Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0813(Antioxidative peptide)

DFBP ID	DFBPANOX0813
Peptide sequence	ALA
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ala-Leu-Ala

Single-letter amino acid

ALA

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	273.32 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

2.4667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2 Source.2: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.4: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.5: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.6: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.7: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.8: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.9: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.10: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.11: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.12: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.13: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.14: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.15: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.16: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.17: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.18: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46 Source.19: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.20: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.21: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.22: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A Source.23: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.24: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.25: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.26: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.27: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.28: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.29: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.30: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.31: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.32: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.33: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.34: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.35: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.36: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.37: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.38: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial Source.39: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.40: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.41: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.42: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1 Source.43: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.44: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.45: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.46: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.47: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.48: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.49: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.50: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.51: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3 Source.52: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.53: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9 Source.54: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.55: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.56: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.57: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.58: DFBPPR0971 ---- Plant proteins ---- Protein STAR1 Source.59: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.60: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.61: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.62: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.63: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185 Source.64: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.65: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.66: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.67: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1 Source.68: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA Source.69: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.70: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.71: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.72: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.73: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.74: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.75: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.76: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.77: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1 Source.78: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.79: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.80: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2 Source.81: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.82: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.83: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.84: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.85: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.86: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.87: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4 Source.88: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1 Source.89: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.90: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.91: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.92: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.93: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.94: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE Source.95: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.96: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.97: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.98: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.99: DFBPPR1101 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 2 Source.100: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3 Source.101: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.102: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.103: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial Source.104: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.105: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.106: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.107: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.108: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.109: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.110: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4 Source.111: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.112: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.113: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6 Source.114: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.115: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.116: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.117: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.118: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog Source.119: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.120: DFBPPR1142 ---- Plant proteins ---- Calreticulin Source.121: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13 Source.122: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.123: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.124: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.125: DFBPPR1150 ---- Plant proteins ---- Abscisic stress-ripening protein 5 Source.126: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2 Source.127: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13 Source.128: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17 Source.129: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.130: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.131: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.132: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic Source.133: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.134: DFBPPR1176 ---- Plant proteins ---- Chitinase 12 Source.135: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.136: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA Source.137: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.138: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.139: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.140: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4 Source.141: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic Source.142: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial Source.143: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.144: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.145: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.146: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.147: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.148: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.149: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic Source.150: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.151: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic Source.152: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.153: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.154: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3 Source.155: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.156: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.157: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.158: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic Source.159: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.160: DFBPPR1292 ---- Plant proteins ---- Chitinase 3 Source.161: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.162: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22 Source.163: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.164: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.165: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.166: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.167: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2 Source.168: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.169: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.170: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.171: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.172: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.173: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.174: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.175: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.176: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5 Source.177: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.178: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.179: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.180: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.181: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.182: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.183: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.184: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2 Source.185: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.186: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.187: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.188: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.189: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.190: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.191: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.192: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.193: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B Source.194: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.195: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.196: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.197: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.198: DFBPPR1431 ---- Plant proteins ---- Glutaredoxin-C6 Source.199: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.200: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic Source.201: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.202: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.203: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.204: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.205: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8 Source.206: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.207: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.208: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2 Source.209: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.210: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.211: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.212: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.213: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.214: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase Source.215: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.216: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.217: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.218: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.219: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3 Source.220: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.221: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.222: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.223: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.224: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.225: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.226: DFBPPR1497 ---- Plant proteins ---- Chitinase 1 Source.227: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.228: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.229: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.230: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.231: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F Source.232: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.233: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.234: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.235: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.236: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.237: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.238: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.239: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.240: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.241: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.242: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.243: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.244: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.245: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1 Source.246: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.247: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.248: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3 Source.249: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A Source.250: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.251: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33 Source.252: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17 Source.253: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.254: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.255: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.256: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.257: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8 Source.258: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.259: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.260: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.261: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic Source.262: DFBPPR1600 ---- Plant proteins ---- Phytosulfokines 5 Source.263: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.264: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.265: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.266: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2 Source.267: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.268: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.269: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.270: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7 Source.271: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a Source.272: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.273: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.274: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.275: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.276: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.277: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.278: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.279: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.280: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.281: DFBPPR1642 ---- Plant proteins ---- Ubiquitin-60S ribosomal protein L40-1 Source.282: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.283: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.284: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.285: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.286: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1 Source.287: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.288: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial Source.289: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.290: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.291: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.292: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.293: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.294: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.295: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.296: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.297: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.298: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic Source.299: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.300: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.301: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.302: DFBPPR1696 ---- Plant proteins ---- Phytosulfokines 2 Source.303: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.304: DFBPPR1706 ---- Plant proteins ---- Phytosulfokines 4 Source.305: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.306: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.307: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.308: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.309: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.310: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.311: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.312: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.313: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP Source.314: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic Source.315: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.316: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.317: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.318: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.319: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3 Source.320: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.321: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.322: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.323: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.324: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.325: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.326: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.327: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1 Source.328: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.329: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.330: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.331: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1 Source.332: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.333: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.334: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.335: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.336: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.337: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.338: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.339: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.340: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.341: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.342: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.343: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B Source.344: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.345: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.346: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.347: DFBPPR1833 ---- Plant proteins ---- Ubiquitin-60S ribosomal protein L40-2 Source.348: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3 Source.349: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.350: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.351: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.352: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.353: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.354: DFBPPR1847 ---- Plant proteins ---- Amidase 1 Source.355: DFBPPR1848 ---- Plant proteins ---- Chitinase 7 Source.356: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.357: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.358: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.359: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.360: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.361: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.362: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.363: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.364: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.365: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B Source.366: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4 Source.367: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3 Source.368: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.369: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.370: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.371: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.372: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.373: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.374: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.375: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.376: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.377: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.378: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10 Source.379: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A Source.380: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.381: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.382: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.383: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.384: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.385: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.386: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.387: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.388: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.389: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.390: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.391: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.392: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.393: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.394: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.395: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.396: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.397: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.398: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2 Source.399: DFBPPR1984 ---- Plant proteins ---- Histone H2B.10 Source.400: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.401: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.402: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28 Source.403: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.404: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.405: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.406: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A Source.407: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.408: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.409: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.410: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.411: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a Source.412: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.413: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.414: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.415: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.416: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.417: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.418: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.419: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.420: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.421: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3 Source.422: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.423: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.424: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.425: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa Source.426: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.427: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.428: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.429: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.430: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.431: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.432: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.433: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.434: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80 Source.435: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.436: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.437: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1 Source.438: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.439: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.440: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.441: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.442: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.443: DFBPPR2115 ---- Plant proteins ---- E3 ubiquitin-protein ligase SIRP1 Source.444: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.445: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD Source.446: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.447: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic Source.448: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.449: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.450: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.451: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.452: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.453: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial Source.454: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1 Source.455: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.456: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.457: DFBPPR2163 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.458: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.459: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.460: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.461: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.462: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.463: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.464: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C Source.465: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1 Source.466: DFBPPR2184 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.467: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2 Source.468: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.469: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.470: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.471: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1 Source.472: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.473: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.474: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.475: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.476: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.477: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial Source.478: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.479: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.480: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.481: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.482: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.483: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.484: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.485: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.486: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.487: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.488: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.489: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76 Source.490: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.491: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1 Source.492: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.493: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13 Source.494: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.495: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.496: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.497: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.498: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.499: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.500: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8 Source.501: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.502: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.503: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.504: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.505: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.506: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.507: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa Source.508: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1 Source.509: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.510: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.511: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial Source.512: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.513: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.514: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.515: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.516: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.517: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.518: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.519: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.520: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.521: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic Source.522: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.523: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3 Source.524: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.525: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3 Source.526: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.527: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.528: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b Source.529: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1 Source.530: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.531: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.532: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.533: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.534: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.535: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.536: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic Source.537: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.538: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.539: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6 Source.540: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein Source.541: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.542: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.543: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10 Source.544: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2 Source.545: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic Source.546: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6 Source.547: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.548: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.549: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.550: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.551: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.552: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2 Source.553: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.554: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.555: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.556: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.557: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.558: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.559: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1 Source.560: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.561: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B Source.562: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.563: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain Source.564: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.565: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.566: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3 Source.567: DFBPPR2460 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic Source.568: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.569: DFBPPR2469 ---- Plant proteins ---- Germin-like protein 8-4 Source.570: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.571: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.572: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7 Source.573: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.574: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.575: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.576: DFBPPR2497 ---- Plant proteins ---- Thioredoxin-like protein HCF164, chloroplastic Source.577: DFBPPR2500 ---- Plant proteins ---- Arabinogalactan peptide 2 Source.578: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B Source.579: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5 Source.580: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.581: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.582: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.583: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.584: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.585: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2 Source.586: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.587: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.588: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.589: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.590: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.591: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.592: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.593: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.594: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.595: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27 Source.596: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.597: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.598: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.599: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.600: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.601: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.602: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.603: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.604: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.605: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.606: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19 Source.607: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.608: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57 Source.609: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.610: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12 Source.611: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.612: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1 Source.613: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial Source.614: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24 Source.615: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.616: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.617: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1 Source.618: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25 Source.619: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.620: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.621: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.622: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.623: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8 Source.624: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1 Source.625: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.626: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2 Source.627: DFBPPR2675 ---- Plant proteins ---- Anamorsin homolog 2 Source.628: DFBPPR2676 ---- Plant proteins ---- Expansin-A11 Source.629: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic Source.630: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.631: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.632: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.633: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.634: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.635: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27 Source.636: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18 Source.637: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.638: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.639: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.640: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.641: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.642: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.643: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.644: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5 Source.645: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.646: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.647: DFBPPR2751 ---- Plant proteins ---- Actin-7 Source.648: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.649: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2 Source.650: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.651: DFBPPR2763 ---- Plant proteins ---- Actin-1 Source.652: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.653: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.654: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.655: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.656: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.657: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.658: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.659: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.660: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.661: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.662: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.663: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.664: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.665: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.666: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.667: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.668: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.669: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.670: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.671: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.672: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.673: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.674: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.675: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.676: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic Source.677: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D Source.678: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.679: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.680: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.681: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131 Source.682: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1 Source.683: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase Source.684: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.685: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.686: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.687: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.688: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.689: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.690: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.691: DFBPPR2889 ---- Plant proteins ---- Monothiol glutaredoxin-S1, mitochondrial Source.692: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c Source.693: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7 Source.694: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.695: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.696: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.697: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.698: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1 Source.699: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.700: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.701: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.702: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.703: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1 Source.704: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.705: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14 Source.706: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.707: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.708: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.709: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.710: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1 Source.711: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.712: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.713: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.714: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.715: DFBPPR2952 ---- Plant proteins ---- Expansin-A17 Source.716: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.717: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.718: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.719: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.720: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.721: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.722: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.723: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.724: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic Source.725: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic Source.726: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.727: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.728: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.729: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.730: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a Source.731: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase Source.732: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.733: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.734: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.735: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.736: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.737: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.738: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.739: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.740: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.741: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1 Source.742: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b Source.743: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3 Source.744: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.745: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic Source.746: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase Source.747: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36 Source.748: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.749: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.750: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.751: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.752: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.753: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.754: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.755: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic Source.756: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial Source.757: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.758: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.759: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1 Source.760: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.761: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.762: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.763: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.764: DFBPPR3087 ---- Plant proteins ---- Actin-3 Source.765: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.766: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.767: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.768: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.769: DFBPPR3095 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 4 Source.770: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.771: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.772: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.773: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.774: DFBPPR3108 ---- Plant proteins ---- Thioredoxin H4-2 Source.775: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.776: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1 Source.777: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial Source.778: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.779: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.780: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.781: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.782: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.783: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.784: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.785: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.786: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.787: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.788: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.789: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.790: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13 Source.791: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.792: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.793: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.794: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.795: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.796: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3 Source.797: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.798: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.799: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.800: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15 Source.801: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.802: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.803: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.804: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.805: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.806: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.807: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.808: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.809: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.810: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.811: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.812: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.813: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.814: DFBPPR3221 ---- Plant proteins ---- Probable acylpyruvase FAHD2, mitochondrial Source.815: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.816: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.817: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.818: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.819: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.820: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.821: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.822: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.823: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.824: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b Source.825: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.826: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21 Source.827: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.828: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2 Source.829: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4 Source.830: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.831: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E Source.832: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.833: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.834: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.835: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8 Source.836: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8 Source.837: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.838: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.839: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5 Source.840: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.841: DFBPPR3337 ---- Plant proteins ---- Probable acylpyruvase FAHD1, mitochondrial Source.842: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.843: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.844: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic Source.845: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2 Source.846: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.847: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.848: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2 Source.849: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.850: DFBPPR3361 ---- Plant proteins ---- Ras-related protein RIC1 Source.851: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.852: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.853: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.854: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.855: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.856: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.857: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.858: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.859: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.860: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.861: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.862: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.863: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7 Source.864: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.865: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.866: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1 Source.867: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.868: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.869: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15 Source.870: DFBPPR3415 ---- Plant proteins ---- Expansin-A33 Source.871: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.872: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.873: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.874: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.875: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.876: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.877: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.878: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.879: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.880: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3 Source.881: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.882: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.883: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.884: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.885: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44 Source.886: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.887: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12 Source.888: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.889: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic Source.890: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1 Source.891: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.892: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1 Source.893: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.894: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3 Source.895: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5 Source.896: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31 Source.897: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.898: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.899: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.900: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.901: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.902: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.903: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.904: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.905: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.906: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4 Source.907: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10 Source.908: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4 Source.909: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.910: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.911: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.912: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8 Source.913: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic Source.914: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.915: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.916: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.917: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.918: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.919: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.920: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.921: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial Source.922: DFBPPR3593 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 1 Source.923: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10 Source.924: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11 Source.925: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1 Source.926: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1 Source.927: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.928: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e Source.929: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic Source.930: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1 Source.931: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A Source.932: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.933: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.934: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.935: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial Source.936: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1 Source.937: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.938: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.939: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.940: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5 Source.941: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.942: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.943: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.944: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.945: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.946: DFBPPR3652 ---- Plant proteins ---- Nucleosome assembly protein 1;3 Source.947: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5 Source.948: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9 Source.949: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic Source.950: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.951: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.952: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.953: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.954: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB Source.955: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.956: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.957: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1 Source.958: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.959: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.960: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.961: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.962: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.963: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.964: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.965: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4 Source.966: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.967: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36 Source.968: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.969: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1 Source.970: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.971: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1 Source.972: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.973: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12 Source.974: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.975: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.976: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1 Source.977: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.978: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.979: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.980: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2 Source.981: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.982: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial Source.983: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.984: DFBPPR3793 ---- Plant proteins ---- Coatomer subunit zeta-2 Source.985: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.986: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E Source.987: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.988: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6 Source.989: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.990: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8 Source.991: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.992: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.993: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.994: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.995: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.996: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2 Source.997: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8 Source.998: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.999: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic Source.1000: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.1001: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.1002: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.1003: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.1004: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31 Source.1005: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.1006: DFBPPR3884 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.1007: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8 Source.1008: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.1009: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3 Source.1010: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5 Source.1011: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.1012: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.1013: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.1014: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2 Source.1015: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.1016: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.1017: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14 Source.1018: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.1019: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10 Source.1020: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1 Source.1021: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.1022: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.1023: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.1024: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19 Source.1025: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.1026: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.1027: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2 Source.1028: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1 Source.1029: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.1030: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2 Source.1031: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.1032: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.1033: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2 Source.1034: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.1035: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.1036: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.1037: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.1038: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A Source.1039: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.1040: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.1041: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7 Source.1042: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.1043: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5 Source.1044: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2 Source.1045: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3 Source.1046: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.1047: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1 Source.1048: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1 Source.1049: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.1050: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.1051: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.1052: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1 Source.1053: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.1054: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2 Source.1055: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6 Source.1056: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C Source.1057: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.1058: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.1059: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.1060: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.1061: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.1062: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.1063: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.1064: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.1065: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.1066: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.1067: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.1068: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.1069: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B Source.1070: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1 Source.1071: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.1072: DFBPPR4101 ---- Plant proteins ---- Succinate dehydrogenase subunit 7, mitochondrial Source.1073: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4 Source.1074: DFBPPR4104 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.1075: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.1076: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.1077: DFBPPR4112 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.1078: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.1079: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3 Source.1080: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2 Source.1081: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2 Source.1082: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5 Source.1083: DFBPPR4134 ---- Plant proteins ---- Glutaredoxin-C1 Source.1084: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.1085: DFBPPR4140 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3, chloroplastic Source.1086: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.1087: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.1088: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.1089: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.1090: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.1091: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.1092: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1 Source.1093: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.1094: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.1095: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.1096: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3 Source.1097: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4 Source.1098: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.1099: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog Source.1100: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3 Source.1101: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.1102: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic Source.1103: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40 Source.1104: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.1105: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.1106: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.1107: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3 Source.1108: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.1109: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.1110: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.1111: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27 Source.1112: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1 Source.1113: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.1114: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.1115: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.1116: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.1117: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.1118: DFBPPR4218 ---- Plant proteins ---- Glycine-rich cell wall structural protein 2 Source.1119: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.1120: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4 Source.1121: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.1122: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.1123: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4 Source.1124: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2 Source.1125: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.1126: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.1127: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.1128: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.1129: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.1130: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3 Source.1131: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.1132: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.1133: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.1134: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600 Source.1135: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1 Source.1136: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4 Source.1137: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16 Source.1138: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.1139: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.1140: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13 Source.1141: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.1142: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3 Source.1143: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6 Source.1144: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.1145: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.1146: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.1147: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.1148: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.1149: DFBPPR4294 ---- Plant proteins ---- Nucleosome assembly protein 1-like 4 Source.1150: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.1151: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.1152: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.1153: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17 Source.1154: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1 Source.1155: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8 Source.1156: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.1157: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6 Source.1158: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1 Source.1159: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.1160: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.1161: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.1162: DFBPPR4319 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.1163: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.1164: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2 Source.1165: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.1166: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.1167: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.1168: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.1169: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G Source.1170: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.1171: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.1172: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.1173: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.1174: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.1175: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.1176: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.1177: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6 Source.1178: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.1179: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.1180: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2 Source.1181: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2 Source.1182: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2 Source.1183: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.1184: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.1185: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D Source.1186: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.1187: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog Source.1188: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.1189: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.1190: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.1191: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.1192: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.1193: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.1194: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.1195: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2 Source.1196: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.1197: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.1198: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3 Source.1199: DFBPPR4455 ---- Plant proteins ---- CASP-like protein 5A2 Source.1200: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial Source.1201: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.1202: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.1203: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16 Source.1204: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.1205: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.1206: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.1207: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.1208: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4 Source.1209: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1 Source.1210: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1 Source.1211: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog Source.1212: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2 Source.1213: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.1214: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.1215: DFBPPR4509 ---- Plant proteins ---- Putative glycine-rich cell wall structural protein 1 Source.1216: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.1217: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3 Source.1218: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2 Source.1219: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.1220: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1 Source.1221: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2 Source.1222: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5 Source.1223: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.1224: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.1225: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.1226: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase Source.1227: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.1228: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.1229: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.1230: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1 Source.1231: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.1232: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1 Source.1233: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1 Source.1234: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3 Source.1235: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.1236: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.1237: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.1238: DFBPPR4592 ---- Plant proteins ---- Ubiquitin-fold modifier 1 Source.1239: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23 Source.1240: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.1241: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.1242: DFBPPR4606 ---- Plant proteins ---- ACT domain-containing protein DS12, chloroplastic Source.1243: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.1244: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.1245: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.1246: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.1247: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000 Source.1248: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.1249: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.1250: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1 Source.1251: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.1252: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1 Source.1253: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.1254: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72 Source.1255: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.1256: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.1257: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.1258: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4 Source.1259: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.1260: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.1261: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.1262: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.1263: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.1264: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.1265: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2 Source.1266: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400 Source.1267: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18 Source.1268: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.1269: DFBPPR4780 ---- Plant proteins ---- Ripening-related protein 3 Source.1270: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.1271: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10 Source.1272: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2 Source.1273: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.1274: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1 Source.1275: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.1276: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.1277: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.1278: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.1279: DFBPPR4838 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 4 Source.1280: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2 Source.1281: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48 Source.1282: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1 Source.1283: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.1284: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37 Source.1285: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.1286: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.1287: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.1288: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein Source.1289: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog Source.1290: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12 Source.1291: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.1292: DFBPPR4898 ---- Plant proteins ---- Serine racemase Source.1293: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.1294: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2 Source.1295: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.1296: DFBPPR4915 ---- Plant proteins ---- Chitinase 2 Source.1297: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.1298: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.1299: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.1300: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.1301: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.1302: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2 Source.1303: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial Source.1304: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1 Source.1305: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.1306: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.1307: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.1308: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.1309: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase Source.1310: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.1311: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1 Source.1312: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.1313: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.1314: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.1315: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.1316: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.1317: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase Source.1318: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.1319: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1320: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.1321: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase Source.1322: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.1323: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.1324: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D Source.1325: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1326: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1327: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.1328: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.1329: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1330: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.1331: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1332: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.1333: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.1334: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.1335: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3 Source.1336: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.1337: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1 Source.1338: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.1339: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase Source.1340: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic Source.1341: DFBPPR5121 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1342: DFBPPR5127 ---- Plant proteins ---- Pathogenesis-related protein 10 Source.1343: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1344: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.1345: DFBPPR5146 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic Source.1346: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1347: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1348: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.1349: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1 Source.1350: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.1351: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1352: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.1353: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1 Source.1354: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.1355: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein Source.1356: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.1357: DFBPPR5185 ---- Plant proteins ---- Actin-1 Source.1358: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.1359: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1360: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9 Source.1361: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1362: DFBPPR5233 ---- Plant proteins ---- Ras-related protein Rab7 Source.1363: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1364: DFBPPR5253 ---- Plant proteins ---- CASP-like protein 7 Source.1365: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.1366: DFBPPR5260 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1367: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3 Source.1368: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22 Source.1369: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.1370: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.1371: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.1372: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.1373: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.1374: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.1375: DFBPPR5310 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.1376: DFBPPR5311 ---- Plant proteins ---- Nodulin-20 Source.1377: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.1378: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1 Source.1379: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a Source.1380: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase Source.1381: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A Source.1382: DFBPPR5369 ---- Plant proteins ---- Early nodulin-36A Source.1383: DFBPPR5370 ---- Plant proteins ---- Early nodulin-36B Source.1384: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.1385: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.1386: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.1387: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.1388: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2 Source.1389: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.1390: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1391: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1392: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1 Source.1393: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.1394: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.1395: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.1396: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein Source.1397: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1 Source.1398: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.1399: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.1400: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.1401: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.1402: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.1403: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.1404: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.1405: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.1406: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2 Source.1407: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.1408: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.1409: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.1410: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.1411: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.1412: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.1413: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.1414: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.1415: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.1416: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.1417: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial Source.1418: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1419: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.1420: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1421: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic Source.1422: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1 Source.1423: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.1424: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.1425: DFBPPR5494 ---- Plant proteins ---- Peroxidase 70 Source.1426: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.1427: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66 Source.1428: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.1429: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.1430: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.1431: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.1432: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.1433: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.1434: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.1435: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.1436: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.1437: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1 Source.1438: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.1439: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.1440: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1441: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1442: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1443: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.1444: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.1445: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1446: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.1447: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.1448: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.1449: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.1450: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.1451: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I Source.1452: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.1453: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.1454: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase Source.1455: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1456: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.1457: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic Source.1458: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.1459: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.1460: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.1461: DFBPPR5627 ---- Plant proteins ---- Expansin-B11 Source.1462: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1463: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1464: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.1465: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1466: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1467: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.1468: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5 Source.1469: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.1470: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.1471: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.1472: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1473: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.1474: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.1475: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4 Source.1476: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.1477: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.1478: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1 Source.1479: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.1480: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.1481: DFBPPR5706 ---- Plant proteins ---- Glutelin-2 Source.1482: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.1483: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase Source.1484: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1485: DFBPPR5722 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1486: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.1487: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.1488: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase Source.1489: DFBPPR5728 ---- Plant proteins ---- Calreticulin Source.1490: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.1491: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.1492: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1493: DFBPPR5739 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR1 Source.1494: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.1495: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.1496: DFBPPR5753 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.1497: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.1498: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform Source.1499: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.1500: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1 Source.1501: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2 Source.1502: DFBPPR5777 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1503: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.1504: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.1505: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.1506: DFBPPR5796 ---- Plant proteins ---- Shugoshin-1 Source.1507: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1508: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1509: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1510: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.1511: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog Source.1512: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic Source.1513: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.1514: DFBPPR5830 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic Source.1515: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.1516: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12 Source.1517: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.1518: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4 Source.1519: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.1520: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.1521: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6 Source.1522: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.1523: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1524: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5 Source.1525: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16 Source.1526: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1 Source.1527: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.1528: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1 Source.1529: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1530: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.1531: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4 Source.1532: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1 Source.1533: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1534: DFBPPR5924 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.1535: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1 Source.1536: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein Source.1537: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin Source.1538: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1539: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1 Source.1540: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2 Source.1541: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1 Source.1542: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.1543: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2 Source.1544: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1545: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.1546: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.1547: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.1548: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.1549: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.1550: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.1551: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1 Source.1552: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.1553: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3 Source.1554: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.1555: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.1556: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.1557: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.1558: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2 Source.1559: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2 Source.1560: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1 Source.1561: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.1562: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.1563: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1564: DFBPPR6024 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1565: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.1566: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.1567: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b Source.1568: DFBPPR6035 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.1569: DFBPPR6037 ---- Plant proteins ---- 19 kDa alpha-zein 19C2 Source.1570: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.1571: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2 Source.1572: DFBPPR6052 ---- Plant proteins ---- Cystatin-1 Source.1573: DFBPPR6054 ---- Plant proteins ---- CASP-like protein 5A3 Source.1574: DFBPPR6056 ---- Plant proteins ---- Bowman-Birk type wound-induced proteinase inhibitor WIP1 Source.1575: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.1576: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.1577: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.1578: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.1579: DFBPPR6073 ---- Plant proteins ---- Protein IAL1 Source.1580: DFBPPR6075 ---- Plant proteins ---- MFS18 protein Source.1581: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1 Source.1582: DFBPPR6087 ---- Plant proteins ---- 40S ribosomal protein S14 Source.1583: DFBPPR6090 ---- Plant proteins ---- 40S ribosomal protein S14 Source.1584: DFBPPR6093 ---- Plant proteins ---- Zein-alpha 19C1 Source.1585: DFBPPR6095 ---- Plant proteins ---- Zein-alpha A20 Source.1586: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3 Source.1587: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1 Source.1588: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.1589: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1 Source.1590: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1 Source.1591: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.1592: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72 Source.1593: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.1594: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase Source.1595: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1596: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.1597: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic Source.1598: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.1599: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.1600: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.1601: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.1602: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.1603: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.1604: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.1605: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.1606: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.1607: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1608: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic Source.1609: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.1610: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.1611: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial Source.1612: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.1613: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1614: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.1615: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1616: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.1617: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.1618: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH Source.1619: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2 Source.1620: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.1621: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.1622: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1623: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5 Source.1624: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.1625: DFBPPR6351 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1626: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic Source.1627: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic Source.1628: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1629: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1630: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1631: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.1632: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1633: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic Source.1634: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.1635: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.1636: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.1637: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.1638: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.1639: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin Source.1640: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic Source.1641: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic Source.1642: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1643: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.1644: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.1645: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.1646: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein Source.1647: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.1648: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a Source.1649: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.1650: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like Source.1651: DFBPPR6502 ---- Plant proteins ---- Early light-induced protein, chloroplastic Source.1652: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6 Source.1653: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1654: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.1655: DFBPPR6550 ---- Plant proteins ---- Actin-3 Source.1656: DFBPPR6551 ---- Plant proteins ---- Actin-2 Source.1657: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.1658: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.1659: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.1660: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.1661: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.1662: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.1663: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.1664: DFBPPR6642 ---- Plant proteins ---- Peroxidase Source.1665: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.1666: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1 Source.1667: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit Source.1668: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.1669: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic Source.1670: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1 Source.1671: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.1672: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.1673: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.1674: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.1675: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1676: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3 Source.1677: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.1678: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.1679: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1 Source.1680: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.1681: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1 Source.1682: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase Source.1683: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1684: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase Source.1685: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.1686: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1687: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.1688: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.1689: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic Source.1690: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.1691: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.1692: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2 Source.1693: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3 Source.1694: DFBPPR6770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.1695: DFBPPR6771 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1696: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1697: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.1698: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.1699: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.1700: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.1701: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38) Source.1702: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.1703: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1704: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A Source.1705: DFBPPR6819 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic Source.1706: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.1707: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1708: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic Source.1709: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1710: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1711: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1712: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic Source.1713: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic Source.1714: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1715: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1716: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.1717: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1718: DFBPPR6887 ---- Plant proteins ---- Glutenin, low molecular weight subunit Source.1719: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.1720: DFBPPR6896 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.1721: DFBPPR6928 ---- Plant proteins ---- Avenin-like a5 Source.1722: DFBPPR6943 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.1723: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin Source.1724: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6 Source.1725: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7 Source.1726: DFBPPR6983 ---- Plant proteins ---- Avenin-like a4 Source.1727: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10 Source.1728: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9 Source.1729: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8 Source.1730: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1731: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.1732: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.1733: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.1734: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1 Source.1735: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.1736: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2 Source.1737: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.1738: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.1739: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1740: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.1741: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase Source.1742: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.1743: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3 Source.1744: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1745: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1746: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4 Source.1747: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.1748: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1749: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.1750: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1751: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.1752: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase Source.1753: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.1754: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.1755: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1756: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII Source.1757: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.1758: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.1759: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.1760: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.1761: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1 Source.1762: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2 Source.1763: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3 Source.1764: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.1765: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.1766: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.1767: DFBPPR7142 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.1768: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.1769: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.1770: DFBPPR7152 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1771: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.1772: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1773: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1774: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin Source.1775: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1776: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic Source.1777: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1778: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3 Source.1779: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.1780: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain Source.1781: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.1782: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1783: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1784: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1785: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.1786: DFBPPR7233 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.1787: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1 Source.1788: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2 Source.1789: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1790: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic Source.1791: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic Source.1792: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic Source.1793: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic Source.1794: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.1795: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic Source.1796: DFBPPR7281 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic Source.1797: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1798: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A Source.1799: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B Source.1800: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.1801: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6 Source.1802: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.1803: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.1804: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1805: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3 Source.1806: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4 Source.1807: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1808: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1809: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1810: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1811: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2 Source.1812: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.1813: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic Source.1814: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.1815: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2 Source.1816: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1 Source.1817: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.1818: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.1819: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1820: DFBPPR7502 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic Source.1821: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2 Source.1822: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.1823: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.1824: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.1825: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.1826: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein Source.1827: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.1828: DFBPPR7605 ---- Milk proteins ---- Beta-casein Source.1829: DFBPPR7608 ---- Milk proteins ---- Kappa-casein Source.1830: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.1831: DFBPPR7622 ---- Milk proteins ---- Mucin-1 Source.1832: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.1833: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.1834: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.1835: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator Source.1836: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.1837: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1838: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.1839: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.1840: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.1841: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A Source.1842: DFBPPR7657 ---- Milk proteins ---- Chymosin Source.1843: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein Source.1844: DFBPPR7665 ---- Milk proteins ---- Beta-casein Source.1845: DFBPPR7668 ---- Milk proteins ---- Beta-casein Source.1846: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A Source.1847: DFBPPR7678 ---- Milk proteins ---- Whey acidic protein Source.1848: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein Source.1849: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein Source.1850: DFBPPR7681 ---- Milk proteins ---- Beta-casein Source.1851: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.1852: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.1853: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.1854: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein Source.1855: DFBPPR7691 ---- Milk proteins ---- Albumin Source.1856: DFBPPR7692 ---- Milk proteins ---- Beta-casein Source.1857: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.1858: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.1859: DFBPPR7700 ---- Milk proteins ---- Beta-casein Source.1860: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein Source.1861: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein Source.1862: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.1863: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.1864: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein Source.1865: DFBPPR7718 ---- Milk proteins ---- Beta-casein Source.1866: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.1867: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1868: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.1869: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.1870: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.1871: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1872: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1873: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1874: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.1875: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase Source.1876: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1877: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase Source.1878: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.1879: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.1880: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1881: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.1882: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1883: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1884: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2 Source.1885: DFBPPR8381 ---- Plant proteins ---- Conglutin-7 Source.1886: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2 Source.1887: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101 Source.1888: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101 Source.1889: DFBPPR8412 ---- Plant proteins ---- Oleosin Ara h 10.0102 Source.1890: DFBPPR8420 ---- Plant proteins ---- Peroxygenase Source.1891: DFBPPR8429 ---- Plant proteins ---- Oleosin H2 Source.1892: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1893: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1894: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.1895: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1896: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein Source.1897: DFBPPR8489 ---- Milk proteins ---- Beta-casein Source.1898: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.1899: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein Source.1900: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.1901: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.1902: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.1903: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.1904: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.1905: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2 Source.1906: DFBPPR8521 ---- Milk proteins ---- Probetacellulin Source.1907: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.1908: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E Source.1909: DFBPPR15937 ---- Animal proteins ---- Appetite-regulating hormone Source.1910: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.1911: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.1912: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.1913: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1914: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1915: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1916: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.1917: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1918: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1 Source.1919: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1920: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.1921: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.1922: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.1923: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1924: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.1925: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.1926: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1927: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14 Source.1928: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.1929: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1930: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.1931: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1932: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1933: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.1934: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1935: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1936: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.1937: DFBPPR16046 ---- Animal proteins ---- C-C motif chemokine 3 Source.1938: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1939: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1940: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type Source.1941: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1942: DFBPPR16071 ---- Animal proteins ---- CD44 antigen Source.1943: DFBPPR16083 ---- Animal proteins ---- Annexin A13 Source.1944: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.1945: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1946: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.1947: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1948: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.1949: DFBPPR16103 ---- Animal proteins ---- Laforin Source.1950: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.1951: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1952: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.1953: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1954: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.1955: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1 Source.1956: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1957: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4 Source.1958: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.1959: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1960: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1961: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein Source.1962: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule Source.1963: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.1964: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.1965: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.1966: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1967: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6 Source.1968: DFBPPR16156 ---- Animal proteins ---- Ras-related protein Rab-22A Source.1969: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1970: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.1971: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2 Source.1972: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.1973: DFBPPR16168 ---- Animal proteins ---- Annexin A2 Source.1974: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase Source.1975: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.1976: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase Source.1977: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1978: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.1979: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1980: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.1981: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1982: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1983: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.1984: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1985: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1986: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.1987: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.1988: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.1989: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1990: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1991: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1992: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1993: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1994: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a Source.1995: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.1996: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1997: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.1998: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1999: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.2000: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta Source.2001: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.2002: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.2003: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.2004: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.2005: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.2006: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C Source.2007: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.2008: DFBPPR16326 ---- Animal proteins ---- Desmin Source.2009: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2010: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.2011: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.2012: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4 Source.2013: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4 Source.2014: DFBPPR16336 ---- Animal proteins ---- Colipase Source.2015: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2016: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype Source.2017: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.2018: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.2019: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain Source.2020: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.2021: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.2022: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.2023: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.2024: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.2025: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.2026: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.2027: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.2028: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6 Source.2029: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B Source.2030: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.2031: DFBPPR16501 ---- Animal proteins ---- F-box/LRR-repeat protein 15 Source.2032: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor Source.2033: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.2034: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.2035: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.2036: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a Source.2037: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3 Source.2038: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.2039: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.2040: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83 Source.2041: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein Source.2042: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.2043: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.2044: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein Source.2045: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.2046: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2047: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.2048: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3 Source.2049: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2050: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3 Source.2051: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein Source.2052: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.2053: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.2054: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype Source.2055: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.2056: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7 Source.2057: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H Source.2058: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2059: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2060: DFBPPR16655 ---- Animal proteins ---- Somatostatin Source.2061: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4 Source.2062: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.2063: DFBPPR16667 ---- Animal proteins ---- 60S ribosomal protein L12 Source.2064: DFBPPR16669 ---- Animal proteins ---- C-C motif chemokine 28 Source.2065: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3 Source.2066: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.2067: DFBPPR16704 ---- Animal proteins ---- Retbindin Source.2068: DFBPPR16721 ---- Animal proteins ---- Testin Source.2069: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.2070: DFBPPR16746 ---- Animal proteins ---- Tektin-1 Source.2071: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2072: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.2073: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase Source.2074: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.2075: DFBPPR16779 ---- Animal proteins ---- Hemoglobin subunit beta Source.2076: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.2077: DFBPPR16797 ---- Animal proteins ---- Albumin Source.2078: DFBPPR16809 ---- Animal proteins ---- Rhodopsin Source.2079: DFBPPR16814 ---- Animal proteins ---- Prothrombin Source.2080: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2081: DFBPPR16818 ---- Animal proteins ---- ATPase inhibitor, mitochondrial Source.2082: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta Source.2083: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.2084: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.2085: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.2086: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.2087: DFBPPR16852 ---- Animal proteins ---- Cytochrome b Source.2088: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor Source.2089: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2090: DFBPPR16877 ---- Animal proteins ---- Peptidoglycan recognition protein 1 Source.2091: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.2092: DFBPPR16879 ---- Animal proteins ---- Inhibin beta A chain Source.2093: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.2094: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.2095: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.2096: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.2097: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein Source.2098: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.2099: DFBPPR16918 ---- Animal proteins ---- Spastin Source.2100: DFBPPR16919 ---- Animal proteins ---- VIP peptides Source.2101: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.2102: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase Source.2103: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.2104: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.2105: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2106: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.2107: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2108: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.2109: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic Source.2110: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.2111: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.2112: DFBPPR16952 ---- Animal proteins ---- Annexin A2 Source.2113: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin Source.2114: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.2115: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.2116: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.2117: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.2118: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.2119: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1 Source.2120: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.2121: DFBPPR16985 ---- Animal proteins ---- Filensin Source.2122: DFBPPR16991 ---- Animal proteins ---- Osteocalcin Source.2123: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1 Source.2124: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.2125: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.2126: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.2127: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.2128: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.2129: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.2130: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.2131: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2132: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain Source.2133: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.2134: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.2135: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.2136: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D Source.2137: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.2138: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.2139: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Source.2140: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.2141: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.2142: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1 Source.2143: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2 Source.2144: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.2145: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.2146: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.2147: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.2148: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.2149: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.2150: DFBPPR17115 ---- Animal proteins ---- CD44 antigen Source.2151: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.2152: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.2153: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.2154: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1 Source.2155: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1 Source.2156: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1 Source.2157: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.2158: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.2159: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.2160: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.2161: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.2162: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.2163: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase Source.2164: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.2165: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1 Source.2166: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2167: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.2168: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.2169: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.2170: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.2171: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.2172: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.2173: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.2174: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.2175: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2176: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.2177: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.2178: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.2179: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.2180: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.2181: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1 Source.2182: DFBPPR17334 ---- Animal proteins ---- Prohibitin Source.2183: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.2184: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.2185: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.2186: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating Source.2187: DFBPPR17341 ---- Animal proteins ---- Radixin Source.2188: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.2189: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1 Source.2190: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.2191: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.2192: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2 Source.2193: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.2194: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.2195: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.2196: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.2197: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.2198: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1 Source.2199: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2 Source.2200: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.2201: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.2202: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.2203: DFBPPR17423 ---- Animal proteins ---- Furin Source.2204: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.2205: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.2206: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2207: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.2208: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.2209: DFBPPR17443 ---- Animal proteins ---- Beclin-1 Source.2210: DFBPPR17449 ---- Animal proteins ---- C-C motif chemokine 3 Source.2211: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.2212: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2213: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.2214: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.2215: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.2216: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2217: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.2218: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N Source.2219: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.2220: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1 Source.2221: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.2222: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.2223: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.2224: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.2225: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.2226: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.2227: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase Source.2228: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.2229: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.2230: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.2231: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.2232: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.2233: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1 Source.2234: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4 Source.2235: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog Source.2236: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1 Source.2237: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4 Source.2238: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.2239: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.2240: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.2241: DFBPPR17580 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5 Source.2242: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1 Source.2243: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.2244: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.2245: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2246: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.2247: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.2248: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2249: DFBPPR17618 ---- Animal proteins ---- Synaptophysin Source.2250: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein Source.2251: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial Source.2252: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2 Source.2253: DFBPPR17646 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial Source.2254: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.2255: DFBPPR17679 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.2256: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.2257: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.2258: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B Source.2259: DFBPPR17727 ---- Animal proteins ---- Insulin-like 3 Source.2260: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.2261: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.2262: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.2263: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.2264: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.2265: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.2266: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.2267: DFBPPR17758 ---- Animal proteins ---- Matrix Gla protein Source.2268: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1 Source.2269: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.2270: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.2271: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.2272: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.2273: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.2274: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.2275: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.2276: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1 Source.2277: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2 Source.2278: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60 Source.2279: DFBPPR17810 ---- Animal proteins ---- Histone H1.2 Source.2280: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.2281: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.2282: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.2283: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D Source.2284: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.2285: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3 Source.2286: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.2287: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.2288: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.2289: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.2290: DFBPPR17856 ---- Animal proteins ---- Selenoprotein S Source.2291: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.2292: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.2293: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.2294: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.2295: DFBPPR17884 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase Source.2296: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.2297: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.2298: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.2299: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.2300: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.2301: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.2302: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.2303: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.2304: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.2305: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.2306: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.2307: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.2308: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.2309: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.2310: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9 Source.2311: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 Source.2312: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.2313: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase Source.2314: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.2315: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.2316: DFBPPR17978 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.2317: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.2318: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.2319: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.2320: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B Source.2321: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.2322: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.2323: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.2324: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase Source.2325: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.2326: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.2327: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.2328: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.2329: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2330: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain Source.2331: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3 Source.2332: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial Source.2333: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1 Source.2334: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1 Source.2335: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2336: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2337: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.2338: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.2339: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2340: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.2341: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4 Source.2342: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1 Source.2343: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.2344: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit Source.2345: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1 Source.2346: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.2347: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2348: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha Source.2349: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.2350: DFBPPR18166 ---- Animal proteins ---- Selenoprotein P Source.2351: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.2352: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.2353: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.2354: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.2355: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.2356: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8 Source.2357: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.2358: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B Source.2359: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.2360: DFBPPR18227 ---- Animal proteins ---- Desmin Source.2361: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.2362: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a Source.2363: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2 Source.2364: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.2365: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.2366: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41 Source.2367: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.2368: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2369: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.2370: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56 Source.2371: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.2372: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.2373: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.2374: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.2375: DFBPPR18307 ---- Animal proteins ---- Claudin-4 Source.2376: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.2377: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.2378: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.2379: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase Source.2380: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2381: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial Source.2382: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a Source.2383: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.2384: DFBPPR18339 ---- Animal proteins ---- SPARC Source.2385: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase Source.2386: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q Source.2387: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.2388: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.2389: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.2390: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.2391: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.2392: DFBPPR18391 ---- Animal proteins ---- Exosome complex component RRP43 Source.2393: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.2394: DFBPPR18394 ---- Animal proteins ---- Histone H1.1 Source.2395: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.2396: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.2397: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.2398: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2399: DFBPPR18427 ---- Animal proteins ---- Cystatin-C Source.2400: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16 Source.2401: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.2402: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12 Source.2403: DFBPPR18441 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.2404: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.2405: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.2406: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1 Source.2407: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.2408: DFBPPR18462 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.2409: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor Source.2410: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.2411: DFBPPR18470 ---- Animal proteins ---- Perilipin-5 Source.2412: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1 Source.2413: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.2414: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial Source.2415: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.2416: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.2417: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.2418: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb Source.2419: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.2420: DFBPPR18508 ---- Animal proteins ---- Regakine-1 Source.2421: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.2422: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.2423: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.2424: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin Source.2425: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.2426: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.2427: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.2428: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.2429: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.2430: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.2431: DFBPPR18564 ---- Animal proteins ---- BRISC and BRCA1-A complex member 1 Source.2432: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.2433: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2 Source.2434: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.2435: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.2436: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial Source.2437: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1 Source.2438: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.2439: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.2440: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6 Source.2441: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor Source.2442: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.2443: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.2444: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.2445: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.2446: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3 Source.2447: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.2448: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3 Source.2449: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial Source.2450: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.2451: DFBPPR18622 ---- Animal proteins ---- CYFIP-related Rac1 interactor B Source.2452: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.2453: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.2454: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.2455: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.2456: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.2457: DFBPPR18686 ---- Animal proteins ---- Intraflagellar transport protein 27 homolog Source.2458: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.2459: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.2460: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.2461: DFBPPR18718 ---- Animal proteins ---- Chondroadherin Source.2462: DFBPPR18720 ---- Animal proteins ---- Protein quaking Source.2463: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor Source.2464: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2465: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.2466: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial Source.2467: DFBPPR18734 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF114 Source.2468: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.2469: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor Source.2470: DFBPPR18745 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein Source.2471: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.2472: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.2473: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.2474: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.2475: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.2476: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9 Source.2477: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.2478: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.2479: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba Source.2480: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.2481: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.2482: DFBPPR18815 ---- Animal proteins ---- Pantetheinase Source.2483: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.2484: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.2485: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.2486: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.2487: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.2488: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.2489: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15 Source.2490: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.2491: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin Source.2492: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.2493: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor Source.2494: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7 Source.2495: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1 Source.2496: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.2497: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2498: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase Source.2499: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.2500: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.2501: DFBPPR18889 ---- Animal proteins ---- Achaete-scute homolog 2 Source.2502: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.2503: DFBPPR18908 ---- Animal proteins ---- Proteasome subunit alpha type-6 Source.2504: DFBPPR18911 ---- Animal proteins ---- Mesencephalic astrocyte-derived neurotrophic factor Source.2505: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.2506: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b Source.2507: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.2508: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.2509: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.2510: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13 Source.2511: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.2512: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1 Source.2513: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.2514: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.2515: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.2516: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3 Source.2517: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease Source.2518: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.2519: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.2520: DFBPPR18982 ---- Animal proteins ---- Gastrin-releasing peptide Source.2521: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.2522: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.2523: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.2524: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.2525: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog Source.2526: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.2527: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa Source.2528: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.2529: DFBPPR19004 ---- Animal proteins ---- Histone H1.3 Source.2530: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.2531: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.2532: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2533: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.2534: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog Source.2535: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.2536: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.2537: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Source.2538: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.2539: DFBPPR19051 ---- Animal proteins ---- Pro-neuropeptide Y Source.2540: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.2541: DFBPPR19056 ---- Animal proteins ---- Gastrin Source.2542: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.2543: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5 Source.2544: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.2545: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.2546: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.2547: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.2548: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2 Source.2549: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.2550: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1 Source.2551: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.2552: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.2553: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.2554: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13 Source.2555: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9 Source.2556: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.2557: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.2558: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.2559: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein Source.2560: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2 Source.2561: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.2562: DFBPPR19137 ---- Animal proteins ---- Serpin H1 Source.2563: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.2564: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.2565: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.2566: DFBPPR19158 ---- Animal proteins ---- Tuberoinfundibular peptide of 39 residues Source.2567: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein Source.2568: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.2569: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.2570: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2 Source.2571: DFBPPR19174 ---- Animal proteins ---- Neuroendocrine secretory protein 55 Source.2572: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin Source.2573: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.2574: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.2575: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.2576: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A Source.2577: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.2578: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.2579: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169 Source.2580: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.2581: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2 Source.2582: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.2583: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B Source.2584: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.2585: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase Source.2586: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.2587: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1 Source.2588: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Source.2589: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.2590: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.2591: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.2592: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2 Source.2593: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2 Source.2594: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4 Source.2595: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2 Source.2596: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.2597: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic Source.2598: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D Source.2599: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1 Source.2600: DFBPPR19312 ---- Animal proteins ---- Copine-1 Source.2601: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.2602: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial Source.2603: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1 Source.2604: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial Source.2605: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.2606: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.2607: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85 Source.2608: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.2609: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase Source.2610: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.2611: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.2612: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.2613: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3 Source.2614: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.2615: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.2616: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2617: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.2618: DFBPPR19362 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5 Source.2619: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.2620: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.2621: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.2622: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.2623: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1 Source.2624: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C Source.2625: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3 Source.2626: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6 Source.2627: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.2628: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.2629: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.2630: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1 Source.2631: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.2632: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.2633: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59 Source.2634: DFBPPR19439 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.2635: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.2636: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.2637: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.2638: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1 Source.2639: DFBPPR19456 ---- Animal proteins ---- Ly-6/neurotoxin-like protein 1 Source.2640: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137 Source.2641: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.2642: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.2643: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.2644: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.2645: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.2646: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.2647: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.2648: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.2649: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.2650: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.2651: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.2652: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2 Source.2653: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.2654: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.2655: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A Source.2656: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.2657: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.2658: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3 Source.2659: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase Source.2660: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.2661: DFBPPR19539 ---- Animal proteins ---- MICOS complex subunit MIC19 Source.2662: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.2663: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial Source.2664: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1 Source.2665: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.2666: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.2667: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4 Source.2668: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.2669: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.2670: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.2671: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.2672: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.2673: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.2674: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1 Source.2675: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1 Source.2676: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.2677: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.2678: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.2679: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.2680: DFBPPR19619 ---- Animal proteins ---- PAXIP1-associated glutamate-rich protein 1 Source.2681: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein Source.2682: DFBPPR19642 ---- Animal proteins ---- Agouti-related protein Source.2683: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4 Source.2684: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.2685: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.2686: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.2687: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter Source.2688: DFBPPR19663 ---- Animal proteins ---- Synembryn-A Source.2689: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2 Source.2690: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.2691: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E Source.2692: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.2693: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.2694: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.2695: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.2696: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1 Source.2697: DFBPPR19728 ---- Animal proteins ---- THO complex subunit 7 homolog Source.2698: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2 Source.2699: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.2700: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein Source.2701: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.2702: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.2703: DFBPPR19767 ---- Animal proteins ---- F-box/LRR-repeat protein 15 Source.2704: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.2705: DFBPPR19783 ---- Animal proteins ---- Syndecan-1 Source.2706: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1 Source.2707: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.2708: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.2709: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.2710: DFBPPR19812 ---- Animal proteins ---- Probable inactive serine protease 37 Source.2711: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog Source.2712: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.2713: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6 Source.2714: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.2715: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.2716: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B Source.2717: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.2718: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.2719: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.2720: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.2721: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.2722: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5 Source.2723: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.2724: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A Source.2725: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.2726: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1 Source.2727: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2728: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.2729: DFBPPR19895 ---- Animal proteins ---- 39S ribosomal protein L24, mitochondrial Source.2730: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.2731: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic Source.2732: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27 Source.2733: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.2734: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial Source.2735: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.2736: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.2737: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.2738: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog Source.2739: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.2740: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.2741: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.2742: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.2743: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.2744: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.2745: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.2746: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4 Source.2747: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.2748: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20 Source.2749: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.2750: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.2751: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.2752: DFBPPR20013 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit gamma Source.2753: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.2754: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.2755: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.2756: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1 Source.2757: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2 Source.2758: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.2759: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase Source.2760: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.2761: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.2762: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.2763: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.2764: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.2765: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.2766: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2767: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.2768: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.2769: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase Source.2770: DFBPPR20161 ---- Animal proteins ---- Calponin-2 Source.2771: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.2772: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.2773: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.2774: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase Source.2775: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7 Source.2776: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98 Source.2777: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.2778: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.2779: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4 Source.2780: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial Source.2781: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.2782: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.2783: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.2784: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2 Source.2785: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.2786: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.2787: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.2788: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3 Source.2789: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2 Source.2790: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog Source.2791: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214 Source.2792: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.2793: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.2794: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.2795: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal Source.2796: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein Source.2797: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.2798: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial Source.2799: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.2800: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial Source.2801: DFBPPR20325 ---- Animal proteins ---- 28S ribosomal protein S12, mitochondrial Source.2802: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.2803: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2804: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase Source.2805: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.2806: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial Source.2807: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2 Source.2808: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.2809: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.2810: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.2811: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase Source.2812: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.2813: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C Source.2814: DFBPPR20363 ---- Animal proteins ---- F-box/LRR-repeat protein 2 Source.2815: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3 Source.2816: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1 Source.2817: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.2818: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.2819: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6 Source.2820: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.2821: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.2822: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.2823: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.2824: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.2825: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog Source.2826: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.2827: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.2828: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38 Source.2829: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.2830: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.2831: DFBPPR20481 ---- Animal proteins ---- Ropporin-1 Source.2832: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54 Source.2833: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1 Source.2834: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.2835: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102 Source.2836: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1 Source.2837: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.2838: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.2839: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.2840: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6 Source.2841: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.2842: DFBPPR20522 ---- Animal proteins ---- Serine palmitoyltransferase small subunit A Source.2843: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.2844: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.2845: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230 Source.2846: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.2847: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase Source.2848: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.2849: DFBPPR20570 ---- Animal proteins ---- Intraflagellar transport protein 22 homolog Source.2850: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.2851: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201 Source.2852: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.2853: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1 Source.2854: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.2855: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein Source.2856: DFBPPR20584 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5-like protein Source.2857: DFBPPR20585 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 3 Source.2858: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.2859: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.2860: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.2861: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.2862: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.2863: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.2864: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase Source.2865: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.2866: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13 Source.2867: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.2868: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.2869: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1 Source.2870: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.2871: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C Source.2872: DFBPPR20640 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 8 Source.2873: DFBPPR20651 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 2, mitochondrial Source.2874: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.2875: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2876: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2 Source.2877: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.2878: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial Source.2879: DFBPPR20671 ---- Animal proteins ---- 39S ribosomal protein L27, mitochondrial Source.2880: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.2881: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease Source.2882: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2 Source.2883: DFBPPR20677 ---- Animal proteins ---- EEF1A lysine methyltransferase 1 Source.2884: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.2885: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.2886: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.2887: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.2888: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.2889: DFBPPR20699 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 31 Source.2890: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1 Source.2891: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.2892: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.2893: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A Source.2894: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase Source.2895: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.2896: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.2897: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.2898: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33 Source.2899: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2 Source.2900: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.2901: DFBPPR20775 ---- Animal proteins ---- Colipase Source.2902: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.2903: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.2904: DFBPPR20785 ---- Animal proteins ---- Ribosomal protein 63, mitochondrial Source.2905: DFBPPR20800 ---- Animal proteins ---- Augurin Source.2906: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2 Source.2907: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14 Source.2908: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT Source.2909: DFBPPR20824 ---- Animal proteins ---- CD151 antigen Source.2910: DFBPPR20832 ---- Animal proteins ---- Metalloproteinase inhibitor 4 Source.2911: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.2912: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.2913: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.2914: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.2915: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.2916: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.2917: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase Source.2918: DFBPPR20863 ---- Animal proteins ---- LIM and senescent cell antigen-like-containing domain protein 2 Source.2919: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.2920: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1 Source.2921: DFBPPR20877 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD5 Source.2922: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.2923: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B Source.2924: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237 Source.2925: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta Source.2926: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.2927: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B Source.2928: DFBPPR20898 ---- Animal proteins ---- Transaldolase Source.2929: DFBPPR20913 ---- Animal proteins ---- Somatostatin Source.2930: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2931: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2932: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1 Source.2933: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1 Source.2934: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial Source.2935: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial Source.2936: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25 Source.2937: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.2938: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A Source.2939: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1 Source.2940: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.2941: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.2942: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein Source.2943: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit Source.2944: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1 Source.2945: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial Source.2946: DFBPPR20990 ---- Animal proteins ---- 60S ribosomal protein L12 Source.2947: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821 Source.2948: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1 Source.2949: DFBPPR21003 ---- Animal proteins ---- Protein BCAP Source.2950: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.2951: DFBPPR21040 ---- Animal proteins ---- Neuritin Source.2952: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.2953: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.2954: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.2955: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.2956: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.2957: DFBPPR21063 ---- Animal proteins ---- Zinc finger protein 691 Source.2958: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial Source.2959: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.2960: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.2961: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A Source.2962: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22 Source.2963: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.2964: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.2965: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.2966: DFBPPR21092 ---- Animal proteins ---- Calponin-1 Source.2967: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4 Source.2968: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2969: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog Source.2970: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.2971: DFBPPR21139 ---- Animal proteins ---- Transcription elongation factor A protein 3 Source.2972: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.2973: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88 Source.2974: DFBPPR21152 ---- Animal proteins ---- Protein S100-A2 Source.2975: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22 Source.2976: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.2977: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2 Source.2978: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3 Source.2979: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.2980: DFBPPR21185 ---- Animal proteins ---- Lymphocyte antigen 6H Source.2981: DFBPPR21188 ---- Animal proteins ---- High mobility group protein B4 Source.2982: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.2983: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.2984: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin Source.2985: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.2986: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2 Source.2987: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1 Source.2988: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2 Source.2989: DFBPPR21207 ---- Animal proteins ---- Ragulator complex protein LAMTOR3 Source.2990: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4 Source.2991: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1 Source.2992: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1 Source.2993: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4 Source.2994: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.2995: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5 Source.2996: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2 Source.2997: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6 Source.2998: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4 Source.2999: DFBPPR21272 ---- Animal proteins ---- Testin Source.3000: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4 Source.3001: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2 Source.3002: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.3003: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.3004: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.3005: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.3006: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.3007: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D Source.3008: DFBPPR21304 ---- Animal proteins ---- NTF2-related export protein 2 Source.3009: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial Source.3010: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.3011: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.3012: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.3013: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner Source.3014: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein Source.3015: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H Source.3016: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115 Source.3017: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.3018: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4 Source.3019: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.3020: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692 Source.3021: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.3022: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C Source.3023: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204 Source.3024: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1 Source.3025: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.3026: DFBPPR21376 ---- Animal proteins ---- Calponin-3 Source.3027: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3 Source.3028: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.3029: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.3030: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.3031: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial Source.3032: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.3033: DFBPPR21416 ---- Animal proteins ---- 39S ribosomal protein L32, mitochondrial Source.3034: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.3035: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84 Source.3036: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.3037: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5 Source.3038: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.3039: DFBPPR21451 ---- Animal proteins ---- Nurim Source.3040: DFBPPR21455 ---- Animal proteins ---- Apolipoprotein C-IV Source.3041: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.3042: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2 Source.3043: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.3044: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.3045: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.3046: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9 Source.3047: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.3048: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial Source.3049: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1 Source.3050: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.3051: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.3052: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.3053: DFBPPR21496 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim9 Source.3054: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.3055: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.3056: DFBPPR21509 ---- Animal proteins ---- Myoneurin Source.3057: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20 Source.3058: DFBPPR21521 ---- Animal proteins ---- Active regulator of SIRT1 Source.3059: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1 Source.3060: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2 Source.3061: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.3062: DFBPPR21536 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.3063: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.3064: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3 Source.3065: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39 Source.3066: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1 Source.3067: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.3068: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.3069: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.3070: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3 Source.3071: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.3072: DFBPPR21586 ---- Animal proteins ---- Cyclin-C Source.3073: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.3074: DFBPPR21617 ---- Animal proteins ---- Proteasome assembly chaperone 3 Source.3075: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a Source.3076: DFBPPR21624 ---- Animal proteins ---- Docking protein 1 Source.3077: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14 Source.3078: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta Source.3079: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44 Source.3080: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6 Source.3081: DFBPPR21657 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 3 Source.3082: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2 Source.3083: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.3084: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4 Source.3085: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.3086: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like Source.3087: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like Source.3088: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2 Source.3089: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.3090: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2 Source.3091: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7 Source.3092: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1 Source.3093: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.3094: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.3095: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10 Source.3096: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.3097: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.3098: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.3099: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12 Source.3100: DFBPPR21768 ---- Animal proteins ---- Tektin-4 Source.3101: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.3102: DFBPPR21777 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 10 Source.3103: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5 Source.3104: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2 Source.3105: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.3106: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.3107: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.3108: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein Source.3109: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.3110: DFBPPR21811 ---- Animal proteins ---- Coiled-coil domain-containing protein 89 Source.3111: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526 Source.3112: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1 Source.3113: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD Source.3114: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein Source.3115: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.3116: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B Source.3117: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC Source.3118: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.3119: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19 Source.3120: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113 Source.3121: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor Source.3122: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein Source.3123: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5 Source.3124: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3 Source.3125: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.3126: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1 Source.3127: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1 Source.3128: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.3129: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6 Source.3130: DFBPPR21918 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 21 Source.3131: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12 Source.3132: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1 Source.3133: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog Source.3134: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14 Source.3135: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.3136: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11 Source.3137: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.3138: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.3139: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.3140: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.3141: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.3142: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.3143: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.3144: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.3145: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.3146: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28 Source.3147: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1 Source.3148: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein Source.3149: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.3150: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101 Source.3151: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10 Source.3152: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.3153: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4 Source.3154: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.3155: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.3156: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.3157: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.3158: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.3159: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2 Source.3160: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.3161: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.3162: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1 Source.3163: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.3164: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.3165: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.3166: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein Source.3167: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1 Source.3168: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7 Source.3169: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1 Source.3170: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2 Source.3171: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.3172: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial Source.3173: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.3174: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain Source.3175: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11 Source.3176: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.3177: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.3178: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.3179: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.3180: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.3181: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.3182: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.3183: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A Source.3184: DFBPPR22161 ---- Animal proteins ---- 39S ribosomal protein L53, mitochondrial Source.3185: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.3186: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2 Source.3187: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143 Source.3188: DFBPPR22169 ---- Animal proteins ---- Transmembrane protein 256 Source.3189: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.3190: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.3191: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8 Source.3192: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.3193: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147 Source.3194: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4 Source.3195: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.3196: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3 Source.3197: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8 Source.3198: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A Source.3199: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.3200: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.3201: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.3202: DFBPPR22250 ---- Animal proteins ---- Tetratricopeptide repeat protein 23-like Source.3203: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5 Source.3204: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34 Source.3205: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1 Source.3206: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18 Source.3207: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog Source.3208: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.3209: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2 Source.3210: DFBPPR22293 ---- Animal proteins ---- Nutritionally-regulated adipose and cardiac-enriched protein homolog Source.3211: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.3212: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.3213: DFBPPR22309 ---- Animal proteins ---- Spermatogenesis-associated protein 9 Source.3214: DFBPPR22312 ---- Animal proteins ---- BolA-like protein 1 Source.3215: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B Source.3216: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35 Source.3217: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.3218: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39 Source.3219: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.3220: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.3221: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.3222: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2 Source.3223: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.3224: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.3225: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6 Source.3226: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.3227: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.3228: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.3229: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4 Source.3230: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1 Source.3231: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein Source.3232: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A Source.3233: DFBPPR22386 ---- Animal proteins ---- DPY30 domain-containing protein 2 Source.3234: DFBPPR22391 ---- Animal proteins ---- Transmembrane protein 88B Source.3235: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog Source.3236: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1 Source.3237: DFBPPR22421 ---- Animal proteins ---- Placenta-specific protein 9 Source.3238: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.3239: DFBPPR22425 ---- Animal proteins ---- Protein THEM6 Source.3240: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.3241: DFBPPR22454 ---- Animal proteins ---- R3H domain-containing protein 4 Source.3242: DFBPPR22465 ---- Animal proteins ---- OCIA domain-containing protein 2 Source.3243: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.3244: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.3245: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A Source.3246: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3 Source.3247: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.3248: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C Source.3249: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog Source.3250: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101 Source.3251: DFBPPR22514 ---- Animal proteins ---- Transmembrane protein 205 Source.3252: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15 Source.3253: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248 Source.3254: DFBPPR22522 ---- Animal proteins ---- Coiled-coil domain-containing protein 126 Source.3255: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54 Source.3256: DFBPPR22529 ---- Animal proteins ---- Purkinje cell protein 4-like protein 1 Source.3257: DFBPPR22532 ---- Animal proteins ---- Cilia- and flagella-associated protein 299 Source.3258: DFBPPR22534 ---- Animal proteins ---- Protein FAM162B Source.3259: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.3260: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.3261: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.3262: DFBPPR22552 ---- Animal proteins ---- Protein AMN1 homolog Source.3263: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187 Source.3264: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1 Source.3265: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.3266: DFBPPR22576 ---- Animal proteins ---- UPF0547 protein C16orf87 homolog Source.3267: DFBPPR22585 ---- Animal proteins ---- UPF0449 protein C19orf25 homolog Source.3268: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.3269: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53 Source.3270: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36 Source.3271: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.3272: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215 Source.3273: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105 Source.3274: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42 Source.3275: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B Source.3276: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157 Source.3277: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein Source.3278: DFBPPR22671 ---- Animal proteins ---- Uncharacterized protein C1orf185 homolog Source.3279: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3 Source.3280: DFBPPR22683 ---- Animal proteins ---- LYR motif-containing protein 2 Source.3281: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.3282: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1 Source.3283: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.3284: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A Source.3285: DFBPPR22700 ---- Animal proteins ---- Protein FAM89A Source.3286: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.3287: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog Source.3288: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog Source.3289: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog Source.3290: DFBPPR22756 ---- Animal proteins ---- Uncharacterized protein C1orf189 homolog Source.3291: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.3292: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3293: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.3294: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.3295: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.3296: DFBPPR8546 ---- Animal proteins ---- Insulin Source.3297: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.3298: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N Source.3299: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.3300: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.3301: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.3302: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.3303: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.3304: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.3305: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.3306: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.3307: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.3308: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.3309: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase Source.3310: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.3311: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.3312: DFBPPR8628 ---- Animal proteins ---- Inhibin beta A chain Source.3313: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.3314: DFBPPR8647 ---- Animal proteins ---- Beclin-1 Source.3315: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A Source.3316: DFBPPR8657 ---- Animal proteins ---- Annexin A2 Source.3317: DFBPPR8668 ---- Animal proteins ---- Annexin A1 Source.3318: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.3319: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1 Source.3320: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.3321: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.3322: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.3323: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.3324: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.3325: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor Source.3326: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.3327: DFBPPR8694 ---- Animal proteins ---- Spastin Source.3328: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.3329: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.3330: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.3331: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.3332: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.3333: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1 Source.3334: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3335: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.3336: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.3337: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.3338: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.3339: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3340: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.3341: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.3342: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.3343: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.3344: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.3345: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.3346: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.3347: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1 Source.3348: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.3349: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II Source.3350: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S Source.3351: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2 Source.3352: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.3353: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.3354: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.3355: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.3356: DFBPPR8825 ---- Animal proteins ---- Optineurin Source.3357: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase Source.3358: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.3359: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase Source.3360: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.3361: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.3362: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide Source.3363: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3364: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.3365: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.3366: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.3367: DFBPPR8897 ---- Animal proteins ---- Cytochrome b Source.3368: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.3369: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.3370: DFBPPR8927 ---- Animal proteins ---- Pro-neuropeptide Y Source.3371: DFBPPR8932 ---- Animal proteins ---- ATPase inhibitor, mitochondrial Source.3372: DFBPPR8933 ---- Animal proteins ---- ATPase inhibitor, mitochondrial Source.3373: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta Source.3374: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.3375: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.3376: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.3377: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3 Source.3378: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.3379: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.3380: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.3381: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.3382: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.3383: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.3384: DFBPPR9036 ---- Animal proteins ---- Antimicrobial peptide NK-lysin Source.3385: DFBPPR9039 ---- Animal proteins ---- Desmin Source.3386: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.3387: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2 Source.3388: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B Source.3389: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.3390: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.3391: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1 Source.3392: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.3393: DFBPPR9073 ---- Animal proteins ---- Vitronectin Source.3394: DFBPPR9076 ---- Animal proteins ---- Histone H1t Source.3395: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide Source.3396: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.3397: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.3398: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5 Source.3399: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.3400: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.3401: DFBPPR9108 ---- Animal proteins ---- Somatostatin Source.3402: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.3403: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.3404: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.3405: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.3406: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.3407: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.3408: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.3409: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.3410: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.3411: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.3412: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.3413: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3414: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.3415: DFBPPR9176 ---- Animal proteins ---- Hemoglobin subunit zeta Source.3416: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.3417: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10 Source.3418: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.3419: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase Source.3420: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.3421: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.3422: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.3423: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain Source.3424: DFBPPR9216 ---- Animal proteins ---- Netrin-1 Source.3425: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1 Source.3426: DFBPPR9223 ---- Animal proteins ---- Protransforming growth factor alpha Source.3427: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.3428: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.3429: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10 Source.3430: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.3431: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B Source.3432: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29 Source.3433: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9 Source.3434: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.3435: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.3436: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.3437: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase Source.3438: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.3439: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.3440: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.3441: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4 Source.3442: DFBPPR9302 ---- Animal proteins ---- Agouti-signaling protein Source.3443: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2 Source.3444: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.3445: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.3446: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.3447: DFBPPR9338 ---- Animal proteins ---- SPARC Source.3448: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.3449: DFBPPR9355 ---- Animal proteins ---- Agouti-related protein Source.3450: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.3451: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.3452: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.3453: DFBPPR9363 ---- Animal proteins ---- Moesin Source.3454: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.3455: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.3456: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor Source.3457: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.3458: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon Source.3459: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.3460: DFBPPR9395 ---- Animal proteins ---- Calponin-2 Source.3461: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.3462: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.3463: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.3464: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.3465: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin Source.3466: DFBPPR9424 ---- Animal proteins ---- Protein S100-A6 Source.3467: DFBPPR9427 ---- Animal proteins ---- Protein quaking Source.3468: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59 Source.3469: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59 Source.3470: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.3471: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.3472: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.3473: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.3474: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14 Source.3475: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.3476: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.3477: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.3478: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.3479: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.3480: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a Source.3481: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.3482: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.3483: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.3484: DFBPPR9539 ---- Animal proteins ---- Neurofilament heavy polypeptide Source.3485: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.3486: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha Source.3487: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.3488: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta Source.3489: DFBPPR9558 ---- Animal proteins ---- Gap junction alpha-4 protein Source.3490: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.3491: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1 Source.3492: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3 Source.3493: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1 Source.3494: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase Source.3495: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.3496: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.3497: DFBPPR9597 ---- Animal proteins ---- Insulin-like 3 Source.3498: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.3499: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.3500: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.3501: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.3502: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.3503: DFBPPR9630 ---- Animal proteins ---- Calponin-1 Source.3504: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3505: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase Source.3506: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.3507: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.3508: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.3509: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.3510: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.3511: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2 Source.3512: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.3513: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.3514: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta Source.3515: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain Source.3516: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain Source.3517: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B Source.3518: DFBPPR9749 ---- Animal proteins ---- Guanylin Source.3519: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.3520: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.3521: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.3522: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.3523: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.3524: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.3525: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8 Source.3526: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.3527: DFBPPR9794 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3 Source.3528: DFBPPR9795 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5 Source.3529: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.3530: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2 Source.3531: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H Source.3532: DFBPPR9814 ---- Animal proteins ---- Testin Source.3533: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.3534: DFBPPR9822 ---- Animal proteins ---- Selenoprotein W Source.3535: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.3536: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.3537: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1 Source.3538: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1 Source.3539: DFBPPR9839 ---- Animal proteins ---- Nurim Source.3540: DFBPPR9843 ---- Animal proteins ---- P protein Source.3541: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.3542: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1 Source.3543: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2 Source.3544: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.3545: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3 Source.3546: DFBPPR9888 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.3547: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19 Source.3548: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3 Source.3549: DFBPPR9926 ---- Animal proteins ---- 60S ribosomal protein L7a Source.3550: DFBPPR9939 ---- Animal proteins ---- Tctex1 domain-containing protein 4 Source.3551: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.3552: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127 Source.3553: DFBPPR9950 ---- Animal proteins ---- 20 kDa neutrophil cationic protein Source.3554: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.3555: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor Source.3556: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase Source.3557: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1 Source.3558: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.3559: DFBPPR9989 ---- Animal proteins ---- VIP peptides Source.3560: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.3561: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.3562: DFBPPR10004 ---- Animal proteins ---- Spastin Source.3563: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.3564: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.3565: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src Source.3566: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.3567: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein Source.3568: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.3569: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.3570: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.3571: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.3572: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.3573: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.3574: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.3575: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor Source.3576: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.3577: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2 Source.3578: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4 Source.3579: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1 Source.3580: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3581: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.3582: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase Source.3583: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.3584: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.3585: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.3586: DFBPPR10136 ---- Animal proteins ---- Annexin A2 Source.3587: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.3588: DFBPPR10139 ---- Animal proteins ---- Cytochrome b Source.3589: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.3590: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.3591: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.3592: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.3593: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.3594: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.3595: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT Source.3596: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.3597: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.3598: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.3599: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.3600: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein Source.3601: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.3602: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.3603: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.3604: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.3605: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A Source.3606: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.3607: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.3608: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1 Source.3609: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.3610: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1 Source.3611: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein Source.3612: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6 Source.3613: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.3614: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.3615: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.3616: DFBPPR10270 ---- Animal proteins ---- Agrin Source.3617: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.3618: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.3619: DFBPPR10276 ---- Animal proteins ---- Adapter molecule crk Source.3620: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C Source.3621: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.3622: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.3623: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.3624: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.3625: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.3626: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.3627: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.3628: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.3629: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.3630: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.3631: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.3632: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.3633: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2 Source.3634: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.3635: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4 Source.3636: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.3637: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.3638: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor Source.3639: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.3640: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3 Source.3641: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.3642: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.3643: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.3644: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.3645: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta Source.3646: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.3647: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR Source.3648: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.3649: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.3650: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.3651: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.3652: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.3653: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.3654: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3 Source.3655: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.3656: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.3657: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.3658: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.3659: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.3660: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.3661: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.3662: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor Source.3663: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10 Source.3664: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.3665: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.3666: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.3667: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.3668: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.3669: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.3670: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.3671: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.3672: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.3673: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.3674: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.3675: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.3676: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3677: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.3678: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.3679: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.3680: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.3681: DFBPPR10481 ---- Animal proteins ---- Syndecan-3 Source.3682: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.3683: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2 Source.3684: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.3685: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.3686: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.3687: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.3688: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3 Source.3689: DFBPPR10509 ---- Animal proteins ---- Calponin-1 Source.3690: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.3691: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.3692: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.3693: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.3694: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase Source.3695: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.3696: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1 Source.3697: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.3698: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.3699: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.3700: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1 Source.3701: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.3702: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.3703: DFBPPR10563 ---- Animal proteins ---- Optineurin Source.3704: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.3705: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.3706: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.3707: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.3708: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.3709: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6 Source.3710: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.3711: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.3712: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B Source.3713: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.3714: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.3715: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.3716: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.3717: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.3718: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.3719: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin Source.3720: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.3721: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3 Source.3722: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.3723: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.3724: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.3725: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.3726: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.3727: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.3728: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.3729: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase Source.3730: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.3731: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.3732: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin Source.3733: DFBPPR10680 ---- Animal proteins ---- Hemoglobin subunit pi Source.3734: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.3735: DFBPPR10688 ---- Animal proteins ---- Protein S100-A6 Source.3736: DFBPPR10691 ---- Animal proteins ---- Beclin-1 Source.3737: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.3738: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase Source.3739: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.3740: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.3741: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.3742: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.3743: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.3744: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.3745: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.3746: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.3747: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor Source.3748: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor Source.3749: DFBPPR10738 ---- Animal proteins ---- Histone H1.10 Source.3750: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3751: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1 Source.3752: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.3753: DFBPPR10757 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.3754: DFBPPR10760 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.3755: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.3756: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3757: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.3758: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.3759: DFBPPR10790 ---- Animal proteins ---- Histone H1 Source.3760: DFBPPR10796 ---- Animal proteins ---- Protrudin Source.3761: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1 Source.3762: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.3763: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.3764: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2 Source.3765: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3 Source.3766: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.3767: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.3768: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.3769: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.3770: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa Source.3771: DFBPPR10840 ---- Animal proteins ---- C-C motif chemokine 4 homolog Source.3772: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5 Source.3773: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.3774: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.3775: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.3776: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.3777: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.3778: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.3779: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.3780: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.3781: DFBPPR10877 ---- Animal proteins ---- Histone H1.01 Source.3782: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.3783: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.3784: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.3785: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.3786: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.3787: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12 Source.3788: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.3789: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1 Source.3790: DFBPPR10919 ---- Animal proteins ---- Ski oncogene Source.3791: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.3792: DFBPPR10923 ---- Animal proteins ---- Ras-related protein Rab-5B Source.3793: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.3794: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.3795: DFBPPR10932 ---- Animal proteins ---- Histone H1.11L Source.3796: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.3797: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.3798: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y Source.3799: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor Source.3800: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho Source.3801: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1 Source.3802: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2 Source.3803: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.3804: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.3805: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.3806: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.3807: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.3808: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.3809: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase Source.3810: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.3811: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.3812: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.3813: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.3814: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.3815: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.3816: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.3817: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13 Source.3818: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.3819: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a Source.3820: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1 Source.3821: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.3822: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.3823: DFBPPR11092 ---- Animal proteins ---- Ataxin-3 Source.3824: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.3825: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.3826: DFBPPR11102 ---- Animal proteins ---- Interferon type A3 Source.3827: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.3828: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase Source.3829: DFBPPR11112 ---- Animal proteins ---- Protein quaking Source.3830: DFBPPR11113 ---- Animal proteins ---- POU domain, class 4, transcription factor 1 Source.3831: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.3832: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1 Source.3833: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform Source.3834: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.3835: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.3836: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3 Source.3837: DFBPPR11151 ---- Animal proteins ---- SPARC Source.3838: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2 Source.3839: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.3840: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1 Source.3841: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2 Source.3842: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.3843: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.3844: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.3845: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1 Source.3846: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.3847: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.3848: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.3849: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1 Source.3850: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.3851: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.3852: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.3853: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.3854: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase Source.3855: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.3856: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.3857: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.3858: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B Source.3859: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.3860: DFBPPR11282 ---- Animal proteins ---- Ras-related protein Rab-5C Source.3861: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.3862: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.3863: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.3864: DFBPPR11302 ---- Animal proteins ---- Histone H1.11R Source.3865: DFBPPR11308 ---- Animal proteins ---- Histone H1.03 Source.3866: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1 Source.3867: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3 Source.3868: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.3869: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2 Source.3870: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15 Source.3871: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1 Source.3872: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase Source.3873: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.3874: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.3875: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.3876: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.3877: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1 Source.3878: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B Source.3879: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.3880: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.3881: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.3882: DFBPPR11401 ---- Animal proteins ---- Inhibitor of growth protein 3 Source.3883: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner Source.3884: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.3885: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231 Source.3886: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.3887: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3 Source.3888: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.3889: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a Source.3890: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11 Source.3891: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.3892: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9 Source.3893: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein Source.3894: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L Source.3895: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.3896: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.3897: DFBPPR11524 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF166 Source.3898: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.3899: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.3900: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.3901: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.3902: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4 Source.3903: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.3904: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.3905: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.3906: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230 Source.3907: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.3908: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog Source.3909: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.3910: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.3911: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.3912: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4 Source.3913: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3914: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3915: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.3916: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1 Source.3917: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.3918: DFBPPR11677 ---- Animal proteins ---- SOSS complex subunit C Source.3919: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13 Source.3920: DFBPPR11683 ---- Animal proteins ---- Somatostatin Source.3921: DFBPPR11692 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14B Source.3922: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1 Source.3923: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1 Source.3924: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.3925: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.3926: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.3927: DFBPPR11712 ---- Animal proteins ---- 60S acidic ribosomal protein P1 Source.3928: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.3929: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8 Source.3930: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.3931: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.3932: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor Source.3933: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.3934: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.3935: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like Source.3936: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.3937: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.3938: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.3939: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1 Source.3940: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.3941: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B Source.3942: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1 Source.3943: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17 Source.3944: DFBPPR11847 ---- Animal proteins ---- Borealin-2 Source.3945: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.3946: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.3947: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.3948: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3 Source.3949: DFBPPR11863 ---- Animal proteins ---- Purpurin Source.3950: DFBPPR11864 ---- Animal proteins ---- Radixin Source.3951: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.3952: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.3953: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.3954: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9 Source.3955: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.3956: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.3957: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.3958: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.3959: DFBPPR11928 ---- Animal proteins ---- Cyclin-C Source.3960: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.3961: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.3962: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.3963: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.3964: DFBPPR11966 ---- Animal proteins ---- Protein CREG1 Source.3965: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.3966: DFBPPR11976 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim9 Source.3967: DFBPPR11999 ---- Animal proteins ---- Dymeclin Source.3968: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein Source.3969: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.3970: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.3971: DFBPPR12041 ---- Animal proteins ---- Paladin Source.3972: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.3973: DFBPPR12046 ---- Animal proteins ---- Hemopexin Source.3974: DFBPPR12047 ---- Animal proteins ---- Ragulator complex protein LAMTOR3 Source.3975: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24 Source.3976: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.3977: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.3978: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.3979: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.3980: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.3981: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.3982: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.3983: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.3984: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237 Source.3985: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.3986: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.3987: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.3988: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2 Source.3989: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21 Source.3990: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.3991: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1 Source.3992: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.3993: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial Source.3994: DFBPPR12138 ---- Animal proteins ---- Protein LZIC Source.3995: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A Source.3996: DFBPPR12142 ---- Animal proteins ---- FGFR1 oncogene partner 2 homolog Source.3997: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.3998: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.3999: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.4000: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A Source.4001: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a Source.4002: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B Source.4003: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.4004: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45 Source.4005: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.4006: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1 Source.4007: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.4008: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6 Source.4009: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog Source.4010: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.4011: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.4012: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.4013: DFBPPR12236 ---- Animal proteins ---- Protein FAM133 Source.4014: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.4015: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.4016: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A Source.4017: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.4018: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.4019: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.4020: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.4021: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.4022: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.4023: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.4024: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.4025: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.4026: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.4027: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.4028: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.4029: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.4030: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.4031: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein Source.4032: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53 Source.4033: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.4034: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4035: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.4036: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.4037: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.4038: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1 Source.4039: DFBPPR12336 ---- Animal proteins ---- Apolipoprotein D Source.4040: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.4041: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.4042: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2 Source.4043: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.4044: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.4045: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.4046: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.4047: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.4048: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a Source.4049: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.4050: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.4051: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.4052: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.4053: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.4054: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.4055: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.4056: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.4057: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.4058: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.4059: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Source.4060: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.4061: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.4062: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.4063: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.4064: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.4065: DFBPPR12417 ---- Animal proteins ---- Rhodopsin Source.4066: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.4067: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.4068: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.4069: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.4070: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.4071: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.4072: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2 Source.4073: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.4074: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.4075: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.4076: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.4077: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4078: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.4079: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.4080: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X Source.4081: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.4082: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.4083: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.4084: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.4085: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.4086: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.4087: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14 Source.4088: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.4089: DFBPPR12496 ---- Animal proteins ---- Protachykinin-1 Source.4090: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.4091: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1 Source.4092: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.4093: DFBPPR12514 ---- Animal proteins ---- Transmembrane protein 109 Source.4094: DFBPPR12517 ---- Animal proteins ---- 5-formyltetrahydrofolate cyclo-ligase Source.4095: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.4096: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase Source.4097: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.4098: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.4099: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.4100: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.4101: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.4102: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.4103: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.4104: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.4105: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.4106: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.4107: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.4108: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.4109: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.4110: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.4111: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.4112: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.4113: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.4114: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.4115: DFBPPR12602 ---- Animal proteins ---- Osteopontin Source.4116: DFBPPR12603 ---- Animal proteins ---- Osteopontin Source.4117: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.4118: DFBPPR12607 ---- Animal proteins ---- Basigin Source.4119: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.4120: DFBPPR12614 ---- Animal proteins ---- Interleukin-6 Source.4121: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.4122: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.4123: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.4124: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain Source.4125: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.4126: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor Source.4127: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.4128: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.4129: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1 Source.4130: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.4131: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.4132: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.4133: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.4134: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.4135: DFBPPR12738 ---- Animal proteins ---- Histone H1.4 Source.4136: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.4137: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.4138: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.4139: DFBPPR12762 ---- Animal proteins ---- SPARC Source.4140: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.4141: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.4142: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.4143: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.4144: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.4145: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.4146: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.4147: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2 Source.4148: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.4149: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2 Source.4150: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma Source.4151: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.4152: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.4153: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.4154: DFBPPR12821 ---- Animal proteins ---- Gastricsin Source.4155: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin Source.4156: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.4157: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.4158: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.4159: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.4160: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.4161: DFBPPR12844 ---- Animal proteins ---- Protein S100-A6 Source.4162: DFBPPR12848 ---- Animal proteins ---- Sarcoplasmic reticulum histidine-rich calcium-binding protein Source.4163: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.4164: DFBPPR12879 ---- Animal proteins ---- Endothelin-2 Source.4165: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.4166: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80 Source.4167: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.4168: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.4169: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a Source.4170: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.4171: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.4172: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.4173: DFBPPR12918 ---- Animal proteins ---- Myosin heavy chain, embryonic smooth muscle isoform Source.4174: DFBPPR12935 ---- Animal proteins ---- Histone H1.3 Source.4175: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.4176: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.4177: DFBPPR12940 ---- Animal proteins ---- Interleukin-4 Source.4178: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1 Source.4179: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.4180: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.4181: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3 Source.4182: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain Source.4183: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.4184: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.4185: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.4186: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.4187: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.4188: DFBPPR13000 ---- Animal proteins ---- Cystatin-C Source.4189: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.4190: DFBPPR13021 ---- Animal proteins ---- Ferritin light chain Source.4191: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2 Source.4192: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.4193: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.4194: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A Source.4195: DFBPPR13043 ---- Animal proteins ---- Whey acidic protein Source.4196: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein Source.4197: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein Source.4198: DFBPPR13052 ---- Animal proteins ---- Ubiquitin-like protein 4A Source.4199: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.4200: DFBPPR13058 ---- Animal proteins ---- Anion exchange transporter Source.4201: DFBPPR13067 ---- Animal proteins ---- Beta-casein Source.4202: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.4203: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.4204: DFBPPR13092 ---- Animal proteins ---- Testin Source.4205: DFBPPR13094 ---- Animal proteins ---- Atherin Source.4206: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.4207: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.4208: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4209: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.4210: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.4211: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5 Source.4212: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain Source.4213: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.4214: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4215: DFBPPR13166 ---- Animal proteins ---- CD44 antigen Source.4216: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11 Source.4217: DFBPPR13195 ---- Animal proteins ---- Albumin Source.4218: DFBPPR13211 ---- Animal proteins ---- Colipase B Source.4219: DFBPPR13216 ---- Animal proteins ---- Colipase A Source.4220: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.4221: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.4222: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.4223: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2 Source.4224: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta Source.4225: DFBPPR13262 ---- Animal proteins ---- Gastrin Source.4226: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E Source.4227: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.4228: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.4229: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.4230: DFBPPR13276 ---- Animal proteins ---- Protein quaking Source.4231: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.4232: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.4233: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.4234: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.4235: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.4236: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.4237: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein Source.4238: DFBPPR13301 ---- Animal proteins ---- Protein S100-A6 Source.4239: DFBPPR13302 ---- Animal proteins ---- Endothelin-2 Source.4240: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta Source.4241: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.4242: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.4243: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.4244: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.4245: DFBPPR13330 ---- Animal proteins ---- Uterocalin Source.4246: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter Source.4247: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a Source.4248: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.4249: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.4250: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.4251: DFBPPR13376 ---- Animal proteins ---- Interleukin-5 Source.4252: DFBPPR13383 ---- Animal proteins ---- Insulin Source.4253: DFBPPR13397 ---- Animal proteins ---- Hemoglobin subunit theta-1 Source.4254: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.4255: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.4256: DFBPPR13409 ---- Animal proteins ---- Testin Source.4257: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.4258: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147 Source.4259: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.4260: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A Source.4261: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.4262: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.4263: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.4264: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.4265: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.4266: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase Source.4267: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.4268: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.4269: DFBPPR13474 ---- Animal proteins ---- Hemoglobin subunit epsilon-1 Source.4270: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.4271: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3 Source.4272: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a Source.4273: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1 Source.4274: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.4275: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.4276: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4277: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.4278: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1 Source.4279: DFBPPR13552 ---- Animal proteins ---- Inhibin beta A chain Source.4280: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.4281: DFBPPR13574 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.4282: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.4283: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53 Source.4284: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.4285: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1 Source.4286: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4287: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.4288: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.4289: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.4290: DFBPPR13605 ---- Animal proteins ---- Rhodopsin Source.4291: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.4292: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.4293: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta Source.4294: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.4295: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.4296: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.4297: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.4298: DFBPPR13672 ---- Animal proteins ---- Annexin A2 Source.4299: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.4300: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.4301: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.4302: DFBPPR13692 ---- Animal proteins ---- Pro-neuropeptide Y Source.4303: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.4304: DFBPPR13702 ---- Animal proteins ---- Protransforming growth factor alpha Source.4305: DFBPPR13708 ---- Animal proteins ---- Renin Source.4306: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.4307: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.4308: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.4309: DFBPPR13734 ---- Animal proteins ---- Perilipin-5 Source.4310: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.4311: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.4312: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.4313: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.4314: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.4315: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.4316: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.4317: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.4318: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.4319: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.4320: DFBPPR13786 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit gamma Source.4321: DFBPPR13788 ---- Animal proteins ---- Albumin Source.4322: DFBPPR13789 ---- Animal proteins ---- Tryptase-2 Source.4323: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.4324: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a Source.4325: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.4326: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3 Source.4327: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.4328: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor Source.4329: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1 Source.4330: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.4331: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin Source.4332: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.4333: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor Source.4334: DFBPPR13875 ---- Animal proteins ---- Gastrin Source.4335: DFBPPR13893 ---- Animal proteins ---- Calponin-1 Source.4336: DFBPPR13896 ---- Animal proteins ---- Somatostatin Source.4337: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.4338: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.4339: DFBPPR13915 ---- Animal proteins ---- Gastrin-releasing peptide Source.4340: DFBPPR13918 ---- Animal proteins ---- Testin Source.4341: DFBPPR13919 ---- Animal proteins ---- Selenoprotein W Source.4342: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.4343: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.4344: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.4345: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.4346: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B Source.4347: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A Source.4348: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1 Source.4349: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2 Source.4350: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha Source.4351: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B Source.4352: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.4353: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.4354: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.4355: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.4356: DFBPPR14035 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.4357: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.4358: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.4359: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.4360: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.4361: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta Source.4362: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha Source.4363: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha Source.4364: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran Source.4365: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A Source.4366: DFBPPR14112 ---- Marine protein ---- Proteasome subunit beta type-6-A like protein Source.4367: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.4368: DFBPPR14114 ---- Marine protein ---- Proteasome subunit beta type-6-B like protein Source.4369: DFBPPR14123 ---- Marine protein ---- Albumin 1 Source.4370: DFBPPR14124 ---- Marine protein ---- Albumin 2 Source.4371: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.4372: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase Source.4373: DFBPPR14133 ---- Marine protein ---- Calumenin-B Source.4374: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.4375: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.4376: DFBPPR14141 ---- Marine protein ---- Ependymin-2 Source.4377: DFBPPR14147 ---- Marine protein ---- Parvalbumin beta 2 Source.4378: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.4379: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.4380: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.4381: DFBPPR14186 ---- Marine protein ---- 60S ribosomal protein L18 Source.4382: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4 Source.4383: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B Source.4384: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein Source.4385: DFBPPR14203 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-A Source.4386: DFBPPR14207 ---- Marine protein ---- Ubiquitin-like protein 4A-B Source.4387: DFBPPR14208 ---- Marine protein ---- Ubiquitin-like protein 4A-A Source.4388: DFBPPR14221 ---- Marine protein ---- LYR motif-containing protein 2 Source.4389: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.4390: DFBPPR14247 ---- Marine protein ---- Pro-MCH 2 Source.4391: DFBPPR14251 ---- Marine protein ---- Isotocin-neurophysin IT 1 Source.4392: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.4393: DFBPPR14302 ---- Marine protein ---- ATP synthase subunit b, chloroplastic Source.4394: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.4395: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.4396: DFBPPR14320 ---- Marine protein ---- Photosystem I assembly protein Ycf3 Source.4397: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4398: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.4399: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta' Source.4400: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.4401: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.4402: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain Source.4403: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain Source.4404: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.4405: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.4406: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.4407: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.4408: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III Source.4409: DFBPPR14442 ---- Marine protein ---- 50S ribosomal protein L18, chloroplastic Source.4410: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38 Source.4411: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92 Source.4412: DFBPPR14517 ---- Marine protein ---- Uncharacterized protein ycf54 Source.4413: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.4414: DFBPPR14546 ---- Marine protein ---- Stanniocalcin Source.4415: DFBPPR14547 ---- Marine protein ---- Interleukin-6 Source.4416: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.4417: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.4418: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.4419: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1 Source.4420: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4 Source.4421: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53 Source.4422: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1 Source.4423: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1 Source.4424: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase Source.4425: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4 Source.4426: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1 Source.4427: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.4428: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2 Source.4429: DFBPPR14596 ---- Marine protein ---- Parvalbumin beta 2 Source.4430: DFBPPR14608 ---- Marine protein ---- Polysialoglycoprotein Source.4431: DFBPPR14625 ---- Marine protein ---- Somatostatin-2 Source.4432: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1 Source.4433: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein Source.4434: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.4435: DFBPPR14645 ---- Marine protein ---- Ependymin-2 Source.4436: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.4437: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.4438: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.4439: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.4440: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.4441: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.4442: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.4443: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1 Source.4444: DFBPPR14684 ---- Marine protein ---- Pro-MCH 2 Source.4445: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2 Source.4446: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2 Source.4447: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.4448: DFBPPR14720 ---- Marine protein ---- Transcription initiation factor IIA subunit 2 Source.4449: DFBPPR14737 ---- Marine protein ---- Ubiquitin-like protein 4A-B Source.4450: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A Source.4451: DFBPPR14746 ---- Marine protein ---- Parvalbumin beta 1 Source.4452: DFBPPR14747 ---- Marine protein ---- Parvalbumin beta 3 Source.4453: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.4454: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.4455: DFBPPR14775 ---- Marine protein ---- Troponin C Source.4456: DFBPPR14779 ---- Marine protein ---- Anti-lipopolysaccharide factor Source.4457: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1 Source.4458: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3 Source.4459: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2 Source.4460: DFBPPR14820 ---- Marine protein ---- Troponin C, isoform 1 Source.4461: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form Source.4462: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4463: DFBPPR14864 ---- Marine protein ---- Hemoglobin anodic subunit beta Source.4464: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta Source.4465: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.4466: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.4467: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit Source.4468: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.4469: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.4470: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase Source.4471: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.4472: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3 Source.4473: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15 Source.4474: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase Source.4475: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.4476: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1 Source.4477: DFBPPR14935 ---- Microorganism protein ---- Actin Source.4478: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase Source.4479: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1 Source.4480: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.4481: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.4482: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.4483: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.4484: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.4485: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.4486: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.4487: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.4488: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.4489: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.4490: DFBPPR14999 ---- Microorganism protein ---- Histone H3-like centromeric protein CSE4 Source.4491: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.4492: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8 Source.4493: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase Source.4494: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.4495: DFBPPR15018 ---- Microorganism protein ---- Sorting nexin-4 Source.4496: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.4497: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.4498: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.4499: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.4500: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate) Source.4501: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial Source.4502: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.4503: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.4504: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.4505: DFBPPR15045 ---- Microorganism protein ---- Enolase Source.4506: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1 Source.4507: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.4508: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.4509: DFBPPR15060 ---- Microorganism protein ---- Transaldolase Source.4510: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.4511: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.4512: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.4513: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.4514: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)] Source.4515: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase Source.4516: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.4517: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase Source.4518: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.4519: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.4520: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase Source.4521: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.4522: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.4523: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase Source.4524: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.4525: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.4526: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A Source.4527: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40 Source.4528: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D Source.4529: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.4530: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.4531: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain Source.4532: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2 Source.4533: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.4534: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.4535: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.4536: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.4537: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.4538: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.4539: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.4540: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.4541: DFBPPR15244 ---- Microorganism protein ---- DASH complex subunit SPC19 Source.4542: DFBPPR15265 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM14 Source.4543: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.4544: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12 Source.4545: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.4546: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.4547: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.4548: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.4549: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21 Source.4550: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.4551: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.4552: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.4553: DFBPPR15316 ---- Microorganism protein ---- Protein URE2 Source.4554: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor Source.4555: DFBPPR15350 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 7 Source.4556: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.4557: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase Source.4558: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.4559: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.4560: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.4561: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1 Source.4562: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.4563: DFBPPR15427 ---- Microorganism protein ---- RNA exonuclease 4 Source.4564: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial Source.4565: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial Source.4566: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2 Source.4567: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.4568: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.4569: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62 Source.4570: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.4571: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.4572: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.4573: DFBPPR15534 ---- Microorganism protein ---- 60S ribosomal protein L30 Source.4574: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.4575: DFBPPR15561 ---- Microorganism protein ---- Ribosome biogenesis protein SLX9 Source.4576: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1 Source.4577: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.4578: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase Source.4579: DFBPPR15609 ---- Microorganism protein ---- Shugoshin Source.4580: DFBPPR15620 ---- Microorganism protein ---- Autophagy-related protein 23 Source.4581: DFBPPR15634 ---- Microorganism protein ---- Hsp70 nucleotide exchange factor FES1 Source.4582: DFBPPR15670 ---- Microorganism protein ---- Imidazoleglycerol-phosphate dehydratase Source.4583: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.4584: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14 Source.4585: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.4586: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4 Source.4587: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.4588: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.4589: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.4590: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21 Source.4591: DFBPPR15743 ---- Microorganism protein ---- Damage-regulated import facilitator 1 Source.4592: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3 Source.4593: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11 Source.4594: DFBPPR15779 ---- Microorganism protein ---- UPF0495 protein KLLA0D04334g Source.4595: DFBPPR15786 ---- Microorganism protein ---- Stationary phase protein 4 Source.4596: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase Source.4597: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase Source.4598: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.4599: DFBPPR15803 ---- Microorganism protein ---- Galactokinase Source.4600: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase Source.4601: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase Source.4602: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.4603: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component Source.4604: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.4605: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain Source.4606: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain Source.4607: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR Source.4608: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.4609: DFBPPR15832 ---- Microorganism protein ---- Uncharacterized protein in fgs 3'region Source.4610: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.4611: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.4612: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3 Source.4613: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.4614: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial Source.4615: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.4616: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.4617: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.4618: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase Source.4619: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4 Source.4620: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.4621: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.4622: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.4623: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.4624: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.4625: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.4626: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.4627: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic Source.4628: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.4629: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.4630: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.4631: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.4632: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.4633: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.4634: DFBPPR7798 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.4635: DFBPPR7799 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.4636: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4637: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4638: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.4639: DFBPPR7812 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic Source.4640: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.4641: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.4642: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.4643: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1 Source.4644: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3 Source.4645: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4 Source.4646: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1 Source.4647: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.4648: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1 Source.4649: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1 Source.4650: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1 Source.4651: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1 Source.4652: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1 Source.4653: DFBPPR7896 ---- Plant protein ---- Photosystem I reaction center subunit IX Source.4654: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1 Source.4655: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1 Source.4656: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1 Source.4657: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1 Source.4658: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2 Source.4659: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1 Source.4660: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2 Source.4661: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1 Source.4662: DFBPPR7926 ---- Plant protein ---- Kafirin PSK8 Source.4663: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.4664: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.4665: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.4666: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1 Source.4667: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.4668: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.4669: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.4670: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4 Source.4671: DFBPPR7987 ---- Plant protein ---- Antifungal protein ginkbilobin-2 Source.4672: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.4673: DFBPPR8000 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic Source.4674: DFBPPR8008 ---- Plant protein ---- CASP-like protein 5A2 Source.4675: DFBPPR8012 ---- Plant protein ---- CASP-like protein 5A1 Source.4676: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase Source.4677: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.4678: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.4679: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.4680: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4681: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.4682: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic Source.4683: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.4684: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic Source.4685: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha Source.4686: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.4687: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.4688: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.4689: DFBPPR8077 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.4690: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1 Source.4691: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.4692: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.4693: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.4694: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.4695: DFBPPR8127 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic Source.4696: DFBPPR8141 ---- Plant protein ---- Photosystem I reaction center subunit IX Source.4697: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.4698: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase Source.4699: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase Source.4700: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.4701: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4702: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.4703: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.4704: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.4705: DFBPPR8244 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.4706: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.4707: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.4708: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.4709: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.4710: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.4711: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.4712: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase Source.4713: DFBPPR8281 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic Source.4714: DFBPPR8286 ---- Plant protein ---- Oleosin Source.4715: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein Source.4716: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.4717: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1 Source.4718: DFBPPR8326 ---- Plant protein ---- Photosystem I reaction center subunit IX Source.4719: DFBPPR8331 ---- Plant protein ---- Auxin-responsive protein SAUR50
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide ALA showed low antioxidant activity with a relative antioxidant activity of 0.19 ± 0.010 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015