E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0727(Antioxidative peptide)
DFBP ID DFBPANOX0727
Peptide sequence MM
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity ACE-inhibitory activity [D1], DPP IV-inhibitory activity [D2], Multifunctional activity [D3]
Calculated physicochemical properties
Three-letter amino acid Met-Met
Single-letter amino acid MM
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 280.40 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 1.9000 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Poultry, Chicken
Precursor protein α-Actin
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.2: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.3: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.4: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5
Source.5: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.6: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.7: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.8: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.9: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.10: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.11: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.12: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.13: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.14: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.15: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.16: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.17: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.18: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.19: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.20: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.21: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.22: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.23: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.24: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.25: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.26: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.27: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.28: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.29: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.30: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.31: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.32: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.33: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.34: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.35: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.36: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.37: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.38: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.39: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.40: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.41: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.42: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.43: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.44: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.45: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.46: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.47: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.48: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.49: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.50: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.51: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.52: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.53: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.54: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.55: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.56: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.57: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.58: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.59: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.60: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.61: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.62: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.63: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.64: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.65: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.66: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.67: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.68: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.69: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.70: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.71: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.72: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.73: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.74: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.75: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.76: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.77: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.78: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.79: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.80: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.81: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.82: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.83: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.84: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.85: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.86: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.87: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.88: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.89: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.90: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.91: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.92: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.93: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.94: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17
Source.95: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.96: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.97: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.98: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.99: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.100: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.101: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.102: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.103: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.104: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.105: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.106: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.107: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.108: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.109: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.110: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.111: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.112: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.113: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.114: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.115: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.116: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.117: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic
Source.118: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.119: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.120: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.121: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.122: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.123: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.124: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.125: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.126: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.127: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.128: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.129: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.130: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.131: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.132: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.133: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.134: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.135: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.136: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.137: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.138: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.139: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.140: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.141: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.142: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.143: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.144: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.145: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.146: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.147: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.148: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.149: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.150: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.151: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.152: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.153: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.154: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.155: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.156: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.157: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.158: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.159: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.160: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.161: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.162: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.163: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.164: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.165: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.166: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.167: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.168: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156
Source.169: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.170: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.171: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.172: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.173: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.174: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.175: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.176: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.177: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.178: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.179: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.180: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.181: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.182: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.183: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.184: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.185: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.186: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.187: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.188: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.189: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.190: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.191: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.192: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.193: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.194: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.195: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.196: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.197: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.198: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.199: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.200: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.201: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.202: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.203: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.204: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.205: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.206: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.207: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.208: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.209: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.210: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.211: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.212: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.213: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.214: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.215: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.216: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.217: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.218: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.219: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.220: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic
Source.221: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.222: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.223: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.224: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.225: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.226: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.227: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.228: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.229: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.230: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.231: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.232: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.233: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.234: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.235: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.236: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.237: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.238: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.239: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.240: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.241: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.242: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.243: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.244: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.245: DFBPPR1671 ---- Plant proteins ---- MADS-box transcription factor 4
Source.246: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.247: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.248: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.249: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.250: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.251: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.252: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.253: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.254: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.255: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.256: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.257: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.258: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.259: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.260: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.261: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.262: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.263: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.264: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.265: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.266: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.267: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.268: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.269: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.270: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.271: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.272: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.273: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.274: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.275: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.276: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.277: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.278: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.279: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.280: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.281: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.282: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.283: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.284: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.285: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.286: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.287: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.288: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.289: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.290: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.291: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.292: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.293: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.294: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.295: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.296: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.297: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.298: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.299: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.300: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.301: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.302: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.303: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.304: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.305: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.306: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.307: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.308: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.309: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.310: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.311: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.312: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.313: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.314: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.315: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.316: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.317: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.318: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.319: DFBPPR1991 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic
Source.320: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.321: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.322: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.323: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.324: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.325: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.326: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.327: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.328: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.329: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.330: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.331: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.332: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.333: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.334: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.335: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.336: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.337: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.338: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.339: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.340: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa
Source.341: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.342: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1
Source.343: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.344: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.345: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.346: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2
Source.347: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.348: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.349: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.350: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.351: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.352: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.353: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.354: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.355: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.356: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5
Source.357: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.358: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.359: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.360: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.361: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.362: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.363: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.364: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.365: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.366: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.367: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.368: DFBPPR2163 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.369: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.370: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.371: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.372: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.373: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.374: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.375: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.376: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.377: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.378: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.379: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.380: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.381: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.382: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.383: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.384: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.385: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.386: DFBPPR2223 ---- Plant proteins ---- Urease
Source.387: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.388: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.389: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.390: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.391: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.392: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.393: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.394: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.395: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.396: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.397: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.398: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.399: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.400: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.401: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.402: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.403: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.404: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.405: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.406: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.407: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.408: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.409: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.410: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.411: DFBPPR2305 ---- Plant proteins ---- Actin-depolymerizing factor 4
Source.412: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.413: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.414: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.415: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic
Source.416: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.417: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.418: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.419: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.420: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.421: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.422: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.423: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.424: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.425: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.426: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.427: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic
Source.428: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.429: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.430: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.431: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.432: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.433: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.434: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.435: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.436: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.437: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.438: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.439: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.440: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.441: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.442: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.443: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.444: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.445: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.446: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.447: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.448: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.449: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.450: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26
Source.451: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.452: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.453: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.454: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.455: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.456: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.457: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.458: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.459: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.460: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.461: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.462: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.463: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.464: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.465: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.466: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.467: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.468: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.469: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.470: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.471: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.472: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1
Source.473: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.474: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.475: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.476: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.477: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.478: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.479: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.480: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.481: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.482: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.483: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.484: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.485: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.486: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.487: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.488: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.489: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.490: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.491: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.492: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.493: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.494: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.495: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2
Source.496: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.497: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.498: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.499: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.500: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500
Source.501: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.502: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.503: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.504: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.505: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.506: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.507: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.508: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.509: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33
Source.510: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.511: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.512: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.513: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.514: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.515: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.516: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.517: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.518: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.519: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.520: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.521: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.522: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.523: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.524: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.525: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.526: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.527: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.528: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.529: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.530: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.531: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.532: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.533: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.534: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.535: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.536: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.537: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.538: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.539: DFBPPR2908 ---- Plant proteins ---- Auxin-responsive protein IAA8
Source.540: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.541: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.542: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28
Source.543: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.544: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.545: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.546: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.547: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.548: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.549: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23
Source.550: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2
Source.551: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.552: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.553: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.554: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.555: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.556: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.557: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.558: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.559: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.560: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.561: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.562: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.563: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.564: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.565: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.566: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.567: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.568: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.569: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.570: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.571: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.572: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.573: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.574: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.575: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.576: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.577: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.578: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.579: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.580: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.581: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.582: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1
Source.583: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8
Source.584: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.585: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.586: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.587: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.588: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.589: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.590: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.591: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.592: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.593: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.594: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17
Source.595: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.596: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.597: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.598: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.599: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.600: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.601: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.602: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.603: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.604: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.605: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.606: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.607: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.608: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.609: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.610: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.611: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.612: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1
Source.613: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.614: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.615: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1
Source.616: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.617: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.618: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.619: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.620: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.621: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.622: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.623: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.624: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.625: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.626: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.627: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.628: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.629: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.630: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.631: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.632: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.633: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.634: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.635: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.636: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.637: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.638: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.639: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase
Source.640: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.641: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.642: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.643: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.644: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.645: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2
Source.646: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.647: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.648: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.649: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.650: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.651: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.652: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.653: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.654: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.655: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.656: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.657: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.658: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.659: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.660: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4
Source.661: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.662: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.663: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.664: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.665: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.666: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.667: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.668: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.669: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.670: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.671: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.672: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.673: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.674: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.675: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.676: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.677: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.678: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.679: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.680: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.681: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3
Source.682: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.683: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.684: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.685: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5
Source.686: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.687: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.688: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2
Source.689: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.690: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.691: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.692: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.693: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.694: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.695: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin
Source.696: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.697: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.698: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.699: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.700: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.701: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.702: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.703: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.704: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.705: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.706: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.707: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.708: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.709: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.710: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.711: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.712: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.713: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.714: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.715: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7
Source.716: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.717: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.718: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.719: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.720: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.721: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.722: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.723: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2
Source.724: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.725: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.726: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.727: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.728: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.729: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.730: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9
Source.731: DFBPPR3923 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic
Source.732: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.733: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.734: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8
Source.735: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.736: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3
Source.737: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3
Source.738: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.739: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.740: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.741: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.742: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.743: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.744: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.745: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.746: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.747: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.748: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.749: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.750: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.751: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.752: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.753: DFBPPR4030 ---- Plant proteins ---- Cytochrome b5
Source.754: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.755: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.756: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.757: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.758: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.759: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.760: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.761: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.762: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.763: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.764: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.765: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.766: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.767: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.768: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.769: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.770: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.771: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.772: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.773: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.774: DFBPPR4125 ---- Plant proteins ---- Calmodulin-like protein 4
Source.775: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.776: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.777: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.778: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.779: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.780: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.781: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.782: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.783: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.784: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.785: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.786: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.787: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.788: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.789: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.790: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.791: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.792: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.793: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.794: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.795: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3
Source.796: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.797: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.798: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.799: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.800: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.801: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22
Source.802: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.803: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.804: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.805: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.806: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.807: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.808: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.809: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.810: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.811: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.812: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.813: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.814: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.815: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.816: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.817: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.818: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.819: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20
Source.820: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.821: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.822: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.823: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.824: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.825: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.826: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.827: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic
Source.828: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.829: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.830: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.831: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.832: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.833: DFBPPR4376 ---- Plant proteins ---- Probable calcium-binding protein CML13
Source.834: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.835: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.836: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14
Source.837: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.838: DFBPPR4400 ---- Plant proteins ---- Putative calmodulin-like protein 6
Source.839: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.840: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.841: DFBPPR4407 ---- Plant proteins ---- Mini zinc finger protein 4
Source.842: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.843: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.844: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.845: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.846: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.847: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.848: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.849: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.850: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.851: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.852: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.853: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.854: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.855: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.856: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28
Source.857: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.858: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18
Source.859: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.860: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17
Source.861: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.862: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16
Source.863: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.864: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.865: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.866: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.867: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.868: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.869: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.870: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.871: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.872: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.873: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.874: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.875: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.876: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.877: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26
Source.878: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.879: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.880: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.881: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.882: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.883: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31
Source.884: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.885: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.886: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.887: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.888: DFBPPR4562 ---- Plant proteins ---- Mini zinc finger protein 2
Source.889: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1
Source.890: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.891: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10
Source.892: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.893: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.894: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.895: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12
Source.896: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15
Source.897: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.898: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.899: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.900: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19
Source.901: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23
Source.902: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.903: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.904: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.905: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.906: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.907: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.908: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1
Source.909: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.910: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.911: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.912: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.913: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.914: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.915: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.916: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.917: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.918: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.919: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.920: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.921: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.922: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.923: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.924: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.925: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.926: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.927: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.928: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.929: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H
Source.930: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.931: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600
Source.932: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.933: DFBPPR4819 ---- Plant proteins ---- B3 domain-containing protein Os08g0324300
Source.934: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.935: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5
Source.936: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.937: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800
Source.938: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.939: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.940: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.941: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.942: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.943: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.944: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900
Source.945: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.946: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100
Source.947: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.948: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.949: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.950: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.951: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.952: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.953: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.954: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.955: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.956: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.957: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.958: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.959: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.960: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.961: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.962: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.963: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.964: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.965: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.966: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.967: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.968: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.969: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.970: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.971: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.972: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.973: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.974: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.975: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.976: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.977: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.978: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.979: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.980: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.981: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.982: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.983: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.984: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.985: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.986: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.987: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.988: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.989: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.990: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.991: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.992: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.993: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.994: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.995: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.996: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.997: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.998: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.999: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1000: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1001: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.1002: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.1003: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.1004: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1005: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.1006: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.1007: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1008: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.1009: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.1010: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1011: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1012: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1013: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.1014: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1015: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1016: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.1017: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1018: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.1019: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.1020: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.1021: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1022: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.1023: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.1024: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.1025: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2
Source.1026: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.1027: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.1028: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1029: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.1030: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1031: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.1032: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.1033: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein
Source.1034: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.1035: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2
Source.1036: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1037: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase
Source.1038: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1039: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.1040: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1041: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1042: DFBPPR5295 ---- Plant proteins ---- Early nodulin-55-1
Source.1043: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.1044: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.1045: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.1046: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2
Source.1047: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.1048: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1049: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1050: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.1051: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1052: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.1053: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1054: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1055: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1056: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1057: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1058: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1059: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1060: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.1061: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.1062: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.1063: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1064: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.1065: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1066: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1067: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1068: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1069: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1070: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.1071: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1072: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1073: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1074: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.1075: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1076: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.1077: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.1078: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.1079: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1080: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1081: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1082: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1083: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.1084: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1085: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.1086: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1087: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.1088: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.1089: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.1090: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1091: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.1092: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1093: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.1094: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.1095: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1096: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.1097: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.1098: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1099: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1100: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1101: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.1102: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.1103: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1104: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.1105: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1106: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1107: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1108: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.1109: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1110: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.1111: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1112: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1113: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.1114: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1115: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1116: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1117: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.1118: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1119: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.1120: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1121: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.1122: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1123: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.1124: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.1125: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.1126: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1127: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1128: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1129: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1130: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1131: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.1132: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1133: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.1134: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1135: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1136: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.1137: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.1138: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1139: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.1140: DFBPPR5723 ---- Plant proteins ---- Single myb histone 3
Source.1141: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1142: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.1143: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.1144: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.1145: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1146: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.1147: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.1148: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1149: DFBPPR5753 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1150: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1151: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.1152: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.1153: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.1154: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1155: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.1156: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF
Source.1157: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a
Source.1158: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.1159: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1160: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.1161: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1
Source.1162: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2
Source.1163: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1164: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.1165: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.1166: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1167: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1168: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1169: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1170: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1171: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1172: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.1173: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.1174: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1175: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase
Source.1176: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1177: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.1178: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1179: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.1180: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1
Source.1181: DFBPPR5945 ---- Plant proteins ---- Calmodulin
Source.1182: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1183: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.1184: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.1185: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1
Source.1186: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.1187: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1188: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.1189: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.1190: DFBPPR6075 ---- Plant proteins ---- MFS18 protein
Source.1191: DFBPPR6108 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 5
Source.1192: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.1193: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1194: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.1195: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.1196: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1197: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.1198: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2
Source.1199: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4
Source.1200: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3
Source.1201: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1202: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1203: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.1204: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1205: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.1206: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.1207: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1208: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1209: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1210: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.1211: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.1212: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.1213: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.1214: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1215: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1216: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.1217: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1218: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.1219: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1220: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1221: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.1222: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.1223: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.1224: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1225: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.1226: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1227: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1228: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1229: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1230: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1231: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1232: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1233: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6
Source.1234: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.1235: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase
Source.1236: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1237: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.1238: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.1239: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1240: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1241: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72
Source.1242: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.1243: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.1244: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.1245: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.1246: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.1247: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.1248: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.1249: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.1250: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.1251: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1252: DFBPPR6494 ---- Plant proteins ---- 50S ribosomal protein L1, chloroplastic
Source.1253: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1254: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.1255: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4
Source.1256: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.1257: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1258: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1259: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.1260: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.1261: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1262: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1
Source.1263: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2
Source.1264: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.1265: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.1266: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.1267: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1268: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G
Source.1269: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.1270: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.1271: DFBPPR6705 ---- Plant proteins ---- Calmodulin
Source.1272: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.1273: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.1274: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1275: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.1276: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.1277: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1278: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1279: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1280: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1281: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1282: DFBPPR6752 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 3
Source.1283: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1284: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1285: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.1286: DFBPPR6770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1287: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.1288: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.1289: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.1290: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.1291: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.1292: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.1293: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.1294: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1295: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1296: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.1297: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1298: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1299: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1300: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1301: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1302: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.1303: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1304: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.1305: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1306: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.1307: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.1308: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.1309: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.1310: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.1311: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.1312: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1313: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.1314: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.1315: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1316: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.1317: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1318: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1319: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.1320: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.1321: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1322: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1323: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1324: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1325: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1326: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.1327: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.1328: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.1329: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1330: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.1331: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1332: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1333: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1334: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.1335: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1336: DFBPPR7142 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1337: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.1338: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.1339: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.1340: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1341: DFBPPR7164 ---- Plant proteins ---- Probable non-specific lipid-transfer protein
Source.1342: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.1343: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1344: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.1345: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin
Source.1346: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1347: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.1348: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.1349: DFBPPR7228 ---- Plant proteins ---- Calmodulin
Source.1350: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.1351: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.1352: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.1353: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1354: DFBPPR7310 ---- Plant proteins ---- ABA-inducible protein PHV A1
Source.1355: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.1356: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.1357: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.1358: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1359: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.1360: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.1361: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.1362: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1363: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1364: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.1365: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.1366: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.1367: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.1368: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1369: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.1370: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.1371: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1372: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1373: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.1374: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.1375: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase
Source.1376: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.1377: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.1378: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.1379: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.1380: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1381: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1382: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.1383: DFBPPR7504 ---- Plant proteins ---- 10 kDa chaperonin
Source.1384: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1385: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.1386: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1387: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1
Source.1388: DFBPPR7543 ---- Plant proteins ---- Polcalcin Bra n 2
Source.1389: DFBPPR7551 ---- Plant proteins ---- Protein BP4A
Source.1390: DFBPPR7552 ---- Plant proteins ---- Protein BP4C
Source.1391: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.1392: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.1393: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.1394: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.1395: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1396: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.1397: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.1398: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.1399: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.1400: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.1401: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.1402: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.1403: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.1404: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.1405: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1406: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.1407: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin
Source.1408: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.1409: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin
Source.1410: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.1411: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.1412: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein
Source.1413: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin
Source.1414: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.1415: DFBPPR7702 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.1416: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.1417: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin
Source.1418: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.1419: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.1420: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1421: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.1422: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1423: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1424: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.1425: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1426: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.1427: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.1428: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1
Source.1429: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.1430: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.1431: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.1432: DFBPPR8357 ---- Plant proteins ---- 2S albumin
Source.1433: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.1434: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.1435: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1436: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1437: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.1438: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.1439: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.1440: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.1441: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.1442: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1443: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1
Source.1444: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1445: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1446: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2
Source.1447: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.1448: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.1449: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.1450: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.1451: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin
Source.1452: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.1453: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1454: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1
Source.1455: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1456: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.1457: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1458: DFBPPR8509 ---- Milk proteins ---- Angiogenin-2
Source.1459: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1460: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor
Source.1461: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein
Source.1462: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.1463: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.1464: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.1465: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.1466: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.1467: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1468: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1469: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.1470: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1471: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.1472: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.1473: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.1474: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1475: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.1476: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.1477: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1478: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.1479: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.1480: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1481: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1482: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1483: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.1484: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.1485: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1486: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.1487: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1488: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.1489: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.1490: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.1491: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1492: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.1493: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1494: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.1495: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.1496: DFBPPR16072 ---- Animal proteins ---- Clusterin
Source.1497: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.1498: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1499: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.1500: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.1501: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.1502: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1503: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.1504: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.1505: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.1506: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1507: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.1508: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.1509: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.1510: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1511: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.1512: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule
Source.1513: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.1514: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1515: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.1516: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1517: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1518: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.1519: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.1520: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1521: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone
Source.1522: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1523: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.1524: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1525: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.1526: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.1527: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1528: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.1529: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1530: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1531: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.1532: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1533: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1534: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1535: DFBPPR16240 ---- Animal proteins ---- Fibronectin
Source.1536: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1537: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.1538: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.1539: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1540: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.1541: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1542: DFBPPR16273 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.1543: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.1544: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.1545: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2
Source.1546: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1547: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.1548: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.1549: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.1550: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.1551: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.1552: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.1553: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.1554: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.1555: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1556: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1557: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.1558: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.1559: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.1560: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.1561: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.1562: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.1563: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.1564: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.1565: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1566: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1567: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1568: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.1569: DFBPPR16483 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.1570: DFBPPR16486 ---- Animal proteins ---- Natriuretic peptides B
Source.1571: DFBPPR16487 ---- Animal proteins ---- Claudin-2
Source.1572: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1573: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.1574: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.1575: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.1576: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.1577: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.1578: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.1579: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.1580: DFBPPR16520 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.1581: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1582: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.1583: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.1584: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.1585: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.1586: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1587: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.1588: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1589: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.1590: DFBPPR16566 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta
Source.1591: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1592: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1593: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1594: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.1595: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1596: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.1597: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.1598: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.1599: DFBPPR16593 ---- Animal proteins ---- Calcyphosin
Source.1600: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.1601: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.1602: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.1603: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4
Source.1604: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1605: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.1606: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1607: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.1608: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.1609: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1
Source.1610: DFBPPR16661 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.1611: DFBPPR16678 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A
Source.1612: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.1613: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.1614: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.1615: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.1616: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1617: DFBPPR16721 ---- Animal proteins ---- Testin
Source.1618: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1619: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.1620: DFBPPR16799 ---- Animal proteins ---- Somatotropin
Source.1621: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.1622: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.1623: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.1624: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1625: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1626: DFBPPR16843 ---- Animal proteins ---- Calmodulin
Source.1627: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.1628: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.1629: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.1630: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.1631: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.1632: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.1633: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.1634: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.1635: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.1636: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.1637: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial
Source.1638: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.1639: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.1640: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1641: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.1642: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.1643: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.1644: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.1645: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13
Source.1646: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.1647: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1648: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.1649: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1650: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.1651: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.1652: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.1653: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.1654: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.1655: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.1656: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.1657: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.1658: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.1659: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.1660: DFBPPR16993 ---- Animal proteins ---- Protein S100-A10
Source.1661: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.1662: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17
Source.1663: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1664: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.1665: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.1666: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.1667: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.1668: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1669: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.1670: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1671: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1672: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.1673: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.1674: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.1675: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1676: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.1677: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.1678: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.1679: DFBPPR17113 ---- Animal proteins ---- Calcineurin B homologous protein 1
Source.1680: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.1681: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.1682: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.1683: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1684: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.1685: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.1686: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.1687: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.1688: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1
Source.1689: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.1690: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1691: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.1692: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.1693: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1694: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.1695: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.1696: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.1697: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.1698: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.1699: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.1700: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.1701: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.1702: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.1703: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.1704: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.1705: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.1706: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1707: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.1708: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1709: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.1710: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.1711: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1712: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.1713: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.1714: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.1715: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.1716: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.1717: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.1718: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1719: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.1720: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.1721: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.1722: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.1723: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1724: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.1725: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.1726: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.1727: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.1728: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.1729: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.1730: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1731: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.1732: DFBPPR17433 ---- Animal proteins ---- Caveolin-3
Source.1733: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.1734: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.1735: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1736: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.1737: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1738: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1739: DFBPPR17452 ---- Animal proteins ---- CD81 antigen
Source.1740: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.1741: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)]
Source.1742: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.1743: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.1744: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.1745: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.1746: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.1747: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1748: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.1749: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.1750: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.1751: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.1752: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.1753: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.1754: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.1755: DFBPPR17500 ---- Animal proteins ---- Lecithin retinol acyltransferase
Source.1756: DFBPPR17504 ---- Animal proteins ---- Duodenase-1
Source.1757: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1758: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.1759: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1760: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.1761: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.1762: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1763: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.1764: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.1765: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.1766: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.1767: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1768: DFBPPR17568 ---- Animal proteins ---- Interferon tau-2
Source.1769: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1770: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.1771: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.1772: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.1773: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.1774: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.1775: DFBPPR17594 ---- Animal proteins ---- E-selectin
Source.1776: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1777: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.1778: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.1779: DFBPPR17637 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial
Source.1780: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.1781: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.1782: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.1783: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.1784: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.1785: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.1786: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.1787: DFBPPR17749 ---- Animal proteins ---- CD9 antigen
Source.1788: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.1789: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.1790: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.1791: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.1792: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.1793: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.1794: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.1795: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.1796: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1797: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.1798: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.1799: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1800: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1801: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.1802: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.1803: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.1804: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.1805: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.1806: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.1807: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.1808: DFBPPR17858 ---- Animal proteins ---- Calsenilin
Source.1809: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.1810: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.1811: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.1812: DFBPPR17877 ---- Animal proteins ---- Syntaxin-7
Source.1813: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1
Source.1814: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor
Source.1815: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1816: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.1817: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.1818: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1819: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.1820: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.1821: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.1822: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.1823: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.1824: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial
Source.1825: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.1826: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.1827: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1828: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.1829: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1830: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.1831: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.1832: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1833: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.1834: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.1835: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.1836: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.1837: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.1838: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.1839: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.1840: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1841: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.1842: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.1843: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.1844: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.1845: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.1846: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.1847: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.1848: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.1849: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.1850: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.1851: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B
Source.1852: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.1853: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.1854: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1855: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2
Source.1856: DFBPPR18039 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.1857: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1858: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.1859: DFBPPR18054 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 9
Source.1860: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.1861: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.1862: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.1863: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.1864: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.1865: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.1866: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.1867: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.1868: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1869: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.1870: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1871: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase
Source.1872: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.1873: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1874: DFBPPR18106 ---- Animal proteins ---- Natriuretic peptides B
Source.1875: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.1876: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1877: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1878: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1879: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.1880: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.1881: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1882: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.1883: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B
Source.1884: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.1885: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1886: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.1887: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.1888: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.1889: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.1890: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.1891: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.1892: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a
Source.1893: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.1894: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.1895: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial
Source.1896: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.1897: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.1898: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1899: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1900: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.1901: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.1902: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.1903: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.1904: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.1905: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.1906: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.1907: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.1908: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1909: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.1910: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1911: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1912: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1913: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.1914: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1
Source.1915: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.1916: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.1917: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1918: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.1919: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.1920: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1921: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.1922: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.1923: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.1924: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.1925: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.1926: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3
Source.1927: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.1928: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.1929: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5
Source.1930: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.1931: DFBPPR18538 ---- Animal proteins ---- Vesicle-associated membrane protein 1
Source.1932: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.1933: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.1934: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor
Source.1935: DFBPPR18558 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.1936: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.1937: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.1938: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.1939: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1940: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6
Source.1941: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.1942: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.1943: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.1944: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1945: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1946: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.1947: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1948: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1949: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.1950: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.1951: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.1952: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.1953: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.1954: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.1955: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1956: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.1957: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.1958: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.1959: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.1960: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.1961: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.1962: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.1963: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.1964: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1965: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.1966: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1967: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.1968: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.1969: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9
Source.1970: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1971: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.1972: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.1973: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone
Source.1974: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A
Source.1975: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.1976: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.1977: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2
Source.1978: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.1979: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1980: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.1981: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.1982: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.1983: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.1984: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.1985: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.1986: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.1987: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.1988: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.1989: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1990: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1991: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1992: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.1993: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1994: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.1995: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.1996: DFBPPR18855 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.1997: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.1998: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.1999: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.2000: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.2001: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.2002: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.2003: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.2004: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2
Source.2005: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.2006: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.2007: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.2008: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.2009: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.2010: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.2011: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.2012: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.2013: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.2014: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.2015: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.2016: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.2017: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.2018: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.2019: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.2020: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.2021: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.2022: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.2023: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1
Source.2024: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.2025: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2026: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.2027: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2028: DFBPPR19045 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta
Source.2029: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.2030: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.2031: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.2032: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.2033: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.2034: DFBPPR19078 ---- Animal proteins ---- Cystatin-B
Source.2035: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.2036: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.2037: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.2038: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.2039: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.2040: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.2041: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.2042: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.2043: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.2044: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.2045: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2
Source.2046: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.2047: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.2048: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.2049: DFBPPR19148 ---- Animal proteins ---- Ribonuclease 4
Source.2050: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.2051: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.2052: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.2053: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2054: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain
Source.2055: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.2056: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.2057: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2058: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.2059: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1
Source.2060: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.2061: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha
Source.2062: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.2063: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.2064: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.2065: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.2066: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.2067: DFBPPR19280 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF183
Source.2068: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.2069: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.2070: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7
Source.2071: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.2072: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.2073: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.2074: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.2075: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.2076: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.2077: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.2078: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.2079: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.2080: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2081: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD
Source.2082: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3
Source.2083: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.2084: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.2085: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel
Source.2086: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1
Source.2087: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.2088: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A
Source.2089: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.2090: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.2091: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.2092: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.2093: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.2094: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.2095: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.2096: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.2097: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.2098: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.2099: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2100: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.2101: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.2102: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.2103: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.2104: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.2105: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.2106: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.2107: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.2108: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2109: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.2110: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.2111: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.2112: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.2113: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.2114: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2115: DFBPPR19519 ---- Animal proteins ---- DnaJ homolog subfamily C member 24
Source.2116: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.2117: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta
Source.2118: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1
Source.2119: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.2120: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.2121: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2122: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.2123: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.2124: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.2125: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.2126: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.2127: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.2128: DFBPPR19590 ---- Animal proteins ---- Norrin
Source.2129: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.2130: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2131: DFBPPR19610 ---- Animal proteins ---- RING finger protein 11
Source.2132: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2133: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.2134: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.2135: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.2136: DFBPPR19640 ---- Animal proteins ---- Prolargin
Source.2137: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.2138: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.2139: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.2140: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.2141: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.2142: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.2143: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.2144: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.2145: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2146: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7
Source.2147: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.2148: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.2149: DFBPPR19707 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.2150: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.2151: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.2152: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.2153: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.2154: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.2155: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.2156: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.2157: DFBPPR19769 ---- Animal proteins ---- Septin-14
Source.2158: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.2159: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.2160: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2161: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.2162: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.2163: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.2164: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.2165: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.2166: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4
Source.2167: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.2168: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.2169: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.2170: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.2171: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.2172: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.2173: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.2174: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.2175: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1
Source.2176: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC
Source.2177: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.2178: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B
Source.2179: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.2180: DFBPPR19894 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.2181: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.2182: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2183: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.2184: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2185: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.2186: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2187: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.2188: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.2189: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.2190: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.2191: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.2192: DFBPPR19972 ---- Animal proteins ---- Prefoldin subunit 5
Source.2193: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.2194: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.2195: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2196: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.2197: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.2198: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.2199: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.2200: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.2201: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.2202: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.2203: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.2204: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.2205: DFBPPR20030 ---- Animal proteins ---- Calumenin
Source.2206: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.2207: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.2208: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.2209: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.2210: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.2211: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.2212: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.2213: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2214: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2215: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.2216: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2217: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.2218: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1
Source.2219: DFBPPR20127 ---- Animal proteins ---- Protein BTG1
Source.2220: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.2221: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.2222: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.2223: DFBPPR20143 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.2224: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.2225: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.2226: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.2227: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.2228: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.2229: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.2230: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.2231: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.2232: DFBPPR20198 ---- Animal proteins ---- Calcium-binding protein 2
Source.2233: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.2234: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.2235: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1
Source.2236: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein
Source.2237: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.2238: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.2239: DFBPPR20225 ---- Animal proteins ---- Claudin-2
Source.2240: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.2241: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.2242: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1
Source.2243: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.2244: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2245: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.2246: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.2247: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.2248: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.2249: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.2250: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.2251: DFBPPR20292 ---- Animal proteins ---- Caltrin
Source.2252: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3
Source.2253: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.2254: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.2255: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.2256: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3
Source.2257: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2258: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.2259: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.2260: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.2261: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.2262: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1
Source.2263: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.2264: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2
Source.2265: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog
Source.2266: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.2267: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.2268: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4
Source.2269: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2270: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.2271: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.2272: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.2273: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.2274: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.2275: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.2276: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.2277: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.2278: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.2279: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.2280: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.2281: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.2282: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2
Source.2283: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.2284: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.2285: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.2286: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.2287: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.2288: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.2289: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.2290: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.2291: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.2292: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.2293: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.2294: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.2295: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.2296: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.2297: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.2298: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.2299: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2300: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1
Source.2301: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2302: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.2303: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2
Source.2304: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.2305: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.2306: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.2307: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.2308: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10
Source.2309: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.2310: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.2311: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.2312: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.2313: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.2314: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.2315: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.2316: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.2317: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.2318: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.2319: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.2320: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.2321: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.2322: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.2323: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.2324: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.2325: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.2326: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.2327: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.2328: DFBPPR20787 ---- Animal proteins ---- UBX domain-containing protein 8
Source.2329: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.2330: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2331: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.2332: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4
Source.2333: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.2334: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.2335: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.2336: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.2337: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.2338: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.2339: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.2340: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.2341: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein
Source.2342: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.2343: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.2344: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.2345: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10
Source.2346: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.2347: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.2348: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.2349: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2350: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2351: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.2352: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4
Source.2353: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.2354: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.2355: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.2356: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.2357: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.2358: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.2359: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.2360: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.2361: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.2362: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.2363: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.2364: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.2365: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.2366: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.2367: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.2368: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.2369: DFBPPR21081 ---- Animal proteins ---- Uteroglobin
Source.2370: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.2371: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.2372: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.2373: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.2374: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3
Source.2375: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein
Source.2376: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3
Source.2377: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.2378: DFBPPR21130 ---- Animal proteins ---- Transmembrane protein 17
Source.2379: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.2380: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.2381: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2382: DFBPPR21145 ---- Animal proteins ---- Transcription elongation factor SPT4
Source.2383: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.2384: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.2385: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.2386: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.2387: DFBPPR21188 ---- Animal proteins ---- High mobility group protein B4
Source.2388: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.2389: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.2390: DFBPPR21201 ---- Animal proteins ---- mRNA turnover protein 4 homolog
Source.2391: DFBPPR21204 ---- Animal proteins ---- ADP-ribosylation factor-like protein 5A
Source.2392: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.2393: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.2394: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2
Source.2395: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein
Source.2396: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36
Source.2397: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.2398: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.2399: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.2400: DFBPPR21272 ---- Animal proteins ---- Testin
Source.2401: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2402: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.2403: DFBPPR21281 ---- Animal proteins ---- 28S ribosomal protein S36, mitochondrial
Source.2404: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.2405: DFBPPR21285 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.2406: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.2407: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.2408: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58
Source.2409: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.2410: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.2411: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.2412: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.2413: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3
Source.2414: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.2415: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.2416: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.2417: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.2418: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.2419: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.2420: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.2421: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.2422: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.2423: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.2424: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.2425: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.2426: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.2427: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.2428: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.2429: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.2430: DFBPPR21428 ---- Animal proteins ---- Protein LBH
Source.2431: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.2432: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.2433: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.2434: DFBPPR21453 ---- Animal proteins ---- Centrosomal protein of 19 kDa
Source.2435: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.2436: DFBPPR21463 ---- Animal proteins ---- Protein BEX2
Source.2437: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2438: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.2439: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.2440: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.2441: DFBPPR21477 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 35
Source.2442: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2
Source.2443: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.2444: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.2445: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.2446: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2
Source.2447: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.2448: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.2449: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3
Source.2450: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.2451: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40
Source.2452: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.2453: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.2454: DFBPPR21510 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.2455: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.2456: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2
Source.2457: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.2458: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.2459: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.2460: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.2461: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.2462: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.2463: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2464: DFBPPR21578 ---- Animal proteins ---- Calcium-binding protein 5
Source.2465: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2466: DFBPPR21590 ---- Animal proteins ---- Rhombotin-1
Source.2467: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.2468: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.2469: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.2470: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.2471: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.2472: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.2473: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.2474: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.2475: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.2476: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2
Source.2477: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11
Source.2478: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18
Source.2479: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.2480: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.2481: DFBPPR21703 ---- Animal proteins ---- RRP15-like protein
Source.2482: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog
Source.2483: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.2484: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.2485: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.2486: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A
Source.2487: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.2488: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.2489: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.2490: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.2491: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.2492: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.2493: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.2494: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.2495: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.2496: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.2497: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial
Source.2498: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.2499: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.2500: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.2501: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.2502: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.2503: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.2504: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.2505: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2
Source.2506: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.2507: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.2508: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.2509: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.2510: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.2511: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39
Source.2512: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.2513: DFBPPR21901 ---- Animal proteins ---- Calcyphosin
Source.2514: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.2515: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13
Source.2516: DFBPPR21934 ---- Animal proteins ---- Transcription elongation factor A protein-like 8
Source.2517: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.2518: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.2519: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.2520: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.2521: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.2522: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2523: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein
Source.2524: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.2525: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.2526: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.2527: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.2528: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2529: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.2530: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.2531: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.2532: DFBPPR22083 ---- Animal proteins ---- 40S ribosomal protein S15a
Source.2533: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.2534: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.2535: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.2536: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.2537: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.2538: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1
Source.2539: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.2540: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.2541: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.2542: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.2543: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.2544: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.2545: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.2546: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.2547: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1
Source.2548: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.2549: DFBPPR22172 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX14
Source.2550: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.2551: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.2552: DFBPPR22212 ---- Animal proteins ---- Protein Asterix
Source.2553: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8
Source.2554: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.2555: DFBPPR22248 ---- Animal proteins ---- rRNA-processing protein FCF1 homolog
Source.2556: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein
Source.2557: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.2558: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7
Source.2559: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.2560: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.2561: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.2562: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.2563: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like
Source.2564: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247
Source.2565: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.2566: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.2567: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1
Source.2568: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.2569: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.2570: DFBPPR22410 ---- Animal proteins ---- Small acidic protein
Source.2571: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1
Source.2572: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog
Source.2573: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18
Source.2574: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.2575: DFBPPR22461 ---- Animal proteins ---- Ashwin
Source.2576: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.2577: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.2578: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.2579: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.2580: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.2581: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.2582: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.2583: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251
Source.2584: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.2585: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.2586: DFBPPR22550 ---- Animal proteins ---- Leucine-rich repeat-containing protein 23
Source.2587: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog
Source.2588: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein
Source.2589: DFBPPR22564 ---- Animal proteins ---- cAMP-dependent protein kinase inhibitor gamma
Source.2590: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.2591: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog
Source.2592: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171
Source.2593: DFBPPR22590 ---- Animal proteins ---- Transmembrane protein 267
Source.2594: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.2595: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.2596: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.2597: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.2598: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4
Source.2599: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.2600: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.2601: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.2602: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.2603: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.2604: DFBPPR22683 ---- Animal proteins ---- LYR motif-containing protein 2
Source.2605: DFBPPR22702 ---- Animal proteins ---- Coiled-coil domain-containing protein 83
Source.2606: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.2607: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.2608: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog
Source.2609: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog
Source.2610: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.2611: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.2612: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.2613: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.2614: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.2615: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.2616: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.2617: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.2618: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.2619: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.2620: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.2621: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.2622: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.2623: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.2624: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.2625: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.2626: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2
Source.2627: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.2628: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.2629: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2630: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.2631: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.2632: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.2633: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2634: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A
Source.2635: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.2636: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.2637: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.2638: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.2639: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.2640: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.2641: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.2642: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.2643: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.2644: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.2645: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2646: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.2647: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.2648: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2649: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.2650: DFBPPR8698 ---- Animal proteins ---- Prorelaxin
Source.2651: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.2652: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.2653: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2654: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.2655: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.2656: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.2657: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.2658: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.2659: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.2660: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.2661: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.2662: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.2663: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.2664: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.2665: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2666: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.2667: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.2668: DFBPPR8759 ---- Animal proteins ---- Caveolin-3
Source.2669: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.2670: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1
Source.2671: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2672: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2673: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.2674: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2675: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone
Source.2676: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.2677: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.2678: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.2679: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.2680: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.2681: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.2682: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.2683: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.2684: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.2685: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.2686: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2687: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.2688: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.2689: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.2690: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.2691: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic
Source.2692: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.2693: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.2694: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.2695: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.2696: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.2697: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.2698: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.2699: DFBPPR9056 ---- Animal proteins ---- Protein S100-A11
Source.2700: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.2701: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.2702: DFBPPR9072 ---- Animal proteins ---- CD9 antigen
Source.2703: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2704: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2705: DFBPPR9091 ---- Animal proteins ---- Antileukoproteinase
Source.2706: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.2707: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.2708: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2709: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.2710: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2711: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2712: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2713: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.2714: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2715: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.2716: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.2717: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.2718: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.2719: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.2720: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2721: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2722: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.2723: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein
Source.2724: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.2725: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.2726: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.2727: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.2728: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.2729: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.2730: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.2731: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.2732: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.2733: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.2734: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4
Source.2735: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.2736: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2737: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.2738: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.2739: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.2740: DFBPPR9285 ---- Animal proteins ---- Saposin-B-Val
Source.2741: DFBPPR9292 ---- Animal proteins ---- Protein S100-A10
Source.2742: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.2743: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.2744: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.2745: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.2746: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.2747: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3
Source.2748: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.2749: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2750: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.2751: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.2752: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2753: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.2754: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.2755: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2756: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2757: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.2758: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.2759: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.2760: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.2761: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.2762: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.2763: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.2764: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.2765: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.2766: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.2767: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.2768: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.2769: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.2770: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2771: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.2772: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.2773: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2774: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.2775: DFBPPR9455 ---- Animal proteins ---- Cystatin-B
Source.2776: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.2777: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.2778: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.2779: DFBPPR9487 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.2780: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.2781: DFBPPR9505 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial
Source.2782: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.2783: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.2784: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.2785: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.2786: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.2787: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.2788: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2789: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.2790: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.2791: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.2792: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.2793: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.2794: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2795: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.2796: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin
Source.2797: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.2798: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.2799: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.2800: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2801: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.2802: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.2803: DFBPPR9652 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.2804: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.2805: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.2806: DFBPPR9668 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.2807: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.2808: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.2809: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial
Source.2810: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.2811: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2812: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.2813: DFBPPR9708 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.2814: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.2815: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2816: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.2817: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2818: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2819: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.2820: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2
Source.2821: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2822: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.2823: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1
Source.2824: DFBPPR9814 ---- Animal proteins ---- Testin
Source.2825: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.2826: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2827: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.2828: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.2829: DFBPPR9843 ---- Animal proteins ---- P protein
Source.2830: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.2831: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.2832: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1
Source.2833: DFBPPR9891 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.2834: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.2835: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.2836: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.2837: DFBPPR9911 ---- Animal proteins ---- Protein Asterix
Source.2838: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.2839: DFBPPR9922 ---- Animal proteins ---- cAMP-dependent protein kinase inhibitor gamma
Source.2840: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2841: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251
Source.2842: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.2843: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.2844: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.2845: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.2846: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.2847: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.2848: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.2849: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2850: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.2851: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein
Source.2852: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6
Source.2853: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.2854: DFBPPR10031 ---- Animal proteins ---- Calcineurin B homologous protein 1
Source.2855: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.2856: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.2857: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.2858: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.2859: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.2860: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.2861: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2862: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2863: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.2864: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.2865: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.2866: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.2867: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.2868: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.2869: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2870: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.2871: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.2872: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.2873: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.2874: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.2875: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.2876: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2877: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.2878: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.2879: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.2880: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.2881: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.2882: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.2883: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.2884: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.2885: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.2886: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.2887: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.2888: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.2889: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.2890: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.2891: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1
Source.2892: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.2893: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.2894: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2895: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1
Source.2896: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.2897: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.2898: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.2899: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.2900: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.2901: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.2902: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.2903: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.2904: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.2905: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.2906: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain
Source.2907: DFBPPR10250 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.2908: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.2909: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.2910: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.2911: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.2912: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.2913: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2914: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.2915: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.2916: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.2917: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.2918: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.2919: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2920: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.2921: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.2922: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.2923: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.2924: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.2925: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.2926: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.2927: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.2928: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.2929: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.2930: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.2931: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2932: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.2933: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.2934: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.2935: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.2936: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.2937: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.2938: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.2939: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.2940: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2941: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2942: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.2943: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.2944: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.2945: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.2946: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.2947: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2948: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.2949: DFBPPR10434 ---- Animal proteins ---- Parathyroid hormone
Source.2950: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.2951: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.2952: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.2953: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.2954: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.2955: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.2956: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.2957: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.2958: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.2959: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.2960: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.2961: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.2962: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6
Source.2963: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.2964: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.2965: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.2966: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.2967: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.2968: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.2969: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.2970: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.2971: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.2972: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.2973: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.2974: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.2975: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.2976: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.2977: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.2978: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.2979: DFBPPR10546 ---- Animal proteins ---- Calmodulin
Source.2980: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2981: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.2982: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.2983: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.2984: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2985: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.2986: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.2987: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.2988: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.2989: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.2990: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.2991: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.2992: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.2993: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.2994: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.2995: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.2996: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.2997: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.2998: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.2999: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.3000: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.3001: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.3002: DFBPPR10640 ---- Animal proteins ---- Caveolin-1
Source.3003: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.3004: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.3005: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.3006: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3007: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.3008: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.3009: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.3010: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.3011: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.3012: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.3013: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3014: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3015: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.3016: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.3017: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3018: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.3019: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.3020: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.3021: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3022: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3023: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.3024: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.3025: DFBPPR10758 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.3026: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.3027: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein
Source.3028: DFBPPR10779 ---- Animal proteins ---- Natriuretic peptides A
Source.3029: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.3030: DFBPPR10787 ---- Animal proteins ---- Angiogenin
Source.3031: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.3032: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.3033: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.3034: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.3035: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.3036: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3037: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.3038: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.3039: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.3040: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.3041: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.3042: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.3043: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2
Source.3044: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.3045: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.3046: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.3047: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.3048: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.3049: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.3050: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.3051: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.3052: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.3053: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.3054: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.3055: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.3056: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.3057: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.3058: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.3059: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.3060: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.3061: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.3062: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.3063: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.3064: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.3065: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.3066: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.3067: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.3068: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3069: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.3070: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.3071: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.3072: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.3073: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.3074: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.3075: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.3076: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.3077: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.3078: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.3079: DFBPPR11031 ---- Animal proteins ---- Ribonuclease homolog
Source.3080: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.3081: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.3082: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.3083: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.3084: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.3085: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.3086: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3087: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.3088: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.3089: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.3090: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.3091: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.3092: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.3093: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.3094: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.3095: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.3096: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.3097: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.3098: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.3099: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3100: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.3101: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.3102: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.3103: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.3104: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3105: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.3106: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.3107: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.3108: DFBPPR11185 ---- Animal proteins ---- Adenosine deaminase 2
Source.3109: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.3110: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.3111: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.3112: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.3113: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3114: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.3115: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.3116: DFBPPR11209 ---- Animal proteins ---- Protein S100-A11
Source.3117: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.3118: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.3119: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.3120: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.3121: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.3122: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.3123: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.3124: DFBPPR11253 ---- Animal proteins ---- Peripherin-2
Source.3125: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.3126: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.3127: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.3128: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.3129: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3130: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.3131: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3132: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.3133: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.3134: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.3135: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.3136: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.3137: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.3138: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.3139: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.3140: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.3141: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.3142: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.3143: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.3144: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.3145: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.3146: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.3147: DFBPPR11397 ---- Animal proteins ---- Frizzled-3
Source.3148: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.3149: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.3150: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.3151: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.3152: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.3153: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.3154: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.3155: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.3156: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.3157: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.3158: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.3159: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.3160: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.3161: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.3162: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.3163: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a
Source.3164: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.3165: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.3166: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.3167: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.3168: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.3169: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.3170: DFBPPR11498 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.3171: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X
Source.3172: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.3173: DFBPPR11508 ---- Animal proteins ---- Cellular retinoic acid-binding protein 2
Source.3174: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.3175: DFBPPR11518 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3176: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3177: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.3178: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.3179: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.3180: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform
Source.3181: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.3182: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.3183: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.3184: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.3185: DFBPPR11549 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.3186: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.3187: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.3188: DFBPPR11554 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3189: DFBPPR11557 ---- Animal proteins ---- Regulator of G-protein signaling 17
Source.3190: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC
Source.3191: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.3192: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.3193: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.3194: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.3195: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.3196: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.3197: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230
Source.3198: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.3199: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.3200: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.3201: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3202: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.3203: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3204: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.3205: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.3206: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon
Source.3207: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.3208: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3209: DFBPPR11649 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3210: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.3211: DFBPPR11657 ---- Animal proteins ---- Protein BTG1
Source.3212: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.3213: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.3214: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.3215: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.3216: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.3217: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.3218: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.3219: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.3220: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.3221: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.3222: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.3223: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.3224: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.3225: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.3226: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.3227: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.3228: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.3229: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.3230: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.3231: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1
Source.3232: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.3233: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.3234: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3
Source.3235: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.3236: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.3237: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.3238: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.3239: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.3240: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.3241: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62
Source.3242: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.3243: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.3244: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.3245: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.3246: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.3247: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.3248: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.3249: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.3250: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.3251: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.3252: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.3253: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z
Source.3254: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.3255: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.3256: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1
Source.3257: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.3258: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.3259: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.3260: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.3261: DFBPPR11856 ---- Animal proteins ---- Spindlin-W
Source.3262: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.3263: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.3264: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.3265: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.3266: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.3267: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1
Source.3268: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.3269: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.3270: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.3271: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.3272: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.3273: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.3274: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.3275: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.3276: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3
Source.3277: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.3278: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.3279: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.3280: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.3281: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.3282: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.3283: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle
Source.3284: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.3285: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.3286: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.3287: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.3288: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.3289: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.3290: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.3291: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.3292: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.3293: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.3294: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.3295: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.3296: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.3297: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.3298: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.3299: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.3300: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.3301: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.3302: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.3303: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.3304: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.3305: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.3306: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.3307: DFBPPR12065 ---- Animal proteins ---- Testin
Source.3308: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.3309: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.3310: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.3311: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.3312: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.3313: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.3314: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.3315: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.3316: DFBPPR12112 ---- Animal proteins ---- Protein LBH
Source.3317: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.3318: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.3319: DFBPPR12118 ---- Animal proteins ---- Protein EURL
Source.3320: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.3321: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.3322: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3323: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.3324: DFBPPR12133 ---- Animal proteins ---- Protein Asterix
Source.3325: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.3326: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.3327: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.3328: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.3329: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.3330: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin
Source.3331: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.3332: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.3333: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.3334: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.3335: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251
Source.3336: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.3337: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.3338: DFBPPR12203 ---- Animal proteins ---- Small acidic protein
Source.3339: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.3340: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.3341: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.3342: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.3343: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.3344: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.3345: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.3346: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3347: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.3348: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.3349: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.3350: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.3351: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.3352: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3353: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.3354: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.3355: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.3356: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.3357: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3358: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.3359: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.3360: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.3361: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.3362: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3363: DFBPPR12318 ---- Animal proteins ---- Endothelin-1
Source.3364: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.3365: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.3366: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.3367: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.3368: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.3369: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.3370: DFBPPR12333 ---- Animal proteins ---- Angiogenin
Source.3371: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3372: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3373: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.3374: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3375: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.3376: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.3377: DFBPPR12350 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.3378: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3379: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.3380: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.3381: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.3382: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.3383: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.3384: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.3385: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3386: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.3387: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.3388: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.3389: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3390: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.3391: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.3392: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.3393: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3394: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.3395: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.3396: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.3397: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.3398: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.3399: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.3400: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.3401: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.3402: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.3403: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.3404: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.3405: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3406: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.3407: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.3408: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3409: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.3410: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.3411: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.3412: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.3413: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.3414: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.3415: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3416: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.3417: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.3418: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.3419: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin
Source.3420: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.3421: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.3422: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.3423: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.3424: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.3425: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3426: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3427: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.3428: DFBPPR12560 ---- Animal proteins ---- Calumenin
Source.3429: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.3430: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.3431: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.3432: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3433: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3434: DFBPPR12585 ---- Animal proteins ---- Calmodulin
Source.3435: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase
Source.3436: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.3437: DFBPPR12611 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A
Source.3438: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.3439: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.3440: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.3441: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.3442: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.3443: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.3444: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.3445: DFBPPR12680 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.3446: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.3447: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.3448: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.3449: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.3450: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2
Source.3451: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.3452: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3453: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.3454: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.3455: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.3456: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.3457: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.3458: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.3459: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.3460: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3461: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.3462: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.3463: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.3464: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.3465: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.3466: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.3467: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.3468: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.3469: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.3470: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3471: DFBPPR12825 ---- Animal proteins ---- Bleomycin hydrolase
Source.3472: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3473: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.3474: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.3475: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.3476: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.3477: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.3478: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.3479: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.3480: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.3481: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.3482: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.3483: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3484: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.3485: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3486: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3487: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.3488: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.3489: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.3490: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3491: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.3492: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.3493: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.3494: DFBPPR13003 ---- Animal proteins ---- Calcyphosin
Source.3495: DFBPPR13004 ---- Animal proteins ---- Protein S100-A10
Source.3496: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3497: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3498: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3499: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.3500: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.3501: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.3502: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.3503: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3504: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.3505: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1
Source.3506: DFBPPR13054 ---- Animal proteins ---- Relaxin-like protein SQ10
Source.3507: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.3508: DFBPPR13092 ---- Animal proteins ---- Testin
Source.3509: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.3510: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3511: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3512: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3513: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.3514: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3515: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.3516: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.3517: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.3518: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3519: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.3520: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.3521: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.3522: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.3523: DFBPPR13209 ---- Animal proteins ---- Parathyroid hormone
Source.3524: DFBPPR13210 ---- Animal proteins ---- Angiogenin
Source.3525: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3526: DFBPPR13233 ---- Animal proteins ---- Fibronectin
Source.3527: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3528: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.3529: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3530: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.3531: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.3532: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.3533: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.3534: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2
Source.3535: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.3536: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3537: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.3538: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.3539: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3540: DFBPPR13330 ---- Animal proteins ---- Uterocalin
Source.3541: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.3542: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3543: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3544: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.3545: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3546: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3547: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3548: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3549: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3550: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.3551: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.3552: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3553: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3554: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3555: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3556: DFBPPR13409 ---- Animal proteins ---- Testin
Source.3557: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3558: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.3559: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3560: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3561: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.3562: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.3563: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.3564: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.3565: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.3566: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3567: DFBPPR13464 ---- Animal proteins ---- Interferon tau
Source.3568: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3569: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.3570: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3571: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.3572: DFBPPR13481 ---- Animal proteins ---- Somatotropin
Source.3573: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.3574: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.3575: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3576: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3577: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3578: DFBPPR13540 ---- Animal proteins ---- Somatotropin
Source.3579: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1
Source.3580: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3581: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.3582: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3583: DFBPPR13564 ---- Animal proteins ---- Calmodulin
Source.3584: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3585: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.3586: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3587: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.3588: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3589: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3590: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.3591: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.3592: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3593: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.3594: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3595: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.3596: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3597: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.3598: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3599: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.3600: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.3601: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2
Source.3602: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.3603: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.3604: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6
Source.3605: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11
Source.3606: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.3607: DFBPPR13667 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.3608: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.3609: DFBPPR13679 ---- Animal proteins ---- Interferon tau-3
Source.3610: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.3611: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.3612: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1
Source.3613: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.3614: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.3615: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10
Source.3616: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.3617: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5
Source.3618: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9
Source.3619: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8
Source.3620: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7
Source.3621: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4
Source.3622: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.3623: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.3624: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.3625: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A
Source.3626: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3627: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.3628: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel
Source.3629: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.3630: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.3631: DFBPPR13832 ---- Animal proteins ---- Cystatin-B
Source.3632: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3633: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3634: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3635: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.3636: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3637: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.3638: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3639: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3640: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3
Source.3641: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.3642: DFBPPR13897 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.3643: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3644: DFBPPR13899 ---- Animal proteins ---- Natriuretic peptides B
Source.3645: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.3646: DFBPPR13912 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3647: DFBPPR13916 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.3648: DFBPPR13918 ---- Animal proteins ---- Testin
Source.3649: DFBPPR13920 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.3650: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.3651: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.3652: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3653: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3654: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.3655: DFBPPR13991 ---- Animal proteins ---- Osteocalcin
Source.3656: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.3657: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.3658: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.3659: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.3660: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.3661: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.3662: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1
Source.3663: DFBPPR14029 ---- Animal proteins ---- Gamma-crystallin M1
Source.3664: DFBPPR14030 ---- Animal proteins ---- Prepro-urotensin II-gamma
Source.3665: DFBPPR14031 ---- Animal proteins ---- Prepro-urotensin II-alpha
Source.3666: DFBPPR14035 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3667: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3668: DFBPPR14043 ---- Animal proteins ---- Prolactin
Source.3669: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.3670: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3671: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2
Source.3672: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog
Source.3673: DFBPPR14072 ---- Marine protein ---- Prolactin
Source.3674: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.3675: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3676: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.3677: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.3678: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.3679: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.3680: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.3681: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.3682: DFBPPR14127 ---- Marine protein ---- RNA-binding protein 8A
Source.3683: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.3684: DFBPPR14132 ---- Marine protein ---- Calumenin-A
Source.3685: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H
Source.3686: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.3687: DFBPPR14152 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3688: DFBPPR14153 ---- Marine protein ---- Progonadoliberin-3
Source.3689: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.3690: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12
Source.3691: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.3692: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.3693: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.3694: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.3695: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.3696: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.3697: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.3698: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.3699: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.3700: DFBPPR14221 ---- Marine protein ---- LYR motif-containing protein 2
Source.3701: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.3702: DFBPPR14232 ---- Marine protein ---- Prolactin-2
Source.3703: DFBPPR14233 ---- Marine protein ---- Prolactin-1
Source.3704: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.3705: DFBPPR14238 ---- Marine protein ---- Insulin
Source.3706: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.3707: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.3708: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.3709: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.3710: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.3711: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.3712: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.3713: DFBPPR14301 ---- Marine protein ---- ATP synthase subunit b', chloroplastic
Source.3714: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.3715: DFBPPR14315 ---- Marine protein ---- Protein CfxQ homolog
Source.3716: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.3717: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3718: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.3719: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.3720: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.3721: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.3722: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.3723: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.3724: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.3725: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.3726: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.3727: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.3728: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.3729: DFBPPR14456 ---- Marine protein ---- Uncharacterized protein ycf17
Source.3730: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29
Source.3731: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic
Source.3732: DFBPPR14476 ---- Marine protein ---- Protein CfxQ homolog
Source.3733: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.3734: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.3735: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.3736: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.3737: DFBPPR14556 ---- Marine protein ---- Interleukin-1 beta
Source.3738: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3739: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.3740: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.3741: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3742: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.3743: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.3744: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.3745: DFBPPR14578 ---- Marine protein ---- Prolactin
Source.3746: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.3747: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.3748: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.3749: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.3750: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.3751: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.3752: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.3753: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.3754: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3755: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.3756: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.3757: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.3758: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1
Source.3759: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.3760: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.3761: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.3762: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.3763: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.3764: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.3765: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.3766: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.3767: DFBPPR14659 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3768: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2
Source.3769: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.3770: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.3771: DFBPPR14697 ---- Marine protein ---- Progonadoliberin-3
Source.3772: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64
Source.3773: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.3774: DFBPPR14731 ---- Marine protein ---- Cytochrome c oxidase polypeptide VIIc
Source.3775: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B
Source.3776: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.3777: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.3778: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2
Source.3779: DFBPPR14763 ---- Marine protein ---- Tachyplesin-1
Source.3780: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.3781: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.3782: DFBPPR14766 ---- Marine protein ---- Tachyplesin-2
Source.3783: DFBPPR14775 ---- Marine protein ---- Troponin C
Source.3784: DFBPPR14787 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform A
Source.3785: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.3786: DFBPPR14805 ---- Marine protein ---- Probable molt-inhibiting hormone
Source.3787: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.3788: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.3789: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.3790: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.3791: DFBPPR14820 ---- Marine protein ---- Troponin C, isoform 1
Source.3792: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B
Source.3793: DFBPPR14833 ---- Marine protein ---- Troponin C, isoform 2A
Source.3794: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3795: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.3796: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.3797: DFBPPR14869 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.3798: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle
Source.3799: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.3800: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.3801: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.3802: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.3803: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.3804: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.3805: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.3806: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.3807: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.3808: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.3809: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.3810: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.3811: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.3812: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.3813: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.3814: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.3815: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.3816: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.3817: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.3818: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.3819: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.3820: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.3821: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.3822: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.3823: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.3824: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.3825: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.3826: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.3827: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.3828: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.3829: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.3830: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.3831: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.3832: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.3833: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.3834: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.3835: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.3836: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.3837: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.3838: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.3839: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.3840: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.3841: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.3842: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.3843: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28
Source.3844: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.3845: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.3846: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.3847: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.3848: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.3849: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.3850: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.3851: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.3852: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.3853: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.3854: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.3855: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.3856: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.3857: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.3858: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.3859: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.3860: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase
Source.3861: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13
Source.3862: DFBPPR15200 ---- Microorganism protein ---- Protein SPT3
Source.3863: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.3864: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.3865: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.3866: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.3867: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.3868: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.3869: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.3870: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.3871: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.3872: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.3873: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.3874: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.3875: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.3876: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.3877: DFBPPR15307 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 21
Source.3878: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.3879: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.3880: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.3881: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.3882: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.3883: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.3884: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.3885: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.3886: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.3887: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.3888: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.3889: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.3890: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.3891: DFBPPR15366 ---- Microorganism protein ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.3892: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.3893: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.3894: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.3895: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.3896: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.3897: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.3898: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.3899: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.3900: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.3901: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2
Source.3902: DFBPPR15478 ---- Microorganism protein ---- COP9 signalosome complex subunit 9
Source.3903: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.3904: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.3905: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.3906: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.3907: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.3908: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.3909: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.3910: DFBPPR15515 ---- Microorganism protein ---- Tethering factor for nuclear proteasome STS1
Source.3911: DFBPPR15517 ---- Microorganism protein ---- rRNA biogenesis protein RRP36
Source.3912: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.3913: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.3914: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.3915: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.3916: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.3917: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.3918: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1
Source.3919: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.3920: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.3921: DFBPPR15579 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit CNL1
Source.3922: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.3923: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.3924: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.3925: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.3926: DFBPPR15596 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit BLS1
Source.3927: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.3928: DFBPPR15607 ---- Microorganism protein ---- Histone H2A.Z-specific chaperone CHZ1
Source.3929: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.3930: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.3931: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.3932: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.3933: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11
Source.3934: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3
Source.3935: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.3936: DFBPPR15648 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 2
Source.3937: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.3938: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.3939: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.3940: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.3941: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.3942: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.3943: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.3944: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.3945: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.3946: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.3947: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.3948: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.3949: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.3950: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11
Source.3951: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.3952: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.3953: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component
Source.3954: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.3955: DFBPPR15802 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurQ
Source.3956: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.3957: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.3958: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.3959: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.3960: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.3961: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.3962: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.3963: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.3964: DFBPPR15845 ---- Microorganism protein ---- Calmodulin
Source.3965: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.3966: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.3967: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.3968: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.3969: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.3970: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.3971: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.3972: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.3973: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.3974: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.3975: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.3976: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.3977: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.3978: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.3979: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.3980: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.3981: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.3982: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.3983: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3984: DFBPPR7799 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.3985: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.3986: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.3987: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase
Source.3988: DFBPPR7832 ---- Plant protein ---- Extensin
Source.3989: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.3990: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.3991: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.3992: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.3993: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.3994: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.3995: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.3996: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.3997: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.3998: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4
Source.3999: DFBPPR7869 ---- Plant protein ---- Alpha-amylase inhibitor 5
Source.4000: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4001: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.4002: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a
Source.4003: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4004: DFBPPR7986 ---- Plant protein ---- Uncharacterized mitochondrial protein ORF154
Source.4005: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4006: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.4007: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.4008: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.4009: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1
Source.4010: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.4011: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.4012: DFBPPR8049 ---- Plant protein ---- Bowman-Birk type proteinase inhibitor 2
Source.4013: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.4014: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.4015: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.4016: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.4017: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.4018: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.4019: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.4020: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4021: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4022: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.4023: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.4024: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.4025: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.4026: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.4027: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4028: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.4029: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.4030: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.4031: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4032: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.4033: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.4034: DFBPPR8228 ---- Plant protein ---- Albumin-8
Source.4035: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.4036: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.4037: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.4038: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.4039: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4040: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.4041: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4042: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.4043: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.4044: DFBPPR8284 ---- Plant protein ---- Calmodulin
Source.4045: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.4046: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.4047: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4048: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein
Source.4049: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein
Source.4050: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The peptide with the sequence MM exhibited moderate oxygen radical-scavenging activity (ORAC-FL value of 0.64 ± 0.03 μmol Trolox* equivalents per μmol of peptide).
*Trolox - 6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid, a water-soluble derivative of vitamin E.

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools No prediction can be made about the peptide bitterness. prediction
SMILES N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCSC)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

In vitro simulated gastrointestinal digestion (Trypsin + Pepsin + α-Chymotrypsin) was performed to evaluate changes in bioactive properties of Poultry protein hydrolysate HCP Premium P150 (PPH) showing strong antioxidant and moderate ACE-inhibitory activity.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The digested Poultry protein hydrolysate HCP Premium P150 proved to be a rich source of antioxidant and ACE inhibiting molecules and could be a potential new food ingredient used for prevention or treatment of socially significant diseases.

Database cross-references
DFBP
[D1] DFBPACEI1781
[D2] DFBPDPIV0209
[D3] DFBPMUFU0525
BIOPEP-UWM [D4] 8833, 9085, 9086
APD [D5] -
BioPepDB [D6] -
MBPDB [D7] -
Reference(s)
Primary literature Anna, T., Alexey, K., Anna, B., Vyacheslav, K., Mikhail, T., Ulia, M. Effect of in Vitro Gastrointestinal Digestion on Bioactivity of Poultry Protein Hydrolysate. Current Research in Nutrition and Food Science Journal. 2016, 4, 77-86.
Other literature(s) N.D
PubDate 2016
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214