E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0686(Antioxidative peptide)
DFBP ID DFBPANOX0686
Peptide sequence KYP
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Lys-Tyr-Pro
Single-letter amino acid KYP
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 406.48 Da c
Net charge 0.00 c
Isoelectric point (pI) 9.70 c
IC50 N.D
pIC50 N.D
GRAVY -2.2667 c
Hydrophilic residue ratio 33.33% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine milk protein
Precursor protein β-Casein
Residue position

f(113-115)

Precursor protein(s) search
Source.1: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.2: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.3: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.4: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.5: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.6: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.7: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.8: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.9: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.10: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.11: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.12: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.13: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.14: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.15: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.16: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.17: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.18: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.19: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.20: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.21: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.22: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.23: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.24: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.25: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.26: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.27: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.28: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.29: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.30: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.31: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.32: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.33: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.34: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.35: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.36: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.37: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.38: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.39: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.40: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.41: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.42: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.43: DFBPPR1887 ---- Plant proteins ---- Probable glutathione S-transferase DHAR2, chloroplastic
Source.44: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.45: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.46: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.47: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.48: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.49: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.50: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.51: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.52: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.53: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.54: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.55: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.56: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.57: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.58: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.59: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.60: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.61: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.62: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.63: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.64: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.65: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.66: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.67: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.68: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C
Source.69: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.70: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.71: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.72: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.73: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.74: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.75: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2
Source.76: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1
Source.77: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.78: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.79: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.80: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.81: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5
Source.82: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.83: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.84: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.85: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.86: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.87: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.88: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.89: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.90: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.91: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.92: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.93: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.94: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.95: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.96: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.97: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.98: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.99: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1
Source.100: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.101: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.102: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.103: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.104: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.105: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.106: DFBPPR3908 ---- Plant proteins ---- Metallothionein-like protein 1A
Source.107: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.108: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.109: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.110: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.111: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.112: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.113: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.114: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.115: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.116: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.117: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.118: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.119: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.120: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.121: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.122: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.123: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.124: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.125: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1
Source.126: DFBPPR4800 ---- Plant proteins ---- Protein BUD31 homolog 2
Source.127: DFBPPR4829 ---- Plant proteins ---- Protein BUD31 homolog 3
Source.128: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.129: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.130: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.131: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.132: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.133: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.134: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.135: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase
Source.136: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.137: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.138: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.139: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.140: DFBPPR5164 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 2
Source.141: DFBPPR5182 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 1
Source.142: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.143: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.144: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.145: DFBPPR5333 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 3
Source.146: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.147: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.148: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.149: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.150: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.151: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.152: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.153: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.154: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.155: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.156: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.157: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.158: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.159: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.160: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.161: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.162: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.163: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.164: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.165: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.166: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.167: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.168: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.169: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2
Source.170: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.171: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.172: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.173: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13
Source.174: DFBPPR6142 ---- Plant proteins ---- Metallothionein-like protein 1
Source.175: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.176: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.177: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.178: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.179: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.180: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.181: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.182: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.183: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.184: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.185: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.186: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.187: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.188: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.189: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.190: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.191: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.192: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.193: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.194: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.195: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.196: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.197: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.198: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.199: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.200: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.201: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.202: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.203: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.204: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.205: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.206: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.207: DFBPPR7274 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1B
Source.208: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.209: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1
Source.210: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.211: DFBPPR7606 ---- Milk proteins ---- Osteopontin
Source.212: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.213: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.214: DFBPPR7692 ---- Milk proteins ---- Beta-casein
Source.215: DFBPPR7700 ---- Milk proteins ---- Beta-casein
Source.216: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.217: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.218: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.219: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.220: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.221: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.222: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.223: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.224: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.225: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.226: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.227: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.228: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.229: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.230: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.231: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.232: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.233: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.234: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.235: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.236: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.237: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.238: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.239: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.240: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.241: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.242: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.243: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.244: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.245: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.246: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.247: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.248: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.249: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.250: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.251: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.252: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.253: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.254: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.255: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.256: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.257: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2
Source.258: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.259: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.260: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.261: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.262: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.263: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.264: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.265: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.266: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.267: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.268: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.269: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.270: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.271: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.272: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.273: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.274: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.275: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.276: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.277: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.278: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.279: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.280: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.281: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.282: DFBPPR17484 ---- Animal proteins ---- Histone H1.8
Source.283: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.284: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.285: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.286: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.287: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.288: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.289: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.290: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.291: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.292: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.293: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.294: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.295: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.296: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.297: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.298: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.299: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.300: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.301: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.302: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.303: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta
Source.304: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.305: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.306: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.307: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.308: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.309: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.310: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2
Source.311: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.312: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.313: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.314: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.315: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.316: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.317: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.318: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.319: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.320: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.321: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor
Source.322: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.323: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.324: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.325: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.326: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.327: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.328: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.329: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.330: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.331: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.332: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.333: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19
Source.334: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1
Source.335: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.336: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.337: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.338: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.339: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.340: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.341: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.342: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.343: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.344: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.345: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.346: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.347: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.348: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.349: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.350: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.351: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.352: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.353: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.354: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.355: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.356: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.357: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.358: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.359: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.360: DFBPPR19654 ---- Animal proteins ---- Alpha-endosulfine
Source.361: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.362: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.363: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.364: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.365: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.366: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.367: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.368: DFBPPR20036 ---- Animal proteins ---- Urocortin-3
Source.369: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.370: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial
Source.371: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.372: DFBPPR20145 ---- Animal proteins ---- Adipogenin
Source.373: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.374: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.375: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.376: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.377: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator
Source.378: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.379: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.380: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.381: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.382: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.383: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a
Source.384: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.385: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.386: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.387: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.388: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.389: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.390: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.391: DFBPPR20699 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 31
Source.392: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.393: DFBPPR20736 ---- Animal proteins ---- Osteopontin-K
Source.394: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.395: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2
Source.396: DFBPPR20828 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1
Source.397: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.398: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.399: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.400: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.401: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.402: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.403: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4
Source.404: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.405: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.406: DFBPPR21242 ---- Animal proteins ---- Tachykinin-3
Source.407: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.408: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.409: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.410: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.411: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.412: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2
Source.413: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.414: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.415: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.416: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS
Source.417: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.418: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.419: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.420: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6
Source.421: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.422: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.423: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.424: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.425: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.426: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.427: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.428: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.429: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.430: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.431: DFBPPR22392 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1A
Source.432: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.433: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.434: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.435: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.436: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4
Source.437: DFBPPR22650 ---- Animal proteins ---- Protein FAM183A
Source.438: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.439: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9
Source.440: DFBPPR22744 ---- Animal proteins ---- Uncharacterized protein C10orf82 homolog
Source.441: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.442: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog
Source.443: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.444: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.445: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.446: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.447: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.448: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.449: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.450: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.451: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.452: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.453: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.454: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.455: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.456: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.457: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.458: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.459: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.460: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.461: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.462: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.463: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.464: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.465: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.466: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.467: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.468: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.469: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.470: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic
Source.471: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.472: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.473: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.474: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.475: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.476: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.477: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.478: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase
Source.479: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.480: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.481: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.482: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.483: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.484: DFBPPR9318 ---- Animal proteins ---- Alpha-endosulfine
Source.485: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.486: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.487: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.488: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.489: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.490: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.491: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.492: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.493: DFBPPR9673 ---- Animal proteins ---- Neurokinin-B
Source.494: DFBPPR9786 ---- Animal proteins ---- Adipogenin
Source.495: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.496: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.497: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor
Source.498: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.499: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.500: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.501: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.502: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.503: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.504: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.505: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.506: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.507: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.508: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.509: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.510: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.511: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.512: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.513: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.514: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.515: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.516: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.517: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.518: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.519: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.520: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.521: DFBPPR10477 ---- Animal proteins ---- Aprataxin
Source.522: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.523: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.524: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.525: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.526: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.527: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.528: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.529: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.530: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.531: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.532: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.533: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.534: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.535: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.536: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.537: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.538: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.539: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.540: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.541: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.542: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.543: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.544: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.545: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3
Source.546: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.547: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.548: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.549: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.550: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.551: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.552: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.553: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.554: DFBPPR11529 ---- Animal proteins ---- Alpha-endosulfine
Source.555: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.556: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.557: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.558: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.559: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.560: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.561: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.562: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.563: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.564: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17
Source.565: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.566: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.567: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.568: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.569: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.570: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.571: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.572: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.573: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.574: DFBPPR11945 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1
Source.575: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.576: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.577: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.578: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.579: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.580: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.581: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.582: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.583: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.584: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.585: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.586: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.587: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.588: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.589: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.590: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.591: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.592: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.593: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3
Source.594: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.595: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.596: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.597: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.598: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.599: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.600: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.601: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.602: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.603: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.604: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.605: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.606: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.607: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.608: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.609: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.610: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.611: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.612: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.613: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.614: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.615: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.616: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8
Source.617: DFBPPR13300 ---- Animal proteins ---- Sex-determining region Y protein
Source.618: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.619: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.620: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.621: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.622: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.623: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.624: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.625: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.626: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.627: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.628: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.629: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.630: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1
Source.631: DFBPPR13704 ---- Animal proteins ---- Osteopontin
Source.632: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.633: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.634: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.635: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.636: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.637: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.638: DFBPPR14179 ---- Marine protein ---- Alpha-endosulfine
Source.639: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region
Source.640: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.641: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.642: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.643: DFBPPR14444 ---- Marine protein ---- 50S ribosomal protein L23, chloroplastic
Source.644: DFBPPR14506 ---- Marine protein ---- Photosystem I reaction center subunit IV
Source.645: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.646: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.647: DFBPPR14519 ---- Marine protein ---- Uncharacterized protein ycf21
Source.648: DFBPPR14530 ---- Marine protein ---- Uncharacterized protein ycf34
Source.649: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.650: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.651: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.652: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.653: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.654: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.655: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.656: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.657: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.658: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.659: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.660: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.661: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.662: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.663: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.664: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.665: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.666: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.667: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.668: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.669: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.670: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.671: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.672: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.673: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.674: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.675: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.676: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.677: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.678: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.679: DFBPPR15237 ---- Microorganism protein ---- U6 snRNA-associated Sm-like protein LSm6
Source.680: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.681: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.682: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.683: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.684: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.685: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.686: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.687: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.688: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.689: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.690: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.691: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.692: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.693: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.694: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.695: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.696: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.697: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.698: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.699: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1
Source.700: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.701: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.702: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.703: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.704: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.705: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.706: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.707: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.708: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.709: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.710: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.711: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.712: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.713: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.714: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.715: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.716: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.717: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The peptide showed potent DPPH radical scavenging activity with the EC50 value of > 5 mM.

Table 1 Inhibitory concentration inducing 50% scavenging (EC50) for 2,2-diphenyl-1-picrylhydrazyl (DPPH) in the presence of short (64 amino acid residues) casein-derived C terminal proline containing peptides.
Compound
DPPH EC50 (mM)
Lys-Tyr-Pro> 5
Trolox
(17.2 ± 5.5) × 10-3a
Values represent mean EC50 values ± confidence interval (P = 0.05) n = 3 and triplicate determination. Values with different superscript letter are significantly different (P < 0.05).
Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

The peptide was from Thermo Fisher Scientific (Ulm, Germany).

Stability & Cytotoxicity
Peptide stability
Literature report:

The peptide was stable for gastrointestinal enzymes (pepsin, trypsin and chymotrypsin).

EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Nongonierma, A.B., FitzGerald, R.J. Inhibition of dipeptidyl peptidase IV (DPP-IV) by proline containing casein-derived peptides. Journal of Functional Foods. 2013, 5, 1909-17.
Other literature(s) N.D
PubDate 2013
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214