source.4: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.5: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A Source.6: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5 Source.7: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.8: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.9: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.10: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.11: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase Source.12: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.13: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.14: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.15: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.16: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.17: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.18: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.19: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.20: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.21: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic Source.22: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.23: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1 Source.24: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.25: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.26: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.27: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.28: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.29: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.30: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.31: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.32: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.33: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.34: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.35: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.36: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A Source.37: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.38: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.39: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5 Source.40: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3 Source.41: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.42: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9 Source.43: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.44: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7 Source.45: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.46: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.47: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.48: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.49: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185 Source.50: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.51: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.52: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.53: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.54: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.55: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.56: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.57: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.58: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.59: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.60: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.61: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.62: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.63: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1 Source.64: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.65: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.66: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.67: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.68: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2 Source.69: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24 Source.70: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.71: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.72: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3 Source.73: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.74: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.75: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.76: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3 Source.77: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.78: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.79: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.80: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4 Source.81: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.82: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.83: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.84: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.85: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2 Source.86: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.87: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17 Source.88: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.89: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.90: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.91: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.92: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2 Source.93: DFBPPR1176 ---- Plant proteins ---- Chitinase 12 Source.94: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.95: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.96: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.97: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.98: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.99: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.100: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.101: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2 Source.102: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.103: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.104: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.105: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.106: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic Source.107: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.108: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.109: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3 Source.110: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.111: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.112: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.113: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.114: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.115: DFBPPR1292 ---- Plant proteins ---- Chitinase 3 Source.116: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.117: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6 Source.118: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.119: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.120: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.121: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.122: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.123: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2 Source.124: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.125: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17 Source.126: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.127: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.128: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.129: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.130: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.131: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B Source.132: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.133: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.134: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.135: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.136: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.137: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.138: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.139: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.140: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.141: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.142: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.143: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.144: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.145: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic Source.146: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.147: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.148: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog Source.149: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2 Source.150: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.151: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.152: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.153: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.154: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.155: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.156: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.157: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.158: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.159: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.160: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.161: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3 Source.162: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.163: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.164: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.165: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.166: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.167: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1 Source.168: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.169: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.170: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.171: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.172: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.173: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.174: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.175: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.176: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.177: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.178: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.179: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.180: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.181: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.182: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.183: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.184: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.185: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.186: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.187: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.188: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.189: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.190: DFBPPR1497 ---- Plant proteins ---- Chitinase 1 Source.191: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.192: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.193: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.194: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.195: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.196: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.197: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.198: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.199: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.200: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2 Source.201: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.202: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.203: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.204: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.205: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.206: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.207: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.208: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.209: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.210: DFBPPR1561 ---- Plant proteins ---- Chitinase 4 Source.211: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.212: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.213: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.214: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33 Source.215: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF Source.216: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.217: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic Source.218: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.219: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8 Source.220: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.221: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.222: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.223: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.224: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2 Source.225: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.226: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.227: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.228: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.229: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.230: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.231: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic Source.232: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C Source.233: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C Source.234: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.235: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.236: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.237: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.238: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.239: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.240: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.241: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1 Source.242: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.243: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.244: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2 Source.245: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.246: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.247: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.248: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.249: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.250: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3 Source.251: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.252: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1 Source.253: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.254: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.255: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.256: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial Source.257: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.258: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.259: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2 Source.260: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.261: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.262: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1 Source.263: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.264: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.265: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.266: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic Source.267: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.268: DFBPPR1803 ---- Plant proteins ---- Chitinase 5 Source.269: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.270: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9 Source.271: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.272: DFBPPR1818 ---- Plant proteins ---- Chitinase 9 Source.273: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.274: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1 Source.275: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.276: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.277: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1 Source.278: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.279: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.280: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.281: DFBPPR1848 ---- Plant proteins ---- Chitinase 7 Source.282: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.283: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.284: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.285: DFBPPR1863 ---- Plant proteins ---- Chitinase 6 Source.286: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4 Source.287: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.288: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.289: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.290: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.291: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.292: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.293: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21 Source.294: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.295: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.296: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.297: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.298: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.299: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.300: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.301: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.302: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.303: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.304: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.305: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.306: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.307: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.308: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.309: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.310: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.311: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.312: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.313: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.314: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.315: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.316: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein Source.317: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.318: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.319: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.320: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.321: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.322: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.323: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.324: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80 Source.325: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.326: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.327: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.328: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.329: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.330: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.331: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.332: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.333: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.334: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.335: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57 Source.336: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic Source.337: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.338: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.339: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.340: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.341: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.342: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.343: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1 Source.344: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.345: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.346: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.347: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.348: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.349: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.350: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.351: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.352: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.353: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1 Source.354: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.355: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.356: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.357: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.358: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.359: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.360: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.361: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.362: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.363: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.364: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.365: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.366: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6 Source.367: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.368: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.369: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.370: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.371: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13 Source.372: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.373: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.374: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.375: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.376: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.377: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3 Source.378: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.379: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.380: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.381: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.382: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.383: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.384: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5 Source.385: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.386: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.387: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.388: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1 Source.389: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A Source.390: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.391: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.392: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.393: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.394: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.395: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.396: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6 Source.397: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.398: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100 Source.399: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10 Source.400: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic Source.401: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.402: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.403: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.404: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2 Source.405: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.406: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.407: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.408: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.409: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3 Source.410: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic Source.411: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56 Source.412: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.413: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.414: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.415: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.416: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.417: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.418: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.419: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.420: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.421: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.422: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.423: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1 Source.424: DFBPPR2526 ---- Plant proteins ---- Chitinase 10 Source.425: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.426: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.427: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5 Source.428: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.429: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.430: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.431: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.432: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27 Source.433: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.434: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.435: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.436: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.437: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.438: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6 Source.439: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.440: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a Source.441: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1 Source.442: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.443: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.444: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.445: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2 Source.446: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.447: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.448: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1 Source.449: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial Source.450: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34 Source.451: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24 Source.452: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.453: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.454: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.455: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.456: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.457: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.458: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.459: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic Source.460: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.461: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.462: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.463: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11 Source.464: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.465: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.466: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.467: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.468: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6 Source.469: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5 Source.470: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.471: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.472: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.473: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.474: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.475: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.476: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.477: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.478: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.479: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.480: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.481: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3 Source.482: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1 Source.483: DFBPPR2825 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.484: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.485: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.486: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.487: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.488: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.489: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4 Source.490: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103 Source.491: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131 Source.492: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.493: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.494: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.495: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.496: DFBPPR2889 ---- Plant proteins ---- Monothiol glutaredoxin-S1, mitochondrial Source.497: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6 Source.498: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2 Source.499: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.500: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7 Source.501: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.502: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.503: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.504: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5 Source.505: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.506: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.507: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.508: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4 Source.509: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.510: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.511: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.512: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.513: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.514: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.515: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.516: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.517: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.518: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.519: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.520: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.521: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.522: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.523: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.524: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.525: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.526: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.527: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.528: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.529: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.530: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.531: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.532: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.533: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1 Source.534: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2 Source.535: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.536: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.537: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.538: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.539: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.540: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.541: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.542: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.543: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.544: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.545: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.546: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6 Source.547: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.548: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.549: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2 Source.550: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.551: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.552: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.553: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.554: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3 Source.555: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11 Source.556: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.557: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.558: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.559: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.560: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300 Source.561: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27 Source.562: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.563: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.564: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.565: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.566: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.567: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4 Source.568: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.569: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.570: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.571: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS Source.572: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.573: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.574: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.575: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21 Source.576: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400 Source.577: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.578: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4 Source.579: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.580: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1 Source.581: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.582: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.583: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.584: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3 Source.585: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.586: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.587: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.588: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.589: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.590: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.591: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic Source.592: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.593: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19 Source.594: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14 Source.595: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.596: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2 Source.597: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.598: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.599: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.600: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.601: DFBPPR3392 ---- Plant proteins ---- Auxin-responsive protein IAA9 Source.602: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20 Source.603: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7 Source.604: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.605: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.606: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12 Source.607: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3 Source.608: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1 Source.609: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.610: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2 Source.611: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1 Source.612: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15 Source.613: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.614: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.615: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.616: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.617: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.618: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.619: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1 Source.620: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.621: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.622: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17 Source.623: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.624: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600 Source.625: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31 Source.626: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32 Source.627: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.628: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.629: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.630: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog Source.631: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.632: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.633: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4 Source.634: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.635: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.636: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56 Source.637: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4 Source.638: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial Source.639: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.640: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.641: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.642: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.643: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3 Source.644: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.645: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3 Source.646: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4 Source.647: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.648: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.649: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61 Source.650: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.651: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5 Source.652: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17 Source.653: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.654: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3 Source.655: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial Source.656: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10 Source.657: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24 Source.658: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11 Source.659: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.660: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1 Source.661: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.662: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic Source.663: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.664: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.665: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.666: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.667: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.668: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.669: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.670: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.671: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25 Source.672: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.673: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.674: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.675: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23 Source.676: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.677: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.678: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.679: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.680: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.681: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.682: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.683: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8 Source.684: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.685: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.686: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.687: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1 Source.688: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30 Source.689: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.690: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.691: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2 Source.692: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16 Source.693: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial Source.694: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1 Source.695: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.696: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.697: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B Source.698: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein Source.699: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2 Source.700: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.701: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.702: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.703: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.704: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.705: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2 Source.706: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13 Source.707: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13 Source.708: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.709: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.710: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.711: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.712: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.713: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.714: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.715: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31 Source.716: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.717: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3 Source.718: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.719: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.720: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.721: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.722: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1 Source.723: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.724: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13 Source.725: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2 Source.726: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.727: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.728: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.729: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.730: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.731: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.732: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.733: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.734: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2 Source.735: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.736: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.737: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.738: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.739: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.740: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.741: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.742: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.743: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.744: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58 Source.745: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.746: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3 Source.747: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.748: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.749: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.750: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.751: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.752: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5 Source.753: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.754: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.755: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.756: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.757: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.758: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.759: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.760: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B Source.761: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic Source.762: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.763: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.764: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4 Source.765: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.766: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.767: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43 Source.768: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.769: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.770: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.771: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.772: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.773: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600 Source.774: DFBPPR4140 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3, chloroplastic Source.775: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.776: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.777: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.778: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.779: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.780: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.781: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.782: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.783: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.784: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.785: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.786: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.787: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.788: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.789: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.790: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.791: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.792: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.793: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5 Source.794: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.795: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.796: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.797: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2 Source.798: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.799: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2 Source.800: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4 Source.801: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.802: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.803: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3 Source.804: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1 Source.805: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6 Source.806: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.807: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21 Source.808: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.809: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.810: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like Source.811: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.812: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1 Source.813: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.814: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1 Source.815: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.816: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic Source.817: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5 Source.818: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.819: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.820: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.821: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.822: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2 Source.823: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5 Source.824: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.825: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5 Source.826: DFBPPR4413 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 4 Source.827: DFBPPR4417 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 3 Source.828: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.829: DFBPPR4420 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 1 Source.830: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.831: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.832: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.833: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.834: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1 Source.835: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.836: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.837: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.838: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.839: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.840: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3 Source.841: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.842: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13 Source.843: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial Source.844: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.845: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.846: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2 Source.847: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.848: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.849: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.850: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.851: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.852: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.853: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein Source.854: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.855: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.856: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6 Source.857: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme Source.858: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.859: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.860: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2 Source.861: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5 Source.862: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.863: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.864: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.865: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.866: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14 Source.867: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7 Source.868: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12 Source.869: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.870: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.871: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10 Source.872: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.873: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4 Source.874: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.875: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.876: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.877: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9 Source.878: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.879: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2 Source.880: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3 Source.881: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.882: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1 Source.883: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3 Source.884: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1 Source.885: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.886: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.887: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1 Source.888: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3 Source.889: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.890: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein Source.891: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial Source.892: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8 Source.893: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.894: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11 Source.895: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.896: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.897: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.898: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.899: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.900: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H Source.901: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.902: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1 Source.903: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.904: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1 Source.905: DFBPPR4800 ---- Plant proteins ---- Protein BUD31 homolog 2 Source.906: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000 Source.907: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.908: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700 Source.909: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20 Source.910: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2 Source.911: DFBPPR4829 ---- Plant proteins ---- Protein BUD31 homolog 3 Source.912: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.913: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5 Source.914: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400 Source.915: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.916: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.917: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.918: DFBPPR4876 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 3 Source.919: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.920: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.921: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.922: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4 Source.923: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.924: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.925: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog Source.926: DFBPPR4898 ---- Plant proteins ---- Serine racemase Source.927: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.928: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.929: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase Source.930: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1 Source.931: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.932: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.933: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.934: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.935: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.936: DFBPPR4915 ---- Plant proteins ---- Chitinase 2 Source.937: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1 Source.938: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.939: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.940: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1 Source.941: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.942: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.943: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.944: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30 Source.945: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.946: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2 Source.947: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.948: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic Source.949: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.950: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.951: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.952: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.953: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G Source.954: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.955: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.956: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.957: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.958: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1 Source.959: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.960: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1 Source.961: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1 Source.962: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.963: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.964: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.965: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.966: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.967: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5 Source.968: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.969: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase Source.970: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.971: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.972: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase Source.973: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.974: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.975: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.976: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.977: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.978: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1 Source.979: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.980: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.981: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.982: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.983: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.984: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.985: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2 Source.986: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.987: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.988: DFBPPR5091 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.989: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.990: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic Source.991: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic Source.992: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.993: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7 Source.994: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2 Source.995: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580 Source.996: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2 Source.997: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1 Source.998: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.999: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1 Source.1000: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein Source.1001: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.1002: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1 Source.1003: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.1004: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1005: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.1006: DFBPPR5198 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.1007: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.1008: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1009: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.1010: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.1011: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1012: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.1013: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.1014: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.1015: DFBPPR5249 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1016: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.1017: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3 Source.1018: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22 Source.1019: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.1020: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28 Source.1021: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.1022: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA Source.1023: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.1024: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1 Source.1025: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2 Source.1026: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.1027: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a Source.1028: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.1029: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.1030: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.1031: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1 Source.1032: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.1033: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.1034: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.1035: DFBPPR5393 ---- Plant proteins ---- Endochitinase A Source.1036: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.1037: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.1038: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.1039: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.1040: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1 Source.1041: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.1042: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.1043: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.1044: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.1045: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.1046: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.1047: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog Source.1048: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.1049: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.1050: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.1051: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.1052: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.1053: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.1054: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.1055: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.1056: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor Source.1057: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.1058: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.1059: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1 Source.1060: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.1061: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.1062: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.1063: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.1064: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.1065: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.1066: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.1067: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.1068: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.1069: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1070: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.1071: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.1072: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.1073: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1 Source.1074: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.1075: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.1076: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.1077: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.1078: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.1079: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.1080: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A Source.1081: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6 Source.1082: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1083: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.1084: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.1085: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1086: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.1087: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.1088: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.1089: DFBPPR5670 ---- Plant proteins ---- Endochitinase B Source.1090: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3 Source.1091: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.1092: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5 Source.1093: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.1094: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1 Source.1095: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.1096: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4 Source.1097: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1098: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5 Source.1099: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2 Source.1100: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.1101: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2 Source.1102: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.1103: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.1104: DFBPPR5752 ---- Plant proteins ---- 60S acidic ribosomal protein P1 Source.1105: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform Source.1106: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1 Source.1107: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1108: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.1109: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.1110: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.1111: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1112: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1113: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.1114: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.1115: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1 Source.1116: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.1117: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.1118: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.1119: DFBPPR5837 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1120: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.1121: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.1122: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.1123: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.1124: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P Source.1125: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.1126: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1127: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.1128: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.1129: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1130: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.1131: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic Source.1132: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.1133: DFBPPR5924 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.1134: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2 Source.1135: DFBPPR5955 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-2, chloroplastic Source.1136: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1137: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.1138: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.1139: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5 Source.1140: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.1141: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.1142: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.1143: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.1144: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3 Source.1145: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1 Source.1146: DFBPPR6055 ---- Plant proteins ---- 14 kDa zinc-binding protein Source.1147: DFBPPR6059 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.1148: DFBPPR6060 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.1149: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.1150: DFBPPR6064 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.1151: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.1152: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.1153: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17 Source.1154: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.1155: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein Source.1156: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1157: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.1158: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.1159: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.1160: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.1161: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1162: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.1163: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.1164: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic Source.1165: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1166: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2 Source.1167: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.1168: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.1169: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.1170: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1171: DFBPPR6310 ---- Plant proteins ---- Catalase Source.1172: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.1173: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic Source.1174: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.1175: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.1176: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.1177: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.1178: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.1179: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.1180: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic Source.1181: DFBPPR6355 ---- Plant proteins ---- Endochitinase Source.1182: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic Source.1183: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.1184: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.1185: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic Source.1186: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.1187: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1188: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4 Source.1189: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.1190: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A Source.1191: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme Source.1192: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B Source.1193: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.1194: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase Source.1195: DFBPPR6464 ---- Plant proteins ---- 50S ribosomal protein 5, chloroplastic Source.1196: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.1197: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1 Source.1198: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.1199: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1 Source.1200: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.1201: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein Source.1202: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.1203: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6 Source.1204: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1205: DFBPPR6526 ---- Plant proteins ---- Albumin-2 Source.1206: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase Source.1207: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1208: DFBPPR6640 ---- Plant proteins ---- Puroindoline-B Source.1209: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D Source.1210: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.1211: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase Source.1212: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.1213: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8 Source.1214: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic Source.1215: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A Source.1216: DFBPPR6656 ---- Plant proteins ---- Catalase Source.1217: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.1218: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.1219: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8 Source.1220: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B Source.1221: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A Source.1222: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3 Source.1223: DFBPPR6684 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor WSCI Source.1224: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.1225: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1226: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1 Source.1227: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.1228: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.1229: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B Source.1230: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.1231: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.1232: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D Source.1233: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.1234: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.1235: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2 Source.1236: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3 Source.1237: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1238: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.1239: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic Source.1240: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic Source.1241: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.1242: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1243: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1244: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.1245: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1246: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1247: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1248: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.1249: DFBPPR6895 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor Source.1250: DFBPPR6897 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1251: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin Source.1252: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B Source.1253: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin Source.1254: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin Source.1255: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2 Source.1256: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.1257: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1 Source.1258: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.1259: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.1260: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic Source.1261: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.1262: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1263: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.1264: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1 Source.1265: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.1266: DFBPPR7032 ---- Plant proteins ---- Hordoindoline-B2 Source.1267: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.1268: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2 Source.1269: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1270: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.1271: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII Source.1272: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.1273: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.1274: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.1275: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3 Source.1276: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1277: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI Source.1278: DFBPPR7069 ---- Plant proteins ---- Hordoindoline-B1 Source.1279: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase Source.1280: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.1281: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1282: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.1283: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2 Source.1284: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.1285: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.1286: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1287: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2 Source.1288: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.1289: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase Source.1290: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.1291: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.1292: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.1293: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII Source.1294: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.1295: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1 Source.1296: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1297: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.1298: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.1299: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.1300: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1301: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1302: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.1303: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.1304: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.1305: DFBPPR7168 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.1306: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.1307: DFBPPR7175 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2A Source.1308: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.1309: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI Source.1310: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic Source.1311: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.1312: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1313: DFBPPR7215 ---- Plant proteins ---- Aldose reductase Source.1314: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.1315: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.1316: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1317: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase Source.1318: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A Source.1319: DFBPPR7274 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1B Source.1320: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C Source.1321: DFBPPR7277 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2B Source.1322: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic Source.1323: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.1324: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R Source.1325: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1 Source.1326: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C Source.1327: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B Source.1328: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2 Source.1329: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.1330: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.1331: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4 Source.1332: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase Source.1333: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1334: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.1335: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic Source.1336: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1337: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.1338: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.1339: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25 Source.1340: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1 Source.1341: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.1342: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.1343: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1344: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.1345: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.1346: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.1347: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.1348: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.1349: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.1350: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.1351: DFBPPR7618 ---- Milk proteins ---- Plasminogen Source.1352: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.1353: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.1354: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.1355: DFBPPR7630 ---- Milk proteins ---- Folate receptor alpha Source.1356: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.1357: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.1358: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1359: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1360: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.1361: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein Source.1362: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein Source.1363: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1364: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein Source.1365: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.1366: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1367: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.1368: DFBPPR7737 ---- Plant proteins ---- Endochitinase Source.1369: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4 Source.1370: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2 Source.1371: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1 Source.1372: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3 Source.1373: DFBPPR7749 ---- Plant proteins ---- Avenin Source.1374: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.1375: DFBPPR8198 ---- Plant proteins ---- Inhibitor of trypsin and hageman factor Source.1376: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.1377: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1378: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.1379: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.1380: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.1381: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1382: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase Source.1383: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.1384: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.1385: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2 Source.1386: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1387: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.1388: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C Source.1389: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A Source.1390: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.1391: DFBPPR8458 ---- Plant proteins ---- Catalase Source.1392: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.1393: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1394: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.1395: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.1396: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.1397: DFBPPR15935 ---- Animal proteins ---- Catalase Source.1398: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E Source.1399: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.1400: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.1401: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.1402: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1403: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1404: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1405: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1406: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.1407: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1408: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1 Source.1409: DFBPPR15973 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5 Source.1410: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.1411: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase Source.1412: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1413: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.1414: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2 Source.1415: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.1416: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1417: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.1418: DFBPPR16006 ---- Animal proteins ---- Leptin Source.1419: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.1420: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.1421: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.1422: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1423: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.1424: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1425: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.1426: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.1427: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1428: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2 Source.1429: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1430: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3 Source.1431: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1432: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase Source.1433: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1434: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4 Source.1435: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.1436: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1437: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO Source.1438: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.1439: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1440: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1441: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.1442: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1443: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.1444: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1445: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.1446: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1447: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.1448: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.1449: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.1450: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.1451: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.1452: DFBPPR16190 ---- Animal proteins ---- Aprataxin Source.1453: DFBPPR16191 ---- Animal proteins ---- Somatotropin Source.1454: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.1455: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.1456: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.1457: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1458: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1459: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type Source.1460: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.1461: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1462: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2 Source.1463: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1464: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1465: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.1466: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.1467: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.1468: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type Source.1469: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.1470: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.1471: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.1472: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin Source.1473: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1474: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.1475: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.1476: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor Source.1477: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.1478: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.1479: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.1480: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.1481: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1482: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2 Source.1483: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain Source.1484: DFBPPR16341 ---- Animal proteins ---- Calmegin Source.1485: DFBPPR16368 ---- Animal proteins ---- Tyrosinase Source.1486: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.1487: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.1488: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1489: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.1490: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1491: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.1492: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.1493: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.1494: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain Source.1495: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor Source.1496: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1497: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1 Source.1498: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1499: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1500: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4 Source.1501: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase Source.1502: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2 Source.1503: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1 Source.1504: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.1505: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1 Source.1506: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor Source.1507: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.1508: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.1509: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor Source.1510: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.1511: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.1512: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.1513: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.1514: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.1515: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1516: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.1517: DFBPPR16594 ---- Animal proteins ---- Macoilin Source.1518: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.1519: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype Source.1520: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.1521: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1522: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.1523: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H Source.1524: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1525: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5 Source.1526: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.1527: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1 Source.1528: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein Source.1529: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1530: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.1531: DFBPPR16703 ---- Animal proteins ---- Beta-defensin 119 Source.1532: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1533: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.1534: DFBPPR16750 ---- Animal proteins ---- 60S ribosomal protein L23 Source.1535: DFBPPR16751 ---- Animal proteins ---- Small integral membrane protein 12 Source.1536: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.1537: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.1538: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.1539: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.1540: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A Source.1541: DFBPPR16810 ---- Animal proteins ---- Cathepsin B Source.1542: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1 Source.1543: DFBPPR16835 ---- Animal proteins ---- Insulin Source.1544: DFBPPR16838 ---- Animal proteins ---- Leptin Source.1545: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1546: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain Source.1547: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.1548: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.1549: DFBPPR16863 ---- Animal proteins ---- Biglycan Source.1550: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.1551: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1552: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.1553: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.1554: DFBPPR16877 ---- Animal proteins ---- Peptidoglycan recognition protein 1 Source.1555: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.1556: DFBPPR16919 ---- Animal proteins ---- VIP peptides Source.1557: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.1558: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1559: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1560: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor Source.1561: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.1562: DFBPPR16937 ---- Animal proteins ---- GTP:AMP phosphotransferase AK3, mitochondrial Source.1563: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1564: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1565: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1566: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.1567: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1568: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.1569: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.1570: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.1571: DFBPPR16960 ---- Animal proteins ---- Catalase Source.1572: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.1573: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.1574: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor Source.1575: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.1576: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.1577: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3 Source.1578: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase Source.1579: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.1580: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1581: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.1582: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1 Source.1583: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.1584: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.1585: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1586: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.1587: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.1588: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor Source.1589: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1590: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.1591: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D Source.1592: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta Source.1593: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin Source.1594: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.1595: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.1596: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1597: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.1598: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.1599: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2 Source.1600: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.1601: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.1602: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.1603: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.1604: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.1605: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.1606: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.1607: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.1608: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.1609: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.1610: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.1611: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7 Source.1612: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.1613: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1614: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1615: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.1616: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1617: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1618: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha Source.1619: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.1620: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase Source.1621: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1622: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1623: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial Source.1624: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.1625: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1 Source.1626: DFBPPR17280 ---- Animal proteins ---- Serine racemase Source.1627: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.1628: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2 Source.1629: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B Source.1630: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.1631: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.1632: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.1633: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.1634: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.1635: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.1636: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1637: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.1638: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.1639: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.1640: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1641: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.1642: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.1643: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.1644: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.1645: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.1646: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.1647: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.1648: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.1649: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6 Source.1650: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.1651: DFBPPR17379 ---- Animal proteins ---- Dematin Source.1652: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1 Source.1653: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5 Source.1654: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.1655: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.1656: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.1657: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.1658: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.1659: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.1660: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1661: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.1662: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5 Source.1663: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein Source.1664: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.1665: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.1666: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1667: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.1668: DFBPPR17447 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5 Source.1669: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.1670: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1671: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.1672: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.1673: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase Source.1674: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.1675: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain Source.1676: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.1677: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.1678: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.1679: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b Source.1680: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.1681: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.1682: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1683: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.1684: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5 Source.1685: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1686: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.1687: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta Source.1688: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.1689: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2 Source.1690: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.1691: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.1692: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.1693: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1694: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.1695: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.1696: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein Source.1697: DFBPPR17647 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1 Source.1698: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12 Source.1699: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1700: DFBPPR17679 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.1701: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial Source.1702: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1703: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.1704: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.1705: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10 Source.1706: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform Source.1707: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1 Source.1708: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5 Source.1709: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.1710: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.1711: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.1712: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.1713: DFBPPR17786 ---- Animal proteins ---- Cathelicidin-4 Source.1714: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.1715: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1716: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase Source.1717: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.1718: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1719: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2 Source.1720: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.1721: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.1722: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3 Source.1723: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1724: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.1725: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1726: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.1727: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1728: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.1729: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.1730: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.1731: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1 Source.1732: DFBPPR17883 ---- Animal proteins ---- Sialidase-1 Source.1733: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.1734: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1735: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.1736: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.1737: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.1738: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1739: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1740: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.1741: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.1742: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.1743: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG Source.1744: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.1745: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.1746: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.1747: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.1748: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3 Source.1749: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2 Source.1750: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1751: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.1752: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.1753: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.1754: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.1755: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein Source.1756: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.1757: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase Source.1758: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.1759: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta Source.1760: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 Source.1761: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3 Source.1762: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1763: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1764: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8 Source.1765: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1766: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1767: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial Source.1768: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.1769: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor Source.1770: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta Source.1771: DFBPPR18100 ---- Animal proteins ---- Derlin-1 Source.1772: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.1773: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1774: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23 Source.1775: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.1776: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1777: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.1778: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.1779: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase Source.1780: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C Source.1781: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.1782: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.1783: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.1784: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.1785: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.1786: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.1787: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.1788: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.1789: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6 Source.1790: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1791: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1 Source.1792: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8 Source.1793: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.1794: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.1795: DFBPPR18242 ---- Animal proteins ---- Heparanase Source.1796: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase Source.1797: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.1798: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.1799: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.1800: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.1801: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.1802: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1803: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10 Source.1804: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.1805: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein Source.1806: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1807: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A Source.1808: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.1809: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.1810: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.1811: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.1812: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1813: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1814: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.1815: DFBPPR18407 ---- Animal proteins ---- DNA damage-inducible transcript 4 protein Source.1816: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.1817: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.1818: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.1819: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.1820: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1821: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.1822: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.1823: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.1824: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.1825: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.1826: DFBPPR18470 ---- Animal proteins ---- Perilipin-5 Source.1827: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1 Source.1828: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.1829: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.1830: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.1831: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.1832: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.1833: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.1834: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6 Source.1835: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.1836: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.1837: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.1838: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.1839: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.1840: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1 Source.1841: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.1842: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.1843: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.1844: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1845: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.1846: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1847: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.1848: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.1849: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.1850: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type Source.1851: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4 Source.1852: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor Source.1853: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase Source.1854: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor Source.1855: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1856: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor Source.1857: DFBPPR18728 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5 Source.1858: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1859: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.1860: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.1861: DFBPPR18743 ---- Animal proteins ---- Sperm-egg fusion protein TMEM95 Source.1862: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase Source.1863: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.1864: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1865: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.1866: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1 Source.1867: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.1868: DFBPPR18779 ---- Animal proteins ---- Mucin-15 Source.1869: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.1870: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.1871: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.1872: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.1873: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1 Source.1874: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1875: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2 Source.1876: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase Source.1877: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1878: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.1879: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type Source.1880: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.1881: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1882: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.1883: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor Source.1884: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.1885: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1886: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.1887: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.1888: DFBPPR18904 ---- Animal proteins ---- Protein KASH5 Source.1889: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5 Source.1890: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.1891: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.1892: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Source.1893: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.1894: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.1895: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma Source.1896: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1897: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.1898: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.1899: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1 Source.1900: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.1901: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5 Source.1902: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Source.1903: DFBPPR18995 ---- Animal proteins ---- Tektin-3 Source.1904: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.1905: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1906: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.1907: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.1908: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic Source.1909: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.1910: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.1911: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial Source.1912: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.1913: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.1914: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.1915: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.1916: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2 Source.1917: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.1918: DFBPPR19100 ---- Animal proteins ---- Interleukin-34 Source.1919: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.1920: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.1921: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1922: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.1923: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.1924: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.1925: DFBPPR19164 ---- Animal proteins ---- RNA-binding protein with serine-rich domain 1 Source.1926: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.1927: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3 Source.1928: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1929: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.1930: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.1931: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639 Source.1932: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2 Source.1933: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7 Source.1934: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.1935: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.1936: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1937: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase Source.1938: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.1939: DFBPPR19247 ---- Animal proteins ---- Calmegin Source.1940: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.1941: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1942: DFBPPR19253 ---- Animal proteins ---- Limbin Source.1943: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28 Source.1944: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.1945: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1 Source.1946: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.1947: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.1948: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.1949: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5 Source.1950: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic Source.1951: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial Source.1952: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial Source.1953: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.1954: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1955: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase Source.1956: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.1957: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1958: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9 Source.1959: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3 Source.1960: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.1961: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.1962: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.1963: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1964: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6 Source.1965: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein Source.1966: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog Source.1967: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3 Source.1968: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2 Source.1969: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.1970: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1971: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1972: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.1973: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.1974: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.1975: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1976: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.1977: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4 Source.1978: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2 Source.1979: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5 Source.1980: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.1981: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.1982: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.1983: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.1984: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein Source.1985: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3 Source.1986: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.1987: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.1988: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.1989: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.1990: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.1991: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.1992: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.1993: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.1994: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.1995: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2 Source.1996: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2 Source.1997: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1 Source.1998: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.1999: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C Source.2000: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein Source.2001: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.2002: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.2003: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.2004: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.2005: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2 Source.2006: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.2007: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2 Source.2008: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.2009: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B Source.2010: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1 Source.2011: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.2012: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.2013: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.2014: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.2015: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.2016: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1 Source.2017: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.2018: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.2019: DFBPPR19738 ---- Animal proteins ---- Translocator protein Source.2020: DFBPPR19748 ---- Animal proteins ---- 60S ribosomal protein L23 Source.2021: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.2022: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1 Source.2023: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13 Source.2024: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog Source.2025: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1 Source.2026: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit Source.2027: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.2028: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.2029: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.2030: DFBPPR19807 ---- Animal proteins ---- Spermine synthase Source.2031: DFBPPR19810 ---- Animal proteins ---- Seipin Source.2032: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.2033: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.2034: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.2035: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.2036: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.2037: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial Source.2038: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.2039: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.2040: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.2041: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.2042: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3 Source.2043: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8 Source.2044: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.2045: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta Source.2046: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.2047: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.2048: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.2049: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog Source.2050: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2 Source.2051: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1 Source.2052: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein Source.2053: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.2054: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.2055: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.2056: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor Source.2057: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.2058: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.2059: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7 Source.2060: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2 Source.2061: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.2062: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase Source.2063: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.2064: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR Source.2065: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.2066: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase Source.2067: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.2068: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase Source.2069: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5 Source.2070: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.2071: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.2072: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26 Source.2073: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.2074: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.2075: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.2076: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.2077: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23 Source.2078: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.2079: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a Source.2080: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase Source.2081: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.2082: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.2083: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.2084: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7 Source.2085: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial Source.2086: DFBPPR20223 ---- Animal proteins ---- Protein cereblon Source.2087: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B Source.2088: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein Source.2089: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.2090: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan Source.2091: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3 Source.2092: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A Source.2093: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.2094: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.2095: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1 Source.2096: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4 Source.2097: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.2098: DFBPPR20292 ---- Animal proteins ---- Caltrin Source.2099: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN Source.2100: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.2101: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial Source.2102: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.2103: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2 Source.2104: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.2105: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.2106: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2107: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.2108: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3 Source.2109: DFBPPR20341 ---- Animal proteins ---- Peptide YY Source.2110: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.2111: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2 Source.2112: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.2113: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.2114: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3 Source.2115: DFBPPR20365 ---- Animal proteins ---- Interleukin-21 Source.2116: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.2117: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial Source.2118: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.2119: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.2120: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1 Source.2121: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.2122: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1 Source.2123: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.2124: DFBPPR20401 ---- Animal proteins ---- Bystin Source.2125: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.2126: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial Source.2127: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial Source.2128: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein Source.2129: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase Source.2130: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.2131: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.2132: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4 Source.2133: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.2134: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3 Source.2135: DFBPPR20453 ---- Animal proteins ---- Cysteine dioxygenase type 1 Source.2136: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8 Source.2137: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.2138: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP Source.2139: DFBPPR20478 ---- Animal proteins ---- Macoilin Source.2140: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.2141: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog Source.2142: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102 Source.2143: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29 Source.2144: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial Source.2145: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.2146: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.2147: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6 Source.2148: DFBPPR20560 ---- Animal proteins ---- Draxin Source.2149: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase Source.2150: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.2151: DFBPPR20570 ---- Animal proteins ---- Intraflagellar transport protein 22 homolog Source.2152: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.2153: DFBPPR20585 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 3 Source.2154: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Source.2155: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.2156: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1 Source.2157: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.2158: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6 Source.2159: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.2160: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase Source.2161: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.2162: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13 Source.2163: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.2164: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1 Source.2165: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2 Source.2166: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.2167: DFBPPR20644 ---- Animal proteins ---- Dynein regulatory complex protein 9 Source.2168: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A Source.2169: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2170: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain Source.2171: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.2172: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.2173: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2 Source.2174: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.2175: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.2176: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12 Source.2177: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.2178: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.2179: DFBPPR20728 ---- Animal proteins ---- Serine protease 45 Source.2180: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5 Source.2181: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.2182: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2 Source.2183: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14 Source.2184: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein Source.2185: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.2186: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.2187: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17 Source.2188: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.2189: DFBPPR20809 ---- Animal proteins ---- F-box and leucine-rich protein 22 Source.2190: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.2191: DFBPPR20838 ---- Animal proteins ---- Cytochrome c oxidase subunit 6B2 Source.2192: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.2193: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.2194: DFBPPR20853 ---- Animal proteins ---- Hemopexin Source.2195: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial Source.2196: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta Source.2197: DFBPPR20867 ---- Animal proteins ---- Protein BUD31 homolog Source.2198: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.2199: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.2200: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna Source.2201: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1 Source.2202: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog Source.2203: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3 Source.2204: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2205: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.2206: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2207: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8 Source.2208: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4 Source.2209: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.2210: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B Source.2211: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2212: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.2213: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.2214: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial Source.2215: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.2216: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1 Source.2217: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.2218: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.2219: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26 Source.2220: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.2221: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1 Source.2222: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C Source.2223: DFBPPR21034 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 25 Source.2224: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.2225: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.2226: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2 Source.2227: DFBPPR21060 ---- Animal proteins ---- Signal peptidase complex subunit 1 Source.2228: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma Source.2229: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.2230: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.2231: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7 Source.2232: DFBPPR21100 ---- Animal proteins ---- Cochlin Source.2233: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.2234: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial Source.2235: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.2236: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B Source.2237: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor Source.2238: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22 Source.2239: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.2240: DFBPPR21187 ---- Animal proteins ---- Plasmolipin Source.2241: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.2242: DFBPPR21203 ---- Animal proteins ---- Nuclear protein 2 Source.2243: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4 Source.2244: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog Source.2245: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.2246: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.2247: DFBPPR21232 ---- Animal proteins ---- Cerebellin-3 Source.2248: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198 Source.2249: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2 Source.2250: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B Source.2251: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.2252: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.2253: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2 Source.2254: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen Source.2255: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial Source.2256: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.2257: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.2258: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial Source.2259: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.2260: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18 Source.2261: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115 Source.2262: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.2263: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C Source.2264: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3 Source.2265: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158 Source.2266: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.2267: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.2268: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.2269: DFBPPR21376 ---- Animal proteins ---- Calponin-3 Source.2270: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.2271: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.2272: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2 Source.2273: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.2274: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.2275: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.2276: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84 Source.2277: DFBPPR21428 ---- Animal proteins ---- Protein LBH Source.2278: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform Source.2279: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.2280: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2 Source.2281: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B Source.2282: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4 Source.2283: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A Source.2284: DFBPPR21454 ---- Animal proteins ---- Cyclin-dependent kinase 2-interacting protein Source.2285: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.2286: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A Source.2287: DFBPPR21465 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD Source.2288: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.2289: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.2290: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1 Source.2291: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.2292: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1 Source.2293: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14 Source.2294: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18 Source.2295: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.2296: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.2297: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.2298: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.2299: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1 Source.2300: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1 Source.2301: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225 Source.2302: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23 Source.2303: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1 Source.2304: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2 Source.2305: DFBPPR21580 ---- Animal proteins ---- Density-regulated protein Source.2306: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1 Source.2307: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2308: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.2309: DFBPPR21603 ---- Animal proteins ---- Beta-defensin 119 Source.2310: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork Source.2311: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.2312: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.2313: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a Source.2314: DFBPPR21624 ---- Animal proteins ---- Docking protein 1 Source.2315: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14 Source.2316: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1 Source.2317: DFBPPR21644 ---- Animal proteins ---- Mpv17-like protein 2 Source.2318: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.2319: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein Source.2320: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.2321: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.2322: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.2323: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.2324: DFBPPR21683 ---- Animal proteins ---- Serine protease 23 Source.2325: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like Source.2326: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B Source.2327: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.2328: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.2329: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.2330: DFBPPR21728 ---- Animal proteins ---- Galectin-9 Source.2331: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A Source.2332: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.2333: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.2334: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.2335: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.2336: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.2337: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog Source.2338: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B Source.2339: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog Source.2340: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.2341: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.2342: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2 Source.2343: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410 Source.2344: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7 Source.2345: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2 Source.2346: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD Source.2347: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17 Source.2348: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.2349: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.2350: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.2351: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial Source.2352: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein Source.2353: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.2354: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein Source.2355: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1 Source.2356: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2 Source.2357: DFBPPR21938 ---- Animal proteins ---- Protein RER1 Source.2358: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1 Source.2359: DFBPPR21959 ---- Animal proteins ---- DDB1- and CUL4-associated factor 16 Source.2360: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.2361: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog Source.2362: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1 Source.2363: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101 Source.2364: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog Source.2365: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1 Source.2366: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.2367: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8 Source.2368: DFBPPR21987 ---- Animal proteins ---- Ribonuclease H2 subunit C Source.2369: DFBPPR21994 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial Source.2370: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E Source.2371: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.2372: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.2373: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein Source.2374: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.2375: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.2376: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.2377: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.2378: DFBPPR22048 ---- Animal proteins ---- Regulated endocrine-specific protein 18 Source.2379: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.2380: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.2381: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial Source.2382: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.2383: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.2384: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1 Source.2385: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.2386: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4 Source.2387: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.2388: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.2389: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2 Source.2390: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.2391: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2 Source.2392: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.2393: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.2394: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1 Source.2395: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.2396: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.2397: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143 Source.2398: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.2399: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8 Source.2400: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5 Source.2401: DFBPPR22190 ---- Animal proteins ---- Protein NKG7 Source.2402: DFBPPR22204 ---- Animal proteins ---- Ubiquitin-like protein 3 Source.2403: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B Source.2404: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog Source.2405: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.2406: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3 Source.2407: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9 Source.2408: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.2409: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.2410: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.2411: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.2412: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26 Source.2413: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.2414: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.2415: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2 Source.2416: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5 Source.2417: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1 Source.2418: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17 Source.2419: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B Source.2420: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1 Source.2421: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.2422: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2 Source.2423: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.2424: DFBPPR22323 ---- Animal proteins ---- Meiosis expressed gene 1 protein homolog Source.2425: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.2426: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.2427: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.2428: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.2429: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog Source.2430: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6 Source.2431: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.2432: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.2433: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.2434: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like Source.2435: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein Source.2436: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B Source.2437: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5 Source.2438: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2439: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog Source.2440: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog Source.2441: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.2442: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B Source.2443: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3 Source.2444: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2 Source.2445: DFBPPR22461 ---- Animal proteins ---- Ashwin Source.2446: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.2447: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.2448: DFBPPR22475 ---- Animal proteins ---- Small integral membrane protein 12 Source.2449: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.2450: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144 Source.2451: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1 Source.2452: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B Source.2453: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C Source.2454: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15 Source.2455: DFBPPR22534 ---- Animal proteins ---- Protein FAM162B Source.2456: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.2457: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.2458: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25 Source.2459: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.2460: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3 Source.2461: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B Source.2462: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187 Source.2463: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog Source.2464: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5 Source.2465: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1 Source.2466: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.2467: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.2468: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog Source.2469: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A Source.2470: DFBPPR22605 ---- Animal proteins ---- Transmembrane protein 254 Source.2471: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215 Source.2472: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B Source.2473: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61 Source.2474: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.2475: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65 Source.2476: DFBPPR22662 ---- Animal proteins ---- Uncharacterized protein C11orf94 homolog Source.2477: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.2478: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog Source.2479: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein Source.2480: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32 Source.2481: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.2482: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.2483: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B Source.2484: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.2485: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A Source.2486: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.2487: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein Source.2488: DFBPPR22722 ---- Animal proteins ---- Uncharacterized protein C11orf91 homolog Source.2489: DFBPPR22725 ---- Animal proteins ---- Uncharacterized protein C4orf46 homolog Source.2490: DFBPPR22726 ---- Animal proteins ---- Uncharacterized protein C16orf90 homolog Source.2491: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog Source.2492: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog Source.2493: DFBPPR22739 ---- Animal proteins ---- Testis, prostate and placenta-expressed protein Source.2494: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein Source.2495: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog Source.2496: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog Source.2497: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog Source.2498: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog Source.2499: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog Source.2500: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2501: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.2502: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.2503: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.2504: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.2505: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.2506: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2507: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase Source.2508: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.2509: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.2510: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.2511: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.2512: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.2513: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1 Source.2514: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.2515: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1 Source.2516: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.2517: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B Source.2518: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.2519: DFBPPR8588 ---- Animal proteins ---- Leptin Source.2520: DFBPPR8598 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5 Source.2521: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.2522: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2 Source.2523: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.2524: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.2525: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.2526: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase Source.2527: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.2528: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.2529: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.2530: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.2531: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.2532: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.2533: DFBPPR8649 ---- Animal proteins ---- Acrosin Source.2534: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.2535: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A Source.2536: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.2537: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.2538: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog Source.2539: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.2540: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.2541: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.2542: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.2543: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.2544: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.2545: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53 Source.2546: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.2547: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.2548: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.2549: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.2550: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.2551: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.2552: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.2553: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1 Source.2554: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.2555: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.2556: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.2557: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.2558: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2559: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.2560: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.2561: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.2562: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2563: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.2564: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2565: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.2566: DFBPPR8792 ---- Animal proteins ---- Plasminogen Source.2567: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.2568: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase Source.2569: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase Source.2570: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.2571: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.2572: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2573: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase Source.2574: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog Source.2575: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2 Source.2576: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B Source.2577: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.2578: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.2579: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2580: DFBPPR8906 ---- Animal proteins ---- Sialidase-1 Source.2581: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.2582: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.2583: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.2584: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.2585: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.2586: DFBPPR8983 ---- Animal proteins ---- Receptor activity-modifying protein 1 Source.2587: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2588: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.2589: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.2590: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.2591: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.2592: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2 Source.2593: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.2594: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.2595: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.2596: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.2597: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.2598: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.2599: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3 Source.2600: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1 Source.2601: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.2602: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.2603: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.2604: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.2605: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.2606: DFBPPR9093 ---- Animal proteins ---- Hemopexin Source.2607: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5 Source.2608: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.2609: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.2610: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.2611: DFBPPR9113 ---- Animal proteins ---- Prophenin and tritrpticin precursor Source.2612: DFBPPR9116 ---- Animal proteins ---- Cathepsin B Source.2613: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.2614: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2615: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2616: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.2617: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.2618: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1 Source.2619: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.2620: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.2621: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.2622: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.2623: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2624: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.2625: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.2626: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2627: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein Source.2628: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.2629: DFBPPR9199 ---- Animal proteins ---- 60S ribosomal protein L23 Source.2630: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2631: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2632: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10 Source.2633: DFBPPR9212 ---- Animal proteins ---- Dihydrofolate reductase Source.2634: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1 Source.2635: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.2636: DFBPPR9221 ---- Animal proteins ---- Catalase Source.2637: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta Source.2638: DFBPPR9239 ---- Animal proteins ---- Prophenin-2 Source.2639: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29 Source.2640: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9 Source.2641: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.2642: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin Source.2643: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1 Source.2644: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor Source.2645: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.2646: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.2647: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.2648: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.2649: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase Source.2650: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.2651: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.2652: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2 Source.2653: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.2654: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.2655: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.2656: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3 Source.2657: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1 Source.2658: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2659: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.2660: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.2661: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3 Source.2662: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.2663: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.2664: DFBPPR9347 ---- Animal proteins ---- C-reactive protein Source.2665: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor Source.2666: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2667: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.2668: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2669: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2670: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.2671: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor Source.2672: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.2673: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.2674: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.2675: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.2676: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.2677: DFBPPR9404 ---- Animal proteins ---- Tryptase Source.2678: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.2679: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type Source.2680: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type Source.2681: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2682: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.2683: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.2684: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.2685: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor Source.2686: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2687: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.2688: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type Source.2689: DFBPPR9484 ---- Animal proteins ---- Macoilin Source.2690: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.2691: DFBPPR9495 ---- Animal proteins ---- Complement factor B Source.2692: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor Source.2693: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.2694: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.2695: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein Source.2696: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.2697: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase Source.2698: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.2699: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha Source.2700: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta Source.2701: DFBPPR9556 ---- Animal proteins ---- N(4)-(Beta-N-acetylglucosaminyl)-L-asparaginase Source.2702: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.2703: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1 Source.2704: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.2705: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase Source.2706: DFBPPR9578 ---- Animal proteins ---- Biglycan Source.2707: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2 Source.2708: DFBPPR9608 ---- Animal proteins ---- Interleukin-21 Source.2709: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2710: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.2711: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.2712: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.2713: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1 Source.2714: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6 Source.2715: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1 Source.2716: DFBPPR9685 ---- Animal proteins ---- Interleukin-27 subunit alpha Source.2717: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.2718: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1 Source.2719: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1 Source.2720: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2721: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis Source.2722: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.2723: DFBPPR9767 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6 Source.2724: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.2725: DFBPPR9784 ---- Animal proteins ---- Translocator protein Source.2726: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.2727: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.2728: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2729: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.2730: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.2731: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase Source.2732: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.2733: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C Source.2734: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.2735: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17 Source.2736: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1 Source.2737: DFBPPR9912 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial Source.2738: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1 Source.2739: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.2740: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.2741: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.2742: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor Source.2743: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin Source.2744: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1 Source.2745: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.2746: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.2747: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.2748: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type Source.2749: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.2750: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.2751: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.2752: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.2753: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase Source.2754: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase Source.2755: DFBPPR10046 ---- Animal proteins ---- Gallinacin-2 Source.2756: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.2757: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.2758: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.2759: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.2760: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.2761: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.2762: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.2763: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2764: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7 Source.2765: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.2766: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.2767: DFBPPR10082 ---- Animal proteins ---- Pinopsin Source.2768: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.2769: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.2770: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.2771: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.2772: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase Source.2773: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.2774: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.2775: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase Source.2776: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein Source.2777: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.2778: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.2779: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2 Source.2780: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.2781: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5 Source.2782: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.2783: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.2784: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.2785: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5 Source.2786: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.2787: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.2788: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein Source.2789: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.2790: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4 Source.2791: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.2792: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.2793: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.2794: DFBPPR10231 ---- Animal proteins ---- Basigin Source.2795: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2 Source.2796: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1 Source.2797: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1 Source.2798: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.2799: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein Source.2800: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.2801: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.2802: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.2803: DFBPPR10270 ---- Animal proteins ---- Agrin Source.2804: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C Source.2805: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.2806: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6 Source.2807: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.2808: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2809: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.2810: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.2811: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.2812: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.2813: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2814: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2 Source.2815: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.2816: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2817: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.2818: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.2819: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.2820: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.2821: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.2822: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR Source.2823: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.2824: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.2825: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.2826: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.2827: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2828: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.2829: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.2830: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.2831: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.2832: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.2833: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A Source.2834: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.2835: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor Source.2836: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2837: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.2838: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.2839: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.2840: DFBPPR10459 ---- Animal proteins ---- Reelin Source.2841: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.2842: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.2843: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.2844: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.2845: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.2846: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor Source.2847: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.2848: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.2849: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta Source.2850: DFBPPR10513 ---- Animal proteins ---- Parafibromin Source.2851: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta Source.2852: DFBPPR10530 ---- Animal proteins ---- Osteopontin Source.2853: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase Source.2854: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type Source.2855: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2856: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.2857: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2858: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.2859: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.2860: DFBPPR10563 ---- Animal proteins ---- Optineurin Source.2861: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.2862: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.2863: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.2864: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2865: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin Source.2866: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.2867: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.2868: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase Source.2869: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.2870: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.2871: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.2872: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.2873: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.2874: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.2875: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.2876: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.2877: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.2878: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase Source.2879: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.2880: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3 Source.2881: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2882: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.2883: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.2884: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.2885: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.2886: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.2887: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase Source.2888: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.2889: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.2890: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2891: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.2892: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase Source.2893: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.2894: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2895: DFBPPR10709 ---- Animal proteins ---- Docking protein 3 Source.2896: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2897: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1 Source.2898: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.2899: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.2900: DFBPPR10731 ---- Animal proteins ---- Protein cereblon Source.2901: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.2902: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2903: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.2904: DFBPPR10747 ---- Animal proteins ---- Cathepsin B Source.2905: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.2906: DFBPPR10755 ---- Animal proteins ---- Draxin Source.2907: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.2908: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.2909: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.2910: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.2911: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.2912: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.2913: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.2914: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.2915: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.2916: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2 Source.2917: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3 Source.2918: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.2919: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.2920: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.2921: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.2922: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.2923: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha Source.2924: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2925: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.2926: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1 Source.2927: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.2928: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3 Source.2929: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.2930: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.2931: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.2932: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.2933: DFBPPR10882 ---- Animal proteins ---- Noggin Source.2934: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.2935: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.2936: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5 Source.2937: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.2938: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.2939: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.2940: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.2941: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.2942: DFBPPR10919 ---- Animal proteins ---- Ski oncogene Source.2943: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3 Source.2944: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2 Source.2945: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.2946: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.2947: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase Source.2948: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.2949: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2950: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.2951: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.2952: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C Source.2953: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.2954: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.2955: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2 Source.2956: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.2957: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase Source.2958: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG Source.2959: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1 Source.2960: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor Source.2961: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.2962: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.2963: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.2964: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.2965: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.2966: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11 Source.2967: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.2968: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A Source.2969: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2 Source.2970: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.2971: DFBPPR11077 ---- Animal proteins ---- Tyrosinase Source.2972: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.2973: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.2974: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1 Source.2975: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.2976: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.2977: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.2978: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.2979: DFBPPR11102 ---- Animal proteins ---- Interferon type A3 Source.2980: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.2981: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein Source.2982: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase Source.2983: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.2984: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.2985: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.2986: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.2987: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.2988: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.2989: DFBPPR11146 ---- Animal proteins ---- Formin Source.2990: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2991: DFBPPR11165 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF185 Source.2992: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.2993: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.2994: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta Source.2995: DFBPPR11174 ---- Animal proteins ---- Gallinacin-6 Source.2996: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein Source.2997: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.2998: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.2999: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.3000: DFBPPR11205 ---- Animal proteins ---- Protein 4.1 Source.3001: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.3002: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.3003: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.3004: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A Source.3005: DFBPPR11244 ---- Animal proteins ---- Frizzled-6 Source.3006: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.3007: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1 Source.3008: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.3009: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.3010: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.3011: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.3012: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.3013: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.3014: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.3015: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.3016: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1 Source.3017: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.3018: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.3019: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4 Source.3020: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.3021: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2 Source.3022: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.3023: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6 Source.3024: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.3025: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7 Source.3026: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.3027: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.3028: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.3029: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner Source.3030: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.3031: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.3032: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.3033: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1 Source.3034: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.3035: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin Source.3036: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide Source.3037: DFBPPR11518 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3038: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.3039: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.3040: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.3041: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12 Source.3042: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.3043: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.3044: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein Source.3045: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog Source.3046: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32 Source.3047: DFBPPR11578 ---- Animal proteins ---- Lymphocyte antigen 86 Source.3048: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.3049: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein Source.3050: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.3051: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.3052: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.3053: DFBPPR11608 ---- Animal proteins ---- ATP synthase protein 8 Source.3054: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein Source.3055: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.3056: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.3057: DFBPPR11635 ---- Animal proteins ---- Cochlin Source.3058: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.3059: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3060: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase Source.3061: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2 Source.3062: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.3063: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial Source.3064: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1 Source.3065: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2 Source.3066: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.3067: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.3068: DFBPPR11712 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.3069: DFBPPR11719 ---- Animal proteins ---- Protein RER1 Source.3070: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor Source.3071: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.3072: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.3073: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3 Source.3074: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.3075: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3 Source.3076: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62 Source.3077: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.3078: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.3079: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1 Source.3080: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog Source.3081: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.3082: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.3083: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein Source.3084: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.3085: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.3086: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.3087: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.3088: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.3089: DFBPPR11894 ---- Animal proteins ---- Centromere protein K Source.3090: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN Source.3091: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.3092: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A Source.3093: DFBPPR11929 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD Source.3094: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.3095: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.3096: DFBPPR11953 ---- Animal proteins ---- Protein NEL Source.3097: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1 Source.3098: DFBPPR11966 ---- Animal proteins ---- Protein CREG1 Source.3099: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.3100: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.3101: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog Source.3102: DFBPPR12015 ---- Animal proteins ---- Homeobox protein Hox-D1 Source.3103: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1 Source.3104: DFBPPR12018 ---- Animal proteins ---- Density-regulated protein Source.3105: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD Source.3106: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.3107: DFBPPR12041 ---- Animal proteins ---- Paladin Source.3108: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.3109: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.3110: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.3111: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1 Source.3112: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.3113: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.3114: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.3115: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.3116: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.3117: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.3118: DFBPPR12112 ---- Animal proteins ---- Protein LBH Source.3119: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.3120: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1 Source.3121: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.3122: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19 Source.3123: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1 Source.3124: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.3125: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a Source.3126: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.3127: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.3128: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.3129: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B Source.3130: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog Source.3131: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.3132: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174 Source.3133: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.3134: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.3135: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.3136: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.3137: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.3138: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.3139: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.3140: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1 Source.3141: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.3142: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.3143: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.3144: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.3145: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.3146: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase Source.3147: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.3148: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.3149: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.3150: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53 Source.3151: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.3152: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.3153: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3154: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.3155: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.3156: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.3157: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.3158: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.3159: DFBPPR12333 ---- Animal proteins ---- Angiogenin Source.3160: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1 Source.3161: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.3162: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.3163: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.3164: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.3165: DFBPPR12358 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1 Source.3166: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.3167: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5 Source.3168: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.3169: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.3170: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.3171: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.3172: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.3173: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase Source.3174: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.3175: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.3176: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.3177: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.3178: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3179: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.3180: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.3181: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.3182: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.3183: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.3184: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.3185: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.3186: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.3187: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.3188: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1 Source.3189: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.3190: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.3191: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.3192: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase Source.3193: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.3194: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.3195: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.3196: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.3197: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.3198: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.3199: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14 Source.3200: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.3201: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.3202: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.3203: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.3204: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.3205: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1 Source.3206: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.3207: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase Source.3208: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.3209: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.3210: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.3211: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.3212: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.3213: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.3214: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.3215: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.3216: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.3217: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.3218: DFBPPR12551 ---- Animal proteins ---- C-reactive protein Source.3219: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.3220: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.3221: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.3222: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type Source.3223: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2 Source.3224: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1 Source.3225: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2 Source.3226: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1 Source.3227: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.3228: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.3229: DFBPPR12607 ---- Animal proteins ---- Basigin Source.3230: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.3231: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14 Source.3232: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.3233: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.3234: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.3235: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.3236: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.3237: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor Source.3238: DFBPPR12681 ---- Animal proteins ---- Myosin-7 Source.3239: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.3240: DFBPPR12709 ---- Animal proteins ---- Somatotropin Source.3241: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.3242: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Source.3243: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.3244: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.3245: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.3246: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1 Source.3247: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.3248: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Source.3249: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.3250: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.3251: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.3252: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.3253: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.3254: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase Source.3255: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.3256: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter Source.3257: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.3258: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B Source.3259: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin Source.3260: DFBPPR12832 ---- Animal proteins ---- Secretin receptor Source.3261: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor Source.3262: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.3263: DFBPPR12836 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Source.3264: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3265: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.3266: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2 Source.3267: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.3268: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1 Source.3269: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor Source.3270: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.3271: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.3272: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.3273: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin Source.3274: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.3275: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.3276: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein Source.3277: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.3278: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.3279: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80 Source.3280: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.3281: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.3282: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6 Source.3283: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.3284: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.3285: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.3286: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.3287: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.3288: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.3289: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.3290: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.3291: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.3292: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.3293: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.3294: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.3295: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.3296: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.3297: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3298: DFBPPR13083 ---- Animal proteins ---- Promotilin Source.3299: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3300: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2 Source.3301: DFBPPR13140 ---- Animal proteins ---- Blastocyst protein 4 Source.3302: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.3303: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53 Source.3304: DFBPPR13156 ---- Animal proteins ---- Leptin Source.3305: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor Source.3306: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3307: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.3308: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.3309: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.3310: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.3311: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11 Source.3312: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha Source.3313: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.3314: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase Source.3315: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1 Source.3316: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.3317: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B Source.3318: DFBPPR13245 ---- Animal proteins ---- Somatotropin Source.3319: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.3320: DFBPPR13262 ---- Animal proteins ---- Gastrin Source.3321: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.3322: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.3323: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2 Source.3324: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.3325: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.3326: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.3327: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.3328: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain Source.3329: DFBPPR13297 ---- Animal proteins ---- Plasminogen Source.3330: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3331: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.3332: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.3333: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.3334: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.3335: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.3336: DFBPPR13344 ---- Animal proteins ---- Interferon omega-2 Source.3337: DFBPPR13362 ---- Animal proteins ---- Biglycan Source.3338: DFBPPR13367 ---- Animal proteins ---- Neutrophil elastase 2B Source.3339: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.3340: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3341: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3342: DFBPPR13420 ---- Animal proteins ---- Small integral membrane protein 12 Source.3343: DFBPPR13424 ---- Animal proteins ---- Leptin Source.3344: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.3345: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3346: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.3347: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2 Source.3348: DFBPPR13441 ---- Animal proteins ---- Acrosin Source.3349: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.3350: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.3351: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.3352: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1 Source.3353: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.3354: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase Source.3355: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.3356: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1 Source.3357: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1 Source.3358: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3359: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.3360: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.3361: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein Source.3362: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.3363: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.3364: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53 Source.3365: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.3366: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.3367: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.3368: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3369: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.3370: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.3371: DFBPPR13601 ---- Animal proteins ---- Cathepsin B Source.3372: DFBPPR13602 ---- Animal proteins ---- Acrosin Source.3373: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta Source.3374: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.3375: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.3376: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.3377: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6 Source.3378: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2 Source.3379: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.3380: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3381: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic Source.3382: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.3383: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.3384: DFBPPR13713 ---- Animal proteins ---- Plasminogen Source.3385: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.3386: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.3387: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.3388: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1 Source.3389: DFBPPR13734 ---- Animal proteins ---- Perilipin-5 Source.3390: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.3391: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21 Source.3392: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.3393: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein Source.3394: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.3395: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor Source.3396: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.3397: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.3398: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.3399: DFBPPR13789 ---- Animal proteins ---- Tryptase-2 Source.3400: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain Source.3401: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor Source.3402: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24 Source.3403: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5 Source.3404: DFBPPR13826 ---- Animal proteins ---- Translocator protein Source.3405: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1 Source.3406: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3407: DFBPPR13902 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.3408: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.3409: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.3410: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.3411: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3412: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.3413: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.3414: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.3415: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.3416: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin Source.3417: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3418: DFBPPR14039 ---- Animal proteins ---- ATP synthase protein 8 Source.3419: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3420: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial Source.3421: DFBPPR14073 ---- Marine protein ---- Elastase-1 Source.3422: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36 Source.3423: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1 Source.3424: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha Source.3425: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.3426: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.3427: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.3428: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.3429: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.3430: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I Source.3431: DFBPPR14155 ---- Marine protein ---- ATP synthase protein 8 Source.3432: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.3433: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog Source.3434: DFBPPR14166 ---- Marine protein ---- Draxin-A Source.3435: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.3436: DFBPPR14175 ---- Marine protein ---- Draxin-B Source.3437: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.3438: DFBPPR14189 ---- Marine protein ---- Protein Flattop Source.3439: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein Source.3440: DFBPPR14217 ---- Marine protein ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.3441: DFBPPR14257 ---- Marine protein ---- Somatolactin Source.3442: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial Source.3443: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.3444: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.3445: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3446: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.3447: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein Source.3448: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.3449: DFBPPR14405 ---- Marine protein ---- Uncharacterized monothiol glutaredoxin ycf64 Source.3450: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4 Source.3451: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III Source.3452: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic Source.3453: DFBPPR14524 ---- Marine protein ---- Uncharacterized protein ycf36 Source.3454: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55 Source.3455: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.3456: DFBPPR14534 ---- Marine protein ---- Uncharacterized protein ORF62 Source.3457: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.3458: DFBPPR14546 ---- Marine protein ---- Stanniocalcin Source.3459: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.3460: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.3461: DFBPPR14562 ---- Marine protein ---- Ladderlectin Source.3462: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.3463: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta Source.3464: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1 Source.3465: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.3466: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27 Source.3467: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase Source.3468: DFBPPR14592 ---- Marine protein ---- Intelectin Source.3469: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2 Source.3470: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.3471: DFBPPR14625 ---- Marine protein ---- Somatostatin-2 Source.3472: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.3473: DFBPPR14650 ---- Marine protein ---- Thyroid hormone receptor alpha Source.3474: DFBPPR14651 ---- Marine protein ---- ATP synthase protein 8 Source.3475: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme Source.3476: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.3477: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor Source.3478: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.3479: DFBPPR14686 ---- Marine protein ---- Cytochrome c oxidase subunit 6A, mitochondrial Source.3480: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog Source.3481: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein Source.3482: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.3483: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.3484: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.3485: DFBPPR14755 ---- Marine protein ---- Techylectin-5A Source.3486: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit Source.3487: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.3488: DFBPPR14758 ---- Marine protein ---- Techylectin-5B Source.3489: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.3490: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain Source.3491: DFBPPR14799 ---- Marine protein ---- Arginine kinase Source.3492: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase Source.3493: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1 Source.3494: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.3495: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1 Source.3496: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha Source.3497: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.3498: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.3499: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system Source.3500: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.3501: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.3502: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.3503: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.3504: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1 Source.3505: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.3506: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5 Source.3507: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1 Source.3508: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.3509: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.3510: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.3511: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.3512: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.3513: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.3514: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.3515: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.3516: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like Source.3517: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.3518: DFBPPR14990 ---- Microorganism protein ---- Nuclear distribution protein PAC1 Source.3519: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.3520: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.3521: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.3522: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1 Source.3523: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5 Source.3524: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.3525: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.3526: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.3527: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.3528: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.3529: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9 Source.3530: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.3531: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12 Source.3532: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.3533: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1 Source.3534: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial Source.3535: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.3536: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.3537: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1 Source.3538: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.3539: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.3540: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4 Source.3541: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.3542: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase Source.3543: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.3544: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1 Source.3545: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.3546: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2 Source.3547: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.3548: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13 Source.3549: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase Source.3550: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.3551: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.3552: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.3553: DFBPPR15216 ---- Microorganism protein ---- Golgi to ER traffic protein 1 Source.3554: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2 Source.3555: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.3556: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3 Source.3557: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial Source.3558: DFBPPR15248 ---- Microorganism protein ---- DASH complex subunit SPC34 Source.3559: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase Source.3560: DFBPPR15262 ---- Microorganism protein ---- Inner kinetochore subunit NKP1 Source.3561: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4 Source.3562: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9 Source.3563: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3 Source.3564: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1 Source.3565: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.3566: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.3567: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase Source.3568: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80 Source.3569: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.3570: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1 Source.3571: DFBPPR15418 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 4 Source.3572: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.3573: DFBPPR15456 ---- Microorganism protein ---- RNA polymerase II holoenzyme cyclin-like subunit Source.3574: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21 Source.3575: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.3576: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2 Source.3577: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.3578: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1 Source.3579: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62 Source.3580: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32 Source.3581: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11 Source.3582: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.3583: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3 Source.3584: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial Source.3585: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.3586: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.3587: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.3588: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6 Source.3589: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.3590: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1 Source.3591: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2 Source.3592: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.3593: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.3594: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1 Source.3595: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial Source.3596: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1 Source.3597: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1 Source.3598: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial Source.3599: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.3600: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.3601: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial Source.3602: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial Source.3603: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1 Source.3604: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6 Source.3605: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.3606: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1 Source.3607: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.3608: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9 Source.3609: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32 Source.3610: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase Source.3611: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.3612: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.3613: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.3614: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3 Source.3615: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3 Source.3616: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.3617: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein Source.3618: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase Source.3619: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.3620: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1 Source.3621: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.3622: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase Source.3623: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.3624: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.3625: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.3626: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.3627: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.3628: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.3629: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A Source.3630: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.3631: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B Source.3632: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3633: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.3634: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.3635: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3 Source.3636: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.3637: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.3638: DFBPPR7819 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial Source.3639: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3640: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.3641: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3642: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.3643: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1 Source.3644: DFBPPR7859 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.3645: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1 Source.3646: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.3647: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.3648: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2 Source.3649: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.3650: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.3651: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.3652: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase Source.3653: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.3654: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.3655: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP Source.3656: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.3657: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.3658: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1 Source.3659: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92 Source.3660: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87 Source.3661: DFBPPR7970 ---- Plant protein ---- Subtilisin inhibitor Source.3662: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1 Source.3663: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3664: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.3665: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.3666: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.3667: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.3668: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3669: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.3670: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.3671: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic Source.3672: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.3673: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform Source.3674: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.3675: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.3676: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1 Source.3677: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2 Source.3678: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1 Source.3679: DFBPPR8106 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3680: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A Source.3681: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.3682: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.3683: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.3684: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic Source.3685: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3686: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.3687: DFBPPR8235 ---- Plant protein ---- Catalase Source.3688: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.3689: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.3690: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.3691: DFBPPR8262 ---- Plant protein ---- ATP-dependent zinc metalloprotease FTSH, chloroplastic Source.3692: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.3693: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.3694: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic Source.3695: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3696: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.3697: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.3698: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.3699: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity	The peptide showed potent 2,2'-azino-bis (3-ethylbenzthiazoline-6- sulphonic acid) radical scavenging activity (EC₅₀ 17.52 ± 0.46 μM).
Specific target protein(s)	N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)N1[C@@]([H])(CCC1)C(=O)O

Preparation method

Mode of preparation	Fermentation
Enzyme(s)/starter culture	Kapi is made from shrimp or mysid shrimp mixed with salt between 20-30% (w/w) which, after sun-drying for 1-2 days, is homogenized to a paste. The paste is then naturally fermented at ambient temperature for 7-10 days before further ripening, under the same condition, for up to 6 months in order to develop unique flavors and aromas.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

Thai traditional fermented shrimp pastes are potential sources of bioactive peptides possessing antioxidant activities.

Database cross-references

DFBP

[D1]	DFBPDPIV0017
[D2]	DFBPMUFU0679

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	Kleekayai T, Harnedy PA, O'Keeffe MB, Poyarkov AA, CunhaNeves A, Suntornsuk W, FitzGerald RJ. Extraction of antioxidant and ACE inhibitory peptides from Thai traditional fermented shrimp pastes. Food Chem. 2015 Jun 1;176:441-7. PMID: 25624254 DOI: 10.1016/j.foodchem.2014.12.026
Other literature(s)	[1] Harnedy P A, Fitzgerald R J. In vitro assessment of the cardioprotective, anti-diabetic and antioxidant potential of Palmaria palmata, protein hydrolysates[J]. Journal of Applied Phycology, 2013, 25(6):1793-1803.
PubDate	2015